.
+
diff --git a/Makefile.am b/Makefile.am
new file mode 100644
index 00000000..4e8dafe8
--- /dev/null
+++ b/Makefile.am
@@ -0,0 +1,11 @@
+#----------------------------------------------------------------------
+# Makefile.am - The Final Cut terminal programming library
+#----------------------------------------------------------------------
+
+AUTOMAKE_OPTIONS = foreign
+
+ACLOCAL_AMFLAGS = -I m4
+
+SUBDIRS = src doc test
+
+doc_DATA = AUTHORS COPYING ChangeLog
diff --git a/Makefile.in b/Makefile.in
new file mode 100644
index 00000000..4d484240
--- /dev/null
+++ b/Makefile.in
@@ -0,0 +1,839 @@
+# Makefile.in generated by automake 1.13.4 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+#----------------------------------------------------------------------
+# Makefile.am - The Final Cut terminal programming library
+#----------------------------------------------------------------------
+
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = .
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+ $(top_srcdir)/configure $(am__configure_deps) AUTHORS COPYING \
+ ChangeLog config.guess config.sub depcomp install-sh missing \
+ ltmain.sh
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/libtool.m4 \
+ $(top_srcdir)/m4/ltoptions.m4 $(top_srcdir)/m4/ltsugar.m4 \
+ $(top_srcdir)/m4/ltversion.m4 $(top_srcdir)/m4/lt~obsolete.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \
+ configure.lineno config.status.lineno
+mkinstalldirs = $(install_sh) -d
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+SOURCES =
+DIST_SOURCES =
+RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \
+ ctags-recursive dvi-recursive html-recursive info-recursive \
+ install-data-recursive install-dvi-recursive \
+ install-exec-recursive install-html-recursive \
+ install-info-recursive install-pdf-recursive \
+ install-ps-recursive install-recursive installcheck-recursive \
+ installdirs-recursive pdf-recursive ps-recursive \
+ tags-recursive uninstall-recursive
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+ srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+ for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+ $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+ if (++n[$$2] == $(am__install_max)) \
+ { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+ END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+ sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+ sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+ test -z "$$files" \
+ || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+ || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+ $(am__cd) "$$dir" && rm -f $$files; }; \
+ }
+am__installdirs = "$(DESTDIR)$(docdir)"
+DATA = $(doc_DATA)
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive \
+ distclean-recursive maintainer-clean-recursive
+am__recursive_targets = \
+ $(RECURSIVE_TARGETS) \
+ $(RECURSIVE_CLEAN_TARGETS) \
+ $(am__extra_recursive_targets)
+AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
+ cscope distdir dist dist-all distcheck
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates. Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+ BEGIN { nonempty = 0; } \
+ { items[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique. This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+ list='$(am__tagged_files)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+CSCOPE = cscope
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+am__remove_distdir = \
+ if test -d "$(distdir)"; then \
+ find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \
+ && rm -rf "$(distdir)" \
+ || { sleep 5 && rm -rf "$(distdir)"; }; \
+ else :; fi
+am__post_remove_distdir = $(am__remove_distdir)
+am__relativize = \
+ dir0=`pwd`; \
+ sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+ sed_rest='s,^[^/]*/*,,'; \
+ sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+ sed_butlast='s,/*[^/]*$$,,'; \
+ while test -n "$$dir1"; do \
+ first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+ if test "$$first" != "."; then \
+ if test "$$first" = ".."; then \
+ dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+ dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+ else \
+ first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+ if test "$$first2" = "$$first"; then \
+ dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+ else \
+ dir2="../$$dir2"; \
+ fi; \
+ dir0="$$dir0"/"$$first"; \
+ fi; \
+ fi; \
+ dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+ done; \
+ reldir="$$dir2"
+DIST_ARCHIVES = $(distdir).tar.gz
+GZIP_ENV = --best
+DIST_TARGETS = dist-gzip
+distuninstallcheck_listfiles = find . -type f -print
+am__distuninstallcheck_listfiles = $(distuninstallcheck_listfiles) \
+ | sed 's|^\./|$(prefix)/|' | grep -v '$(infodir)/dir$$'
+distcleancheck_listfiles = find . -type f -print
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIBTOOL_DEPS = @LIBTOOL_DEPS@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+SO_VERSION = @SO_VERSION@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+AUTOMAKE_OPTIONS = foreign
+ACLOCAL_AMFLAGS = -I m4
+SUBDIRS = src doc test
+doc_DATA = AUTHORS COPYING ChangeLog
+all: all-recursive
+
+.SUFFIXES:
+am--refresh: Makefile
+ @:
+$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \
+ $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \
+ && exit 0; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --foreign Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ echo ' $(SHELL) ./config.status'; \
+ $(SHELL) ./config.status;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ $(SHELL) ./config.status --recheck
+
+$(top_srcdir)/configure: $(am__configure_deps)
+ $(am__cd) $(srcdir) && $(AUTOCONF)
+$(ACLOCAL_M4): $(am__aclocal_m4_deps)
+ $(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS)
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+
+distclean-libtool:
+ -rm -f libtool config.lt
+install-docDATA: $(doc_DATA)
+ @$(NORMAL_INSTALL)
+ @list='$(doc_DATA)'; test -n "$(docdir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(docdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(docdir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(docdir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(docdir)" || exit $$?; \
+ done
+
+uninstall-docDATA:
+ @$(NORMAL_UNINSTALL)
+ @list='$(doc_DATA)'; test -n "$(docdir)" || list=; \
+ files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+ dir='$(DESTDIR)$(docdir)'; $(am__uninstall_files_from_dir)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run 'make' without going through this Makefile.
+# To change the values of 'make' variables: instead of editing Makefiles,
+# (1) if the variable is set in 'config.status', edit 'config.status'
+# (which will cause the Makefiles to be regenerated when you run 'make');
+# (2) otherwise, pass the desired values on the 'make' command line.
+$(am__recursive_targets):
+ @fail=; \
+ if $(am__make_keepgoing); then \
+ failcom='fail=yes'; \
+ else \
+ failcom='exit 1'; \
+ fi; \
+ dot_seen=no; \
+ target=`echo $@ | sed s/-recursive//`; \
+ case "$@" in \
+ distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+ *) list='$(SUBDIRS)' ;; \
+ esac; \
+ for subdir in $$list; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ dot_seen=yes; \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done; \
+ if test "$$dot_seen" = "no"; then \
+ $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+ fi; test -z "$$fail"
+
+ID: $(am__tagged_files)
+ $(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-recursive
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ set x; \
+ here=`pwd`; \
+ if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+ include_option=--etags-include; \
+ empty_fix=.; \
+ else \
+ include_option=--include; \
+ empty_fix=; \
+ fi; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test ! -f $$subdir/TAGS || \
+ set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+ fi; \
+ done; \
+ $(am__define_uniq_tagged_files); \
+ shift; \
+ if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ if test $$# -gt 0; then \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ "$$@" $$unique; \
+ else \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$unique; \
+ fi; \
+ fi
+ctags: ctags-recursive
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ $(am__define_uniq_tagged_files); \
+ test -z "$(CTAGS_ARGS)$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && $(am__cd) $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) "$$here"
+cscope: cscope.files
+ test ! -s cscope.files \
+ || $(CSCOPE) -b -q $(AM_CSCOPEFLAGS) $(CSCOPEFLAGS) -i cscope.files $(CSCOPE_ARGS)
+clean-cscope:
+ -rm -f cscope.files
+cscope.files: clean-cscope cscopelist
+cscopelist: cscopelist-recursive
+
+cscopelist-am: $(am__tagged_files)
+ list='$(am__tagged_files)'; \
+ case "$(srcdir)" in \
+ [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+ *) sdir=$(subdir)/$(srcdir) ;; \
+ esac; \
+ for i in $$list; do \
+ if test -f "$$i"; then \
+ echo "$(subdir)/$$i"; \
+ else \
+ echo "$$sdir/$$i"; \
+ fi; \
+ done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+ -rm -f cscope.out cscope.in.out cscope.po.out cscope.files
+
+distdir: $(DISTFILES)
+ $(am__remove_distdir)
+ test -d "$(distdir)" || mkdir "$(distdir)"
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+ @list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ $(am__make_dryrun) \
+ || test -d "$(distdir)/$$subdir" \
+ || $(MKDIR_P) "$(distdir)/$$subdir" \
+ || exit 1; \
+ dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+ $(am__relativize); \
+ new_distdir=$$reldir; \
+ dir1=$$subdir; dir2="$(top_distdir)"; \
+ $(am__relativize); \
+ new_top_distdir=$$reldir; \
+ echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+ echo " am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+ ($(am__cd) $$subdir && \
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$$new_top_distdir" \
+ distdir="$$new_distdir" \
+ am__remove_distdir=: \
+ am__skip_length_check=: \
+ am__skip_mode_fix=: \
+ distdir) \
+ || exit 1; \
+ fi; \
+ done
+ -test -n "$(am__skip_mode_fix)" \
+ || find "$(distdir)" -type d ! -perm -755 \
+ -exec chmod u+rwx,go+rx {} \; -o \
+ ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -400 -exec chmod a+r {} \; -o \
+ ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \
+ || chmod -R a+r "$(distdir)"
+dist-gzip: distdir
+ tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz
+ $(am__post_remove_distdir)
+
+dist-bzip2: distdir
+ tardir=$(distdir) && $(am__tar) | BZIP2=$${BZIP2--9} bzip2 -c >$(distdir).tar.bz2
+ $(am__post_remove_distdir)
+
+dist-lzip: distdir
+ tardir=$(distdir) && $(am__tar) | lzip -c $${LZIP_OPT--9} >$(distdir).tar.lz
+ $(am__post_remove_distdir)
+
+dist-xz: distdir
+ tardir=$(distdir) && $(am__tar) | XZ_OPT=$${XZ_OPT--e} xz -c >$(distdir).tar.xz
+ $(am__post_remove_distdir)
+
+dist-tarZ: distdir
+ tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z
+ $(am__post_remove_distdir)
+
+dist-shar: distdir
+ shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz
+ $(am__post_remove_distdir)
+
+dist-zip: distdir
+ -rm -f $(distdir).zip
+ zip -rq $(distdir).zip $(distdir)
+ $(am__post_remove_distdir)
+
+dist dist-all:
+ $(MAKE) $(AM_MAKEFLAGS) $(DIST_TARGETS) am__post_remove_distdir='@:'
+ $(am__post_remove_distdir)
+
+# This target untars the dist file and tries a VPATH configuration. Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+ case '$(DIST_ARCHIVES)' in \
+ *.tar.gz*) \
+ GZIP=$(GZIP_ENV) gzip -dc $(distdir).tar.gz | $(am__untar) ;;\
+ *.tar.bz2*) \
+ bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\
+ *.tar.lz*) \
+ lzip -dc $(distdir).tar.lz | $(am__untar) ;;\
+ *.tar.xz*) \
+ xz -dc $(distdir).tar.xz | $(am__untar) ;;\
+ *.tar.Z*) \
+ uncompress -c $(distdir).tar.Z | $(am__untar) ;;\
+ *.shar.gz*) \
+ GZIP=$(GZIP_ENV) gzip -dc $(distdir).shar.gz | unshar ;;\
+ *.zip*) \
+ unzip $(distdir).zip ;;\
+ esac
+ chmod -R a-w $(distdir)
+ chmod u+w $(distdir)
+ mkdir $(distdir)/_build $(distdir)/_inst
+ chmod a-w $(distdir)
+ test -d $(distdir)/_build || exit 0; \
+ dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \
+ && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \
+ && am__cwd=`pwd` \
+ && $(am__cd) $(distdir)/_build \
+ && ../configure --srcdir=.. --prefix="$$dc_install_base" \
+ $(AM_DISTCHECK_CONFIGURE_FLAGS) \
+ $(DISTCHECK_CONFIGURE_FLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) \
+ && $(MAKE) $(AM_MAKEFLAGS) dvi \
+ && $(MAKE) $(AM_MAKEFLAGS) check \
+ && $(MAKE) $(AM_MAKEFLAGS) install \
+ && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+ && $(MAKE) $(AM_MAKEFLAGS) uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \
+ distuninstallcheck \
+ && chmod -R a-w "$$dc_install_base" \
+ && ({ \
+ (cd ../.. && umask 077 && mkdir "$$dc_destdir") \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \
+ && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \
+ distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \
+ } || { rm -rf "$$dc_destdir"; exit 1; }) \
+ && rm -rf "$$dc_destdir" \
+ && $(MAKE) $(AM_MAKEFLAGS) dist \
+ && rm -rf $(DIST_ARCHIVES) \
+ && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \
+ && cd "$$am__cwd" \
+ || exit 1
+ $(am__post_remove_distdir)
+ @(echo "$(distdir) archives ready for distribution: "; \
+ list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \
+ sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x'
+distuninstallcheck:
+ @test -n '$(distuninstallcheck_dir)' || { \
+ echo 'ERROR: trying to run $@ with an empty' \
+ '$$(distuninstallcheck_dir)' >&2; \
+ exit 1; \
+ }; \
+ $(am__cd) '$(distuninstallcheck_dir)' || { \
+ echo 'ERROR: cannot chdir into $(distuninstallcheck_dir)' >&2; \
+ exit 1; \
+ }; \
+ test `$(am__distuninstallcheck_listfiles) | wc -l` -eq 0 \
+ || { echo "ERROR: files left after uninstall:" ; \
+ if test -n "$(DESTDIR)"; then \
+ echo " (check DESTDIR support)"; \
+ fi ; \
+ $(distuninstallcheck_listfiles) ; \
+ exit 1; } >&2
+distcleancheck: distclean
+ @if test '$(srcdir)' = . ; then \
+ echo "ERROR: distcleancheck can only run from a VPATH build" ; \
+ exit 1 ; \
+ fi
+ @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \
+ || { echo "ERROR: files left in build directory after distclean:" ; \
+ $(distcleancheck_listfiles) ; \
+ exit 1; } >&2
+check-am: all-am
+check: check-recursive
+all-am: Makefile $(DATA)
+installdirs: installdirs-recursive
+installdirs-am:
+ for dir in "$(DESTDIR)$(docdir)"; do \
+ test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+ done
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-recursive
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic distclean-libtool \
+ distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am: install-docDATA
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+ -rm -f $(am__CONFIG_DISTCLEAN_FILES)
+ -rm -rf $(top_srcdir)/autom4te.cache
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-docDATA
+
+.MAKE: $(am__recursive_targets) install-am install-strip
+
+.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am \
+ am--refresh check check-am clean clean-cscope clean-generic \
+ clean-libtool cscope cscopelist-am ctags ctags-am dist \
+ dist-all dist-bzip2 dist-gzip dist-lzip dist-shar dist-tarZ \
+ dist-xz dist-zip distcheck distclean distclean-generic \
+ distclean-libtool distclean-tags distcleancheck distdir \
+ distuninstallcheck dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am \
+ install-docDATA install-dvi install-dvi-am install-exec \
+ install-exec-am install-html install-html-am install-info \
+ install-info-am install-man install-pdf install-pdf-am \
+ install-ps install-ps-am install-strip installcheck \
+ installcheck-am installdirs installdirs-am maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-generic \
+ mostlyclean-libtool pdf pdf-am ps ps-am tags tags-am uninstall \
+ uninstall-am uninstall-docDATA
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/README.md b/README.md
new file mode 100644
index 00000000..c7e36a7d
--- /dev/null
+++ b/README.md
@@ -0,0 +1,163 @@
+The Final Cut
+=============
+The Final Cut is a programming library and widget toolkit that creates a text-based user interface with full mouse support. It supports the controlled handling of multiple simultaneous windows.
+The C++ class design is inspired by the Qt framework. It offers common user interface elements like dialog windows, push buttons, check boxes, radio buttons, input lines, list boxes, status bars and so on.
+
+
+
+
+
+
+
+
+newfont
+-------
+A new text font for X11 and the Linux console.
+
+
+
+
+
+Virtual terminal
+----------------
+It uses a virtual terminal to print the character via an update method on the screen.
+The virtual windows are an overlying layer to realizing window movements.
+The update method transmits only the changes to the virtual terminal or the screen.
+
+
+ print(...)
+printf(...)
+ │
+ │ ╔═════════════════════════[ vterm ]═════════════════════════╗
+ │ ║createVTerm() ║
+ │ ║ ┌ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ┐ ║
+ │ ║ ║
+ │ ║ │ restoreVTerm(x,y,w,h) │ ║
+ │ ║ ║
+ │ ║ └ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ┘ ║
+ │ ║ ║
+ │ ┌───────╨─────[ vwin ]─────────────┐ ║
+ │ │createArea(area) │ ║
+ │ │ │ ║
+ │ │ │ ║
+ └───┼─────────────► ──────► updateVTerm(area) ────► ║
+ │ │ ║
+ │ putArea(x,y,area) ║
+ │ ────────────────────► ║
+ │ getArea(x,y,area) ║
+ │ ◄──────────────────── ║
+ │ │ ║
+ │ │ ║
+ │ resizeArea(area)│ ║
+ └───────╥──────────────────────────┘ ║
+ ║ ║
+ ║ ║
+ ║ ║
+ ║ │ resizeVTerm()║
+ ╚═══▼═══════════════════════════════════════════════════════╝
+ │
+ │ putVTerm() ┌───────────────┐
+ └───────────────────►│ output_buffer │
+ updateTerminal() └───────┬───────┘
+ │
+ │ flush_out()
+ │ +
+ │ Fputchar(char)
+ │
+ ▼
+ ▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄
+ ▌ ▐
+ ▌ screen ▐
+ ▌ ───────────── ▐
+ ▌ real terminal ▐
+ ▌ ▐
+ ▀▀▀▀▀▀▀███▀▀▀▀▀▀▀
+ ███
+ ▀▀▀▀▀▀▀▀▀
+
+
+
+Class digramm
+-------------
+
+ ┌───────────┐
+ ┌────┤ FKeyEvent │
+ │ └───────────┘
+ │ ┌─────────────┐
+ ├────┤ FMouseEvent │
+ │ └─────────────┘
+ │ ┌─────────────┐
+ ├────┤ FWheelEvent │
+ │ └─────────────┘
+ │ ┌─────────────┐
+ ├────┤ FFocusEvent │
+ │ └─────────────┘
+ │ ┌─────────────┐
+ ┌────────┐ ├────┤ FAccelEvent │
+ │ FEvent │◄─┤ └─────────────┘
+ └────┬───┘ │ ┌──────────────┐
+ │1 ├────┤ FResizeEvent │
+ │ │ └──────────────┘
+ │ │ ┌────────────┐
+ │ ├────┤ FShowEvent │
+ │ │ └────────────┘
+ │ │ ┌────────────┐
+ │ ├────┤ FHideEvent │
+ │ │ └────────────┘
+ │ │ ┌─────────────┐
+ │ ├────┤ FCloseEvent │
+ │ │ └─────────────┘
+ │ │ ┌─────────────┐
+ │ └────┤ FTimerEvent │
+ │ └─────────────┘
+ │
+ │ ┌──────────────┐
+ │ ┌────┤ FApplication │
+ │ │ └──────────────┘
+ │ │ ┌─────────┐1
+ │ ├────┤ FButton ├-----------------------------.
+ │ │ └─────────┘ │
+ │ │ ┌────────┐1 │
+ │ ├────┤ FLabel ├------------------------------┤
+ │ │ └────────┘ │
+ │ │ ┌───────────┐1 │
+ │ ├────┤ FLineEdit ├---------------------------┤
+ │ │ └───────────┘ ┌──────────────┐1 │
+ │ │ ┌───────────────┐ ┌──┤ FRadioButton ├--┤
+ │1 ├────┤ FToggleButton │◄─┤ └──────────────┘ │
+ ┌─────────┐ ┌─────┴───┐ │ └───────────────┘ │ ┌───────────┐1 │
+ │ FObject │◄─┬┤ FWidget │◄─┤ ┌──────────────┐ └──┤ FCheckBox ├-----┤
+ └─────────┘ │└───┬─┬───┘ ├────┤ FButtonGroup │ └───────────┘ │
+ │ │1│1 │ └──────────────┘ │
+ ┌───────┐ │ │ │ │ ┌──────────────┐ │
+ │ FTerm │◄─┘ │ │ ├────┤ FProgressbar │ │ *┌─────────┐
+ └──┬─┬──┘ │ │ │ └──────────────┘ ├---┤ FString │
+ │1│1 │ │ │ ┌────────────┐ │ └─────────┘
+ │ └----------┤ │ ├────┤ FScrollbar │ │
+ │* │ │ │ └────────────┘ │
+ ┌────┴──────┐ │ │ │ ┌───────────┐1 │
+ │ FOptiMove │ │ │ ├────┤ FTextView ├---------------------------┤
+ └───────────┘ │ │ │ └───────────┘ │
+ │ │ │ ┌──────────┐1 *┌──────────────┐1 │
+ │ │ ├────┤ FListBox ├-------┤ FListBoxItem ├-----┤
+ │ │ │ └──────────┘ └──────────────┘ │
+ │ │ │ ┌────────────┐1 *┌────────────┐1 │
+ │ │ ├────┤ FStatusBar ├-----┤ FStatusKey ├-------┤
+ │ │ │ └────┬───────┘ └────────────┘ │
+ │ │ │ 1└----------------------------------┤
+ │ │ │ ┌─────────────┐1 │
+ │ │ ┌───┴─────┐ ┌─────────┐ ┌──┤ FFileDialog ├----┤
+ │ │ │ FWindow │◄─┤ FDialog │◄──┤ └─────────────┘ │
+ │ │ └─────────┘ └────┬────┘ │ ┌─────────────┐1 │
+ │ │ │ └──┤ FMessageBox ├----┤
+ │ │ │ └─────────────┘ │
+ │ │ 1└------------------------------┤
+ │ │ │
+ │ └---------------------------------------------------'
+ │ *┌────────┐
+ ├---┤ FPoint │
+ │ └────────┘
+ │ *┌───────┐
+ └---┤ FRect │
+ └───────┘
+
diff --git a/aclocal.m4 b/aclocal.m4
new file mode 100644
index 00000000..950b0d58
--- /dev/null
+++ b/aclocal.m4
@@ -0,0 +1,1044 @@
+# generated automatically by aclocal 1.13.4 -*- Autoconf -*-
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+m4_ifndef([AC_CONFIG_MACRO_DIRS], [m4_defun([_AM_CONFIG_MACRO_DIRS], [])m4_defun([AC_CONFIG_MACRO_DIRS], [_AM_CONFIG_MACRO_DIRS($@)])])
+m4_ifndef([AC_AUTOCONF_VERSION],
+ [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+m4_if(m4_defn([AC_AUTOCONF_VERSION]), [2.69],,
+[m4_warning([this file was generated for autoconf 2.69.
+You have another version of autoconf. It may work, but is not guaranteed to.
+If you have problems, you may need to regenerate the build system entirely.
+To do so, use the procedure documented by the package, typically 'autoreconf'.])])
+
+# Copyright (C) 2002-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_AUTOMAKE_VERSION(VERSION)
+# ----------------------------
+# Automake X.Y traces this macro to ensure aclocal.m4 has been
+# generated from the m4 files accompanying Automake X.Y.
+# (This private macro should not be called outside this file.)
+AC_DEFUN([AM_AUTOMAKE_VERSION],
+[am__api_version='1.13'
+dnl Some users find AM_AUTOMAKE_VERSION and mistake it for a way to
+dnl require some minimum version. Point them to the right macro.
+m4_if([$1], [1.13.4], [],
+ [AC_FATAL([Do not call $0, use AM_INIT_AUTOMAKE([$1]).])])dnl
+])
+
+# _AM_AUTOCONF_VERSION(VERSION)
+# -----------------------------
+# aclocal traces this macro to find the Autoconf version.
+# This is a private macro too. Using m4_define simplifies
+# the logic in aclocal, which can simply ignore this definition.
+m4_define([_AM_AUTOCONF_VERSION], [])
+
+# AM_SET_CURRENT_AUTOMAKE_VERSION
+# -------------------------------
+# Call AM_AUTOMAKE_VERSION and AM_AUTOMAKE_VERSION so they can be traced.
+# This function is AC_REQUIREd by AM_INIT_AUTOMAKE.
+AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION],
+[AM_AUTOMAKE_VERSION([1.13.4])dnl
+m4_ifndef([AC_AUTOCONF_VERSION],
+ [m4_copy([m4_PACKAGE_VERSION], [AC_AUTOCONF_VERSION])])dnl
+_AM_AUTOCONF_VERSION(m4_defn([AC_AUTOCONF_VERSION]))])
+
+# AM_AUX_DIR_EXPAND -*- Autoconf -*-
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets
+# $ac_aux_dir to '$srcdir/foo'. In other projects, it is set to
+# '$srcdir', '$srcdir/..', or '$srcdir/../..'.
+#
+# Of course, Automake must honor this variable whenever it calls a
+# tool from the auxiliary directory. The problem is that $srcdir (and
+# therefore $ac_aux_dir as well) can be either absolute or relative,
+# depending on how configure is run. This is pretty annoying, since
+# it makes $ac_aux_dir quite unusable in subdirectories: in the top
+# source directory, any form will work fine, but in subdirectories a
+# relative path needs to be adjusted first.
+#
+# $ac_aux_dir/missing
+# fails when called from a subdirectory if $ac_aux_dir is relative
+# $top_srcdir/$ac_aux_dir/missing
+# fails if $ac_aux_dir is absolute,
+# fails when called from a subdirectory in a VPATH build with
+# a relative $ac_aux_dir
+#
+# The reason of the latter failure is that $top_srcdir and $ac_aux_dir
+# are both prefixed by $srcdir. In an in-source build this is usually
+# harmless because $srcdir is '.', but things will broke when you
+# start a VPATH build or use an absolute $srcdir.
+#
+# So we could use something similar to $top_srcdir/$ac_aux_dir/missing,
+# iff we strip the leading $srcdir from $ac_aux_dir. That would be:
+# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"`
+# and then we would define $MISSING as
+# MISSING="\${SHELL} $am_aux_dir/missing"
+# This will work as long as MISSING is not called from configure, because
+# unfortunately $(top_srcdir) has no meaning in configure.
+# However there are other variables, like CC, which are often used in
+# configure, and could therefore not use this "fixed" $ac_aux_dir.
+#
+# Another solution, used here, is to always expand $ac_aux_dir to an
+# absolute PATH. The drawback is that using absolute paths prevent a
+# configured tree to be moved without reconfiguration.
+
+AC_DEFUN([AM_AUX_DIR_EXPAND],
+[dnl Rely on autoconf to set up CDPATH properly.
+AC_PREREQ([2.50])dnl
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+])
+
+# AM_CONDITIONAL -*- Autoconf -*-
+
+# Copyright (C) 1997-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_CONDITIONAL(NAME, SHELL-CONDITION)
+# -------------------------------------
+# Define a conditional.
+AC_DEFUN([AM_CONDITIONAL],
+[AC_PREREQ([2.52])dnl
+ m4_if([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])],
+ [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl
+AC_SUBST([$1_TRUE])dnl
+AC_SUBST([$1_FALSE])dnl
+_AM_SUBST_NOTMAKE([$1_TRUE])dnl
+_AM_SUBST_NOTMAKE([$1_FALSE])dnl
+m4_define([_AM_COND_VALUE_$1], [$2])dnl
+if $2; then
+ $1_TRUE=
+ $1_FALSE='#'
+else
+ $1_TRUE='#'
+ $1_FALSE=
+fi
+AC_CONFIG_COMMANDS_PRE(
+[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then
+ AC_MSG_ERROR([[conditional "$1" was never defined.
+Usually this means the macro was only invoked conditionally.]])
+fi])])
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+
+# There are a few dirty hacks below to avoid letting 'AC_PROG_CC' be
+# written in clear, in which case automake, when reading aclocal.m4,
+# will think it sees a *use*, and therefore will trigger all it's
+# C support machinery. Also note that it means that autoscan, seeing
+# CC etc. in the Makefile, will ask for an AC_PROG_CC use...
+
+
+# _AM_DEPENDENCIES(NAME)
+# ----------------------
+# See how the compiler implements dependency checking.
+# NAME is "CC", "CXX", "OBJC", "OBJCXX", "UPC", or "GJC".
+# We try a few techniques and use that to set a single cache variable.
+#
+# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was
+# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular
+# dependency, and given that the user is not expected to run this macro,
+# just rely on AC_PROG_CC.
+AC_DEFUN([_AM_DEPENDENCIES],
+[AC_REQUIRE([AM_SET_DEPDIR])dnl
+AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl
+AC_REQUIRE([AM_MAKE_INCLUDE])dnl
+AC_REQUIRE([AM_DEP_TRACK])dnl
+
+m4_if([$1], [CC], [depcc="$CC" am_compiler_list=],
+ [$1], [CXX], [depcc="$CXX" am_compiler_list=],
+ [$1], [OBJC], [depcc="$OBJC" am_compiler_list='gcc3 gcc'],
+ [$1], [OBJCXX], [depcc="$OBJCXX" am_compiler_list='gcc3 gcc'],
+ [$1], [UPC], [depcc="$UPC" am_compiler_list=],
+ [$1], [GCJ], [depcc="$GCJ" am_compiler_list='gcc3 gcc'],
+ [depcc="$$1" am_compiler_list=])
+
+AC_CACHE_CHECK([dependency style of $depcc],
+ [am_cv_$1_dependencies_compiler_type],
+[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named 'D' -- because '-MD' means "put the output
+ # in D".
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_$1_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp`
+ fi
+ am__universal=false
+ m4_case([$1], [CC],
+ [case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac],
+ [CXX],
+ [case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac])
+
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+ # Solaris 10 /bin/sh.
+ echo '/* dummy */' > sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ # We check with '-c' and '-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle '-M -o', and we need to detect this. Also, some Intel
+ # versions had trouble with output in subdirs.
+ am__obj=sub/conftest.${OBJEXT-o}
+ am__minus_obj="-o $am__obj"
+ case $depmode in
+ gcc)
+ # This depmode causes a compiler race in universal mode.
+ test "$am__universal" = false || continue
+ ;;
+ nosideeffect)
+ # After this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested.
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+ # This compiler won't grok '-c -o', but also, the minuso test has
+ # not run yet. These depmodes are late enough in the game, and
+ # so weak that their functioning should not be impacted.
+ am__obj=conftest.${OBJEXT-o}
+ am__minus_obj=
+ ;;
+ none) break ;;
+ esac
+ if depmode=$depmode \
+ source=sub/conftest.c object=$am__obj \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_$1_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_$1_dependencies_compiler_type=none
+fi
+])
+AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type])
+AM_CONDITIONAL([am__fastdep$1], [
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_$1_dependencies_compiler_type" = gcc3])
+])
+
+
+# AM_SET_DEPDIR
+# -------------
+# Choose a directory name for dependency files.
+# This macro is AC_REQUIREd in _AM_DEPENDENCIES.
+AC_DEFUN([AM_SET_DEPDIR],
+[AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl
+])
+
+
+# AM_DEP_TRACK
+# ------------
+AC_DEFUN([AM_DEP_TRACK],
+[AC_ARG_ENABLE([dependency-tracking], [dnl
+AS_HELP_STRING(
+ [--enable-dependency-tracking],
+ [do not reject slow dependency extractors])
+AS_HELP_STRING(
+ [--disable-dependency-tracking],
+ [speeds up one-time build])])
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+ am__nodep='_no'
+fi
+AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno])
+AC_SUBST([AMDEPBACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AMDEPBACKSLASH])dnl
+AC_SUBST([am__nodep])dnl
+_AM_SUBST_NOTMAKE([am__nodep])dnl
+])
+
+# Generate code to set up dependency tracking. -*- Autoconf -*-
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+
+# _AM_OUTPUT_DEPENDENCY_COMMANDS
+# ------------------------------
+AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS],
+[{
+ # Older Autoconf quotes --file arguments for eval, but not when files
+ # are listed without --file. Let's play safe and only enable the eval
+ # if we detect the quoting.
+ case $CONFIG_FILES in
+ *\'*) eval set x "$CONFIG_FILES" ;;
+ *) set x $CONFIG_FILES ;;
+ esac
+ shift
+ for mf
+ do
+ # Strip MF so we end up with the name of the file.
+ mf=`echo "$mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile or not.
+ # We used to match only the files named 'Makefile.in', but
+ # some people rename them; so instead we look at the file content.
+ # Grep'ing the first line is not enough: some people post-process
+ # each Makefile.in and add a new line on top of each file to say so.
+ # Grep'ing the whole file is not good either: AIX grep has a line
+ # limit of 2048, but all sed's we know have understand at least 4000.
+ if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
+ dirpart=`AS_DIRNAME("$mf")`
+ else
+ continue
+ fi
+ # Extract the definition of DEPDIR, am__include, and am__quote
+ # from the Makefile without running 'make'.
+ DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+ test -z "$DEPDIR" && continue
+ am__include=`sed -n 's/^am__include = //p' < "$mf"`
+ test -z "$am__include" && continue
+ am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+ # Find all dependency output files, they are included files with
+ # $(DEPDIR) in their names. We invoke sed twice because it is the
+ # simplest approach to changing $(DEPDIR) to its actual value in the
+ # expansion.
+ for file in `sed -n "
+ s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+ sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g'`; do
+ # Make sure the directory exists.
+ test -f "$dirpart/$file" && continue
+ fdir=`AS_DIRNAME(["$file"])`
+ AS_MKDIR_P([$dirpart/$fdir])
+ # echo "creating $dirpart/$file"
+ echo '# dummy' > "$dirpart/$file"
+ done
+ done
+}
+])# _AM_OUTPUT_DEPENDENCY_COMMANDS
+
+
+# AM_OUTPUT_DEPENDENCY_COMMANDS
+# -----------------------------
+# This macro should only be invoked once -- use via AC_REQUIRE.
+#
+# This code is only required when automatic dependency tracking
+# is enabled. FIXME. This creates each '.P' file that we will
+# need in order to bootstrap the dependency handling code.
+AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS],
+[AC_CONFIG_COMMANDS([depfiles],
+ [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS],
+ [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"])
+])
+
+# Do all the work for Automake. -*- Autoconf -*-
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This macro actually does too much. Some checks are only needed if
+# your package does certain things. But this isn't really a big deal.
+
+# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE])
+# AM_INIT_AUTOMAKE([OPTIONS])
+# -----------------------------------------------
+# The call with PACKAGE and VERSION arguments is the old style
+# call (pre autoconf-2.50), which is being phased out. PACKAGE
+# and VERSION should now be passed to AC_INIT and removed from
+# the call to AM_INIT_AUTOMAKE.
+# We support both call styles for the transition. After
+# the next Automake release, Autoconf can make the AC_INIT
+# arguments mandatory, and then we can depend on a new Autoconf
+# release and drop the old call support.
+AC_DEFUN([AM_INIT_AUTOMAKE],
+[AC_PREREQ([2.65])dnl
+dnl Autoconf wants to disallow AM_ names. We explicitly allow
+dnl the ones we care about.
+m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl
+AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl
+AC_REQUIRE([AC_PROG_INSTALL])dnl
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+ # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+ # is not polluted with repeated "-I."
+ AC_SUBST([am__isrc], [' -I$(srcdir)'])_AM_SUBST_NOTMAKE([am__isrc])dnl
+ # test to see if srcdir already configured
+ if test -f $srcdir/config.status; then
+ AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+ fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+AC_SUBST([CYGPATH_W])
+
+# Define the identity of the package.
+dnl Distinguish between old-style and new-style calls.
+m4_ifval([$2],
+[AC_DIAGNOSE([obsolete],
+ [$0: two- and three-arguments forms are deprecated.])
+m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl
+ AC_SUBST([PACKAGE], [$1])dnl
+ AC_SUBST([VERSION], [$2])],
+[_AM_SET_OPTIONS([$1])dnl
+dnl Diagnose old-style AC_INIT with new-style AM_AUTOMAKE_INIT.
+m4_if(
+ m4_ifdef([AC_PACKAGE_NAME], [ok]):m4_ifdef([AC_PACKAGE_VERSION], [ok]),
+ [ok:ok],,
+ [m4_fatal([AC_INIT should be called with package and version arguments])])dnl
+ AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl
+ AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl
+
+_AM_IF_OPTION([no-define],,
+[AC_DEFINE_UNQUOTED([PACKAGE], ["$PACKAGE"], [Name of package])
+ AC_DEFINE_UNQUOTED([VERSION], ["$VERSION"], [Version number of package])])dnl
+
+# Some tools Automake needs.
+AC_REQUIRE([AM_SANITY_CHECK])dnl
+AC_REQUIRE([AC_ARG_PROGRAM])dnl
+AM_MISSING_PROG([ACLOCAL], [aclocal-${am__api_version}])
+AM_MISSING_PROG([AUTOCONF], [autoconf])
+AM_MISSING_PROG([AUTOMAKE], [automake-${am__api_version}])
+AM_MISSING_PROG([AUTOHEADER], [autoheader])
+AM_MISSING_PROG([MAKEINFO], [makeinfo])
+AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+AC_REQUIRE([AM_PROG_INSTALL_STRIP])dnl
+AC_REQUIRE([AC_PROG_MKDIR_P])dnl
+# For better backward compatibility. To be removed once Automake 1.9.x
+# dies out for good. For more background, see:
+#
+#
+AC_SUBST([mkdir_p], ['$(MKDIR_P)'])
+# We need awk for the "check" target. The system "awk" is bad on
+# some platforms.
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([AC_PROG_MAKE_SET])dnl
+AC_REQUIRE([AM_SET_LEADING_DOT])dnl
+_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])],
+ [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])],
+ [_AM_PROG_TAR([v7])])])
+_AM_IF_OPTION([no-dependencies],,
+[AC_PROVIDE_IFELSE([AC_PROG_CC],
+ [_AM_DEPENDENCIES([CC])],
+ [m4_define([AC_PROG_CC],
+ m4_defn([AC_PROG_CC])[_AM_DEPENDENCIES([CC])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_CXX],
+ [_AM_DEPENDENCIES([CXX])],
+ [m4_define([AC_PROG_CXX],
+ m4_defn([AC_PROG_CXX])[_AM_DEPENDENCIES([CXX])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJC],
+ [_AM_DEPENDENCIES([OBJC])],
+ [m4_define([AC_PROG_OBJC],
+ m4_defn([AC_PROG_OBJC])[_AM_DEPENDENCIES([OBJC])])])dnl
+AC_PROVIDE_IFELSE([AC_PROG_OBJCXX],
+ [_AM_DEPENDENCIES([OBJCXX])],
+ [m4_define([AC_PROG_OBJCXX],
+ m4_defn([AC_PROG_OBJCXX])[_AM_DEPENDENCIES([OBJCXX])])])dnl
+])
+AC_REQUIRE([AM_SILENT_RULES])dnl
+dnl The testsuite driver may need to know about EXEEXT, so add the
+dnl 'am__EXEEXT' conditional if _AM_COMPILER_EXEEXT was seen. This
+dnl macro is hooked onto _AC_COMPILER_EXEEXT early, see below.
+AC_CONFIG_COMMANDS_PRE(dnl
+[m4_provide_if([_AM_COMPILER_EXEEXT],
+ [AM_CONDITIONAL([am__EXEEXT], [test -n "$EXEEXT"])])])dnl
+])
+
+dnl Hook into '_AC_COMPILER_EXEEXT' early to learn its expansion. Do not
+dnl add the conditional right here, as _AC_COMPILER_EXEEXT may be further
+dnl mangled by Autoconf and run in a shell conditional statement.
+m4_define([_AC_COMPILER_EXEEXT],
+m4_defn([_AC_COMPILER_EXEEXT])[m4_provide([_AM_COMPILER_EXEEXT])])
+
+
+# When config.status generates a header, we must update the stamp-h file.
+# This file resides in the same directory as the config header
+# that is generated. The stamp files are numbered to have different names.
+
+# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the
+# loop where config.status creates the headers, so we can generate
+# our stamp files there.
+AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK],
+[# Compute $1's index in $config_headers.
+_am_arg=$1
+_am_stamp_count=1
+for _am_header in $config_headers :; do
+ case $_am_header in
+ $_am_arg | $_am_arg:* )
+ break ;;
+ * )
+ _am_stamp_count=`expr $_am_stamp_count + 1` ;;
+ esac
+done
+echo "timestamp for $_am_arg" >`AS_DIRNAME(["$_am_arg"])`/stamp-h[]$_am_stamp_count])
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_SH
+# ------------------
+# Define $install_sh.
+AC_DEFUN([AM_PROG_INSTALL_SH],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+if test x"${install_sh}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+ *)
+ install_sh="\${SHELL} $am_aux_dir/install-sh"
+ esac
+fi
+AC_SUBST([install_sh])])
+
+# Copyright (C) 2003-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# Check whether the underlying file-system supports filenames
+# with a leading dot. For instance MS-DOS doesn't.
+AC_DEFUN([AM_SET_LEADING_DOT],
+[rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+AC_SUBST([am__leading_dot])])
+
+# Check to see how 'make' treats includes. -*- Autoconf -*-
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MAKE_INCLUDE()
+# -----------------
+# Check to see how make treats includes.
+AC_DEFUN([AM_MAKE_INCLUDE],
+[am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+ @echo this is the am__doit target
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+AC_MSG_CHECKING([for style of include used by $am_make])
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# Ignore all kinds of additional output from 'make'.
+case `$am_make -s -f confmf 2> /dev/null` in #(
+*the\ am__doit\ target*)
+ am__include=include
+ am__quote=
+ _am_result=GNU
+ ;;
+esac
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+ echo '.include "confinc"' > confmf
+ case `$am_make -s -f confmf 2> /dev/null` in #(
+ *the\ am__doit\ target*)
+ am__include=.include
+ am__quote="\""
+ _am_result=BSD
+ ;;
+ esac
+fi
+AC_SUBST([am__include])
+AC_SUBST([am__quote])
+AC_MSG_RESULT([$_am_result])
+rm -f confinc confmf
+])
+
+# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*-
+
+# Copyright (C) 1997-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_MISSING_PROG(NAME, PROGRAM)
+# ------------------------------
+AC_DEFUN([AM_MISSING_PROG],
+[AC_REQUIRE([AM_MISSING_HAS_RUN])
+$1=${$1-"${am_missing_run}$2"}
+AC_SUBST($1)])
+
+# AM_MISSING_HAS_RUN
+# ------------------
+# Define MISSING if not defined so far and test if it is modern enough.
+# If it is, set am_missing_run to use it, otherwise, to nothing.
+AC_DEFUN([AM_MISSING_HAS_RUN],
+[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl
+AC_REQUIRE_AUX_FILE([missing])dnl
+if test x"${MISSING+set}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ MISSING="\${SHELL} \"$am_aux_dir/missing\"" ;;
+ *)
+ MISSING="\${SHELL} $am_aux_dir/missing" ;;
+ esac
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --is-lightweight"; then
+ am_missing_run="$MISSING "
+else
+ am_missing_run=
+ AC_MSG_WARN(['missing' script is too old or missing])
+fi
+])
+
+# Helper functions for option handling. -*- Autoconf -*-
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_MANGLE_OPTION(NAME)
+# -----------------------
+AC_DEFUN([_AM_MANGLE_OPTION],
+[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])])
+
+# _AM_SET_OPTION(NAME)
+# --------------------
+# Set option NAME. Presently that only means defining a flag for this option.
+AC_DEFUN([_AM_SET_OPTION],
+[m4_define(_AM_MANGLE_OPTION([$1]), [1])])
+
+# _AM_SET_OPTIONS(OPTIONS)
+# ------------------------
+# OPTIONS is a space-separated list of Automake options.
+AC_DEFUN([_AM_SET_OPTIONS],
+[m4_foreach_w([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])])
+
+# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET])
+# -------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+AC_DEFUN([_AM_IF_OPTION],
+[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])])
+
+# Check to make sure that the build environment is sane. -*- Autoconf -*-
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_SANITY_CHECK
+# ---------------
+AC_DEFUN([AM_SANITY_CHECK],
+[AC_MSG_CHECKING([whether build environment is sane])
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name. Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+ *[[\\\"\#\$\&\'\`$am_lf]]*)
+ AC_MSG_ERROR([unsafe absolute working directory name]);;
+esac
+case $srcdir in
+ *[[\\\"\#\$\&\'\`$am_lf\ \ ]]*)
+ AC_MSG_ERROR([unsafe srcdir value: '$srcdir']);;
+esac
+
+# Do 'set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ am_has_slept=no
+ for am_try in 1 2; do
+ echo "timestamp, slept: $am_has_slept" > conftest.file
+ set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+ if test "$[*]" = "X"; then
+ # -L didn't work.
+ set X `ls -t "$srcdir/configure" conftest.file`
+ fi
+ if test "$[*]" != "X $srcdir/configure conftest.file" \
+ && test "$[*]" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken
+ alias in your environment])
+ fi
+ if test "$[2]" = conftest.file || test $am_try -eq 2; then
+ break
+ fi
+ # Just in case.
+ sleep 1
+ am_has_slept=yes
+ done
+ test "$[2]" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+AC_MSG_RESULT([yes])
+# If we didn't sleep, we still need to ensure time stamps of config.status and
+# generated files are strictly newer.
+am_sleep_pid=
+if grep 'slept: no' conftest.file >/dev/null 2>&1; then
+ ( sleep 1 ) &
+ am_sleep_pid=$!
+fi
+AC_CONFIG_COMMANDS_PRE(
+ [AC_MSG_CHECKING([that generated files are newer than configure])
+ if test -n "$am_sleep_pid"; then
+ # Hide warnings about reused PIDs.
+ wait $am_sleep_pid 2>/dev/null
+ fi
+ AC_MSG_RESULT([done])])
+rm -f conftest.file
+])
+
+# Copyright (C) 2009-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_SILENT_RULES([DEFAULT])
+# --------------------------
+# Enable less verbose build rules; with the default set to DEFAULT
+# ("yes" being less verbose, "no" or empty being verbose).
+AC_DEFUN([AM_SILENT_RULES],
+[AC_ARG_ENABLE([silent-rules], [dnl
+AS_HELP_STRING(
+ [--enable-silent-rules],
+ [less verbose build output (undo: "make V=1")])
+AS_HELP_STRING(
+ [--disable-silent-rules],
+ [verbose build output (undo: "make V=0")])dnl
+])
+case $enable_silent_rules in @%:@ (((
+ yes) AM_DEFAULT_VERBOSITY=0;;
+ no) AM_DEFAULT_VERBOSITY=1;;
+ *) AM_DEFAULT_VERBOSITY=m4_if([$1], [yes], [0], [1]);;
+esac
+dnl
+dnl A few 'make' implementations (e.g., NonStop OS and NextStep)
+dnl do not support nested variable expansions.
+dnl See automake bug#9928 and bug#10237.
+am_make=${MAKE-make}
+AC_CACHE_CHECK([whether $am_make supports nested variables],
+ [am_cv_make_support_nested_variables],
+ [if AS_ECHO([['TRUE=$(BAR$(V))
+BAR0=false
+BAR1=true
+V=1
+am__doit:
+ @$(TRUE)
+.PHONY: am__doit']]) | $am_make -f - >/dev/null 2>&1; then
+ am_cv_make_support_nested_variables=yes
+else
+ am_cv_make_support_nested_variables=no
+fi])
+if test $am_cv_make_support_nested_variables = yes; then
+ dnl Using '$V' instead of '$(V)' breaks IRIX make.
+ AM_V='$(V)'
+ AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)'
+else
+ AM_V=$AM_DEFAULT_VERBOSITY
+ AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY
+fi
+AC_SUBST([AM_V])dnl
+AM_SUBST_NOTMAKE([AM_V])dnl
+AC_SUBST([AM_DEFAULT_V])dnl
+AM_SUBST_NOTMAKE([AM_DEFAULT_V])dnl
+AC_SUBST([AM_DEFAULT_VERBOSITY])dnl
+AM_BACKSLASH='\'
+AC_SUBST([AM_BACKSLASH])dnl
+_AM_SUBST_NOTMAKE([AM_BACKSLASH])dnl
+])
+
+# Copyright (C) 2001-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# AM_PROG_INSTALL_STRIP
+# ---------------------
+# One issue with vendor 'install' (even GNU) is that you can't
+# specify the program used to strip binaries. This is especially
+# annoying in cross-compiling environments, where the build's strip
+# is unlikely to handle the host's binaries.
+# Fortunately install-sh will honor a STRIPPROG variable, so we
+# always use install-sh in "make install-strip", and initialize
+# STRIPPROG with the value of the STRIP variable (set by the user).
+AC_DEFUN([AM_PROG_INSTALL_STRIP],
+[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl
+# Installed binaries are usually stripped using 'strip' when the user
+# run "make install-strip". However 'strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the 'STRIP' environment variable to overrule this program.
+dnl Don't test for $cross_compiling = yes, because it might be 'maybe'.
+if test "$cross_compiling" != no; then
+ AC_CHECK_TOOL([STRIP], [strip], :)
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+AC_SUBST([INSTALL_STRIP_PROGRAM])])
+
+# Copyright (C) 2006-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_SUBST_NOTMAKE(VARIABLE)
+# ---------------------------
+# Prevent Automake from outputting VARIABLE = @VARIABLE@ in Makefile.in.
+# This macro is traced by Automake.
+AC_DEFUN([_AM_SUBST_NOTMAKE])
+
+# AM_SUBST_NOTMAKE(VARIABLE)
+# --------------------------
+# Public sister of _AM_SUBST_NOTMAKE.
+AC_DEFUN([AM_SUBST_NOTMAKE], [_AM_SUBST_NOTMAKE($@)])
+
+# Check how to create a tarball. -*- Autoconf -*-
+
+# Copyright (C) 2004-2013 Free Software Foundation, Inc.
+#
+# This file is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# _AM_PROG_TAR(FORMAT)
+# --------------------
+# Check how to create a tarball in format FORMAT.
+# FORMAT should be one of 'v7', 'ustar', or 'pax'.
+#
+# Substitute a variable $(am__tar) that is a command
+# writing to stdout a FORMAT-tarball containing the directory
+# $tardir.
+# tardir=directory && $(am__tar) > result.tar
+#
+# Substitute a variable $(am__untar) that extract such
+# a tarball read from stdin.
+# $(am__untar) < result.tar
+#
+AC_DEFUN([_AM_PROG_TAR],
+[# Always define AMTAR for backward compatibility. Yes, it's still used
+# in the wild :-( We should find a proper way to deprecate it ...
+AC_SUBST([AMTAR], ['$${TAR-tar}'])
+
+# We'll loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none'
+
+m4_if([$1], [v7],
+ [am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'],
+
+ [m4_case([$1],
+ [ustar],
+ [# The POSIX 1988 'ustar' format is defined with fixed-size fields.
+ # There is notably a 21 bits limit for the UID and the GID. In fact,
+ # the 'pax' utility can hang on bigger UID/GID (see automake bug#8343
+ # and bug#13588).
+ am_max_uid=2097151 # 2^21 - 1
+ am_max_gid=$am_max_uid
+ # The $UID and $GID variables are not portable, so we need to resort
+ # to the POSIX-mandated id(1) utility. Errors in the 'id' calls
+ # below are definitely unexpected, so allow the users to see them
+ # (that is, avoid stderr redirection).
+ am_uid=`id -u || echo unknown`
+ am_gid=`id -g || echo unknown`
+ AC_MSG_CHECKING([whether UID '$am_uid' is supported by ustar format])
+ if test $am_uid -le $am_max_uid; then
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ _am_tools=none
+ fi
+ AC_MSG_CHECKING([whether GID '$am_gid' is supported by ustar format])
+ if test $am_gid -le $am_max_gid; then
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ _am_tools=none
+ fi],
+
+ [pax],
+ [],
+
+ [m4_fatal([Unknown tar format])])
+
+ AC_MSG_CHECKING([how to create a $1 tar archive])
+
+ # Go ahead even if we have the value already cached. We do so because we
+ # need to set the values for the 'am__tar' and 'am__untar' variables.
+ _am_tools=${am_cv_prog_tar_$1-$_am_tools}
+
+ for _am_tool in $_am_tools; do
+ case $_am_tool in
+ gnutar)
+ for _am_tar in tar gnutar gtar; do
+ AM_RUN_LOG([$_am_tar --version]) && break
+ done
+ am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"'
+ am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"'
+ am__untar="$_am_tar -xf -"
+ ;;
+ plaintar)
+ # Must skip GNU tar: if it does not support --format= it doesn't create
+ # ustar tarball either.
+ (tar --version) >/dev/null 2>&1 && continue
+ am__tar='tar chf - "$$tardir"'
+ am__tar_='tar chf - "$tardir"'
+ am__untar='tar xf -'
+ ;;
+ pax)
+ am__tar='pax -L -x $1 -w "$$tardir"'
+ am__tar_='pax -L -x $1 -w "$tardir"'
+ am__untar='pax -r'
+ ;;
+ cpio)
+ am__tar='find "$$tardir" -print | cpio -o -H $1 -L'
+ am__tar_='find "$tardir" -print | cpio -o -H $1 -L'
+ am__untar='cpio -i -H $1 -d'
+ ;;
+ none)
+ am__tar=false
+ am__tar_=false
+ am__untar=false
+ ;;
+ esac
+
+ # If the value was cached, stop now. We just wanted to have am__tar
+ # and am__untar set.
+ test -n "${am_cv_prog_tar_$1}" && break
+
+ # tar/untar a dummy directory, and stop if the command works.
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ echo GrepMe > conftest.dir/file
+ AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar])
+ rm -rf conftest.dir
+ if test -s conftest.tar; then
+ AM_RUN_LOG([$am__untar /dev/null 2>&1 && break
+ fi
+ done
+ rm -rf conftest.dir
+
+ AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool])
+ AC_MSG_RESULT([$am_cv_prog_tar_$1])])
+
+AC_SUBST([am__tar])
+AC_SUBST([am__untar])
+]) # _AM_PROG_TAR
+
+m4_include([m4/libtool.m4])
+m4_include([m4/ltoptions.m4])
+m4_include([m4/ltsugar.m4])
+m4_include([m4/ltversion.m4])
+m4_include([m4/lt~obsolete.m4])
diff --git a/autogen.sh b/autogen.sh
new file mode 100755
index 00000000..c1e39859
--- /dev/null
+++ b/autogen.sh
@@ -0,0 +1,28 @@
+#!/bin/sh
+
+# Set up an m4 environment
+aclocal
+
+# Generate configure from configure.ac
+autoconf
+
+# reate a template header (config.h.in) for configure
+autoheader
+
+# generates a custom version of the generic libtool script
+libtoolize --copy
+
+# Generate Makefile.in from Makefile.am
+automake --add-missing --copy
+
+echo
+echo 'run "./configure ; make"'
+echo
+
+# Generate Makefile from Makefile.in
+#./configure
+
+# Use Makefile to build and test a tarball to distribute
+#make distcheck
+#make distclean
+
diff --git a/build.sh b/build.sh
new file mode 100755
index 00000000..41817c3b
--- /dev/null
+++ b/build.sh
@@ -0,0 +1,20 @@
+#!/bin/sh
+
+case "$1" in
+ "--help"|"help")
+ echo "Usage: $0 {help|debug|release}"
+ exit 1
+ ;;
+ "--debug"|"debug")
+ ./configure CPPFLAGS="-DDEBUG" CXXFLAGS="-g -O0 -DDEBUG -W -Wall -pedantic"
+ ;;
+ "--profile"|"profile")
+ ./configure CPPFLAGS="-DDEBUG" CXXFLAGS="-pg -O0 -DDEBUG -W -Wall -pedantic"
+ ;;
+ "--release"|"release"|*)
+ ./configure
+ ;;
+esac
+
+make
+# make install
diff --git a/config.guess b/config.guess
new file mode 100755
index 00000000..c6fad2f5
--- /dev/null
+++ b/config.guess
@@ -0,0 +1,1568 @@
+#! /bin/sh
+# Attempt to guess a canonical system name.
+# Copyright 1992-2013 Free Software Foundation, Inc.
+
+timestamp='2013-06-10'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, see .
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that
+# program. This Exception is an additional permission under section 7
+# of the GNU General Public License, version 3 ("GPLv3").
+#
+# Originally written by Per Bothner.
+#
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD
+#
+# Please send patches with a ChangeLog entry to config-patches@gnu.org.
+
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION]
+
+Output the configuration name of the system \`$me' is run on.
+
+Operation modes:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to ."
+
+version="\
+GNU config.guess ($timestamp)
+
+Originally written by Per Bothner.
+Copyright 1992-2013 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit ;;
+ --version | -v )
+ echo "$version" ; exit ;;
+ --help | --h* | -h )
+ echo "$usage"; exit ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help" >&2
+ exit 1 ;;
+ * )
+ break ;;
+ esac
+done
+
+if test $# != 0; then
+ echo "$me: too many arguments$help" >&2
+ exit 1
+fi
+
+trap 'exit 1' 1 2 15
+
+# CC_FOR_BUILD -- compiler used by this script. Note that the use of a
+# compiler to aid in system detection is discouraged as it requires
+# temporary files to be created and, as you can see below, it is a
+# headache to deal with in a portable fashion.
+
+# Historically, `CC_FOR_BUILD' used to be named `HOST_CC'. We still
+# use `HOST_CC' if defined, but it is deprecated.
+
+# Portable tmp directory creation inspired by the Autoconf team.
+
+set_cc_for_build='
+trap "exitcode=\$?; (rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null) && exit \$exitcode" 0 ;
+trap "rm -f \$tmpfiles 2>/dev/null; rmdir \$tmp 2>/dev/null; exit 1" 1 2 13 15 ;
+: ${TMPDIR=/tmp} ;
+ { tmp=`(umask 077 && mktemp -d "$TMPDIR/cgXXXXXX") 2>/dev/null` && test -n "$tmp" && test -d "$tmp" ; } ||
+ { test -n "$RANDOM" && tmp=$TMPDIR/cg$$-$RANDOM && (umask 077 && mkdir $tmp) ; } ||
+ { tmp=$TMPDIR/cg-$$ && (umask 077 && mkdir $tmp) && echo "Warning: creating insecure temp directory" >&2 ; } ||
+ { echo "$me: cannot create a temporary directory in $TMPDIR" >&2 ; exit 1 ; } ;
+dummy=$tmp/dummy ;
+tmpfiles="$dummy.c $dummy.o $dummy.rel $dummy" ;
+case $CC_FOR_BUILD,$HOST_CC,$CC in
+ ,,) echo "int x;" > $dummy.c ;
+ for c in cc gcc c89 c99 ; do
+ if ($c -c -o $dummy.o $dummy.c) >/dev/null 2>&1 ; then
+ CC_FOR_BUILD="$c"; break ;
+ fi ;
+ done ;
+ if test x"$CC_FOR_BUILD" = x ; then
+ CC_FOR_BUILD=no_compiler_found ;
+ fi
+ ;;
+ ,,*) CC_FOR_BUILD=$CC ;;
+ ,*,*) CC_FOR_BUILD=$HOST_CC ;;
+esac ; set_cc_for_build= ;'
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi@noc.rutgers.edu 1994-08-24)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+ PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+case "${UNAME_SYSTEM}" in
+Linux|GNU|GNU/*)
+ # If the system lacks a compiler, then just pick glibc.
+ # We could probably try harder.
+ LIBC=gnu
+
+ eval $set_cc_for_build
+ cat <<-EOF > $dummy.c
+ #include
+ #if defined(__UCLIBC__)
+ LIBC=uclibc
+ #elif defined(__dietlibc__)
+ LIBC=dietlibc
+ #else
+ LIBC=gnu
+ #endif
+ EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^LIBC'`
+ ;;
+esac
+
+case "${UNAME_MACHINE}" in
+ i?86)
+ test -z "$VENDOR" && VENDOR=pc
+ ;;
+ *)
+ test -z "$VENDOR" && VENDOR=unknown
+ ;;
+esac
+test -f /etc/SuSE-release -o -f /.buildenv && VENDOR=suse
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+ *:NetBSD:*:*)
+ # NetBSD (nbsd) targets should (where applicable) match one or
+ # more of the tuples: *-*-netbsdelf*, *-*-netbsdaout*,
+ # *-*-netbsdecoff* and *-*-netbsd*. For targets that recently
+ # switched to ELF, *-*-netbsd* would select the old
+ # object file format. This provides both forward
+ # compatibility and a consistent mechanism for selecting the
+ # object file format.
+ #
+ # Note: NetBSD doesn't particularly care about the vendor
+ # portion of the name. We always set it to "unknown".
+ sysctl="sysctl -n hw.machine_arch"
+ UNAME_MACHINE_ARCH=`(/sbin/$sysctl 2>/dev/null || \
+ /usr/sbin/$sysctl 2>/dev/null || echo unknown)`
+ case "${UNAME_MACHINE_ARCH}" in
+ armeb) machine=armeb-unknown ;;
+ arm*) machine=arm-unknown ;;
+ sh3el) machine=shl-unknown ;;
+ sh3eb) machine=sh-unknown ;;
+ sh5el) machine=sh5le-unknown ;;
+ *) machine=${UNAME_MACHINE_ARCH}-unknown ;;
+ esac
+ # The Operating System including object format, if it has switched
+ # to ELF recently, or will in the future.
+ case "${UNAME_MACHINE_ARCH}" in
+ arm*|i386|m68k|ns32k|sh3*|sparc|vax)
+ eval $set_cc_for_build
+ if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep -q __ELF__
+ then
+ # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout).
+ # Return netbsd for either. FIX?
+ os=netbsd
+ else
+ os=netbsdelf
+ fi
+ ;;
+ *)
+ os=netbsd
+ ;;
+ esac
+ # The OS release
+ # Debian GNU/NetBSD machines have a different userland, and
+ # thus, need a distinct triplet. However, they do not need
+ # kernel version information, so it can be replaced with a
+ # suitable tag, in the style of linux-gnu.
+ case "${UNAME_VERSION}" in
+ Debian*)
+ release='-gnu'
+ ;;
+ *)
+ release=`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+ ;;
+ esac
+ # Since CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM:
+ # contains redundant information, the shorter form:
+ # CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used.
+ echo "${machine}-${os}${release}"
+ exit ;;
+ *:Bitrig:*:*)
+ UNAME_MACHINE_ARCH=`arch | sed 's/Bitrig.//'`
+ echo ${UNAME_MACHINE_ARCH}-${VENDOR}-bitrig${UNAME_RELEASE}
+ exit ;;
+ *:OpenBSD:*:*)
+ UNAME_MACHINE_ARCH=`arch | sed 's/OpenBSD.//'`
+ echo ${UNAME_MACHINE_ARCH}-${VENDOR}-openbsd${UNAME_RELEASE}
+ exit ;;
+ *:ekkoBSD:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-ekkobsd${UNAME_RELEASE}
+ exit ;;
+ *:SolidBSD:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-solidbsd${UNAME_RELEASE}
+ exit ;;
+ macppc:MirBSD:*:*)
+ echo powerpc-${VENDOR}-mirbsd${UNAME_RELEASE}
+ exit ;;
+ *:MirBSD:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-mirbsd${UNAME_RELEASE}
+ exit ;;
+ alpha:OSF1:*:*)
+ case $UNAME_RELEASE in
+ *4.0)
+ UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+ ;;
+ *5.*)
+ UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $4}'`
+ ;;
+ esac
+ # According to Compaq, /usr/sbin/psrinfo has been available on
+ # OSF/1 and Tru64 systems produced since 1995. I hope that
+ # covers most systems running today. This code pipes the CPU
+ # types through head -n 1, so we only detect the type of CPU 0.
+ ALPHA_CPU_TYPE=`/usr/sbin/psrinfo -v | sed -n -e 's/^ The alpha \(.*\) processor.*$/\1/p' | head -n 1`
+ case "$ALPHA_CPU_TYPE" in
+ "EV4 (21064)")
+ UNAME_MACHINE="alpha" ;;
+ "EV4.5 (21064)")
+ UNAME_MACHINE="alpha" ;;
+ "LCA4 (21066/21068)")
+ UNAME_MACHINE="alpha" ;;
+ "EV5 (21164)")
+ UNAME_MACHINE="alphaev5" ;;
+ "EV5.6 (21164A)")
+ UNAME_MACHINE="alphaev56" ;;
+ "EV5.6 (21164PC)")
+ UNAME_MACHINE="alphapca56" ;;
+ "EV5.7 (21164PC)")
+ UNAME_MACHINE="alphapca57" ;;
+ "EV6 (21264)")
+ UNAME_MACHINE="alphaev6" ;;
+ "EV6.7 (21264A)")
+ UNAME_MACHINE="alphaev67" ;;
+ "EV6.8CB (21264C)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.8AL (21264B)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.8CX (21264D)")
+ UNAME_MACHINE="alphaev68" ;;
+ "EV6.9A (21264/EV69A)")
+ UNAME_MACHINE="alphaev69" ;;
+ "EV7 (21364)")
+ UNAME_MACHINE="alphaev7" ;;
+ "EV7.9 (21364A)")
+ UNAME_MACHINE="alphaev79" ;;
+ esac
+ # A Pn.n version is a patched version.
+ # A Vn.n version is a released version.
+ # A Tn.n version is a released field test version.
+ # A Xn.n version is an unreleased experimental baselevel.
+ # 1.2 uses "1.2" for uname -r.
+ echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[PVTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ # Reset EXIT trap before exiting to avoid spurious non-zero exit code.
+ exitcode=$?
+ trap '' 0
+ exit $exitcode ;;
+ Alpha\ *:Windows_NT*:*)
+ # How do we know it's Interix rather than the generic POSIX subsystem?
+ # Should we change UNAME_MACHINE based on the output of uname instead
+ # of the specific Alpha model?
+ echo alpha-pc-interix
+ exit ;;
+ 21064:Windows_NT:50:3)
+ echo alpha-dec-winnt3.5
+ exit ;;
+ Amiga*:UNIX_System_V:4.0:*)
+ echo m68k-${VENDOR}-sysv4
+ exit ;;
+ *:[Aa]miga[Oo][Ss]:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-amigaos
+ exit ;;
+ *:[Mm]orph[Oo][Ss]:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-morphos
+ exit ;;
+ *:OS/390:*:*)
+ echo i370-ibm-openedition
+ exit ;;
+ *:z/VM:*:*)
+ echo s390-ibm-zvmoe
+ exit ;;
+ *:OS400:*:*)
+ echo powerpc-ibm-os400
+ exit ;;
+ arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+ echo arm-acorn-riscix${UNAME_RELEASE}
+ exit ;;
+ arm*:riscos:*:*|arm*:RISCOS:*:*)
+ echo arm-${VENDOR}-riscos
+ exit ;;
+ SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*)
+ echo hppa1.1-hitachi-hiuxmpp
+ exit ;;
+ Pyramid*:OSx*:*:* | MIS*:OSx*:*:* | MIS*:SMP_DC-OSx*:*:*)
+ # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+ if test "`(/bin/universe) 2>/dev/null`" = att ; then
+ echo pyramid-pyramid-sysv3
+ else
+ echo pyramid-pyramid-bsd
+ fi
+ exit ;;
+ NILE*:*:*:dcosx)
+ echo pyramid-pyramid-svr4
+ exit ;;
+ DRS?6000:unix:4.0:6*)
+ echo sparc-icl-nx6
+ exit ;;
+ DRS?6000:UNIX_SV:4.2*:7* | DRS?6000:isis:4.2*:7*)
+ case `/usr/bin/uname -p` in
+ sparc) echo sparc-icl-nx7; exit ;;
+ esac ;;
+ s390x:SunOS:*:*)
+ echo ${UNAME_MACHINE}-ibm-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4H:SunOS:5.*:*)
+ echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+ echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ i86pc:AuroraUX:5.*:* | i86xen:AuroraUX:5.*:*)
+ echo i386-pc-auroraux${UNAME_RELEASE}
+ exit ;;
+ i86pc:SunOS:5.*:* | i86xen:SunOS:5.*:*)
+ eval $set_cc_for_build
+ SUN_ARCH="i386"
+ # If there is a compiler, see if it is configured for 64-bit objects.
+ # Note that the Sun cc does not turn __LP64__ into 1 like gcc does.
+ # This test works for both compilers.
+ if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+ if (echo '#ifdef __amd64'; echo IS_64BIT_ARCH; echo '#endif') | \
+ (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+ grep IS_64BIT_ARCH >/dev/null
+ then
+ SUN_ARCH="x86_64"
+ fi
+ fi
+ echo ${SUN_ARCH}-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4*:SunOS:6*:*)
+ # According to config.sub, this is the proper way to canonicalize
+ # SunOS6. Hard to guess exactly what SunOS6 will be like, but
+ # it's likely to be more like Solaris than SunOS4.
+ echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ sun4*:SunOS:*:*)
+ case "`/usr/bin/arch -k`" in
+ Series*|S4*)
+ UNAME_RELEASE=`uname -v`
+ ;;
+ esac
+ # Japanese Language versions have a version number like `4.1.3-JL'.
+ echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+ exit ;;
+ sun3*:SunOS:*:*)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ exit ;;
+ sun*:*:4.2BSD:*)
+ UNAME_RELEASE=`(sed 1q /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+ test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+ case "`/bin/arch`" in
+ sun3)
+ echo m68k-sun-sunos${UNAME_RELEASE}
+ ;;
+ sun4)
+ echo sparc-sun-sunos${UNAME_RELEASE}
+ ;;
+ esac
+ exit ;;
+ aushp:SunOS:*:*)
+ echo sparc-auspex-sunos${UNAME_RELEASE}
+ exit ;;
+ # The situation for MiNT is a little confusing. The machine name
+ # can be virtually everything (everything which is not
+ # "atarist" or "atariste" at least should have a processor
+ # > m68000). The system name ranges from "MiNT" over "FreeMiNT"
+ # to the lowercase version "mint" (or "freemint"). Finally
+ # the system name "TOS" denotes a system which is actually not
+ # MiNT. But MiNT is downward compatible to TOS, so this should
+ # be no problem.
+ atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit ;;
+ atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit ;;
+ *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*)
+ echo m68k-atari-mint${UNAME_RELEASE}
+ exit ;;
+ milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*)
+ echo m68k-milan-mint${UNAME_RELEASE}
+ exit ;;
+ hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*)
+ echo m68k-hades-mint${UNAME_RELEASE}
+ exit ;;
+ *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*)
+ echo m68k-${VENDOR}-mint${UNAME_RELEASE}
+ exit ;;
+ m68k:machten:*:*)
+ echo m68k-apple-machten${UNAME_RELEASE}
+ exit ;;
+ powerpc:machten:*:*)
+ echo powerpc-apple-machten${UNAME_RELEASE}
+ exit ;;
+ RISC*:Mach:*:*)
+ echo mips-dec-mach_bsd4.3
+ exit ;;
+ RISC*:ULTRIX:*:*)
+ echo mips-dec-ultrix${UNAME_RELEASE}
+ exit ;;
+ VAX*:ULTRIX*:*:*)
+ echo vax-dec-ultrix${UNAME_RELEASE}
+ exit ;;
+ 2020:CLIX:*:* | 2430:CLIX:*:*)
+ echo clipper-intergraph-clix${UNAME_RELEASE}
+ exit ;;
+ mips:*:*:UMIPS | mips:*:*:RISCos)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+#ifdef __cplusplus
+#include /* for printf() prototype */
+ int main (int argc, char *argv[]) {
+#else
+ int main (argc, argv) int argc; char *argv[]; {
+#endif
+ #if defined (host_mips) && defined (MIPSEB)
+ #if defined (SYSTYPE_SYSV)
+ printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_SVR4)
+ printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+ #endif
+ #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+ printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+ #endif
+ #endif
+ exit (-1);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c &&
+ dummyarg=`echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` &&
+ SYSTEM_NAME=`$dummy $dummyarg` &&
+ { echo "$SYSTEM_NAME"; exit; }
+ echo mips-mips-riscos${UNAME_RELEASE}
+ exit ;;
+ Motorola:PowerMAX_OS:*:*)
+ echo powerpc-motorola-powermax
+ exit ;;
+ Motorola:*:4.3:PL8-*)
+ echo powerpc-harris-powermax
+ exit ;;
+ Night_Hawk:*:*:PowerMAX_OS | Synergy:PowerMAX_OS:*:*)
+ echo powerpc-harris-powermax
+ exit ;;
+ Night_Hawk:Power_UNIX:*:*)
+ echo powerpc-harris-powerunix
+ exit ;;
+ m88k:CX/UX:7*:*)
+ echo m88k-harris-cxux7
+ exit ;;
+ m88k:*:4*:R4*)
+ echo m88k-motorola-sysv4
+ exit ;;
+ m88k:*:3*:R3*)
+ echo m88k-motorola-sysv3
+ exit ;;
+ AViiON:dgux:*:*)
+ # DG/UX returns AViiON for all architectures
+ UNAME_PROCESSOR=`/usr/bin/uname -p`
+ if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ]
+ then
+ if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \
+ [ ${TARGET_BINARY_INTERFACE}x = x ]
+ then
+ echo m88k-dg-dgux${UNAME_RELEASE}
+ else
+ echo m88k-dg-dguxbcs${UNAME_RELEASE}
+ fi
+ else
+ echo i586-dg-dgux${UNAME_RELEASE}
+ fi
+ exit ;;
+ M88*:DolphinOS:*:*) # DolphinOS (SVR3)
+ echo m88k-dolphin-sysv3
+ exit ;;
+ M88*:*:R3*:*)
+ # Delta 88k system running SVR3
+ echo m88k-motorola-sysv3
+ exit ;;
+ XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+ echo m88k-tektronix-sysv3
+ exit ;;
+ Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+ echo m68k-tektronix-bsd
+ exit ;;
+ *:IRIX*:*:*)
+ echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+ exit ;;
+ ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+ echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id
+ exit ;; # Note that: echo "'`uname -s`'" gives 'AIX '
+ i*86:AIX:*:*)
+ echo i386-ibm-aix
+ exit ;;
+ ia64:AIX:*:*)
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ fi
+ echo ${UNAME_MACHINE}-ibm-aix${IBM_REV}
+ exit ;;
+ *:AIX:2:3)
+ if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include
+
+ main()
+ {
+ if (!__power_pc())
+ exit(1);
+ puts("powerpc-ibm-aix3.2.5");
+ exit(0);
+ }
+EOF
+ if $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy`
+ then
+ echo "$SYSTEM_NAME"
+ else
+ echo rs6000-ibm-aix3.2.5
+ fi
+ elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+ echo rs6000-ibm-aix3.2.4
+ else
+ echo rs6000-ibm-aix3.2
+ fi
+ exit ;;
+ *:AIX:*:[4567])
+ IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'`
+ if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then
+ IBM_ARCH=rs6000
+ else
+ IBM_ARCH=powerpc
+ fi
+ if [ -x /usr/bin/oslevel ] ; then
+ IBM_REV=`/usr/bin/oslevel`
+ else
+ IBM_REV=${UNAME_VERSION}.${UNAME_RELEASE}
+ fi
+ echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+ exit ;;
+ *:AIX:*:*)
+ echo rs6000-ibm-aix
+ exit ;;
+ ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+ echo romp-ibm-bsd4.4
+ exit ;;
+ ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC BSD and
+ echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to
+ exit ;; # report: romp-ibm BSD 4.3
+ *:BOSX:*:*)
+ echo rs6000-bull-bosx
+ exit ;;
+ DPX/2?00:B.O.S.:*:*)
+ echo m68k-bull-sysv3
+ exit ;;
+ 9000/[34]??:4.3bsd:1.*:*)
+ echo m68k-hp-bsd
+ exit ;;
+ hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+ echo m68k-hp-bsd4.4
+ exit ;;
+ 9000/[34678]??:HP-UX:*:*)
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ case "${UNAME_MACHINE}" in
+ 9000/31? ) HP_ARCH=m68000 ;;
+ 9000/[34]?? ) HP_ARCH=m68k ;;
+ 9000/[678][0-9][0-9])
+ if [ -x /usr/bin/getconf ]; then
+ sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null`
+ sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null`
+ case "${sc_cpu_version}" in
+ 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0
+ 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1
+ 532) # CPU_PA_RISC2_0
+ case "${sc_kernel_bits}" in
+ 32) HP_ARCH="hppa2.0n" ;;
+ 64) HP_ARCH="hppa2.0w" ;;
+ '') HP_ARCH="hppa2.0" ;; # HP-UX 10.20
+ esac ;;
+ esac
+ fi
+ if [ "${HP_ARCH}" = "" ]; then
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+
+ #define _HPUX_SOURCE
+ #include
+ #include
+
+ int main ()
+ {
+ #if defined(_SC_KERNEL_BITS)
+ long bits = sysconf(_SC_KERNEL_BITS);
+ #endif
+ long cpu = sysconf (_SC_CPU_VERSION);
+
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1"); break;
+ case CPU_PA_RISC2_0:
+ #if defined(_SC_KERNEL_BITS)
+ switch (bits)
+ {
+ case 64: puts ("hppa2.0w"); break;
+ case 32: puts ("hppa2.0n"); break;
+ default: puts ("hppa2.0"); break;
+ } break;
+ #else /* !defined(_SC_KERNEL_BITS) */
+ puts ("hppa2.0"); break;
+ #endif
+ default: puts ("hppa1.0"); break;
+ }
+ exit (0);
+ }
+EOF
+ (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy`
+ test -z "$HP_ARCH" && HP_ARCH=hppa
+ fi ;;
+ esac
+ if [ ${HP_ARCH} = "hppa2.0w" ]
+ then
+ eval $set_cc_for_build
+
+ # hppa2.0w-hp-hpux* has a 64-bit kernel and a compiler generating
+ # 32-bit code. hppa64-hp-hpux* has the same kernel and a compiler
+ # generating 64-bit code. GNU and HP use different nomenclature:
+ #
+ # $ CC_FOR_BUILD=cc ./config.guess
+ # => hppa2.0w-hp-hpux11.23
+ # $ CC_FOR_BUILD="cc +DA2.0w" ./config.guess
+ # => hppa64-hp-hpux11.23
+
+ if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) |
+ grep -q __LP64__
+ then
+ HP_ARCH="hppa2.0w"
+ else
+ HP_ARCH="hppa64"
+ fi
+ fi
+ echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+ exit ;;
+ ia64:HP-UX:*:*)
+ HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+ echo ia64-hp-hpux${HPUX_REV}
+ exit ;;
+ 3050*:HI-UX:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #include
+ int
+ main ()
+ {
+ long cpu = sysconf (_SC_CPU_VERSION);
+ /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+ true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct
+ results, however. */
+ if (CPU_IS_PA_RISC (cpu))
+ {
+ switch (cpu)
+ {
+ case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+ case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+ default: puts ("hppa-hitachi-hiuxwe2"); break;
+ }
+ }
+ else if (CPU_IS_HP_MC68K (cpu))
+ puts ("m68k-hitachi-hiuxwe2");
+ else puts ("unknown-hitachi-hiuxwe2");
+ exit (0);
+ }
+EOF
+ $CC_FOR_BUILD -o $dummy $dummy.c && SYSTEM_NAME=`$dummy` &&
+ { echo "$SYSTEM_NAME"; exit; }
+ echo unknown-hitachi-hiuxwe2
+ exit ;;
+ 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+ echo hppa1.1-hp-bsd
+ exit ;;
+ 9000/8??:4.3bsd:*:*)
+ echo hppa1.0-hp-bsd
+ exit ;;
+ *9??*:MPE/iX:*:* | *3000*:MPE/iX:*:*)
+ echo hppa1.0-hp-mpeix
+ exit ;;
+ hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+ echo hppa1.1-hp-osf
+ exit ;;
+ hp8??:OSF1:*:*)
+ echo hppa1.0-hp-osf
+ exit ;;
+ i*86:OSF1:*:*)
+ if [ -x /usr/sbin/sysversion ] ; then
+ echo ${UNAME_MACHINE}-${VENDOR}-osf1mk
+ else
+ echo ${UNAME_MACHINE}-${VENDOR}-osf1
+ fi
+ exit ;;
+ parisc*:Lites*:*:*)
+ echo hppa1.1-hp-lites
+ exit ;;
+ C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+ echo c1-convex-bsd
+ exit ;;
+ C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit ;;
+ C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+ echo c34-convex-bsd
+ exit ;;
+ C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+ echo c38-convex-bsd
+ exit ;;
+ C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+ echo c4-convex-bsd
+ exit ;;
+ CRAY*Y-MP:*:*:*)
+ echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*[A-Z]90:*:*:*)
+ echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+ | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+ -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ \
+ -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*TS:*:*:*)
+ echo t90-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*T3E:*:*:*)
+ echo alphaev5-cray-unicosmk${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ CRAY*SV1:*:*:*)
+ echo sv1-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ *:UNICOS/mp:*:*)
+ echo craynv-cray-unicosmp${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/'
+ exit ;;
+ F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*)
+ FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'`
+ FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+ FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+ echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+ exit ;;
+ 5000:UNIX_System_V:4.*:*)
+ FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'`
+ FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'`
+ echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+ exit ;;
+ i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*)
+ echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+ exit ;;
+ sparc*:BSD/OS:*:*)
+ echo sparc-${VENDOR}-bsdi${UNAME_RELEASE}
+ exit ;;
+ *:BSD/OS:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-bsdi${UNAME_RELEASE}
+ exit ;;
+ *:FreeBSD:*:*)
+ UNAME_PROCESSOR=`/usr/bin/uname -p`
+ case ${UNAME_PROCESSOR} in
+ amd64)
+ echo x86_64-${VENDOR}-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+ *)
+ echo ${UNAME_PROCESSOR}-${VENDOR}-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;;
+ esac
+ exit ;;
+ i*:CYGWIN*:*)
+ echo ${UNAME_MACHINE}-pc-cygwin
+ exit ;;
+ *:MINGW64*:*)
+ echo ${UNAME_MACHINE}-pc-mingw64
+ exit ;;
+ *:MINGW*:*)
+ echo ${UNAME_MACHINE}-pc-mingw32
+ exit ;;
+ i*:MSYS*:*)
+ echo ${UNAME_MACHINE}-pc-msys
+ exit ;;
+ i*:windows32*:*)
+ # uname -m includes "-pc" on this system.
+ echo ${UNAME_MACHINE}-mingw32
+ exit ;;
+ i*:PW*:*)
+ echo ${UNAME_MACHINE}-pc-pw32
+ exit ;;
+ *:Interix*:*)
+ case ${UNAME_MACHINE} in
+ x86)
+ echo i586-pc-interix${UNAME_RELEASE}
+ exit ;;
+ authenticamd | genuineintel | EM64T)
+ echo x86_64-${VENDOR}-interix${UNAME_RELEASE}
+ exit ;;
+ IA64)
+ echo ia64-${VENDOR}-interix${UNAME_RELEASE}
+ exit ;;
+ esac ;;
+ [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*)
+ echo i${UNAME_MACHINE}-pc-mks
+ exit ;;
+ 8664:Windows_NT:*)
+ echo x86_64-pc-mks
+ exit ;;
+ i*:Windows_NT*:* | Pentium*:Windows_NT*:*)
+ # How do we know it's Interix rather than the generic POSIX subsystem?
+ # It also conflicts with pre-2.0 versions of AT&T UWIN. Should we
+ # UNAME_MACHINE based on the output of uname instead of i386?
+ echo i586-pc-interix
+ exit ;;
+ i*:UWIN*:*)
+ echo ${UNAME_MACHINE}-pc-uwin
+ exit ;;
+ amd64:CYGWIN*:*:* | x86_64:CYGWIN*:*:*)
+ echo x86_64-${VENDOR}-cygwin
+ exit ;;
+ p*:CYGWIN*:*)
+ echo powerpcle-${VENDOR}-cygwin
+ exit ;;
+ prep*:SunOS:5.*:*)
+ echo powerpcle-${VENDOR}-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+ exit ;;
+ *:GNU:*:*)
+ # the GNU system
+ echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-${VENDOR}-${LIBC}`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+ exit ;;
+ *:GNU/*:*:*)
+ # other systems with GNU libc and userland
+ echo ${UNAME_MACHINE}-${VENDOR}-`echo ${UNAME_SYSTEM} | sed 's,^[^/]*/,,' | tr '[A-Z]' '[a-z]'``echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`-${LIBC}
+ exit ;;
+ i*86:Minix:*:*)
+ echo ${UNAME_MACHINE}-pc-minix
+ exit ;;
+ aarch64:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ aarch64_be:Linux:*:*)
+ UNAME_MACHINE=aarch64_be
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ alpha:Linux:*:*)
+ case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in
+ EV5) UNAME_MACHINE=alphaev5 ;;
+ EV56) UNAME_MACHINE=alphaev56 ;;
+ PCA56) UNAME_MACHINE=alphapca56 ;;
+ PCA57) UNAME_MACHINE=alphapca56 ;;
+ EV6) UNAME_MACHINE=alphaev6 ;;
+ EV67) UNAME_MACHINE=alphaev67 ;;
+ EV68*) UNAME_MACHINE=alphaev68 ;;
+ esac
+ objdump --private-headers /bin/sh | grep -q ld.so.1
+ if test "$?" = 0 ; then LIBC="gnulibc1" ; fi
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ arc:Linux:*:* | arceb:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ arm*:Linux:*:*)
+ eval $set_cc_for_build
+ if echo __ARM_EABI__ | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep -q __ARM_EABI__
+ then
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ else
+ if echo __ARM_PCS_VFP | $CC_FOR_BUILD -E - 2>/dev/null \
+ | grep -q __ARM_PCS_VFP
+ then
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}eabi
+ else
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}eabihf
+ fi
+ fi
+ exit ;;
+ avr32*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ cris:Linux:*:*)
+ echo ${UNAME_MACHINE}-axis-linux-${LIBC}
+ exit ;;
+ crisv32:Linux:*:*)
+ echo ${UNAME_MACHINE}-axis-linux-${LIBC}
+ exit ;;
+ frv:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ hexagon:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ i*86:Linux:*:*)
+ echo ${UNAME_MACHINE}-pc-linux-${LIBC}
+ exit ;;
+ ia64:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ m32r*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ m68*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ mips:Linux:*:* | mips64:Linux:*:*)
+ eval $set_cc_for_build
+ sed 's/^ //' << EOF >$dummy.c
+ #undef CPU
+ #undef ${UNAME_MACHINE}
+ #undef ${UNAME_MACHINE}el
+ #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL)
+ CPU=${UNAME_MACHINE}el
+ #else
+ #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB)
+ CPU=${UNAME_MACHINE}
+ #else
+ CPU=
+ #endif
+ #endif
+EOF
+ eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^CPU'`
+ test x"${CPU}" != x && { echo "${CPU}-${VENDOR}-linux-${LIBC}"; exit; }
+ ;;
+ or1k:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ or32:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ padre:Linux:*:*)
+ echo sparc-${VENDOR}-linux-${LIBC}
+ exit ;;
+ parisc64:Linux:*:* | hppa64:Linux:*:*)
+ echo hppa64-${VENDOR}-linux-${LIBC}
+ exit ;;
+ parisc:Linux:*:* | hppa:Linux:*:*)
+ # Look for CPU level
+ case `grep '^cpu[^a-z]*:' /proc/cpuinfo 2>/dev/null | cut -d' ' -f2` in
+ PA7*) echo hppa1.1-${VENDOR}-linux-${LIBC} ;;
+ PA8*) echo hppa2.0-${VENDOR}-linux-${LIBC} ;;
+ *) echo hppa-${VENDOR}-linux-${LIBC} ;;
+ esac
+ exit ;;
+ ppc64:Linux:*:*)
+ echo powerpc64-${VENDOR}-linux-${LIBC}
+ exit ;;
+ ppc:Linux:*:*)
+ echo powerpc-${VENDOR}-linux-${LIBC}
+ exit ;;
+ ppc64le:Linux:*:*)
+ echo powerpc64le-${VENDOR}-linux-${LIBC}
+ exit ;;
+ ppcle:Linux:*:*)
+ echo powerpcle-${VENDOR}-linux-${LIBC}
+ exit ;;
+ s390:Linux:*:* | s390x:Linux:*:*)
+ echo ${UNAME_MACHINE}-ibm-linux-${LIBC}
+ exit ;;
+ sh64*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ sh*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ sparc:Linux:*:* | sparc64:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ tile*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ vax:Linux:*:*)
+ echo ${UNAME_MACHINE}-dec-linux-${LIBC}
+ exit ;;
+ x86_64:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ xtensa*:Linux:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-linux-${LIBC}
+ exit ;;
+ i*86:DYNIX/ptx:4*:*)
+ # ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.
+ # earlier versions are messed up and put the nodename in both
+ # sysname and nodename.
+ echo i386-sequent-sysv4
+ exit ;;
+ i*86:UNIX_SV:4.2MP:2.*)
+ # Unixware is an offshoot of SVR4, but it has its own version
+ # number series starting with 2...
+ # I am not positive that other SVR4 systems won't match this,
+ # I just have to hope. -- rms.
+ # Use sysv4.2uw... so that sysv4* matches it.
+ echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+ exit ;;
+ i*86:OS/2:*:*)
+ # If we were able to find `uname', then EMX Unix compatibility
+ # is probably installed.
+ echo ${UNAME_MACHINE}-pc-os2-emx
+ exit ;;
+ i*86:XTS-300:*:STOP)
+ echo ${UNAME_MACHINE}-${VENDOR}-stop
+ exit ;;
+ i*86:atheos:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-atheos
+ exit ;;
+ i*86:syllable:*:*)
+ echo ${UNAME_MACHINE}-pc-syllable
+ exit ;;
+ i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.[02]*:*)
+ echo i386-${VENODR}-lynxos${UNAME_RELEASE}
+ exit ;;
+ i*86:*DOS:*:*)
+ echo ${UNAME_MACHINE}-pc-msdosdjgpp
+ exit ;;
+ i*86:*:4.*:* | i*86:SYSTEM_V:4.*:*)
+ UNAME_REL=`echo ${UNAME_RELEASE} | sed 's/\/MP$//'`
+ if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+ echo ${UNAME_MACHINE}-univel-sysv${UNAME_REL}
+ else
+ echo ${UNAME_MACHINE}-pc-sysv${UNAME_REL}
+ fi
+ exit ;;
+ i*86:*:5:[678]*)
+ # UnixWare 7.x, OpenUNIX and OpenServer 6.
+ case `/bin/uname -X | grep "^Machine"` in
+ *486*) UNAME_MACHINE=i486 ;;
+ *Pentium) UNAME_MACHINE=i586 ;;
+ *Pent*|*Celeron) UNAME_MACHINE=i686 ;;
+ esac
+ echo ${UNAME_MACHINE}-${VENDOR}-sysv${UNAME_RELEASE}${UNAME_SYSTEM}${UNAME_VERSION}
+ exit ;;
+ i*86:*:3.2:*)
+ if test -f /usr/options/cb.name; then
+ UNAME_REL=`sed -n 's/.*Version //p' /dev/null >/dev/null ; then
+ UNAME_REL=`(/bin/uname -X|grep Release|sed -e 's/.*= //')`
+ (/bin/uname -X|grep i80486 >/dev/null) && UNAME_MACHINE=i486
+ (/bin/uname -X|grep '^Machine.*Pentium' >/dev/null) \
+ && UNAME_MACHINE=i586
+ (/bin/uname -X|grep '^Machine.*Pent *II' >/dev/null) \
+ && UNAME_MACHINE=i686
+ (/bin/uname -X|grep '^Machine.*Pentium Pro' >/dev/null) \
+ && UNAME_MACHINE=i686
+ echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+ else
+ echo ${UNAME_MACHINE}-pc-sysv32
+ fi
+ exit ;;
+ pc:*:*:*)
+ # Left here for compatibility:
+ # uname -m prints for DJGPP always 'pc', but it prints nothing about
+ # the processor, so we play safe by assuming i586.
+ # Note: whatever this is, it MUST be the same as what config.sub
+ # prints for the "djgpp" host, or else GDB configury will decide that
+ # this is a cross-build.
+ echo i586-pc-msdosdjgpp
+ exit ;;
+ Intel:Mach:3*:*)
+ echo i386-pc-mach3
+ exit ;;
+ paragon:*:*:*)
+ echo i860-intel-osf1
+ exit ;;
+ i860:*:4.*:*) # i860-SVR4
+ if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+ echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+ else # Add other i860-SVR4 vendors below as they are discovered.
+ echo i860-${VENODR}-sysv${UNAME_RELEASE} # Unknown i860-SVR4
+ fi
+ exit ;;
+ mini*:CTIX:SYS*5:*)
+ # "miniframe"
+ echo m68010-convergent-sysv
+ exit ;;
+ mc68k:UNIX:SYSTEM5:3.51m)
+ echo m68k-convergent-sysv
+ exit ;;
+ M680?0:D-NIX:5.3:*)
+ echo m68k-diab-dnix
+ exit ;;
+ M68*:*:R3V[5678]*:*)
+ test -r /sysV68 && { echo 'm68k-motorola-sysv'; exit; } ;;
+ 3[345]??:*:4.0:3.0 | 3[34]??A:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 3[34]??/*:*:4.0:3.0 | 4400:*:4.0:3.0 | 4850:*:4.0:3.0 | SKA40:*:4.0:3.0 | SDS2:*:4.0:3.0 | SHG2:*:4.0:3.0 | S7501*:*:4.0:3.0)
+ OS_REL=''
+ test -r /etc/.relid \
+ && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+ /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+ && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+ 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && { echo i486-ncr-sysv4; exit; } ;;
+ NCR*:*:4.2:* | MPRAS*:*:4.2:*)
+ OS_REL='.3'
+ test -r /etc/.relid \
+ && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+ /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+ && { echo i486-ncr-sysv4.3${OS_REL}; exit; }
+ /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+ && { echo i586-ncr-sysv4.3${OS_REL}; exit; }
+ /bin/uname -p 2>/dev/null | /bin/grep pteron >/dev/null \
+ && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;;
+ m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*)
+ echo m68k-${VENDOR}-lynxos${UNAME_RELEASE}
+ exit ;;
+ mc68030:UNIX_System_V:4.*:*)
+ echo m68k-atari-sysv4
+ exit ;;
+ TSUNAMI:LynxOS:2.*:*)
+ echo sparc-${VENDOR}-lynxos${UNAME_RELEASE}
+ exit ;;
+ rs6000:LynxOS:2.*:*)
+ echo rs6000-${VENDOR}-lynxos${UNAME_RELEASE}
+ exit ;;
+ PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.[02]*:*)
+ echo powerpc-${VENDOR}-lynxos${UNAME_RELEASE}
+ exit ;;
+ SM[BE]S:UNIX_SV:*:*)
+ echo mips-dde-sysv${UNAME_RELEASE}
+ exit ;;
+ RM*:ReliantUNIX-*:*:*)
+ echo mips-sni-sysv4
+ exit ;;
+ RM*:SINIX-*:*:*)
+ echo mips-sni-sysv4
+ exit ;;
+ *:SINIX-*:*:*)
+ if uname -p 2>/dev/null >/dev/null ; then
+ UNAME_MACHINE=`(uname -p) 2>/dev/null`
+ echo ${UNAME_MACHINE}-sni-sysv4
+ else
+ echo ns32k-sni-sysv
+ fi
+ exit ;;
+ PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+ # says
+ echo i586-unisys-sysv4
+ exit ;;
+ *:UNIX_System_V:4*:FTX*)
+ # From Gerald Hewes .
+ # How about differentiating between stratus architectures? -djm
+ echo hppa1.1-stratus-sysv4
+ exit ;;
+ *:*:*:FTX*)
+ # From seanf@swdc.stratus.com.
+ echo i860-stratus-sysv4
+ exit ;;
+ i*86:VOS:*:*)
+ # From Paul.Green@stratus.com.
+ echo ${UNAME_MACHINE}-stratus-vos
+ exit ;;
+ *:VOS:*:*)
+ # From Paul.Green@stratus.com.
+ echo hppa1.1-stratus-vos
+ exit ;;
+ mc68*:A/UX:*:*)
+ echo m68k-apple-aux${UNAME_RELEASE}
+ exit ;;
+ news*:NEWS-OS:6*:*)
+ echo mips-sony-newsos6
+ exit ;;
+ R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*)
+ if [ -d /usr/nec ]; then
+ echo mips-nec-sysv${UNAME_RELEASE}
+ else
+ echo mips-${VENDOR}-sysv${UNAME_RELEASE}
+ fi
+ exit ;;
+ BeBox:BeOS:*:*) # BeOS running on hardware made by Be, PPC only.
+ echo powerpc-be-beos
+ exit ;;
+ BeMac:BeOS:*:*) # BeOS running on Mac or Mac clone, PPC only.
+ echo powerpc-apple-beos
+ exit ;;
+ BePC:BeOS:*:*) # BeOS running on Intel PC compatible.
+ echo i586-pc-beos
+ exit ;;
+ BePC:Haiku:*:*) # Haiku running on Intel PC compatible.
+ echo i586-pc-haiku
+ exit ;;
+ x86_64:Haiku:*:*)
+ echo x86_64-${VENDOR}-haiku
+ exit ;;
+ SX-4:SUPER-UX:*:*)
+ echo sx4-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-5:SUPER-UX:*:*)
+ echo sx5-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-6:SUPER-UX:*:*)
+ echo sx6-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-7:SUPER-UX:*:*)
+ echo sx7-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-8:SUPER-UX:*:*)
+ echo sx8-nec-superux${UNAME_RELEASE}
+ exit ;;
+ SX-8R:SUPER-UX:*:*)
+ echo sx8r-nec-superux${UNAME_RELEASE}
+ exit ;;
+ Power*:Rhapsody:*:*)
+ echo powerpc-apple-rhapsody${UNAME_RELEASE}
+ exit ;;
+ *:Rhapsody:*:*)
+ echo ${UNAME_MACHINE}-apple-rhapsody${UNAME_RELEASE}
+ exit ;;
+ *:Darwin:*:*)
+ UNAME_PROCESSOR=`uname -p` || UNAME_PROCESSOR=unknown
+ eval $set_cc_for_build
+ if test "$UNAME_PROCESSOR" = unknown ; then
+ UNAME_PROCESSOR=powerpc
+ fi
+ if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then
+ if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \
+ (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \
+ grep IS_64BIT_ARCH >/dev/null
+ then
+ case $UNAME_PROCESSOR in
+ i386) UNAME_PROCESSOR=x86_64 ;;
+ powerpc) UNAME_PROCESSOR=powerpc64 ;;
+ esac
+ fi
+ fi
+ echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE}
+ exit ;;
+ *:procnto*:*:* | *:QNX:[0123456789]*:*)
+ UNAME_PROCESSOR=`uname -p`
+ if test "$UNAME_PROCESSOR" = "x86"; then
+ UNAME_PROCESSOR=i386
+ UNAME_MACHINE=pc
+ fi
+ echo ${UNAME_PROCESSOR}-${UNAME_MACHINE}-nto-qnx${UNAME_RELEASE}
+ exit ;;
+ *:QNX:*:4*)
+ echo i386-pc-qnx
+ exit ;;
+ NEO-?:NONSTOP_KERNEL:*:*)
+ echo neo-tandem-nsk${UNAME_RELEASE}
+ exit ;;
+ NSE-*:NONSTOP_KERNEL:*:*)
+ echo nse-tandem-nsk${UNAME_RELEASE}
+ exit ;;
+ NSR-?:NONSTOP_KERNEL:*:*)
+ echo nsr-tandem-nsk${UNAME_RELEASE}
+ exit ;;
+ *:NonStop-UX:*:*)
+ echo mips-compaq-nonstopux
+ exit ;;
+ BS2000:POSIX*:*:*)
+ echo bs2000-siemens-sysv
+ exit ;;
+ DS/*:UNIX_System_V:*:*)
+ echo ${UNAME_MACHINE}-${UNAME_SYSTEM}-${UNAME_RELEASE}
+ exit ;;
+ *:Plan9:*:*)
+ # "uname -m" is not consistent, so use $cputype instead. 386
+ # is converted to i386 for consistency with other x86
+ # operating systems.
+ if test "$cputype" = "386"; then
+ UNAME_MACHINE=i386
+ else
+ UNAME_MACHINE="$cputype"
+ fi
+ echo ${UNAME_MACHINE}-${VENDOR}-plan9
+ exit ;;
+ *:TOPS-10:*:*)
+ echo pdp10-${VENDOR}-tops10
+ exit ;;
+ *:TENEX:*:*)
+ echo pdp10-${VENDOR}-tenex
+ exit ;;
+ KS10:TOPS-20:*:* | KL10:TOPS-20:*:* | TYPE4:TOPS-20:*:*)
+ echo pdp10-dec-tops20
+ exit ;;
+ XKL-1:TOPS-20:*:* | TYPE5:TOPS-20:*:*)
+ echo pdp10-xkl-tops20
+ exit ;;
+ *:TOPS-20:*:*)
+ echo pdp10-${VENDOR}-tops20
+ exit ;;
+ *:ITS:*:*)
+ echo pdp10-${VENDOR}-its
+ exit ;;
+ SEI:*:*:SEIUX)
+ echo mips-sei-seiux${UNAME_RELEASE}
+ exit ;;
+ *:DragonFly:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-dragonfly`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+ exit ;;
+ *:*VMS:*:*)
+ UNAME_MACHINE=`(uname -p) 2>/dev/null`
+ case "${UNAME_MACHINE}" in
+ A*) echo alpha-dec-vms ; exit ;;
+ I*) echo ia64-dec-vms ; exit ;;
+ V*) echo vax-dec-vms ; exit ;;
+ esac ;;
+ *:XENIX:*:SysV)
+ echo i386-pc-xenix
+ exit ;;
+ i*86:skyos:*:*)
+ echo ${UNAME_MACHINE}-pc-skyos`echo ${UNAME_RELEASE}` | sed -e 's/ .*$//'
+ exit ;;
+ i*86:rdos:*:*)
+ echo ${UNAME_MACHINE}-pc-rdos
+ exit ;;
+ i*86:AROS:*:*)
+ echo ${UNAME_MACHINE}-pc-aros
+ exit ;;
+ x86_64:VMkernel:*:*)
+ echo ${UNAME_MACHINE}-${VENDOR}-esx
+ exit ;;
+esac
+
+eval $set_cc_for_build
+cat >$dummy.c <
+# include
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+ /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed,
+ I don't know.... */
+ printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include
+ printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+ "4"
+#else
+ ""
+#endif
+ ); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+ printf ("arm-acorn-riscix\n"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+ printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+ int version;
+ version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+ if (version < 4)
+ printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+ else
+ printf ("%s-next-openstep%d\n", __ARCHITECTURE__, version);
+ exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+ printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+ printf ("ns32k-encore-mach\n"); exit (0);
+#else
+ printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+ printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+ printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+ printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+ struct utsname un;
+
+ uname(&un);
+
+ if (strncmp(un.version, "V2", 2) == 0) {
+ printf ("i386-sequent-ptx2\n"); exit (0);
+ }
+ if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+ printf ("i386-sequent-ptx1\n"); exit (0);
+ }
+ printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+# if !defined (ultrix)
+# include
+# if defined (BSD)
+# if BSD == 43
+ printf ("vax-dec-bsd4.3\n"); exit (0);
+# else
+# if BSD == 199006
+ printf ("vax-dec-bsd4.3reno\n"); exit (0);
+# else
+ printf ("vax-dec-bsd\n"); exit (0);
+# endif
+# endif
+# else
+ printf ("vax-dec-bsd\n"); exit (0);
+# endif
+# else
+ printf ("vax-dec-ultrix\n"); exit (0);
+# endif
+#endif
+
+#if defined (alliant) && defined (i860)
+ printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+ exit (1);
+}
+EOF
+
+$CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null && SYSTEM_NAME=`$dummy` &&
+ { echo "$SYSTEM_NAME"; exit; }
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+ case `getsysinfo -f cpu_type` in
+ c1*)
+ echo c1-convex-bsd
+ exit ;;
+ c2*)
+ if getsysinfo -f scalar_acc
+ then echo c32-convex-bsd
+ else echo c2-convex-bsd
+ fi
+ exit ;;
+ c34*)
+ echo c34-convex-bsd
+ exit ;;
+ c38*)
+ echo c38-convex-bsd
+ exit ;;
+ c4*)
+ echo c4-convex-bsd
+ exit ;;
+ esac
+fi
+
+cat >&2 < in order to provide the needed
+information to handle your system.
+
+config.guess timestamp = $timestamp
+
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null`
+/bin/uname -X = `(/bin/uname -X) 2>/dev/null`
+
+hostinfo = `(hostinfo) 2>/dev/null`
+/bin/universe = `(/bin/universe) 2>/dev/null`
+/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null`
+/bin/arch = `(/bin/arch) 2>/dev/null`
+/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null`
+
+UNAME_MACHINE = ${UNAME_MACHINE}
+UNAME_RELEASE = ${UNAME_RELEASE}
+UNAME_SYSTEM = ${UNAME_SYSTEM}
+UNAME_VERSION = ${UNAME_VERSION}
+EOF
+
+exit 1
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/config.sub b/config.sub
new file mode 100755
index 00000000..8b612ab8
--- /dev/null
+++ b/config.sub
@@ -0,0 +1,1788 @@
+#! /bin/sh
+# Configuration validation subroutine script.
+# Copyright 1992-2013 Free Software Foundation, Inc.
+
+timestamp='2013-04-24'
+
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 3 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, see .
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that
+# program. This Exception is an additional permission under section 7
+# of the GNU General Public License, version 3 ("GPLv3").
+
+
+# Please send patches with a ChangeLog entry to config-patches@gnu.org.
+#
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# You can get the latest version of this script from:
+# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support. The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+me=`echo "$0" | sed -e 's,.*/,,'`
+
+usage="\
+Usage: $0 [OPTION] CPU-MFR-OPSYS
+ $0 [OPTION] ALIAS
+
+Canonicalize a configuration name.
+
+Operation modes:
+ -h, --help print this help, then exit
+ -t, --time-stamp print date of last modification, then exit
+ -v, --version print version number, then exit
+
+Report bugs and patches to ."
+
+version="\
+GNU config.sub ($timestamp)
+
+Copyright 1992-2013 Free Software Foundation, Inc.
+
+This is free software; see the source for copying conditions. There is NO
+warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE."
+
+help="
+Try \`$me --help' for more information."
+
+# Parse command line
+while test $# -gt 0 ; do
+ case $1 in
+ --time-stamp | --time* | -t )
+ echo "$timestamp" ; exit ;;
+ --version | -v )
+ echo "$version" ; exit ;;
+ --help | --h* | -h )
+ echo "$usage"; exit ;;
+ -- ) # Stop option processing
+ shift; break ;;
+ - ) # Use stdin as input.
+ break ;;
+ -* )
+ echo "$me: invalid option $1$help"
+ exit 1 ;;
+
+ *local*)
+ # First pass through any local machine types.
+ echo $1
+ exit ;;
+
+ * )
+ break ;;
+ esac
+done
+
+case $# in
+ 0) echo "$me: missing argument$help" >&2
+ exit 1;;
+ 1) ;;
+ *) echo "$me: too many arguments$help" >&2
+ exit 1;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+ nto-qnx* | linux-gnu* | linux-android* | linux-dietlibc | linux-newlib* | \
+ linux-musl* | linux-uclibc* | uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | \
+ knetbsd*-gnu* | netbsd*-gnu* | \
+ kopensolaris*-gnu* | \
+ storm-chaos* | os2-emx* | rtmk-nova*)
+ os=-$maybe_os
+ basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+ ;;
+ android-linux)
+ os=-linux-android
+ basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`-unknown
+ ;;
+ *)
+ basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+ if [ $basic_machine != $1 ]
+ then os=`echo $1 | sed 's/.*-/-/'`
+ else os=; fi
+ ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work. We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+ -sun*os*)
+ # Prevent following clause from handling this invalid input.
+ ;;
+ -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+ -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+ -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+ -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+ -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+ -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+ -apple | -axis | -knuth | -cray | -microblaze*)
+ os=
+ basic_machine=$1
+ ;;
+ -bluegene*)
+ os=-cnk
+ ;;
+ -sim | -cisco | -oki | -wec | -winbond)
+ os=
+ basic_machine=$1
+ ;;
+ -scout)
+ ;;
+ -wrs)
+ os=-vxworks
+ basic_machine=$1
+ ;;
+ -chorusos*)
+ os=-chorusos
+ basic_machine=$1
+ ;;
+ -chorusrdb)
+ os=-chorusrdb
+ basic_machine=$1
+ ;;
+ -hiux*)
+ os=-hiuxwe2
+ ;;
+ -sco6)
+ os=-sco5v6
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco5)
+ os=-sco3.2v5
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco4)
+ os=-sco3.2v4
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2.[4-9]*)
+ os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco3.2v[4-9]*)
+ # Don't forget version if it is 3.2v4 or newer.
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco5v6*)
+ # Don't forget version if it is 3.2v4 or newer.
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -sco*)
+ os=-sco3.2v2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -udk*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -isc)
+ os=-isc2.2
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -clix*)
+ basic_machine=clipper-intergraph
+ ;;
+ -isc*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+ ;;
+ -lynx*178)
+ os=-lynxos178
+ ;;
+ -lynx*5)
+ os=-lynxos5
+ ;;
+ -lynx*)
+ os=-lynxos
+ ;;
+ -ptx*)
+ basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+ ;;
+ -windowsnt*)
+ os=`echo $os | sed -e 's/windowsnt/winnt/'`
+ ;;
+ -psos*)
+ os=-psos
+ ;;
+ -mint | -mint[0-9]*)
+ basic_machine=m68k-atari
+ os=-mint
+ ;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+ # Recognize the basic CPU types without company name.
+ # Some are omitted here because they have special meanings below.
+ 1750a | 580 \
+ | a29k \
+ | aarch64 | aarch64_be \
+ | alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \
+ | alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \
+ | am33_2.0 \
+ | arc | arceb \
+ | arm | arm[bl]e | arme[lb] | armv[2-8] | armv[3-8][lb] | armv7[arm] \
+ | avr | avr32 \
+ | be32 | be64 \
+ | bfin \
+ | c4x | clipper \
+ | d10v | d30v | dlx | dsp16xx \
+ | epiphany \
+ | fido | fr30 | frv \
+ | h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \
+ | hexagon \
+ | i370 | i860 | i960 | ia64 \
+ | ip2k | iq2000 \
+ | le32 | le64 \
+ | lm32 \
+ | m32c | m32r | m32rle | m68000 | m68k | m88k \
+ | maxq | mb | microblaze | microblazeel | mcore | mep | metag \
+ | mips | mipsbe | mipseb | mipsel | mipsle \
+ | mips16 \
+ | mips64 | mips64el \
+ | mips64octeon | mips64octeonel \
+ | mips64orion | mips64orionel \
+ | mips64r5900 | mips64r5900el \
+ | mips64vr | mips64vrel \
+ | mips64vr4100 | mips64vr4100el \
+ | mips64vr4300 | mips64vr4300el \
+ | mips64vr5000 | mips64vr5000el \
+ | mips64vr5900 | mips64vr5900el \
+ | mipsisa32 | mipsisa32el \
+ | mipsisa32r2 | mipsisa32r2el \
+ | mipsisa64 | mipsisa64el \
+ | mipsisa64r2 | mipsisa64r2el \
+ | mipsisa64sb1 | mipsisa64sb1el \
+ | mipsisa64sr71k | mipsisa64sr71kel \
+ | mipsr5900 | mipsr5900el \
+ | mipstx39 | mipstx39el \
+ | mn10200 | mn10300 \
+ | moxie \
+ | mt \
+ | msp430 \
+ | nds32 | nds32le | nds32be \
+ | nios | nios2 | nios2eb | nios2el \
+ | ns16k | ns32k \
+ | open8 \
+ | or1k | or32 \
+ | pdp10 | pdp11 | pj | pjl \
+ | powerpc | powerpc64 | powerpc64le | powerpcle \
+ | pyramid \
+ | rl78 | rx \
+ | score \
+ | sh | sh[1234] | sh[24]a | sh[24]aeb | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \
+ | sh64 | sh64le \
+ | sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \
+ | sparcv8 | sparcv9 | sparcv9b | sparcv9v \
+ | spu \
+ | tahoe | tic4x | tic54x | tic55x | tic6x | tic80 | tron \
+ | ubicom32 \
+ | v850 | v850e | v850e1 | v850e2 | v850es | v850e2v3 \
+ | we32k \
+ | x86 | xc16x | xstormy16 | xtensa \
+ | z8k | z80)
+ basic_machine=$basic_machine-unknown
+ ;;
+ c54x)
+ basic_machine=tic54x-unknown
+ ;;
+ c55x)
+ basic_machine=tic55x-unknown
+ ;;
+ c6x)
+ basic_machine=tic6x-unknown
+ ;;
+ m6811 | m68hc11 | m6812 | m68hc12 | m68hcs12x | picochip)
+ basic_machine=$basic_machine-unknown
+ os=-none
+ ;;
+ m88110 | m680[12346]0 | m683?2 | m68360 | m5200 | v70 | w65 | z8k)
+ ;;
+ ms1)
+ basic_machine=mt-unknown
+ ;;
+
+ strongarm | thumb | xscale)
+ basic_machine=arm-unknown
+ ;;
+ xgate)
+ basic_machine=$basic_machine-unknown
+ os=-none
+ ;;
+ xscaleeb)
+ basic_machine=armeb-unknown
+ ;;
+
+ xscaleel)
+ basic_machine=armel-unknown
+ ;;
+
+ # We use `pc' rather than `unknown'
+ # because (1) that's what they normally are, and
+ # (2) the word "unknown" tends to confuse beginning users.
+ i*86 | x86_64)
+ basic_machine=$basic_machine-pc
+ ;;
+ # Object if more than one company name word.
+ *-*-*)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+ # Recognize the basic CPU types with company name.
+ 580-* \
+ | a29k-* \
+ | aarch64-* | aarch64_be-* \
+ | alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \
+ | alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \
+ | alphapca5[67]-* | alpha64pca5[67]-* | arc-* | arceb-* \
+ | arm-* | armbe-* | armle-* | armeb-* | armv*-* \
+ | avr-* | avr32-* \
+ | be32-* | be64-* \
+ | bfin-* | bs2000-* \
+ | c[123]* | c30-* | [cjt]90-* | c4x-* \
+ | clipper-* | craynv-* | cydra-* \
+ | d10v-* | d30v-* | dlx-* \
+ | elxsi-* \
+ | f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \
+ | h8300-* | h8500-* \
+ | hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \
+ | hexagon-* \
+ | i*86-* | i860-* | i960-* | ia64-* \
+ | ip2k-* | iq2000-* \
+ | le32-* | le64-* \
+ | lm32-* \
+ | m32c-* | m32r-* | m32rle-* \
+ | m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \
+ | m88110-* | m88k-* | maxq-* | mcore-* | metag-* \
+ | microblaze-* | microblazeel-* \
+ | mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \
+ | mips16-* \
+ | mips64-* | mips64el-* \
+ | mips64octeon-* | mips64octeonel-* \
+ | mips64orion-* | mips64orionel-* \
+ | mips64r5900-* | mips64r5900el-* \
+ | mips64vr-* | mips64vrel-* \
+ | mips64vr4100-* | mips64vr4100el-* \
+ | mips64vr4300-* | mips64vr4300el-* \
+ | mips64vr5000-* | mips64vr5000el-* \
+ | mips64vr5900-* | mips64vr5900el-* \
+ | mipsisa32-* | mipsisa32el-* \
+ | mipsisa32r2-* | mipsisa32r2el-* \
+ | mipsisa64-* | mipsisa64el-* \
+ | mipsisa64r2-* | mipsisa64r2el-* \
+ | mipsisa64sb1-* | mipsisa64sb1el-* \
+ | mipsisa64sr71k-* | mipsisa64sr71kel-* \
+ | mipsr5900-* | mipsr5900el-* \
+ | mipstx39-* | mipstx39el-* \
+ | mmix-* \
+ | mt-* \
+ | msp430-* \
+ | nds32-* | nds32le-* | nds32be-* \
+ | nios-* | nios2-* | nios2eb-* | nios2el-* \
+ | none-* | np1-* | ns16k-* | ns32k-* \
+ | open8-* \
+ | orion-* \
+ | pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \
+ | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* \
+ | pyramid-* \
+ | rl78-* | romp-* | rs6000-* | rx-* \
+ | sh-* | sh[1234]-* | sh[24]a-* | sh[24]aeb-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \
+ | shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \
+ | sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \
+ | sparclite-* \
+ | sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | sv1-* | sx?-* \
+ | tahoe-* \
+ | tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \
+ | tile*-* \
+ | tron-* \
+ | ubicom32-* \
+ | v850-* | v850e-* | v850e1-* | v850es-* | v850e2-* | v850e2v3-* \
+ | vax-* \
+ | we32k-* \
+ | x86-* | x86_64-* | xc16x-* | xps100-* \
+ | xstormy16-* | xtensa*-* \
+ | ymp-* \
+ | z8k-* | z80-*)
+ ;;
+ # Recognize the basic CPU types without company name, with glob match.
+ xtensa*)
+ basic_machine=$basic_machine-unknown
+ ;;
+ # Recognize the various machine names and aliases which stand
+ # for a CPU type and a company and sometimes even an OS.
+ 386bsd)
+ basic_machine=i386-unknown
+ os=-bsd
+ ;;
+ 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+ basic_machine=m68000-att
+ ;;
+ 3b*)
+ basic_machine=we32k-att
+ ;;
+ a29khif)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ abacus)
+ basic_machine=abacus-unknown
+ ;;
+ adobe68k)
+ basic_machine=m68010-adobe
+ os=-scout
+ ;;
+ alliant | fx80)
+ basic_machine=fx80-alliant
+ ;;
+ altos | altos3068)
+ basic_machine=m68k-altos
+ ;;
+ am29k)
+ basic_machine=a29k-none
+ os=-bsd
+ ;;
+ amd64)
+ basic_machine=x86_64-pc
+ ;;
+ amd64-*)
+ basic_machine=x86_64-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ amdahl)
+ basic_machine=580-amdahl
+ os=-sysv
+ ;;
+ amiga | amiga-*)
+ basic_machine=m68k-unknown
+ ;;
+ amigaos | amigados)
+ basic_machine=m68k-unknown
+ os=-amigaos
+ ;;
+ amigaunix | amix)
+ basic_machine=m68k-unknown
+ os=-sysv4
+ ;;
+ apollo68)
+ basic_machine=m68k-apollo
+ os=-sysv
+ ;;
+ apollo68bsd)
+ basic_machine=m68k-apollo
+ os=-bsd
+ ;;
+ aros)
+ basic_machine=i386-pc
+ os=-aros
+ ;;
+ aux)
+ basic_machine=m68k-apple
+ os=-aux
+ ;;
+ balance)
+ basic_machine=ns32k-sequent
+ os=-dynix
+ ;;
+ blackfin)
+ basic_machine=bfin-unknown
+ os=-linux
+ ;;
+ blackfin-*)
+ basic_machine=bfin-`echo $basic_machine | sed 's/^[^-]*-//'`
+ os=-linux
+ ;;
+ bluegene*)
+ basic_machine=powerpc-ibm
+ os=-cnk
+ ;;
+ c54x-*)
+ basic_machine=tic54x-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ c55x-*)
+ basic_machine=tic55x-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ c6x-*)
+ basic_machine=tic6x-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ c90)
+ basic_machine=c90-cray
+ os=-unicos
+ ;;
+ cegcc)
+ basic_machine=arm-unknown
+ os=-cegcc
+ ;;
+ convex-c1)
+ basic_machine=c1-convex
+ os=-bsd
+ ;;
+ convex-c2)
+ basic_machine=c2-convex
+ os=-bsd
+ ;;
+ convex-c32)
+ basic_machine=c32-convex
+ os=-bsd
+ ;;
+ convex-c34)
+ basic_machine=c34-convex
+ os=-bsd
+ ;;
+ convex-c38)
+ basic_machine=c38-convex
+ os=-bsd
+ ;;
+ cray | j90)
+ basic_machine=j90-cray
+ os=-unicos
+ ;;
+ craynv)
+ basic_machine=craynv-cray
+ os=-unicosmp
+ ;;
+ cr16 | cr16-*)
+ basic_machine=cr16-unknown
+ os=-elf
+ ;;
+ crds | unos)
+ basic_machine=m68k-crds
+ ;;
+ crisv32 | crisv32-* | etraxfs*)
+ basic_machine=crisv32-axis
+ ;;
+ cris | cris-* | etrax*)
+ basic_machine=cris-axis
+ ;;
+ crx)
+ basic_machine=crx-unknown
+ os=-elf
+ ;;
+ da30 | da30-*)
+ basic_machine=m68k-da30
+ ;;
+ decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+ basic_machine=mips-dec
+ ;;
+ decsystem10* | dec10*)
+ basic_machine=pdp10-dec
+ os=-tops10
+ ;;
+ decsystem20* | dec20*)
+ basic_machine=pdp10-dec
+ os=-tops20
+ ;;
+ delta | 3300 | motorola-3300 | motorola-delta \
+ | 3300-motorola | delta-motorola)
+ basic_machine=m68k-motorola
+ ;;
+ delta88)
+ basic_machine=m88k-motorola
+ os=-sysv3
+ ;;
+ dicos)
+ basic_machine=i686-pc
+ os=-dicos
+ ;;
+ djgpp)
+ basic_machine=i586-pc
+ os=-msdosdjgpp
+ ;;
+ dpx20 | dpx20-*)
+ basic_machine=rs6000-bull
+ os=-bosx
+ ;;
+ dpx2* | dpx2*-bull)
+ basic_machine=m68k-bull
+ os=-sysv3
+ ;;
+ ebmon29k)
+ basic_machine=a29k-amd
+ os=-ebmon
+ ;;
+ elxsi)
+ basic_machine=elxsi-elxsi
+ os=-bsd
+ ;;
+ encore | umax | mmax)
+ basic_machine=ns32k-encore
+ ;;
+ es1800 | OSE68k | ose68k | ose | OSE)
+ basic_machine=m68k-ericsson
+ os=-ose
+ ;;
+ fx2800)
+ basic_machine=i860-alliant
+ ;;
+ genix)
+ basic_machine=ns32k-ns
+ ;;
+ gmicro)
+ basic_machine=tron-gmicro
+ os=-sysv
+ ;;
+ go32)
+ basic_machine=i386-pc
+ os=-go32
+ ;;
+ h3050r* | hiux*)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ h8300hms)
+ basic_machine=h8300-hitachi
+ os=-hms
+ ;;
+ h8300xray)
+ basic_machine=h8300-hitachi
+ os=-xray
+ ;;
+ h8500hms)
+ basic_machine=h8500-hitachi
+ os=-hms
+ ;;
+ harris)
+ basic_machine=m88k-harris
+ os=-sysv3
+ ;;
+ hp300-*)
+ basic_machine=m68k-hp
+ ;;
+ hp300bsd)
+ basic_machine=m68k-hp
+ os=-bsd
+ ;;
+ hp300hpux)
+ basic_machine=m68k-hp
+ os=-hpux
+ ;;
+ hp3k9[0-9][0-9] | hp9[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hp9k2[0-9][0-9] | hp9k31[0-9])
+ basic_machine=m68000-hp
+ ;;
+ hp9k3[2-9][0-9])
+ basic_machine=m68k-hp
+ ;;
+ hp9k6[0-9][0-9] | hp6[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hp9k7[0-79][0-9] | hp7[0-79][0-9])
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k78[0-9] | hp78[0-9])
+ # FIXME: really hppa2.0-hp
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[67]1 | hp8[67]1 | hp9k80[24] | hp80[24] | hp9k8[78]9 | hp8[78]9 | hp9k893 | hp893)
+ # FIXME: really hppa2.0-hp
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][13679] | hp8[0-9][13679])
+ basic_machine=hppa1.1-hp
+ ;;
+ hp9k8[0-9][0-9] | hp8[0-9][0-9])
+ basic_machine=hppa1.0-hp
+ ;;
+ hppa-next)
+ os=-nextstep3
+ ;;
+ hppaosf)
+ basic_machine=hppa1.1-hp
+ os=-osf
+ ;;
+ hppro)
+ basic_machine=hppa1.1-hp
+ os=-proelf
+ ;;
+ i370-ibm* | ibm*)
+ basic_machine=i370-ibm
+ ;;
+ i*86v32)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv32
+ ;;
+ i*86v4*)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv4
+ ;;
+ i*86v)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-sysv
+ ;;
+ i*86sol2)
+ basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+ os=-solaris2
+ ;;
+ i386mach)
+ basic_machine=i386-mach
+ os=-mach
+ ;;
+ i386-vsta | vsta)
+ basic_machine=i386-unknown
+ os=-vsta
+ ;;
+ iris | iris4d)
+ basic_machine=mips-sgi
+ case $os in
+ -irix*)
+ ;;
+ *)
+ os=-irix4
+ ;;
+ esac
+ ;;
+ isi68 | isi)
+ basic_machine=m68k-isi
+ os=-sysv
+ ;;
+ m68knommu)
+ basic_machine=m68k-unknown
+ os=-linux
+ ;;
+ m68knommu-*)
+ basic_machine=m68k-`echo $basic_machine | sed 's/^[^-]*-//'`
+ os=-linux
+ ;;
+ m88k-omron*)
+ basic_machine=m88k-omron
+ ;;
+ magnum | m3230)
+ basic_machine=mips-mips
+ os=-sysv
+ ;;
+ merlin)
+ basic_machine=ns32k-utek
+ os=-sysv
+ ;;
+ microblaze*)
+ basic_machine=microblaze-xilinx
+ ;;
+ mingw64)
+ basic_machine=x86_64-pc
+ os=-mingw64
+ ;;
+ mingw32)
+ basic_machine=i386-pc
+ os=-mingw32
+ ;;
+ mingw32ce)
+ basic_machine=arm-unknown
+ os=-mingw32ce
+ ;;
+ miniframe)
+ basic_machine=m68000-convergent
+ ;;
+ *mint | -mint[0-9]* | *MiNT | *MiNT[0-9]*)
+ basic_machine=m68k-atari
+ os=-mint
+ ;;
+ mips3*-*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+ ;;
+ mips3*)
+ basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+ ;;
+ monitor)
+ basic_machine=m68k-rom68k
+ os=-coff
+ ;;
+ morphos)
+ basic_machine=powerpc-unknown
+ os=-morphos
+ ;;
+ msdos)
+ basic_machine=i386-pc
+ os=-msdos
+ ;;
+ ms1-*)
+ basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'`
+ ;;
+ msys)
+ basic_machine=i386-pc
+ os=-msys
+ ;;
+ mvs)
+ basic_machine=i370-ibm
+ os=-mvs
+ ;;
+ nacl)
+ basic_machine=le32-unknown
+ os=-nacl
+ ;;
+ ncr3000)
+ basic_machine=i486-ncr
+ os=-sysv4
+ ;;
+ netbsd386)
+ basic_machine=i386-unknown
+ os=-netbsd
+ ;;
+ netwinder)
+ basic_machine=armv4l-rebel
+ os=-linux
+ ;;
+ news | news700 | news800 | news900)
+ basic_machine=m68k-sony
+ os=-newsos
+ ;;
+ news1000)
+ basic_machine=m68030-sony
+ os=-newsos
+ ;;
+ news-3600 | risc-news)
+ basic_machine=mips-sony
+ os=-newsos
+ ;;
+ necv70)
+ basic_machine=v70-nec
+ os=-sysv
+ ;;
+ next | m*-next )
+ basic_machine=m68k-next
+ case $os in
+ -nextstep* )
+ ;;
+ -ns2*)
+ os=-nextstep2
+ ;;
+ *)
+ os=-nextstep3
+ ;;
+ esac
+ ;;
+ nh3000)
+ basic_machine=m68k-harris
+ os=-cxux
+ ;;
+ nh[45]000)
+ basic_machine=m88k-harris
+ os=-cxux
+ ;;
+ nindy960)
+ basic_machine=i960-intel
+ os=-nindy
+ ;;
+ mon960)
+ basic_machine=i960-intel
+ os=-mon960
+ ;;
+ nonstopux)
+ basic_machine=mips-compaq
+ os=-nonstopux
+ ;;
+ np1)
+ basic_machine=np1-gould
+ ;;
+ neo-tandem)
+ basic_machine=neo-tandem
+ ;;
+ nse-tandem)
+ basic_machine=nse-tandem
+ ;;
+ nsr-tandem)
+ basic_machine=nsr-tandem
+ ;;
+ op50n-* | op60c-*)
+ basic_machine=hppa1.1-oki
+ os=-proelf
+ ;;
+ openrisc | openrisc-*)
+ basic_machine=or32-unknown
+ ;;
+ os400)
+ basic_machine=powerpc-ibm
+ os=-os400
+ ;;
+ OSE68000 | ose68000)
+ basic_machine=m68000-ericsson
+ os=-ose
+ ;;
+ os68k)
+ basic_machine=m68k-none
+ os=-os68k
+ ;;
+ pa-hitachi)
+ basic_machine=hppa1.1-hitachi
+ os=-hiuxwe2
+ ;;
+ paragon)
+ basic_machine=i860-intel
+ os=-osf
+ ;;
+ parisc)
+ basic_machine=hppa-unknown
+ os=-linux
+ ;;
+ parisc-*)
+ basic_machine=hppa-`echo $basic_machine | sed 's/^[^-]*-//'`
+ os=-linux
+ ;;
+ pbd)
+ basic_machine=sparc-tti
+ ;;
+ pbb)
+ basic_machine=m68k-tti
+ ;;
+ pc532 | pc532-*)
+ basic_machine=ns32k-pc532
+ ;;
+ pc98)
+ basic_machine=i386-pc
+ ;;
+ pc98-*)
+ basic_machine=i386-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentium | p5 | k5 | k6 | nexgen | viac3)
+ basic_machine=i586-pc
+ ;;
+ pentiumpro | p6 | 6x86 | athlon | athlon_*)
+ basic_machine=i686-pc
+ ;;
+ pentiumii | pentium2 | pentiumiii | pentium3)
+ basic_machine=i686-pc
+ ;;
+ pentium4)
+ basic_machine=i786-pc
+ ;;
+ pentium-* | p5-* | k5-* | k6-* | nexgen-* | viac3-*)
+ basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumpro-* | p6-* | 6x86-* | athlon-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentiumii-* | pentium2-* | pentiumiii-* | pentium3-*)
+ basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pentium4-*)
+ basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ pn)
+ basic_machine=pn-gould
+ ;;
+ power) basic_machine=power-ibm
+ ;;
+ ppc | ppcbe) basic_machine=powerpc-unknown
+ ;;
+ ppc-* | ppcbe-*)
+ basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppcle | powerpclittle | ppc-le | powerpc-little)
+ basic_machine=powerpcle-unknown
+ ;;
+ ppcle-* | powerpclittle-*)
+ basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppc64) basic_machine=powerpc64-unknown
+ ;;
+ ppc64-*) basic_machine=powerpc64-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ppc64le | powerpc64little | ppc64-le | powerpc64-little)
+ basic_machine=powerpc64le-unknown
+ ;;
+ ppc64le-* | powerpc64little-*)
+ basic_machine=powerpc64le-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ ps2)
+ basic_machine=i386-ibm
+ ;;
+ pw32)
+ basic_machine=i586-unknown
+ os=-pw32
+ ;;
+ rdos | rdos64)
+ basic_machine=x86_64-pc
+ os=-rdos
+ ;;
+ rdos32)
+ basic_machine=i386-pc
+ os=-rdos
+ ;;
+ rom68k)
+ basic_machine=m68k-rom68k
+ os=-coff
+ ;;
+ rm[46]00)
+ basic_machine=mips-siemens
+ ;;
+ rtpc | rtpc-*)
+ basic_machine=romp-ibm
+ ;;
+ s390 | s390-*)
+ basic_machine=s390-ibm
+ ;;
+ s390x | s390x-*)
+ basic_machine=s390x-ibm
+ ;;
+ sa29200)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ sb1)
+ basic_machine=mipsisa64sb1-unknown
+ ;;
+ sb1el)
+ basic_machine=mipsisa64sb1el-unknown
+ ;;
+ sde)
+ basic_machine=mipsisa32-sde
+ os=-elf
+ ;;
+ sei)
+ basic_machine=mips-sei
+ os=-seiux
+ ;;
+ sequent)
+ basic_machine=i386-sequent
+ ;;
+ sh)
+ basic_machine=sh-hitachi
+ os=-hms
+ ;;
+ sh5el)
+ basic_machine=sh5le-unknown
+ ;;
+ sh64)
+ basic_machine=sh64-unknown
+ ;;
+ sparclite-wrs | simso-wrs)
+ basic_machine=sparclite-wrs
+ os=-vxworks
+ ;;
+ sps7)
+ basic_machine=m68k-bull
+ os=-sysv2
+ ;;
+ spur)
+ basic_machine=spur-unknown
+ ;;
+ st2000)
+ basic_machine=m68k-tandem
+ ;;
+ stratus)
+ basic_machine=i860-stratus
+ os=-sysv4
+ ;;
+ strongarm-* | thumb-*)
+ basic_machine=arm-`echo $basic_machine | sed 's/^[^-]*-//'`
+ ;;
+ sun2)
+ basic_machine=m68000-sun
+ ;;
+ sun2os3)
+ basic_machine=m68000-sun
+ os=-sunos3
+ ;;
+ sun2os4)
+ basic_machine=m68000-sun
+ os=-sunos4
+ ;;
+ sun3os3)
+ basic_machine=m68k-sun
+ os=-sunos3
+ ;;
+ sun3os4)
+ basic_machine=m68k-sun
+ os=-sunos4
+ ;;
+ sun4os3)
+ basic_machine=sparc-sun
+ os=-sunos3
+ ;;
+ sun4os4)
+ basic_machine=sparc-sun
+ os=-sunos4
+ ;;
+ sun4sol2)
+ basic_machine=sparc-sun
+ os=-solaris2
+ ;;
+ sun3 | sun3-*)
+ basic_machine=m68k-sun
+ ;;
+ sun4)
+ basic_machine=sparc-sun
+ ;;
+ sun386 | sun386i | roadrunner)
+ basic_machine=i386-sun
+ ;;
+ sv1)
+ basic_machine=sv1-cray
+ os=-unicos
+ ;;
+ symmetry)
+ basic_machine=i386-sequent
+ os=-dynix
+ ;;
+ t3e)
+ basic_machine=alphaev5-cray
+ os=-unicos
+ ;;
+ t90)
+ basic_machine=t90-cray
+ os=-unicos
+ ;;
+ tile*)
+ basic_machine=$basic_machine-unknown
+ os=-linux-gnu
+ ;;
+ tx39)
+ basic_machine=mipstx39-unknown
+ ;;
+ tx39el)
+ basic_machine=mipstx39el-unknown
+ ;;
+ toad1)
+ basic_machine=pdp10-xkl
+ os=-tops20
+ ;;
+ tower | tower-32)
+ basic_machine=m68k-ncr
+ ;;
+ tpf)
+ basic_machine=s390x-ibm
+ os=-tpf
+ ;;
+ udi29k)
+ basic_machine=a29k-amd
+ os=-udi
+ ;;
+ ultra3)
+ basic_machine=a29k-nyu
+ os=-sym1
+ ;;
+ v810 | necv810)
+ basic_machine=v810-nec
+ os=-none
+ ;;
+ vaxv)
+ basic_machine=vax-dec
+ os=-sysv
+ ;;
+ vms)
+ basic_machine=vax-dec
+ os=-vms
+ ;;
+ vpp*|vx|vx-*)
+ basic_machine=f301-fujitsu
+ ;;
+ vxworks960)
+ basic_machine=i960-wrs
+ os=-vxworks
+ ;;
+ vxworks68)
+ basic_machine=m68k-wrs
+ os=-vxworks
+ ;;
+ vxworks29k)
+ basic_machine=a29k-wrs
+ os=-vxworks
+ ;;
+ w65*)
+ basic_machine=w65-wdc
+ os=-none
+ ;;
+ w89k-*)
+ basic_machine=hppa1.1-winbond
+ os=-proelf
+ ;;
+ xbox)
+ basic_machine=i686-pc
+ os=-mingw32
+ ;;
+ xps | xps100)
+ basic_machine=xps100-honeywell
+ ;;
+ xscale-* | xscalee[bl]-*)
+ basic_machine=`echo $basic_machine | sed 's/^xscale/arm/'`
+ ;;
+ ymp)
+ basic_machine=ymp-cray
+ os=-unicos
+ ;;
+ z8k-*-coff)
+ basic_machine=z8k-unknown
+ os=-sim
+ ;;
+ z80-*-coff)
+ basic_machine=z80-unknown
+ os=-sim
+ ;;
+ none)
+ basic_machine=none-none
+ os=-none
+ ;;
+
+# Here we handle the default manufacturer of certain CPU types. It is in
+# some cases the only manufacturer, in others, it is the most popular.
+ w89k)
+ basic_machine=hppa1.1-winbond
+ ;;
+ op50n)
+ basic_machine=hppa1.1-oki
+ ;;
+ op60c)
+ basic_machine=hppa1.1-oki
+ ;;
+ romp)
+ basic_machine=romp-ibm
+ ;;
+ mmix)
+ basic_machine=mmix-knuth
+ ;;
+ rs6000)
+ basic_machine=rs6000-ibm
+ ;;
+ vax)
+ basic_machine=vax-dec
+ ;;
+ pdp10)
+ # there are many clones, so DEC is not a safe bet
+ basic_machine=pdp10-unknown
+ ;;
+ pdp11)
+ basic_machine=pdp11-dec
+ ;;
+ we32k)
+ basic_machine=we32k-att
+ ;;
+ sh[1234] | sh[24]a | sh[24]aeb | sh[34]eb | sh[1234]le | sh[23]ele)
+ basic_machine=sh-unknown
+ ;;
+ sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v)
+ basic_machine=sparc-sun
+ ;;
+ cydra)
+ basic_machine=cydra-cydrome
+ ;;
+ orion)
+ basic_machine=orion-highlevel
+ ;;
+ orion105)
+ basic_machine=clipper-highlevel
+ ;;
+ mac | mpw | mac-mpw)
+ basic_machine=m68k-apple
+ ;;
+ pmac | pmac-mpw)
+ basic_machine=powerpc-apple
+ ;;
+ *-unknown)
+ # Make sure to match an already-canonicalized machine name.
+ ;;
+ *)
+ echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+ *-digital*)
+ basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+ ;;
+ *-commodore*)
+ basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+ ;;
+ *)
+ ;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+ # First match some system type aliases
+ # that might get confused with valid system types.
+ # -solaris* is a basic system type, with this one exception.
+ -auroraux)
+ os=-auroraux
+ ;;
+ -solaris1 | -solaris1.*)
+ os=`echo $os | sed -e 's|solaris1|sunos4|'`
+ ;;
+ -solaris)
+ os=-solaris2
+ ;;
+ -svr4*)
+ os=-sysv4
+ ;;
+ -unixware*)
+ os=-sysv4.2uw
+ ;;
+ -gnu/linux*)
+ os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+ ;;
+ # First accept the basic system types.
+ # The portable systems comes first.
+ # Each alternative MUST END IN A *, to match a version number.
+ # -sysv* is not here because it comes later, after sysvr4.
+ -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+ | -*vms* | -sco* | -esix* | -isc* | -aix* | -cnk* | -sunos | -sunos[34]*\
+ | -hpux* | -unos* | -osf* | -luna* | -dgux* | -auroraux* | -solaris* \
+ | -sym* | -kopensolaris* | -plan9* \
+ | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+ | -aos* | -aros* \
+ | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+ | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+ | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \
+ | -bitrig* | -openbsd* | -solidbsd* \
+ | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \
+ | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \
+ | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+ | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+ | -chorusos* | -chorusrdb* | -cegcc* \
+ | -cygwin* | -msys* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+ | -mingw32* | -mingw64* | -linux-gnu* | -linux-android* \
+ | -linux-newlib* | -linux-musl* | -linux-uclibc* \
+ | -uxpv* | -beos* | -mpeix* | -udk* \
+ | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \
+ | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \
+ | -storm-chaos* | -tops10* | -tenex* | -tops20* | -its* \
+ | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \
+ | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \
+ | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \
+ | -skyos* | -haiku* | -rdos* | -toppers* | -drops* | -es*)
+ # Remember, each alternative MUST END IN *, to match a version number.
+ ;;
+ -qnx*)
+ case $basic_machine in
+ x86-* | i*86-*)
+ ;;
+ *)
+ os=-nto$os
+ ;;
+ esac
+ ;;
+ -nto-qnx*)
+ ;;
+ -nto*)
+ os=`echo $os | sed -e 's|nto|nto-qnx|'`
+ ;;
+ -sim | -es1800* | -hms* | -xray | -os68k* | -none* | -v88r* \
+ | -windows* | -osx | -abug | -netware* | -os9* | -beos* | -haiku* \
+ | -macos* | -mpw* | -magic* | -mmixware* | -mon960* | -lnews*)
+ ;;
+ -mac*)
+ os=`echo $os | sed -e 's|mac|macos|'`
+ ;;
+ -linux-dietlibc)
+ os=-linux-dietlibc
+ ;;
+ -linux*)
+ os=`echo $os | sed -e 's|linux|linux-gnu|'`
+ ;;
+ -sunos5*)
+ os=`echo $os | sed -e 's|sunos5|solaris2|'`
+ ;;
+ -sunos6*)
+ os=`echo $os | sed -e 's|sunos6|solaris3|'`
+ ;;
+ -opened*)
+ os=-openedition
+ ;;
+ -os400*)
+ os=-os400
+ ;;
+ -wince*)
+ os=-wince
+ ;;
+ -osfrose*)
+ os=-osfrose
+ ;;
+ -osf*)
+ os=-osf
+ ;;
+ -utek*)
+ os=-bsd
+ ;;
+ -dynix*)
+ os=-bsd
+ ;;
+ -acis*)
+ os=-aos
+ ;;
+ -atheos*)
+ os=-atheos
+ ;;
+ -syllable*)
+ os=-syllable
+ ;;
+ -386bsd)
+ os=-bsd
+ ;;
+ -ctix* | -uts*)
+ os=-sysv
+ ;;
+ -nova*)
+ os=-rtmk-nova
+ ;;
+ -ns2 )
+ os=-nextstep2
+ ;;
+ -nsk*)
+ os=-nsk
+ ;;
+ # Preserve the version number of sinix5.
+ -sinix5.*)
+ os=`echo $os | sed -e 's|sinix|sysv|'`
+ ;;
+ -sinix*)
+ os=-sysv4
+ ;;
+ -tpf*)
+ os=-tpf
+ ;;
+ -triton*)
+ os=-sysv3
+ ;;
+ -oss*)
+ os=-sysv3
+ ;;
+ -svr4)
+ os=-sysv4
+ ;;
+ -svr3)
+ os=-sysv3
+ ;;
+ -sysvr4)
+ os=-sysv4
+ ;;
+ # This must come after -sysvr4.
+ -sysv*)
+ ;;
+ -ose*)
+ os=-ose
+ ;;
+ -es1800*)
+ os=-ose
+ ;;
+ -xenix)
+ os=-xenix
+ ;;
+ -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+ os=-mint
+ ;;
+ -aros*)
+ os=-aros
+ ;;
+ -zvmoe)
+ os=-zvmoe
+ ;;
+ -dicos*)
+ os=-dicos
+ ;;
+ -nacl*)
+ ;;
+ -none)
+ ;;
+ *)
+ # Get rid of the `-' at the beginning of $os.
+ os=`echo $os | sed 's/[^-]*-//'`
+ echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+ exit 1
+ ;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system. Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+ score-*)
+ os=-elf
+ ;;
+ spu-*)
+ os=-elf
+ ;;
+ *-acorn)
+ os=-riscix1.2
+ ;;
+ arm*-rebel)
+ os=-linux
+ ;;
+ arm*-semi)
+ os=-aout
+ ;;
+ c4x-* | tic4x-*)
+ os=-coff
+ ;;
+ hexagon-*)
+ os=-elf
+ ;;
+ tic54x-*)
+ os=-coff
+ ;;
+ tic55x-*)
+ os=-coff
+ ;;
+ tic6x-*)
+ os=-coff
+ ;;
+ # This must come before the *-dec entry.
+ pdp10-*)
+ os=-tops20
+ ;;
+ pdp11-*)
+ os=-none
+ ;;
+ *-dec | vax-*)
+ os=-ultrix4.2
+ ;;
+ m68*-apollo)
+ os=-domain
+ ;;
+ i386-sun)
+ os=-sunos4.0.2
+ ;;
+ m68000-sun)
+ os=-sunos3
+ ;;
+ m68*-cisco)
+ os=-aout
+ ;;
+ mep-*)
+ os=-elf
+ ;;
+ mips*-cisco)
+ os=-elf
+ ;;
+ mips*-*)
+ os=-elf
+ ;;
+ or1k-*)
+ os=-elf
+ ;;
+ or32-*)
+ os=-coff
+ ;;
+ *-tti) # must be before sparc entry or we get the wrong os.
+ os=-sysv3
+ ;;
+ sparc-* | *-sun)
+ os=-sunos4.1.1
+ ;;
+ *-be)
+ os=-beos
+ ;;
+ *-haiku)
+ os=-haiku
+ ;;
+ *-ibm)
+ os=-aix
+ ;;
+ *-knuth)
+ os=-mmixware
+ ;;
+ *-wec)
+ os=-proelf
+ ;;
+ *-winbond)
+ os=-proelf
+ ;;
+ *-oki)
+ os=-proelf
+ ;;
+ *-hp)
+ os=-hpux
+ ;;
+ *-hitachi)
+ os=-hiux
+ ;;
+ i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+ os=-sysv
+ ;;
+ *-cbm)
+ os=-amigaos
+ ;;
+ *-dg)
+ os=-dgux
+ ;;
+ *-dolphin)
+ os=-sysv3
+ ;;
+ m68k-ccur)
+ os=-rtu
+ ;;
+ m88k-omron*)
+ os=-luna
+ ;;
+ *-next )
+ os=-nextstep
+ ;;
+ *-sequent)
+ os=-ptx
+ ;;
+ *-crds)
+ os=-unos
+ ;;
+ *-ns)
+ os=-genix
+ ;;
+ i370-*)
+ os=-mvs
+ ;;
+ *-next)
+ os=-nextstep3
+ ;;
+ *-gould)
+ os=-sysv
+ ;;
+ *-highlevel)
+ os=-bsd
+ ;;
+ *-encore)
+ os=-bsd
+ ;;
+ *-sgi)
+ os=-irix
+ ;;
+ *-siemens)
+ os=-sysv4
+ ;;
+ *-masscomp)
+ os=-rtu
+ ;;
+ f30[01]-fujitsu | f700-fujitsu)
+ os=-uxpv
+ ;;
+ *-rom68k)
+ os=-coff
+ ;;
+ *-*bug)
+ os=-coff
+ ;;
+ *-apple)
+ os=-macos
+ ;;
+ *-atari*)
+ os=-mint
+ ;;
+ *)
+ os=-none
+ ;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer. We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+ *-unknown)
+ case $os in
+ -riscix*)
+ vendor=acorn
+ ;;
+ -sunos*)
+ vendor=sun
+ ;;
+ -cnk*|-aix*)
+ vendor=ibm
+ ;;
+ -beos*)
+ vendor=be
+ ;;
+ -hpux*)
+ vendor=hp
+ ;;
+ -mpeix*)
+ vendor=hp
+ ;;
+ -hiux*)
+ vendor=hitachi
+ ;;
+ -unos*)
+ vendor=crds
+ ;;
+ -dgux*)
+ vendor=dg
+ ;;
+ -luna*)
+ vendor=omron
+ ;;
+ -genix*)
+ vendor=ns
+ ;;
+ -mvs* | -opened*)
+ vendor=ibm
+ ;;
+ -os400*)
+ vendor=ibm
+ ;;
+ -ptx*)
+ vendor=sequent
+ ;;
+ -tpf*)
+ vendor=ibm
+ ;;
+ -vxsim* | -vxworks* | -windiss*)
+ vendor=wrs
+ ;;
+ -aux*)
+ vendor=apple
+ ;;
+ -hms*)
+ vendor=hitachi
+ ;;
+ -mpw* | -macos*)
+ vendor=apple
+ ;;
+ -*mint | -mint[0-9]* | -*MiNT | -MiNT[0-9]*)
+ vendor=atari
+ ;;
+ -vos*)
+ vendor=stratus
+ ;;
+ esac
+ basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+ ;;
+esac
+
+echo $basic_machine$os
+exit
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "timestamp='"
+# time-stamp-format: "%:y-%02m-%02d"
+# time-stamp-end: "'"
+# End:
diff --git a/configure b/configure
new file mode 100755
index 00000000..a09e7e9a
--- /dev/null
+++ b/configure
@@ -0,0 +1,19329 @@
+#! /bin/sh
+# Guess values for system-dependent variables and create Makefiles.
+# Generated by GNU Autoconf 2.69 for finalcut 0.1.0b.
+#
+#
+# Copyright (C) 1992-1996, 1998-2012 Free Software Foundation, Inc.
+#
+#
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+ && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='print -r --'
+ as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='printf %s\n'
+ as_echo_n='printf %s'
+else
+ if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+ as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+ as_echo_n='/usr/ucb/echo -n'
+ else
+ as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+ as_echo_n_body='eval
+ arg=$1;
+ case $arg in #(
+ *"$as_nl"*)
+ expr "X$arg" : "X\\(.*\\)$as_nl";
+ arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+ esac;
+ expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+ '
+ export as_echo_n_body
+ as_echo_n='sh -c $as_echo_n_body as_echo'
+ fi
+ export as_echo_body
+ as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ PATH_SEPARATOR=:
+ (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+ (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+ PATH_SEPARATOR=';'
+ }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order. Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" "" $as_nl"
+
+# Find who we are. Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+ as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+ $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+ exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there. '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+ && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+# Use a proper internal environment variable to ensure we don't fall
+ # into an infinite loop, continuously re-executing ourselves.
+ if test x"${_as_can_reexec}" != xno && test "x$CONFIG_SHELL" != x; then
+ _as_can_reexec=no; export _as_can_reexec;
+ # We cannot yet assume a decent shell, so we have to provide a
+# neutralization value for shells without unset; and this also
+# works around shells that cannot unset nonexistent variables.
+# Preserve -v and -x to the replacement shell.
+BASH_ENV=/dev/null
+ENV=/dev/null
+(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV
+case $- in # ((((
+ *v*x* | *x*v* ) as_opts=-vx ;;
+ *v* ) as_opts=-v ;;
+ *x* ) as_opts=-x ;;
+ * ) as_opts= ;;
+esac
+exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"}
+# Admittedly, this is quite paranoid, since all the known shells bail
+# out after a failed `exec'.
+$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2
+as_fn_exit 255
+ fi
+ # We don't want this to propagate to other subprocesses.
+ { _as_can_reexec=; unset _as_can_reexec;}
+if test "x$CONFIG_SHELL" = x; then
+ as_bourne_compatible="if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on \${1+\"\$@\"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '\${1+\"\$@\"}'='\"\$@\"'
+ setopt NO_GLOB_SUBST
+else
+ case \`(set -o) 2>/dev/null\` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+"
+ as_required="as_fn_return () { (exit \$1); }
+as_fn_success () { as_fn_return 0; }
+as_fn_failure () { as_fn_return 1; }
+as_fn_ret_success () { return 0; }
+as_fn_ret_failure () { return 1; }
+
+exitcode=0
+as_fn_success || { exitcode=1; echo as_fn_success failed.; }
+as_fn_failure && { exitcode=1; echo as_fn_failure succeeded.; }
+as_fn_ret_success || { exitcode=1; echo as_fn_ret_success failed.; }
+as_fn_ret_failure && { exitcode=1; echo as_fn_ret_failure succeeded.; }
+if ( set x; as_fn_ret_success y && test x = \"\$1\" ); then :
+
+else
+ exitcode=1; echo positional parameters were not saved.
+fi
+test x\$exitcode = x0 || exit 1
+test -x / || exit 1"
+ as_suggested=" as_lineno_1=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_1a=\$LINENO
+ as_lineno_2=";as_suggested=$as_suggested$LINENO;as_suggested=$as_suggested" as_lineno_2a=\$LINENO
+ eval 'test \"x\$as_lineno_1'\$as_run'\" != \"x\$as_lineno_2'\$as_run'\" &&
+ test \"x\`expr \$as_lineno_1'\$as_run' + 1\`\" = \"x\$as_lineno_2'\$as_run'\"' || exit 1
+test \$(( 1 + 1 )) = 2 || exit 1
+
+ test -n \"\${ZSH_VERSION+set}\${BASH_VERSION+set}\" || (
+ ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO
+ ECHO=\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO\$ECHO
+ PATH=/empty FPATH=/empty; export PATH FPATH
+ test \"X\`printf %s \$ECHO\`\" = \"X\$ECHO\" \\
+ || test \"X\`print -r -- \$ECHO\`\" = \"X\$ECHO\" ) || exit 1"
+ if (eval "$as_required") 2>/dev/null; then :
+ as_have_required=yes
+else
+ as_have_required=no
+fi
+ if test x$as_have_required = xyes && (eval "$as_suggested") 2>/dev/null; then :
+
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+as_found=false
+for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ as_found=:
+ case $as_dir in #(
+ /*)
+ for as_base in sh bash ksh sh5; do
+ # Try only shells that exist, to save several forks.
+ as_shell=$as_dir/$as_base
+ if { test -f "$as_shell" || test -f "$as_shell.exe"; } &&
+ { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$as_shell"; } 2>/dev/null; then :
+ CONFIG_SHELL=$as_shell as_have_required=yes
+ if { $as_echo "$as_bourne_compatible""$as_suggested" | as_run=a "$as_shell"; } 2>/dev/null; then :
+ break 2
+fi
+fi
+ done;;
+ esac
+ as_found=false
+done
+$as_found || { if { test -f "$SHELL" || test -f "$SHELL.exe"; } &&
+ { $as_echo "$as_bourne_compatible""$as_required" | as_run=a "$SHELL"; } 2>/dev/null; then :
+ CONFIG_SHELL=$SHELL as_have_required=yes
+fi; }
+IFS=$as_save_IFS
+
+
+ if test "x$CONFIG_SHELL" != x; then :
+ export CONFIG_SHELL
+ # We cannot yet assume a decent shell, so we have to provide a
+# neutralization value for shells without unset; and this also
+# works around shells that cannot unset nonexistent variables.
+# Preserve -v and -x to the replacement shell.
+BASH_ENV=/dev/null
+ENV=/dev/null
+(unset BASH_ENV) >/dev/null 2>&1 && unset BASH_ENV ENV
+case $- in # ((((
+ *v*x* | *x*v* ) as_opts=-vx ;;
+ *v* ) as_opts=-v ;;
+ *x* ) as_opts=-x ;;
+ * ) as_opts= ;;
+esac
+exec $CONFIG_SHELL $as_opts "$as_myself" ${1+"$@"}
+# Admittedly, this is quite paranoid, since all the known shells bail
+# out after a failed `exec'.
+$as_echo "$0: could not re-execute with $CONFIG_SHELL" >&2
+exit 255
+fi
+
+ if test x$as_have_required = xno; then :
+ $as_echo "$0: This script requires a shell more modern than all"
+ $as_echo "$0: the shells that I found on your system."
+ if test x${ZSH_VERSION+set} = xset ; then
+ $as_echo "$0: In particular, zsh $ZSH_VERSION has bugs and should"
+ $as_echo "$0: be upgraded to zsh 4.3.4 or later."
+ else
+ $as_echo "$0: Please tell bug-autoconf@gnu.org about your system,
+$0: including any error possibly output before this
+$0: message. Then install a modern shell, or manually run
+$0: the script under such a shell if you do have one."
+ fi
+ exit 1
+fi
+fi
+fi
+SHELL=${CONFIG_SHELL-/bin/sh}
+export SHELL
+# Unset more variables known to interfere with behavior of common tools.
+CLICOLOR_FORCE= GREP_OPTIONS=
+unset CLICOLOR_FORCE GREP_OPTIONS
+
+## --------------------- ##
+## M4sh Shell Functions. ##
+## --------------------- ##
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+ { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+ return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+ set +e
+ as_fn_set_status $1
+ exit $1
+} # as_fn_exit
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+ case $as_dir in #(
+ -*) as_dir=./$as_dir;;
+ esac
+ test -d "$as_dir" || eval $as_mkdir_p || {
+ as_dirs=
+ while :; do
+ case $as_dir in #(
+ *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+ *) as_qdir=$as_dir;;
+ esac
+ as_dirs="'$as_qdir' $as_dirs"
+ as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ test -d "$as_dir" && break
+ done
+ test -z "$as_dirs" || eval "mkdir $as_dirs"
+ } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+ test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+ eval 'as_fn_append ()
+ {
+ eval $1+=\$2
+ }'
+else
+ as_fn_append ()
+ {
+ eval $1=\$$1\$2
+ }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+ eval 'as_fn_arith ()
+ {
+ as_val=$(( $* ))
+ }'
+else
+ as_fn_arith ()
+ {
+ as_val=`expr "$@" || test $? -eq 1`
+ }
+fi # as_fn_arith
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+ as_status=$1; test $as_status -eq 0 && as_status=1
+ if test "$4"; then
+ as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+ fi
+ $as_echo "$as_me: error: $2" >&2
+ as_fn_exit $as_status
+} # as_fn_error
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+ test "X`expr 00001 : '.*\(...\)'`" = X001; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+ as_dirname=dirname
+else
+ as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+
+ as_lineno_1=$LINENO as_lineno_1a=$LINENO
+ as_lineno_2=$LINENO as_lineno_2a=$LINENO
+ eval 'test "x$as_lineno_1'$as_run'" != "x$as_lineno_2'$as_run'" &&
+ test "x`expr $as_lineno_1'$as_run' + 1`" = "x$as_lineno_2'$as_run'"' || {
+ # Blame Lee E. McMahon (1931-1989) for sed's syntax. :-)
+ sed -n '
+ p
+ /[$]LINENO/=
+ ' <$as_myself |
+ sed '
+ s/[$]LINENO.*/&-/
+ t lineno
+ b
+ :lineno
+ N
+ :loop
+ s/[$]LINENO\([^'$as_cr_alnum'_].*\n\)\(.*\)/\2\1\2/
+ t loop
+ s/-\n.*//
+ ' >$as_me.lineno &&
+ chmod +x "$as_me.lineno" ||
+ { $as_echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2; as_fn_exit 1; }
+
+ # If we had to re-execute with $CONFIG_SHELL, we're ensured to have
+ # already done that, so ensure we don't try to do so again and fall
+ # in an infinite loop. This has already happened in practice.
+ _as_can_reexec=no; export _as_can_reexec
+ # Don't try to exec as it changes $[0], causing all sort of problems
+ # (the dirname of $[0] is not the place where we might find the
+ # original and so on. Autoconf is especially sensitive to this).
+ . "./$as_me.lineno"
+ # Exit status is that of the last command.
+ exit
+}
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+ case `echo 'xy\c'` in
+ *c*) ECHO_T=' ';; # ECHO_T is single tab character.
+ xy) ECHO_C='\c';;
+ *) echo `echo ksh88 bug on AIX 6.1` > /dev/null
+ ECHO_T=' ';;
+ esac;;
+*)
+ ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+ rm -f conf$$.dir/conf$$.file
+else
+ rm -f conf$$.dir
+ mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+ if ln -s conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s='ln -s'
+ # ... but there are two gotchas:
+ # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+ # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+ # In both cases, we have to default to `cp -pR'.
+ ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+ as_ln_s='cp -pR'
+ elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+ else
+ as_ln_s='cp -pR'
+ fi
+else
+ as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p='mkdir -p "$as_dir"'
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+SHELL=${CONFIG_SHELL-/bin/sh}
+
+
+test -n "$DJDIR" || exec 7<&0 &1
+
+# Name of the host.
+# hostname on some systems (SVR3.2, old GNU/Linux) returns a bogus exit status,
+# so uname gets run too.
+ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q`
+
+#
+# Initializations.
+#
+ac_default_prefix=/usr/local
+ac_clean_files=
+ac_config_libobj_dir=.
+LIBOBJS=
+cross_compiling=no
+subdirs=
+MFLAGS=
+MAKEFLAGS=
+
+# Identity of this package.
+PACKAGE_NAME='finalcut'
+PACKAGE_TARNAME='finalcut'
+PACKAGE_VERSION='0.1.0b'
+PACKAGE_STRING='finalcut 0.1.0b'
+PACKAGE_BUGREPORT=''
+PACKAGE_URL=''
+
+ac_unique_file="src/fobject.cpp"
+# Factoring default headers for most tests.
+ac_includes_default="\
+#include
+#ifdef HAVE_SYS_TYPES_H
+# include
+#endif
+#ifdef HAVE_SYS_STAT_H
+# include
+#endif
+#ifdef STDC_HEADERS
+# include
+# include
+#else
+# ifdef HAVE_STDLIB_H
+# include
+# endif
+#endif
+#ifdef HAVE_STRING_H
+# if !defined STDC_HEADERS && defined HAVE_MEMORY_H
+# include
+# endif
+# include
+#endif
+#ifdef HAVE_STRINGS_H
+# include
+#endif
+#ifdef HAVE_INTTYPES_H
+# include
+#endif
+#ifdef HAVE_STDINT_H
+# include
+#endif
+#ifdef HAVE_UNISTD_H
+# include
+#endif"
+
+ac_subst_vars='am__EXEEXT_FALSE
+am__EXEEXT_TRUE
+LTLIBOBJS
+LIBOBJS
+LIBTOOL_DEPS
+SO_VERSION
+CXXCPP
+OTOOL64
+OTOOL
+LIPO
+NMEDIT
+DSYMUTIL
+MANIFEST_TOOL
+RANLIB
+ac_ct_AR
+AR
+DLLTOOL
+OBJDUMP
+LN_S
+NM
+ac_ct_DUMPBIN
+DUMPBIN
+LD
+FGREP
+SED
+host_os
+host_vendor
+host_cpu
+host
+build_os
+build_vendor
+build_cpu
+build
+LIBTOOL
+EGREP
+GREP
+CPP
+am__fastdepCXX_FALSE
+am__fastdepCXX_TRUE
+CXXDEPMODE
+ac_ct_CXX
+CXXFLAGS
+CXX
+am__fastdepCC_FALSE
+am__fastdepCC_TRUE
+CCDEPMODE
+am__nodep
+AMDEPBACKSLASH
+AMDEP_FALSE
+AMDEP_TRUE
+am__quote
+am__include
+DEPDIR
+OBJEXT
+EXEEXT
+ac_ct_CC
+CPPFLAGS
+LDFLAGS
+CFLAGS
+CC
+AM_BACKSLASH
+AM_DEFAULT_VERBOSITY
+AM_DEFAULT_V
+AM_V
+am__untar
+am__tar
+AMTAR
+am__leading_dot
+SET_MAKE
+AWK
+mkdir_p
+MKDIR_P
+INSTALL_STRIP_PROGRAM
+STRIP
+install_sh
+MAKEINFO
+AUTOHEADER
+AUTOMAKE
+AUTOCONF
+ACLOCAL
+VERSION
+PACKAGE
+CYGPATH_W
+am__isrc
+INSTALL_DATA
+INSTALL_SCRIPT
+INSTALL_PROGRAM
+target_alias
+host_alias
+build_alias
+LIBS
+ECHO_T
+ECHO_N
+ECHO_C
+DEFS
+mandir
+localedir
+libdir
+psdir
+pdfdir
+dvidir
+htmldir
+infodir
+docdir
+oldincludedir
+includedir
+localstatedir
+sharedstatedir
+sysconfdir
+datadir
+datarootdir
+libexecdir
+sbindir
+bindir
+program_transform_name
+prefix
+exec_prefix
+PACKAGE_URL
+PACKAGE_BUGREPORT
+PACKAGE_STRING
+PACKAGE_VERSION
+PACKAGE_TARNAME
+PACKAGE_NAME
+PATH_SEPARATOR
+SHELL'
+ac_subst_files=''
+ac_user_opts='
+enable_option_checking
+enable_silent_rules
+enable_dependency_tracking
+enable_shared
+enable_static
+with_pic
+enable_fast_install
+with_gnu_ld
+with_sysroot
+enable_libtool_lock
+with_gpm
+'
+ ac_precious_vars='build_alias
+host_alias
+target_alias
+CC
+CFLAGS
+LDFLAGS
+LIBS
+CPPFLAGS
+CXX
+CXXFLAGS
+CCC
+CPP
+CXXCPP'
+
+
+# Initialize some variables set by options.
+ac_init_help=
+ac_init_version=false
+ac_unrecognized_opts=
+ac_unrecognized_sep=
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+cache_file=/dev/null
+exec_prefix=NONE
+no_create=
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+verbose=
+x_includes=NONE
+x_libraries=NONE
+
+# Installation directory options.
+# These are left unexpanded so users can "make install exec_prefix=/foo"
+# and all the variables that are supposed to be based on exec_prefix
+# by default will actually change.
+# Use braces instead of parens because sh, perl, etc. also accept them.
+# (The list follows the same order as the GNU Coding Standards.)
+bindir='${exec_prefix}/bin'
+sbindir='${exec_prefix}/sbin'
+libexecdir='${exec_prefix}/libexec'
+datarootdir='${prefix}/share'
+datadir='${datarootdir}'
+sysconfdir='${prefix}/etc'
+sharedstatedir='${prefix}/com'
+localstatedir='${prefix}/var'
+includedir='${prefix}/include'
+oldincludedir='/usr/include'
+docdir='${datarootdir}/doc/${PACKAGE_TARNAME}'
+infodir='${datarootdir}/info'
+htmldir='${docdir}'
+dvidir='${docdir}'
+pdfdir='${docdir}'
+psdir='${docdir}'
+libdir='${exec_prefix}/lib'
+localedir='${datarootdir}/locale'
+mandir='${datarootdir}/man'
+
+ac_prev=
+ac_dashdash=
+for ac_option
+do
+ # If the previous option needs an argument, assign it.
+ if test -n "$ac_prev"; then
+ eval $ac_prev=\$ac_option
+ ac_prev=
+ continue
+ fi
+
+ case $ac_option in
+ *=?*) ac_optarg=`expr "X$ac_option" : '[^=]*=\(.*\)'` ;;
+ *=) ac_optarg= ;;
+ *) ac_optarg=yes ;;
+ esac
+
+ # Accept the important Cygnus configure options, so we can diagnose typos.
+
+ case $ac_dashdash$ac_option in
+ --)
+ ac_dashdash=yes ;;
+
+ -bindir | --bindir | --bindi | --bind | --bin | --bi)
+ ac_prev=bindir ;;
+ -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*)
+ bindir=$ac_optarg ;;
+
+ -build | --build | --buil | --bui | --bu)
+ ac_prev=build_alias ;;
+ -build=* | --build=* | --buil=* | --bui=* | --bu=*)
+ build_alias=$ac_optarg ;;
+
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ cache_file=$ac_optarg ;;
+
+ --config-cache | -C)
+ cache_file=config.cache ;;
+
+ -datadir | --datadir | --datadi | --datad)
+ ac_prev=datadir ;;
+ -datadir=* | --datadir=* | --datadi=* | --datad=*)
+ datadir=$ac_optarg ;;
+
+ -datarootdir | --datarootdir | --datarootdi | --datarootd | --dataroot \
+ | --dataroo | --dataro | --datar)
+ ac_prev=datarootdir ;;
+ -datarootdir=* | --datarootdir=* | --datarootdi=* | --datarootd=* \
+ | --dataroot=* | --dataroo=* | --dataro=* | --datar=*)
+ datarootdir=$ac_optarg ;;
+
+ -disable-* | --disable-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*disable-\(.*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid feature name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"enable_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--disable-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval enable_$ac_useropt=no ;;
+
+ -docdir | --docdir | --docdi | --doc | --do)
+ ac_prev=docdir ;;
+ -docdir=* | --docdir=* | --docdi=* | --doc=* | --do=*)
+ docdir=$ac_optarg ;;
+
+ -dvidir | --dvidir | --dvidi | --dvid | --dvi | --dv)
+ ac_prev=dvidir ;;
+ -dvidir=* | --dvidir=* | --dvidi=* | --dvid=* | --dvi=* | --dv=*)
+ dvidir=$ac_optarg ;;
+
+ -enable-* | --enable-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid feature name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"enable_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--enable-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval enable_$ac_useropt=\$ac_optarg ;;
+
+ -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+ | --exec | --exe | --ex)
+ ac_prev=exec_prefix ;;
+ -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+ | --exec=* | --exe=* | --ex=*)
+ exec_prefix=$ac_optarg ;;
+
+ -gas | --gas | --ga | --g)
+ # Obsolete; use --with-gas.
+ with_gas=yes ;;
+
+ -help | --help | --hel | --he | -h)
+ ac_init_help=long ;;
+ -help=r* | --help=r* | --hel=r* | --he=r* | -hr*)
+ ac_init_help=recursive ;;
+ -help=s* | --help=s* | --hel=s* | --he=s* | -hs*)
+ ac_init_help=short ;;
+
+ -host | --host | --hos | --ho)
+ ac_prev=host_alias ;;
+ -host=* | --host=* | --hos=* | --ho=*)
+ host_alias=$ac_optarg ;;
+
+ -htmldir | --htmldir | --htmldi | --htmld | --html | --htm | --ht)
+ ac_prev=htmldir ;;
+ -htmldir=* | --htmldir=* | --htmldi=* | --htmld=* | --html=* | --htm=* \
+ | --ht=*)
+ htmldir=$ac_optarg ;;
+
+ -includedir | --includedir | --includedi | --included | --include \
+ | --includ | --inclu | --incl | --inc)
+ ac_prev=includedir ;;
+ -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \
+ | --includ=* | --inclu=* | --incl=* | --inc=*)
+ includedir=$ac_optarg ;;
+
+ -infodir | --infodir | --infodi | --infod | --info | --inf)
+ ac_prev=infodir ;;
+ -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*)
+ infodir=$ac_optarg ;;
+
+ -libdir | --libdir | --libdi | --libd)
+ ac_prev=libdir ;;
+ -libdir=* | --libdir=* | --libdi=* | --libd=*)
+ libdir=$ac_optarg ;;
+
+ -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \
+ | --libexe | --libex | --libe)
+ ac_prev=libexecdir ;;
+ -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \
+ | --libexe=* | --libex=* | --libe=*)
+ libexecdir=$ac_optarg ;;
+
+ -localedir | --localedir | --localedi | --localed | --locale)
+ ac_prev=localedir ;;
+ -localedir=* | --localedir=* | --localedi=* | --localed=* | --locale=*)
+ localedir=$ac_optarg ;;
+
+ -localstatedir | --localstatedir | --localstatedi | --localstated \
+ | --localstate | --localstat | --localsta | --localst | --locals)
+ ac_prev=localstatedir ;;
+ -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \
+ | --localstate=* | --localstat=* | --localsta=* | --localst=* | --locals=*)
+ localstatedir=$ac_optarg ;;
+
+ -mandir | --mandir | --mandi | --mand | --man | --ma | --m)
+ ac_prev=mandir ;;
+ -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*)
+ mandir=$ac_optarg ;;
+
+ -nfp | --nfp | --nf)
+ # Obsolete; use --without-fp.
+ with_fp=no ;;
+
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c | -n)
+ no_create=yes ;;
+
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+ no_recursion=yes ;;
+
+ -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \
+ | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \
+ | --oldin | --oldi | --old | --ol | --o)
+ ac_prev=oldincludedir ;;
+ -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \
+ | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \
+ | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*)
+ oldincludedir=$ac_optarg ;;
+
+ -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+ ac_prev=prefix ;;
+ -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+ prefix=$ac_optarg ;;
+
+ -program-prefix | --program-prefix | --program-prefi | --program-pref \
+ | --program-pre | --program-pr | --program-p)
+ ac_prev=program_prefix ;;
+ -program-prefix=* | --program-prefix=* | --program-prefi=* \
+ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+ program_prefix=$ac_optarg ;;
+
+ -program-suffix | --program-suffix | --program-suffi | --program-suff \
+ | --program-suf | --program-su | --program-s)
+ ac_prev=program_suffix ;;
+ -program-suffix=* | --program-suffix=* | --program-suffi=* \
+ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+ program_suffix=$ac_optarg ;;
+
+ -program-transform-name | --program-transform-name \
+ | --program-transform-nam | --program-transform-na \
+ | --program-transform-n | --program-transform- \
+ | --program-transform | --program-transfor \
+ | --program-transfo | --program-transf \
+ | --program-trans | --program-tran \
+ | --progr-tra | --program-tr | --program-t)
+ ac_prev=program_transform_name ;;
+ -program-transform-name=* | --program-transform-name=* \
+ | --program-transform-nam=* | --program-transform-na=* \
+ | --program-transform-n=* | --program-transform-=* \
+ | --program-transform=* | --program-transfor=* \
+ | --program-transfo=* | --program-transf=* \
+ | --program-trans=* | --program-tran=* \
+ | --progr-tra=* | --program-tr=* | --program-t=*)
+ program_transform_name=$ac_optarg ;;
+
+ -pdfdir | --pdfdir | --pdfdi | --pdfd | --pdf | --pd)
+ ac_prev=pdfdir ;;
+ -pdfdir=* | --pdfdir=* | --pdfdi=* | --pdfd=* | --pdf=* | --pd=*)
+ pdfdir=$ac_optarg ;;
+
+ -psdir | --psdir | --psdi | --psd | --ps)
+ ac_prev=psdir ;;
+ -psdir=* | --psdir=* | --psdi=* | --psd=* | --ps=*)
+ psdir=$ac_optarg ;;
+
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ silent=yes ;;
+
+ -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb)
+ ac_prev=sbindir ;;
+ -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \
+ | --sbi=* | --sb=*)
+ sbindir=$ac_optarg ;;
+
+ -sharedstatedir | --sharedstatedir | --sharedstatedi \
+ | --sharedstated | --sharedstate | --sharedstat | --sharedsta \
+ | --sharedst | --shareds | --shared | --share | --shar \
+ | --sha | --sh)
+ ac_prev=sharedstatedir ;;
+ -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \
+ | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \
+ | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \
+ | --sha=* | --sh=*)
+ sharedstatedir=$ac_optarg ;;
+
+ -site | --site | --sit)
+ ac_prev=site ;;
+ -site=* | --site=* | --sit=*)
+ site=$ac_optarg ;;
+
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ srcdir=$ac_optarg ;;
+
+ -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \
+ | --syscon | --sysco | --sysc | --sys | --sy)
+ ac_prev=sysconfdir ;;
+ -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \
+ | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*)
+ sysconfdir=$ac_optarg ;;
+
+ -target | --target | --targe | --targ | --tar | --ta | --t)
+ ac_prev=target_alias ;;
+ -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+ target_alias=$ac_optarg ;;
+
+ -v | -verbose | --verbose | --verbos | --verbo | --verb)
+ verbose=yes ;;
+
+ -version | --version | --versio | --versi | --vers | -V)
+ ac_init_version=: ;;
+
+ -with-* | --with-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*with-\([^=]*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid package name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"with_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--with-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval with_$ac_useropt=\$ac_optarg ;;
+
+ -without-* | --without-*)
+ ac_useropt=`expr "x$ac_option" : 'x-*without-\(.*\)'`
+ # Reject names that are not valid shell variable names.
+ expr "x$ac_useropt" : ".*[^-+._$as_cr_alnum]" >/dev/null &&
+ as_fn_error $? "invalid package name: $ac_useropt"
+ ac_useropt_orig=$ac_useropt
+ ac_useropt=`$as_echo "$ac_useropt" | sed 's/[-+.]/_/g'`
+ case $ac_user_opts in
+ *"
+"with_$ac_useropt"
+"*) ;;
+ *) ac_unrecognized_opts="$ac_unrecognized_opts$ac_unrecognized_sep--without-$ac_useropt_orig"
+ ac_unrecognized_sep=', ';;
+ esac
+ eval with_$ac_useropt=no ;;
+
+ --x)
+ # Obsolete; use --with-x.
+ with_x=yes ;;
+
+ -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+ | --x-incl | --x-inc | --x-in | --x-i)
+ ac_prev=x_includes ;;
+ -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+ x_includes=$ac_optarg ;;
+
+ -x-libraries | --x-libraries | --x-librarie | --x-librari \
+ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+ ac_prev=x_libraries ;;
+ -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+ x_libraries=$ac_optarg ;;
+
+ -*) as_fn_error $? "unrecognized option: \`$ac_option'
+Try \`$0 --help' for more information"
+ ;;
+
+ *=*)
+ ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='`
+ # Reject names that are not valid shell variable names.
+ case $ac_envvar in #(
+ '' | [0-9]* | *[!_$as_cr_alnum]* )
+ as_fn_error $? "invalid variable name: \`$ac_envvar'" ;;
+ esac
+ eval $ac_envvar=\$ac_optarg
+ export $ac_envvar ;;
+
+ *)
+ # FIXME: should be removed in autoconf 3.0.
+ $as_echo "$as_me: WARNING: you should use --build, --host, --target" >&2
+ expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null &&
+ $as_echo "$as_me: WARNING: invalid host type: $ac_option" >&2
+ : "${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option}"
+ ;;
+
+ esac
+done
+
+if test -n "$ac_prev"; then
+ ac_option=--`echo $ac_prev | sed 's/_/-/g'`
+ as_fn_error $? "missing argument to $ac_option"
+fi
+
+if test -n "$ac_unrecognized_opts"; then
+ case $enable_option_checking in
+ no) ;;
+ fatal) as_fn_error $? "unrecognized options: $ac_unrecognized_opts" ;;
+ *) $as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2 ;;
+ esac
+fi
+
+# Check all directory arguments for consistency.
+for ac_var in exec_prefix prefix bindir sbindir libexecdir datarootdir \
+ datadir sysconfdir sharedstatedir localstatedir includedir \
+ oldincludedir docdir infodir htmldir dvidir pdfdir psdir \
+ libdir localedir mandir
+do
+ eval ac_val=\$$ac_var
+ # Remove trailing slashes.
+ case $ac_val in
+ */ )
+ ac_val=`expr "X$ac_val" : 'X\(.*[^/]\)' \| "X$ac_val" : 'X\(.*\)'`
+ eval $ac_var=\$ac_val;;
+ esac
+ # Be sure to have absolute directory names.
+ case $ac_val in
+ [\\/$]* | ?:[\\/]* ) continue;;
+ NONE | '' ) case $ac_var in *prefix ) continue;; esac;;
+ esac
+ as_fn_error $? "expected an absolute directory name for --$ac_var: $ac_val"
+done
+
+# There might be people who depend on the old broken behavior: `$host'
+# used to hold the argument of --host etc.
+# FIXME: To remove some day.
+build=$build_alias
+host=$host_alias
+target=$target_alias
+
+# FIXME: To remove some day.
+if test "x$host_alias" != x; then
+ if test "x$build_alias" = x; then
+ cross_compiling=maybe
+ elif test "x$build_alias" != "x$host_alias"; then
+ cross_compiling=yes
+ fi
+fi
+
+ac_tool_prefix=
+test -n "$host_alias" && ac_tool_prefix=$host_alias-
+
+test "$silent" = yes && exec 6>/dev/null
+
+
+ac_pwd=`pwd` && test -n "$ac_pwd" &&
+ac_ls_di=`ls -di .` &&
+ac_pwd_ls_di=`cd "$ac_pwd" && ls -di .` ||
+ as_fn_error $? "working directory cannot be determined"
+test "X$ac_ls_di" = "X$ac_pwd_ls_di" ||
+ as_fn_error $? "pwd does not report name of working directory"
+
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+ ac_srcdir_defaulted=yes
+ # Try the directory containing this script, then the parent directory.
+ ac_confdir=`$as_dirname -- "$as_myself" ||
+$as_expr X"$as_myself" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_myself" : 'X\(//\)[^/]' \| \
+ X"$as_myself" : 'X\(//\)$' \| \
+ X"$as_myself" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_myself" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ srcdir=$ac_confdir
+ if test ! -r "$srcdir/$ac_unique_file"; then
+ srcdir=..
+ fi
+else
+ ac_srcdir_defaulted=no
+fi
+if test ! -r "$srcdir/$ac_unique_file"; then
+ test "$ac_srcdir_defaulted" = yes && srcdir="$ac_confdir or .."
+ as_fn_error $? "cannot find sources ($ac_unique_file) in $srcdir"
+fi
+ac_msg="sources are in $srcdir, but \`cd $srcdir' does not work"
+ac_abs_confdir=`(
+ cd "$srcdir" && test -r "./$ac_unique_file" || as_fn_error $? "$ac_msg"
+ pwd)`
+# When building in place, set srcdir=.
+if test "$ac_abs_confdir" = "$ac_pwd"; then
+ srcdir=.
+fi
+# Remove unnecessary trailing slashes from srcdir.
+# Double slashes in file names in object file debugging info
+# mess up M-x gdb in Emacs.
+case $srcdir in
+*/) srcdir=`expr "X$srcdir" : 'X\(.*[^/]\)' \| "X$srcdir" : 'X\(.*\)'`;;
+esac
+for ac_var in $ac_precious_vars; do
+ eval ac_env_${ac_var}_set=\${${ac_var}+set}
+ eval ac_env_${ac_var}_value=\$${ac_var}
+ eval ac_cv_env_${ac_var}_set=\${${ac_var}+set}
+ eval ac_cv_env_${ac_var}_value=\$${ac_var}
+done
+
+#
+# Report the --help message.
+#
+if test "$ac_init_help" = "long"; then
+ # Omit some internal or obsolete options to make the list less imposing.
+ # This message is too long to be a string in the A/UX 3.1 sh.
+ cat <<_ACEOF
+\`configure' configures finalcut 0.1.0b to adapt to many kinds of systems.
+
+Usage: $0 [OPTION]... [VAR=VALUE]...
+
+To assign environment variables (e.g., CC, CFLAGS...), specify them as
+VAR=VALUE. See below for descriptions of some of the useful variables.
+
+Defaults for the options are specified in brackets.
+
+Configuration:
+ -h, --help display this help and exit
+ --help=short display options specific to this package
+ --help=recursive display the short help of all the included packages
+ -V, --version display version information and exit
+ -q, --quiet, --silent do not print \`checking ...' messages
+ --cache-file=FILE cache test results in FILE [disabled]
+ -C, --config-cache alias for \`--cache-file=config.cache'
+ -n, --no-create do not create output files
+ --srcdir=DIR find the sources in DIR [configure dir or \`..']
+
+Installation directories:
+ --prefix=PREFIX install architecture-independent files in PREFIX
+ [$ac_default_prefix]
+ --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX
+ [PREFIX]
+
+By default, \`make install' will install all the files in
+\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify
+an installation prefix other than \`$ac_default_prefix' using \`--prefix',
+for instance \`--prefix=\$HOME'.
+
+For better control, use the options below.
+
+Fine tuning of the installation directories:
+ --bindir=DIR user executables [EPREFIX/bin]
+ --sbindir=DIR system admin executables [EPREFIX/sbin]
+ --libexecdir=DIR program executables [EPREFIX/libexec]
+ --sysconfdir=DIR read-only single-machine data [PREFIX/etc]
+ --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com]
+ --localstatedir=DIR modifiable single-machine data [PREFIX/var]
+ --libdir=DIR object code libraries [EPREFIX/lib]
+ --includedir=DIR C header files [PREFIX/include]
+ --oldincludedir=DIR C header files for non-gcc [/usr/include]
+ --datarootdir=DIR read-only arch.-independent data root [PREFIX/share]
+ --datadir=DIR read-only architecture-independent data [DATAROOTDIR]
+ --infodir=DIR info documentation [DATAROOTDIR/info]
+ --localedir=DIR locale-dependent data [DATAROOTDIR/locale]
+ --mandir=DIR man documentation [DATAROOTDIR/man]
+ --docdir=DIR documentation root [DATAROOTDIR/doc/finalcut]
+ --htmldir=DIR html documentation [DOCDIR]
+ --dvidir=DIR dvi documentation [DOCDIR]
+ --pdfdir=DIR pdf documentation [DOCDIR]
+ --psdir=DIR ps documentation [DOCDIR]
+_ACEOF
+
+ cat <<\_ACEOF
+
+Program names:
+ --program-prefix=PREFIX prepend PREFIX to installed program names
+ --program-suffix=SUFFIX append SUFFIX to installed program names
+ --program-transform-name=PROGRAM run sed PROGRAM on installed program names
+
+System types:
+ --build=BUILD configure for building on BUILD [guessed]
+ --host=HOST cross-compile to build programs to run on HOST [BUILD]
+_ACEOF
+fi
+
+if test -n "$ac_init_help"; then
+ case $ac_init_help in
+ short | recursive ) echo "Configuration of finalcut 0.1.0b:";;
+ esac
+ cat <<\_ACEOF
+
+Optional Features:
+ --disable-option-checking ignore unrecognized --enable/--with options
+ --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no)
+ --enable-FEATURE[=ARG] include FEATURE [ARG=yes]
+ --enable-silent-rules less verbose build output (undo: "make V=1")
+ --disable-silent-rules verbose build output (undo: "make V=0")
+ --enable-dependency-tracking
+ do not reject slow dependency extractors
+ --disable-dependency-tracking
+ speeds up one-time build
+ --enable-shared[=PKGS] build shared libraries [default=yes]
+ --enable-static[=PKGS] build static libraries [default=no]
+ --enable-fast-install[=PKGS]
+ optimize for fast installation [default=yes]
+ --disable-libtool-lock avoid locking (might break parallel builds)
+
+Optional Packages:
+ --with-PACKAGE[=ARG] use PACKAGE [ARG=yes]
+ --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
+ --with-pic[=PKGS] try to use only PIC/non-PIC objects [default=use
+ both]
+ --with-gnu-ld assume the C compiler uses GNU ld [default=no]
+ --with-sysroot=DIR Search for dependent libraries within DIR
+ (or the compiler's sysroot if not specified).
+ --without-gpm Disable GPM mouse support
+
+Some influential environment variables:
+ CC C compiler command
+ CFLAGS C compiler flags
+ LDFLAGS linker flags, e.g. -L if you have libraries in a
+ nonstandard directory
+ LIBS libraries to pass to the linker, e.g. -l
+ CPPFLAGS (Objective) C/C++ preprocessor flags, e.g. -I if
+ you have headers in a nonstandard directory
+ CXX C++ compiler command
+ CXXFLAGS C++ compiler flags
+ CPP C preprocessor
+ CXXCPP C++ preprocessor
+
+Use these variables to override the choices made by `configure' or to help
+it to find libraries and programs with nonstandard names/locations.
+
+Report bugs to the package provider.
+_ACEOF
+ac_status=$?
+fi
+
+if test "$ac_init_help" = "recursive"; then
+ # If there are subdirs, report their specific --help.
+ for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue
+ test -d "$ac_dir" ||
+ { cd "$srcdir" && ac_pwd=`pwd` && srcdir=. && test -d "$ac_dir"; } ||
+ continue
+ ac_builddir=.
+
+case "$ac_dir" in
+.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;;
+*)
+ ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'`
+ # A ".." for each directory in $ac_dir_suffix.
+ ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'`
+ case $ac_top_builddir_sub in
+ "") ac_top_builddir_sub=. ac_top_build_prefix= ;;
+ *) ac_top_build_prefix=$ac_top_builddir_sub/ ;;
+ esac ;;
+esac
+ac_abs_top_builddir=$ac_pwd
+ac_abs_builddir=$ac_pwd$ac_dir_suffix
+# for backward compatibility:
+ac_top_builddir=$ac_top_build_prefix
+
+case $srcdir in
+ .) # We are building in place.
+ ac_srcdir=.
+ ac_top_srcdir=$ac_top_builddir_sub
+ ac_abs_top_srcdir=$ac_pwd ;;
+ [\\/]* | ?:[\\/]* ) # Absolute name.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir
+ ac_abs_top_srcdir=$srcdir ;;
+ *) # Relative name.
+ ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_build_prefix$srcdir
+ ac_abs_top_srcdir=$ac_pwd/$srcdir ;;
+esac
+ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix
+
+ cd "$ac_dir" || { ac_status=$?; continue; }
+ # Check for guested configure.
+ if test -f "$ac_srcdir/configure.gnu"; then
+ echo &&
+ $SHELL "$ac_srcdir/configure.gnu" --help=recursive
+ elif test -f "$ac_srcdir/configure"; then
+ echo &&
+ $SHELL "$ac_srcdir/configure" --help=recursive
+ else
+ $as_echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2
+ fi || ac_status=$?
+ cd "$ac_pwd" || { ac_status=$?; break; }
+ done
+fi
+
+test -n "$ac_init_help" && exit $ac_status
+if $ac_init_version; then
+ cat <<\_ACEOF
+finalcut configure 0.1.0b
+generated by GNU Autoconf 2.69
+
+Copyright (C) 2012 Free Software Foundation, Inc.
+This configure script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it.
+_ACEOF
+ exit
+fi
+
+## ------------------------ ##
+## Autoconf initialization. ##
+## ------------------------ ##
+
+# ac_fn_c_try_compile LINENO
+# --------------------------
+# Try to compile conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_compile ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ rm -f conftest.$ac_objext
+ if { { ac_try="$ac_compile"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compile") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && {
+ test -z "$ac_c_werror_flag" ||
+ test ! -s conftest.err
+ } && test -s conftest.$ac_objext; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_compile
+
+# ac_fn_cxx_try_compile LINENO
+# ----------------------------
+# Try to compile conftest.$ac_ext, and return whether this succeeded.
+ac_fn_cxx_try_compile ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ rm -f conftest.$ac_objext
+ if { { ac_try="$ac_compile"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compile") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && {
+ test -z "$ac_cxx_werror_flag" ||
+ test ! -s conftest.err
+ } && test -s conftest.$ac_objext; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_cxx_try_compile
+
+# ac_fn_c_try_cpp LINENO
+# ----------------------
+# Try to preprocess conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_cpp ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if { { ac_try="$ac_cpp conftest.$ac_ext"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_cpp conftest.$ac_ext") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } > conftest.i && {
+ test -z "$ac_c_preproc_warn_flag$ac_c_werror_flag" ||
+ test ! -s conftest.err
+ }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_cpp
+
+# ac_fn_c_try_run LINENO
+# ----------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded. Assumes
+# that executables *can* be run.
+ac_fn_c_try_run ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && { ac_try='./conftest$ac_exeext'
+ { { case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_try") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: program exited with status $ac_status" >&5
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=$ac_status
+fi
+ rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_run
+
+# ac_fn_c_check_header_mongrel LINENO HEADER VAR INCLUDES
+# -------------------------------------------------------
+# Tests whether HEADER exists, giving a warning if it cannot be compiled using
+# the include files in INCLUDES and setting the cache variable VAR
+# accordingly.
+ac_fn_c_check_header_mongrel ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if eval \${$3+:} false; then :
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+else
+ # Is the header compilable?
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 usability" >&5
+$as_echo_n "checking $2 usability... " >&6; }
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+#include <$2>
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_header_compiler=yes
+else
+ ac_header_compiler=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_compiler" >&5
+$as_echo "$ac_header_compiler" >&6; }
+
+# Is the header present?
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking $2 presence" >&5
+$as_echo_n "checking $2 presence... " >&6; }
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include <$2>
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+ ac_header_preproc=yes
+else
+ ac_header_preproc=no
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_header_preproc" >&5
+$as_echo "$ac_header_preproc" >&6; }
+
+# So? What about this header?
+case $ac_header_compiler:$ac_header_preproc:$ac_c_preproc_warn_flag in #((
+ yes:no: )
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&5
+$as_echo "$as_me: WARNING: $2: accepted by the compiler, rejected by the preprocessor!" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5
+$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;}
+ ;;
+ no:yes:* )
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: present but cannot be compiled" >&5
+$as_echo "$as_me: WARNING: $2: present but cannot be compiled" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: check for missing prerequisite headers?" >&5
+$as_echo "$as_me: WARNING: $2: check for missing prerequisite headers?" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: see the Autoconf documentation" >&5
+$as_echo "$as_me: WARNING: $2: see the Autoconf documentation" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: section \"Present But Cannot Be Compiled\"" >&5
+$as_echo "$as_me: WARNING: $2: section \"Present But Cannot Be Compiled\"" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $2: proceeding with the compiler's result" >&5
+$as_echo "$as_me: WARNING: $2: proceeding with the compiler's result" >&2;}
+ ;;
+esac
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ eval "$3=\$ac_header_compiler"
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_header_mongrel
+
+# ac_fn_c_check_header_compile LINENO HEADER VAR INCLUDES
+# -------------------------------------------------------
+# Tests whether HEADER exists and can be compiled using the include files in
+# INCLUDES, setting the cache variable VAR accordingly.
+ac_fn_c_check_header_compile ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+$4
+#include <$2>
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ eval "$3=yes"
+else
+ eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_header_compile
+
+# ac_fn_c_try_link LINENO
+# -----------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded.
+ac_fn_c_try_link ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ rm -f conftest.$ac_objext conftest$ac_exeext
+ if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && {
+ test -z "$ac_c_werror_flag" ||
+ test ! -s conftest.err
+ } && test -s conftest$ac_exeext && {
+ test "$cross_compiling" = yes ||
+ test -x conftest$ac_exeext
+ }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ # Delete the IPA/IPO (Inter Procedural Analysis/Optimization) information
+ # created by the PGI compiler (conftest_ipa8_conftest.oo), as it would
+ # interfere with the next link command; also delete a directory that is
+ # left behind by Apple's compiler. We do this before executing the actions.
+ rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_c_try_link
+
+# ac_fn_c_check_func LINENO FUNC VAR
+# ----------------------------------
+# Tests whether FUNC exists, setting the cache variable VAR accordingly
+ac_fn_c_check_func ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for $2" >&5
+$as_echo_n "checking for $2... " >&6; }
+if eval \${$3+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+/* Define $2 to an innocuous variant, in case declares $2.
+ For example, HP-UX 11i declares gettimeofday. */
+#define $2 innocuous_$2
+
+/* System header to define __stub macros and hopefully few prototypes,
+ which can conflict with char $2 (); below.
+ Prefer to if __STDC__ is defined, since
+ exists even on freestanding compilers. */
+
+#ifdef __STDC__
+# include
+#else
+# include
+#endif
+
+#undef $2
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char $2 ();
+/* The GNU C library defines this for functions which it implements
+ to always fail with ENOSYS. Some functions are actually named
+ something starting with __ and the normal name is an alias. */
+#if defined __stub_$2 || defined __stub___$2
+choke me
+#endif
+
+int
+main ()
+{
+return $2 ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ eval "$3=yes"
+else
+ eval "$3=no"
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+fi
+eval ac_res=\$$3
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_res" >&5
+$as_echo "$ac_res" >&6; }
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+
+} # ac_fn_c_check_func
+
+# ac_fn_cxx_try_cpp LINENO
+# ------------------------
+# Try to preprocess conftest.$ac_ext, and return whether this succeeded.
+ac_fn_cxx_try_cpp ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ if { { ac_try="$ac_cpp conftest.$ac_ext"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_cpp conftest.$ac_ext") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } > conftest.i && {
+ test -z "$ac_cxx_preproc_warn_flag$ac_cxx_werror_flag" ||
+ test ! -s conftest.err
+ }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_cxx_try_cpp
+
+# ac_fn_cxx_try_link LINENO
+# -------------------------
+# Try to link conftest.$ac_ext, and return whether this succeeded.
+ac_fn_cxx_try_link ()
+{
+ as_lineno=${as_lineno-"$1"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ rm -f conftest.$ac_objext conftest$ac_exeext
+ if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ grep -v '^ *+' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ mv -f conftest.er1 conftest.err
+ fi
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && {
+ test -z "$ac_cxx_werror_flag" ||
+ test ! -s conftest.err
+ } && test -s conftest$ac_exeext && {
+ test "$cross_compiling" = yes ||
+ test -x conftest$ac_exeext
+ }; then :
+ ac_retval=0
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+ ac_retval=1
+fi
+ # Delete the IPA/IPO (Inter Procedural Analysis/Optimization) information
+ # created by the PGI compiler (conftest_ipa8_conftest.oo), as it would
+ # interfere with the next link command; also delete a directory that is
+ # left behind by Apple's compiler. We do this before executing the actions.
+ rm -rf conftest.dSYM conftest_ipa8_conftest.oo
+ eval $as_lineno_stack; ${as_lineno_stack:+:} unset as_lineno
+ as_fn_set_status $ac_retval
+
+} # ac_fn_cxx_try_link
+cat >config.log <<_ACEOF
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+
+It was created by finalcut $as_me 0.1.0b, which was
+generated by GNU Autoconf 2.69. Invocation command line was
+
+ $ $0 $@
+
+_ACEOF
+exec 5>>config.log
+{
+cat <<_ASUNAME
+## --------- ##
+## Platform. ##
+## --------- ##
+
+hostname = `(hostname || uname -n) 2>/dev/null | sed 1q`
+uname -m = `(uname -m) 2>/dev/null || echo unknown`
+uname -r = `(uname -r) 2>/dev/null || echo unknown`
+uname -s = `(uname -s) 2>/dev/null || echo unknown`
+uname -v = `(uname -v) 2>/dev/null || echo unknown`
+
+/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown`
+/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown`
+
+/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown`
+/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown`
+/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown`
+/usr/bin/hostinfo = `(/usr/bin/hostinfo) 2>/dev/null || echo unknown`
+/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown`
+/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown`
+/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown`
+
+_ASUNAME
+
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ $as_echo "PATH: $as_dir"
+ done
+IFS=$as_save_IFS
+
+} >&5
+
+cat >&5 <<_ACEOF
+
+
+## ----------- ##
+## Core tests. ##
+## ----------- ##
+
+_ACEOF
+
+
+# Keep a trace of the command line.
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Strip out --silent because we don't want to record it for future runs.
+# Also quote any args containing shell meta-characters.
+# Make two passes to allow for proper duplicate-argument suppression.
+ac_configure_args=
+ac_configure_args0=
+ac_configure_args1=
+ac_must_keep_next=false
+for ac_pass in 1 2
+do
+ for ac_arg
+ do
+ case $ac_arg in
+ -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;;
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ continue ;;
+ *\'*)
+ ac_arg=`$as_echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;;
+ esac
+ case $ac_pass in
+ 1) as_fn_append ac_configure_args0 " '$ac_arg'" ;;
+ 2)
+ as_fn_append ac_configure_args1 " '$ac_arg'"
+ if test $ac_must_keep_next = true; then
+ ac_must_keep_next=false # Got value, back to normal.
+ else
+ case $ac_arg in
+ *=* | --config-cache | -C | -disable-* | --disable-* \
+ | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \
+ | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \
+ | -with-* | --with-* | -without-* | --without-* | --x)
+ case "$ac_configure_args0 " in
+ "$ac_configure_args1"*" '$ac_arg' "* ) continue ;;
+ esac
+ ;;
+ -* ) ac_must_keep_next=true ;;
+ esac
+ fi
+ as_fn_append ac_configure_args " '$ac_arg'"
+ ;;
+ esac
+ done
+done
+{ ac_configure_args0=; unset ac_configure_args0;}
+{ ac_configure_args1=; unset ac_configure_args1;}
+
+# When interrupted or exit'd, cleanup temporary files, and complete
+# config.log. We remove comments because anyway the quotes in there
+# would cause problems or look ugly.
+# WARNING: Use '\'' to represent an apostrophe within the trap.
+# WARNING: Do not start the trap code with a newline, due to a FreeBSD 4.0 bug.
+trap 'exit_status=$?
+ # Save into config.log some information that might help in debugging.
+ {
+ echo
+
+ $as_echo "## ---------------- ##
+## Cache variables. ##
+## ---------------- ##"
+ echo
+ # The following way of writing the cache mishandles newlines in values,
+(
+ for ac_var in `(set) 2>&1 | sed -n '\''s/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'\''`; do
+ eval ac_val=\$$ac_var
+ case $ac_val in #(
+ *${as_nl}*)
+ case $ac_var in #(
+ *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5
+$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;;
+ esac
+ case $ac_var in #(
+ _ | IFS | as_nl) ;; #(
+ BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #(
+ *) { eval $ac_var=; unset $ac_var;} ;;
+ esac ;;
+ esac
+ done
+ (set) 2>&1 |
+ case $as_nl`(ac_space='\'' '\''; set) 2>&1` in #(
+ *${as_nl}ac_space=\ *)
+ sed -n \
+ "s/'\''/'\''\\\\'\'''\''/g;
+ s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\''\\2'\''/p"
+ ;; #(
+ *)
+ sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p"
+ ;;
+ esac |
+ sort
+)
+ echo
+
+ $as_echo "## ----------------- ##
+## Output variables. ##
+## ----------------- ##"
+ echo
+ for ac_var in $ac_subst_vars
+ do
+ eval ac_val=\$$ac_var
+ case $ac_val in
+ *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;;
+ esac
+ $as_echo "$ac_var='\''$ac_val'\''"
+ done | sort
+ echo
+
+ if test -n "$ac_subst_files"; then
+ $as_echo "## ------------------- ##
+## File substitutions. ##
+## ------------------- ##"
+ echo
+ for ac_var in $ac_subst_files
+ do
+ eval ac_val=\$$ac_var
+ case $ac_val in
+ *\'\''*) ac_val=`$as_echo "$ac_val" | sed "s/'\''/'\''\\\\\\\\'\'''\''/g"`;;
+ esac
+ $as_echo "$ac_var='\''$ac_val'\''"
+ done | sort
+ echo
+ fi
+
+ if test -s confdefs.h; then
+ $as_echo "## ----------- ##
+## confdefs.h. ##
+## ----------- ##"
+ echo
+ cat confdefs.h
+ echo
+ fi
+ test "$ac_signal" != 0 &&
+ $as_echo "$as_me: caught signal $ac_signal"
+ $as_echo "$as_me: exit $exit_status"
+ } >&5
+ rm -f core *.core core.conftest.* &&
+ rm -f -r conftest* confdefs* conf$$* $ac_clean_files &&
+ exit $exit_status
+' 0
+for ac_signal in 1 2 13 15; do
+ trap 'ac_signal='$ac_signal'; as_fn_exit 1' $ac_signal
+done
+ac_signal=0
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -f -r conftest* confdefs.h
+
+$as_echo "/* confdefs.h */" > confdefs.h
+
+# Predefined preprocessor variables.
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_NAME "$PACKAGE_NAME"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_TARNAME "$PACKAGE_TARNAME"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_VERSION "$PACKAGE_VERSION"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_STRING "$PACKAGE_STRING"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT"
+_ACEOF
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE_URL "$PACKAGE_URL"
+_ACEOF
+
+
+# Let the site file select an alternate cache file if it wants to.
+# Prefer an explicitly selected file to automatically selected ones.
+ac_site_file1=NONE
+ac_site_file2=NONE
+if test -n "$CONFIG_SITE"; then
+ # We do not want a PATH search for config.site.
+ case $CONFIG_SITE in #((
+ -*) ac_site_file1=./$CONFIG_SITE;;
+ */*) ac_site_file1=$CONFIG_SITE;;
+ *) ac_site_file1=./$CONFIG_SITE;;
+ esac
+elif test "x$prefix" != xNONE; then
+ ac_site_file1=$prefix/share/config.site
+ ac_site_file2=$prefix/etc/config.site
+else
+ ac_site_file1=$ac_default_prefix/share/config.site
+ ac_site_file2=$ac_default_prefix/etc/config.site
+fi
+for ac_site_file in "$ac_site_file1" "$ac_site_file2"
+do
+ test "x$ac_site_file" = xNONE && continue
+ if test /dev/null != "$ac_site_file" && test -r "$ac_site_file"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: loading site script $ac_site_file" >&5
+$as_echo "$as_me: loading site script $ac_site_file" >&6;}
+ sed 's/^/| /' "$ac_site_file" >&5
+ . "$ac_site_file" \
+ || { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "failed to load site script $ac_site_file
+See \`config.log' for more details" "$LINENO" 5; }
+ fi
+done
+
+if test -r "$cache_file"; then
+ # Some versions of bash will fail to source /dev/null (special files
+ # actually), so we avoid doing that. DJGPP emulates it as a regular file.
+ if test /dev/null != "$cache_file" && test -f "$cache_file"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: loading cache $cache_file" >&5
+$as_echo "$as_me: loading cache $cache_file" >&6;}
+ case $cache_file in
+ [\\/]* | ?:[\\/]* ) . "$cache_file";;
+ *) . "./$cache_file";;
+ esac
+ fi
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: creating cache $cache_file" >&5
+$as_echo "$as_me: creating cache $cache_file" >&6;}
+ >$cache_file
+fi
+
+# Check that the precious variables saved in the cache have kept the same
+# value.
+ac_cache_corrupted=false
+for ac_var in $ac_precious_vars; do
+ eval ac_old_set=\$ac_cv_env_${ac_var}_set
+ eval ac_new_set=\$ac_env_${ac_var}_set
+ eval ac_old_val=\$ac_cv_env_${ac_var}_value
+ eval ac_new_val=\$ac_env_${ac_var}_value
+ case $ac_old_set,$ac_new_set in
+ set,)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5
+$as_echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;}
+ ac_cache_corrupted=: ;;
+ ,set)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' was not set in the previous run" >&5
+$as_echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;}
+ ac_cache_corrupted=: ;;
+ ,);;
+ *)
+ if test "x$ac_old_val" != "x$ac_new_val"; then
+ # differences in whitespace do not lead to failure.
+ ac_old_val_w=`echo x $ac_old_val`
+ ac_new_val_w=`echo x $ac_new_val`
+ if test "$ac_old_val_w" != "$ac_new_val_w"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: \`$ac_var' has changed since the previous run:" >&5
+$as_echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;}
+ ac_cache_corrupted=:
+ else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&5
+$as_echo "$as_me: warning: ignoring whitespace changes in \`$ac_var' since the previous run:" >&2;}
+ eval $ac_var=\$ac_old_val
+ fi
+ { $as_echo "$as_me:${as_lineno-$LINENO}: former value: \`$ac_old_val'" >&5
+$as_echo "$as_me: former value: \`$ac_old_val'" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: current value: \`$ac_new_val'" >&5
+$as_echo "$as_me: current value: \`$ac_new_val'" >&2;}
+ fi;;
+ esac
+ # Pass precious variables to config.status.
+ if test "$ac_new_set" = set; then
+ case $ac_new_val in
+ *\'*) ac_arg=$ac_var=`$as_echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;;
+ *) ac_arg=$ac_var=$ac_new_val ;;
+ esac
+ case " $ac_configure_args " in
+ *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy.
+ *) as_fn_append ac_configure_args " '$ac_arg'" ;;
+ esac
+ fi
+done
+if $ac_cache_corrupted; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+ { $as_echo "$as_me:${as_lineno-$LINENO}: error: changes in the environment can compromise the build" >&5
+$as_echo "$as_me: error: changes in the environment can compromise the build" >&2;}
+ as_fn_error $? "run \`make distclean' and/or \`rm $cache_file' and start over" "$LINENO" 5
+fi
+## -------------------- ##
+## Main body of script. ##
+## -------------------- ##
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+
+am__api_version='1.13'
+
+ac_aux_dir=
+for ac_dir in "$srcdir" "$srcdir/.." "$srcdir/../.."; do
+ if test -f "$ac_dir/install-sh"; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install-sh -c"
+ break
+ elif test -f "$ac_dir/install.sh"; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install.sh -c"
+ break
+ elif test -f "$ac_dir/shtool"; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/shtool install -c"
+ break
+ fi
+done
+if test -z "$ac_aux_dir"; then
+ as_fn_error $? "cannot find install-sh, install.sh, or shtool in \"$srcdir\" \"$srcdir/..\" \"$srcdir/../..\"" "$LINENO" 5
+fi
+
+# These three variables are undocumented and unsupported,
+# and are intended to be withdrawn in a future Autoconf release.
+# They can cause serious problems if a builder's source tree is in a directory
+# whose full name contains unusual characters.
+ac_config_guess="$SHELL $ac_aux_dir/config.guess" # Please don't use this var.
+ac_config_sub="$SHELL $ac_aux_dir/config.sub" # Please don't use this var.
+ac_configure="$SHELL $ac_aux_dir/configure" # Please don't use this var.
+
+
+# Find a good install program. We prefer a C program (faster),
+# so one script is as good as another. But avoid the broken or
+# incompatible versions:
+# SysV /etc/install, /usr/sbin/install
+# SunOS /usr/etc/install
+# IRIX /sbin/install
+# AIX /bin/install
+# AmigaOS /C/install, which installs bootblocks on floppy discs
+# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag
+# AFS /usr/afsws/bin/install, which mishandles nonexistent args
+# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff"
+# OS/2's system install, which has a completely different semantic
+# ./install, which can be erroneously created by make from ./install.sh.
+# Reject install programs that cannot install multiple files.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a BSD-compatible install" >&5
+$as_echo_n "checking for a BSD-compatible install... " >&6; }
+if test -z "$INSTALL"; then
+if ${ac_cv_path_install+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ # Account for people who put trailing slashes in PATH elements.
+case $as_dir/ in #((
+ ./ | .// | /[cC]/* | \
+ /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \
+ ?:[\\/]os2[\\/]install[\\/]* | ?:[\\/]OS2[\\/]INSTALL[\\/]* | \
+ /usr/ucb/* ) ;;
+ *)
+ # OSF1 and SCO ODT 3.0 have their own names for install.
+ # Don't use installbsd from OSF since it installs stuff as root
+ # by default.
+ for ac_prog in ginstall scoinst install; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then
+ if test $ac_prog = install &&
+ grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+ # AIX install. It has an incompatible calling convention.
+ :
+ elif test $ac_prog = install &&
+ grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then
+ # program-specific install script used by HP pwplus--don't use.
+ :
+ else
+ rm -rf conftest.one conftest.two conftest.dir
+ echo one > conftest.one
+ echo two > conftest.two
+ mkdir conftest.dir
+ if "$as_dir/$ac_prog$ac_exec_ext" -c conftest.one conftest.two "`pwd`/conftest.dir" &&
+ test -s conftest.one && test -s conftest.two &&
+ test -s conftest.dir/conftest.one &&
+ test -s conftest.dir/conftest.two
+ then
+ ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c"
+ break 3
+ fi
+ fi
+ fi
+ done
+ done
+ ;;
+esac
+
+ done
+IFS=$as_save_IFS
+
+rm -rf conftest.one conftest.two conftest.dir
+
+fi
+ if test "${ac_cv_path_install+set}" = set; then
+ INSTALL=$ac_cv_path_install
+ else
+ # As a last resort, use the slow shell script. Don't cache a
+ # value for INSTALL within a source directory, because that will
+ # break other packages using the cache if that directory is
+ # removed, or if the value is a relative name.
+ INSTALL=$ac_install_sh
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $INSTALL" >&5
+$as_echo "$INSTALL" >&6; }
+
+# Use test -z because SunOS4 sh mishandles braces in ${var-val}.
+# It thinks the first close brace ends the variable substitution.
+test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}'
+
+test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}'
+
+test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644'
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether build environment is sane" >&5
+$as_echo_n "checking whether build environment is sane... " >&6; }
+# Reject unsafe characters in $srcdir or the absolute working directory
+# name. Accept space and tab only in the latter.
+am_lf='
+'
+case `pwd` in
+ *[\\\"\#\$\&\'\`$am_lf]*)
+ as_fn_error $? "unsafe absolute working directory name" "$LINENO" 5;;
+esac
+case $srcdir in
+ *[\\\"\#\$\&\'\`$am_lf\ \ ]*)
+ as_fn_error $? "unsafe srcdir value: '$srcdir'" "$LINENO" 5;;
+esac
+
+# Do 'set' in a subshell so we don't clobber the current shell's
+# arguments. Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+ am_has_slept=no
+ for am_try in 1 2; do
+ echo "timestamp, slept: $am_has_slept" > conftest.file
+ set X `ls -Lt "$srcdir/configure" conftest.file 2> /dev/null`
+ if test "$*" = "X"; then
+ # -L didn't work.
+ set X `ls -t "$srcdir/configure" conftest.file`
+ fi
+ if test "$*" != "X $srcdir/configure conftest.file" \
+ && test "$*" != "X conftest.file $srcdir/configure"; then
+
+ # If neither matched, then we have a broken ls. This can happen
+ # if, for instance, CONFIG_SHELL is bash and it inherits a
+ # broken ls alias from the environment. This has actually
+ # happened. Such a system could not be considered "sane".
+ as_fn_error $? "ls -t appears to fail. Make sure there is not a broken
+ alias in your environment" "$LINENO" 5
+ fi
+ if test "$2" = conftest.file || test $am_try -eq 2; then
+ break
+ fi
+ # Just in case.
+ sleep 1
+ am_has_slept=yes
+ done
+ test "$2" = conftest.file
+ )
+then
+ # Ok.
+ :
+else
+ as_fn_error $? "newly created file is older than distributed files!
+Check your system clock" "$LINENO" 5
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+# If we didn't sleep, we still need to ensure time stamps of config.status and
+# generated files are strictly newer.
+am_sleep_pid=
+if grep 'slept: no' conftest.file >/dev/null 2>&1; then
+ ( sleep 1 ) &
+ am_sleep_pid=$!
+fi
+
+rm -f conftest.file
+
+test "$program_prefix" != NONE &&
+ program_transform_name="s&^&$program_prefix&;$program_transform_name"
+# Use a double $ so make ignores it.
+test "$program_suffix" != NONE &&
+ program_transform_name="s&\$&$program_suffix&;$program_transform_name"
+# Double any \ or $.
+# By default was `s,x,x', remove it if useless.
+ac_script='s/[\\$]/&&/g;s/;s,x,x,$//'
+program_transform_name=`$as_echo "$program_transform_name" | sed "$ac_script"`
+
+# expand $ac_aux_dir to an absolute path
+am_aux_dir=`cd $ac_aux_dir && pwd`
+
+if test x"${MISSING+set}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ MISSING="\${SHELL} \"$am_aux_dir/missing\"" ;;
+ *)
+ MISSING="\${SHELL} $am_aux_dir/missing" ;;
+ esac
+fi
+# Use eval to expand $SHELL
+if eval "$MISSING --is-lightweight"; then
+ am_missing_run="$MISSING "
+else
+ am_missing_run=
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: 'missing' script is too old or missing" >&5
+$as_echo "$as_me: WARNING: 'missing' script is too old or missing" >&2;}
+fi
+
+if test x"${install_sh}" != xset; then
+ case $am_aux_dir in
+ *\ * | *\ *)
+ install_sh="\${SHELL} '$am_aux_dir/install-sh'" ;;
+ *)
+ install_sh="\${SHELL} $am_aux_dir/install-sh"
+ esac
+fi
+
+# Installed binaries are usually stripped using 'strip' when the user
+# run "make install-strip". However 'strip' might not be the right
+# tool to use in cross-compilation environments, therefore Automake
+# will honor the 'STRIP' environment variable to overrule this program.
+if test "$cross_compiling" != no; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$STRIP"; then
+ ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5
+$as_echo "$STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+ ac_ct_STRIP=$STRIP
+ # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_STRIP"; then
+ ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_STRIP="strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5
+$as_echo "$ac_ct_STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_STRIP" = x; then
+ STRIP=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ STRIP=$ac_ct_STRIP
+ fi
+else
+ STRIP="$ac_cv_prog_STRIP"
+fi
+
+fi
+INSTALL_STRIP_PROGRAM="\$(install_sh) -c -s"
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a thread-safe mkdir -p" >&5
+$as_echo_n "checking for a thread-safe mkdir -p... " >&6; }
+if test -z "$MKDIR_P"; then
+ if ${ac_cv_path_mkdir+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/opt/sfw/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in mkdir gmkdir; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ as_fn_executable_p "$as_dir/$ac_prog$ac_exec_ext" || continue
+ case `"$as_dir/$ac_prog$ac_exec_ext" --version 2>&1` in #(
+ 'mkdir (GNU coreutils) '* | \
+ 'mkdir (coreutils) '* | \
+ 'mkdir (fileutils) '4.1*)
+ ac_cv_path_mkdir=$as_dir/$ac_prog$ac_exec_ext
+ break 3;;
+ esac
+ done
+ done
+ done
+IFS=$as_save_IFS
+
+fi
+
+ test -d ./--version && rmdir ./--version
+ if test "${ac_cv_path_mkdir+set}" = set; then
+ MKDIR_P="$ac_cv_path_mkdir -p"
+ else
+ # As a last resort, use the slow shell script. Don't cache a
+ # value for MKDIR_P within a source directory, because that will
+ # break other packages using the cache if that directory is
+ # removed, or if the value is a relative name.
+ MKDIR_P="$ac_install_sh -d"
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $MKDIR_P" >&5
+$as_echo "$MKDIR_P" >&6; }
+
+for ac_prog in gawk mawk nawk awk
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AWK+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$AWK"; then
+ ac_cv_prog_AWK="$AWK" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AWK="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+AWK=$ac_cv_prog_AWK
+if test -n "$AWK"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AWK" >&5
+$as_echo "$AWK" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$AWK" && break
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ${MAKE-make} sets \$(MAKE)" >&5
+$as_echo_n "checking whether ${MAKE-make} sets \$(MAKE)... " >&6; }
+set x ${MAKE-make}
+ac_make=`$as_echo "$2" | sed 's/+/p/g; s/[^a-zA-Z0-9_]/_/g'`
+if eval \${ac_cv_prog_make_${ac_make}_set+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat >conftest.make <<\_ACEOF
+SHELL = /bin/sh
+all:
+ @echo '@@@%%%=$(MAKE)=@@@%%%'
+_ACEOF
+# GNU make sometimes prints "make[1]: Entering ...", which would confuse us.
+case `${MAKE-make} -f conftest.make 2>/dev/null` in
+ *@@@%%%=?*=@@@%%%*)
+ eval ac_cv_prog_make_${ac_make}_set=yes;;
+ *)
+ eval ac_cv_prog_make_${ac_make}_set=no;;
+esac
+rm -f conftest.make
+fi
+if eval test \$ac_cv_prog_make_${ac_make}_set = yes; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+ SET_MAKE=
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ SET_MAKE="MAKE=${MAKE-make}"
+fi
+
+rm -rf .tst 2>/dev/null
+mkdir .tst 2>/dev/null
+if test -d .tst; then
+ am__leading_dot=.
+else
+ am__leading_dot=_
+fi
+rmdir .tst 2>/dev/null
+
+# Check whether --enable-silent-rules was given.
+if test "${enable_silent_rules+set}" = set; then :
+ enableval=$enable_silent_rules;
+fi
+
+case $enable_silent_rules in # (((
+ yes) AM_DEFAULT_VERBOSITY=0;;
+ no) AM_DEFAULT_VERBOSITY=1;;
+ *) AM_DEFAULT_VERBOSITY=1;;
+esac
+am_make=${MAKE-make}
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $am_make supports nested variables" >&5
+$as_echo_n "checking whether $am_make supports nested variables... " >&6; }
+if ${am_cv_make_support_nested_variables+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if $as_echo 'TRUE=$(BAR$(V))
+BAR0=false
+BAR1=true
+V=1
+am__doit:
+ @$(TRUE)
+.PHONY: am__doit' | $am_make -f - >/dev/null 2>&1; then
+ am_cv_make_support_nested_variables=yes
+else
+ am_cv_make_support_nested_variables=no
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_make_support_nested_variables" >&5
+$as_echo "$am_cv_make_support_nested_variables" >&6; }
+if test $am_cv_make_support_nested_variables = yes; then
+ AM_V='$(V)'
+ AM_DEFAULT_V='$(AM_DEFAULT_VERBOSITY)'
+else
+ AM_V=$AM_DEFAULT_VERBOSITY
+ AM_DEFAULT_V=$AM_DEFAULT_VERBOSITY
+fi
+AM_BACKSLASH='\'
+
+if test "`cd $srcdir && pwd`" != "`pwd`"; then
+ # Use -I$(srcdir) only when $(srcdir) != ., so that make's output
+ # is not polluted with repeated "-I."
+ am__isrc=' -I$(srcdir)'
+ # test to see if srcdir already configured
+ if test -f $srcdir/config.status; then
+ as_fn_error $? "source directory already configured; run \"make distclean\" there first" "$LINENO" 5
+ fi
+fi
+
+# test whether we have cygpath
+if test -z "$CYGPATH_W"; then
+ if (cygpath --version) >/dev/null 2>/dev/null; then
+ CYGPATH_W='cygpath -w'
+ else
+ CYGPATH_W=echo
+ fi
+fi
+
+
+# Define the identity of the package.
+ PACKAGE='finalcut'
+ VERSION='0.1.0b'
+
+
+cat >>confdefs.h <<_ACEOF
+#define PACKAGE "$PACKAGE"
+_ACEOF
+
+
+cat >>confdefs.h <<_ACEOF
+#define VERSION "$VERSION"
+_ACEOF
+
+# Some tools Automake needs.
+
+ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"}
+
+
+AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"}
+
+
+AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"}
+
+
+AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"}
+
+
+MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"}
+
+# For better backward compatibility. To be removed once Automake 1.9.x
+# dies out for good. For more background, see:
+#
+#
+mkdir_p='$(MKDIR_P)'
+
+# We need awk for the "check" target. The system "awk" is bad on
+# some platforms.
+# Always define AMTAR for backward compatibility. Yes, it's still used
+# in the wild :-( We should find a proper way to deprecate it ...
+AMTAR='$${TAR-tar}'
+
+
+# We'll loop over all known methods to create a tar archive until one works.
+_am_tools='gnutar pax cpio none'
+
+am__tar='$${TAR-tar} chof - "$$tardir"' am__untar='$${TAR-tar} xf -'
+
+
+
+
+
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}gcc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}gcc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_CC"; then
+ ac_ct_CC=$CC
+ # Extract the first word of "gcc", so it can be a program name with args.
+set dummy gcc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="gcc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5
+$as_echo "$ac_ct_CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_CC" = x; then
+ CC=""
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ CC=$ac_ct_CC
+ fi
+else
+ CC="$ac_cv_prog_CC"
+fi
+
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args.
+set dummy ${ac_tool_prefix}cc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="${ac_tool_prefix}cc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ fi
+fi
+if test -z "$CC"; then
+ # Extract the first word of "cc", so it can be a program name with args.
+set dummy cc; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+ ac_prog_rejected=no
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then
+ ac_prog_rejected=yes
+ continue
+ fi
+ ac_cv_prog_CC="cc"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+if test $ac_prog_rejected = yes; then
+ # We found a bogon in the path, so make sure we never use it.
+ set dummy $ac_cv_prog_CC
+ shift
+ if test $# != 0; then
+ # We chose a different compiler from the bogus one.
+ # However, it has the same basename, so the bogon will be chosen
+ # first if we set CC to just the basename; use the full file name.
+ shift
+ ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@"
+ fi
+fi
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$CC"; then
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in cl.exe
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CC"; then
+ ac_cv_prog_CC="$CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CC="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CC=$ac_cv_prog_CC
+if test -n "$CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CC" >&5
+$as_echo "$CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$CC" && break
+ done
+fi
+if test -z "$CC"; then
+ ac_ct_CC=$CC
+ for ac_prog in cl.exe
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CC+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_CC"; then
+ ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CC="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CC=$ac_cv_prog_ac_ct_CC
+if test -n "$ac_ct_CC"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CC" >&5
+$as_echo "$ac_ct_CC" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_CC" && break
+done
+
+ if test "x$ac_ct_CC" = x; then
+ CC=""
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ CC=$ac_ct_CC
+ fi
+fi
+
+fi
+
+
+test -z "$CC" && { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "no acceptable C compiler found in \$PATH
+See \`config.log' for more details" "$LINENO" 5; }
+
+# Provide some information about the compiler.
+$as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler version" >&5
+set X $ac_compile
+ac_compiler=$2
+for ac_option in --version -v -V -qversion; do
+ { { ac_try="$ac_compiler $ac_option >&5"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compiler $ac_option >&5") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ sed '10a\
+... rest of stderr output deleted ...
+ 10q' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ fi
+ rm -f conftest.er1 conftest.err
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+done
+
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files a.out a.out.dSYM a.exe b.out"
+# Try to create an executable without -o first, disregard a.out.
+# It will help us diagnose broken compilers, and finding out an intuition
+# of exeext.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler works" >&5
+$as_echo_n "checking whether the C compiler works... " >&6; }
+ac_link_default=`$as_echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'`
+
+# The possible output files:
+ac_files="a.out conftest.exe conftest a.exe a_out.exe b.out conftest.*"
+
+ac_rmfiles=
+for ac_file in $ac_files
+do
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;;
+ * ) ac_rmfiles="$ac_rmfiles $ac_file";;
+ esac
+done
+rm -f $ac_rmfiles
+
+if { { ac_try="$ac_link_default"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link_default") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then :
+ # Autoconf-2.13 could set the ac_cv_exeext variable to `no'.
+# So ignore a value of `no', otherwise this would lead to `EXEEXT = no'
+# in a Makefile. We should not override ac_cv_exeext if it was cached,
+# so that the user can short-circuit this test for compilers unknown to
+# Autoconf.
+for ac_file in $ac_files ''
+do
+ test -f "$ac_file" || continue
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj )
+ ;;
+ [ab].out )
+ # We found the default executable, but exeext='' is most
+ # certainly right.
+ break;;
+ *.* )
+ if test "${ac_cv_exeext+set}" = set && test "$ac_cv_exeext" != no;
+ then :; else
+ ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+ fi
+ # We set ac_cv_exeext here because the later test for it is not
+ # safe: cross compilers may not add the suffix if given an `-o'
+ # argument, so we may need to know it at that point already.
+ # Even if this section looks crufty: it has the advantage of
+ # actually working.
+ break;;
+ * )
+ break;;
+ esac
+done
+test "$ac_cv_exeext" = no && ac_cv_exeext=
+
+else
+ ac_file=''
+fi
+if test -z "$ac_file"; then :
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+$as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error 77 "C compiler cannot create executables
+See \`config.log' for more details" "$LINENO" 5; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for C compiler default output file name" >&5
+$as_echo_n "checking for C compiler default output file name... " >&6; }
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_file" >&5
+$as_echo "$ac_file" >&6; }
+ac_exeext=$ac_cv_exeext
+
+rm -f -r a.out a.out.dSYM a.exe conftest$ac_cv_exeext b.out
+ac_clean_files=$ac_clean_files_save
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of executables" >&5
+$as_echo_n "checking for suffix of executables... " >&6; }
+if { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then :
+ # If both `conftest.exe' and `conftest' are `present' (well, observable)
+# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will
+# work properly (i.e., refer to `conftest.exe'), while it won't with
+# `rm'.
+for ac_file in conftest.exe conftest conftest.*; do
+ test -f "$ac_file" || continue
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM | *.o | *.obj ) ;;
+ *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'`
+ break;;
+ * ) break;;
+ esac
+done
+else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot compute suffix of executables: cannot compile and link
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+rm -f conftest conftest$ac_cv_exeext
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_exeext" >&5
+$as_echo "$ac_cv_exeext" >&6; }
+
+rm -f conftest.$ac_ext
+EXEEXT=$ac_cv_exeext
+ac_exeext=$EXEEXT
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+int
+main ()
+{
+FILE *f = fopen ("conftest.out", "w");
+ return ferror (f) || fclose (f) != 0;
+
+ ;
+ return 0;
+}
+_ACEOF
+ac_clean_files="$ac_clean_files conftest.out"
+# Check that the compiler produces executables we can run. If not, either
+# the compiler is broken, or we cross compile.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are cross compiling" >&5
+$as_echo_n "checking whether we are cross compiling... " >&6; }
+if test "$cross_compiling" != yes; then
+ { { ac_try="$ac_link"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_link") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ if { ac_try='./conftest$ac_cv_exeext'
+ { { case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_try") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; }; then
+ cross_compiling=no
+ else
+ if test "$cross_compiling" = maybe; then
+ cross_compiling=yes
+ else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot run C compiled programs.
+If you meant to cross compile, use \`--host'.
+See \`config.log' for more details" "$LINENO" 5; }
+ fi
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $cross_compiling" >&5
+$as_echo "$cross_compiling" >&6; }
+
+rm -f conftest.$ac_ext conftest$ac_cv_exeext conftest.out
+ac_clean_files=$ac_clean_files_save
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for suffix of object files" >&5
+$as_echo_n "checking for suffix of object files... " >&6; }
+if ${ac_cv_objext+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+rm -f conftest.o conftest.obj
+if { { ac_try="$ac_compile"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compile") 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then :
+ for ac_file in conftest.o conftest.obj conftest.*; do
+ test -f "$ac_file" || continue;
+ case $ac_file in
+ *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.map | *.inf | *.dSYM ) ;;
+ *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'`
+ break;;
+ esac
+done
+else
+ $as_echo "$as_me: failed program was:" >&5
+sed 's/^/| /' conftest.$ac_ext >&5
+
+{ { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "cannot compute suffix of object files: cannot compile
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+rm -f conftest.$ac_cv_objext conftest.$ac_ext
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_objext" >&5
+$as_echo "$ac_cv_objext" >&6; }
+OBJEXT=$ac_cv_objext
+ac_objext=$OBJEXT
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are using the GNU C compiler" >&5
+$as_echo_n "checking whether we are using the GNU C compiler... " >&6; }
+if ${ac_cv_c_compiler_gnu+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+#ifndef __GNUC__
+ choke me
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_compiler_gnu=yes
+else
+ ac_compiler_gnu=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_c_compiler_gnu=$ac_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_c_compiler_gnu" >&5
+$as_echo "$ac_cv_c_compiler_gnu" >&6; }
+if test $ac_compiler_gnu = yes; then
+ GCC=yes
+else
+ GCC=
+fi
+ac_test_CFLAGS=${CFLAGS+set}
+ac_save_CFLAGS=$CFLAGS
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CC accepts -g" >&5
+$as_echo_n "checking whether $CC accepts -g... " >&6; }
+if ${ac_cv_prog_cc_g+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_save_c_werror_flag=$ac_c_werror_flag
+ ac_c_werror_flag=yes
+ ac_cv_prog_cc_g=no
+ CFLAGS="-g"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_prog_cc_g=yes
+else
+ CFLAGS=""
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+
+else
+ ac_c_werror_flag=$ac_save_c_werror_flag
+ CFLAGS="-g"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_prog_cc_g=yes
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ ac_c_werror_flag=$ac_save_c_werror_flag
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_g" >&5
+$as_echo "$ac_cv_prog_cc_g" >&6; }
+if test "$ac_test_CFLAGS" = set; then
+ CFLAGS=$ac_save_CFLAGS
+elif test $ac_cv_prog_cc_g = yes; then
+ if test "$GCC" = yes; then
+ CFLAGS="-g -O2"
+ else
+ CFLAGS="-g"
+ fi
+else
+ if test "$GCC" = yes; then
+ CFLAGS="-O2"
+ else
+ CFLAGS=
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $CC option to accept ISO C89" >&5
+$as_echo_n "checking for $CC option to accept ISO C89... " >&6; }
+if ${ac_cv_prog_cc_c89+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_cv_prog_cc_c89=no
+ac_save_CC=$CC
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+#include
+struct stat;
+/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */
+struct buf { int x; };
+FILE * (*rcsopen) (struct buf *, struct stat *, int);
+static char *e (p, i)
+ char **p;
+ int i;
+{
+ return p[i];
+}
+static char *f (char * (*g) (char **, int), char **p, ...)
+{
+ char *s;
+ va_list v;
+ va_start (v,p);
+ s = g (p, va_arg (v,int));
+ va_end (v);
+ return s;
+}
+
+/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has
+ function prototypes and stuff, but not '\xHH' hex character constants.
+ These don't provoke an error unfortunately, instead are silently treated
+ as 'x'. The following induces an error, until -std is added to get
+ proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an
+ array size at least. It's necessary to write '\x00'==0 to get something
+ that's true only with -std. */
+int osf4_cc_array ['\x00' == 0 ? 1 : -1];
+
+/* IBM C 6 for AIX is almost-ANSI by default, but it replaces macro parameters
+ inside strings and character constants. */
+#define FOO(x) 'x'
+int xlc6_cc_array[FOO(a) == 'x' ? 1 : -1];
+
+int test (int i, double x);
+struct s1 {int (*f) (int a);};
+struct s2 {int (*f) (double a);};
+int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int);
+int argc;
+char **argv;
+int
+main ()
+{
+return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1];
+ ;
+ return 0;
+}
+_ACEOF
+for ac_arg in '' -qlanglvl=extc89 -qlanglvl=ansi -std \
+ -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__"
+do
+ CC="$ac_save_CC $ac_arg"
+ if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_prog_cc_c89=$ac_arg
+fi
+rm -f core conftest.err conftest.$ac_objext
+ test "x$ac_cv_prog_cc_c89" != "xno" && break
+done
+rm -f conftest.$ac_ext
+CC=$ac_save_CC
+
+fi
+# AC_CACHE_VAL
+case "x$ac_cv_prog_cc_c89" in
+ x)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: none needed" >&5
+$as_echo "none needed" >&6; } ;;
+ xno)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: unsupported" >&5
+$as_echo "unsupported" >&6; } ;;
+ *)
+ CC="$CC $ac_cv_prog_cc_c89"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cc_c89" >&5
+$as_echo "$ac_cv_prog_cc_c89" >&6; } ;;
+esac
+if test "x$ac_cv_prog_cc_c89" != xno; then :
+
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+DEPDIR="${am__leading_dot}deps"
+
+ac_config_commands="$ac_config_commands depfiles"
+
+
+am_make=${MAKE-make}
+cat > confinc << 'END'
+am__doit:
+ @echo this is the am__doit target
+.PHONY: am__doit
+END
+# If we don't find an include directive, just comment out the code.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for style of include used by $am_make" >&5
+$as_echo_n "checking for style of include used by $am_make... " >&6; }
+am__include="#"
+am__quote=
+_am_result=none
+# First try GNU make style include.
+echo "include confinc" > confmf
+# Ignore all kinds of additional output from 'make'.
+case `$am_make -s -f confmf 2> /dev/null` in #(
+*the\ am__doit\ target*)
+ am__include=include
+ am__quote=
+ _am_result=GNU
+ ;;
+esac
+# Now try BSD make style include.
+if test "$am__include" = "#"; then
+ echo '.include "confinc"' > confmf
+ case `$am_make -s -f confmf 2> /dev/null` in #(
+ *the\ am__doit\ target*)
+ am__include=.include
+ am__quote="\""
+ _am_result=BSD
+ ;;
+ esac
+fi
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $_am_result" >&5
+$as_echo "$_am_result" >&6; }
+rm -f confinc confmf
+
+# Check whether --enable-dependency-tracking was given.
+if test "${enable_dependency_tracking+set}" = set; then :
+ enableval=$enable_dependency_tracking;
+fi
+
+if test "x$enable_dependency_tracking" != xno; then
+ am_depcomp="$ac_aux_dir/depcomp"
+ AMDEPBACKSLASH='\'
+ am__nodep='_no'
+fi
+ if test "x$enable_dependency_tracking" != xno; then
+ AMDEP_TRUE=
+ AMDEP_FALSE='#'
+else
+ AMDEP_TRUE='#'
+ AMDEP_FALSE=
+fi
+
+
+
+depcc="$CC" am_compiler_list=
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking dependency style of $depcc" >&5
+$as_echo_n "checking dependency style of $depcc... " >&6; }
+if ${am_cv_CC_dependencies_compiler_type+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named 'D' -- because '-MD' means "put the output
+ # in D".
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_CC_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+ fi
+ am__universal=false
+ case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac
+
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+ # Solaris 10 /bin/sh.
+ echo '/* dummy */' > sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ # We check with '-c' and '-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle '-M -o', and we need to detect this. Also, some Intel
+ # versions had trouble with output in subdirs.
+ am__obj=sub/conftest.${OBJEXT-o}
+ am__minus_obj="-o $am__obj"
+ case $depmode in
+ gcc)
+ # This depmode causes a compiler race in universal mode.
+ test "$am__universal" = false || continue
+ ;;
+ nosideeffect)
+ # After this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested.
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+ # This compiler won't grok '-c -o', but also, the minuso test has
+ # not run yet. These depmodes are late enough in the game, and
+ # so weak that their functioning should not be impacted.
+ am__obj=conftest.${OBJEXT-o}
+ am__minus_obj=
+ ;;
+ none) break ;;
+ esac
+ if depmode=$depmode \
+ source=sub/conftest.c object=$am__obj \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_CC_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_CC_dependencies_compiler_type=none
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_CC_dependencies_compiler_type" >&5
+$as_echo "$am_cv_CC_dependencies_compiler_type" >&6; }
+CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type
+
+ if
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then
+ am__fastdepCC_TRUE=
+ am__fastdepCC_FALSE='#'
+else
+ am__fastdepCC_TRUE='#'
+ am__fastdepCC_FALSE=
+fi
+
+
+ac_ext=cpp
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+if test -z "$CXX"; then
+ if test -n "$CCC"; then
+ CXX=$CCC
+ else
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in g++ c++ gpp aCC CC cxx cc++ cl.exe FCC KCC RCC xlC_r xlC
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$CXX"; then
+ ac_cv_prog_CXX="$CXX" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_CXX="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+CXX=$ac_cv_prog_CXX
+if test -n "$CXX"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $CXX" >&5
+$as_echo "$CXX" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$CXX" && break
+ done
+fi
+if test -z "$CXX"; then
+ ac_ct_CXX=$CXX
+ for ac_prog in g++ c++ gpp aCC CC cxx cc++ cl.exe FCC KCC RCC xlC_r xlC
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_CXX"; then
+ ac_cv_prog_ac_ct_CXX="$ac_ct_CXX" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_CXX="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_CXX=$ac_cv_prog_ac_ct_CXX
+if test -n "$ac_ct_CXX"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_CXX" >&5
+$as_echo "$ac_ct_CXX" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_CXX" && break
+done
+
+ if test "x$ac_ct_CXX" = x; then
+ CXX="g++"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ CXX=$ac_ct_CXX
+ fi
+fi
+
+ fi
+fi
+# Provide some information about the compiler.
+$as_echo "$as_me:${as_lineno-$LINENO}: checking for C++ compiler version" >&5
+set X $ac_compile
+ac_compiler=$2
+for ac_option in --version -v -V -qversion; do
+ { { ac_try="$ac_compiler $ac_option >&5"
+case "(($ac_try" in
+ *\"* | *\`* | *\\*) ac_try_echo=\$ac_try;;
+ *) ac_try_echo=$ac_try;;
+esac
+eval ac_try_echo="\"\$as_me:${as_lineno-$LINENO}: $ac_try_echo\""
+$as_echo "$ac_try_echo"; } >&5
+ (eval "$ac_compiler $ac_option >&5") 2>conftest.err
+ ac_status=$?
+ if test -s conftest.err; then
+ sed '10a\
+... rest of stderr output deleted ...
+ 10q' conftest.err >conftest.er1
+ cat conftest.er1 >&5
+ fi
+ rm -f conftest.er1 conftest.err
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+done
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether we are using the GNU C++ compiler" >&5
+$as_echo_n "checking whether we are using the GNU C++ compiler... " >&6; }
+if ${ac_cv_cxx_compiler_gnu+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+#ifndef __GNUC__
+ choke me
+#endif
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_compile "$LINENO"; then :
+ ac_compiler_gnu=yes
+else
+ ac_compiler_gnu=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ac_cv_cxx_compiler_gnu=$ac_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_cxx_compiler_gnu" >&5
+$as_echo "$ac_cv_cxx_compiler_gnu" >&6; }
+if test $ac_compiler_gnu = yes; then
+ GXX=yes
+else
+ GXX=
+fi
+ac_test_CXXFLAGS=${CXXFLAGS+set}
+ac_save_CXXFLAGS=$CXXFLAGS
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether $CXX accepts -g" >&5
+$as_echo_n "checking whether $CXX accepts -g... " >&6; }
+if ${ac_cv_prog_cxx_g+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_save_cxx_werror_flag=$ac_cxx_werror_flag
+ ac_cxx_werror_flag=yes
+ ac_cv_prog_cxx_g=no
+ CXXFLAGS="-g"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_compile "$LINENO"; then :
+ ac_cv_prog_cxx_g=yes
+else
+ CXXFLAGS=""
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_compile "$LINENO"; then :
+
+else
+ ac_cxx_werror_flag=$ac_save_cxx_werror_flag
+ CXXFLAGS="-g"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_compile "$LINENO"; then :
+ ac_cv_prog_cxx_g=yes
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+ ac_cxx_werror_flag=$ac_save_cxx_werror_flag
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_prog_cxx_g" >&5
+$as_echo "$ac_cv_prog_cxx_g" >&6; }
+if test "$ac_test_CXXFLAGS" = set; then
+ CXXFLAGS=$ac_save_CXXFLAGS
+elif test $ac_cv_prog_cxx_g = yes; then
+ if test "$GXX" = yes; then
+ CXXFLAGS="-g -O2"
+ else
+ CXXFLAGS="-g"
+ fi
+else
+ if test "$GXX" = yes; then
+ CXXFLAGS="-O2"
+ else
+ CXXFLAGS=
+ fi
+fi
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+depcc="$CXX" am_compiler_list=
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking dependency style of $depcc" >&5
+$as_echo_n "checking dependency style of $depcc... " >&6; }
+if ${am_cv_CXX_dependencies_compiler_type+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then
+ # We make a subdir and do the tests there. Otherwise we can end up
+ # making bogus files that we don't know about and never remove. For
+ # instance it was reported that on HP-UX the gcc test will end up
+ # making a dummy file named 'D' -- because '-MD' means "put the output
+ # in D".
+ rm -rf conftest.dir
+ mkdir conftest.dir
+ # Copy depcomp to subdir because otherwise we won't find it if we're
+ # using a relative directory.
+ cp "$am_depcomp" conftest.dir
+ cd conftest.dir
+ # We will build objects and dependencies in a subdirectory because
+ # it helps to detect inapplicable dependency modes. For instance
+ # both Tru64's cc and ICC support -MD to output dependencies as a
+ # side effect of compilation, but ICC will put the dependencies in
+ # the current directory while Tru64 will put them in the object
+ # directory.
+ mkdir sub
+
+ am_cv_CXX_dependencies_compiler_type=none
+ if test "$am_compiler_list" = ""; then
+ am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp`
+ fi
+ am__universal=false
+ case " $depcc " in #(
+ *\ -arch\ *\ -arch\ *) am__universal=true ;;
+ esac
+
+ for depmode in $am_compiler_list; do
+ # Setup a source with many dependencies, because some compilers
+ # like to wrap large dependency lists on column 80 (with \), and
+ # we should not choose a depcomp mode which is confused by this.
+ #
+ # We need to recreate these files for each test, as the compiler may
+ # overwrite some of them when testing with obscure command lines.
+ # This happens at least with the AIX C compiler.
+ : > sub/conftest.c
+ for i in 1 2 3 4 5 6; do
+ echo '#include "conftst'$i'.h"' >> sub/conftest.c
+ # Using ": > sub/conftst$i.h" creates only sub/conftst1.h with
+ # Solaris 10 /bin/sh.
+ echo '/* dummy */' > sub/conftst$i.h
+ done
+ echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf
+
+ # We check with '-c' and '-o' for the sake of the "dashmstdout"
+ # mode. It turns out that the SunPro C++ compiler does not properly
+ # handle '-M -o', and we need to detect this. Also, some Intel
+ # versions had trouble with output in subdirs.
+ am__obj=sub/conftest.${OBJEXT-o}
+ am__minus_obj="-o $am__obj"
+ case $depmode in
+ gcc)
+ # This depmode causes a compiler race in universal mode.
+ test "$am__universal" = false || continue
+ ;;
+ nosideeffect)
+ # After this tag, mechanisms are not by side-effect, so they'll
+ # only be used when explicitly requested.
+ if test "x$enable_dependency_tracking" = xyes; then
+ continue
+ else
+ break
+ fi
+ ;;
+ msvc7 | msvc7msys | msvisualcpp | msvcmsys)
+ # This compiler won't grok '-c -o', but also, the minuso test has
+ # not run yet. These depmodes are late enough in the game, and
+ # so weak that their functioning should not be impacted.
+ am__obj=conftest.${OBJEXT-o}
+ am__minus_obj=
+ ;;
+ none) break ;;
+ esac
+ if depmode=$depmode \
+ source=sub/conftest.c object=$am__obj \
+ depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \
+ $SHELL ./depcomp $depcc -c $am__minus_obj sub/conftest.c \
+ >/dev/null 2>conftest.err &&
+ grep sub/conftst1.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 &&
+ grep $am__obj sub/conftest.Po > /dev/null 2>&1 &&
+ ${MAKE-make} -s -f confmf > /dev/null 2>&1; then
+ # icc doesn't choke on unknown options, it will just issue warnings
+ # or remarks (even with -Werror). So we grep stderr for any message
+ # that says an option was ignored or not supported.
+ # When given -MP, icc 7.0 and 7.1 complain thusly:
+ # icc: Command line warning: ignoring option '-M'; no argument required
+ # The diagnosis changed in icc 8.0:
+ # icc: Command line remark: option '-MP' not supported
+ if (grep 'ignoring option' conftest.err ||
+ grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else
+ am_cv_CXX_dependencies_compiler_type=$depmode
+ break
+ fi
+ fi
+ done
+
+ cd ..
+ rm -rf conftest.dir
+else
+ am_cv_CXX_dependencies_compiler_type=none
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $am_cv_CXX_dependencies_compiler_type" >&5
+$as_echo "$am_cv_CXX_dependencies_compiler_type" >&6; }
+CXXDEPMODE=depmode=$am_cv_CXX_dependencies_compiler_type
+
+ if
+ test "x$enable_dependency_tracking" != xno \
+ && test "$am_cv_CXX_dependencies_compiler_type" = gcc3; then
+ am__fastdepCXX_TRUE=
+ am__fastdepCXX_FALSE='#'
+else
+ am__fastdepCXX_TRUE='#'
+ am__fastdepCXX_FALSE=
+fi
+
+
+
+# Checks for header files.
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to run the C preprocessor" >&5
+$as_echo_n "checking how to run the C preprocessor... " >&6; }
+# On Suns, sometimes $CPP names a directory.
+if test -n "$CPP" && test -d "$CPP"; then
+ CPP=
+fi
+if test -z "$CPP"; then
+ if ${ac_cv_prog_CPP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ # Double quotes because CPP needs to be expanded
+ for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp"
+ do
+ ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer to if __STDC__ is defined, since
+ # exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifdef __STDC__
+# include
+#else
+# include
+#endif
+ Syntax error
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+
+else
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether nonexistent headers
+ # can be detected and how.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+ # Broken: success on invalid input.
+continue
+else
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+ break
+fi
+
+ done
+ ac_cv_prog_CPP=$CPP
+
+fi
+ CPP=$ac_cv_prog_CPP
+else
+ ac_cv_prog_CPP=$CPP
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $CPP" >&5
+$as_echo "$CPP" >&6; }
+ac_preproc_ok=false
+for ac_c_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer to if __STDC__ is defined, since
+ # exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifdef __STDC__
+# include
+#else
+# include
+#endif
+ Syntax error
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+
+else
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether nonexistent headers
+ # can be detected and how.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+_ACEOF
+if ac_fn_c_try_cpp "$LINENO"; then :
+ # Broken: success on invalid input.
+continue
+else
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+
+else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "C preprocessor \"$CPP\" fails sanity check
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for grep that handles long lines and -e" >&5
+$as_echo_n "checking for grep that handles long lines and -e... " >&6; }
+if ${ac_cv_path_GREP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$GREP"; then
+ ac_path_GREP_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in grep ggrep; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_GREP="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_GREP" || continue
+# Check for GNU ac_path_GREP and select it if it is found.
+ # Check for GNU $ac_path_GREP
+case `"$ac_path_GREP" --version 2>&1` in
+*GNU*)
+ ac_cv_path_GREP="$ac_path_GREP" ac_path_GREP_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo 'GREP' >> "conftest.nl"
+ "$ac_path_GREP" -e 'GREP$' -e '-(cannot match)-' < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_GREP_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_GREP="$ac_path_GREP"
+ ac_path_GREP_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_GREP_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_GREP"; then
+ as_fn_error $? "no acceptable grep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+ fi
+else
+ ac_cv_path_GREP=$GREP
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_GREP" >&5
+$as_echo "$ac_cv_path_GREP" >&6; }
+ GREP="$ac_cv_path_GREP"
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for egrep" >&5
+$as_echo_n "checking for egrep... " >&6; }
+if ${ac_cv_path_EGREP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if echo a | $GREP -E '(a|b)' >/dev/null 2>&1
+ then ac_cv_path_EGREP="$GREP -E"
+ else
+ if test -z "$EGREP"; then
+ ac_path_EGREP_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in egrep; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_EGREP="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_EGREP" || continue
+# Check for GNU ac_path_EGREP and select it if it is found.
+ # Check for GNU $ac_path_EGREP
+case `"$ac_path_EGREP" --version 2>&1` in
+*GNU*)
+ ac_cv_path_EGREP="$ac_path_EGREP" ac_path_EGREP_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo 'EGREP' >> "conftest.nl"
+ "$ac_path_EGREP" 'EGREP$' < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_EGREP_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_EGREP="$ac_path_EGREP"
+ ac_path_EGREP_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_EGREP_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_EGREP"; then
+ as_fn_error $? "no acceptable egrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+ fi
+else
+ ac_cv_path_EGREP=$EGREP
+fi
+
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_EGREP" >&5
+$as_echo "$ac_cv_path_EGREP" >&6; }
+ EGREP="$ac_cv_path_EGREP"
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for ANSI C header files" >&5
+$as_echo_n "checking for ANSI C header files... " >&6; }
+if ${ac_cv_header_stdc+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+#include
+#include
+#include
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ ac_cv_header_stdc=yes
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+if test $ac_cv_header_stdc = yes; then
+ # SunOS 4.x string.h does not declare mem*, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "memchr" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+
+_ACEOF
+if (eval "$ac_cpp conftest.$ac_ext") 2>&5 |
+ $EGREP "free" >/dev/null 2>&1; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f conftest*
+
+fi
+
+if test $ac_cv_header_stdc = yes; then
+ # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi.
+ if test "$cross_compiling" = yes; then :
+ :
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+#include
+#if ((' ' & 0x0FF) == 0x020)
+# define ISLOWER(c) ('a' <= (c) && (c) <= 'z')
+# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c))
+#else
+# define ISLOWER(c) \
+ (('a' <= (c) && (c) <= 'i') \
+ || ('j' <= (c) && (c) <= 'r') \
+ || ('s' <= (c) && (c) <= 'z'))
+# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c))
+#endif
+
+#define XOR(e, f) (((e) && !(f)) || (!(e) && (f)))
+int
+main ()
+{
+ int i;
+ for (i = 0; i < 256; i++)
+ if (XOR (islower (i), ISLOWER (i))
+ || toupper (i) != TOUPPER (i))
+ return 2;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_run "$LINENO"; then :
+
+else
+ ac_cv_header_stdc=no
+fi
+rm -f core *.core core.conftest.* gmon.out bb.out conftest$ac_exeext \
+ conftest.$ac_objext conftest.beam conftest.$ac_ext
+fi
+
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_header_stdc" >&5
+$as_echo "$ac_cv_header_stdc" >&6; }
+if test $ac_cv_header_stdc = yes; then
+
+$as_echo "#define STDC_HEADERS 1" >>confdefs.h
+
+fi
+
+# On IRIX 5.3, sys/types and inttypes.h are conflicting.
+for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \
+ inttypes.h stdint.h unistd.h
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_compile "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default
+"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+for ac_header in \
+ linux/fb.h \
+ sys/io.h \
+ sys/kd.h \
+ sys/stat.h \
+ sys/time.h \
+ fcntl.h \
+ langinfo.h \
+ term.h \
+ termios.h \
+ unistd.h \
+ cmath \
+ csignal \
+ cstdlib \
+ list \
+ map \
+ queue \
+ vector
+do :
+ as_ac_Header=`$as_echo "ac_cv_header_$ac_header" | $as_tr_sh`
+ac_fn_c_check_header_mongrel "$LINENO" "$ac_header" "$as_ac_Header" "$ac_includes_default"
+if eval test \"x\$"$as_ac_Header"\" = x"yes"; then :
+ cat >>confdefs.h <<_ACEOF
+#define `$as_echo "HAVE_$ac_header" | $as_tr_cpp` 1
+_ACEOF
+
+fi
+
+done
+
+
+# Checks for 'tgetent'
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for library containing tgetent" >&5
+$as_echo_n "checking for library containing tgetent... " >&6; }
+if ${ac_cv_search_tgetent+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_func_search_save_LIBS=$LIBS
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char tgetent ();
+int
+main ()
+{
+return tgetent ();
+ ;
+ return 0;
+}
+_ACEOF
+for ac_lib in '' termcap tinfo curses ncurses; do
+ if test -z "$ac_lib"; then
+ ac_res="none required"
+ else
+ ac_res=-l$ac_lib
+ LIBS="-l$ac_lib $ac_func_search_save_LIBS"
+ fi
+ if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_search_tgetent=$ac_res
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext
+ if ${ac_cv_search_tgetent+:} false; then :
+ break
+fi
+done
+if ${ac_cv_search_tgetent+:} false; then :
+
+else
+ ac_cv_search_tgetent=no
+fi
+rm conftest.$ac_ext
+LIBS=$ac_func_search_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_search_tgetent" >&5
+$as_echo "$ac_cv_search_tgetent" >&6; }
+ac_res=$ac_cv_search_tgetent
+if test "$ac_res" != no; then :
+ test "$ac_res" = "none required" || LIBS="$ac_res $LIBS"
+
+fi
+
+
+# Checks for libtool
+# Check whether --enable-shared was given.
+if test "${enable_shared+set}" = set; then :
+ enableval=$enable_shared; p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_shared=yes ;;
+ no) enable_shared=no ;;
+ *)
+ enable_shared=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_shared=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ enable_shared=yes
+fi
+
+
+
+
+
+
+
+
+
+# Check whether --enable-static was given.
+if test "${enable_static+set}" = set; then :
+ enableval=$enable_static; p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_static=yes ;;
+ no) enable_static=no ;;
+ *)
+ enable_static=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_static=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ enable_static=no
+fi
+
+
+
+
+
+
+
+
+
+case `pwd` in
+ *\ * | *\ *)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&5
+$as_echo "$as_me: WARNING: Libtool does not cope well with whitespace in \`pwd\`" >&2;} ;;
+esac
+
+
+
+macro_version='2.4.2'
+macro_revision='1.3337'
+
+
+
+
+
+
+
+
+
+
+
+
+
+ltmain="$ac_aux_dir/ltmain.sh"
+
+# Make sure we can run config.sub.
+$SHELL "$ac_aux_dir/config.sub" sun4 >/dev/null 2>&1 ||
+ as_fn_error $? "cannot run $SHELL $ac_aux_dir/config.sub" "$LINENO" 5
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking build system type" >&5
+$as_echo_n "checking build system type... " >&6; }
+if ${ac_cv_build+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_build_alias=$build_alias
+test "x$ac_build_alias" = x &&
+ ac_build_alias=`$SHELL "$ac_aux_dir/config.guess"`
+test "x$ac_build_alias" = x &&
+ as_fn_error $? "cannot guess build type; you must specify one" "$LINENO" 5
+ac_cv_build=`$SHELL "$ac_aux_dir/config.sub" $ac_build_alias` ||
+ as_fn_error $? "$SHELL $ac_aux_dir/config.sub $ac_build_alias failed" "$LINENO" 5
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_build" >&5
+$as_echo "$ac_cv_build" >&6; }
+case $ac_cv_build in
+*-*-*) ;;
+*) as_fn_error $? "invalid value of canonical build" "$LINENO" 5;;
+esac
+build=$ac_cv_build
+ac_save_IFS=$IFS; IFS='-'
+set x $ac_cv_build
+shift
+build_cpu=$1
+build_vendor=$2
+shift; shift
+# Remember, the first character of IFS is used to create $*,
+# except with old shells:
+build_os=$*
+IFS=$ac_save_IFS
+case $build_os in *\ *) build_os=`echo "$build_os" | sed 's/ /-/g'`;; esac
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking host system type" >&5
+$as_echo_n "checking host system type... " >&6; }
+if ${ac_cv_host+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "x$host_alias" = x; then
+ ac_cv_host=$ac_cv_build
+else
+ ac_cv_host=`$SHELL "$ac_aux_dir/config.sub" $host_alias` ||
+ as_fn_error $? "$SHELL $ac_aux_dir/config.sub $host_alias failed" "$LINENO" 5
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_host" >&5
+$as_echo "$ac_cv_host" >&6; }
+case $ac_cv_host in
+*-*-*) ;;
+*) as_fn_error $? "invalid value of canonical host" "$LINENO" 5;;
+esac
+host=$ac_cv_host
+ac_save_IFS=$IFS; IFS='-'
+set x $ac_cv_host
+shift
+host_cpu=$1
+host_vendor=$2
+shift; shift
+# Remember, the first character of IFS is used to create $*,
+# except with old shells:
+host_os=$*
+IFS=$ac_save_IFS
+case $host_os in *\ *) host_os=`echo "$host_os" | sed 's/ /-/g'`;; esac
+
+
+# Backslashify metacharacters that are still active within
+# double-quoted strings.
+sed_quote_subst='s/\(["`$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to delay expansion of an escaped single quote.
+delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+
+ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to print strings" >&5
+$as_echo_n "checking how to print strings... " >&6; }
+# Test print first, because it will be a builtin if present.
+if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \
+ test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then
+ ECHO='print -r --'
+elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then
+ ECHO='printf %s\n'
+else
+ # Use this function as a fallback that always works.
+ func_fallback_echo ()
+ {
+ eval 'cat <<_LTECHO_EOF
+$1
+_LTECHO_EOF'
+ }
+ ECHO='func_fallback_echo'
+fi
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+ $ECHO ""
+}
+
+case "$ECHO" in
+ printf*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: printf" >&5
+$as_echo "printf" >&6; } ;;
+ print*) { $as_echo "$as_me:${as_lineno-$LINENO}: result: print -r" >&5
+$as_echo "print -r" >&6; } ;;
+ *) { $as_echo "$as_me:${as_lineno-$LINENO}: result: cat" >&5
+$as_echo "cat" >&6; } ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for a sed that does not truncate output" >&5
+$as_echo_n "checking for a sed that does not truncate output... " >&6; }
+if ${ac_cv_path_SED+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_script=s/aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa/bbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbbb/
+ for ac_i in 1 2 3 4 5 6 7; do
+ ac_script="$ac_script$as_nl$ac_script"
+ done
+ echo "$ac_script" 2>/dev/null | sed 99q >conftest.sed
+ { ac_script=; unset ac_script;}
+ if test -z "$SED"; then
+ ac_path_SED_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in sed gsed; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_SED="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_SED" || continue
+# Check for GNU ac_path_SED and select it if it is found.
+ # Check for GNU $ac_path_SED
+case `"$ac_path_SED" --version 2>&1` in
+*GNU*)
+ ac_cv_path_SED="$ac_path_SED" ac_path_SED_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo '' >> "conftest.nl"
+ "$ac_path_SED" -f conftest.sed < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_SED_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_SED="$ac_path_SED"
+ ac_path_SED_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_SED_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_SED"; then
+ as_fn_error $? "no acceptable sed could be found in \$PATH" "$LINENO" 5
+ fi
+else
+ ac_cv_path_SED=$SED
+fi
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_SED" >&5
+$as_echo "$ac_cv_path_SED" >&6; }
+ SED="$ac_cv_path_SED"
+ rm -f conftest.sed
+
+test -z "$SED" && SED=sed
+Xsed="$SED -e 1s/^X//"
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for fgrep" >&5
+$as_echo_n "checking for fgrep... " >&6; }
+if ${ac_cv_path_FGREP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if echo 'ab*c' | $GREP -F 'ab*c' >/dev/null 2>&1
+ then ac_cv_path_FGREP="$GREP -F"
+ else
+ if test -z "$FGREP"; then
+ ac_path_FGREP_found=false
+ # Loop through the user's path and test for each of PROGNAME-LIST
+ as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH$PATH_SEPARATOR/usr/xpg4/bin
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_prog in fgrep; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ ac_path_FGREP="$as_dir/$ac_prog$ac_exec_ext"
+ as_fn_executable_p "$ac_path_FGREP" || continue
+# Check for GNU ac_path_FGREP and select it if it is found.
+ # Check for GNU $ac_path_FGREP
+case `"$ac_path_FGREP" --version 2>&1` in
+*GNU*)
+ ac_cv_path_FGREP="$ac_path_FGREP" ac_path_FGREP_found=:;;
+*)
+ ac_count=0
+ $as_echo_n 0123456789 >"conftest.in"
+ while :
+ do
+ cat "conftest.in" "conftest.in" >"conftest.tmp"
+ mv "conftest.tmp" "conftest.in"
+ cp "conftest.in" "conftest.nl"
+ $as_echo 'FGREP' >> "conftest.nl"
+ "$ac_path_FGREP" FGREP < "conftest.nl" >"conftest.out" 2>/dev/null || break
+ diff "conftest.out" "conftest.nl" >/dev/null 2>&1 || break
+ as_fn_arith $ac_count + 1 && ac_count=$as_val
+ if test $ac_count -gt ${ac_path_FGREP_max-0}; then
+ # Best one so far, save it but keep looking for a better one
+ ac_cv_path_FGREP="$ac_path_FGREP"
+ ac_path_FGREP_max=$ac_count
+ fi
+ # 10*(2^10) chars as input seems more than enough
+ test $ac_count -gt 10 && break
+ done
+ rm -f conftest.in conftest.tmp conftest.nl conftest.out;;
+esac
+
+ $ac_path_FGREP_found && break 3
+ done
+ done
+ done
+IFS=$as_save_IFS
+ if test -z "$ac_cv_path_FGREP"; then
+ as_fn_error $? "no acceptable fgrep could be found in $PATH$PATH_SEPARATOR/usr/xpg4/bin" "$LINENO" 5
+ fi
+else
+ ac_cv_path_FGREP=$FGREP
+fi
+
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_path_FGREP" >&5
+$as_echo "$ac_cv_path_FGREP" >&6; }
+ FGREP="$ac_cv_path_FGREP"
+
+
+test -z "$GREP" && GREP=grep
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# Check whether --with-gnu-ld was given.
+if test "${with_gnu_ld+set}" = set; then :
+ withval=$with_gnu_ld; test "$withval" = no || with_gnu_ld=yes
+else
+ with_gnu_ld=no
+fi
+
+ac_prog=ld
+if test "$GCC" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ld used by $CC" >&5
+$as_echo_n "checking for ld used by $CC... " >&6; }
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [\\/]* | ?:[\\/]*)
+ re_direlt='/[^/][^/]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'`
+ while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for GNU ld" >&5
+$as_echo_n "checking for GNU ld... " >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for non-GNU ld" >&5
+$as_echo_n "checking for non-GNU ld... " >&6; }
+fi
+if ${lt_cv_path_LD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$LD"; then
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 &5
+$as_echo "$LD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+test -z "$LD" && as_fn_error $? "no acceptable ld found in \$PATH" "$LINENO" 5
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if the linker ($LD) is GNU ld" >&5
+$as_echo_n "checking if the linker ($LD) is GNU ld... " >&6; }
+if ${lt_cv_prog_gnu_ld+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ # I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 &5
+$as_echo "$lt_cv_prog_gnu_ld" >&6; }
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for BSD- or MS-compatible name lister (nm)" >&5
+$as_echo_n "checking for BSD- or MS-compatible name lister (nm)... " >&6; }
+if ${lt_cv_path_NM+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$NM"; then
+ # Let the user override the test.
+ lt_cv_path_NM="$NM"
+else
+ lt_nm_to_check="${ac_tool_prefix}nm"
+ if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+ lt_nm_to_check="$lt_nm_to_check nm"
+ fi
+ for lt_tmp_nm in $lt_nm_to_check; do
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ tmp_nm="$ac_dir/$lt_tmp_nm"
+ if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ # Tru64's nm complains that /dev/null is an invalid object file
+ case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in
+ */dev/null* | *'Invalid file or object type'*)
+ lt_cv_path_NM="$tmp_nm -B"
+ break
+ ;;
+ *)
+ case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+ */dev/null*)
+ lt_cv_path_NM="$tmp_nm -p"
+ break
+ ;;
+ *)
+ lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+ continue # so that we can try to find one that supports BSD flags
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+ done
+ : ${lt_cv_path_NM=no}
+fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_NM" >&5
+$as_echo "$lt_cv_path_NM" >&6; }
+if test "$lt_cv_path_NM" != "no"; then
+ NM="$lt_cv_path_NM"
+else
+ # Didn't find any BSD compatible name lister, look for dumpbin.
+ if test -n "$DUMPBIN"; then :
+ # Let the user override the test.
+ else
+ if test -n "$ac_tool_prefix"; then
+ for ac_prog in dumpbin "link -dump"
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DUMPBIN+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DUMPBIN"; then
+ ac_cv_prog_DUMPBIN="$DUMPBIN" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DUMPBIN="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DUMPBIN=$ac_cv_prog_DUMPBIN
+if test -n "$DUMPBIN"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DUMPBIN" >&5
+$as_echo "$DUMPBIN" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$DUMPBIN" && break
+ done
+fi
+if test -z "$DUMPBIN"; then
+ ac_ct_DUMPBIN=$DUMPBIN
+ for ac_prog in dumpbin "link -dump"
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DUMPBIN+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DUMPBIN"; then
+ ac_cv_prog_ac_ct_DUMPBIN="$ac_ct_DUMPBIN" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DUMPBIN="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DUMPBIN=$ac_cv_prog_ac_ct_DUMPBIN
+if test -n "$ac_ct_DUMPBIN"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DUMPBIN" >&5
+$as_echo "$ac_ct_DUMPBIN" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_DUMPBIN" && break
+done
+
+ if test "x$ac_ct_DUMPBIN" = x; then
+ DUMPBIN=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DUMPBIN=$ac_ct_DUMPBIN
+ fi
+fi
+
+ case `$DUMPBIN -symbols /dev/null 2>&1 | sed '1q'` in
+ *COFF*)
+ DUMPBIN="$DUMPBIN -symbols"
+ ;;
+ *)
+ DUMPBIN=:
+ ;;
+ esac
+ fi
+
+ if test "$DUMPBIN" != ":"; then
+ NM="$DUMPBIN"
+ fi
+fi
+test -z "$NM" && NM=nm
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the name lister ($NM) interface" >&5
+$as_echo_n "checking the name lister ($NM) interface... " >&6; }
+if ${lt_cv_nm_interface+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_nm_interface="BSD nm"
+ echo "int some_variable = 0;" > conftest.$ac_ext
+ (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&5)
+ (eval "$ac_compile" 2>conftest.err)
+ cat conftest.err >&5
+ (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&5)
+ (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out)
+ cat conftest.err >&5
+ (eval echo "\"\$as_me:$LINENO: output\"" >&5)
+ cat conftest.out >&5
+ if $GREP 'External.*some_variable' conftest.out > /dev/null; then
+ lt_cv_nm_interface="MS dumpbin"
+ fi
+ rm -f conftest*
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_nm_interface" >&5
+$as_echo "$lt_cv_nm_interface" >&6; }
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether ln -s works" >&5
+$as_echo_n "checking whether ln -s works... " >&6; }
+LN_S=$as_ln_s
+if test "$LN_S" = "ln -s"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no, using $LN_S" >&5
+$as_echo "no, using $LN_S" >&6; }
+fi
+
+# find the maximum length of command line arguments
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking the maximum length of command line arguments" >&5
+$as_echo_n "checking the maximum length of command line arguments... " >&6; }
+if ${lt_cv_sys_max_cmd_len+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ i=0
+ teststring="ABCD"
+
+ case $build_os in
+ msdosdjgpp*)
+ # On DJGPP, this test can blow up pretty badly due to problems in libc
+ # (any single argument exceeding 2000 bytes causes a buffer overrun
+ # during glob expansion). Even if it were fixed, the result of this
+ # check would be larger than it should be.
+ lt_cv_sys_max_cmd_len=12288; # 12K is about right
+ ;;
+
+ gnu*)
+ # Under GNU Hurd, this test is not required because there is
+ # no limit to the length of command line arguments.
+ # Libtool will interpret -1 as no limit whatsoever
+ lt_cv_sys_max_cmd_len=-1;
+ ;;
+
+ cygwin* | mingw* | cegcc*)
+ # On Win9x/ME, this test blows up -- it succeeds, but takes
+ # about 5 minutes as the teststring grows exponentially.
+ # Worse, since 9x/ME are not pre-emptively multitasking,
+ # you end up with a "frozen" computer, even though with patience
+ # the test eventually succeeds (with a max line length of 256k).
+ # Instead, let's just punt: use the minimum linelength reported by
+ # all of the supported platforms: 8192 (on NT/2K/XP).
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ mint*)
+ # On MiNT this can take a long time and run out of memory.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ amigaos*)
+ # On AmigaOS with pdksh, this test takes hours, literally.
+ # So we just punt and use a minimum line length of 8192.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ netbsd* | freebsd* | openbsd* | darwin* | dragonfly*)
+ # This has been around since 386BSD, at least. Likely further.
+ if test -x /sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+ elif test -x /usr/sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+ else
+ lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs
+ fi
+ # And add a safety zone
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ ;;
+
+ interix*)
+ # We know the value 262144 and hardcode it with a safety zone (like BSD)
+ lt_cv_sys_max_cmd_len=196608
+ ;;
+
+ os2*)
+ # The test takes a long time on OS/2.
+ lt_cv_sys_max_cmd_len=8192
+ ;;
+
+ osf*)
+ # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+ # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+ # nice to cause kernel panics so lets avoid the loop below.
+ # First set a reasonable default.
+ lt_cv_sys_max_cmd_len=16384
+ #
+ if test -x /sbin/sysconfig; then
+ case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+ *1*) lt_cv_sys_max_cmd_len=-1 ;;
+ esac
+ fi
+ ;;
+ sco3.2v5*)
+ lt_cv_sys_max_cmd_len=102400
+ ;;
+ sysv5* | sco5v6* | sysv4.2uw2*)
+ kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+ if test -n "$kargmax"; then
+ lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[ ]//'`
+ else
+ lt_cv_sys_max_cmd_len=32768
+ fi
+ ;;
+ *)
+ lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null`
+ if test -n "$lt_cv_sys_max_cmd_len"; then
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ else
+ # Make teststring a little bigger before we do anything with it.
+ # a 1K string should be a reasonable start.
+ for i in 1 2 3 4 5 6 7 8 ; do
+ teststring=$teststring$teststring
+ done
+ SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+ # If test is not a shell built-in, we'll probably end up computing a
+ # maximum length that is only half of the actual maximum length, but
+ # we can't tell.
+ while { test "X"`env echo "$teststring$teststring" 2>/dev/null` \
+ = "X$teststring$teststring"; } >/dev/null 2>&1 &&
+ test $i != 17 # 1/2 MB should be enough
+ do
+ i=`expr $i + 1`
+ teststring=$teststring$teststring
+ done
+ # Only check the string length outside the loop.
+ lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1`
+ teststring=
+ # Add a significant safety factor because C++ compilers can tack on
+ # massive amounts of additional arguments before passing them to the
+ # linker. It appears as though 1/2 is a usable value.
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+ fi
+ ;;
+ esac
+
+fi
+
+if test -n $lt_cv_sys_max_cmd_len ; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sys_max_cmd_len" >&5
+$as_echo "$lt_cv_sys_max_cmd_len" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: none" >&5
+$as_echo "none" >&6; }
+fi
+max_cmd_len=$lt_cv_sys_max_cmd_len
+
+
+
+
+
+
+: ${CP="cp -f"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the shell understands some XSI constructs" >&5
+$as_echo_n "checking whether the shell understands some XSI constructs... " >&6; }
+# Try some XSI features
+xsi_shell=no
+( _lt_dummy="a/b/c"
+ test "${_lt_dummy##*/},${_lt_dummy%/*},${_lt_dummy#??}"${_lt_dummy%"$_lt_dummy"}, \
+ = c,a/b,b/c, \
+ && eval 'test $(( 1 + 1 )) -eq 2 \
+ && test "${#_lt_dummy}" -eq 5' ) >/dev/null 2>&1 \
+ && xsi_shell=yes
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $xsi_shell" >&5
+$as_echo "$xsi_shell" >&6; }
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the shell understands \"+=\"" >&5
+$as_echo_n "checking whether the shell understands \"+=\"... " >&6; }
+lt_shell_append=no
+( foo=bar; set foo baz; eval "$1+=\$2" && test "$foo" = barbaz ) \
+ >/dev/null 2>&1 \
+ && lt_shell_append=yes
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_shell_append" >&5
+$as_echo "$lt_shell_append" >&6; }
+
+
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+ lt_unset=unset
+else
+ lt_unset=false
+fi
+
+
+
+
+
+# test EBCDIC or ASCII
+case `echo X|tr X '\101'` in
+ A) # ASCII based system
+ # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr
+ lt_SP2NL='tr \040 \012'
+ lt_NL2SP='tr \015\012 \040\040'
+ ;;
+ *) # EBCDIC based system
+ lt_SP2NL='tr \100 \n'
+ lt_NL2SP='tr \r\n \100\100'
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to $host format" >&5
+$as_echo_n "checking how to convert $build file names to $host format... " >&6; }
+if ${lt_cv_to_host_file_cmd+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $host in
+ *-*-mingw* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32
+ ;;
+ *-*-cygwin* )
+ lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32
+ ;;
+ * ) # otherwise, assume *nix
+ lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32
+ ;;
+ esac
+ ;;
+ *-*-cygwin* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin
+ ;;
+ *-*-cygwin* )
+ lt_cv_to_host_file_cmd=func_convert_file_noop
+ ;;
+ * ) # otherwise, assume *nix
+ lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin
+ ;;
+ esac
+ ;;
+ * ) # unhandled hosts (and "normal" native builds)
+ lt_cv_to_host_file_cmd=func_convert_file_noop
+ ;;
+esac
+
+fi
+
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_host_file_cmd" >&5
+$as_echo "$lt_cv_to_host_file_cmd" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to convert $build file names to toolchain format" >&5
+$as_echo_n "checking how to convert $build file names to toolchain format... " >&6; }
+if ${lt_cv_to_tool_file_cmd+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ #assume ordinary cross tools, or native build.
+lt_cv_to_tool_file_cmd=func_convert_file_noop
+case $host in
+ *-*-mingw* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32
+ ;;
+ esac
+ ;;
+esac
+
+fi
+
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_to_tool_file_cmd" >&5
+$as_echo "$lt_cv_to_tool_file_cmd" >&6; }
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $LD option to reload object files" >&5
+$as_echo_n "checking for $LD option to reload object files... " >&6; }
+if ${lt_cv_ld_reload_flag+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ld_reload_flag='-r'
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_reload_flag" >&5
+$as_echo "$lt_cv_ld_reload_flag" >&6; }
+reload_flag=$lt_cv_ld_reload_flag
+case $reload_flag in
+"" | " "*) ;;
+*) reload_flag=" $reload_flag" ;;
+esac
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ if test "$GCC" != yes; then
+ reload_cmds=false
+ fi
+ ;;
+ darwin*)
+ if test "$GCC" = yes; then
+ reload_cmds='$LTCC $LTCFLAGS -nostdlib ${wl}-r -o $output$reload_objs'
+ else
+ reload_cmds='$LD$reload_flag -o $output$reload_objs'
+ fi
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}objdump", so it can be a program name with args.
+set dummy ${ac_tool_prefix}objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OBJDUMP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OBJDUMP"; then
+ ac_cv_prog_OBJDUMP="$OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OBJDUMP="${ac_tool_prefix}objdump"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OBJDUMP=$ac_cv_prog_OBJDUMP
+if test -n "$OBJDUMP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OBJDUMP" >&5
+$as_echo "$OBJDUMP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OBJDUMP"; then
+ ac_ct_OBJDUMP=$OBJDUMP
+ # Extract the first word of "objdump", so it can be a program name with args.
+set dummy objdump; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OBJDUMP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OBJDUMP"; then
+ ac_cv_prog_ac_ct_OBJDUMP="$ac_ct_OBJDUMP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OBJDUMP="objdump"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OBJDUMP=$ac_cv_prog_ac_ct_OBJDUMP
+if test -n "$ac_ct_OBJDUMP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OBJDUMP" >&5
+$as_echo "$ac_ct_OBJDUMP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OBJDUMP" = x; then
+ OBJDUMP="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OBJDUMP=$ac_ct_OBJDUMP
+ fi
+else
+ OBJDUMP="$ac_cv_prog_OBJDUMP"
+fi
+
+test -z "$OBJDUMP" && OBJDUMP=objdump
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to recognize dependent libraries" >&5
+$as_echo_n "checking how to recognize dependent libraries... " >&6; }
+if ${lt_cv_deplibs_check_method+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_file_magic_cmd='$MAGIC_CMD'
+lt_cv_file_magic_test_file=
+lt_cv_deplibs_check_method='unknown'
+# Need to set the preceding variable on all platforms that support
+# interlibrary dependencies.
+# 'none' -- dependencies not supported.
+# `unknown' -- same as none, but documents that we really don't know.
+# 'pass_all' -- all dependencies passed with no checks.
+# 'test_compile' -- check by making test program.
+# 'file_magic [[regex]]' -- check by looking for files in library path
+# which responds to the $file_magic_cmd with a given extended regex.
+# If you have `file' or equivalent on your system and you're not sure
+# whether `pass_all' will *always* work, you probably want this one.
+
+case $host_os in
+aix[4-9]*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+beos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+bsdi[45]*)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)'
+ lt_cv_file_magic_cmd='/usr/bin/file -L'
+ lt_cv_file_magic_test_file=/shlib/libc.so
+ ;;
+
+cygwin*)
+ # func_win32_libid is a shell function defined in ltmain.sh
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ ;;
+
+mingw* | pw32*)
+ # Base MSYS/MinGW do not provide the 'file' command needed by
+ # func_win32_libid shell function, so use a weaker test based on 'objdump',
+ # unless we find 'file', for example because we are cross-compiling.
+ # func_win32_libid assumes BSD nm, so disallow it if using MS dumpbin.
+ if ( test "$lt_cv_nm_interface" = "BSD nm" && file / ) >/dev/null 2>&1; then
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ else
+ # Keep this pattern in sync with the one in func_win32_libid.
+ lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ fi
+ ;;
+
+cegcc*)
+ # use the weaker test based on 'objdump'. See mingw*.
+ lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ ;;
+
+darwin* | rhapsody*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+freebsd* | dragonfly*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+ case $host_cpu in
+ i*86 )
+ # Not sure whether the presence of OpenBSD here was a mistake.
+ # Let's accept both of them until this is cleared up.
+ lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[3-9]86 (compact )?demand paged shared library'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+ ;;
+ esac
+ else
+ lt_cv_deplibs_check_method=pass_all
+ fi
+ ;;
+
+gnu*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+haiku*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+hpux10.20* | hpux11*)
+ lt_cv_file_magic_cmd=/usr/bin/file
+ case $host_cpu in
+ ia64*)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64'
+ lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+ ;;
+ hppa*64*)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]'
+ lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+ ;;
+ *)
+ lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9]\.[0-9]) shared library'
+ lt_cv_file_magic_test_file=/usr/lib/libc.sl
+ ;;
+ esac
+ ;;
+
+interix[3-9]*)
+ # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|\.a)$'
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $LD in
+ *-32|*"-32 ") libmagic=32-bit;;
+ *-n32|*"-n32 ") libmagic=N32;;
+ *-64|*"-64 ") libmagic=64-bit;;
+ *) libmagic=never-match;;
+ esac
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so|_pic\.a)$'
+ fi
+ ;;
+
+newos6*)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=/usr/lib/libnls.so
+ ;;
+
+*nto* | *qnx*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+openbsd*)
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|\.so|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[^/]+(\.so\.[0-9]+\.[0-9]+|_pic\.a)$'
+ fi
+ ;;
+
+osf3* | osf4* | osf5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+rdos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+solaris*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv4 | sysv4.3*)
+ case $host_vendor in
+ motorola)
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]'
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+ ;;
+ ncr)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ sequent)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [LM]SB (shared object|dynamic lib )'
+ ;;
+ sni)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method="file_magic ELF [0-9][0-9]*-bit [LM]SB dynamic lib"
+ lt_cv_file_magic_test_file=/lib/libc.so
+ ;;
+ siemens)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ pc)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ esac
+ ;;
+
+tpf*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+esac
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_deplibs_check_method" >&5
+$as_echo "$lt_cv_deplibs_check_method" >&6; }
+
+file_magic_glob=
+want_nocaseglob=no
+if test "$build" = "$host"; then
+ case $host_os in
+ mingw* | pw32*)
+ if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then
+ want_nocaseglob=yes
+ else
+ file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[\1]\/[\1]\/g;/g"`
+ fi
+ ;;
+ esac
+fi
+
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}dlltool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DLLTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DLLTOOL"; then
+ ac_cv_prog_DLLTOOL="$DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DLLTOOL="${ac_tool_prefix}dlltool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DLLTOOL=$ac_cv_prog_DLLTOOL
+if test -n "$DLLTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DLLTOOL" >&5
+$as_echo "$DLLTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DLLTOOL"; then
+ ac_ct_DLLTOOL=$DLLTOOL
+ # Extract the first word of "dlltool", so it can be a program name with args.
+set dummy dlltool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DLLTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DLLTOOL"; then
+ ac_cv_prog_ac_ct_DLLTOOL="$ac_ct_DLLTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DLLTOOL="dlltool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DLLTOOL=$ac_cv_prog_ac_ct_DLLTOOL
+if test -n "$ac_ct_DLLTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DLLTOOL" >&5
+$as_echo "$ac_ct_DLLTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_DLLTOOL" = x; then
+ DLLTOOL="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DLLTOOL=$ac_ct_DLLTOOL
+ fi
+else
+ DLLTOOL="$ac_cv_prog_DLLTOOL"
+fi
+
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to associate runtime and link libraries" >&5
+$as_echo_n "checking how to associate runtime and link libraries... " >&6; }
+if ${lt_cv_sharedlib_from_linklib_cmd+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_sharedlib_from_linklib_cmd='unknown'
+
+case $host_os in
+cygwin* | mingw* | pw32* | cegcc*)
+ # two different shell functions defined in ltmain.sh
+ # decide which to use based on capabilities of $DLLTOOL
+ case `$DLLTOOL --help 2>&1` in
+ *--identify-strict*)
+ lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib
+ ;;
+ *)
+ lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback
+ ;;
+ esac
+ ;;
+*)
+ # fallback: assume linklib IS sharedlib
+ lt_cv_sharedlib_from_linklib_cmd="$ECHO"
+ ;;
+esac
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_sharedlib_from_linklib_cmd" >&5
+$as_echo "$lt_cv_sharedlib_from_linklib_cmd" >&6; }
+sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd
+test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ for ac_prog in ar
+ do
+ # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args.
+set dummy $ac_tool_prefix$ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_AR+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$AR"; then
+ ac_cv_prog_AR="$AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_AR="$ac_tool_prefix$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+AR=$ac_cv_prog_AR
+if test -n "$AR"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $AR" >&5
+$as_echo "$AR" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$AR" && break
+ done
+fi
+if test -z "$AR"; then
+ ac_ct_AR=$AR
+ for ac_prog in ar
+do
+ # Extract the first word of "$ac_prog", so it can be a program name with args.
+set dummy $ac_prog; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_AR+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_AR"; then
+ ac_cv_prog_ac_ct_AR="$ac_ct_AR" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_AR="$ac_prog"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_AR=$ac_cv_prog_ac_ct_AR
+if test -n "$ac_ct_AR"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_AR" >&5
+$as_echo "$ac_ct_AR" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ test -n "$ac_ct_AR" && break
+done
+
+ if test "x$ac_ct_AR" = x; then
+ AR="false"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ AR=$ac_ct_AR
+ fi
+fi
+
+: ${AR=ar}
+: ${AR_FLAGS=cru}
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for archiver @FILE support" >&5
+$as_echo_n "checking for archiver @FILE support... " >&6; }
+if ${lt_cv_ar_at_file+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ar_at_file=no
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_compile "$LINENO"; then :
+ echo conftest.$ac_objext > conftest.lst
+ lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&5'
+ { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5
+ (eval $lt_ar_try) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ if test "$ac_status" -eq 0; then
+ # Ensure the archiver fails upon bogus file names.
+ rm -f conftest.$ac_objext libconftest.a
+ { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$lt_ar_try\""; } >&5
+ (eval $lt_ar_try) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ if test "$ac_status" -ne 0; then
+ lt_cv_ar_at_file=@
+ fi
+ fi
+ rm -f conftest.* libconftest.a
+
+fi
+rm -f core conftest.err conftest.$ac_objext conftest.$ac_ext
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ar_at_file" >&5
+$as_echo "$lt_cv_ar_at_file" >&6; }
+
+if test "x$lt_cv_ar_at_file" = xno; then
+ archiver_list_spec=
+else
+ archiver_list_spec=$lt_cv_ar_at_file
+fi
+
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args.
+set dummy ${ac_tool_prefix}strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$STRIP"; then
+ ac_cv_prog_STRIP="$STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_STRIP="${ac_tool_prefix}strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+STRIP=$ac_cv_prog_STRIP
+if test -n "$STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $STRIP" >&5
+$as_echo "$STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_STRIP"; then
+ ac_ct_STRIP=$STRIP
+ # Extract the first word of "strip", so it can be a program name with args.
+set dummy strip; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_STRIP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_STRIP"; then
+ ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_STRIP="strip"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP
+if test -n "$ac_ct_STRIP"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_STRIP" >&5
+$as_echo "$ac_ct_STRIP" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_STRIP" = x; then
+ STRIP=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ STRIP=$ac_ct_STRIP
+ fi
+else
+ STRIP="$ac_cv_prog_STRIP"
+fi
+
+test -z "$STRIP" && STRIP=:
+
+
+
+
+
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args.
+set dummy ${ac_tool_prefix}ranlib; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_RANLIB+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$RANLIB"; then
+ ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+RANLIB=$ac_cv_prog_RANLIB
+if test -n "$RANLIB"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $RANLIB" >&5
+$as_echo "$RANLIB" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_RANLIB"; then
+ ac_ct_RANLIB=$RANLIB
+ # Extract the first word of "ranlib", so it can be a program name with args.
+set dummy ranlib; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_RANLIB+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_RANLIB"; then
+ ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_RANLIB="ranlib"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB
+if test -n "$ac_ct_RANLIB"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_RANLIB" >&5
+$as_echo "$ac_ct_RANLIB" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_RANLIB" = x; then
+ RANLIB=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ RANLIB=$ac_ct_RANLIB
+ fi
+else
+ RANLIB="$ac_cv_prog_RANLIB"
+fi
+
+test -z "$RANLIB" && RANLIB=:
+
+
+
+
+
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+ case $host_os in
+ openbsd*)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib"
+ ;;
+ *)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib"
+ ;;
+ esac
+ old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib"
+fi
+
+case $host_os in
+ darwin*)
+ lock_old_archive_extraction=yes ;;
+ *)
+ lock_old_archive_extraction=no ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking command to parse $NM output from $compiler object" >&5
+$as_echo_n "checking command to parse $NM output from $compiler object... " >&6; }
+if ${lt_cv_sys_global_symbol_pipe+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix. What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[BCDEGRST]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([_A-Za-z][_A-Za-z0-9]*\)'
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+ symcode='[BCDT]'
+ ;;
+cygwin* | mingw* | pw32* | cegcc*)
+ symcode='[ABCDGISTW]'
+ ;;
+hpux*)
+ if test "$host_cpu" = ia64; then
+ symcode='[ABCDEGRST]'
+ fi
+ ;;
+irix* | nonstopux*)
+ symcode='[BCDEGRST]'
+ ;;
+osf*)
+ symcode='[BCDEGQRST]'
+ ;;
+solaris*)
+ symcode='[BDRT]'
+ ;;
+sco3.2v5*)
+ symcode='[DT]'
+ ;;
+sysv4.2uw2*)
+ symcode='[DT]'
+ ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+ symcode='[ABDT]'
+ ;;
+sysv4)
+ symcode='[DFNSTU]'
+ ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+ symcode='[ABCDGIRSTW]' ;;
+esac
+
+# Transform an extracted symbol line into a proper C declaration.
+# Some systems (esp. on ia64) link data and code symbols differently,
+# so use this general approach.
+lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([^ ]*\)[ ]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"\2\", (void *) \&\2},/p'"
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n -e 's/^: \([^ ]*\)[ ]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([^ ]*\) \(lib[^ ]*\)$/ {\"\2\", (void *) \&\2},/p' -e 's/^$symcode* \([^ ]*\) \([^ ]*\)$/ {\"lib\2\", (void *) \&\2},/p'"
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+ opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+ ;;
+esac
+
+# Try without a prefix underscore, then with it.
+for ac_symprfx in "" "_"; do
+
+ # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+ symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+ # Write the raw and C identifiers.
+ if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ # Fake it for dumpbin and say T for any non-static function
+ # and D for any global variable.
+ # Also find C++ and __fastcall symbols from MSVC++,
+ # which start with @ or ?.
+ lt_cv_sys_global_symbol_pipe="$AWK '"\
+" {last_section=section; section=\$ 3};"\
+" /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\
+" /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\
+" \$ 0!~/External *\|/{next};"\
+" / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\
+" {if(hide[section]) next};"\
+" {f=0}; \$ 0~/\(\).*\|/{f=1}; {printf f ? \"T \" : \"D \"};"\
+" {split(\$ 0, a, /\||\r/); split(a[2], s)};"\
+" s[1]~/^[@?]/{print s[1], s[1]; next};"\
+" s[1]~prfx {split(s[1],t,\"@\"); print t[1], substr(t[1],length(prfx))}"\
+" ' prfx=^$ac_symprfx"
+ else
+ lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[ ]\($symcode$symcode*\)[ ][ ]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+ fi
+ lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'"
+
+ # Check to see that the pipe works correctly.
+ pipe_works=no
+
+ rm -f conftest*
+ cat > conftest.$ac_ext <<_LT_EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(void);
+void nm_test_func(void){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+_LT_EOF
+
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ # Now try to grab the symbols.
+ nlist=conftest.nm
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist\""; } >&5
+ (eval $NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s "$nlist"; then
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ else
+ rm -f "$nlist"T
+ fi
+
+ # Make sure that we snagged all the symbols we need.
+ if $GREP ' nm_test_var$' "$nlist" >/dev/null; then
+ if $GREP ' nm_test_func$' "$nlist" >/dev/null; then
+ cat <<_LT_EOF > conftest.$ac_ext
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */
+#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE)
+/* DATA imports from DLLs on WIN32 con't be const, because runtime
+ relocations are performed -- see ld's documentation on pseudo-relocs. */
+# define LT_DLSYM_CONST
+#elif defined(__osf__)
+/* This system does not cope well with relocations in const data. */
+# define LT_DLSYM_CONST
+#else
+# define LT_DLSYM_CONST const
+#endif
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+_LT_EOF
+ # Now generate the symbol file.
+ eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext'
+
+ cat <<_LT_EOF >> conftest.$ac_ext
+
+/* The mapping between symbol names and symbols. */
+LT_DLSYM_CONST struct {
+ const char *name;
+ void *address;
+}
+lt__PROGRAM__LTX_preloaded_symbols[] =
+{
+ { "@PROGRAM@", (void *) 0 },
+_LT_EOF
+ $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (void *) \&\2},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext
+ cat <<\_LT_EOF >> conftest.$ac_ext
+ {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+ return lt__PROGRAM__LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+_LT_EOF
+ # Now try linking the two files.
+ mv conftest.$ac_objext conftstm.$ac_objext
+ lt_globsym_save_LIBS=$LIBS
+ lt_globsym_save_CFLAGS=$CFLAGS
+ LIBS="conftstm.$ac_objext"
+ CFLAGS="$CFLAGS$lt_prog_compiler_no_builtin_flag"
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s conftest${ac_exeext}; then
+ pipe_works=yes
+ fi
+ LIBS=$lt_globsym_save_LIBS
+ CFLAGS=$lt_globsym_save_CFLAGS
+ else
+ echo "cannot find nm_test_func in $nlist" >&5
+ fi
+ else
+ echo "cannot find nm_test_var in $nlist" >&5
+ fi
+ else
+ echo "cannot run $lt_cv_sys_global_symbol_pipe" >&5
+ fi
+ else
+ echo "$progname: failed program was:" >&5
+ cat conftest.$ac_ext >&5
+ fi
+ rm -rf conftest* conftst*
+
+ # Do not use the global_symbol_pipe unless it works.
+ if test "$pipe_works" = yes; then
+ break
+ else
+ lt_cv_sys_global_symbol_pipe=
+ fi
+done
+
+fi
+
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+ lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: failed" >&5
+$as_echo "failed" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: ok" >&5
+$as_echo "ok" >&6; }
+fi
+
+# Response file support.
+if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ nm_file_list_spec='@'
+elif $NM --help 2>/dev/null | grep '[@]FILE' >/dev/null; then
+ nm_file_list_spec='@'
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for sysroot" >&5
+$as_echo_n "checking for sysroot... " >&6; }
+
+# Check whether --with-sysroot was given.
+if test "${with_sysroot+set}" = set; then :
+ withval=$with_sysroot;
+else
+ with_sysroot=no
+fi
+
+
+lt_sysroot=
+case ${with_sysroot} in #(
+ yes)
+ if test "$GCC" = yes; then
+ lt_sysroot=`$CC --print-sysroot 2>/dev/null`
+ fi
+ ;; #(
+ /*)
+ lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"`
+ ;; #(
+ no|'')
+ ;; #(
+ *)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: ${with_sysroot}" >&5
+$as_echo "${with_sysroot}" >&6; }
+ as_fn_error $? "The sysroot must be an absolute path." "$LINENO" 5
+ ;;
+esac
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: ${lt_sysroot:-no}" >&5
+$as_echo "${lt_sysroot:-no}" >&6; }
+
+
+
+
+
+# Check whether --enable-libtool-lock was given.
+if test "${enable_libtool_lock+set}" = set; then :
+ enableval=$enable_libtool_lock;
+fi
+
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *ELF-32*)
+ HPUX_IA64_MODE="32"
+ ;;
+ *ELF-64*)
+ HPUX_IA64_MODE="64"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+*-*-irix6*)
+ # Find out which ABI we are using.
+ echo '#line '$LINENO' "configure"' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -melf32bsmip"
+ ;;
+ *N32*)
+ LD="${LD-ld} -melf32bmipn32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -melf64bmip"
+ ;;
+ esac
+ else
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -32"
+ ;;
+ *N32*)
+ LD="${LD-ld} -n32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -64"
+ ;;
+ esac
+ fi
+ fi
+ rm -rf conftest*
+ ;;
+
+x86_64-*kfreebsd*-gnu|x86_64-*linux*|powerpc*-*linux*| \
+s390*-*linux*|s390*-*tpf*|sparc*-*linux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ case `/usr/bin/file conftest.o` in
+ *32-bit*)
+ case $host in
+ x86_64-*kfreebsd*-gnu)
+ LD="${LD-ld} -m elf_i386_fbsd"
+ ;;
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_i386"
+ ;;
+ powerpc64le-*linux*)
+ LD="${LD-ld} -m elf32lppclinux"
+ ;;
+ powerpc64-*linux*)
+ LD="${LD-ld} -m elf32ppclinux"
+ ;;
+ s390x-*linux*)
+ LD="${LD-ld} -m elf_s390"
+ ;;
+ sparc64-*linux*)
+ LD="${LD-ld} -m elf32_sparc"
+ ;;
+ esac
+ ;;
+ *64-bit*)
+ case $host in
+ x86_64-*kfreebsd*-gnu)
+ LD="${LD-ld} -m elf_x86_64_fbsd"
+ ;;
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ powerpcle-*linux*)
+ LD="${LD-ld} -m elf64lppc"
+ ;;
+ powerpc-*linux*)
+ LD="${LD-ld} -m elf64ppc"
+ ;;
+ s390*-*linux*|s390*-*tpf*)
+ LD="${LD-ld} -m elf64_s390"
+ ;;
+ sparc*-*linux*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+*-*-sco3.2v5*)
+ # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -belf"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the C compiler needs -belf" >&5
+$as_echo_n "checking whether the C compiler needs -belf... " >&6; }
+if ${lt_cv_cc_needs_belf+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ lt_cv_cc_needs_belf=yes
+else
+ lt_cv_cc_needs_belf=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_cc_needs_belf" >&5
+$as_echo "$lt_cv_cc_needs_belf" >&6; }
+ if test x"$lt_cv_cc_needs_belf" != x"yes"; then
+ # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+ CFLAGS="$SAVE_CFLAGS"
+ fi
+ ;;
+*-*solaris*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ case `/usr/bin/file conftest.o` in
+ *64-bit*)
+ case $lt_cv_prog_gnu_ld in
+ yes*)
+ case $host in
+ i?86-*-solaris*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ sparc*-*-solaris*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ # GNU ld 2.21 introduced _sol2 emulations. Use them if available.
+ if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then
+ LD="${LD-ld}_sol2"
+ fi
+ ;;
+ *)
+ if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then
+ LD="${LD-ld} -64"
+ fi
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+esac
+
+need_locks="$enable_libtool_lock"
+
+if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}mt", so it can be a program name with args.
+set dummy ${ac_tool_prefix}mt; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_MANIFEST_TOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$MANIFEST_TOOL"; then
+ ac_cv_prog_MANIFEST_TOOL="$MANIFEST_TOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_MANIFEST_TOOL="${ac_tool_prefix}mt"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+MANIFEST_TOOL=$ac_cv_prog_MANIFEST_TOOL
+if test -n "$MANIFEST_TOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MANIFEST_TOOL" >&5
+$as_echo "$MANIFEST_TOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_MANIFEST_TOOL"; then
+ ac_ct_MANIFEST_TOOL=$MANIFEST_TOOL
+ # Extract the first word of "mt", so it can be a program name with args.
+set dummy mt; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_MANIFEST_TOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_MANIFEST_TOOL"; then
+ ac_cv_prog_ac_ct_MANIFEST_TOOL="$ac_ct_MANIFEST_TOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_MANIFEST_TOOL="mt"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_MANIFEST_TOOL=$ac_cv_prog_ac_ct_MANIFEST_TOOL
+if test -n "$ac_ct_MANIFEST_TOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_MANIFEST_TOOL" >&5
+$as_echo "$ac_ct_MANIFEST_TOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_MANIFEST_TOOL" = x; then
+ MANIFEST_TOOL=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ MANIFEST_TOOL=$ac_ct_MANIFEST_TOOL
+ fi
+else
+ MANIFEST_TOOL="$ac_cv_prog_MANIFEST_TOOL"
+fi
+
+test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $MANIFEST_TOOL is a manifest tool" >&5
+$as_echo_n "checking if $MANIFEST_TOOL is a manifest tool... " >&6; }
+if ${lt_cv_path_mainfest_tool+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_path_mainfest_tool=no
+ echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&5
+ $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out
+ cat conftest.err >&5
+ if $GREP 'Manifest Tool' conftest.out > /dev/null; then
+ lt_cv_path_mainfest_tool=yes
+ fi
+ rm -f conftest*
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_path_mainfest_tool" >&5
+$as_echo "$lt_cv_path_mainfest_tool" >&6; }
+if test "x$lt_cv_path_mainfest_tool" != xyes; then
+ MANIFEST_TOOL=:
+fi
+
+
+
+
+
+
+ case $host_os in
+ rhapsody* | darwin*)
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}dsymutil", so it can be a program name with args.
+set dummy ${ac_tool_prefix}dsymutil; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_DSYMUTIL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$DSYMUTIL"; then
+ ac_cv_prog_DSYMUTIL="$DSYMUTIL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_DSYMUTIL="${ac_tool_prefix}dsymutil"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+DSYMUTIL=$ac_cv_prog_DSYMUTIL
+if test -n "$DSYMUTIL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $DSYMUTIL" >&5
+$as_echo "$DSYMUTIL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_DSYMUTIL"; then
+ ac_ct_DSYMUTIL=$DSYMUTIL
+ # Extract the first word of "dsymutil", so it can be a program name with args.
+set dummy dsymutil; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_DSYMUTIL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_DSYMUTIL"; then
+ ac_cv_prog_ac_ct_DSYMUTIL="$ac_ct_DSYMUTIL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_DSYMUTIL="dsymutil"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_DSYMUTIL=$ac_cv_prog_ac_ct_DSYMUTIL
+if test -n "$ac_ct_DSYMUTIL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_DSYMUTIL" >&5
+$as_echo "$ac_ct_DSYMUTIL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_DSYMUTIL" = x; then
+ DSYMUTIL=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ DSYMUTIL=$ac_ct_DSYMUTIL
+ fi
+else
+ DSYMUTIL="$ac_cv_prog_DSYMUTIL"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}nmedit", so it can be a program name with args.
+set dummy ${ac_tool_prefix}nmedit; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_NMEDIT+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$NMEDIT"; then
+ ac_cv_prog_NMEDIT="$NMEDIT" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_NMEDIT="${ac_tool_prefix}nmedit"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+NMEDIT=$ac_cv_prog_NMEDIT
+if test -n "$NMEDIT"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $NMEDIT" >&5
+$as_echo "$NMEDIT" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_NMEDIT"; then
+ ac_ct_NMEDIT=$NMEDIT
+ # Extract the first word of "nmedit", so it can be a program name with args.
+set dummy nmedit; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_NMEDIT+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_NMEDIT"; then
+ ac_cv_prog_ac_ct_NMEDIT="$ac_ct_NMEDIT" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_NMEDIT="nmedit"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_NMEDIT=$ac_cv_prog_ac_ct_NMEDIT
+if test -n "$ac_ct_NMEDIT"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_NMEDIT" >&5
+$as_echo "$ac_ct_NMEDIT" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_NMEDIT" = x; then
+ NMEDIT=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ NMEDIT=$ac_ct_NMEDIT
+ fi
+else
+ NMEDIT="$ac_cv_prog_NMEDIT"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}lipo", so it can be a program name with args.
+set dummy ${ac_tool_prefix}lipo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_LIPO+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$LIPO"; then
+ ac_cv_prog_LIPO="$LIPO" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_LIPO="${ac_tool_prefix}lipo"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+LIPO=$ac_cv_prog_LIPO
+if test -n "$LIPO"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $LIPO" >&5
+$as_echo "$LIPO" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_LIPO"; then
+ ac_ct_LIPO=$LIPO
+ # Extract the first word of "lipo", so it can be a program name with args.
+set dummy lipo; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_LIPO+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_LIPO"; then
+ ac_cv_prog_ac_ct_LIPO="$ac_ct_LIPO" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_LIPO="lipo"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_LIPO=$ac_cv_prog_ac_ct_LIPO
+if test -n "$ac_ct_LIPO"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_LIPO" >&5
+$as_echo "$ac_ct_LIPO" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_LIPO" = x; then
+ LIPO=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ LIPO=$ac_ct_LIPO
+ fi
+else
+ LIPO="$ac_cv_prog_LIPO"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}otool", so it can be a program name with args.
+set dummy ${ac_tool_prefix}otool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OTOOL"; then
+ ac_cv_prog_OTOOL="$OTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OTOOL="${ac_tool_prefix}otool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OTOOL=$ac_cv_prog_OTOOL
+if test -n "$OTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL" >&5
+$as_echo "$OTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OTOOL"; then
+ ac_ct_OTOOL=$OTOOL
+ # Extract the first word of "otool", so it can be a program name with args.
+set dummy otool; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OTOOL+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OTOOL"; then
+ ac_cv_prog_ac_ct_OTOOL="$ac_ct_OTOOL" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OTOOL="otool"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OTOOL=$ac_cv_prog_ac_ct_OTOOL
+if test -n "$ac_ct_OTOOL"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL" >&5
+$as_echo "$ac_ct_OTOOL" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OTOOL" = x; then
+ OTOOL=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OTOOL=$ac_ct_OTOOL
+ fi
+else
+ OTOOL="$ac_cv_prog_OTOOL"
+fi
+
+ if test -n "$ac_tool_prefix"; then
+ # Extract the first word of "${ac_tool_prefix}otool64", so it can be a program name with args.
+set dummy ${ac_tool_prefix}otool64; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_OTOOL64+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$OTOOL64"; then
+ ac_cv_prog_OTOOL64="$OTOOL64" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_OTOOL64="${ac_tool_prefix}otool64"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+OTOOL64=$ac_cv_prog_OTOOL64
+if test -n "$OTOOL64"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $OTOOL64" >&5
+$as_echo "$OTOOL64" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+fi
+if test -z "$ac_cv_prog_OTOOL64"; then
+ ac_ct_OTOOL64=$OTOOL64
+ # Extract the first word of "otool64", so it can be a program name with args.
+set dummy otool64; ac_word=$2
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $ac_word" >&5
+$as_echo_n "checking for $ac_word... " >&6; }
+if ${ac_cv_prog_ac_ct_OTOOL64+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -n "$ac_ct_OTOOL64"; then
+ ac_cv_prog_ac_ct_OTOOL64="$ac_ct_OTOOL64" # Let the user override the test.
+else
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if as_fn_executable_p "$as_dir/$ac_word$ac_exec_ext"; then
+ ac_cv_prog_ac_ct_OTOOL64="otool64"
+ $as_echo "$as_me:${as_lineno-$LINENO}: found $as_dir/$ac_word$ac_exec_ext" >&5
+ break 2
+ fi
+done
+ done
+IFS=$as_save_IFS
+
+fi
+fi
+ac_ct_OTOOL64=$ac_cv_prog_ac_ct_OTOOL64
+if test -n "$ac_ct_OTOOL64"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_ct_OTOOL64" >&5
+$as_echo "$ac_ct_OTOOL64" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+ if test "x$ac_ct_OTOOL64" = x; then
+ OTOOL64=":"
+ else
+ case $cross_compiling:$ac_tool_warned in
+yes:)
+{ $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: using cross tools not prefixed with host triplet" >&5
+$as_echo "$as_me: WARNING: using cross tools not prefixed with host triplet" >&2;}
+ac_tool_warned=yes ;;
+esac
+ OTOOL64=$ac_ct_OTOOL64
+ fi
+else
+ OTOOL64="$ac_cv_prog_OTOOL64"
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -single_module linker flag" >&5
+$as_echo_n "checking for -single_module linker flag... " >&6; }
+if ${lt_cv_apple_cc_single_mod+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_apple_cc_single_mod=no
+ if test -z "${LT_MULTI_MODULE}"; then
+ # By default we will add the -single_module flag. You can override
+ # by either setting the environment variable LT_MULTI_MODULE
+ # non-empty at configure time, or by adding -multi_module to the
+ # link flags.
+ rm -rf libconftest.dylib*
+ echo "int foo(void){return 1;}" > conftest.c
+ echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+-dynamiclib -Wl,-single_module conftest.c" >&5
+ $LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+ -dynamiclib -Wl,-single_module conftest.c 2>conftest.err
+ _lt_result=$?
+ # If there is a non-empty error log, and "single_module"
+ # appears in it, assume the flag caused a linker warning
+ if test -s conftest.err && $GREP single_module conftest.err; then
+ cat conftest.err >&5
+ # Otherwise, if the output was created with a 0 exit code from
+ # the compiler, it worked.
+ elif test -f libconftest.dylib && test $_lt_result -eq 0; then
+ lt_cv_apple_cc_single_mod=yes
+ else
+ cat conftest.err >&5
+ fi
+ rm -rf libconftest.dylib*
+ rm -f conftest.*
+ fi
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_apple_cc_single_mod" >&5
+$as_echo "$lt_cv_apple_cc_single_mod" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -exported_symbols_list linker flag" >&5
+$as_echo_n "checking for -exported_symbols_list linker flag... " >&6; }
+if ${lt_cv_ld_exported_symbols_list+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ld_exported_symbols_list=no
+ save_LDFLAGS=$LDFLAGS
+ echo "_main" > conftest.sym
+ LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ lt_cv_ld_exported_symbols_list=yes
+else
+ lt_cv_ld_exported_symbols_list=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_exported_symbols_list" >&5
+$as_echo "$lt_cv_ld_exported_symbols_list" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for -force_load linker flag" >&5
+$as_echo_n "checking for -force_load linker flag... " >&6; }
+if ${lt_cv_ld_force_load+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_ld_force_load=no
+ cat > conftest.c << _LT_EOF
+int forced_loaded() { return 2;}
+_LT_EOF
+ echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&5
+ $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&5
+ echo "$AR cru libconftest.a conftest.o" >&5
+ $AR cru libconftest.a conftest.o 2>&5
+ echo "$RANLIB libconftest.a" >&5
+ $RANLIB libconftest.a 2>&5
+ cat > conftest.c << _LT_EOF
+int main() { return 0;}
+_LT_EOF
+ echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&5
+ $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err
+ _lt_result=$?
+ if test -s conftest.err && $GREP force_load conftest.err; then
+ cat conftest.err >&5
+ elif test -f conftest && test $_lt_result -eq 0 && $GREP forced_load conftest >/dev/null 2>&1 ; then
+ lt_cv_ld_force_load=yes
+ else
+ cat conftest.err >&5
+ fi
+ rm -f conftest.err libconftest.a conftest conftest.c
+ rm -rf conftest.dSYM
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_ld_force_load" >&5
+$as_echo "$lt_cv_ld_force_load" >&6; }
+ case $host_os in
+ rhapsody* | darwin1.[012])
+ _lt_dar_allow_undefined='${wl}-undefined ${wl}suppress' ;;
+ darwin1.*)
+ _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+ darwin*) # darwin 5.x on
+ # if running on 10.5 or later, the deployment target defaults
+ # to the OS version, if on x86, and 10.4, the deployment
+ # target defaults to 10.4. Don't you love it?
+ case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in
+ 10.0,*86*-darwin8*|10.0,*-darwin[91]*)
+ _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+ 10.[012]*)
+ _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+ 10.*)
+ _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+ esac
+ ;;
+ esac
+ if test "$lt_cv_apple_cc_single_mod" = "yes"; then
+ _lt_dar_single_mod='$single_module'
+ fi
+ if test "$lt_cv_ld_exported_symbols_list" = "yes"; then
+ _lt_dar_export_syms=' ${wl}-exported_symbols_list,$output_objdir/${libname}-symbols.expsym'
+ else
+ _lt_dar_export_syms='~$NMEDIT -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ fi
+ if test "$DSYMUTIL" != ":" && test "$lt_cv_ld_force_load" = "no"; then
+ _lt_dsymutil='~$DSYMUTIL $lib || :'
+ else
+ _lt_dsymutil=
+ fi
+ ;;
+ esac
+
+for ac_header in dlfcn.h
+do :
+ ac_fn_c_check_header_compile "$LINENO" "dlfcn.h" "ac_cv_header_dlfcn_h" "$ac_includes_default
+"
+if test "x$ac_cv_header_dlfcn_h" = xyes; then :
+ cat >>confdefs.h <<_ACEOF
+#define HAVE_DLFCN_H 1
+_ACEOF
+
+fi
+
+done
+
+
+
+
+func_stripname_cnf ()
+{
+ case ${2} in
+ .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;;
+ *) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;;
+ esac
+} # func_stripname_cnf
+
+
+
+
+
+# Set options
+enable_dlopen=yes
+
+
+
+
+ enable_win32_dll=no
+
+
+
+
+
+# Check whether --with-pic was given.
+if test "${with_pic+set}" = set; then :
+ withval=$with_pic; lt_p=${PACKAGE-default}
+ case $withval in
+ yes|no) pic_mode=$withval ;;
+ *)
+ pic_mode=default
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for lt_pkg in $withval; do
+ IFS="$lt_save_ifs"
+ if test "X$lt_pkg" = "X$lt_p"; then
+ pic_mode=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ pic_mode=default
+fi
+
+
+test -z "$pic_mode" && pic_mode=default
+
+
+
+
+
+
+
+ # Check whether --enable-fast-install was given.
+if test "${enable_fast_install+set}" = set; then :
+ enableval=$enable_fast_install; p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_fast_install=yes ;;
+ no) enable_fast_install=no ;;
+ *)
+ enable_fast_install=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_fast_install=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac
+else
+ enable_fast_install=yes
+fi
+
+
+
+
+
+
+
+
+
+
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS="$ltmain"
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+test -z "$LN_S" && LN_S="ln -s"
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for objdir" >&5
+$as_echo_n "checking for objdir... " >&6; }
+if ${lt_cv_objdir+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+ lt_cv_objdir=.libs
+else
+ # MS-DOS does not allow filenames that begin with a dot.
+ lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_objdir" >&5
+$as_echo "$lt_cv_objdir" >&6; }
+objdir=$lt_cv_objdir
+
+
+
+
+
+cat >>confdefs.h <<_ACEOF
+#define LT_OBJDIR "$lt_cv_objdir/"
+_ACEOF
+
+
+
+
+case $host_os in
+aix3*)
+ # AIX sometimes has problems with the GCC collect2 program. For some
+ # reason, if we set the COLLECT_NAMES environment variable, the problems
+ # vanish in a puff of smoke.
+ if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+ fi
+ ;;
+esac
+
+# Global variables:
+ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+
+with_gnu_ld="$lt_cv_prog_gnu_ld"
+
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+
+# Set sane defaults for various variables
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$LD" && LD=ld
+test -z "$ac_objext" && ac_objext=o
+
+for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+
+
+# Only perform the check for file, if the check method requires it
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+case $deplibs_check_method in
+file_magic*)
+ if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ${ac_tool_prefix}file" >&5
+$as_echo_n "checking for ${ac_tool_prefix}file... " >&6; }
+if ${lt_cv_path_MAGIC_CMD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $MAGIC_CMD in
+[\\/*] | ?:[\\/]*)
+ lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD="$MAGIC_CMD"
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+ for ac_dir in $ac_dummy; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/${ac_tool_prefix}file; then
+ lt_cv_path_MAGIC_CMD="$ac_dir/${ac_tool_prefix}file"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+_LT_EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+ MAGIC_CMD="$lt_save_MAGIC_CMD"
+ ;;
+esac
+fi
+
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5
+$as_echo "$MAGIC_CMD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+
+
+
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+ if test -n "$ac_tool_prefix"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for file" >&5
+$as_echo_n "checking for file... " >&6; }
+if ${lt_cv_path_MAGIC_CMD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ case $MAGIC_CMD in
+[\\/*] | ?:[\\/]*)
+ lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD="$MAGIC_CMD"
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ ac_dummy="/usr/bin$PATH_SEPARATOR$PATH"
+ for ac_dir in $ac_dummy; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/file; then
+ lt_cv_path_MAGIC_CMD="$ac_dir/file"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+_LT_EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+ MAGIC_CMD="$lt_save_MAGIC_CMD"
+ ;;
+esac
+fi
+
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $MAGIC_CMD" >&5
+$as_echo "$MAGIC_CMD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+
+
+ else
+ MAGIC_CMD=:
+ fi
+fi
+
+ fi
+ ;;
+esac
+
+# Use C for the default configuration in the libtool script
+
+lt_save_CC="$CC"
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+objext=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}'
+
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+# Save the default compiler, since it gets overwritten when the other
+# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP.
+compiler_DEFAULT=$CC
+
+# save warnings/boilerplate of simple test code
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$RM conftest*
+
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$RM -r conftest*
+
+
+## CAVEAT EMPTOR:
+## There is no encapsulation within the following macros, do not change
+## the running order or otherwise move them around unless you know exactly
+## what you are doing...
+if test -n "$compiler"; then
+
+lt_prog_compiler_no_builtin_flag=
+
+if test "$GCC" = yes; then
+ case $cc_basename in
+ nvcc*)
+ lt_prog_compiler_no_builtin_flag=' -Xcompiler -fno-builtin' ;;
+ *)
+ lt_prog_compiler_no_builtin_flag=' -fno-builtin' ;;
+ esac
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -fno-rtti -fno-exceptions" >&5
+$as_echo_n "checking if $compiler supports -fno-rtti -fno-exceptions... " >&6; }
+if ${lt_cv_prog_compiler_rtti_exceptions+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_rtti_exceptions=no
+ ac_outfile=conftest.$ac_objext
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="-fno-rtti -fno-exceptions"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_rtti_exceptions=yes
+ fi
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_rtti_exceptions" >&5
+$as_echo "$lt_cv_prog_compiler_rtti_exceptions" >&6; }
+
+if test x"$lt_cv_prog_compiler_rtti_exceptions" = xyes; then
+ lt_prog_compiler_no_builtin_flag="$lt_prog_compiler_no_builtin_flag -fno-rtti -fno-exceptions"
+else
+ :
+fi
+
+fi
+
+
+
+
+
+
+ lt_prog_compiler_wl=
+lt_prog_compiler_pic=
+lt_prog_compiler_static=
+
+
+ if test "$GCC" = yes; then
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_static='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ m68k)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ lt_prog_compiler_pic='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ esac
+ ;;
+
+ beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | cygwin* | pw32* | os2* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ # Although the cygwin gcc ignores -fPIC, still need this for old-style
+ # (--disable-auto-import) libraries
+ lt_prog_compiler_pic='-DDLL_EXPORT'
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic='-fno-common'
+ ;;
+
+ haiku*)
+ # PIC is the default for Haiku.
+ # The "-static" flag exists, but is broken.
+ lt_prog_compiler_static=
+ ;;
+
+ hpux*)
+ # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+ # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag
+ # sets the default TLS model and affects inlining.
+ case $host_cpu in
+ hppa*64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ esac
+ ;;
+
+ interix[3-9]*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ lt_prog_compiler_can_build_shared=no
+ enable_shared=no
+ ;;
+
+ *nto* | *qnx*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ lt_prog_compiler_pic='-fPIC -shared'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic=-Kconform_pic
+ fi
+ ;;
+
+ *)
+ lt_prog_compiler_pic='-fPIC'
+ ;;
+ esac
+
+ case $cc_basename in
+ nvcc*) # Cuda Compiler Driver 2.2
+ lt_prog_compiler_wl='-Xlinker '
+ if test -n "$lt_prog_compiler_pic"; then
+ lt_prog_compiler_pic="-Xcompiler $lt_prog_compiler_pic"
+ fi
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ lt_prog_compiler_wl='-Wl,'
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static='-Bstatic'
+ else
+ lt_prog_compiler_static='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+
+ mingw* | cygwin* | pw32* | os2* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic='-DDLL_EXPORT'
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ lt_prog_compiler_wl='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ lt_prog_compiler_static='${wl}-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ lt_prog_compiler_wl='-Wl,'
+ # PIC (with -KPIC) is the default.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ case $cc_basename in
+ # old Intel for x86_64 which still supported -KPIC.
+ ecc*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ # icc used to be incompatible with GCC.
+ # ICC 10 doesn't accept -KPIC any more.
+ icc* | ifort*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ # Lahey Fortran 8.1.
+ lf95*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='--shared'
+ lt_prog_compiler_static='--static'
+ ;;
+ nagfor*)
+ # NAG Fortran compiler
+ lt_prog_compiler_wl='-Wl,-Wl,,'
+ lt_prog_compiler_pic='-PIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fpic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ ccc*)
+ lt_prog_compiler_wl='-Wl,'
+ # All Alpha code is PIC.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+ xl* | bgxl* | bgf* | mpixl*)
+ # IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-qpic'
+ lt_prog_compiler_static='-qstaticlink'
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [1-7].* | *Sun*Fortran*\ 8.[0-3]*)
+ # Sun Fortran 8.3 passes all unrecognized flags to the linker
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ lt_prog_compiler_wl=''
+ ;;
+ *Sun\ F* | *Sun*Fortran*)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ lt_prog_compiler_wl='-Qoption ld '
+ ;;
+ *Sun\ C*)
+ # Sun C 5.9
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ lt_prog_compiler_wl='-Wl,'
+ ;;
+ *Intel*\ [CF]*Compiler*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fPIC'
+ lt_prog_compiler_static='-static'
+ ;;
+ *Portland\ Group*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-fpic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+
+ newsos6)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ *nto* | *qnx*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ lt_prog_compiler_pic='-fPIC -shared'
+ ;;
+
+ osf3* | osf4* | osf5*)
+ lt_prog_compiler_wl='-Wl,'
+ # All OSF/1 code is PIC.
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ rdos*)
+ lt_prog_compiler_static='-non_shared'
+ ;;
+
+ solaris*)
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95* | sunf77* | sunf90* | sunf95*)
+ lt_prog_compiler_wl='-Qoption ld ';;
+ *)
+ lt_prog_compiler_wl='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ lt_prog_compiler_wl='-Qoption ld '
+ lt_prog_compiler_pic='-PIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec ;then
+ lt_prog_compiler_pic='-Kconform_pic'
+ lt_prog_compiler_static='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_pic='-KPIC'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ unicos*)
+ lt_prog_compiler_wl='-Wl,'
+ lt_prog_compiler_can_build_shared=no
+ ;;
+
+ uts4*)
+ lt_prog_compiler_pic='-pic'
+ lt_prog_compiler_static='-Bstatic'
+ ;;
+
+ *)
+ lt_prog_compiler_can_build_shared=no
+ ;;
+ esac
+ fi
+
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic=
+ ;;
+ *)
+ lt_prog_compiler_pic="$lt_prog_compiler_pic -DPIC"
+ ;;
+esac
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $compiler option to produce PIC" >&5
+$as_echo_n "checking for $compiler option to produce PIC... " >&6; }
+if ${lt_cv_prog_compiler_pic+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_pic=$lt_prog_compiler_pic
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic" >&5
+$as_echo "$lt_cv_prog_compiler_pic" >&6; }
+lt_prog_compiler_pic=$lt_cv_prog_compiler_pic
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler PIC flag $lt_prog_compiler_pic works" >&5
+$as_echo_n "checking if $compiler PIC flag $lt_prog_compiler_pic works... " >&6; }
+if ${lt_cv_prog_compiler_pic_works+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_pic_works=no
+ ac_outfile=conftest.$ac_objext
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic -DPIC"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_pic_works=yes
+ fi
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic_works" >&5
+$as_echo "$lt_cv_prog_compiler_pic_works" >&6; }
+
+if test x"$lt_cv_prog_compiler_pic_works" = xyes; then
+ case $lt_prog_compiler_pic in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic=" $lt_prog_compiler_pic" ;;
+ esac
+else
+ lt_prog_compiler_pic=
+ lt_prog_compiler_can_build_shared=no
+fi
+
+fi
+
+
+
+
+
+
+
+
+
+
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl eval lt_tmp_static_flag=\"$lt_prog_compiler_static\"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+$as_echo_n "checking if $compiler static flag $lt_tmp_static_flag works... " >&6; }
+if ${lt_cv_prog_compiler_static_works+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_static_works=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ echo "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_static_works=yes
+ fi
+ else
+ lt_cv_prog_compiler_static_works=yes
+ fi
+ fi
+ $RM -r conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_static_works" >&5
+$as_echo "$lt_cv_prog_compiler_static_works" >&6; }
+
+if test x"$lt_cv_prog_compiler_static_works" = xyes; then
+ :
+else
+ lt_prog_compiler_static=
+fi
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_c_o=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5
+$as_echo "$lt_cv_prog_compiler_c_o" >&6; }
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_c_o=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o" >&5
+$as_echo "$lt_cv_prog_compiler_c_o" >&6; }
+
+
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if we can lock with hard links" >&5
+$as_echo_n "checking if we can lock with hard links... " >&6; }
+ hard_links=yes
+ $RM conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $hard_links" >&5
+$as_echo "$hard_links" >&6; }
+ if test "$hard_links" = no; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+$as_echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+$as_echo_n "checking whether the $compiler linker ($LD) supports shared libraries... " >&6; }
+
+ runpath_var=
+ allow_undefined_flag=
+ always_export_symbols=no
+ archive_cmds=
+ archive_expsym_cmds=
+ compiler_needs_object=no
+ enable_shared_with_static_runtimes=no
+ export_dynamic_flag_spec=
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ hardcode_automatic=no
+ hardcode_direct=no
+ hardcode_direct_absolute=no
+ hardcode_libdir_flag_spec=
+ hardcode_libdir_separator=
+ hardcode_minus_L=no
+ hardcode_shlibpath_var=unsupported
+ inherit_rpath=no
+ link_all_deplibs=unknown
+ module_cmds=
+ module_expsym_cmds=
+ old_archive_from_new_cmds=
+ old_archive_from_expsyms_cmds=
+ thread_safe_flag_spec=
+ whole_archive_flag_spec=
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ include_expsyms=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ` (' and `)$', so one must not match beginning or
+ # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+ # as well as any symbol that contains `d'.
+ exclude_expsyms='_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*'
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ # Exclude shared library initialization/finalization symbols.
+ extract_expsyms_cmds=
+
+ case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ ld_shlibs=yes
+
+ # On some targets, GNU ld is compatible enough with the native linker
+ # that we're better off using the native interface for both.
+ lt_use_gnu_ld_interface=no
+ if test "$with_gnu_ld" = yes; then
+ case $host_os in
+ aix*)
+ # The AIX port of GNU ld has always aspired to compatibility
+ # with the native linker. However, as the warning in the GNU ld
+ # block says, versions before 2.19.5* couldn't really create working
+ # shared libraries, regardless of the interface used.
+ case `$LD -v 2>&1` in
+ *\ \(GNU\ Binutils\)\ 2.19.5*) ;;
+ *\ \(GNU\ Binutils\)\ 2.[2-9]*) ;;
+ *\ \(GNU\ Binutils\)\ [3-9]*) ;;
+ *)
+ lt_use_gnu_ld_interface=yes
+ ;;
+ esac
+ ;;
+ *)
+ lt_use_gnu_ld_interface=yes
+ ;;
+ esac
+ fi
+
+ if test "$lt_use_gnu_ld_interface" = yes; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='${wl}'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ export_dynamic_flag_spec='${wl}--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ whole_archive_flag_spec=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v 2>&1` in
+ *GNU\ gold*) supports_anon_versioning=yes ;;
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix[3-9]*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.19, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to install binutils
+*** 2.20 or above, or modify your PATH so that a non-GNU linker is found.
+*** You will then need to restart the configuration process.
+
+_LT_EOF
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds=''
+ ;;
+ m68k)
+ archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+ esac
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag=unsupported
+ # Joseph Beckenbach says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ # _LT_TAGVAR(hardcode_libdir_flag_spec, ) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec='-L$libdir'
+ export_dynamic_flag_spec='${wl}--export-all-symbols'
+ allow_undefined_flag=unsupported
+ always_export_symbols=no
+ enable_shared_with_static_runtimes=yes
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1 DATA/;s/^.*[ ]__nm__\([^ ]*\)[ ][^ ]*/\1 DATA/;/^I[ ]/d;/^[AITW][ ]/s/.* //'\'' | sort | uniq > $export_symbols'
+ exclude_expsyms='[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname'
+
+ if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ haiku*)
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ link_all_deplibs=yes
+ ;;
+
+ interix[3-9]*)
+ hardcode_direct=no
+ hardcode_shlibpath_var=no
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu)
+ tmp_diet=no
+ if test "$host_os" = linux-dietlibc; then
+ case $cc_basename in
+ diet\ *) tmp_diet=yes;; # linux-dietlibc with static linking (!diet-dyn)
+ esac
+ fi
+ if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \
+ && test "$tmp_diet" = no
+ then
+ tmp_addflag=' $pic_flag'
+ tmp_sharedflag='-shared'
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95* | pgfortran*)
+ # Portland Group f77 and f90 compilers
+ whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ lf95*) # Lahey Fortran 8.1
+ whole_archive_flag_spec=
+ tmp_sharedflag='--shared' ;;
+ xl[cC]* | bgxl[cC]* | mpixl[cC]*) # IBM XL C 8.0 on PPC (deal with xlf below)
+ tmp_sharedflag='-qmkshrobj'
+ tmp_addflag= ;;
+ nvcc*) # Cuda Compiler Driver 2.2
+ whole_archive_flag_spec='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ compiler_needs_object=yes
+ ;;
+ esac
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*) # Sun C 5.9
+ whole_archive_flag_spec='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ compiler_needs_object=yes
+ tmp_sharedflag='-G' ;;
+ *Sun\ F*) # Sun Fortran 8.3
+ tmp_sharedflag='-G' ;;
+ esac
+ archive_cmds='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+ if test "x$supports_anon_versioning" = xyes; then
+ archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+
+ case $cc_basename in
+ xlf* | bgf* | bgxlf* | mpixlf*)
+ # IBM XL Fortran 10.1 on PPC cannot create shared libs itself
+ whole_archive_flag_spec='--whole-archive$convenience --no-whole-archive'
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ archive_cmds='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib'
+ if test "x$supports_anon_versioning" = xyes; then
+ archive_expsym_cmds='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib'
+ fi
+ ;;
+ esac
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ archive_cmds='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [01].* | *\ 2.[0-9].* | *\ 2.1[0-5].*)
+ ld_shlibs=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ # For security reasons, it is highly recommended that you always
+ # use absolute paths for naming shared libraries, and exclude the
+ # DT_RUNPATH tag from executables and libraries. But doing so
+ # requires that you compile everything twice, which is a pain.
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ archive_cmds='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ ld_shlibs=no
+ fi
+ ;;
+ esac
+
+ if test "$ld_shlibs" = no; then
+ runpath_var=
+ hardcode_libdir_flag_spec=
+ export_dynamic_flag_spec=
+ whole_archive_flag_spec=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ allow_undefined_flag=unsupported
+ always_export_symbols=yes
+ archive_expsym_cmds='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ hardcode_minus_L=yes
+ if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ hardcode_direct=unsupported
+ fi
+ ;;
+
+ aix[4-9]*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ # Also, AIX nm treats weak defined symbols like other global
+ # defined symbols, whereas GNU nm marks them as "W".
+ if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+ export_symbols_cmds='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix[5-9]*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds=''
+ hardcode_direct=yes
+ hardcode_direct_absolute=yes
+ hardcode_libdir_separator=':'
+ link_all_deplibs=yes
+ file_list_spec='${wl}-f,'
+
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" &&
+ strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ :
+ else
+ # We have old collect2
+ hardcode_direct=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L=yes
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_libdir_separator=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ export_dynamic_flag_spec='${wl}-bexpall'
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ always_export_symbols=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag='-berok'
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ if test "${lt_cv_aix_libpath+set}" = set; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ if ${lt_cv_aix_libpath_+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+ lt_aix_libpath_sed='
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }'
+ lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_="/usr/lib:/lib"
+ fi
+
+fi
+
+ aix_libpath=$lt_cv_aix_libpath_
+fi
+
+ hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+ archive_expsym_cmds='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec='${wl}-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag="-z nodefs"
+ archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ if test "${lt_cv_aix_libpath+set}" = set; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ if ${lt_cv_aix_libpath_+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+
+ lt_aix_libpath_sed='
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }'
+ lt_cv_aix_libpath_=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ if test -z "$lt_cv_aix_libpath_"; then
+ lt_cv_aix_libpath_="/usr/lib:/lib"
+ fi
+
+fi
+
+ aix_libpath=$lt_cv_aix_libpath_
+fi
+
+ hardcode_libdir_flag_spec='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag=' ${wl}-bernotok'
+ allow_undefined_flag=' ${wl}-berok'
+ if test "$with_gnu_ld" = yes; then
+ # We only use this code for GNU lds that support --whole-archive.
+ whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ else
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec='$convenience'
+ fi
+ archive_cmds_need_lc=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ archive_expsym_cmds="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds=''
+ ;;
+ m68k)
+ archive_cmds='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ ;;
+ esac
+ ;;
+
+ bsdi[45]*)
+ export_dynamic_flag_spec=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ case $cc_basename in
+ cl*)
+ # Native MSVC
+ hardcode_libdir_flag_spec=' '
+ allow_undefined_flag=unsupported
+ always_export_symbols=yes
+ file_list_spec='@'
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+ archive_expsym_cmds='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ sed -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+ else
+ sed -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+ fi~
+ $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+ linknames='
+ # The linker will not automatically build a static lib if we build a DLL.
+ # _LT_TAGVAR(old_archive_from_new_cmds, )='true'
+ enable_shared_with_static_runtimes=yes
+ exclude_expsyms='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+ export_symbols_cmds='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1,DATA/'\'' | $SED -e '\''/^[AITW][ ]/s/.*[ ]//'\'' | sort | uniq > $export_symbols'
+ # Don't use ranlib
+ old_postinstall_cmds='chmod 644 $oldlib'
+ postlink_cmds='lt_outputfile="@OUTPUT@"~
+ lt_tool_outputfile="@TOOL_OUTPUT@"~
+ case $lt_outputfile in
+ *.exe|*.EXE) ;;
+ *)
+ lt_outputfile="$lt_outputfile.exe"
+ lt_tool_outputfile="$lt_tool_outputfile.exe"
+ ;;
+ esac~
+ if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+ $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+ $RM "$lt_outputfile.manifest";
+ fi'
+ ;;
+ *)
+ # Assume MSVC wrapper
+ hardcode_libdir_flag_spec=' '
+ allow_undefined_flag=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ old_archive_from_new_cmds='true'
+ # FIXME: Should let the user specify the lib program.
+ old_archive_cmds='lib -OUT:$oldlib$oldobjs$old_deplibs'
+ enable_shared_with_static_runtimes=yes
+ ;;
+ esac
+ ;;
+
+ darwin* | rhapsody*)
+
+
+ archive_cmds_need_lc=no
+ hardcode_direct=no
+ hardcode_automatic=yes
+ hardcode_shlibpath_var=unsupported
+ if test "$lt_cv_ld_force_load" = "yes"; then
+ whole_archive_flag_spec='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`'
+
+ else
+ whole_archive_flag_spec=''
+ fi
+ link_all_deplibs=yes
+ allow_undefined_flag="$_lt_dar_allow_undefined"
+ case $cc_basename in
+ ifort*) _lt_dar_can_shared=yes ;;
+ *) _lt_dar_can_shared=$GCC ;;
+ esac
+ if test "$_lt_dar_can_shared" = "yes"; then
+ output_verbose_link_cmd=func_echo_all
+ archive_cmds="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}"
+ module_cmds="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}"
+ archive_expsym_cmds="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}"
+ module_expsym_cmds="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}"
+
+ else
+ ld_shlibs=no
+ fi
+
+ ;;
+
+ dgux*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_shlibpath_var=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2.*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | dragonfly*)
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ hpux9*)
+ if test "$GCC" = yes; then
+ archive_cmds='$RM $output_objdir/$soname~$CC -shared $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ archive_cmds='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ fi
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ export_dynamic_flag_spec='${wl}-E'
+ ;;
+
+ hpux10*)
+ if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+ archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_direct=yes
+ hardcode_direct_absolute=yes
+ export_dynamic_flag_spec='${wl}-E'
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+
+ # Older versions of the 11.00 compiler do not understand -b yet
+ # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $CC understands -b" >&5
+$as_echo_n "checking if $CC understands -b... " >&6; }
+if ${lt_cv_prog_compiler__b+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler__b=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS -b"
+ echo "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler__b=yes
+ fi
+ else
+ lt_cv_prog_compiler__b=yes
+ fi
+ fi
+ $RM -r conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler__b" >&5
+$as_echo "$lt_cv_prog_compiler__b" >&6; }
+
+if test x"$lt_cv_prog_compiler__b" = xyes; then
+ archive_cmds='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+else
+ archive_cmds='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+fi
+
+ ;;
+ esac
+ fi
+ if test "$with_gnu_ld" = no; then
+ hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_direct=no
+ hardcode_shlibpath_var=no
+ ;;
+ *)
+ hardcode_direct=yes
+ hardcode_direct_absolute=yes
+ export_dynamic_flag_spec='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ hardcode_minus_L=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test "$GCC" = yes; then
+ archive_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ # Try to use the -exported_symbol ld option, if it does not
+ # work, assume that -exports_file does not work either and
+ # implicitly export all symbols.
+ # This should be the same for all languages, so no per-tag cache variable.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $host_os linker accepts -exported_symbol" >&5
+$as_echo_n "checking whether the $host_os linker accepts -exported_symbol... " >&6; }
+if ${lt_cv_irix_exported_symbol+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS -shared ${wl}-exported_symbol ${wl}foo ${wl}-update_registry ${wl}/dev/null"
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+int foo (void) { return 0; }
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ lt_cv_irix_exported_symbol=yes
+else
+ lt_cv_irix_exported_symbol=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS="$save_LDFLAGS"
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_irix_exported_symbol" >&5
+$as_echo "$lt_cv_irix_exported_symbol" >&6; }
+ if test "$lt_cv_irix_exported_symbol" = yes; then
+ archive_expsym_cmds='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations ${wl}-exports_file ${wl}$export_symbols -o $lib'
+ fi
+ else
+ archive_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -exports_file $export_symbols -o $lib'
+ fi
+ archive_cmds_need_lc='no'
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ inherit_rpath=yes
+ link_all_deplibs=yes
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ archive_cmds='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ newsos6)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ hardcode_shlibpath_var=no
+ ;;
+
+ *nto* | *qnx*)
+ ;;
+
+ openbsd*)
+ if test -f /usr/libexec/ld.so; then
+ hardcode_direct=yes
+ hardcode_shlibpath_var=no
+ hardcode_direct_absolute=yes
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec='${wl}-E'
+ else
+ case $host_os in
+ openbsd[01].* | openbsd2.[0-7] | openbsd2.[0-7].*)
+ archive_cmds='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-R$libdir'
+ ;;
+ *)
+ archive_cmds='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ hardcode_libdir_flag_spec='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ else
+ ld_shlibs=no
+ fi
+ ;;
+
+ os2*)
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_minus_L=yes
+ allow_undefined_flag=unsupported
+ archive_cmds='$ECHO "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~echo DATA >> $output_objdir/$libname.def~echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+ old_archive_from_new_cmds='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+ ;;
+
+ osf3*)
+ if test "$GCC" = yes; then
+ allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ fi
+ archive_cmds_need_lc='no'
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test "$GCC" = yes; then
+ allow_undefined_flag=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds='$CC -shared${allow_undefined_flag} $pic_flag $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+ else
+ allow_undefined_flag=' -expect_unresolved \*'
+ archive_cmds='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~
+ $CC -shared${allow_undefined_flag} ${wl}-input ${wl}$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~$RM $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ hardcode_libdir_flag_spec='-rpath $libdir'
+ fi
+ archive_cmds_need_lc='no'
+ hardcode_libdir_separator=:
+ ;;
+
+ solaris*)
+ no_undefined_flag=' -z defs'
+ if test "$GCC" = yes; then
+ wlarc='${wl}'
+ archive_cmds='$CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+ else
+ case `$CC -V 2>&1` in
+ *"Compilers 5.0"*)
+ wlarc=''
+ archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp'
+ ;;
+ *)
+ wlarc='${wl}'
+ archive_cmds='$CC -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+ ;;
+ esac
+ fi
+ hardcode_libdir_flag_spec='-R$libdir'
+ hardcode_shlibpath_var=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The compiler driver will combine and reorder linker options,
+ # but understands `-z linker_flag'. GCC discards it without `$wl',
+ # but is careful enough not to reorder.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ if test "$GCC" = yes; then
+ whole_archive_flag_spec='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+ else
+ whole_archive_flag_spec='-z allextract$convenience -z defaultextract'
+ fi
+ ;;
+ esac
+ link_all_deplibs=yes
+ ;;
+
+ sunos4*)
+ if test "x$host_vendor" = xsequent; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ archive_cmds='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_direct=yes
+ hardcode_minus_L=yes
+ hardcode_shlibpath_var=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ archive_cmds='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ reload_cmds='$CC -r -o $output$reload_objs'
+ hardcode_direct=no
+ ;;
+ motorola)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_direct=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ hardcode_shlibpath_var=no
+ ;;
+
+ sysv4.3*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var=no
+ export_dynamic_flag_spec='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_shlibpath_var=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ ld_shlibs=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+ no_undefined_flag='${wl}-z,text'
+ archive_cmds_need_lc=no
+ hardcode_shlibpath_var=no
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ no_undefined_flag='${wl}-z,text'
+ allow_undefined_flag='${wl}-z,nodefs'
+ archive_cmds_need_lc=no
+ hardcode_shlibpath_var=no
+ hardcode_libdir_flag_spec='${wl}-R,$libdir'
+ hardcode_libdir_separator=':'
+ link_all_deplibs=yes
+ export_dynamic_flag_spec='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ archive_cmds='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ archive_cmds='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ archive_cmds='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ hardcode_libdir_flag_spec='-L$libdir'
+ hardcode_shlibpath_var=no
+ ;;
+
+ *)
+ ld_shlibs=no
+ ;;
+ esac
+
+ if test x$host_vendor = xsni; then
+ case $host in
+ sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*)
+ export_dynamic_flag_spec='${wl}-Blargedynsym'
+ ;;
+ esac
+ fi
+ fi
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ld_shlibs" >&5
+$as_echo "$ld_shlibs" >&6; }
+test "$ld_shlibs" = no && can_build_shared=no
+
+with_gnu_ld=$with_gnu_ld
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $archive_cmds in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether -lc should be explicitly linked in" >&5
+$as_echo_n "checking whether -lc should be explicitly linked in... " >&6; }
+if ${lt_cv_archive_cmds_need_lc+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ $RM conftest*
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl
+ pic_flag=$lt_prog_compiler_pic
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag
+ allow_undefined_flag=
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1\""; } >&5
+ (eval $archive_cmds 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ then
+ lt_cv_archive_cmds_need_lc=no
+ else
+ lt_cv_archive_cmds_need_lc=yes
+ fi
+ allow_undefined_flag=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_archive_cmds_need_lc" >&5
+$as_echo "$lt_cv_archive_cmds_need_lc" >&6; }
+ archive_cmds_need_lc=$lt_cv_archive_cmds_need_lc
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking dynamic linker characteristics" >&5
+$as_echo_n "checking dynamic linker characteristics... " >&6; }
+
+if test "$GCC" = yes; then
+ case $host_os in
+ darwin*) lt_awk_arg="/^libraries:/,/LR/" ;;
+ *) lt_awk_arg="/^libraries:/" ;;
+ esac
+ case $host_os in
+ mingw* | cegcc*) lt_sed_strip_eq="s,=\([A-Za-z]:\),\1,g" ;;
+ *) lt_sed_strip_eq="s,=/,/,g" ;;
+ esac
+ lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq`
+ case $lt_search_path_spec in
+ *\;*)
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'`
+ ;;
+ *)
+ lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ esac
+ # Ok, now we have the path, separated by spaces, we can step through it
+ # and add multilib dir if necessary.
+ lt_tmp_lt_search_path_spec=
+ lt_multi_os_dir=`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null`
+ for lt_sys_path in $lt_search_path_spec; do
+ if test -d "$lt_sys_path/$lt_multi_os_dir"; then
+ lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path/$lt_multi_os_dir"
+ else
+ test -d "$lt_sys_path" && \
+ lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path"
+ fi
+ done
+ lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk '
+BEGIN {RS=" "; FS="/|\n";} {
+ lt_foo="";
+ lt_count=0;
+ for (lt_i = NF; lt_i > 0; lt_i--) {
+ if ($lt_i != "" && $lt_i != ".") {
+ if ($lt_i == "..") {
+ lt_count++;
+ } else {
+ if (lt_count == 0) {
+ lt_foo="/" $lt_i lt_foo;
+ } else {
+ lt_count--;
+ }
+ }
+ }
+ }
+ if (lt_foo != "") { lt_freq[lt_foo]++; }
+ if (lt_freq[lt_foo] == 1) { print lt_foo; }
+}'`
+ # AWK program above erroneously prepends '/' to C:/dos/paths
+ # for these hosts.
+ case $host_os in
+ mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\
+ $SED 's,/\([A-Za-z]:\),\1,g'` ;;
+ esac
+ sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP`
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix[4-9]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib.so
+ # instead of lib.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ case $host_cpu in
+ powerpc)
+ # Since July 2007 AmigaOS4 officially supports .so libraries.
+ # When compiling the executable, add -use-dynld -Lsobjs: to the compileline.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ ;;
+ m68k)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+ esac
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32* | cegcc*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$cc_basename in
+ yes,*)
+ # gcc
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname~
+ if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+ eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+ fi'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api"
+ ;;
+ mingw* | cegcc*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ ;;
+
+ *,cl*)
+ # Native MSVC
+ libname_spec='$name'
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ library_names_spec='${libname}.dll.lib'
+
+ case $build_os in
+ mingw*)
+ sys_lib_search_path_spec=
+ lt_save_ifs=$IFS
+ IFS=';'
+ for lt_path in $LIB
+ do
+ IFS=$lt_save_ifs
+ # Let DOS variable expansion print the short 8.3 style file name.
+ lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"`
+ sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path"
+ done
+ IFS=$lt_save_ifs
+ # Convert to MSYS style.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([a-zA-Z]\\):| /\\1|g' -e 's|^ ||'`
+ ;;
+ cygwin*)
+ # Convert to unix form, then to dos form, then back to unix form
+ # but this time dos style (no spaces!) so that the unix form looks
+ # like /cygdrive/c/PROGRA~1:/cygdr...
+ sys_lib_search_path_spec=`cygpath --path --unix "$LIB"`
+ sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null`
+ sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ *)
+ sys_lib_search_path_spec="$LIB"
+ if $ECHO "$sys_lib_search_path_spec" | $GREP ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ # FIXME: find the short name or the path components, as spaces are
+ # common. (e.g. "Program Files" -> "PROGRA~1")
+ ;;
+ esac
+
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+ dynamic_linker='Win32 link.exe'
+ ;;
+
+ *)
+ # Assume MSVC wrapper
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ dynamic_linker='Win32 ld.exe'
+ ;;
+ esac
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib"
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[23].*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2.*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ *) # from 4.6 on, and DragonFly
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+haiku*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ dynamic_linker="$host_os runtime_loader"
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib'
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555, ...
+ postinstall_cmds='chmod 555 $lib'
+ # or fails outright, so override atomically:
+ install_override_mode=555
+ ;;
+
+interix[3-9]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+
+ # Some binutils ld are patched to set DT_RUNPATH
+ if ${lt_cv_shlibpath_overrides_runpath+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_shlibpath_overrides_runpath=no
+ save_LDFLAGS=$LDFLAGS
+ save_libdir=$libdir
+ eval "libdir=/foo; wl=\"$lt_prog_compiler_wl\"; \
+ LDFLAGS=\"\$LDFLAGS $hardcode_libdir_flag_spec\""
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ if ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null; then :
+ lt_cv_shlibpath_overrides_runpath=yes
+fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS=$save_LDFLAGS
+ libdir=$save_libdir
+
+fi
+
+ shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath
+
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+*nto* | *qnx*)
+ version_type=qnx
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='ldqnx.so'
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[89] | openbsd2.[89].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+rdos*)
+ dynamic_linker=no
+ ;;
+
+solaris*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+tpf*)
+ # TPF is a cross-target only. Preferred cross-host = GNU/Linux.
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+uts4*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $dynamic_linker" >&5
+$as_echo "$dynamic_linker" >&6; }
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then
+ sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec"
+fi
+if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then
+ sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec"
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking how to hardcode library paths into programs" >&5
+$as_echo_n "checking how to hardcode library paths into programs... " >&6; }
+hardcode_action=
+if test -n "$hardcode_libdir_flag_spec" ||
+ test -n "$runpath_var" ||
+ test "X$hardcode_automatic" = "Xyes" ; then
+
+ # We can hardcode non-existent directories.
+ if test "$hardcode_direct" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_TAGVAR(hardcode_shlibpath_var, )" != no &&
+ test "$hardcode_minus_L" != no; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action=unsupported
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $hardcode_action" >&5
+$as_echo "$hardcode_action" >&6; }
+
+if test "$hardcode_action" = relink ||
+ test "$inherit_rpath" = yes; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+
+
+
+
+
+ if test "x$enable_dlopen" != xyes; then
+ enable_dlopen=unknown
+ enable_dlopen_self=unknown
+ enable_dlopen_self_static=unknown
+else
+ lt_cv_dlopen=no
+ lt_cv_dlopen_libs=
+
+ case $host_os in
+ beos*)
+ lt_cv_dlopen="load_add_on"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ;;
+
+ mingw* | pw32* | cegcc*)
+ lt_cv_dlopen="LoadLibrary"
+ lt_cv_dlopen_libs=
+ ;;
+
+ cygwin*)
+ lt_cv_dlopen="dlopen"
+ lt_cv_dlopen_libs=
+ ;;
+
+ darwin*)
+ # if libdl is installed we need to link against it
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5
+$as_echo_n "checking for dlopen in -ldl... " >&6; }
+if ${ac_cv_lib_dl_dlopen+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dl_dlopen=yes
+else
+ ac_cv_lib_dl_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5
+$as_echo "$ac_cv_lib_dl_dlopen" >&6; }
+if test "x$ac_cv_lib_dl_dlopen" = xyes; then :
+ lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"
+else
+
+ lt_cv_dlopen="dyld"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+
+fi
+
+ ;;
+
+ *)
+ ac_fn_c_check_func "$LINENO" "shl_load" "ac_cv_func_shl_load"
+if test "x$ac_cv_func_shl_load" = xyes; then :
+ lt_cv_dlopen="shl_load"
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for shl_load in -ldld" >&5
+$as_echo_n "checking for shl_load in -ldld... " >&6; }
+if ${ac_cv_lib_dld_shl_load+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char shl_load ();
+int
+main ()
+{
+return shl_load ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dld_shl_load=yes
+else
+ ac_cv_lib_dld_shl_load=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_shl_load" >&5
+$as_echo "$ac_cv_lib_dld_shl_load" >&6; }
+if test "x$ac_cv_lib_dld_shl_load" = xyes; then :
+ lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-ldld"
+else
+ ac_fn_c_check_func "$LINENO" "dlopen" "ac_cv_func_dlopen"
+if test "x$ac_cv_func_dlopen" = xyes; then :
+ lt_cv_dlopen="dlopen"
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -ldl" >&5
+$as_echo_n "checking for dlopen in -ldl... " >&6; }
+if ${ac_cv_lib_dl_dlopen+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldl $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dl_dlopen=yes
+else
+ ac_cv_lib_dl_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dl_dlopen" >&5
+$as_echo "$ac_cv_lib_dl_dlopen" >&6; }
+if test "x$ac_cv_lib_dl_dlopen" = xyes; then :
+ lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dlopen in -lsvld" >&5
+$as_echo_n "checking for dlopen in -lsvld... " >&6; }
+if ${ac_cv_lib_svld_dlopen+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-lsvld $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dlopen ();
+int
+main ()
+{
+return dlopen ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_svld_dlopen=yes
+else
+ ac_cv_lib_svld_dlopen=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_svld_dlopen" >&5
+$as_echo "$ac_cv_lib_svld_dlopen" >&6; }
+if test "x$ac_cv_lib_svld_dlopen" = xyes; then :
+ lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for dld_link in -ldld" >&5
+$as_echo_n "checking for dld_link in -ldld... " >&6; }
+if ${ac_cv_lib_dld_dld_link+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-ldld $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+/* Override any GCC internal prototype to avoid an error.
+ Use char because int might match the return type of a GCC
+ builtin and then its argument prototype would still apply. */
+#ifdef __cplusplus
+extern "C"
+#endif
+char dld_link ();
+int
+main ()
+{
+return dld_link ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_dld_dld_link=yes
+else
+ ac_cv_lib_dld_dld_link=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_dld_dld_link" >&5
+$as_echo "$ac_cv_lib_dld_dld_link" >&6; }
+if test "x$ac_cv_lib_dld_dld_link" = xyes; then :
+ lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-ldld"
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+
+fi
+
+ ;;
+ esac
+
+ if test "x$lt_cv_dlopen" != xno; then
+ enable_dlopen=yes
+ else
+ enable_dlopen=no
+ fi
+
+ case $lt_cv_dlopen in
+ dlopen)
+ save_CPPFLAGS="$CPPFLAGS"
+ test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+ save_LDFLAGS="$LDFLAGS"
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+ save_LIBS="$LIBS"
+ LIBS="$lt_cv_dlopen_libs $LIBS"
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a program can dlopen itself" >&5
+$as_echo_n "checking whether a program can dlopen itself... " >&6; }
+if ${lt_cv_dlopen_self+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "$cross_compiling" = yes; then :
+ lt_cv_dlopen_self=cross
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<_LT_EOF
+#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include
+#endif
+
+#include
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+/* When -fvisbility=hidden is used, assume the code has been annotated
+ correspondingly for the symbols needed. */
+#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else
+ {
+ if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ else puts (dlerror ());
+ }
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ return status;
+}
+_LT_EOF
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s conftest${ac_exeext} 2>/dev/null; then
+ (./conftest; exit; ) >&5 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) lt_cv_dlopen_self=yes ;;
+ x$lt_dlneed_uscore) lt_cv_dlopen_self=yes ;;
+ x$lt_dlunknown|x*) lt_cv_dlopen_self=no ;;
+ esac
+ else :
+ # compilation failed
+ lt_cv_dlopen_self=no
+ fi
+fi
+rm -fr conftest*
+
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self" >&5
+$as_echo "$lt_cv_dlopen_self" >&6; }
+
+ if test "x$lt_cv_dlopen_self" = xyes; then
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether a statically linked program can dlopen itself" >&5
+$as_echo_n "checking whether a statically linked program can dlopen itself... " >&6; }
+if ${lt_cv_dlopen_self_static+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test "$cross_compiling" = yes; then :
+ lt_cv_dlopen_self_static=cross
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<_LT_EOF
+#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include
+#endif
+
+#include
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+/* When -fvisbility=hidden is used, assume the code has been annotated
+ correspondingly for the symbols needed. */
+#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else
+ {
+ if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ else puts (dlerror ());
+ }
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ return status;
+}
+_LT_EOF
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_link\""; } >&5
+ (eval $ac_link) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } && test -s conftest${ac_exeext} 2>/dev/null; then
+ (./conftest; exit; ) >&5 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) lt_cv_dlopen_self_static=yes ;;
+ x$lt_dlneed_uscore) lt_cv_dlopen_self_static=yes ;;
+ x$lt_dlunknown|x*) lt_cv_dlopen_self_static=no ;;
+ esac
+ else :
+ # compilation failed
+ lt_cv_dlopen_self_static=no
+ fi
+fi
+rm -fr conftest*
+
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_dlopen_self_static" >&5
+$as_echo "$lt_cv_dlopen_self_static" >&6; }
+ fi
+
+ CPPFLAGS="$save_CPPFLAGS"
+ LDFLAGS="$save_LDFLAGS"
+ LIBS="$save_LIBS"
+ ;;
+ esac
+
+ case $lt_cv_dlopen_self in
+ yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+ *) enable_dlopen_self=unknown ;;
+ esac
+
+ case $lt_cv_dlopen_self_static in
+ yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+ *) enable_dlopen_self_static=unknown ;;
+ esac
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+striplib=
+old_striplib=
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking whether stripping libraries is possible" >&5
+$as_echo_n "checking whether stripping libraries is possible... " >&6; }
+if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then
+ test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+ test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+ case $host_os in
+ darwin*)
+ if test -n "$STRIP" ; then
+ striplib="$STRIP -x"
+ old_striplib="$STRIP -S"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: yes" >&5
+$as_echo "yes" >&6; }
+ else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ fi
+ ;;
+ *)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+ ;;
+ esac
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+ # Report which library types will actually be built
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if libtool supports shared libraries" >&5
+$as_echo_n "checking if libtool supports shared libraries... " >&6; }
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $can_build_shared" >&5
+$as_echo "$can_build_shared" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build shared libraries" >&5
+$as_echo_n "checking whether to build shared libraries... " >&6; }
+ test "$can_build_shared" = "no" && enable_shared=no
+
+ # On AIX, shared libraries and static libraries use the same namespace, and
+ # are all built from PIC.
+ case $host_os in
+ aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+
+ aix[4-9]*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+ esac
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_shared" >&5
+$as_echo "$enable_shared" >&6; }
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether to build static libraries" >&5
+$as_echo_n "checking whether to build static libraries... " >&6; }
+ # Make sure either enable_shared or enable_static is yes.
+ test "$enable_shared" = yes || enable_static=yes
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $enable_static" >&5
+$as_echo "$enable_static" >&6; }
+
+
+
+
+fi
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+CC="$lt_save_CC"
+
+ if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+ ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+ (test "X$CXX" != "Xg++"))) ; then
+ ac_ext=cpp
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking how to run the C++ preprocessor" >&5
+$as_echo_n "checking how to run the C++ preprocessor... " >&6; }
+if test -z "$CXXCPP"; then
+ if ${ac_cv_prog_CXXCPP+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ # Double quotes because CXXCPP needs to be expanded
+ for CXXCPP in "$CXX -E" "/lib/cpp"
+ do
+ ac_preproc_ok=false
+for ac_cxx_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer to if __STDC__ is defined, since
+ # exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifdef __STDC__
+# include
+#else
+# include
+#endif
+ Syntax error
+_ACEOF
+if ac_fn_cxx_try_cpp "$LINENO"; then :
+
+else
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether nonexistent headers
+ # can be detected and how.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+_ACEOF
+if ac_fn_cxx_try_cpp "$LINENO"; then :
+ # Broken: success on invalid input.
+continue
+else
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+ break
+fi
+
+ done
+ ac_cv_prog_CXXCPP=$CXXCPP
+
+fi
+ CXXCPP=$ac_cv_prog_CXXCPP
+else
+ ac_cv_prog_CXXCPP=$CXXCPP
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $CXXCPP" >&5
+$as_echo "$CXXCPP" >&6; }
+ac_preproc_ok=false
+for ac_cxx_preproc_warn_flag in '' yes
+do
+ # Use a header file that comes with gcc, so configuring glibc
+ # with a fresh cross-compiler works.
+ # Prefer to if __STDC__ is defined, since
+ # exists even on freestanding compilers.
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp. "Syntax error" is here to catch this case.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#ifdef __STDC__
+# include
+#else
+# include
+#endif
+ Syntax error
+_ACEOF
+if ac_fn_cxx_try_cpp "$LINENO"; then :
+
+else
+ # Broken: fails on valid input.
+continue
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+ # OK, works on sane cases. Now check whether nonexistent headers
+ # can be detected and how.
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+#include
+_ACEOF
+if ac_fn_cxx_try_cpp "$LINENO"; then :
+ # Broken: success on invalid input.
+continue
+else
+ # Passes both tests.
+ac_preproc_ok=:
+break
+fi
+rm -f conftest.err conftest.i conftest.$ac_ext
+
+done
+# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped.
+rm -f conftest.i conftest.err conftest.$ac_ext
+if $ac_preproc_ok; then :
+
+else
+ { { $as_echo "$as_me:${as_lineno-$LINENO}: error: in \`$ac_pwd':" >&5
+$as_echo "$as_me: error: in \`$ac_pwd':" >&2;}
+as_fn_error $? "C++ preprocessor \"$CXXCPP\" fails sanity check
+See \`config.log' for more details" "$LINENO" 5; }
+fi
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+else
+ _lt_caught_CXX_error=yes
+fi
+
+ac_ext=cpp
+ac_cpp='$CXXCPP $CPPFLAGS'
+ac_compile='$CXX -c $CXXFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CXX -o conftest$ac_exeext $CXXFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_cxx_compiler_gnu
+
+archive_cmds_need_lc_CXX=no
+allow_undefined_flag_CXX=
+always_export_symbols_CXX=no
+archive_expsym_cmds_CXX=
+compiler_needs_object_CXX=no
+export_dynamic_flag_spec_CXX=
+hardcode_direct_CXX=no
+hardcode_direct_absolute_CXX=no
+hardcode_libdir_flag_spec_CXX=
+hardcode_libdir_separator_CXX=
+hardcode_minus_L_CXX=no
+hardcode_shlibpath_var_CXX=unsupported
+hardcode_automatic_CXX=no
+inherit_rpath_CXX=no
+module_cmds_CXX=
+module_expsym_cmds_CXX=
+link_all_deplibs_CXX=unknown
+old_archive_cmds_CXX=$old_archive_cmds
+reload_flag_CXX=$reload_flag
+reload_cmds_CXX=$reload_cmds
+no_undefined_flag_CXX=
+whole_archive_flag_spec_CXX=
+enable_shared_with_static_runtimes_CXX=no
+
+# Source file extension for C++ test sources.
+ac_ext=cpp
+
+# Object file extension for compiled C++ test sources.
+objext=o
+objext_CXX=$objext
+
+# No sense in running all these tests if we already determined that
+# the CXX compiler isn't working. Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_caught_CXX_error" != yes; then
+ # Code to be used in simple compile tests
+ lt_simple_compile_test_code="int some_variable = 0;"
+
+ # Code to be used in simple link tests
+ lt_simple_link_test_code='int main(int, char *[]) { return(0); }'
+
+ # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+
+
+
+
+
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+
+
+ # save warnings/boilerplate of simple test code
+ ac_outfile=conftest.$ac_objext
+echo "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$RM conftest*
+
+ ac_outfile=conftest.$ac_objext
+echo "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$RM -r conftest*
+
+
+ # Allow CC to be a program name with arguments.
+ lt_save_CC=$CC
+ lt_save_CFLAGS=$CFLAGS
+ lt_save_LD=$LD
+ lt_save_GCC=$GCC
+ GCC=$GXX
+ lt_save_with_gnu_ld=$with_gnu_ld
+ lt_save_path_LD=$lt_cv_path_LD
+ if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then
+ lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx
+ else
+ $as_unset lt_cv_prog_gnu_ld
+ fi
+ if test -n "${lt_cv_path_LDCXX+set}"; then
+ lt_cv_path_LD=$lt_cv_path_LDCXX
+ else
+ $as_unset lt_cv_path_LD
+ fi
+ test -z "${LDCXX+set}" || LD=$LDCXX
+ CC=${CXX-"c++"}
+ CFLAGS=$CXXFLAGS
+ compiler=$CC
+ compiler_CXX=$CC
+ for cc_temp in $compiler""; do
+ case $cc_temp in
+ compile | *[\\/]compile | ccache | *[\\/]ccache ) ;;
+ distcc | *[\\/]distcc | purify | *[\\/]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+
+
+ if test -n "$compiler"; then
+ # We don't want -fno-exception when compiling C++ code, so set the
+ # no_builtin_flag separately
+ if test "$GXX" = yes; then
+ lt_prog_compiler_no_builtin_flag_CXX=' -fno-builtin'
+ else
+ lt_prog_compiler_no_builtin_flag_CXX=
+ fi
+
+ if test "$GXX" = yes; then
+ # Set up default GNU C++ configuration
+
+
+
+# Check whether --with-gnu-ld was given.
+if test "${with_gnu_ld+set}" = set; then :
+ withval=$with_gnu_ld; test "$withval" = no || with_gnu_ld=yes
+else
+ with_gnu_ld=no
+fi
+
+ac_prog=ld
+if test "$GCC" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for ld used by $CC" >&5
+$as_echo_n "checking for ld used by $CC... " >&6; }
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [\\/]* | ?:[\\/]*)
+ re_direlt='/[^/][^/]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'`
+ while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for GNU ld" >&5
+$as_echo_n "checking for GNU ld... " >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for non-GNU ld" >&5
+$as_echo_n "checking for non-GNU ld... " >&6; }
+fi
+if ${lt_cv_path_LD+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ if test -z "$LD"; then
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 &5
+$as_echo "$LD" >&6; }
+else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: no" >&5
+$as_echo "no" >&6; }
+fi
+test -z "$LD" && as_fn_error $? "no acceptable ld found in \$PATH" "$LINENO" 5
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if the linker ($LD) is GNU ld" >&5
+$as_echo_n "checking if the linker ($LD) is GNU ld... " >&6; }
+if ${lt_cv_prog_gnu_ld+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ # I'd rather use --version here, but apparently some GNU lds only accept -v.
+case `$LD -v 2>&1 &5
+$as_echo "$lt_cv_prog_gnu_ld" >&6; }
+with_gnu_ld=$lt_cv_prog_gnu_ld
+
+
+
+
+
+
+
+ # Check if GNU C++ uses GNU ld as the underlying linker, since the
+ # archiving commands below assume that GNU ld is being used.
+ if test "$with_gnu_ld" = yes; then
+ archive_cmds_CXX='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to
+ # investigate it a little bit more. (MM)
+ wlarc='${wl}'
+
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if eval "`$CC -print-prog-name=ld` --help 2>&1" |
+ $GREP 'no-whole-archive' > /dev/null; then
+ whole_archive_flag_spec_CXX="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ whole_archive_flag_spec_CXX=
+ fi
+ else
+ with_gnu_ld=no
+ wlarc=
+
+ # A generic and very simple default shared library creation
+ # command for GNU C++ for the case where it uses the native
+ # linker, instead of GNU ld. If possible, this setting should
+ # overridden to take advantage of the native linker features on
+ # the platform it is being used on.
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ fi
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+
+ else
+ GXX=no
+ with_gnu_ld=no
+ wlarc=
+ fi
+
+ # PORTME: fill in a description of your system's C++ link characteristics
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+$as_echo_n "checking whether the $compiler linker ($LD) supports shared libraries... " >&6; }
+ ld_shlibs_CXX=yes
+ case $host_os in
+ aix3*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ aix[4-9]*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[23]|aix4.[23].*|aix[5-9]*)
+ for ld_flag in $LDFLAGS; do
+ case $ld_flag in
+ *-brtl*)
+ aix_use_runtimelinking=yes
+ break
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ archive_cmds_CXX=''
+ hardcode_direct_CXX=yes
+ hardcode_direct_absolute_CXX=yes
+ hardcode_libdir_separator_CXX=':'
+ link_all_deplibs_CXX=yes
+ file_list_spec_CXX='${wl}-f,'
+
+ if test "$GXX" = yes; then
+ case $host_os in aix4.[012]|aix4.[012].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" &&
+ strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ :
+ else
+ # We have old collect2
+ hardcode_direct_CXX=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ hardcode_minus_L_CXX=yes
+ hardcode_libdir_flag_spec_CXX='-L$libdir'
+ hardcode_libdir_separator_CXX=
+ fi
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ export_dynamic_flag_spec_CXX='${wl}-bexpall'
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to
+ # export.
+ always_export_symbols_CXX=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ allow_undefined_flag_CXX='-berok'
+ # Determine the default libpath from the value encoded in an empty
+ # executable.
+ if test "${lt_cv_aix_libpath+set}" = set; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ if ${lt_cv_aix_libpath__CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_link "$LINENO"; then :
+
+ lt_aix_libpath_sed='
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }'
+ lt_cv_aix_libpath__CXX=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$lt_cv_aix_libpath__CXX"; then
+ lt_cv_aix_libpath__CXX=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ if test -z "$lt_cv_aix_libpath__CXX"; then
+ lt_cv_aix_libpath__CXX="/usr/lib:/lib"
+ fi
+
+fi
+
+ aix_libpath=$lt_cv_aix_libpath__CXX
+fi
+
+ hardcode_libdir_flag_spec_CXX='${wl}-blibpath:$libdir:'"$aix_libpath"
+
+ archive_expsym_cmds_CXX='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ hardcode_libdir_flag_spec_CXX='${wl}-R $libdir:/usr/lib:/lib'
+ allow_undefined_flag_CXX="-z nodefs"
+ archive_expsym_cmds_CXX="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ if test "${lt_cv_aix_libpath+set}" = set; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ if ${lt_cv_aix_libpath__CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_link "$LINENO"; then :
+
+ lt_aix_libpath_sed='
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }'
+ lt_cv_aix_libpath__CXX=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$lt_cv_aix_libpath__CXX"; then
+ lt_cv_aix_libpath__CXX=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ if test -z "$lt_cv_aix_libpath__CXX"; then
+ lt_cv_aix_libpath__CXX="/usr/lib:/lib"
+ fi
+
+fi
+
+ aix_libpath=$lt_cv_aix_libpath__CXX
+fi
+
+ hardcode_libdir_flag_spec_CXX='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ no_undefined_flag_CXX=' ${wl}-bernotok'
+ allow_undefined_flag_CXX=' ${wl}-berok'
+ if test "$with_gnu_ld" = yes; then
+ # We only use this code for GNU lds that support --whole-archive.
+ whole_archive_flag_spec_CXX='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ else
+ # Exported symbols can be pulled into shared objects from archives
+ whole_archive_flag_spec_CXX='$convenience'
+ fi
+ archive_cmds_need_lc_CXX=yes
+ # This is similar to how AIX traditionally builds its shared
+ # libraries.
+ archive_expsym_cmds_CXX="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ allow_undefined_flag_CXX=unsupported
+ # Joseph Beckenbach says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ archive_cmds_CXX='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ ld_shlibs_CXX=no
+ fi
+ ;;
+
+ chorus*)
+ case $cc_basename in
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ case $GXX,$cc_basename in
+ ,cl* | no,cl*)
+ # Native MSVC
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ hardcode_libdir_flag_spec_CXX=' '
+ allow_undefined_flag_CXX=unsupported
+ always_export_symbols_CXX=yes
+ file_list_spec_CXX='@'
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ archive_cmds_CXX='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+ archive_expsym_cmds_CXX='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ $SED -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+ else
+ $SED -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+ fi~
+ $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+ linknames='
+ # The linker will not automatically build a static lib if we build a DLL.
+ # _LT_TAGVAR(old_archive_from_new_cmds, CXX)='true'
+ enable_shared_with_static_runtimes_CXX=yes
+ # Don't use ranlib
+ old_postinstall_cmds_CXX='chmod 644 $oldlib'
+ postlink_cmds_CXX='lt_outputfile="@OUTPUT@"~
+ lt_tool_outputfile="@TOOL_OUTPUT@"~
+ case $lt_outputfile in
+ *.exe|*.EXE) ;;
+ *)
+ lt_outputfile="$lt_outputfile.exe"
+ lt_tool_outputfile="$lt_tool_outputfile.exe"
+ ;;
+ esac~
+ func_to_tool_file "$lt_outputfile"~
+ if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+ $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+ $RM "$lt_outputfile.manifest";
+ fi'
+ ;;
+ *)
+ # g++
+ # _LT_TAGVAR(hardcode_libdir_flag_spec, CXX) is actually meaningless,
+ # as there is no search path for DLLs.
+ hardcode_libdir_flag_spec_CXX='-L$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-all-symbols'
+ allow_undefined_flag_CXX=unsupported
+ always_export_symbols_CXX=no
+ enable_shared_with_static_runtimes_CXX=yes
+
+ if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+ archive_cmds_CXX='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ archive_expsym_cmds_CXX='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+ darwin* | rhapsody*)
+
+
+ archive_cmds_need_lc_CXX=no
+ hardcode_direct_CXX=no
+ hardcode_automatic_CXX=yes
+ hardcode_shlibpath_var_CXX=unsupported
+ if test "$lt_cv_ld_force_load" = "yes"; then
+ whole_archive_flag_spec_CXX='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`'
+
+ else
+ whole_archive_flag_spec_CXX=''
+ fi
+ link_all_deplibs_CXX=yes
+ allow_undefined_flag_CXX="$_lt_dar_allow_undefined"
+ case $cc_basename in
+ ifort*) _lt_dar_can_shared=yes ;;
+ *) _lt_dar_can_shared=$GCC ;;
+ esac
+ if test "$_lt_dar_can_shared" = "yes"; then
+ output_verbose_link_cmd=func_echo_all
+ archive_cmds_CXX="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}"
+ module_cmds_CXX="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}"
+ archive_expsym_cmds_CXX="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}"
+ module_expsym_cmds_CXX="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}"
+ if test "$lt_cv_apple_cc_single_mod" != "yes"; then
+ archive_cmds_CXX="\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dsymutil}"
+ archive_expsym_cmds_CXX="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dar_export_syms}${_lt_dsymutil}"
+ fi
+
+ else
+ ld_shlibs_CXX=no
+ fi
+
+ ;;
+
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+
+ freebsd2.*)
+ # C++ shared libraries reported to be fairly broken before
+ # switch to ELF
+ ld_shlibs_CXX=no
+ ;;
+
+ freebsd-elf*)
+ archive_cmds_need_lc_CXX=no
+ ;;
+
+ freebsd* | dragonfly*)
+ # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF
+ # conventions
+ ld_shlibs_CXX=yes
+ ;;
+
+ gnu*)
+ ;;
+
+ haiku*)
+ archive_cmds_CXX='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ link_all_deplibs_CXX=yes
+ ;;
+
+ hpux9*)
+ hardcode_libdir_flag_spec_CXX='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ hardcode_direct_CXX=yes
+ hardcode_minus_L_CXX=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ aCC*)
+ archive_cmds_CXX='$RM $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $EGREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ archive_cmds_CXX='$RM $output_objdir/$soname~$CC -shared -nostdlib $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+
+ hpux10*|hpux11*)
+ if test $with_gnu_ld = no; then
+ hardcode_libdir_flag_spec_CXX='${wl}+b ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ ;;
+ *)
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ ;;
+ esac
+ fi
+ case $host_cpu in
+ hppa*64*|ia64*)
+ hardcode_direct_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ ;;
+ *)
+ hardcode_direct_CXX=yes
+ hardcode_direct_absolute_CXX=yes
+ hardcode_minus_L_CXX=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+ ;;
+ esac
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ aCC*)
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $GREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test $with_gnu_ld = no; then
+ case $host_cpu in
+ hppa*64*)
+ archive_cmds_CXX='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ archive_cmds_CXX='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ fi
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+
+ interix[3-9]*)
+ hardcode_direct_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ archive_cmds_CXX='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ archive_expsym_cmds_CXX='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+ irix5* | irix6*)
+ case $cc_basename in
+ CC*)
+ # SGI C++
+ archive_cmds_CXX='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+
+ # Archives containing C++ object files must be created using
+ # "CC -ar", where "CC" is the IRIX C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ old_archive_cmds_CXX='$CC -ar -WR,-u -o $oldlib $oldobjs'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test "$with_gnu_ld" = no; then
+ archive_cmds_CXX='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ archive_cmds_CXX='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` -o $lib'
+ fi
+ fi
+ link_all_deplibs_CXX=yes
+ ;;
+ esac
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+ inherit_rpath_CXX=yes
+ ;;
+
+ linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+ archive_expsym_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | $GREP "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+
+ # Archives containing C++ object files must be created using
+ # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+ old_archive_cmds_CXX='$CC -Bstatic -o $oldlib $oldobjs'
+ ;;
+ icpc* | ecpc* )
+ # Intel C++
+ with_gnu_ld=yes
+ # version 8.0 and above of icpc choke on multiply defined symbols
+ # if we add $predep_objects and $postdep_objects, however 7.1 and
+ # earlier do not add the objects themselves.
+ case `$CC -V 2>&1` in
+ *"Version 7."*)
+ archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ *) # Version 8.0 or newer
+ tmp_idyn=
+ case $host_cpu in
+ ia64*) tmp_idyn=' -i_dynamic';;
+ esac
+ archive_cmds_CXX='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ esac
+ archive_cmds_need_lc_CXX=no
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+ whole_archive_flag_spec_CXX='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ ;;
+ pgCC* | pgcpp*)
+ # Portland Group C++ compiler
+ case `$CC -V` in
+ *pgCC\ [1-5].* | *pgcpp\ [1-5].*)
+ prelink_cmds_CXX='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $objs $libobjs $compile_deplibs~
+ compile_command="$compile_command `find $tpldir -name \*.o | sort | $NL2SP`"'
+ old_archive_cmds_CXX='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $oldobjs$old_deplibs~
+ $AR $AR_FLAGS $oldlib$oldobjs$old_deplibs `find $tpldir -name \*.o | sort | $NL2SP`~
+ $RANLIB $oldlib'
+ archive_cmds_CXX='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~
+ $CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+ archive_expsym_cmds_CXX='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~
+ $CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+ ;;
+ *) # Version 6 and above use weak symbols
+ archive_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+ ;;
+ esac
+
+ hardcode_libdir_flag_spec_CXX='${wl}--rpath ${wl}$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+ whole_archive_flag_spec_CXX='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ ;;
+ cxx*)
+ # Compaq C++
+ archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols'
+
+ runpath_var=LD_RUN_PATH
+ hardcode_libdir_flag_spec_CXX='-rpath $libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "X$list" | $Xsed'
+ ;;
+ xl* | mpixl* | bgxl*)
+ # IBM XL 8.0 on PPC, with GNU ld
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ export_dynamic_flag_spec_CXX='${wl}--export-dynamic'
+ archive_cmds_CXX='$CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ if test "x$supports_anon_versioning" = xyes; then
+ archive_expsym_cmds_CXX='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ # Sun C++ 5.9
+ no_undefined_flag_CXX=' -zdefs'
+ archive_cmds_CXX='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file ${wl}$export_symbols'
+ hardcode_libdir_flag_spec_CXX='-R$libdir'
+ whole_archive_flag_spec_CXX='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ compiler_needs_object_CXX=yes
+
+ # Not sure whether something based on
+ # $CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1
+ # would be better.
+ output_verbose_link_cmd='func_echo_all'
+
+ # Archives containing C++ object files must be created using
+ # "CC -xar", where "CC" is the Sun C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ old_archive_cmds_CXX='$CC -xar -o $oldlib $oldobjs'
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+
+ lynxos*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+
+ m88k*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ archive_cmds_CXX='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags'
+ wlarc=
+ hardcode_libdir_flag_spec_CXX='-R$libdir'
+ hardcode_direct_CXX=yes
+ hardcode_shlibpath_var_CXX=no
+ fi
+ # Workaround some broken pre-1.5 toolchains
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"'
+ ;;
+
+ *nto* | *qnx*)
+ ld_shlibs_CXX=yes
+ ;;
+
+ openbsd2*)
+ # C++ shared libraries are fairly broken
+ ld_shlibs_CXX=no
+ ;;
+
+ openbsd*)
+ if test -f /usr/libexec/ld.so; then
+ hardcode_direct_CXX=yes
+ hardcode_shlibpath_var_CXX=no
+ hardcode_direct_absolute_CXX=yes
+ archive_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ archive_expsym_cmds_CXX='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib'
+ export_dynamic_flag_spec_CXX='${wl}-E'
+ whole_archive_flag_spec_CXX="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ fi
+ output_verbose_link_cmd=func_echo_all
+ else
+ ld_shlibs_CXX=no
+ fi
+ ;;
+
+ osf3* | osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ archive_cmds_CXX='tempext=`echo $shared_ext | $SED -e '\''s/\([^()0-9A-Za-z{}]\)/\\\\\1/g'\''`; templib=`echo "$lib" | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath,$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Archives containing C++ object files must be created using
+ # the KAI C++ compiler.
+ case $host in
+ osf3*) old_archive_cmds_CXX='$CC -Bstatic -o $oldlib $oldobjs' ;;
+ *) old_archive_cmds_CXX='$CC -o $oldlib $oldobjs' ;;
+ esac
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ cxx*)
+ case $host in
+ osf3*)
+ allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*'
+ archive_cmds_CXX='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && func_echo_all "${wl}-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ ;;
+ *)
+ allow_undefined_flag_CXX=' -expect_unresolved \*'
+ archive_cmds_CXX='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ archive_expsym_cmds_CXX='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~
+ echo "-hidden">> $lib.exp~
+ $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname ${wl}-input ${wl}$lib.exp `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~
+ $RM $lib.exp'
+ hardcode_libdir_flag_spec_CXX='-rpath $libdir'
+ ;;
+ esac
+
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld" | $GREP -v "ld:"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+ ;;
+ *)
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ allow_undefined_flag_CXX=' ${wl}-expect_unresolved ${wl}\*'
+ case $host in
+ osf3*)
+ archive_cmds_CXX='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared $pic_flag -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ ;;
+ esac
+
+ hardcode_libdir_flag_spec_CXX='${wl}-rpath ${wl}$libdir'
+ hardcode_libdir_separator_CXX=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+
+ else
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ fi
+ ;;
+ esac
+ ;;
+
+ psos*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ lcc*)
+ # Lucid
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+
+ solaris*)
+ case $cc_basename in
+ CC* | sunCC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ archive_cmds_need_lc_CXX=yes
+ no_undefined_flag_CXX=' -zdefs'
+ archive_cmds_CXX='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ archive_expsym_cmds_CXX='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+ hardcode_libdir_flag_spec_CXX='-R$libdir'
+ hardcode_shlibpath_var_CXX=no
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ # The compiler driver will combine and reorder linker options,
+ # but understands `-z linker_flag'.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ whole_archive_flag_spec_CXX='-z allextract$convenience -z defaultextract'
+ ;;
+ esac
+ link_all_deplibs_CXX=yes
+
+ output_verbose_link_cmd='func_echo_all'
+
+ # Archives containing C++ object files must be created using
+ # "CC -xar", where "CC" is the Sun C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ old_archive_cmds_CXX='$CC -xar -o $oldlib $oldobjs'
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ archive_cmds_CXX='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+
+ # The C++ compiler must be used to create the archive.
+ old_archive_cmds_CXX='$CC $LDFLAGS -archive -o $oldlib $oldobjs'
+ ;;
+ *)
+ # GNU C++ compiler with Solaris linker
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ no_undefined_flag_CXX=' ${wl}-z ${wl}defs'
+ if $CC --version | $GREP -v '^2\.7' > /dev/null; then
+ archive_cmds_CXX='$CC -shared $pic_flag -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -shared $pic_flag -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+ else
+ # g++ 2.7 appears to require `-G' NOT `-shared' on this
+ # platform.
+ archive_cmds_CXX='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ archive_expsym_cmds_CXX='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -G $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+ fi
+
+ hardcode_libdir_flag_spec_CXX='${wl}-R $wl$libdir'
+ case $host_os in
+ solaris2.[0-5] | solaris2.[0-5].*) ;;
+ *)
+ whole_archive_flag_spec_CXX='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[01].[10]* | unixware7* | sco3.2v5.0.[024]*)
+ no_undefined_flag_CXX='${wl}-z,text'
+ archive_cmds_need_lc_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ archive_cmds_CXX='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ no_undefined_flag_CXX='${wl}-z,text'
+ allow_undefined_flag_CXX='${wl}-z,nodefs'
+ archive_cmds_need_lc_CXX=no
+ hardcode_shlibpath_var_CXX=no
+ hardcode_libdir_flag_spec_CXX='${wl}-R,$libdir'
+ hardcode_libdir_separator_CXX=':'
+ link_all_deplibs_CXX=yes
+ export_dynamic_flag_spec_CXX='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ archive_cmds_CXX='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ old_archive_cmds_CXX='$CC -Tprelink_objects $oldobjs~
+ '"$old_archive_cmds_CXX"
+ reload_cmds_CXX='$CC -Tprelink_objects $reload_objs~
+ '"$reload_cmds_CXX"
+ ;;
+ *)
+ archive_cmds_CXX='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ archive_expsym_cmds_CXX='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+ ;;
+
+ vxworks*)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+
+ *)
+ # FIXME: insert proper C++ library support
+ ld_shlibs_CXX=no
+ ;;
+ esac
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $ld_shlibs_CXX" >&5
+$as_echo "$ld_shlibs_CXX" >&6; }
+ test "$ld_shlibs_CXX" = no && can_build_shared=no
+
+ GCC_CXX="$GXX"
+ LD_CXX="$LD"
+
+ ## CAVEAT EMPTOR:
+ ## There is no encapsulation within the following macros, do not change
+ ## the running order or otherwise move them around unless you know exactly
+ ## what you are doing...
+ # Dependencies to place before and after the object being linked:
+predep_objects_CXX=
+postdep_objects_CXX=
+predeps_CXX=
+postdeps_CXX=
+compiler_lib_search_path_CXX=
+
+cat > conftest.$ac_ext <<_LT_EOF
+class Foo
+{
+public:
+ Foo (void) { a = 0; }
+private:
+ int a;
+};
+_LT_EOF
+
+
+_lt_libdeps_save_CFLAGS=$CFLAGS
+case "$CC $CFLAGS " in #(
+*\ -flto*\ *) CFLAGS="$CFLAGS -fno-lto" ;;
+*\ -fwhopr*\ *) CFLAGS="$CFLAGS -fno-whopr" ;;
+*\ -fuse-linker-plugin*\ *) CFLAGS="$CFLAGS -fno-use-linker-plugin" ;;
+esac
+
+if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }; then
+ # Parse the compiler output and extract the necessary
+ # objects, libraries and library flags.
+
+ # Sentinel used to keep track of whether or not we are before
+ # the conftest object file.
+ pre_test_object_deps_done=no
+
+ for p in `eval "$output_verbose_link_cmd"`; do
+ case ${prev}${p} in
+
+ -L* | -R* | -l*)
+ # Some compilers place space between "-{L,R}" and the path.
+ # Remove the space.
+ if test $p = "-L" ||
+ test $p = "-R"; then
+ prev=$p
+ continue
+ fi
+
+ # Expand the sysroot to ease extracting the directories later.
+ if test -z "$prev"; then
+ case $p in
+ -L*) func_stripname_cnf '-L' '' "$p"; prev=-L; p=$func_stripname_result ;;
+ -R*) func_stripname_cnf '-R' '' "$p"; prev=-R; p=$func_stripname_result ;;
+ -l*) func_stripname_cnf '-l' '' "$p"; prev=-l; p=$func_stripname_result ;;
+ esac
+ fi
+ case $p in
+ =*) func_stripname_cnf '=' '' "$p"; p=$lt_sysroot$func_stripname_result ;;
+ esac
+ if test "$pre_test_object_deps_done" = no; then
+ case ${prev} in
+ -L | -R)
+ # Internal compiler library paths should come after those
+ # provided the user. The postdeps already come after the
+ # user supplied libs so there is no need to process them.
+ if test -z "$compiler_lib_search_path_CXX"; then
+ compiler_lib_search_path_CXX="${prev}${p}"
+ else
+ compiler_lib_search_path_CXX="${compiler_lib_search_path_CXX} ${prev}${p}"
+ fi
+ ;;
+ # The "-l" case would never come before the object being
+ # linked, so don't bother handling this case.
+ esac
+ else
+ if test -z "$postdeps_CXX"; then
+ postdeps_CXX="${prev}${p}"
+ else
+ postdeps_CXX="${postdeps_CXX} ${prev}${p}"
+ fi
+ fi
+ prev=
+ ;;
+
+ *.lto.$objext) ;; # Ignore GCC LTO objects
+ *.$objext)
+ # This assumes that the test object file only shows up
+ # once in the compiler output.
+ if test "$p" = "conftest.$objext"; then
+ pre_test_object_deps_done=yes
+ continue
+ fi
+
+ if test "$pre_test_object_deps_done" = no; then
+ if test -z "$predep_objects_CXX"; then
+ predep_objects_CXX="$p"
+ else
+ predep_objects_CXX="$predep_objects_CXX $p"
+ fi
+ else
+ if test -z "$postdep_objects_CXX"; then
+ postdep_objects_CXX="$p"
+ else
+ postdep_objects_CXX="$postdep_objects_CXX $p"
+ fi
+ fi
+ ;;
+
+ *) ;; # Ignore the rest.
+
+ esac
+ done
+
+ # Clean up.
+ rm -f a.out a.exe
+else
+ echo "libtool.m4: error: problem compiling CXX test program"
+fi
+
+$RM -f confest.$objext
+CFLAGS=$_lt_libdeps_save_CFLAGS
+
+# PORTME: override above test on systems where it is broken
+case $host_os in
+interix[3-9]*)
+ # Interix 3.5 installs completely hosed .la files for C++, so rather than
+ # hack all around it, let's just trust "g++" to DTRT.
+ predep_objects_CXX=
+ postdep_objects_CXX=
+ postdeps_CXX=
+ ;;
+
+linux*)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ # Sun C++ 5.9
+
+ # The more standards-conforming stlport4 library is
+ # incompatible with the Cstd library. Avoid specifying
+ # it if it's in CXXFLAGS. Ignore libCrun as
+ # -library=stlport4 depends on it.
+ case " $CXX $CXXFLAGS " in
+ *" -library=stlport4 "*)
+ solaris_use_stlport4=yes
+ ;;
+ esac
+
+ if test "$solaris_use_stlport4" != yes; then
+ postdeps_CXX='-library=Cstd -library=Crun'
+ fi
+ ;;
+ esac
+ ;;
+
+solaris*)
+ case $cc_basename in
+ CC* | sunCC*)
+ # The more standards-conforming stlport4 library is
+ # incompatible with the Cstd library. Avoid specifying
+ # it if it's in CXXFLAGS. Ignore libCrun as
+ # -library=stlport4 depends on it.
+ case " $CXX $CXXFLAGS " in
+ *" -library=stlport4 "*)
+ solaris_use_stlport4=yes
+ ;;
+ esac
+
+ # Adding this requires a known-good setup of shared libraries for
+ # Sun compiler versions before 5.6, else PIC objects from an old
+ # archive will be linked into the output, leading to subtle bugs.
+ if test "$solaris_use_stlport4" != yes; then
+ postdeps_CXX='-library=Cstd -library=Crun'
+ fi
+ ;;
+ esac
+ ;;
+esac
+
+
+case " $postdeps_CXX " in
+*" -lc "*) archive_cmds_need_lc_CXX=no ;;
+esac
+ compiler_lib_search_dirs_CXX=
+if test -n "${compiler_lib_search_path_CXX}"; then
+ compiler_lib_search_dirs_CXX=`echo " ${compiler_lib_search_path_CXX}" | ${SED} -e 's! -L! !g' -e 's!^ !!'`
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ lt_prog_compiler_wl_CXX=
+lt_prog_compiler_pic_CXX=
+lt_prog_compiler_static_CXX=
+
+
+ # C++ specific cases for pic, static, wl, etc.
+ if test "$GXX" = yes; then
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_CXX='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ m68k)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ lt_prog_compiler_pic_CXX='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ esac
+ ;;
+
+ beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+ mingw* | cygwin* | os2* | pw32* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ # Although the cygwin gcc ignores -fPIC, still need this for old-style
+ # (--disable-auto-import) libraries
+ lt_prog_compiler_pic_CXX='-DDLL_EXPORT'
+ ;;
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ lt_prog_compiler_pic_CXX='-fno-common'
+ ;;
+ *djgpp*)
+ # DJGPP does not support shared libraries at all
+ lt_prog_compiler_pic_CXX=
+ ;;
+ haiku*)
+ # PIC is the default for Haiku.
+ # The "-static" flag exists, but is broken.
+ lt_prog_compiler_static_CXX=
+ ;;
+ interix[3-9]*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ lt_prog_compiler_pic_CXX=-Kconform_pic
+ fi
+ ;;
+ hpux*)
+ # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+ # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag
+ # sets the default TLS model and affects inlining.
+ case $host_cpu in
+ hppa*64*)
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ esac
+ ;;
+ *qnx* | *nto*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ lt_prog_compiler_pic_CXX='-fPIC -shared'
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ esac
+ else
+ case $host_os in
+ aix[4-9]*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ lt_prog_compiler_static_CXX='-Bstatic'
+ else
+ lt_prog_compiler_static_CXX='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ chorus*)
+ case $cc_basename in
+ cxch68*)
+ # Green Hills C++ Compiler
+ # _LT_TAGVAR(lt_prog_compiler_static, CXX)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a"
+ ;;
+ esac
+ ;;
+ mingw* | cygwin* | os2* | pw32* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ lt_prog_compiler_pic_CXX='-DDLL_EXPORT'
+ ;;
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ lt_prog_compiler_pic_CXX='-KPIC'
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ lt_prog_compiler_pic_CXX='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ freebsd* | dragonfly*)
+ # FreeBSD uses GNU C++
+ ;;
+ hpux9* | hpux10* | hpux11*)
+ case $cc_basename in
+ CC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='${wl}-a ${wl}archive'
+ if test "$host_cpu" != ia64; then
+ lt_prog_compiler_pic_CXX='+Z'
+ fi
+ ;;
+ aCC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='${wl}-a ${wl}archive'
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX='+Z'
+ ;;
+ esac
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ interix*)
+ # This is c89, which is MS Visual C++ (no shared libs)
+ # Anyone wants to do a port?
+ ;;
+ irix5* | irix6* | nonstopux*)
+ case $cc_basename in
+ CC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_static_CXX='-non_shared'
+ # CC pic flag -KPIC is the default.
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ case $cc_basename in
+ KCC*)
+ # KAI C++ Compiler
+ lt_prog_compiler_wl_CXX='--backend -Wl,'
+ lt_prog_compiler_pic_CXX='-fPIC'
+ ;;
+ ecpc* )
+ # old Intel C++ for x86_64 which still supported -KPIC.
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-static'
+ ;;
+ icpc* )
+ # Intel C++, used to be incompatible with GCC.
+ # ICC 10 doesn't accept -KPIC any more.
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-fPIC'
+ lt_prog_compiler_static_CXX='-static'
+ ;;
+ pgCC* | pgcpp*)
+ # Portland Group C++ compiler
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-fpic'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ ;;
+ cxx*)
+ # Compaq C++
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ lt_prog_compiler_pic_CXX=
+ lt_prog_compiler_static_CXX='-non_shared'
+ ;;
+ xlc* | xlC* | bgxl[cC]* | mpixl[cC]*)
+ # IBM XL 8.0, 9.0 on PPC and BlueGene
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-qpic'
+ lt_prog_compiler_static_CXX='-qstaticlink'
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ # Sun C++ 5.9
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ lt_prog_compiler_wl_CXX='-Qoption ld '
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+ lynxos*)
+ ;;
+ m88k*)
+ ;;
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ lt_prog_compiler_pic_CXX='-W c,exportall'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ netbsd*)
+ ;;
+ *qnx* | *nto*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ lt_prog_compiler_pic_CXX='-fPIC -shared'
+ ;;
+ osf3* | osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ lt_prog_compiler_wl_CXX='--backend -Wl,'
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ lt_prog_compiler_pic_CXX='-pic'
+ ;;
+ cxx*)
+ # Digital/Compaq C++
+ lt_prog_compiler_wl_CXX='-Wl,'
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ lt_prog_compiler_pic_CXX=
+ lt_prog_compiler_static_CXX='-non_shared'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ psos*)
+ ;;
+ solaris*)
+ case $cc_basename in
+ CC* | sunCC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ lt_prog_compiler_wl_CXX='-Qoption ld '
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ lt_prog_compiler_pic_CXX='-PIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ lt_prog_compiler_pic_CXX='-pic'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ ;;
+ lcc*)
+ # Lucid
+ lt_prog_compiler_pic_CXX='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ case $cc_basename in
+ CC*)
+ lt_prog_compiler_wl_CXX='-Wl,'
+ lt_prog_compiler_pic_CXX='-KPIC'
+ lt_prog_compiler_static_CXX='-Bstatic'
+ ;;
+ esac
+ ;;
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ lt_prog_compiler_pic_CXX='-KPIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ vxworks*)
+ ;;
+ *)
+ lt_prog_compiler_can_build_shared_CXX=no
+ ;;
+ esac
+ fi
+
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ lt_prog_compiler_pic_CXX=
+ ;;
+ *)
+ lt_prog_compiler_pic_CXX="$lt_prog_compiler_pic_CXX -DPIC"
+ ;;
+esac
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for $compiler option to produce PIC" >&5
+$as_echo_n "checking for $compiler option to produce PIC... " >&6; }
+if ${lt_cv_prog_compiler_pic_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_pic_CXX=$lt_prog_compiler_pic_CXX
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic_CXX" >&5
+$as_echo "$lt_cv_prog_compiler_pic_CXX" >&6; }
+lt_prog_compiler_pic_CXX=$lt_cv_prog_compiler_pic_CXX
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$lt_prog_compiler_pic_CXX"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler PIC flag $lt_prog_compiler_pic_CXX works" >&5
+$as_echo_n "checking if $compiler PIC flag $lt_prog_compiler_pic_CXX works... " >&6; }
+if ${lt_cv_prog_compiler_pic_works_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_pic_works_CXX=no
+ ac_outfile=conftest.$ac_objext
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$lt_prog_compiler_pic_CXX -DPIC"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_pic_works_CXX=yes
+ fi
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_pic_works_CXX" >&5
+$as_echo "$lt_cv_prog_compiler_pic_works_CXX" >&6; }
+
+if test x"$lt_cv_prog_compiler_pic_works_CXX" = xyes; then
+ case $lt_prog_compiler_pic_CXX in
+ "" | " "*) ;;
+ *) lt_prog_compiler_pic_CXX=" $lt_prog_compiler_pic_CXX" ;;
+ esac
+else
+ lt_prog_compiler_pic_CXX=
+ lt_prog_compiler_can_build_shared_CXX=no
+fi
+
+fi
+
+
+
+
+
+#
+# Check to make sure the static flag actually works.
+#
+wl=$lt_prog_compiler_wl_CXX eval lt_tmp_static_flag=\"$lt_prog_compiler_static_CXX\"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler static flag $lt_tmp_static_flag works" >&5
+$as_echo_n "checking if $compiler static flag $lt_tmp_static_flag works... " >&6; }
+if ${lt_cv_prog_compiler_static_works_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_static_works_CXX=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $lt_tmp_static_flag"
+ echo "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&5
+ $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_static_works_CXX=yes
+ fi
+ else
+ lt_cv_prog_compiler_static_works_CXX=yes
+ fi
+ fi
+ $RM -r conftest*
+ LDFLAGS="$save_LDFLAGS"
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_static_works_CXX" >&5
+$as_echo "$lt_cv_prog_compiler_static_works_CXX" >&6; }
+
+if test x"$lt_cv_prog_compiler_static_works_CXX" = xyes; then
+ :
+else
+ lt_prog_compiler_static_CXX=
+fi
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_c_o_CXX=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o_CXX=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o_CXX" >&5
+$as_echo "$lt_cv_prog_compiler_c_o_CXX" >&6; }
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if $compiler supports -c -o file.$ac_objext" >&5
+$as_echo_n "checking if $compiler supports -c -o file.$ac_objext... " >&6; }
+if ${lt_cv_prog_compiler_c_o_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_prog_compiler_c_o_CXX=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [^ ]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&5)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&5
+ echo "$as_me:$LINENO: \$? = $ac_status" >&5
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ lt_cv_prog_compiler_c_o_CXX=yes
+ fi
+ fi
+ chmod u+w . 2>&5
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_prog_compiler_c_o_CXX" >&5
+$as_echo "$lt_cv_prog_compiler_c_o_CXX" >&6; }
+
+
+
+
+hard_links="nottested"
+if test "$lt_cv_prog_compiler_c_o_CXX" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking if we can lock with hard links" >&5
+$as_echo_n "checking if we can lock with hard links... " >&6; }
+ hard_links=yes
+ $RM conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: $hard_links" >&5
+$as_echo "$hard_links" >&6; }
+ if test "$hard_links" = no; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&5
+$as_echo "$as_me: WARNING: \`$CC' does not support \`-c -o', so \`make -j' may be unsafe" >&2;}
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether the $compiler linker ($LD) supports shared libraries" >&5
+$as_echo_n "checking whether the $compiler linker ($LD) supports shared libraries... " >&6; }
+
+ export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ exclude_expsyms_CXX='_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*'
+ case $host_os in
+ aix[4-9]*)
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ # Also, AIX nm treats weak defined symbols like other global defined
+ # symbols, whereas GNU nm marks them as "W".
+ if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+ export_symbols_cmds_CXX='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ else
+ export_symbols_cmds_CXX='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && (substr(\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ fi
+ ;;
+ pw32*)
+ export_symbols_cmds_CXX="$ltdll_cmds"
+ ;;
+ cygwin* | mingw* | cegcc*)
+ case $cc_basename in
+ cl*)
+ exclude_expsyms_CXX='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+ ;;
+ *)
+ export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[BCDGRS][ ]/s/.*[ ]\([^ ]*\)/\1 DATA/;s/^.*[ ]__nm__\([^ ]*\)[ ][^ ]*/\1 DATA/;/^I[ ]/d;/^[AITW][ ]/s/.* //'\'' | sort | uniq > $export_symbols'
+ exclude_expsyms_CXX='[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname'
+ ;;
+ esac
+ ;;
+ *)
+ export_symbols_cmds_CXX='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ ;;
+ esac
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ld_shlibs_CXX" >&5
+$as_echo "$ld_shlibs_CXX" >&6; }
+test "$ld_shlibs_CXX" = no && can_build_shared=no
+
+with_gnu_ld_CXX=$with_gnu_ld
+
+
+
+
+
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$archive_cmds_need_lc_CXX" in
+x|xyes)
+ # Assume -lc should be added
+ archive_cmds_need_lc_CXX=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $archive_cmds_CXX in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking whether -lc should be explicitly linked in" >&5
+$as_echo_n "checking whether -lc should be explicitly linked in... " >&6; }
+if ${lt_cv_archive_cmds_need_lc_CXX+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ $RM conftest*
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$ac_compile\""; } >&5
+ (eval $ac_compile) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; } 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$lt_prog_compiler_wl_CXX
+ pic_flag=$lt_prog_compiler_pic_CXX
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$allow_undefined_flag_CXX
+ allow_undefined_flag_CXX=
+ if { { eval echo "\"\$as_me\":${as_lineno-$LINENO}: \"$archive_cmds_CXX 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1\""; } >&5
+ (eval $archive_cmds_CXX 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1) 2>&5
+ ac_status=$?
+ $as_echo "$as_me:${as_lineno-$LINENO}: \$? = $ac_status" >&5
+ test $ac_status = 0; }
+ then
+ lt_cv_archive_cmds_need_lc_CXX=no
+ else
+ lt_cv_archive_cmds_need_lc_CXX=yes
+ fi
+ allow_undefined_flag_CXX=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $RM conftest*
+
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $lt_cv_archive_cmds_need_lc_CXX" >&5
+$as_echo "$lt_cv_archive_cmds_need_lc_CXX" >&6; }
+ archive_cmds_need_lc_CXX=$lt_cv_archive_cmds_need_lc_CXX
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking dynamic linker characteristics" >&5
+$as_echo_n "checking dynamic linker characteristics... " >&6; }
+
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix[4-9]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[01] | aix4.[01].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib.so
+ # instead of lib.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ case $host_cpu in
+ powerpc)
+ # Since July 2007 AmigaOS4 officially supports .so libraries.
+ # When compiling the executable, add -use-dynld -Lsobjs: to the compileline.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ ;;
+ m68k)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+ esac
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[45]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32* | cegcc*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$cc_basename in
+ yes,*)
+ # gcc
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname~
+ if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+ eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+ fi'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+
+ ;;
+ mingw* | cegcc*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ ;;
+
+ *,cl*)
+ # Native MSVC
+ libname_spec='$name'
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext}'
+ library_names_spec='${libname}.dll.lib'
+
+ case $build_os in
+ mingw*)
+ sys_lib_search_path_spec=
+ lt_save_ifs=$IFS
+ IFS=';'
+ for lt_path in $LIB
+ do
+ IFS=$lt_save_ifs
+ # Let DOS variable expansion print the short 8.3 style file name.
+ lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"`
+ sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path"
+ done
+ IFS=$lt_save_ifs
+ # Convert to MSYS style.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([a-zA-Z]\\):| /\\1|g' -e 's|^ ||'`
+ ;;
+ cygwin*)
+ # Convert to unix form, then to dos form, then back to unix form
+ # but this time dos style (no spaces!) so that the unix form looks
+ # like /cygdrive/c/PROGRA~1:/cygdr...
+ sys_lib_search_path_spec=`cygpath --path --unix "$LIB"`
+ sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null`
+ sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ *)
+ sys_lib_search_path_spec="$LIB"
+ if $ECHO "$sys_lib_search_path_spec" | $GREP ';[c-zC-Z]:/' >/dev/null; then
+ # It is most probably a Windows format PATH.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ # FIXME: find the short name or the path components, as spaces are
+ # common. (e.g. "Program Files" -> "PROGRA~1")
+ ;;
+ esac
+
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+ dynamic_linker='Win32 link.exe'
+ ;;
+
+ *)
+ # Assume MSVC wrapper
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[.]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ dynamic_linker='Win32 ld.exe'
+ ;;
+ esac
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[23].*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2.*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[01]* | freebsdelf3.[01]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[2-9]* | freebsdelf3.[2-9]* | \
+ freebsd4.[0-5] | freebsdelf4.[0-5] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ *) # from 4.6 on, and DragonFly
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+haiku*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ dynamic_linker="$host_os runtime_loader"
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib'
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555, ...
+ postinstall_cmds='chmod 555 $lib'
+ # or fails outright, so override atomically:
+ install_override_mode=555
+ ;;
+
+interix[3-9]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+
+ # Some binutils ld are patched to set DT_RUNPATH
+ if ${lt_cv_shlibpath_overrides_runpath+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ lt_cv_shlibpath_overrides_runpath=no
+ save_LDFLAGS=$LDFLAGS
+ save_libdir=$libdir
+ eval "libdir=/foo; wl=\"$lt_prog_compiler_wl_CXX\"; \
+ LDFLAGS=\"\$LDFLAGS $hardcode_libdir_flag_spec_CXX\""
+ cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+int
+main ()
+{
+
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_cxx_try_link "$LINENO"; then :
+ if ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null; then :
+ lt_cv_shlibpath_overrides_runpath=yes
+fi
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+ LDFLAGS=$save_LDFLAGS
+ libdir=$save_libdir
+
+fi
+
+ shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath
+
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \$2)); skip = 1; } { if (!skip) print \$0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+*nto* | *qnx*)
+ version_type=qnx
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='ldqnx.so'
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[89] | openbsd2.[89].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+rdos*)
+ dynamic_linker=no
+ ;;
+
+solaris*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+tpf*)
+ # TPF is a cross-target only. Preferred cross-host = GNU/Linux.
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+uts4*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $dynamic_linker" >&5
+$as_echo "$dynamic_linker" >&6; }
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then
+ sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec"
+fi
+if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then
+ sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec"
+fi
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking how to hardcode library paths into programs" >&5
+$as_echo_n "checking how to hardcode library paths into programs... " >&6; }
+hardcode_action_CXX=
+if test -n "$hardcode_libdir_flag_spec_CXX" ||
+ test -n "$runpath_var_CXX" ||
+ test "X$hardcode_automatic_CXX" = "Xyes" ; then
+
+ # We can hardcode non-existent directories.
+ if test "$hardcode_direct_CXX" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_TAGVAR(hardcode_shlibpath_var, CXX)" != no &&
+ test "$hardcode_minus_L_CXX" != no; then
+ # Linking always hardcodes the temporary library directory.
+ hardcode_action_CXX=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ hardcode_action_CXX=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ hardcode_action_CXX=unsupported
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $hardcode_action_CXX" >&5
+$as_echo "$hardcode_action_CXX" >&6; }
+
+if test "$hardcode_action_CXX" = relink ||
+ test "$inherit_rpath_CXX" = yes; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+
+
+
+
+
+
+
+ fi # test -n "$compiler"
+
+ CC=$lt_save_CC
+ CFLAGS=$lt_save_CFLAGS
+ LDCXX=$LD
+ LD=$lt_save_LD
+ GCC=$lt_save_GCC
+ with_gnu_ld=$lt_save_with_gnu_ld
+ lt_cv_path_LDCXX=$lt_cv_path_LD
+ lt_cv_path_LD=$lt_save_path_LD
+ lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld
+ lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld
+fi # test "$_lt_caught_CXX_error" != yes
+
+ac_ext=c
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5'
+ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5'
+ac_compiler_gnu=$ac_cv_c_compiler_gnu
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ ac_config_commands="$ac_config_commands libtool"
+
+
+
+
+# Only expand once:
+
+
+
+: ${CONFIG_LT=./config.lt}
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_LT" >&5
+$as_echo "$as_me: creating $CONFIG_LT" >&6;}
+as_write_fail=0
+cat >"$CONFIG_LT" <<_ASEOF || as_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+# Run this file to recreate a libtool stub with the current configuration.
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>"$CONFIG_LT" <<\_ASEOF || as_write_fail=1
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+ && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='print -r --'
+ as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='printf %s\n'
+ as_echo_n='printf %s'
+else
+ if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+ as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+ as_echo_n='/usr/ucb/echo -n'
+ else
+ as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+ as_echo_n_body='eval
+ arg=$1;
+ case $arg in #(
+ *"$as_nl"*)
+ expr "X$arg" : "X\\(.*\\)$as_nl";
+ arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+ esac;
+ expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+ '
+ export as_echo_n_body
+ as_echo_n='sh -c $as_echo_n_body as_echo'
+ fi
+ export as_echo_body
+ as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ PATH_SEPARATOR=:
+ (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+ (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+ PATH_SEPARATOR=';'
+ }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order. Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" "" $as_nl"
+
+# Find who we are. Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+ as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+ $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+ exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there. '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+ && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+ as_status=$1; test $as_status -eq 0 && as_status=1
+ if test "$4"; then
+ as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+ fi
+ $as_echo "$as_me: error: $2" >&2
+ as_fn_exit $as_status
+} # as_fn_error
+
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+ return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+ set +e
+ as_fn_set_status $1
+ exit $1
+} # as_fn_exit
+
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+ { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+ eval 'as_fn_append ()
+ {
+ eval $1+=\$2
+ }'
+else
+ as_fn_append ()
+ {
+ eval $1=\$$1\$2
+ }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+ eval 'as_fn_arith ()
+ {
+ as_val=$(( $* ))
+ }'
+else
+ as_fn_arith ()
+ {
+ as_val=`expr "$@" || test $? -eq 1`
+ }
+fi # as_fn_arith
+
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+ test "X`expr 00001 : '.*\(...\)'`" = X001; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+ as_dirname=dirname
+else
+ as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+ case `echo 'xy\c'` in
+ *c*) ECHO_T=' ';; # ECHO_T is single tab character.
+ xy) ECHO_C='\c';;
+ *) echo `echo ksh88 bug on AIX 6.1` > /dev/null
+ ECHO_T=' ';;
+ esac;;
+*)
+ ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+ rm -f conf$$.dir/conf$$.file
+else
+ rm -f conf$$.dir
+ mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+ if ln -s conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s='ln -s'
+ # ... but there are two gotchas:
+ # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+ # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+ # In both cases, we have to default to `cp -pR'.
+ ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+ as_ln_s='cp -pR'
+ elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+ else
+ as_ln_s='cp -pR'
+ fi
+else
+ as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+ case $as_dir in #(
+ -*) as_dir=./$as_dir;;
+ esac
+ test -d "$as_dir" || eval $as_mkdir_p || {
+ as_dirs=
+ while :; do
+ case $as_dir in #(
+ *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+ *) as_qdir=$as_dir;;
+ esac
+ as_dirs="'$as_qdir' $as_dirs"
+ as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ test -d "$as_dir" && break
+ done
+ test -z "$as_dirs" || eval "mkdir $as_dirs"
+ } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p='mkdir -p "$as_dir"'
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+ test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+exec 6>&1
+## --------------------------------- ##
+## Main body of "$CONFIG_LT" script. ##
+## --------------------------------- ##
+_ASEOF
+test $as_write_fail = 0 && chmod +x "$CONFIG_LT"
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+lt_cl_silent=false
+exec 5>>config.log
+{
+ echo
+ sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX
+## Running $as_me. ##
+_ASBOX
+} >&5
+
+lt_cl_help="\
+\`$as_me' creates a local libtool stub from the current configuration,
+for use in further configure time tests before the real libtool is
+generated.
+
+Usage: $0 [OPTIONS]
+
+ -h, --help print this help, then exit
+ -V, --version print version number, then exit
+ -q, --quiet do not print progress messages
+ -d, --debug don't remove temporary files
+
+Report bugs to ."
+
+lt_cl_version="\
+finalcut config.lt 0.1.0b
+configured by $0, generated by GNU Autoconf 2.69.
+
+Copyright (C) 2011 Free Software Foundation, Inc.
+This config.lt script is free software; the Free Software Foundation
+gives unlimited permision to copy, distribute and modify it."
+
+while test $# != 0
+do
+ case $1 in
+ --version | --v* | -V )
+ echo "$lt_cl_version"; exit 0 ;;
+ --help | --h* | -h )
+ echo "$lt_cl_help"; exit 0 ;;
+ --debug | --d* | -d )
+ debug=: ;;
+ --quiet | --q* | --silent | --s* | -q )
+ lt_cl_silent=: ;;
+
+ -*) as_fn_error $? "unrecognized option: $1
+Try \`$0 --help' for more information." "$LINENO" 5 ;;
+
+ *) as_fn_error $? "unrecognized argument: $1
+Try \`$0 --help' for more information." "$LINENO" 5 ;;
+ esac
+ shift
+done
+
+if $lt_cl_silent; then
+ exec 6>/dev/null
+fi
+_LTEOF
+
+cat >>"$CONFIG_LT" <<_LTEOF
+
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`'
+enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`'
+macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`'
+macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`'
+pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`'
+enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`'
+SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`'
+ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`'
+PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`'
+host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`'
+host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`'
+host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`'
+build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`'
+build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`'
+build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`'
+SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`'
+Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`'
+GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`'
+EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`'
+FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`'
+LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`'
+NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`'
+LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`'
+max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`'
+ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`'
+exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`'
+lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`'
+lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`'
+lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`'
+reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`'
+reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`'
+OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`'
+deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`'
+file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`'
+file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`'
+want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`'
+DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`'
+sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`'
+AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`'
+AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`'
+archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`'
+STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`'
+RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`'
+old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`'
+lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`'
+CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`'
+CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`'
+compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`'
+GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`'
+nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`'
+lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`'
+objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`'
+MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`'
+need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`'
+MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`'
+DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`'
+NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`'
+LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`'
+OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`'
+OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`'
+libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`'
+shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`'
+extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`'
+hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`'
+inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`'
+always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`'
+include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`'
+prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`'
+postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`'
+file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`'
+variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`'
+need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`'
+need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`'
+version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`'
+runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`'
+libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`'
+library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`'
+soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`'
+install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`'
+postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`'
+finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`'
+hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`'
+sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`'
+sys_lib_dlsearch_path_spec='`$ECHO "$sys_lib_dlsearch_path_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`'
+enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`'
+old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`'
+striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_dirs='`$ECHO "$compiler_lib_search_dirs" | $SED "$delay_single_quote_subst"`'
+predep_objects='`$ECHO "$predep_objects" | $SED "$delay_single_quote_subst"`'
+postdep_objects='`$ECHO "$postdep_objects" | $SED "$delay_single_quote_subst"`'
+predeps='`$ECHO "$predeps" | $SED "$delay_single_quote_subst"`'
+postdeps='`$ECHO "$postdeps" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_path='`$ECHO "$compiler_lib_search_path" | $SED "$delay_single_quote_subst"`'
+LD_CXX='`$ECHO "$LD_CXX" | $SED "$delay_single_quote_subst"`'
+reload_flag_CXX='`$ECHO "$reload_flag_CXX" | $SED "$delay_single_quote_subst"`'
+reload_cmds_CXX='`$ECHO "$reload_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds_CXX='`$ECHO "$old_archive_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_CXX='`$ECHO "$compiler_CXX" | $SED "$delay_single_quote_subst"`'
+GCC_CXX='`$ECHO "$GCC_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag_CXX='`$ECHO "$lt_prog_compiler_no_builtin_flag_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic_CXX='`$ECHO "$lt_prog_compiler_pic_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl_CXX='`$ECHO "$lt_prog_compiler_wl_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static_CXX='`$ECHO "$lt_prog_compiler_static_CXX" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o_CXX='`$ECHO "$lt_cv_prog_compiler_c_o_CXX" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc_CXX='`$ECHO "$archive_cmds_need_lc_CXX" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes_CXX='`$ECHO "$enable_shared_with_static_runtimes_CXX" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec_CXX='`$ECHO "$export_dynamic_flag_spec_CXX" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec_CXX='`$ECHO "$whole_archive_flag_spec_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object_CXX='`$ECHO "$compiler_needs_object_CXX" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds_CXX='`$ECHO "$old_archive_from_new_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds_CXX='`$ECHO "$old_archive_from_expsyms_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+archive_cmds_CXX='`$ECHO "$archive_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds_CXX='`$ECHO "$archive_expsym_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+module_cmds_CXX='`$ECHO "$module_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds_CXX='`$ECHO "$module_expsym_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld_CXX='`$ECHO "$with_gnu_ld_CXX" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag_CXX='`$ECHO "$allow_undefined_flag_CXX" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag_CXX='`$ECHO "$no_undefined_flag_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec_CXX='`$ECHO "$hardcode_libdir_flag_spec_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator_CXX='`$ECHO "$hardcode_libdir_separator_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_CXX='`$ECHO "$hardcode_direct_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute_CXX='`$ECHO "$hardcode_direct_absolute_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L_CXX='`$ECHO "$hardcode_minus_L_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var_CXX='`$ECHO "$hardcode_shlibpath_var_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic_CXX='`$ECHO "$hardcode_automatic_CXX" | $SED "$delay_single_quote_subst"`'
+inherit_rpath_CXX='`$ECHO "$inherit_rpath_CXX" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs_CXX='`$ECHO "$link_all_deplibs_CXX" | $SED "$delay_single_quote_subst"`'
+always_export_symbols_CXX='`$ECHO "$always_export_symbols_CXX" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds_CXX='`$ECHO "$export_symbols_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms_CXX='`$ECHO "$exclude_expsyms_CXX" | $SED "$delay_single_quote_subst"`'
+include_expsyms_CXX='`$ECHO "$include_expsyms_CXX" | $SED "$delay_single_quote_subst"`'
+prelink_cmds_CXX='`$ECHO "$prelink_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+postlink_cmds_CXX='`$ECHO "$postlink_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+file_list_spec_CXX='`$ECHO "$file_list_spec_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_action_CXX='`$ECHO "$hardcode_action_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_dirs_CXX='`$ECHO "$compiler_lib_search_dirs_CXX" | $SED "$delay_single_quote_subst"`'
+predep_objects_CXX='`$ECHO "$predep_objects_CXX" | $SED "$delay_single_quote_subst"`'
+postdep_objects_CXX='`$ECHO "$postdep_objects_CXX" | $SED "$delay_single_quote_subst"`'
+predeps_CXX='`$ECHO "$predeps_CXX" | $SED "$delay_single_quote_subst"`'
+postdeps_CXX='`$ECHO "$postdeps_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_path_CXX='`$ECHO "$compiler_lib_search_path_CXX" | $SED "$delay_single_quote_subst"`'
+
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in SHELL \
+ECHO \
+PATH_SEPARATOR \
+SED \
+GREP \
+EGREP \
+FGREP \
+LD \
+NM \
+LN_S \
+lt_SP2NL \
+lt_NL2SP \
+reload_flag \
+OBJDUMP \
+deplibs_check_method \
+file_magic_cmd \
+file_magic_glob \
+want_nocaseglob \
+DLLTOOL \
+sharedlib_from_linklib_cmd \
+AR \
+AR_FLAGS \
+archiver_list_spec \
+STRIP \
+RANLIB \
+CC \
+CFLAGS \
+compiler \
+lt_cv_sys_global_symbol_pipe \
+lt_cv_sys_global_symbol_to_cdecl \
+lt_cv_sys_global_symbol_to_c_name_address \
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \
+nm_file_list_spec \
+lt_prog_compiler_no_builtin_flag \
+lt_prog_compiler_pic \
+lt_prog_compiler_wl \
+lt_prog_compiler_static \
+lt_cv_prog_compiler_c_o \
+need_locks \
+MANIFEST_TOOL \
+DSYMUTIL \
+NMEDIT \
+LIPO \
+OTOOL \
+OTOOL64 \
+shrext_cmds \
+export_dynamic_flag_spec \
+whole_archive_flag_spec \
+compiler_needs_object \
+with_gnu_ld \
+allow_undefined_flag \
+no_undefined_flag \
+hardcode_libdir_flag_spec \
+hardcode_libdir_separator \
+exclude_expsyms \
+include_expsyms \
+file_list_spec \
+variables_saved_for_relink \
+libname_spec \
+library_names_spec \
+soname_spec \
+install_override_mode \
+finish_eval \
+old_striplib \
+striplib \
+compiler_lib_search_dirs \
+predep_objects \
+postdep_objects \
+predeps \
+postdeps \
+compiler_lib_search_path \
+LD_CXX \
+reload_flag_CXX \
+compiler_CXX \
+lt_prog_compiler_no_builtin_flag_CXX \
+lt_prog_compiler_pic_CXX \
+lt_prog_compiler_wl_CXX \
+lt_prog_compiler_static_CXX \
+lt_cv_prog_compiler_c_o_CXX \
+export_dynamic_flag_spec_CXX \
+whole_archive_flag_spec_CXX \
+compiler_needs_object_CXX \
+with_gnu_ld_CXX \
+allow_undefined_flag_CXX \
+no_undefined_flag_CXX \
+hardcode_libdir_flag_spec_CXX \
+hardcode_libdir_separator_CXX \
+exclude_expsyms_CXX \
+include_expsyms_CXX \
+file_list_spec_CXX \
+compiler_lib_search_dirs_CXX \
+predep_objects_CXX \
+postdep_objects_CXX \
+predeps_CXX \
+postdeps_CXX \
+compiler_lib_search_path_CXX; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\""
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+# Double-quote double-evaled strings.
+for var in reload_cmds \
+old_postinstall_cmds \
+old_postuninstall_cmds \
+old_archive_cmds \
+extract_expsyms_cmds \
+old_archive_from_new_cmds \
+old_archive_from_expsyms_cmds \
+archive_cmds \
+archive_expsym_cmds \
+module_cmds \
+module_expsym_cmds \
+export_symbols_cmds \
+prelink_cmds \
+postlink_cmds \
+postinstall_cmds \
+postuninstall_cmds \
+finish_cmds \
+sys_lib_search_path_spec \
+sys_lib_dlsearch_path_spec \
+reload_cmds_CXX \
+old_archive_cmds_CXX \
+old_archive_from_new_cmds_CXX \
+old_archive_from_expsyms_cmds_CXX \
+archive_cmds_CXX \
+archive_expsym_cmds_CXX \
+module_cmds_CXX \
+module_expsym_cmds_CXX \
+export_symbols_cmds_CXX \
+prelink_cmds_CXX \
+postlink_cmds_CXX; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\""
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+ac_aux_dir='$ac_aux_dir'
+xsi_shell='$xsi_shell'
+lt_shell_append='$lt_shell_append'
+
+# See if we are running on zsh, and set the options which allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+fi
+
+
+ PACKAGE='$PACKAGE'
+ VERSION='$VERSION'
+ TIMESTAMP='$TIMESTAMP'
+ RM='$RM'
+ ofile='$ofile'
+
+
+
+
+
+_LTEOF
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $ofile" >&5
+$as_echo "$as_me: creating $ofile" >&6;}
+
+
+ # See if we are running on zsh, and set the options which allow our
+ # commands through without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+
+ cfgfile="${ofile}T"
+ trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+ $RM "$cfgfile"
+
+ cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+
+# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+# 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+# Foundation, Inc.
+# Written by Gordon Matzigkeit, 1996
+#
+# This file is part of GNU Libtool.
+#
+# GNU Libtool is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING. If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html, or
+# obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+# The names of the tagged configurations supported by this script.
+available_tags="CXX "
+
+# ### BEGIN LIBTOOL CONFIG
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Which release of libtool.m4 was used?
+macro_version=$macro_version
+macro_revision=$macro_revision
+
+# What type of objects to build.
+pic_mode=$pic_mode
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# An echo program that protects backslashes.
+ECHO=$lt_ECHO
+
+# The PATH separator for the build system.
+PATH_SEPARATOR=$lt_PATH_SEPARATOR
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="\$SED -e 1s/^X//"
+
+# A grep program that handles long lines.
+GREP=$lt_GREP
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# A literal string matcher.
+FGREP=$lt_FGREP
+
+# A BSD- or MS-compatible name lister.
+NM=$lt_NM
+
+# Whether we need soft or hard links.
+LN_S=$lt_LN_S
+
+# What is the maximum length of a command?
+max_cmd_len=$max_cmd_len
+
+# Object file suffix (normally "o").
+objext=$ac_objext
+
+# Executable file suffix (normally "").
+exeext=$exeext
+
+# whether the shell understands "unset".
+lt_unset=$lt_unset
+
+# turn spaces into newlines.
+SP2NL=$lt_lt_SP2NL
+
+# turn newlines into spaces.
+NL2SP=$lt_lt_NL2SP
+
+# convert \$build file names to \$host format.
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+
+# convert \$build files to toolchain format.
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+
+# An object symbol dumper.
+OBJDUMP=$lt_OBJDUMP
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method = "file_magic".
+file_magic_cmd=$lt_file_magic_cmd
+
+# How to find potential files when deplibs_check_method = "file_magic".
+file_magic_glob=$lt_file_magic_glob
+
+# Find potential files using nocaseglob when deplibs_check_method = "file_magic".
+want_nocaseglob=$lt_want_nocaseglob
+
+# DLL creation program.
+DLLTOOL=$lt_DLLTOOL
+
+# Command to associate shared and link libraries.
+sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd
+
+# The archiver.
+AR=$lt_AR
+
+# Flags to create an archive.
+AR_FLAGS=$lt_AR_FLAGS
+
+# How to feed a file listing to the archiver.
+archiver_list_spec=$lt_archiver_list_spec
+
+# A symbol stripping program.
+STRIP=$lt_STRIP
+
+# Commands used to install an old-style archive.
+RANLIB=$lt_RANLIB
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Whether to use a lock for old archive extraction.
+lock_old_archive_extraction=$lock_old_archive_extraction
+
+# A C compiler.
+LTCC=$lt_CC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_CFLAGS
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration.
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair.
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# Transform the output of nm in a C name address pair when lib prefix is needed.
+global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix
+
+# Specify filename containing input files for \$NM.
+nm_file_list_spec=$lt_nm_file_list_spec
+
+# The root where to search for dependent libraries,and in which our libraries should be installed.
+lt_sysroot=$lt_sysroot
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# Used to examine libraries when file_magic_cmd begins with "file".
+MAGIC_CMD=$MAGIC_CMD
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Manifest tool.
+MANIFEST_TOOL=$lt_MANIFEST_TOOL
+
+# Tool to manipulate archived DWARF debug symbol files on Mac OS X.
+DSYMUTIL=$lt_DSYMUTIL
+
+# Tool to change global to local symbols on Mac OS X.
+NMEDIT=$lt_NMEDIT
+
+# Tool to manipulate fat objects and archives on Mac OS X.
+LIPO=$lt_LIPO
+
+# ldd/readelf like tool for Mach-O binaries on Mac OS X.
+OTOOL=$lt_OTOOL
+
+# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4.
+OTOOL64=$lt_OTOOL64
+
+# Old archive suffix (normally "a").
+libext=$libext
+
+# Shared library suffix (normally ".so").
+shrext_cmds=$lt_shrext_cmds
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at link time.
+variables_saved_for_relink=$lt_variables_saved_for_relink
+
+# Do we need the "lib" prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Library versioning type.
+version_type=$version_type
+
+# Shared library runtime path variable.
+runpath_var=$runpath_var
+
+# Shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Permission mode override for installation of shared libraries.
+install_override_mode=$lt_install_override_mode
+
+# Command to use after installation of a shared archive.
+postinstall_cmds=$lt_postinstall_cmds
+
+# Command to use after uninstallation of a shared archive.
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# As "finish_cmds", except a single script fragment to be evaled but
+# not shown.
+finish_eval=$lt_finish_eval
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Compile-time system search path for libraries.
+sys_lib_search_path_spec=$lt_sys_lib_search_path_spec
+
+# Run-time system search path for libraries.
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+
+# The linker used to build libraries.
+LD=$lt_LD
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds
+
+# A language specific compiler.
+CC=$lt_compiler
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds
+archive_expsym_cmds=$lt_archive_expsym_cmds
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds
+module_expsym_cmds=$lt_module_expsym_cmds
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \${shlibpath_var} if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# The directories searched by this compiler when creating a shared library.
+compiler_lib_search_dirs=$lt_compiler_lib_search_dirs
+
+# Dependencies to place before and after the objects being linked to
+# create a shared library.
+predep_objects=$lt_predep_objects
+postdep_objects=$lt_postdep_objects
+predeps=$lt_predeps
+postdeps=$lt_postdeps
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=$lt_compiler_lib_search_path
+
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+ case $host_os in
+ aix3*)
+ cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+_LT_EOF
+ ;;
+ esac
+
+
+ltmain="$ac_aux_dir/ltmain.sh"
+
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" \
+ || (rm -f "$cfgfile"; exit 1)
+
+ if test x"$xsi_shell" = xyes; then
+ sed -e '/^func_dirname ()$/,/^} # func_dirname /c\
+func_dirname ()\
+{\
+\ case ${1} in\
+\ */*) func_dirname_result="${1%/*}${2}" ;;\
+\ * ) func_dirname_result="${3}" ;;\
+\ esac\
+} # Extended-shell func_dirname implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_basename ()$/,/^} # func_basename /c\
+func_basename ()\
+{\
+\ func_basename_result="${1##*/}"\
+} # Extended-shell func_basename implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_dirname_and_basename ()$/,/^} # func_dirname_and_basename /c\
+func_dirname_and_basename ()\
+{\
+\ case ${1} in\
+\ */*) func_dirname_result="${1%/*}${2}" ;;\
+\ * ) func_dirname_result="${3}" ;;\
+\ esac\
+\ func_basename_result="${1##*/}"\
+} # Extended-shell func_dirname_and_basename implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_stripname ()$/,/^} # func_stripname /c\
+func_stripname ()\
+{\
+\ # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are\
+\ # positional parameters, so assign one to ordinary parameter first.\
+\ func_stripname_result=${3}\
+\ func_stripname_result=${func_stripname_result#"${1}"}\
+\ func_stripname_result=${func_stripname_result%"${2}"}\
+} # Extended-shell func_stripname implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_split_long_opt ()$/,/^} # func_split_long_opt /c\
+func_split_long_opt ()\
+{\
+\ func_split_long_opt_name=${1%%=*}\
+\ func_split_long_opt_arg=${1#*=}\
+} # Extended-shell func_split_long_opt implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_split_short_opt ()$/,/^} # func_split_short_opt /c\
+func_split_short_opt ()\
+{\
+\ func_split_short_opt_arg=${1#??}\
+\ func_split_short_opt_name=${1%"$func_split_short_opt_arg"}\
+} # Extended-shell func_split_short_opt implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_lo2o ()$/,/^} # func_lo2o /c\
+func_lo2o ()\
+{\
+\ case ${1} in\
+\ *.lo) func_lo2o_result=${1%.lo}.${objext} ;;\
+\ *) func_lo2o_result=${1} ;;\
+\ esac\
+} # Extended-shell func_lo2o implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_xform ()$/,/^} # func_xform /c\
+func_xform ()\
+{\
+ func_xform_result=${1%.*}.lo\
+} # Extended-shell func_xform implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_arith ()$/,/^} # func_arith /c\
+func_arith ()\
+{\
+ func_arith_result=$(( $* ))\
+} # Extended-shell func_arith implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_len ()$/,/^} # func_len /c\
+func_len ()\
+{\
+ func_len_result=${#1}\
+} # Extended-shell func_len implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+fi
+
+if test x"$lt_shell_append" = xyes; then
+ sed -e '/^func_append ()$/,/^} # func_append /c\
+func_append ()\
+{\
+ eval "${1}+=\\${2}"\
+} # Extended-shell func_append implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_append_quoted ()$/,/^} # func_append_quoted /c\
+func_append_quoted ()\
+{\
+\ func_quote_for_eval "${2}"\
+\ eval "${1}+=\\\\ \\$func_quote_for_eval_result"\
+} # Extended-shell func_append_quoted implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ # Save a `func_append' function call where possible by direct use of '+='
+ sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+ test 0 -eq $? || _lt_function_replace_fail=:
+else
+ # Save a `func_append' function call even when '+=' is not available
+ sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+ test 0 -eq $? || _lt_function_replace_fail=:
+fi
+
+if test x"$_lt_function_replace_fail" = x":"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Unable to substitute extended shell functions in $ofile" >&5
+$as_echo "$as_me: WARNING: Unable to substitute extended shell functions in $ofile" >&2;}
+fi
+
+
+ mv -f "$cfgfile" "$ofile" ||
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+
+
+ cat <<_LT_EOF >> "$ofile"
+
+# ### BEGIN LIBTOOL TAG CONFIG: CXX
+
+# The linker used to build libraries.
+LD=$lt_LD_CXX
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag_CXX
+reload_cmds=$lt_reload_cmds_CXX
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds_CXX
+
+# A language specific compiler.
+CC=$lt_compiler_CXX
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC_CXX
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_CXX
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic_CXX
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl_CXX
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static_CXX
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o_CXX
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc_CXX
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_CXX
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_CXX
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec_CXX
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object_CXX
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_CXX
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_CXX
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds_CXX
+archive_expsym_cmds=$lt_archive_expsym_cmds_CXX
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds_CXX
+module_expsym_cmds=$lt_module_expsym_cmds_CXX
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld_CXX
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag_CXX
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag_CXX
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_CXX
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator_CXX
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct_CXX
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \${shlibpath_var} if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute_CXX
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L_CXX
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var_CXX
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic_CXX
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath_CXX
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs_CXX
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols_CXX
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds_CXX
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms_CXX
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms_CXX
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds_CXX
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds_CXX
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec_CXX
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action_CXX
+
+# The directories searched by this compiler when creating a shared library.
+compiler_lib_search_dirs=$lt_compiler_lib_search_dirs_CXX
+
+# Dependencies to place before and after the objects being linked to
+# create a shared library.
+predep_objects=$lt_predep_objects_CXX
+postdep_objects=$lt_postdep_objects_CXX
+predeps=$lt_predeps_CXX
+postdeps=$lt_postdeps_CXX
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=$lt_compiler_lib_search_path_CXX
+
+# ### END LIBTOOL TAG CONFIG: CXX
+_LT_EOF
+
+
+as_fn_exit 0
+_LTEOF
+chmod +x "$CONFIG_LT"
+
+# configure is writing to config.log, but config.lt does its own redirection,
+# appending to config.log, which fails on DOS, as config.log is still kept
+# open by configure. Here we exec the FD to /dev/null, effectively closing
+# config.log, so it can be properly (re)opened and appended to by config.lt.
+lt_cl_success=:
+test "$silent" = yes &&
+ lt_config_lt_args="$lt_config_lt_args --quiet"
+exec 5>/dev/null
+$SHELL "$CONFIG_LT" $lt_config_lt_args || lt_cl_success=false
+exec 5>>config.log
+$lt_cl_success || as_fn_exit 1
+
+
+### This defines the version number of the installed .so files
+### using libtool's versioning system.
+SO_VERSION="0:0:0"
+
+
+
+
+
+
+ac_config_files="$ac_config_files Makefile src/Makefile src/fonts/Makefile doc/Makefile test/Makefile"
+
+
+# use GPM (General Purpose Mouse)
+
+# Check whether --with-gpm was given.
+if test "${with_gpm+set}" = set; then :
+ withval=$with_gpm;
+else
+ with_gpm=yes
+fi
+
+
+if test "x$with_gpm" != "xno"
+then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: checking for main in -lgpm" >&5
+$as_echo_n "checking for main in -lgpm... " >&6; }
+if ${ac_cv_lib_gpm_main+:} false; then :
+ $as_echo_n "(cached) " >&6
+else
+ ac_check_lib_save_LIBS=$LIBS
+LIBS="-lgpm $LIBS"
+cat confdefs.h - <<_ACEOF >conftest.$ac_ext
+/* end confdefs.h. */
+
+
+int
+main ()
+{
+return main ();
+ ;
+ return 0;
+}
+_ACEOF
+if ac_fn_c_try_link "$LINENO"; then :
+ ac_cv_lib_gpm_main=yes
+else
+ ac_cv_lib_gpm_main=no
+fi
+rm -f core conftest.err conftest.$ac_objext \
+ conftest$ac_exeext conftest.$ac_ext
+LIBS=$ac_check_lib_save_LIBS
+fi
+{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_gpm_main" >&5
+$as_echo "$ac_cv_lib_gpm_main" >&6; }
+if test "x$ac_cv_lib_gpm_main" = xyes; then :
+ $as_echo "#define HAVE_LIBGPM 1" >>confdefs.h
+ LIBS="$LIBS -lgpm"
+fi
+
+fi
+
+cat >confcache <<\_ACEOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs, see configure's option --config-cache.
+# It is not useful on other systems. If it contains results you don't
+# want to keep, you may remove or edit it.
+#
+# config.status only pays attention to the cache file if you give it
+# the --recheck option to rerun configure.
+#
+# `ac_cv_env_foo' variables (set or unset) will be overridden when
+# loading this file, other *unset* `ac_cv_foo' will be assigned the
+# following values.
+
+_ACEOF
+
+# The following way of writing the cache mishandles newlines in values,
+# but we know of no workaround that is simple, portable, and efficient.
+# So, we kill variables containing newlines.
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+(
+ for ac_var in `(set) 2>&1 | sed -n 's/^\([a-zA-Z_][a-zA-Z0-9_]*\)=.*/\1/p'`; do
+ eval ac_val=\$$ac_var
+ case $ac_val in #(
+ *${as_nl}*)
+ case $ac_var in #(
+ *_cv_*) { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: cache variable $ac_var contains a newline" >&5
+$as_echo "$as_me: WARNING: cache variable $ac_var contains a newline" >&2;} ;;
+ esac
+ case $ac_var in #(
+ _ | IFS | as_nl) ;; #(
+ BASH_ARGV | BASH_SOURCE) eval $ac_var= ;; #(
+ *) { eval $ac_var=; unset $ac_var;} ;;
+ esac ;;
+ esac
+ done
+
+ (set) 2>&1 |
+ case $as_nl`(ac_space=' '; set) 2>&1` in #(
+ *${as_nl}ac_space=\ *)
+ # `set' does not quote correctly, so add quotes: double-quote
+ # substitution turns \\\\ into \\, and sed turns \\ into \.
+ sed -n \
+ "s/'/'\\\\''/g;
+ s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p"
+ ;; #(
+ *)
+ # `set' quotes correctly as required by POSIX, so do not add quotes.
+ sed -n "/^[_$as_cr_alnum]*_cv_[_$as_cr_alnum]*=/p"
+ ;;
+ esac |
+ sort
+) |
+ sed '
+ /^ac_cv_env_/b end
+ t clear
+ :clear
+ s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/
+ t end
+ s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/
+ :end' >>confcache
+if diff "$cache_file" confcache >/dev/null 2>&1; then :; else
+ if test -w "$cache_file"; then
+ if test "x$cache_file" != "x/dev/null"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: updating cache $cache_file" >&5
+$as_echo "$as_me: updating cache $cache_file" >&6;}
+ if test ! -f "$cache_file" || test -h "$cache_file"; then
+ cat confcache >"$cache_file"
+ else
+ case $cache_file in #(
+ */* | ?:*)
+ mv -f confcache "$cache_file"$$ &&
+ mv -f "$cache_file"$$ "$cache_file" ;; #(
+ *)
+ mv -f confcache "$cache_file" ;;
+ esac
+ fi
+ fi
+ else
+ { $as_echo "$as_me:${as_lineno-$LINENO}: not updating unwritable cache $cache_file" >&5
+$as_echo "$as_me: not updating unwritable cache $cache_file" >&6;}
+ fi
+fi
+rm -f confcache
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+# Transform confdefs.h into DEFS.
+# Protect against shell expansion while executing Makefile rules.
+# Protect against Makefile macro expansion.
+#
+# If the first sed substitution is executed (which looks for macros that
+# take arguments), then branch to the quote section. Otherwise,
+# look for a macro that doesn't take arguments.
+ac_script='
+:mline
+/\\$/{
+ N
+ s,\\\n,,
+ b mline
+}
+t clear
+:clear
+s/^[ ]*#[ ]*define[ ][ ]*\([^ (][^ (]*([^)]*)\)[ ]*\(.*\)/-D\1=\2/g
+t quote
+s/^[ ]*#[ ]*define[ ][ ]*\([^ ][^ ]*\)[ ]*\(.*\)/-D\1=\2/g
+t quote
+b any
+:quote
+s/[ `~#$^&*(){}\\|;'\''"<>?]/\\&/g
+s/\[/\\&/g
+s/\]/\\&/g
+s/\$/$$/g
+H
+:any
+${
+ g
+ s/^\n//
+ s/\n/ /g
+ p
+}
+'
+DEFS=`sed -n "$ac_script" confdefs.h`
+
+
+ac_libobjs=
+ac_ltlibobjs=
+U=
+for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue
+ # 1. Remove the extension, and $U if already installed.
+ ac_script='s/\$U\././;s/\.o$//;s/\.obj$//'
+ ac_i=`$as_echo "$ac_i" | sed "$ac_script"`
+ # 2. Prepend LIBOBJDIR. When used with automake>=1.10 LIBOBJDIR
+ # will be set to the directory where LIBOBJS objects are built.
+ as_fn_append ac_libobjs " \${LIBOBJDIR}$ac_i\$U.$ac_objext"
+ as_fn_append ac_ltlibobjs " \${LIBOBJDIR}$ac_i"'$U.lo'
+done
+LIBOBJS=$ac_libobjs
+
+LTLIBOBJS=$ac_ltlibobjs
+
+
+{ $as_echo "$as_me:${as_lineno-$LINENO}: checking that generated files are newer than configure" >&5
+$as_echo_n "checking that generated files are newer than configure... " >&6; }
+ if test -n "$am_sleep_pid"; then
+ # Hide warnings about reused PIDs.
+ wait $am_sleep_pid 2>/dev/null
+ fi
+ { $as_echo "$as_me:${as_lineno-$LINENO}: result: done" >&5
+$as_echo "done" >&6; }
+ if test -n "$EXEEXT"; then
+ am__EXEEXT_TRUE=
+ am__EXEEXT_FALSE='#'
+else
+ am__EXEEXT_TRUE='#'
+ am__EXEEXT_FALSE=
+fi
+
+if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then
+ as_fn_error $? "conditional \"AMDEP\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then
+ as_fn_error $? "conditional \"am__fastdepCC\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+if test -z "${am__fastdepCXX_TRUE}" && test -z "${am__fastdepCXX_FALSE}"; then
+ as_fn_error $? "conditional \"am__fastdepCXX\" was never defined.
+Usually this means the macro was only invoked conditionally." "$LINENO" 5
+fi
+
+: "${CONFIG_STATUS=./config.status}"
+ac_write_fail=0
+ac_clean_files_save=$ac_clean_files
+ac_clean_files="$ac_clean_files $CONFIG_STATUS"
+{ $as_echo "$as_me:${as_lineno-$LINENO}: creating $CONFIG_STATUS" >&5
+$as_echo "$as_me: creating $CONFIG_STATUS" >&6;}
+as_write_fail=0
+cat >$CONFIG_STATUS <<_ASEOF || as_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+# Run this file to recreate the current configuration.
+# Compiler output produced by configure, useful for debugging
+# configure, is in config.log if it exists.
+
+debug=false
+ac_cs_recheck=false
+ac_cs_silent=false
+
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>$CONFIG_STATUS <<\_ASEOF || as_write_fail=1
+## -------------------- ##
+## M4sh Initialization. ##
+## -------------------- ##
+
+# Be more Bourne compatible
+DUALCASE=1; export DUALCASE # for MKS sh
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then :
+ emulate sh
+ NULLCMD=:
+ # Pre-4.2 versions of Zsh do word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in #(
+ *posix*) :
+ set -o posix ;; #(
+ *) :
+ ;;
+esac
+fi
+
+
+as_nl='
+'
+export as_nl
+# Printing a long string crashes Solaris 7 /usr/bin/printf.
+as_echo='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo
+as_echo=$as_echo$as_echo$as_echo$as_echo$as_echo$as_echo
+# Prefer a ksh shell builtin over an external printf program on Solaris,
+# but without wasting forks for bash or zsh.
+if test -z "$BASH_VERSION$ZSH_VERSION" \
+ && (test "X`print -r -- $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='print -r --'
+ as_echo_n='print -rn --'
+elif (test "X`printf %s $as_echo`" = "X$as_echo") 2>/dev/null; then
+ as_echo='printf %s\n'
+ as_echo_n='printf %s'
+else
+ if test "X`(/usr/ucb/echo -n -n $as_echo) 2>/dev/null`" = "X-n $as_echo"; then
+ as_echo_body='eval /usr/ucb/echo -n "$1$as_nl"'
+ as_echo_n='/usr/ucb/echo -n'
+ else
+ as_echo_body='eval expr "X$1" : "X\\(.*\\)"'
+ as_echo_n_body='eval
+ arg=$1;
+ case $arg in #(
+ *"$as_nl"*)
+ expr "X$arg" : "X\\(.*\\)$as_nl";
+ arg=`expr "X$arg" : ".*$as_nl\\(.*\\)"`;;
+ esac;
+ expr "X$arg" : "X\\(.*\\)" | tr -d "$as_nl"
+ '
+ export as_echo_n_body
+ as_echo_n='sh -c $as_echo_n_body as_echo'
+ fi
+ export as_echo_body
+ as_echo='sh -c $as_echo_body as_echo'
+fi
+
+# The user is always right.
+if test "${PATH_SEPARATOR+set}" != set; then
+ PATH_SEPARATOR=:
+ (PATH='/bin;/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 && {
+ (PATH='/bin:/bin'; FPATH=$PATH; sh -c :) >/dev/null 2>&1 ||
+ PATH_SEPARATOR=';'
+ }
+fi
+
+
+# IFS
+# We need space, tab and new line, in precisely that order. Quoting is
+# there to prevent editors from complaining about space-tab.
+# (If _AS_PATH_WALK were called with IFS unset, it would disable word
+# splitting by setting IFS to empty value.)
+IFS=" "" $as_nl"
+
+# Find who we are. Look in the path if we contain no directory separator.
+as_myself=
+case $0 in #((
+ *[\\/]* ) as_myself=$0 ;;
+ *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break
+ done
+IFS=$as_save_IFS
+
+ ;;
+esac
+# We did not find ourselves, most probably we were run as `sh COMMAND'
+# in which case we are not to be found in the path.
+if test "x$as_myself" = x; then
+ as_myself=$0
+fi
+if test ! -f "$as_myself"; then
+ $as_echo "$as_myself: error: cannot find myself; rerun with an absolute file name" >&2
+ exit 1
+fi
+
+# Unset variables that we do not need and which cause bugs (e.g. in
+# pre-3.0 UWIN ksh). But do not cause bugs in bash 2.01; the "|| exit 1"
+# suppresses any "Segmentation fault" message there. '((' could
+# trigger a bug in pdksh 5.2.14.
+for as_var in BASH_ENV ENV MAIL MAILPATH
+do eval test x\${$as_var+set} = xset \
+ && ( (unset $as_var) || exit 1) >/dev/null 2>&1 && unset $as_var || :
+done
+PS1='$ '
+PS2='> '
+PS4='+ '
+
+# NLS nuisances.
+LC_ALL=C
+export LC_ALL
+LANGUAGE=C
+export LANGUAGE
+
+# CDPATH.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+
+# as_fn_error STATUS ERROR [LINENO LOG_FD]
+# ----------------------------------------
+# Output "`basename $0`: error: ERROR" to stderr. If LINENO and LOG_FD are
+# provided, also output the error to LOG_FD, referencing LINENO. Then exit the
+# script with STATUS, using 1 if that was 0.
+as_fn_error ()
+{
+ as_status=$1; test $as_status -eq 0 && as_status=1
+ if test "$4"; then
+ as_lineno=${as_lineno-"$3"} as_lineno_stack=as_lineno_stack=$as_lineno_stack
+ $as_echo "$as_me:${as_lineno-$LINENO}: error: $2" >&$4
+ fi
+ $as_echo "$as_me: error: $2" >&2
+ as_fn_exit $as_status
+} # as_fn_error
+
+
+# as_fn_set_status STATUS
+# -----------------------
+# Set $? to STATUS, without forking.
+as_fn_set_status ()
+{
+ return $1
+} # as_fn_set_status
+
+# as_fn_exit STATUS
+# -----------------
+# Exit the shell with STATUS, even in a "trap 0" or "set -e" context.
+as_fn_exit ()
+{
+ set +e
+ as_fn_set_status $1
+ exit $1
+} # as_fn_exit
+
+# as_fn_unset VAR
+# ---------------
+# Portably unset VAR.
+as_fn_unset ()
+{
+ { eval $1=; unset $1;}
+}
+as_unset=as_fn_unset
+# as_fn_append VAR VALUE
+# ----------------------
+# Append the text in VALUE to the end of the definition contained in VAR. Take
+# advantage of any shell optimizations that allow amortized linear growth over
+# repeated appends, instead of the typical quadratic growth present in naive
+# implementations.
+if (eval "as_var=1; as_var+=2; test x\$as_var = x12") 2>/dev/null; then :
+ eval 'as_fn_append ()
+ {
+ eval $1+=\$2
+ }'
+else
+ as_fn_append ()
+ {
+ eval $1=\$$1\$2
+ }
+fi # as_fn_append
+
+# as_fn_arith ARG...
+# ------------------
+# Perform arithmetic evaluation on the ARGs, and store the result in the
+# global $as_val. Take advantage of shells that can avoid forks. The arguments
+# must be portable across $(()) and expr.
+if (eval "test \$(( 1 + 1 )) = 2") 2>/dev/null; then :
+ eval 'as_fn_arith ()
+ {
+ as_val=$(( $* ))
+ }'
+else
+ as_fn_arith ()
+ {
+ as_val=`expr "$@" || test $? -eq 1`
+ }
+fi # as_fn_arith
+
+
+if expr a : '\(a\)' >/dev/null 2>&1 &&
+ test "X`expr 00001 : '.*\(...\)'`" = X001; then
+ as_expr=expr
+else
+ as_expr=false
+fi
+
+if (basename -- /) >/dev/null 2>&1 && test "X`basename -- / 2>&1`" = "X/"; then
+ as_basename=basename
+else
+ as_basename=false
+fi
+
+if (as_dir=`dirname -- /` && test "X$as_dir" = X/) >/dev/null 2>&1; then
+ as_dirname=dirname
+else
+ as_dirname=false
+fi
+
+as_me=`$as_basename -- "$0" ||
+$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \
+ X"$0" : 'X\(//\)$' \| \
+ X"$0" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X/"$0" |
+ sed '/^.*\/\([^/][^/]*\)\/*$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\/\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+
+# Avoid depending upon Character Ranges.
+as_cr_letters='abcdefghijklmnopqrstuvwxyz'
+as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+as_cr_Letters=$as_cr_letters$as_cr_LETTERS
+as_cr_digits='0123456789'
+as_cr_alnum=$as_cr_Letters$as_cr_digits
+
+ECHO_C= ECHO_N= ECHO_T=
+case `echo -n x` in #(((((
+-n*)
+ case `echo 'xy\c'` in
+ *c*) ECHO_T=' ';; # ECHO_T is single tab character.
+ xy) ECHO_C='\c';;
+ *) echo `echo ksh88 bug on AIX 6.1` > /dev/null
+ ECHO_T=' ';;
+ esac;;
+*)
+ ECHO_N='-n';;
+esac
+
+rm -f conf$$ conf$$.exe conf$$.file
+if test -d conf$$.dir; then
+ rm -f conf$$.dir/conf$$.file
+else
+ rm -f conf$$.dir
+ mkdir conf$$.dir 2>/dev/null
+fi
+if (echo >conf$$.file) 2>/dev/null; then
+ if ln -s conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s='ln -s'
+ # ... but there are two gotchas:
+ # 1) On MSYS, both `ln -s file dir' and `ln file dir' fail.
+ # 2) DJGPP < 2.04 has no symlinks; `ln -s' creates a wrapper executable.
+ # In both cases, we have to default to `cp -pR'.
+ ln -s conf$$.file conf$$.dir 2>/dev/null && test ! -f conf$$.exe ||
+ as_ln_s='cp -pR'
+ elif ln conf$$.file conf$$ 2>/dev/null; then
+ as_ln_s=ln
+ else
+ as_ln_s='cp -pR'
+ fi
+else
+ as_ln_s='cp -pR'
+fi
+rm -f conf$$ conf$$.exe conf$$.dir/conf$$.file conf$$.file
+rmdir conf$$.dir 2>/dev/null
+
+
+# as_fn_mkdir_p
+# -------------
+# Create "$as_dir" as a directory, including parents if necessary.
+as_fn_mkdir_p ()
+{
+
+ case $as_dir in #(
+ -*) as_dir=./$as_dir;;
+ esac
+ test -d "$as_dir" || eval $as_mkdir_p || {
+ as_dirs=
+ while :; do
+ case $as_dir in #(
+ *\'*) as_qdir=`$as_echo "$as_dir" | sed "s/'/'\\\\\\\\''/g"`;; #'(
+ *) as_qdir=$as_dir;;
+ esac
+ as_dirs="'$as_qdir' $as_dirs"
+ as_dir=`$as_dirname -- "$as_dir" ||
+$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$as_dir" : 'X\(//\)[^/]' \| \
+ X"$as_dir" : 'X\(//\)$' \| \
+ X"$as_dir" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$as_dir" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ test -d "$as_dir" && break
+ done
+ test -z "$as_dirs" || eval "mkdir $as_dirs"
+ } || test -d "$as_dir" || as_fn_error $? "cannot create directory $as_dir"
+
+
+} # as_fn_mkdir_p
+if mkdir -p . 2>/dev/null; then
+ as_mkdir_p='mkdir -p "$as_dir"'
+else
+ test -d ./-p && rmdir ./-p
+ as_mkdir_p=false
+fi
+
+
+# as_fn_executable_p FILE
+# -----------------------
+# Test if FILE is an executable regular file.
+as_fn_executable_p ()
+{
+ test -f "$1" && test -x "$1"
+} # as_fn_executable_p
+as_test_x='test -x'
+as_executable_p=as_fn_executable_p
+
+# Sed expression to map a string onto a valid CPP name.
+as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'"
+
+# Sed expression to map a string onto a valid variable name.
+as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'"
+
+
+exec 6>&1
+## ----------------------------------- ##
+## Main body of $CONFIG_STATUS script. ##
+## ----------------------------------- ##
+_ASEOF
+test $as_write_fail = 0 && chmod +x $CONFIG_STATUS || ac_write_fail=1
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# Save the log message, to keep $0 and so on meaningful, and to
+# report actual input values of CONFIG_FILES etc. instead of their
+# values after options handling.
+ac_log="
+This file was extended by finalcut $as_me 0.1.0b, which was
+generated by GNU Autoconf 2.69. Invocation command line was
+
+ CONFIG_FILES = $CONFIG_FILES
+ CONFIG_HEADERS = $CONFIG_HEADERS
+ CONFIG_LINKS = $CONFIG_LINKS
+ CONFIG_COMMANDS = $CONFIG_COMMANDS
+ $ $0 $@
+
+on `(hostname || uname -n) 2>/dev/null | sed 1q`
+"
+
+_ACEOF
+
+case $ac_config_files in *"
+"*) set x $ac_config_files; shift; ac_config_files=$*;;
+esac
+
+
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+# Files that config.status was made for.
+config_files="$ac_config_files"
+config_commands="$ac_config_commands"
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+ac_cs_usage="\
+\`$as_me' instantiates files and other configuration actions
+from templates according to the current configuration. Unless the files
+and actions are specified as TAGs, all are instantiated by default.
+
+Usage: $0 [OPTION]... [TAG]...
+
+ -h, --help print this help, then exit
+ -V, --version print version number and configuration settings, then exit
+ --config print configuration, then exit
+ -q, --quiet, --silent
+ do not print progress messages
+ -d, --debug don't remove temporary files
+ --recheck update $as_me by reconfiguring in the same conditions
+ --file=FILE[:TEMPLATE]
+ instantiate the configuration file FILE
+
+Configuration files:
+$config_files
+
+Configuration commands:
+$config_commands
+
+Report bugs to the package provider."
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ac_cs_config="`$as_echo "$ac_configure_args" | sed 's/^ //; s/[\\""\`\$]/\\\\&/g'`"
+ac_cs_version="\\
+finalcut config.status 0.1.0b
+configured by $0, generated by GNU Autoconf 2.69,
+ with options \\"\$ac_cs_config\\"
+
+Copyright (C) 2012 Free Software Foundation, Inc.
+This config.status script is free software; the Free Software Foundation
+gives unlimited permission to copy, distribute and modify it."
+
+ac_pwd='$ac_pwd'
+srcdir='$srcdir'
+INSTALL='$INSTALL'
+MKDIR_P='$MKDIR_P'
+AWK='$AWK'
+test -n "\$AWK" || AWK=awk
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# The default lists apply if the user does not specify any file.
+ac_need_defaults=:
+while test $# != 0
+do
+ case $1 in
+ --*=?*)
+ ac_option=`expr "X$1" : 'X\([^=]*\)='`
+ ac_optarg=`expr "X$1" : 'X[^=]*=\(.*\)'`
+ ac_shift=:
+ ;;
+ --*=)
+ ac_option=`expr "X$1" : 'X\([^=]*\)='`
+ ac_optarg=
+ ac_shift=:
+ ;;
+ *)
+ ac_option=$1
+ ac_optarg=$2
+ ac_shift=shift
+ ;;
+ esac
+
+ case $ac_option in
+ # Handling of the options.
+ -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+ ac_cs_recheck=: ;;
+ --version | --versio | --versi | --vers | --ver | --ve | --v | -V )
+ $as_echo "$ac_cs_version"; exit ;;
+ --config | --confi | --conf | --con | --co | --c )
+ $as_echo "$ac_cs_config"; exit ;;
+ --debug | --debu | --deb | --de | --d | -d )
+ debug=: ;;
+ --file | --fil | --fi | --f )
+ $ac_shift
+ case $ac_optarg in
+ *\'*) ac_optarg=`$as_echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` ;;
+ '') as_fn_error $? "missing file argument" ;;
+ esac
+ as_fn_append CONFIG_FILES " '$ac_optarg'"
+ ac_need_defaults=false;;
+ --he | --h | --help | --hel | -h )
+ $as_echo "$ac_cs_usage"; exit ;;
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil | --si | --s)
+ ac_cs_silent=: ;;
+
+ # This is an error.
+ -*) as_fn_error $? "unrecognized option: \`$1'
+Try \`$0 --help' for more information." ;;
+
+ *) as_fn_append ac_config_targets " $1"
+ ac_need_defaults=false ;;
+
+ esac
+ shift
+done
+
+ac_configure_extra_args=
+
+if $ac_cs_silent; then
+ exec 6>/dev/null
+ ac_configure_extra_args="$ac_configure_extra_args --silent"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+if \$ac_cs_recheck; then
+ set X $SHELL '$0' $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion
+ shift
+ \$as_echo "running CONFIG_SHELL=$SHELL \$*" >&6
+ CONFIG_SHELL='$SHELL'
+ export CONFIG_SHELL
+ exec "\$@"
+fi
+
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+exec 5>>config.log
+{
+ echo
+ sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX
+## Running $as_me. ##
+_ASBOX
+ $as_echo "$ac_log"
+} >&5
+
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+#
+# INIT-COMMANDS
+#
+AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"
+
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+enable_shared='`$ECHO "$enable_shared" | $SED "$delay_single_quote_subst"`'
+enable_static='`$ECHO "$enable_static" | $SED "$delay_single_quote_subst"`'
+macro_version='`$ECHO "$macro_version" | $SED "$delay_single_quote_subst"`'
+macro_revision='`$ECHO "$macro_revision" | $SED "$delay_single_quote_subst"`'
+pic_mode='`$ECHO "$pic_mode" | $SED "$delay_single_quote_subst"`'
+enable_fast_install='`$ECHO "$enable_fast_install" | $SED "$delay_single_quote_subst"`'
+SHELL='`$ECHO "$SHELL" | $SED "$delay_single_quote_subst"`'
+ECHO='`$ECHO "$ECHO" | $SED "$delay_single_quote_subst"`'
+PATH_SEPARATOR='`$ECHO "$PATH_SEPARATOR" | $SED "$delay_single_quote_subst"`'
+host_alias='`$ECHO "$host_alias" | $SED "$delay_single_quote_subst"`'
+host='`$ECHO "$host" | $SED "$delay_single_quote_subst"`'
+host_os='`$ECHO "$host_os" | $SED "$delay_single_quote_subst"`'
+build_alias='`$ECHO "$build_alias" | $SED "$delay_single_quote_subst"`'
+build='`$ECHO "$build" | $SED "$delay_single_quote_subst"`'
+build_os='`$ECHO "$build_os" | $SED "$delay_single_quote_subst"`'
+SED='`$ECHO "$SED" | $SED "$delay_single_quote_subst"`'
+Xsed='`$ECHO "$Xsed" | $SED "$delay_single_quote_subst"`'
+GREP='`$ECHO "$GREP" | $SED "$delay_single_quote_subst"`'
+EGREP='`$ECHO "$EGREP" | $SED "$delay_single_quote_subst"`'
+FGREP='`$ECHO "$FGREP" | $SED "$delay_single_quote_subst"`'
+LD='`$ECHO "$LD" | $SED "$delay_single_quote_subst"`'
+NM='`$ECHO "$NM" | $SED "$delay_single_quote_subst"`'
+LN_S='`$ECHO "$LN_S" | $SED "$delay_single_quote_subst"`'
+max_cmd_len='`$ECHO "$max_cmd_len" | $SED "$delay_single_quote_subst"`'
+ac_objext='`$ECHO "$ac_objext" | $SED "$delay_single_quote_subst"`'
+exeext='`$ECHO "$exeext" | $SED "$delay_single_quote_subst"`'
+lt_unset='`$ECHO "$lt_unset" | $SED "$delay_single_quote_subst"`'
+lt_SP2NL='`$ECHO "$lt_SP2NL" | $SED "$delay_single_quote_subst"`'
+lt_NL2SP='`$ECHO "$lt_NL2SP" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_host_file_cmd='`$ECHO "$lt_cv_to_host_file_cmd" | $SED "$delay_single_quote_subst"`'
+lt_cv_to_tool_file_cmd='`$ECHO "$lt_cv_to_tool_file_cmd" | $SED "$delay_single_quote_subst"`'
+reload_flag='`$ECHO "$reload_flag" | $SED "$delay_single_quote_subst"`'
+reload_cmds='`$ECHO "$reload_cmds" | $SED "$delay_single_quote_subst"`'
+OBJDUMP='`$ECHO "$OBJDUMP" | $SED "$delay_single_quote_subst"`'
+deplibs_check_method='`$ECHO "$deplibs_check_method" | $SED "$delay_single_quote_subst"`'
+file_magic_cmd='`$ECHO "$file_magic_cmd" | $SED "$delay_single_quote_subst"`'
+file_magic_glob='`$ECHO "$file_magic_glob" | $SED "$delay_single_quote_subst"`'
+want_nocaseglob='`$ECHO "$want_nocaseglob" | $SED "$delay_single_quote_subst"`'
+DLLTOOL='`$ECHO "$DLLTOOL" | $SED "$delay_single_quote_subst"`'
+sharedlib_from_linklib_cmd='`$ECHO "$sharedlib_from_linklib_cmd" | $SED "$delay_single_quote_subst"`'
+AR='`$ECHO "$AR" | $SED "$delay_single_quote_subst"`'
+AR_FLAGS='`$ECHO "$AR_FLAGS" | $SED "$delay_single_quote_subst"`'
+archiver_list_spec='`$ECHO "$archiver_list_spec" | $SED "$delay_single_quote_subst"`'
+STRIP='`$ECHO "$STRIP" | $SED "$delay_single_quote_subst"`'
+RANLIB='`$ECHO "$RANLIB" | $SED "$delay_single_quote_subst"`'
+old_postinstall_cmds='`$ECHO "$old_postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_postuninstall_cmds='`$ECHO "$old_postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds='`$ECHO "$old_archive_cmds" | $SED "$delay_single_quote_subst"`'
+lock_old_archive_extraction='`$ECHO "$lock_old_archive_extraction" | $SED "$delay_single_quote_subst"`'
+CC='`$ECHO "$CC" | $SED "$delay_single_quote_subst"`'
+CFLAGS='`$ECHO "$CFLAGS" | $SED "$delay_single_quote_subst"`'
+compiler='`$ECHO "$compiler" | $SED "$delay_single_quote_subst"`'
+GCC='`$ECHO "$GCC" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_pipe='`$ECHO "$lt_cv_sys_global_symbol_pipe" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_cdecl='`$ECHO "$lt_cv_sys_global_symbol_to_cdecl" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address" | $SED "$delay_single_quote_subst"`'
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix='`$ECHO "$lt_cv_sys_global_symbol_to_c_name_address_lib_prefix" | $SED "$delay_single_quote_subst"`'
+nm_file_list_spec='`$ECHO "$nm_file_list_spec" | $SED "$delay_single_quote_subst"`'
+lt_sysroot='`$ECHO "$lt_sysroot" | $SED "$delay_single_quote_subst"`'
+objdir='`$ECHO "$objdir" | $SED "$delay_single_quote_subst"`'
+MAGIC_CMD='`$ECHO "$MAGIC_CMD" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag='`$ECHO "$lt_prog_compiler_no_builtin_flag" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic='`$ECHO "$lt_prog_compiler_pic" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl='`$ECHO "$lt_prog_compiler_wl" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static='`$ECHO "$lt_prog_compiler_static" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o='`$ECHO "$lt_cv_prog_compiler_c_o" | $SED "$delay_single_quote_subst"`'
+need_locks='`$ECHO "$need_locks" | $SED "$delay_single_quote_subst"`'
+MANIFEST_TOOL='`$ECHO "$MANIFEST_TOOL" | $SED "$delay_single_quote_subst"`'
+DSYMUTIL='`$ECHO "$DSYMUTIL" | $SED "$delay_single_quote_subst"`'
+NMEDIT='`$ECHO "$NMEDIT" | $SED "$delay_single_quote_subst"`'
+LIPO='`$ECHO "$LIPO" | $SED "$delay_single_quote_subst"`'
+OTOOL='`$ECHO "$OTOOL" | $SED "$delay_single_quote_subst"`'
+OTOOL64='`$ECHO "$OTOOL64" | $SED "$delay_single_quote_subst"`'
+libext='`$ECHO "$libext" | $SED "$delay_single_quote_subst"`'
+shrext_cmds='`$ECHO "$shrext_cmds" | $SED "$delay_single_quote_subst"`'
+extract_expsyms_cmds='`$ECHO "$extract_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc='`$ECHO "$archive_cmds_need_lc" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes='`$ECHO "$enable_shared_with_static_runtimes" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec='`$ECHO "$export_dynamic_flag_spec" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec='`$ECHO "$whole_archive_flag_spec" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object='`$ECHO "$compiler_needs_object" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds='`$ECHO "$old_archive_from_new_cmds" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds='`$ECHO "$old_archive_from_expsyms_cmds" | $SED "$delay_single_quote_subst"`'
+archive_cmds='`$ECHO "$archive_cmds" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds='`$ECHO "$archive_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+module_cmds='`$ECHO "$module_cmds" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds='`$ECHO "$module_expsym_cmds" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld='`$ECHO "$with_gnu_ld" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag='`$ECHO "$allow_undefined_flag" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag='`$ECHO "$no_undefined_flag" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec='`$ECHO "$hardcode_libdir_flag_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator='`$ECHO "$hardcode_libdir_separator" | $SED "$delay_single_quote_subst"`'
+hardcode_direct='`$ECHO "$hardcode_direct" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute='`$ECHO "$hardcode_direct_absolute" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L='`$ECHO "$hardcode_minus_L" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var='`$ECHO "$hardcode_shlibpath_var" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic='`$ECHO "$hardcode_automatic" | $SED "$delay_single_quote_subst"`'
+inherit_rpath='`$ECHO "$inherit_rpath" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs='`$ECHO "$link_all_deplibs" | $SED "$delay_single_quote_subst"`'
+always_export_symbols='`$ECHO "$always_export_symbols" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds='`$ECHO "$export_symbols_cmds" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms='`$ECHO "$exclude_expsyms" | $SED "$delay_single_quote_subst"`'
+include_expsyms='`$ECHO "$include_expsyms" | $SED "$delay_single_quote_subst"`'
+prelink_cmds='`$ECHO "$prelink_cmds" | $SED "$delay_single_quote_subst"`'
+postlink_cmds='`$ECHO "$postlink_cmds" | $SED "$delay_single_quote_subst"`'
+file_list_spec='`$ECHO "$file_list_spec" | $SED "$delay_single_quote_subst"`'
+variables_saved_for_relink='`$ECHO "$variables_saved_for_relink" | $SED "$delay_single_quote_subst"`'
+need_lib_prefix='`$ECHO "$need_lib_prefix" | $SED "$delay_single_quote_subst"`'
+need_version='`$ECHO "$need_version" | $SED "$delay_single_quote_subst"`'
+version_type='`$ECHO "$version_type" | $SED "$delay_single_quote_subst"`'
+runpath_var='`$ECHO "$runpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_var='`$ECHO "$shlibpath_var" | $SED "$delay_single_quote_subst"`'
+shlibpath_overrides_runpath='`$ECHO "$shlibpath_overrides_runpath" | $SED "$delay_single_quote_subst"`'
+libname_spec='`$ECHO "$libname_spec" | $SED "$delay_single_quote_subst"`'
+library_names_spec='`$ECHO "$library_names_spec" | $SED "$delay_single_quote_subst"`'
+soname_spec='`$ECHO "$soname_spec" | $SED "$delay_single_quote_subst"`'
+install_override_mode='`$ECHO "$install_override_mode" | $SED "$delay_single_quote_subst"`'
+postinstall_cmds='`$ECHO "$postinstall_cmds" | $SED "$delay_single_quote_subst"`'
+postuninstall_cmds='`$ECHO "$postuninstall_cmds" | $SED "$delay_single_quote_subst"`'
+finish_cmds='`$ECHO "$finish_cmds" | $SED "$delay_single_quote_subst"`'
+finish_eval='`$ECHO "$finish_eval" | $SED "$delay_single_quote_subst"`'
+hardcode_into_libs='`$ECHO "$hardcode_into_libs" | $SED "$delay_single_quote_subst"`'
+sys_lib_search_path_spec='`$ECHO "$sys_lib_search_path_spec" | $SED "$delay_single_quote_subst"`'
+sys_lib_dlsearch_path_spec='`$ECHO "$sys_lib_dlsearch_path_spec" | $SED "$delay_single_quote_subst"`'
+hardcode_action='`$ECHO "$hardcode_action" | $SED "$delay_single_quote_subst"`'
+enable_dlopen='`$ECHO "$enable_dlopen" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self='`$ECHO "$enable_dlopen_self" | $SED "$delay_single_quote_subst"`'
+enable_dlopen_self_static='`$ECHO "$enable_dlopen_self_static" | $SED "$delay_single_quote_subst"`'
+old_striplib='`$ECHO "$old_striplib" | $SED "$delay_single_quote_subst"`'
+striplib='`$ECHO "$striplib" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_dirs='`$ECHO "$compiler_lib_search_dirs" | $SED "$delay_single_quote_subst"`'
+predep_objects='`$ECHO "$predep_objects" | $SED "$delay_single_quote_subst"`'
+postdep_objects='`$ECHO "$postdep_objects" | $SED "$delay_single_quote_subst"`'
+predeps='`$ECHO "$predeps" | $SED "$delay_single_quote_subst"`'
+postdeps='`$ECHO "$postdeps" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_path='`$ECHO "$compiler_lib_search_path" | $SED "$delay_single_quote_subst"`'
+LD_CXX='`$ECHO "$LD_CXX" | $SED "$delay_single_quote_subst"`'
+reload_flag_CXX='`$ECHO "$reload_flag_CXX" | $SED "$delay_single_quote_subst"`'
+reload_cmds_CXX='`$ECHO "$reload_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+old_archive_cmds_CXX='`$ECHO "$old_archive_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_CXX='`$ECHO "$compiler_CXX" | $SED "$delay_single_quote_subst"`'
+GCC_CXX='`$ECHO "$GCC_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_no_builtin_flag_CXX='`$ECHO "$lt_prog_compiler_no_builtin_flag_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_pic_CXX='`$ECHO "$lt_prog_compiler_pic_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_wl_CXX='`$ECHO "$lt_prog_compiler_wl_CXX" | $SED "$delay_single_quote_subst"`'
+lt_prog_compiler_static_CXX='`$ECHO "$lt_prog_compiler_static_CXX" | $SED "$delay_single_quote_subst"`'
+lt_cv_prog_compiler_c_o_CXX='`$ECHO "$lt_cv_prog_compiler_c_o_CXX" | $SED "$delay_single_quote_subst"`'
+archive_cmds_need_lc_CXX='`$ECHO "$archive_cmds_need_lc_CXX" | $SED "$delay_single_quote_subst"`'
+enable_shared_with_static_runtimes_CXX='`$ECHO "$enable_shared_with_static_runtimes_CXX" | $SED "$delay_single_quote_subst"`'
+export_dynamic_flag_spec_CXX='`$ECHO "$export_dynamic_flag_spec_CXX" | $SED "$delay_single_quote_subst"`'
+whole_archive_flag_spec_CXX='`$ECHO "$whole_archive_flag_spec_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_needs_object_CXX='`$ECHO "$compiler_needs_object_CXX" | $SED "$delay_single_quote_subst"`'
+old_archive_from_new_cmds_CXX='`$ECHO "$old_archive_from_new_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+old_archive_from_expsyms_cmds_CXX='`$ECHO "$old_archive_from_expsyms_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+archive_cmds_CXX='`$ECHO "$archive_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+archive_expsym_cmds_CXX='`$ECHO "$archive_expsym_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+module_cmds_CXX='`$ECHO "$module_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+module_expsym_cmds_CXX='`$ECHO "$module_expsym_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+with_gnu_ld_CXX='`$ECHO "$with_gnu_ld_CXX" | $SED "$delay_single_quote_subst"`'
+allow_undefined_flag_CXX='`$ECHO "$allow_undefined_flag_CXX" | $SED "$delay_single_quote_subst"`'
+no_undefined_flag_CXX='`$ECHO "$no_undefined_flag_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_flag_spec_CXX='`$ECHO "$hardcode_libdir_flag_spec_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_libdir_separator_CXX='`$ECHO "$hardcode_libdir_separator_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_CXX='`$ECHO "$hardcode_direct_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_direct_absolute_CXX='`$ECHO "$hardcode_direct_absolute_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_minus_L_CXX='`$ECHO "$hardcode_minus_L_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_shlibpath_var_CXX='`$ECHO "$hardcode_shlibpath_var_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_automatic_CXX='`$ECHO "$hardcode_automatic_CXX" | $SED "$delay_single_quote_subst"`'
+inherit_rpath_CXX='`$ECHO "$inherit_rpath_CXX" | $SED "$delay_single_quote_subst"`'
+link_all_deplibs_CXX='`$ECHO "$link_all_deplibs_CXX" | $SED "$delay_single_quote_subst"`'
+always_export_symbols_CXX='`$ECHO "$always_export_symbols_CXX" | $SED "$delay_single_quote_subst"`'
+export_symbols_cmds_CXX='`$ECHO "$export_symbols_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+exclude_expsyms_CXX='`$ECHO "$exclude_expsyms_CXX" | $SED "$delay_single_quote_subst"`'
+include_expsyms_CXX='`$ECHO "$include_expsyms_CXX" | $SED "$delay_single_quote_subst"`'
+prelink_cmds_CXX='`$ECHO "$prelink_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+postlink_cmds_CXX='`$ECHO "$postlink_cmds_CXX" | $SED "$delay_single_quote_subst"`'
+file_list_spec_CXX='`$ECHO "$file_list_spec_CXX" | $SED "$delay_single_quote_subst"`'
+hardcode_action_CXX='`$ECHO "$hardcode_action_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_dirs_CXX='`$ECHO "$compiler_lib_search_dirs_CXX" | $SED "$delay_single_quote_subst"`'
+predep_objects_CXX='`$ECHO "$predep_objects_CXX" | $SED "$delay_single_quote_subst"`'
+postdep_objects_CXX='`$ECHO "$postdep_objects_CXX" | $SED "$delay_single_quote_subst"`'
+predeps_CXX='`$ECHO "$predeps_CXX" | $SED "$delay_single_quote_subst"`'
+postdeps_CXX='`$ECHO "$postdeps_CXX" | $SED "$delay_single_quote_subst"`'
+compiler_lib_search_path_CXX='`$ECHO "$compiler_lib_search_path_CXX" | $SED "$delay_single_quote_subst"`'
+
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in SHELL \
+ECHO \
+PATH_SEPARATOR \
+SED \
+GREP \
+EGREP \
+FGREP \
+LD \
+NM \
+LN_S \
+lt_SP2NL \
+lt_NL2SP \
+reload_flag \
+OBJDUMP \
+deplibs_check_method \
+file_magic_cmd \
+file_magic_glob \
+want_nocaseglob \
+DLLTOOL \
+sharedlib_from_linklib_cmd \
+AR \
+AR_FLAGS \
+archiver_list_spec \
+STRIP \
+RANLIB \
+CC \
+CFLAGS \
+compiler \
+lt_cv_sys_global_symbol_pipe \
+lt_cv_sys_global_symbol_to_cdecl \
+lt_cv_sys_global_symbol_to_c_name_address \
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix \
+nm_file_list_spec \
+lt_prog_compiler_no_builtin_flag \
+lt_prog_compiler_pic \
+lt_prog_compiler_wl \
+lt_prog_compiler_static \
+lt_cv_prog_compiler_c_o \
+need_locks \
+MANIFEST_TOOL \
+DSYMUTIL \
+NMEDIT \
+LIPO \
+OTOOL \
+OTOOL64 \
+shrext_cmds \
+export_dynamic_flag_spec \
+whole_archive_flag_spec \
+compiler_needs_object \
+with_gnu_ld \
+allow_undefined_flag \
+no_undefined_flag \
+hardcode_libdir_flag_spec \
+hardcode_libdir_separator \
+exclude_expsyms \
+include_expsyms \
+file_list_spec \
+variables_saved_for_relink \
+libname_spec \
+library_names_spec \
+soname_spec \
+install_override_mode \
+finish_eval \
+old_striplib \
+striplib \
+compiler_lib_search_dirs \
+predep_objects \
+postdep_objects \
+predeps \
+postdeps \
+compiler_lib_search_path \
+LD_CXX \
+reload_flag_CXX \
+compiler_CXX \
+lt_prog_compiler_no_builtin_flag_CXX \
+lt_prog_compiler_pic_CXX \
+lt_prog_compiler_wl_CXX \
+lt_prog_compiler_static_CXX \
+lt_cv_prog_compiler_c_o_CXX \
+export_dynamic_flag_spec_CXX \
+whole_archive_flag_spec_CXX \
+compiler_needs_object_CXX \
+with_gnu_ld_CXX \
+allow_undefined_flag_CXX \
+no_undefined_flag_CXX \
+hardcode_libdir_flag_spec_CXX \
+hardcode_libdir_separator_CXX \
+exclude_expsyms_CXX \
+include_expsyms_CXX \
+file_list_spec_CXX \
+compiler_lib_search_dirs_CXX \
+predep_objects_CXX \
+postdep_objects_CXX \
+predeps_CXX \
+postdeps_CXX \
+compiler_lib_search_path_CXX; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\""
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+# Double-quote double-evaled strings.
+for var in reload_cmds \
+old_postinstall_cmds \
+old_postuninstall_cmds \
+old_archive_cmds \
+extract_expsyms_cmds \
+old_archive_from_new_cmds \
+old_archive_from_expsyms_cmds \
+archive_cmds \
+archive_expsym_cmds \
+module_cmds \
+module_expsym_cmds \
+export_symbols_cmds \
+prelink_cmds \
+postlink_cmds \
+postinstall_cmds \
+postuninstall_cmds \
+finish_cmds \
+sys_lib_search_path_spec \
+sys_lib_dlsearch_path_spec \
+reload_cmds_CXX \
+old_archive_cmds_CXX \
+old_archive_from_new_cmds_CXX \
+old_archive_from_expsyms_cmds_CXX \
+archive_cmds_CXX \
+archive_expsym_cmds_CXX \
+module_cmds_CXX \
+module_expsym_cmds_CXX \
+export_symbols_cmds_CXX \
+prelink_cmds_CXX \
+postlink_cmds_CXX; do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[\\\\\\\`\\"\\\$]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\""
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+ac_aux_dir='$ac_aux_dir'
+xsi_shell='$xsi_shell'
+lt_shell_append='$lt_shell_append'
+
+# See if we are running on zsh, and set the options which allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+fi
+
+
+ PACKAGE='$PACKAGE'
+ VERSION='$VERSION'
+ TIMESTAMP='$TIMESTAMP'
+ RM='$RM'
+ ofile='$ofile'
+
+
+
+ac_aux_dir='$ac_aux_dir'
+
+
+
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+
+# Handling of arguments.
+for ac_config_target in $ac_config_targets
+do
+ case $ac_config_target in
+ "depfiles") CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;;
+ "libtool") CONFIG_COMMANDS="$CONFIG_COMMANDS libtool" ;;
+ "Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;;
+ "src/Makefile") CONFIG_FILES="$CONFIG_FILES src/Makefile" ;;
+ "src/fonts/Makefile") CONFIG_FILES="$CONFIG_FILES src/fonts/Makefile" ;;
+ "doc/Makefile") CONFIG_FILES="$CONFIG_FILES doc/Makefile" ;;
+ "test/Makefile") CONFIG_FILES="$CONFIG_FILES test/Makefile" ;;
+
+ *) as_fn_error $? "invalid argument: \`$ac_config_target'" "$LINENO" 5;;
+ esac
+done
+
+
+# If the user did not use the arguments to specify the items to instantiate,
+# then the envvar interface is used. Set only those that are not.
+# We use the long form for the default assignment because of an extremely
+# bizarre bug on SunOS 4.1.3.
+if $ac_need_defaults; then
+ test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files
+ test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands
+fi
+
+# Have a temporary directory for convenience. Make it in the build tree
+# simply because there is no reason against having it here, and in addition,
+# creating and moving files from /tmp can sometimes cause problems.
+# Hook for its removal unless debugging.
+# Note that there is a small window in which the directory will not be cleaned:
+# after its creation but before its name has been assigned to `$tmp'.
+$debug ||
+{
+ tmp= ac_tmp=
+ trap 'exit_status=$?
+ : "${ac_tmp:=$tmp}"
+ { test ! -d "$ac_tmp" || rm -fr "$ac_tmp"; } && exit $exit_status
+' 0
+ trap 'as_fn_exit 1' 1 2 13 15
+}
+# Create a (secure) tmp directory for tmp files.
+
+{
+ tmp=`(umask 077 && mktemp -d "./confXXXXXX") 2>/dev/null` &&
+ test -d "$tmp"
+} ||
+{
+ tmp=./conf$$-$RANDOM
+ (umask 077 && mkdir "$tmp")
+} || as_fn_error $? "cannot create a temporary directory in ." "$LINENO" 5
+ac_tmp=$tmp
+
+# Set up the scripts for CONFIG_FILES section.
+# No need to generate them if there are no CONFIG_FILES.
+# This happens for instance with `./config.status config.h'.
+if test -n "$CONFIG_FILES"; then
+
+
+ac_cr=`echo X | tr X '\015'`
+# On cygwin, bash can eat \r inside `` if the user requested igncr.
+# But we know of no other shell where ac_cr would be empty at this
+# point, so we can use a bashism as a fallback.
+if test "x$ac_cr" = x; then
+ eval ac_cr=\$\'\\r\'
+fi
+ac_cs_awk_cr=`$AWK 'BEGIN { print "a\rb" }' /dev/null`
+if test "$ac_cs_awk_cr" = "a${ac_cr}b"; then
+ ac_cs_awk_cr='\\r'
+else
+ ac_cs_awk_cr=$ac_cr
+fi
+
+echo 'BEGIN {' >"$ac_tmp/subs1.awk" &&
+_ACEOF
+
+
+{
+ echo "cat >conf$$subs.awk <<_ACEOF" &&
+ echo "$ac_subst_vars" | sed 's/.*/&!$&$ac_delim/' &&
+ echo "_ACEOF"
+} >conf$$subs.sh ||
+ as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+ac_delim_num=`echo "$ac_subst_vars" | grep -c '^'`
+ac_delim='%!_!# '
+for ac_last_try in false false false false false :; do
+ . ./conf$$subs.sh ||
+ as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+
+ ac_delim_n=`sed -n "s/.*$ac_delim\$/X/p" conf$$subs.awk | grep -c X`
+ if test $ac_delim_n = $ac_delim_num; then
+ break
+ elif $ac_last_try; then
+ as_fn_error $? "could not make $CONFIG_STATUS" "$LINENO" 5
+ else
+ ac_delim="$ac_delim!$ac_delim _$ac_delim!! "
+ fi
+done
+rm -f conf$$subs.sh
+
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+cat >>"\$ac_tmp/subs1.awk" <<\\_ACAWK &&
+_ACEOF
+sed -n '
+h
+s/^/S["/; s/!.*/"]=/
+p
+g
+s/^[^!]*!//
+:repl
+t repl
+s/'"$ac_delim"'$//
+t delim
+:nl
+h
+s/\(.\{148\}\)..*/\1/
+t more1
+s/["\\]/\\&/g; s/^/"/; s/$/\\n"\\/
+p
+n
+b repl
+:more1
+s/["\\]/\\&/g; s/^/"/; s/$/"\\/
+p
+g
+s/.\{148\}//
+t nl
+:delim
+h
+s/\(.\{148\}\)..*/\1/
+t more2
+s/["\\]/\\&/g; s/^/"/; s/$/"/
+p
+b
+:more2
+s/["\\]/\\&/g; s/^/"/; s/$/"\\/
+p
+g
+s/.\{148\}//
+t delim
+' >$CONFIG_STATUS || ac_write_fail=1
+rm -f conf$$subs.awk
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+_ACAWK
+cat >>"\$ac_tmp/subs1.awk" <<_ACAWK &&
+ for (key in S) S_is_set[key] = 1
+ FS = ""
+
+}
+{
+ line = $ 0
+ nfields = split(line, field, "@")
+ substed = 0
+ len = length(field[1])
+ for (i = 2; i < nfields; i++) {
+ key = field[i]
+ keylen = length(key)
+ if (S_is_set[key]) {
+ value = S[key]
+ line = substr(line, 1, len) "" value "" substr(line, len + keylen + 3)
+ len += length(value) + length(field[++i])
+ substed = 1
+ } else
+ len += 1 + keylen
+ }
+
+ print line
+}
+
+_ACAWK
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+if sed "s/$ac_cr//" < /dev/null > /dev/null 2>&1; then
+ sed "s/$ac_cr\$//; s/$ac_cr/$ac_cs_awk_cr/g"
+else
+ cat
+fi < "$ac_tmp/subs1.awk" > "$ac_tmp/subs.awk" \
+ || as_fn_error $? "could not setup config files machinery" "$LINENO" 5
+_ACEOF
+
+# VPATH may cause trouble with some makes, so we remove sole $(srcdir),
+# ${srcdir} and @srcdir@ entries from VPATH if srcdir is ".", strip leading and
+# trailing colons and then remove the whole line if VPATH becomes empty
+# (actually we leave an empty line to preserve line numbers).
+if test "x$srcdir" = x.; then
+ ac_vpsub='/^[ ]*VPATH[ ]*=[ ]*/{
+h
+s///
+s/^/:/
+s/[ ]*$/:/
+s/:\$(srcdir):/:/g
+s/:\${srcdir}:/:/g
+s/:@srcdir@:/:/g
+s/^:*//
+s/:*$//
+x
+s/\(=[ ]*\).*/\1/
+G
+s/\n//
+s/^[^=]*=[ ]*$//
+}'
+fi
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+fi # test -n "$CONFIG_FILES"
+
+
+eval set X " :F $CONFIG_FILES :C $CONFIG_COMMANDS"
+shift
+for ac_tag
+do
+ case $ac_tag in
+ :[FHLC]) ac_mode=$ac_tag; continue;;
+ esac
+ case $ac_mode$ac_tag in
+ :[FHL]*:*);;
+ :L* | :C*:*) as_fn_error $? "invalid tag \`$ac_tag'" "$LINENO" 5;;
+ :[FH]-) ac_tag=-:-;;
+ :[FH]*) ac_tag=$ac_tag:$ac_tag.in;;
+ esac
+ ac_save_IFS=$IFS
+ IFS=:
+ set x $ac_tag
+ IFS=$ac_save_IFS
+ shift
+ ac_file=$1
+ shift
+
+ case $ac_mode in
+ :L) ac_source=$1;;
+ :[FH])
+ ac_file_inputs=
+ for ac_f
+ do
+ case $ac_f in
+ -) ac_f="$ac_tmp/stdin";;
+ *) # Look for the file first in the build tree, then in the source tree
+ # (if the path is not absolute). The absolute path cannot be DOS-style,
+ # because $ac_f cannot contain `:'.
+ test -f "$ac_f" ||
+ case $ac_f in
+ [\\/$]*) false;;
+ *) test -f "$srcdir/$ac_f" && ac_f="$srcdir/$ac_f";;
+ esac ||
+ as_fn_error 1 "cannot find input file: \`$ac_f'" "$LINENO" 5;;
+ esac
+ case $ac_f in *\'*) ac_f=`$as_echo "$ac_f" | sed "s/'/'\\\\\\\\''/g"`;; esac
+ as_fn_append ac_file_inputs " '$ac_f'"
+ done
+
+ # Let's still pretend it is `configure' which instantiates (i.e., don't
+ # use $as_me), people would be surprised to read:
+ # /* config.h. Generated by config.status. */
+ configure_input='Generated from '`
+ $as_echo "$*" | sed 's|^[^:]*/||;s|:[^:]*/|, |g'
+ `' by configure.'
+ if test x"$ac_file" != x-; then
+ configure_input="$ac_file. $configure_input"
+ { $as_echo "$as_me:${as_lineno-$LINENO}: creating $ac_file" >&5
+$as_echo "$as_me: creating $ac_file" >&6;}
+ fi
+ # Neutralize special characters interpreted by sed in replacement strings.
+ case $configure_input in #(
+ *\&* | *\|* | *\\* )
+ ac_sed_conf_input=`$as_echo "$configure_input" |
+ sed 's/[\\\\&|]/\\\\&/g'`;; #(
+ *) ac_sed_conf_input=$configure_input;;
+ esac
+
+ case $ac_tag in
+ *:-:* | *:-) cat >"$ac_tmp/stdin" \
+ || as_fn_error $? "could not create $ac_file" "$LINENO" 5 ;;
+ esac
+ ;;
+ esac
+
+ ac_dir=`$as_dirname -- "$ac_file" ||
+$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$ac_file" : 'X\(//\)[^/]' \| \
+ X"$ac_file" : 'X\(//\)$' \| \
+ X"$ac_file" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$ac_file" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ as_dir="$ac_dir"; as_fn_mkdir_p
+ ac_builddir=.
+
+case "$ac_dir" in
+.) ac_dir_suffix= ac_top_builddir_sub=. ac_top_build_prefix= ;;
+*)
+ ac_dir_suffix=/`$as_echo "$ac_dir" | sed 's|^\.[\\/]||'`
+ # A ".." for each directory in $ac_dir_suffix.
+ ac_top_builddir_sub=`$as_echo "$ac_dir_suffix" | sed 's|/[^\\/]*|/..|g;s|/||'`
+ case $ac_top_builddir_sub in
+ "") ac_top_builddir_sub=. ac_top_build_prefix= ;;
+ *) ac_top_build_prefix=$ac_top_builddir_sub/ ;;
+ esac ;;
+esac
+ac_abs_top_builddir=$ac_pwd
+ac_abs_builddir=$ac_pwd$ac_dir_suffix
+# for backward compatibility:
+ac_top_builddir=$ac_top_build_prefix
+
+case $srcdir in
+ .) # We are building in place.
+ ac_srcdir=.
+ ac_top_srcdir=$ac_top_builddir_sub
+ ac_abs_top_srcdir=$ac_pwd ;;
+ [\\/]* | ?:[\\/]* ) # Absolute name.
+ ac_srcdir=$srcdir$ac_dir_suffix;
+ ac_top_srcdir=$srcdir
+ ac_abs_top_srcdir=$srcdir ;;
+ *) # Relative name.
+ ac_srcdir=$ac_top_build_prefix$srcdir$ac_dir_suffix
+ ac_top_srcdir=$ac_top_build_prefix$srcdir
+ ac_abs_top_srcdir=$ac_pwd/$srcdir ;;
+esac
+ac_abs_srcdir=$ac_abs_top_srcdir$ac_dir_suffix
+
+
+ case $ac_mode in
+ :F)
+ #
+ # CONFIG_FILE
+ #
+
+ case $INSTALL in
+ [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;;
+ *) ac_INSTALL=$ac_top_build_prefix$INSTALL ;;
+ esac
+ ac_MKDIR_P=$MKDIR_P
+ case $MKDIR_P in
+ [\\/$]* | ?:[\\/]* ) ;;
+ */*) ac_MKDIR_P=$ac_top_build_prefix$MKDIR_P ;;
+ esac
+_ACEOF
+
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+# If the template does not know about datarootdir, expand it.
+# FIXME: This hack should be removed a few years after 2.60.
+ac_datarootdir_hack=; ac_datarootdir_seen=
+ac_sed_dataroot='
+/datarootdir/ {
+ p
+ q
+}
+/@datadir@/p
+/@docdir@/p
+/@infodir@/p
+/@localedir@/p
+/@mandir@/p'
+case `eval "sed -n \"\$ac_sed_dataroot\" $ac_file_inputs"` in
+*datarootdir*) ac_datarootdir_seen=yes;;
+*@datadir@*|*@docdir@*|*@infodir@*|*@localedir@*|*@mandir@*)
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&5
+$as_echo "$as_me: WARNING: $ac_file_inputs seems to ignore the --datarootdir setting" >&2;}
+_ACEOF
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ ac_datarootdir_hack='
+ s&@datadir@&$datadir&g
+ s&@docdir@&$docdir&g
+ s&@infodir@&$infodir&g
+ s&@localedir@&$localedir&g
+ s&@mandir@&$mandir&g
+ s&\\\${datarootdir}&$datarootdir&g' ;;
+esac
+_ACEOF
+
+# Neutralize VPATH when `$srcdir' = `.'.
+# Shell code in configure.ac might set extrasub.
+# FIXME: do we really want to maintain this feature?
+cat >>$CONFIG_STATUS <<_ACEOF || ac_write_fail=1
+ac_sed_extra="$ac_vpsub
+$extrasub
+_ACEOF
+cat >>$CONFIG_STATUS <<\_ACEOF || ac_write_fail=1
+:t
+/@[a-zA-Z_][a-zA-Z_0-9]*@/!b
+s|@configure_input@|$ac_sed_conf_input|;t t
+s&@top_builddir@&$ac_top_builddir_sub&;t t
+s&@top_build_prefix@&$ac_top_build_prefix&;t t
+s&@srcdir@&$ac_srcdir&;t t
+s&@abs_srcdir@&$ac_abs_srcdir&;t t
+s&@top_srcdir@&$ac_top_srcdir&;t t
+s&@abs_top_srcdir@&$ac_abs_top_srcdir&;t t
+s&@builddir@&$ac_builddir&;t t
+s&@abs_builddir@&$ac_abs_builddir&;t t
+s&@abs_top_builddir@&$ac_abs_top_builddir&;t t
+s&@INSTALL@&$ac_INSTALL&;t t
+s&@MKDIR_P@&$ac_MKDIR_P&;t t
+$ac_datarootdir_hack
+"
+eval sed \"\$ac_sed_extra\" "$ac_file_inputs" | $AWK -f "$ac_tmp/subs.awk" \
+ >$ac_tmp/out || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+
+test -z "$ac_datarootdir_hack$ac_datarootdir_seen" &&
+ { ac_out=`sed -n '/\${datarootdir}/p' "$ac_tmp/out"`; test -n "$ac_out"; } &&
+ { ac_out=`sed -n '/^[ ]*datarootdir[ ]*:*=/p' \
+ "$ac_tmp/out"`; test -z "$ac_out"; } &&
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: $ac_file contains a reference to the variable \`datarootdir'
+which seems to be undefined. Please make sure it is defined" >&5
+$as_echo "$as_me: WARNING: $ac_file contains a reference to the variable \`datarootdir'
+which seems to be undefined. Please make sure it is defined" >&2;}
+
+ rm -f "$ac_tmp/stdin"
+ case $ac_file in
+ -) cat "$ac_tmp/out" && rm -f "$ac_tmp/out";;
+ *) rm -f "$ac_file" && mv "$ac_tmp/out" "$ac_file";;
+ esac \
+ || as_fn_error $? "could not create $ac_file" "$LINENO" 5
+ ;;
+
+
+ :C) { $as_echo "$as_me:${as_lineno-$LINENO}: executing $ac_file commands" >&5
+$as_echo "$as_me: executing $ac_file commands" >&6;}
+ ;;
+ esac
+
+
+ case $ac_file$ac_mode in
+ "depfiles":C) test x"$AMDEP_TRUE" != x"" || {
+ # Older Autoconf quotes --file arguments for eval, but not when files
+ # are listed without --file. Let's play safe and only enable the eval
+ # if we detect the quoting.
+ case $CONFIG_FILES in
+ *\'*) eval set x "$CONFIG_FILES" ;;
+ *) set x $CONFIG_FILES ;;
+ esac
+ shift
+ for mf
+ do
+ # Strip MF so we end up with the name of the file.
+ mf=`echo "$mf" | sed -e 's/:.*$//'`
+ # Check whether this is an Automake generated Makefile or not.
+ # We used to match only the files named 'Makefile.in', but
+ # some people rename them; so instead we look at the file content.
+ # Grep'ing the first line is not enough: some people post-process
+ # each Makefile.in and add a new line on top of each file to say so.
+ # Grep'ing the whole file is not good either: AIX grep has a line
+ # limit of 2048, but all sed's we know have understand at least 4000.
+ if sed -n 's,^#.*generated by automake.*,X,p' "$mf" | grep X >/dev/null 2>&1; then
+ dirpart=`$as_dirname -- "$mf" ||
+$as_expr X"$mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$mf" : 'X\(//\)[^/]' \| \
+ X"$mf" : 'X\(//\)$' \| \
+ X"$mf" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$mf" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ else
+ continue
+ fi
+ # Extract the definition of DEPDIR, am__include, and am__quote
+ # from the Makefile without running 'make'.
+ DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"`
+ test -z "$DEPDIR" && continue
+ am__include=`sed -n 's/^am__include = //p' < "$mf"`
+ test -z "$am__include" && continue
+ am__quote=`sed -n 's/^am__quote = //p' < "$mf"`
+ # Find all dependency output files, they are included files with
+ # $(DEPDIR) in their names. We invoke sed twice because it is the
+ # simplest approach to changing $(DEPDIR) to its actual value in the
+ # expansion.
+ for file in `sed -n "
+ s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \
+ sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g'`; do
+ # Make sure the directory exists.
+ test -f "$dirpart/$file" && continue
+ fdir=`$as_dirname -- "$file" ||
+$as_expr X"$file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$file" : 'X\(//\)[^/]' \| \
+ X"$file" : 'X\(//\)$' \| \
+ X"$file" : 'X\(/\)' \| . 2>/dev/null ||
+$as_echo X"$file" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'`
+ as_dir=$dirpart/$fdir; as_fn_mkdir_p
+ # echo "creating $dirpart/$file"
+ echo '# dummy' > "$dirpart/$file"
+ done
+ done
+}
+ ;;
+ "libtool":C)
+
+ # See if we are running on zsh, and set the options which allow our
+ # commands through without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+
+ cfgfile="${ofile}T"
+ trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+ $RM "$cfgfile"
+
+ cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+
+# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+# 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+# Foundation, Inc.
+# Written by Gordon Matzigkeit, 1996
+#
+# This file is part of GNU Libtool.
+#
+# GNU Libtool is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING. If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html, or
+# obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+
+# The names of the tagged configurations supported by this script.
+available_tags="CXX "
+
+# ### BEGIN LIBTOOL CONFIG
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# Which release of libtool.m4 was used?
+macro_version=$macro_version
+macro_revision=$macro_revision
+
+# What type of objects to build.
+pic_mode=$pic_mode
+
+# Whether or not to optimize for fast installation.
+fast_install=$enable_fast_install
+
+# Shell to use when invoking shell scripts.
+SHELL=$lt_SHELL
+
+# An echo program that protects backslashes.
+ECHO=$lt_ECHO
+
+# The PATH separator for the build system.
+PATH_SEPARATOR=$lt_PATH_SEPARATOR
+
+# The host system.
+host_alias=$host_alias
+host=$host
+host_os=$host_os
+
+# The build system.
+build_alias=$build_alias
+build=$build
+build_os=$build_os
+
+# A sed program that does not truncate output.
+SED=$lt_SED
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="\$SED -e 1s/^X//"
+
+# A grep program that handles long lines.
+GREP=$lt_GREP
+
+# An ERE matcher.
+EGREP=$lt_EGREP
+
+# A literal string matcher.
+FGREP=$lt_FGREP
+
+# A BSD- or MS-compatible name lister.
+NM=$lt_NM
+
+# Whether we need soft or hard links.
+LN_S=$lt_LN_S
+
+# What is the maximum length of a command?
+max_cmd_len=$max_cmd_len
+
+# Object file suffix (normally "o").
+objext=$ac_objext
+
+# Executable file suffix (normally "").
+exeext=$exeext
+
+# whether the shell understands "unset".
+lt_unset=$lt_unset
+
+# turn spaces into newlines.
+SP2NL=$lt_lt_SP2NL
+
+# turn newlines into spaces.
+NL2SP=$lt_lt_NL2SP
+
+# convert \$build file names to \$host format.
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+
+# convert \$build files to toolchain format.
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+
+# An object symbol dumper.
+OBJDUMP=$lt_OBJDUMP
+
+# Method to check whether dependent libraries are shared objects.
+deplibs_check_method=$lt_deplibs_check_method
+
+# Command to use when deplibs_check_method = "file_magic".
+file_magic_cmd=$lt_file_magic_cmd
+
+# How to find potential files when deplibs_check_method = "file_magic".
+file_magic_glob=$lt_file_magic_glob
+
+# Find potential files using nocaseglob when deplibs_check_method = "file_magic".
+want_nocaseglob=$lt_want_nocaseglob
+
+# DLL creation program.
+DLLTOOL=$lt_DLLTOOL
+
+# Command to associate shared and link libraries.
+sharedlib_from_linklib_cmd=$lt_sharedlib_from_linklib_cmd
+
+# The archiver.
+AR=$lt_AR
+
+# Flags to create an archive.
+AR_FLAGS=$lt_AR_FLAGS
+
+# How to feed a file listing to the archiver.
+archiver_list_spec=$lt_archiver_list_spec
+
+# A symbol stripping program.
+STRIP=$lt_STRIP
+
+# Commands used to install an old-style archive.
+RANLIB=$lt_RANLIB
+old_postinstall_cmds=$lt_old_postinstall_cmds
+old_postuninstall_cmds=$lt_old_postuninstall_cmds
+
+# Whether to use a lock for old archive extraction.
+lock_old_archive_extraction=$lock_old_archive_extraction
+
+# A C compiler.
+LTCC=$lt_CC
+
+# LTCC compiler flags.
+LTCFLAGS=$lt_CFLAGS
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe=$lt_lt_cv_sys_global_symbol_pipe
+
+# Transform the output of nm in a proper C declaration.
+global_symbol_to_cdecl=$lt_lt_cv_sys_global_symbol_to_cdecl
+
+# Transform the output of nm in a C name address pair.
+global_symbol_to_c_name_address=$lt_lt_cv_sys_global_symbol_to_c_name_address
+
+# Transform the output of nm in a C name address pair when lib prefix is needed.
+global_symbol_to_c_name_address_lib_prefix=$lt_lt_cv_sys_global_symbol_to_c_name_address_lib_prefix
+
+# Specify filename containing input files for \$NM.
+nm_file_list_spec=$lt_nm_file_list_spec
+
+# The root where to search for dependent libraries,and in which our libraries should be installed.
+lt_sysroot=$lt_sysroot
+
+# The name of the directory that contains temporary libtool files.
+objdir=$objdir
+
+# Used to examine libraries when file_magic_cmd begins with "file".
+MAGIC_CMD=$MAGIC_CMD
+
+# Must we lock files when doing compilation?
+need_locks=$lt_need_locks
+
+# Manifest tool.
+MANIFEST_TOOL=$lt_MANIFEST_TOOL
+
+# Tool to manipulate archived DWARF debug symbol files on Mac OS X.
+DSYMUTIL=$lt_DSYMUTIL
+
+# Tool to change global to local symbols on Mac OS X.
+NMEDIT=$lt_NMEDIT
+
+# Tool to manipulate fat objects and archives on Mac OS X.
+LIPO=$lt_LIPO
+
+# ldd/readelf like tool for Mach-O binaries on Mac OS X.
+OTOOL=$lt_OTOOL
+
+# ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4.
+OTOOL64=$lt_OTOOL64
+
+# Old archive suffix (normally "a").
+libext=$libext
+
+# Shared library suffix (normally ".so").
+shrext_cmds=$lt_shrext_cmds
+
+# The commands to extract the exported symbol list from a shared archive.
+extract_expsyms_cmds=$lt_extract_expsyms_cmds
+
+# Variables whose values should be saved in libtool wrapper scripts and
+# restored at link time.
+variables_saved_for_relink=$lt_variables_saved_for_relink
+
+# Do we need the "lib" prefix for modules?
+need_lib_prefix=$need_lib_prefix
+
+# Do we need a version for libraries?
+need_version=$need_version
+
+# Library versioning type.
+version_type=$version_type
+
+# Shared library runtime path variable.
+runpath_var=$runpath_var
+
+# Shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# Is shlibpath searched before the hard-coded library search path?
+shlibpath_overrides_runpath=$shlibpath_overrides_runpath
+
+# Format of library name prefix.
+libname_spec=$lt_libname_spec
+
+# List of archive names. First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME
+library_names_spec=$lt_library_names_spec
+
+# The coded name of the library, if different from the real name.
+soname_spec=$lt_soname_spec
+
+# Permission mode override for installation of shared libraries.
+install_override_mode=$lt_install_override_mode
+
+# Command to use after installation of a shared archive.
+postinstall_cmds=$lt_postinstall_cmds
+
+# Command to use after uninstallation of a shared archive.
+postuninstall_cmds=$lt_postuninstall_cmds
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds=$lt_finish_cmds
+
+# As "finish_cmds", except a single script fragment to be evaled but
+# not shown.
+finish_eval=$lt_finish_eval
+
+# Whether we should hardcode library paths into libraries.
+hardcode_into_libs=$hardcode_into_libs
+
+# Compile-time system search path for libraries.
+sys_lib_search_path_spec=$lt_sys_lib_search_path_spec
+
+# Run-time system search path for libraries.
+sys_lib_dlsearch_path_spec=$lt_sys_lib_dlsearch_path_spec
+
+# Whether dlopen is supported.
+dlopen_support=$enable_dlopen
+
+# Whether dlopen of programs is supported.
+dlopen_self=$enable_dlopen_self
+
+# Whether dlopen of statically linked programs is supported.
+dlopen_self_static=$enable_dlopen_self_static
+
+# Commands to strip libraries.
+old_striplib=$lt_old_striplib
+striplib=$lt_striplib
+
+
+# The linker used to build libraries.
+LD=$lt_LD
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag
+reload_cmds=$lt_reload_cmds
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds
+
+# A language specific compiler.
+CC=$lt_compiler
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds
+archive_expsym_cmds=$lt_archive_expsym_cmds
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds
+module_expsym_cmds=$lt_module_expsym_cmds
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \${shlibpath_var} if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# The directories searched by this compiler when creating a shared library.
+compiler_lib_search_dirs=$lt_compiler_lib_search_dirs
+
+# Dependencies to place before and after the objects being linked to
+# create a shared library.
+predep_objects=$lt_predep_objects
+postdep_objects=$lt_postdep_objects
+predeps=$lt_predeps
+postdeps=$lt_postdeps
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=$lt_compiler_lib_search_path
+
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+ case $host_os in
+ aix3*)
+ cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+_LT_EOF
+ ;;
+ esac
+
+
+ltmain="$ac_aux_dir/ltmain.sh"
+
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" \
+ || (rm -f "$cfgfile"; exit 1)
+
+ if test x"$xsi_shell" = xyes; then
+ sed -e '/^func_dirname ()$/,/^} # func_dirname /c\
+func_dirname ()\
+{\
+\ case ${1} in\
+\ */*) func_dirname_result="${1%/*}${2}" ;;\
+\ * ) func_dirname_result="${3}" ;;\
+\ esac\
+} # Extended-shell func_dirname implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_basename ()$/,/^} # func_basename /c\
+func_basename ()\
+{\
+\ func_basename_result="${1##*/}"\
+} # Extended-shell func_basename implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_dirname_and_basename ()$/,/^} # func_dirname_and_basename /c\
+func_dirname_and_basename ()\
+{\
+\ case ${1} in\
+\ */*) func_dirname_result="${1%/*}${2}" ;;\
+\ * ) func_dirname_result="${3}" ;;\
+\ esac\
+\ func_basename_result="${1##*/}"\
+} # Extended-shell func_dirname_and_basename implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_stripname ()$/,/^} # func_stripname /c\
+func_stripname ()\
+{\
+\ # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are\
+\ # positional parameters, so assign one to ordinary parameter first.\
+\ func_stripname_result=${3}\
+\ func_stripname_result=${func_stripname_result#"${1}"}\
+\ func_stripname_result=${func_stripname_result%"${2}"}\
+} # Extended-shell func_stripname implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_split_long_opt ()$/,/^} # func_split_long_opt /c\
+func_split_long_opt ()\
+{\
+\ func_split_long_opt_name=${1%%=*}\
+\ func_split_long_opt_arg=${1#*=}\
+} # Extended-shell func_split_long_opt implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_split_short_opt ()$/,/^} # func_split_short_opt /c\
+func_split_short_opt ()\
+{\
+\ func_split_short_opt_arg=${1#??}\
+\ func_split_short_opt_name=${1%"$func_split_short_opt_arg"}\
+} # Extended-shell func_split_short_opt implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_lo2o ()$/,/^} # func_lo2o /c\
+func_lo2o ()\
+{\
+\ case ${1} in\
+\ *.lo) func_lo2o_result=${1%.lo}.${objext} ;;\
+\ *) func_lo2o_result=${1} ;;\
+\ esac\
+} # Extended-shell func_lo2o implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_xform ()$/,/^} # func_xform /c\
+func_xform ()\
+{\
+ func_xform_result=${1%.*}.lo\
+} # Extended-shell func_xform implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_arith ()$/,/^} # func_arith /c\
+func_arith ()\
+{\
+ func_arith_result=$(( $* ))\
+} # Extended-shell func_arith implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_len ()$/,/^} # func_len /c\
+func_len ()\
+{\
+ func_len_result=${#1}\
+} # Extended-shell func_len implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+fi
+
+if test x"$lt_shell_append" = xyes; then
+ sed -e '/^func_append ()$/,/^} # func_append /c\
+func_append ()\
+{\
+ eval "${1}+=\\${2}"\
+} # Extended-shell func_append implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ sed -e '/^func_append_quoted ()$/,/^} # func_append_quoted /c\
+func_append_quoted ()\
+{\
+\ func_quote_for_eval "${2}"\
+\ eval "${1}+=\\\\ \\$func_quote_for_eval_result"\
+} # Extended-shell func_append_quoted implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+
+
+ # Save a `func_append' function call where possible by direct use of '+='
+ sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+ test 0 -eq $? || _lt_function_replace_fail=:
+else
+ # Save a `func_append' function call even when '+=' is not available
+ sed -e 's%func_append \([a-zA-Z_]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+ test 0 -eq $? || _lt_function_replace_fail=:
+fi
+
+if test x"$_lt_function_replace_fail" = x":"; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: Unable to substitute extended shell functions in $ofile" >&5
+$as_echo "$as_me: WARNING: Unable to substitute extended shell functions in $ofile" >&2;}
+fi
+
+
+ mv -f "$cfgfile" "$ofile" ||
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+
+
+ cat <<_LT_EOF >> "$ofile"
+
+# ### BEGIN LIBTOOL TAG CONFIG: CXX
+
+# The linker used to build libraries.
+LD=$lt_LD_CXX
+
+# How to create reloadable object files.
+reload_flag=$lt_reload_flag_CXX
+reload_cmds=$lt_reload_cmds_CXX
+
+# Commands used to build an old-style archive.
+old_archive_cmds=$lt_old_archive_cmds_CXX
+
+# A language specific compiler.
+CC=$lt_compiler_CXX
+
+# Is the compiler the GNU compiler?
+with_gcc=$GCC_CXX
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag=$lt_lt_prog_compiler_no_builtin_flag_CXX
+
+# Additional compiler flags for building library objects.
+pic_flag=$lt_lt_prog_compiler_pic_CXX
+
+# How to pass a linker flag through the compiler.
+wl=$lt_lt_prog_compiler_wl_CXX
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag=$lt_lt_prog_compiler_static_CXX
+
+# Does compiler simultaneously support -c and -o options?
+compiler_c_o=$lt_lt_cv_prog_compiler_c_o_CXX
+
+# Whether or not to add -lc for building shared libraries.
+build_libtool_need_lc=$archive_cmds_need_lc_CXX
+
+# Whether or not to disallow shared libs when runtime libs are static.
+allow_libtool_libs_with_static_runtimes=$enable_shared_with_static_runtimes_CXX
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec=$lt_export_dynamic_flag_spec_CXX
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec=$lt_whole_archive_flag_spec_CXX
+
+# Whether the compiler copes with passing no objects directly.
+compiler_needs_object=$lt_compiler_needs_object_CXX
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds=$lt_old_archive_from_new_cmds_CXX
+
+# Create a temporary old-style archive to link instead of a shared archive.
+old_archive_from_expsyms_cmds=$lt_old_archive_from_expsyms_cmds_CXX
+
+# Commands used to build a shared archive.
+archive_cmds=$lt_archive_cmds_CXX
+archive_expsym_cmds=$lt_archive_expsym_cmds_CXX
+
+# Commands used to build a loadable module if different from building
+# a shared archive.
+module_cmds=$lt_module_cmds_CXX
+module_expsym_cmds=$lt_module_expsym_cmds_CXX
+
+# Whether we are building with GNU ld or not.
+with_gnu_ld=$lt_with_gnu_ld_CXX
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag=$lt_allow_undefined_flag_CXX
+
+# Flag that enforces no undefined symbols.
+no_undefined_flag=$lt_no_undefined_flag_CXX
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist
+hardcode_libdir_flag_spec=$lt_hardcode_libdir_flag_spec_CXX
+
+# Whether we need a single "-rpath" flag with a separated argument.
+hardcode_libdir_separator=$lt_hardcode_libdir_separator_CXX
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary.
+hardcode_direct=$hardcode_direct_CXX
+
+# Set to "yes" if using DIR/libNAME\${shared_ext} during linking hardcodes
+# DIR into the resulting binary and the resulting library dependency is
+# "absolute",i.e impossible to change by setting \${shlibpath_var} if the
+# library is relocated.
+hardcode_direct_absolute=$hardcode_direct_absolute_CXX
+
+# Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+# into the resulting binary.
+hardcode_minus_L=$hardcode_minus_L_CXX
+
+# Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+# into the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var_CXX
+
+# Set to "yes" if building a shared library automatically hardcodes DIR
+# into the library and all subsequent libraries and executables linked
+# against it.
+hardcode_automatic=$hardcode_automatic_CXX
+
+# Set to yes if linker adds runtime paths of dependent libraries
+# to runtime path list.
+inherit_rpath=$inherit_rpath_CXX
+
+# Whether libtool must link a program against all its dependency libraries.
+link_all_deplibs=$link_all_deplibs_CXX
+
+# Set to "yes" if exported symbols are required.
+always_export_symbols=$always_export_symbols_CXX
+
+# The commands to list exported symbols.
+export_symbols_cmds=$lt_export_symbols_cmds_CXX
+
+# Symbols that should not be listed in the preloaded symbols.
+exclude_expsyms=$lt_exclude_expsyms_CXX
+
+# Symbols that must always be exported.
+include_expsyms=$lt_include_expsyms_CXX
+
+# Commands necessary for linking programs (against libraries) with templates.
+prelink_cmds=$lt_prelink_cmds_CXX
+
+# Commands necessary for finishing linking programs.
+postlink_cmds=$lt_postlink_cmds_CXX
+
+# Specify filename containing input files.
+file_list_spec=$lt_file_list_spec_CXX
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action_CXX
+
+# The directories searched by this compiler when creating a shared library.
+compiler_lib_search_dirs=$lt_compiler_lib_search_dirs_CXX
+
+# Dependencies to place before and after the objects being linked to
+# create a shared library.
+predep_objects=$lt_predep_objects_CXX
+postdep_objects=$lt_postdep_objects_CXX
+predeps=$lt_predeps_CXX
+postdeps=$lt_postdeps_CXX
+
+# The library search path used internally by the compiler when linking
+# a shared library.
+compiler_lib_search_path=$lt_compiler_lib_search_path_CXX
+
+# ### END LIBTOOL TAG CONFIG: CXX
+_LT_EOF
+
+ ;;
+
+ esac
+done # for ac_tag
+
+
+as_fn_exit 0
+_ACEOF
+ac_clean_files=$ac_clean_files_save
+
+test $ac_write_fail = 0 ||
+ as_fn_error $? "write failure creating $CONFIG_STATUS" "$LINENO" 5
+
+
+# configure is writing to config.log, and then calls config.status.
+# config.status does its own redirection, appending to config.log.
+# Unfortunately, on DOS this fails, as config.log is still kept open
+# by configure, so config.status won't be able to write to it; its
+# output is simply discarded. So we exec the FD to /dev/null,
+# effectively closing config.log, so it can be properly (re)opened and
+# appended to by config.status. When coming back to configure, we
+# need to make the FD available again.
+if test "$no_create" != yes; then
+ ac_cs_success=:
+ ac_config_status_args=
+ test "$silent" = yes &&
+ ac_config_status_args="$ac_config_status_args --quiet"
+ exec 5>/dev/null
+ $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false
+ exec 5>>config.log
+ # Use ||, not &&, to avoid exiting from the if with $? = 1, which
+ # would make configure fail if this is the last instruction.
+ $ac_cs_success || as_fn_exit 1
+fi
+if test -n "$ac_unrecognized_opts" && test "$enable_option_checking" != no; then
+ { $as_echo "$as_me:${as_lineno-$LINENO}: WARNING: unrecognized options: $ac_unrecognized_opts" >&5
+$as_echo "$as_me: WARNING: unrecognized options: $ac_unrecognized_opts" >&2;}
+fi
+
diff --git a/configure.ac b/configure.ac
new file mode 100644
index 00000000..f6227996
--- /dev/null
+++ b/configure.ac
@@ -0,0 +1,67 @@
+#----------------------------------------------------------------------
+# configure.ac - the Final Cut library
+#----------------------------------------------------------------------
+
+# Process this file with autoconf to produce a configure script.
+
+AC_INIT([finalcut], [0.1.0b])
+AC_CONFIG_SRCDIR([src/fobject.cpp])
+AM_INIT_AUTOMAKE
+AC_PROG_CC
+AC_PROG_CXX
+
+# Checks for header files.
+AC_HEADER_STDC
+AC_CHECK_HEADERS( \
+ linux/fb.h \
+ sys/io.h \
+ sys/kd.h \
+ sys/stat.h \
+ sys/time.h \
+ fcntl.h \
+ langinfo.h \
+ term.h \
+ termios.h \
+ unistd.h \
+ cmath \
+ csignal \
+ cstdlib \
+ list \
+ map \
+ queue \
+ vector)
+
+# Checks for 'tgetent'
+AC_SEARCH_LIBS([tgetent], [termcap tinfo curses ncurses])
+
+# Checks for libtool
+AM_ENABLE_SHARED
+AM_DISABLE_STATIC
+LT_INIT([dlopen])
+LT_LANG([C++])
+LT_OUTPUT
+
+### This defines the version number of the installed .so files
+### using libtool's versioning system.
+AC_SUBST(SO_VERSION, ["0:0:0"])
+
+AC_SUBST([LIBTOOL_DEPS])
+
+AC_CONFIG_MACRO_DIR([m4])
+
+AC_CONFIG_FILES([Makefile src/Makefile src/fonts/Makefile doc/Makefile test/Makefile])
+
+# use GPM (General Purpose Mouse)
+AC_ARG_WITH([gpm],
+ [AS_HELP_STRING([--without-gpm], [Disable GPM mouse support])],
+ [],
+ [with_gpm=yes])
+
+if test "x$with_gpm" != "xno"
+then
+ AC_CHECK_LIB([gpm],
+ [main],
+ [AC_DEFINE(HAVE_LIBGPM) LIBS="$LIBS -lgpm"])
+fi
+
+AC_OUTPUT
diff --git a/depcomp b/depcomp
new file mode 100755
index 00000000..4ebd5b3a
--- /dev/null
+++ b/depcomp
@@ -0,0 +1,791 @@
+#! /bin/sh
+# depcomp - compile a program generating dependencies as side-effects
+
+scriptversion=2013-05-30.07; # UTC
+
+# Copyright (C) 1999-2013 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program. If not, see .
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Originally written by Alexandre Oliva .
+
+case $1 in
+ '')
+ echo "$0: No command. Try '$0 --help' for more information." 1>&2
+ exit 1;
+ ;;
+ -h | --h*)
+ cat <<\EOF
+Usage: depcomp [--help] [--version] PROGRAM [ARGS]
+
+Run PROGRAMS ARGS to compile a file, generating dependencies
+as side-effects.
+
+Environment variables:
+ depmode Dependency tracking mode.
+ source Source file read by 'PROGRAMS ARGS'.
+ object Object file output by 'PROGRAMS ARGS'.
+ DEPDIR directory where to store dependencies.
+ depfile Dependency file to output.
+ tmpdepfile Temporary file to use when outputting dependencies.
+ libtool Whether libtool is used (yes/no).
+
+Report bugs to .
+EOF
+ exit $?
+ ;;
+ -v | --v*)
+ echo "depcomp $scriptversion"
+ exit $?
+ ;;
+esac
+
+# Get the directory component of the given path, and save it in the
+# global variables '$dir'. Note that this directory component will
+# be either empty or ending with a '/' character. This is deliberate.
+set_dir_from ()
+{
+ case $1 in
+ */*) dir=`echo "$1" | sed -e 's|/[^/]*$|/|'`;;
+ *) dir=;;
+ esac
+}
+
+# Get the suffix-stripped basename of the given path, and save it the
+# global variable '$base'.
+set_base_from ()
+{
+ base=`echo "$1" | sed -e 's|^.*/||' -e 's/\.[^.]*$//'`
+}
+
+# If no dependency file was actually created by the compiler invocation,
+# we still have to create a dummy depfile, to avoid errors with the
+# Makefile "include basename.Plo" scheme.
+make_dummy_depfile ()
+{
+ echo "#dummy" > "$depfile"
+}
+
+# Factor out some common post-processing of the generated depfile.
+# Requires the auxiliary global variable '$tmpdepfile' to be set.
+aix_post_process_depfile ()
+{
+ # If the compiler actually managed to produce a dependency file,
+ # post-process it.
+ if test -f "$tmpdepfile"; then
+ # Each line is of the form 'foo.o: dependency.h'.
+ # Do two passes, one to just change these to
+ # $object: dependency.h
+ # and one to simply output
+ # dependency.h:
+ # which is needed to avoid the deleted-header problem.
+ { sed -e "s,^.*\.[$lower]*:,$object:," < "$tmpdepfile"
+ sed -e "s,^.*\.[$lower]*:[$tab ]*,," -e 's,$,:,' < "$tmpdepfile"
+ } > "$depfile"
+ rm -f "$tmpdepfile"
+ else
+ make_dummy_depfile
+ fi
+}
+
+# A tabulation character.
+tab=' '
+# A newline character.
+nl='
+'
+# Character ranges might be problematic outside the C locale.
+# These definitions help.
+upper=ABCDEFGHIJKLMNOPQRSTUVWXYZ
+lower=abcdefghijklmnopqrstuvwxyz
+digits=0123456789
+alpha=${upper}${lower}
+
+if test -z "$depmode" || test -z "$source" || test -z "$object"; then
+ echo "depcomp: Variables source, object and depmode must be set" 1>&2
+ exit 1
+fi
+
+# Dependencies for sub/bar.o or sub/bar.obj go into sub/.deps/bar.Po.
+depfile=${depfile-`echo "$object" |
+ sed 's|[^\\/]*$|'${DEPDIR-.deps}'/&|;s|\.\([^.]*\)$|.P\1|;s|Pobj$|Po|'`}
+tmpdepfile=${tmpdepfile-`echo "$depfile" | sed 's/\.\([^.]*\)$/.T\1/'`}
+
+rm -f "$tmpdepfile"
+
+# Avoid interferences from the environment.
+gccflag= dashmflag=
+
+# Some modes work just like other modes, but use different flags. We
+# parameterize here, but still list the modes in the big case below,
+# to make depend.m4 easier to write. Note that we *cannot* use a case
+# here, because this file can only contain one case statement.
+if test "$depmode" = hp; then
+ # HP compiler uses -M and no extra arg.
+ gccflag=-M
+ depmode=gcc
+fi
+
+if test "$depmode" = dashXmstdout; then
+ # This is just like dashmstdout with a different argument.
+ dashmflag=-xM
+ depmode=dashmstdout
+fi
+
+cygpath_u="cygpath -u -f -"
+if test "$depmode" = msvcmsys; then
+ # This is just like msvisualcpp but w/o cygpath translation.
+ # Just convert the backslash-escaped backslashes to single forward
+ # slashes to satisfy depend.m4
+ cygpath_u='sed s,\\\\,/,g'
+ depmode=msvisualcpp
+fi
+
+if test "$depmode" = msvc7msys; then
+ # This is just like msvc7 but w/o cygpath translation.
+ # Just convert the backslash-escaped backslashes to single forward
+ # slashes to satisfy depend.m4
+ cygpath_u='sed s,\\\\,/,g'
+ depmode=msvc7
+fi
+
+if test "$depmode" = xlc; then
+ # IBM C/C++ Compilers xlc/xlC can output gcc-like dependency information.
+ gccflag=-qmakedep=gcc,-MF
+ depmode=gcc
+fi
+
+case "$depmode" in
+gcc3)
+## gcc 3 implements dependency tracking that does exactly what
+## we want. Yay! Note: for some reason libtool 1.4 doesn't like
+## it if -MD -MP comes after the -MF stuff. Hmm.
+## Unfortunately, FreeBSD c89 acceptance of flags depends upon
+## the command line argument order; so add the flags where they
+## appear in depend2.am. Note that the slowdown incurred here
+## affects only configure: in makefiles, %FASTDEP% shortcuts this.
+ for arg
+ do
+ case $arg in
+ -c) set fnord "$@" -MT "$object" -MD -MP -MF "$tmpdepfile" "$arg" ;;
+ *) set fnord "$@" "$arg" ;;
+ esac
+ shift # fnord
+ shift # $arg
+ done
+ "$@"
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ mv "$tmpdepfile" "$depfile"
+ ;;
+
+gcc)
+## Note that this doesn't just cater to obsosete pre-3.x GCC compilers.
+## but also to in-use compilers like IMB xlc/xlC and the HP C compiler.
+## (see the conditional assignment to $gccflag above).
+## There are various ways to get dependency output from gcc. Here's
+## why we pick this rather obscure method:
+## - Don't want to use -MD because we'd like the dependencies to end
+## up in a subdir. Having to rename by hand is ugly.
+## (We might end up doing this anyway to support other compilers.)
+## - The DEPENDENCIES_OUTPUT environment variable makes gcc act like
+## -MM, not -M (despite what the docs say). Also, it might not be
+## supported by the other compilers which use the 'gcc' depmode.
+## - Using -M directly means running the compiler twice (even worse
+## than renaming).
+ if test -z "$gccflag"; then
+ gccflag=-MD,
+ fi
+ "$@" -Wp,"$gccflag$tmpdepfile"
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ # The second -e expression handles DOS-style file names with drive
+ # letters.
+ sed -e 's/^[^:]*: / /' \
+ -e 's/^['$alpha']:\/[^:]*: / /' < "$tmpdepfile" >> "$depfile"
+## This next piece of magic avoids the "deleted header file" problem.
+## The problem is that when a header file which appears in a .P file
+## is deleted, the dependency causes make to die (because there is
+## typically no way to rebuild the header). We avoid this by adding
+## dummy dependencies for each header file. Too bad gcc doesn't do
+## this for us directly.
+## Some versions of gcc put a space before the ':'. On the theory
+## that the space means something, we add a space to the output as
+## well. hp depmode also adds that space, but also prefixes the VPATH
+## to the object. Take care to not repeat it in the output.
+## Some versions of the HPUX 10.20 sed can't process this invocation
+## correctly. Breaking it into two sed invocations is a workaround.
+ tr ' ' "$nl" < "$tmpdepfile" \
+ | sed -e 's/^\\$//' -e '/^$/d' -e "s|.*$object$||" -e '/:$/d' \
+ | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+hp)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+sgi)
+ if test "$libtool" = yes; then
+ "$@" "-Wp,-MDupdate,$tmpdepfile"
+ else
+ "$@" -MDupdate "$tmpdepfile"
+ fi
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+
+ if test -f "$tmpdepfile"; then # yes, the sourcefile depend on other files
+ echo "$object : \\" > "$depfile"
+ # Clip off the initial element (the dependent). Don't try to be
+ # clever and replace this with sed code, as IRIX sed won't handle
+ # lines with more than a fixed number of characters (4096 in
+ # IRIX 6.2 sed, 8192 in IRIX 6.5). We also remove comment lines;
+ # the IRIX cc adds comments like '#:fec' to the end of the
+ # dependency line.
+ tr ' ' "$nl" < "$tmpdepfile" \
+ | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' \
+ | tr "$nl" ' ' >> "$depfile"
+ echo >> "$depfile"
+ # The second pass generates a dummy entry for each header file.
+ tr ' ' "$nl" < "$tmpdepfile" \
+ | sed -e 's/^.*\.o://' -e 's/#.*$//' -e '/^$/ d' -e 's/$/:/' \
+ >> "$depfile"
+ else
+ make_dummy_depfile
+ fi
+ rm -f "$tmpdepfile"
+ ;;
+
+xlc)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+aix)
+ # The C for AIX Compiler uses -M and outputs the dependencies
+ # in a .u file. In older versions, this file always lives in the
+ # current directory. Also, the AIX compiler puts '$object:' at the
+ # start of each line; $object doesn't have directory information.
+ # Version 6 uses the directory in both cases.
+ set_dir_from "$object"
+ set_base_from "$object"
+ if test "$libtool" = yes; then
+ tmpdepfile1=$dir$base.u
+ tmpdepfile2=$base.u
+ tmpdepfile3=$dir.libs/$base.u
+ "$@" -Wc,-M
+ else
+ tmpdepfile1=$dir$base.u
+ tmpdepfile2=$dir$base.u
+ tmpdepfile3=$dir$base.u
+ "$@" -M
+ fi
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ aix_post_process_depfile
+ ;;
+
+tcc)
+ # tcc (Tiny C Compiler) understand '-MD -MF file' since version 0.9.26
+ # FIXME: That version still under development at the moment of writing.
+ # Make that this statement remains true also for stable, released
+ # versions.
+ # It will wrap lines (doesn't matter whether long or short) with a
+ # trailing '\', as in:
+ #
+ # foo.o : \
+ # foo.c \
+ # foo.h \
+ #
+ # It will put a trailing '\' even on the last line, and will use leading
+ # spaces rather than leading tabs (at least since its commit 0394caf7
+ # "Emit spaces for -MD").
+ "$@" -MD -MF "$tmpdepfile"
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ # Each non-empty line is of the form 'foo.o : \' or ' dep.h \'.
+ # We have to change lines of the first kind to '$object: \'.
+ sed -e "s|.*:|$object :|" < "$tmpdepfile" > "$depfile"
+ # And for each line of the second kind, we have to emit a 'dep.h:'
+ # dummy dependency, to avoid the deleted-header problem.
+ sed -n -e 's|^ *\(.*\) *\\$|\1:|p' < "$tmpdepfile" >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+## The order of this option in the case statement is important, since the
+## shell code in configure will try each of these formats in the order
+## listed in this file. A plain '-MD' option would be understood by many
+## compilers, so we must ensure this comes after the gcc and icc options.
+pgcc)
+ # Portland's C compiler understands '-MD'.
+ # Will always output deps to 'file.d' where file is the root name of the
+ # source file under compilation, even if file resides in a subdirectory.
+ # The object file name does not affect the name of the '.d' file.
+ # pgcc 10.2 will output
+ # foo.o: sub/foo.c sub/foo.h
+ # and will wrap long lines using '\' :
+ # foo.o: sub/foo.c ... \
+ # sub/foo.h ... \
+ # ...
+ set_dir_from "$object"
+ # Use the source, not the object, to determine the base name, since
+ # that's sadly what pgcc will do too.
+ set_base_from "$source"
+ tmpdepfile=$base.d
+
+ # For projects that build the same source file twice into different object
+ # files, the pgcc approach of using the *source* file root name can cause
+ # problems in parallel builds. Use a locking strategy to avoid stomping on
+ # the same $tmpdepfile.
+ lockdir=$base.d-lock
+ trap "
+ echo '$0: caught signal, cleaning up...' >&2
+ rmdir '$lockdir'
+ exit 1
+ " 1 2 13 15
+ numtries=100
+ i=$numtries
+ while test $i -gt 0; do
+ # mkdir is a portable test-and-set.
+ if mkdir "$lockdir" 2>/dev/null; then
+ # This process acquired the lock.
+ "$@" -MD
+ stat=$?
+ # Release the lock.
+ rmdir "$lockdir"
+ break
+ else
+ # If the lock is being held by a different process, wait
+ # until the winning process is done or we timeout.
+ while test -d "$lockdir" && test $i -gt 0; do
+ sleep 1
+ i=`expr $i - 1`
+ done
+ fi
+ i=`expr $i - 1`
+ done
+ trap - 1 2 13 15
+ if test $i -le 0; then
+ echo "$0: failed to acquire lock after $numtries attempts" >&2
+ echo "$0: check lockdir '$lockdir'" >&2
+ exit 1
+ fi
+
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ # Each line is of the form `foo.o: dependent.h',
+ # or `foo.o: dep1.h dep2.h \', or ` dep3.h dep4.h \'.
+ # Do two passes, one to just change these to
+ # `$object: dependent.h' and one to simply `dependent.h:'.
+ sed "s,^[^:]*:,$object :," < "$tmpdepfile" > "$depfile"
+ # Some versions of the HPUX 10.20 sed can't process this invocation
+ # correctly. Breaking it into two sed invocations is a workaround.
+ sed 's,^[^:]*: \(.*\)$,\1,;s/^\\$//;/^$/d;/:$/d' < "$tmpdepfile" \
+ | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+hp2)
+ # The "hp" stanza above does not work with aCC (C++) and HP's ia64
+ # compilers, which have integrated preprocessors. The correct option
+ # to use with these is +Maked; it writes dependencies to a file named
+ # 'foo.d', which lands next to the object file, wherever that
+ # happens to be.
+ # Much of this is similar to the tru64 case; see comments there.
+ set_dir_from "$object"
+ set_base_from "$object"
+ if test "$libtool" = yes; then
+ tmpdepfile1=$dir$base.d
+ tmpdepfile2=$dir.libs/$base.d
+ "$@" -Wc,+Maked
+ else
+ tmpdepfile1=$dir$base.d
+ tmpdepfile2=$dir$base.d
+ "$@" +Maked
+ fi
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile1" "$tmpdepfile2"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ if test -f "$tmpdepfile"; then
+ sed -e "s,^.*\.[$lower]*:,$object:," "$tmpdepfile" > "$depfile"
+ # Add 'dependent.h:' lines.
+ sed -ne '2,${
+ s/^ *//
+ s/ \\*$//
+ s/$/:/
+ p
+ }' "$tmpdepfile" >> "$depfile"
+ else
+ make_dummy_depfile
+ fi
+ rm -f "$tmpdepfile" "$tmpdepfile2"
+ ;;
+
+tru64)
+ # The Tru64 compiler uses -MD to generate dependencies as a side
+ # effect. 'cc -MD -o foo.o ...' puts the dependencies into 'foo.o.d'.
+ # At least on Alpha/Redhat 6.1, Compaq CCC V6.2-504 seems to put
+ # dependencies in 'foo.d' instead, so we check for that too.
+ # Subdirectories are respected.
+ set_dir_from "$object"
+ set_base_from "$object"
+
+ if test "$libtool" = yes; then
+ # Libtool generates 2 separate objects for the 2 libraries. These
+ # two compilations output dependencies in $dir.libs/$base.o.d and
+ # in $dir$base.o.d. We have to check for both files, because
+ # one of the two compilations can be disabled. We should prefer
+ # $dir$base.o.d over $dir.libs/$base.o.d because the latter is
+ # automatically cleaned when .libs/ is deleted, while ignoring
+ # the former would cause a distcleancheck panic.
+ tmpdepfile1=$dir$base.o.d # libtool 1.5
+ tmpdepfile2=$dir.libs/$base.o.d # Likewise.
+ tmpdepfile3=$dir.libs/$base.d # Compaq CCC V6.2-504
+ "$@" -Wc,-MD
+ else
+ tmpdepfile1=$dir$base.d
+ tmpdepfile2=$dir$base.d
+ tmpdepfile3=$dir$base.d
+ "$@" -MD
+ fi
+
+ stat=$?
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+ exit $stat
+ fi
+
+ for tmpdepfile in "$tmpdepfile1" "$tmpdepfile2" "$tmpdepfile3"
+ do
+ test -f "$tmpdepfile" && break
+ done
+ # Same post-processing that is required for AIX mode.
+ aix_post_process_depfile
+ ;;
+
+msvc7)
+ if test "$libtool" = yes; then
+ showIncludes=-Wc,-showIncludes
+ else
+ showIncludes=-showIncludes
+ fi
+ "$@" $showIncludes > "$tmpdepfile"
+ stat=$?
+ grep -v '^Note: including file: ' "$tmpdepfile"
+ if test $stat -ne 0; then
+ rm -f "$tmpdepfile"
+ exit $stat
+ fi
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ # The first sed program below extracts the file names and escapes
+ # backslashes for cygpath. The second sed program outputs the file
+ # name when reading, but also accumulates all include files in the
+ # hold buffer in order to output them again at the end. This only
+ # works with sed implementations that can handle large buffers.
+ sed < "$tmpdepfile" -n '
+/^Note: including file: *\(.*\)/ {
+ s//\1/
+ s/\\/\\\\/g
+ p
+}' | $cygpath_u | sort -u | sed -n '
+s/ /\\ /g
+s/\(.*\)/'"$tab"'\1 \\/p
+s/.\(.*\) \\/\1:/
+H
+$ {
+ s/.*/'"$tab"'/
+ G
+ p
+}' >> "$depfile"
+ echo >> "$depfile" # make sure the fragment doesn't end with a backslash
+ rm -f "$tmpdepfile"
+ ;;
+
+msvc7msys)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+#nosideeffect)
+ # This comment above is used by automake to tell side-effect
+ # dependency tracking mechanisms from slower ones.
+
+dashmstdout)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout, regardless of -o.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ # Remove '-o $object'.
+ IFS=" "
+ for arg
+ do
+ case $arg in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift # fnord
+ shift # $arg
+ ;;
+ esac
+ done
+
+ test -z "$dashmflag" && dashmflag=-M
+ # Require at least two characters before searching for ':'
+ # in the target name. This is to cope with DOS-style filenames:
+ # a dependency such as 'c:/foo/bar' could be seen as target 'c' otherwise.
+ "$@" $dashmflag |
+ sed "s|^[$tab ]*[^:$tab ][^:][^:]*:[$tab ]*|$object: |" > "$tmpdepfile"
+ rm -f "$depfile"
+ cat < "$tmpdepfile" > "$depfile"
+ # Some versions of the HPUX 10.20 sed can't process this sed invocation
+ # correctly. Breaking it into two sed invocations is a workaround.
+ tr ' ' "$nl" < "$tmpdepfile" \
+ | sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' \
+ | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+dashXmstdout)
+ # This case only exists to satisfy depend.m4. It is never actually
+ # run, as this mode is specially recognized in the preamble.
+ exit 1
+ ;;
+
+makedepend)
+ "$@" || exit $?
+ # Remove any Libtool call
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+ # X makedepend
+ shift
+ cleared=no eat=no
+ for arg
+ do
+ case $cleared in
+ no)
+ set ""; shift
+ cleared=yes ;;
+ esac
+ if test $eat = yes; then
+ eat=no
+ continue
+ fi
+ case "$arg" in
+ -D*|-I*)
+ set fnord "$@" "$arg"; shift ;;
+ # Strip any option that makedepend may not understand. Remove
+ # the object too, otherwise makedepend will parse it as a source file.
+ -arch)
+ eat=yes ;;
+ -*|$object)
+ ;;
+ *)
+ set fnord "$@" "$arg"; shift ;;
+ esac
+ done
+ obj_suffix=`echo "$object" | sed 's/^.*\././'`
+ touch "$tmpdepfile"
+ ${MAKEDEPEND-makedepend} -o"$obj_suffix" -f"$tmpdepfile" "$@"
+ rm -f "$depfile"
+ # makedepend may prepend the VPATH from the source file name to the object.
+ # No need to regex-escape $object, excess matching of '.' is harmless.
+ sed "s|^.*\($object *:\)|\1|" "$tmpdepfile" > "$depfile"
+ # Some versions of the HPUX 10.20 sed can't process the last invocation
+ # correctly. Breaking it into two sed invocations is a workaround.
+ sed '1,2d' "$tmpdepfile" \
+ | tr ' ' "$nl" \
+ | sed -e 's/^\\$//' -e '/^$/d' -e '/:$/d' \
+ | sed -e 's/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile" "$tmpdepfile".bak
+ ;;
+
+cpp)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ # Remove '-o $object'.
+ IFS=" "
+ for arg
+ do
+ case $arg in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift # fnord
+ shift # $arg
+ ;;
+ esac
+ done
+
+ "$@" -E \
+ | sed -n -e '/^# [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+ -e '/^#line [0-9][0-9]* "\([^"]*\)".*/ s:: \1 \\:p' \
+ | sed '$ s: \\$::' > "$tmpdepfile"
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ cat < "$tmpdepfile" >> "$depfile"
+ sed < "$tmpdepfile" '/^$/d;s/^ //;s/ \\$//;s/$/ :/' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+msvisualcpp)
+ # Important note: in order to support this mode, a compiler *must*
+ # always write the preprocessed file to stdout.
+ "$@" || exit $?
+
+ # Remove the call to Libtool.
+ if test "$libtool" = yes; then
+ while test "X$1" != 'X--mode=compile'; do
+ shift
+ done
+ shift
+ fi
+
+ IFS=" "
+ for arg
+ do
+ case "$arg" in
+ -o)
+ shift
+ ;;
+ $object)
+ shift
+ ;;
+ "-Gm"|"/Gm"|"-Gi"|"/Gi"|"-ZI"|"/ZI")
+ set fnord "$@"
+ shift
+ shift
+ ;;
+ *)
+ set fnord "$@" "$arg"
+ shift
+ shift
+ ;;
+ esac
+ done
+ "$@" -E 2>/dev/null |
+ sed -n '/^#line [0-9][0-9]* "\([^"]*\)"/ s::\1:p' | $cygpath_u | sort -u > "$tmpdepfile"
+ rm -f "$depfile"
+ echo "$object : \\" > "$depfile"
+ sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::'"$tab"'\1 \\:p' >> "$depfile"
+ echo "$tab" >> "$depfile"
+ sed < "$tmpdepfile" -n -e 's% %\\ %g' -e '/^\(.*\)$/ s::\1\::p' >> "$depfile"
+ rm -f "$tmpdepfile"
+ ;;
+
+msvcmsys)
+ # This case exists only to let depend.m4 do its work. It works by
+ # looking at the text of this script. This case will never be run,
+ # since it is checked for above.
+ exit 1
+ ;;
+
+none)
+ exec "$@"
+ ;;
+
+*)
+ echo "Unknown depmode $depmode" 1>&2
+ exit 1
+ ;;
+esac
+
+exit 0
+
+# Local Variables:
+# mode: shell-script
+# sh-indentation: 2
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/doc/100prozent.txt b/doc/100prozent.txt
new file mode 100644
index 00000000..8c92c0f9
--- /dev/null
+++ b/doc/100prozent.txt
@@ -0,0 +1,23 @@
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_LARGEFILE) = 0
+select(1, [0], NULL, NULL, {0, 100000}) = 1 (in [0], left {0, 99999})
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_NONBLOCK|O_LARGEFILE) = 0
+read(0, "", 1023) = 0
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_LARGEFILE) = 0
+select(1, [0], NULL, NULL, {0, 100000}) = 1 (in [0], left {0, 99998})
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_NONBLOCK|O_LARGEFILE) = 0
+read(0, "", 1023) = 0
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_LARGEFILE) = 0
+select(1, [0], NULL, NULL, {0, 100000}) = 1 (in [0], left {0, 99999})
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_NONBLOCK|O_LARGEFILE) = 0
+read(0, "", 1023) = 0
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_LARGEFILE) = 0
+select(1, [0], NULL, NULL, {0, 100000}) = 1 (in [0], left {0, 99999})
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_NONBLOCK|O_LARGEFILE) = 0
+read(0, "", 1023) = 0
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_LARGEFILE) = 0
+select(1, [0], NULL, NULL, {0, 100000}) = 1 (in [0], left {0, 99999})
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_NONBLOCK|O_LARGEFILE) = 0
+read(0, "", 1023) = 0
+fcntl(0, F_SETFL, O_RDWR|O_APPEND|O_LARGEFILE) = 0
+^CProcess 7036 detached
+
diff --git a/doc/Makefile.am b/doc/Makefile.am
new file mode 100644
index 00000000..da0eda92
--- /dev/null
+++ b/doc/Makefile.am
@@ -0,0 +1,44 @@
+#----------------------------------------------------------------------
+# Makefile.am - the Final Cut library
+#----------------------------------------------------------------------
+
+EXTRA_DIST = \
+ calendar-draft.png \
+ class-diagram.txt \
+ console_codes-manual.sh \
+ console_ioctl-manual.sh \
+ fileopen-dialog.png \
+ menu-draft.png \
+ ncurses.supp \
+ newfont1.png \
+ newfont2.png \
+ progress-bar.png \
+ readme.txt \
+ terminfo-capabilities.sh \
+ terminfo-manual.sh \
+ textview.png \
+ TODO \
+ vt100_line_drawing_graphics.png \
+ VTerm.txt \
+ xgraphics
+
+doc_DATA = \
+ calendar-draft.png \
+ class-diagram.txt \
+ console_codes-manual.sh \
+ console_ioctl-manual.sh \
+ fileopen-dialog.png \
+ menu-draft.png \
+ ncurses.supp \
+ newfont1.png \
+ newfont2.png \
+ progress-bar.png \
+ readme.txt \
+ terminfo-capabilities.sh \
+ terminfo-manual.sh \
+ textview.png \
+ TODO \
+ vt100_line_drawing_graphics.png \
+ VTerm.txt \
+ xgraphics
+
diff --git a/doc/Makefile.in b/doc/Makefile.in
new file mode 100644
index 00000000..0a6ff13e
--- /dev/null
+++ b/doc/Makefile.in
@@ -0,0 +1,526 @@
+# Makefile.in generated by automake 1.13.4 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+#----------------------------------------------------------------------
+# Makefile.am - the Final Cut library
+#----------------------------------------------------------------------
+
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = doc
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am TODO
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/libtool.m4 \
+ $(top_srcdir)/m4/ltoptions.m4 $(top_srcdir)/m4/ltsugar.m4 \
+ $(top_srcdir)/m4/ltversion.m4 $(top_srcdir)/m4/lt~obsolete.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+SOURCES =
+DIST_SOURCES =
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+ srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+ for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+ $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+ if (++n[$$2] == $(am__install_max)) \
+ { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+ END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+ sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+ sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+ test -z "$$files" \
+ || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+ || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+ $(am__cd) "$$dir" && rm -f $$files; }; \
+ }
+am__installdirs = "$(DESTDIR)$(docdir)"
+DATA = $(doc_DATA)
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIBTOOL_DEPS = @LIBTOOL_DEPS@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+SO_VERSION = @SO_VERSION@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+EXTRA_DIST = \
+ calendar-draft.png \
+ class-diagram.txt \
+ console_codes-manual.sh \
+ console_ioctl-manual.sh \
+ fileopen-dialog.png \
+ menu-draft.png \
+ ncurses.supp \
+ newfont1.png \
+ newfont2.png \
+ progress-bar.png \
+ readme.txt \
+ terminfo-capabilities.sh \
+ terminfo-manual.sh \
+ textview.png \
+ TODO \
+ vt100_line_drawing_graphics.png \
+ VTerm.txt \
+ xgraphics
+
+doc_DATA = \
+ calendar-draft.png \
+ class-diagram.txt \
+ console_codes-manual.sh \
+ console_ioctl-manual.sh \
+ fileopen-dialog.png \
+ menu-draft.png \
+ ncurses.supp \
+ newfont1.png \
+ newfont2.png \
+ progress-bar.png \
+ readme.txt \
+ terminfo-capabilities.sh \
+ terminfo-manual.sh \
+ textview.png \
+ TODO \
+ vt100_line_drawing_graphics.png \
+ VTerm.txt \
+ xgraphics
+
+all: all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu doc/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --gnu doc/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+install-docDATA: $(doc_DATA)
+ @$(NORMAL_INSTALL)
+ @list='$(doc_DATA)'; test -n "$(docdir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(docdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(docdir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(docdir)'"; \
+ $(INSTALL_DATA) $$files "$(DESTDIR)$(docdir)" || exit $$?; \
+ done
+
+uninstall-docDATA:
+ @$(NORMAL_UNINSTALL)
+ @list='$(doc_DATA)'; test -n "$(docdir)" || list=; \
+ files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+ dir='$(DESTDIR)$(docdir)'; $(am__uninstall_files_from_dir)
+tags TAGS:
+
+ctags CTAGS:
+
+cscope cscopelist:
+
+
+distdir: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-am
+all-am: Makefile $(DATA)
+installdirs:
+ for dir in "$(DESTDIR)$(docdir)"; do \
+ test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+ done
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am: install-docDATA
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am: uninstall-docDATA
+
+.MAKE: install-am install-strip
+
+.PHONY: all all-am check check-am clean clean-generic clean-libtool \
+ cscopelist-am ctags-am distclean distclean-generic \
+ distclean-libtool distdir dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am \
+ install-docDATA install-dvi install-dvi-am install-exec \
+ install-exec-am install-html install-html-am install-info \
+ install-info-am install-man install-pdf install-pdf-am \
+ install-ps install-ps-am install-strip installcheck \
+ installcheck-am installdirs maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-generic \
+ mostlyclean-libtool pdf pdf-am ps ps-am tags-am uninstall \
+ uninstall-am uninstall-docDATA
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/doc/TODO b/doc/TODO
new file mode 100644
index 00000000..69a56da5
--- /dev/null
+++ b/doc/TODO
@@ -0,0 +1,24 @@
+Bugs
+~~~~
+-
+
+Missing Features
+~~~~~~~~~~~~~~~~
+- application menu
+ - FMenuBar()
+ - FPopupMenu()
+
+- list/tree view with Columns
+ - FListView()
+---------------------------------------
+ /
+ ├──► bin
+ ├──▼ usr
+ │ ├──► bin
+ │ ├──► lib
+ │ └──► local
+ └──► tmp
+---------------------------------------
+
+- Multiple lines support for FLabel
+
diff --git a/doc/VTerm.txt b/doc/VTerm.txt
new file mode 100644
index 00000000..995f1a8d
--- /dev/null
+++ b/doc/VTerm.txt
@@ -0,0 +1,51 @@
+
+ print(...)
+printf(...)
+ │
+ │ ╔═════════════════════════[ vterm ]═════════════════════════╗
+ │ ║createVTerm() ║
+ │ ║ ┌ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ┐ ║
+ │ ║ ║
+ │ ║ │ restoreVTerm(x,y,w,h) │ ║
+ │ ║ ║
+ │ ║ └ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ─ ┘ ║
+ │ ║ ║
+ │ ┌───────╨─────[ vwin ]─────────────┐ ║
+ │ │createArea(area) │ ║
+ │ │ │ ║
+ │ │ │ ║
+ └───┼─────────────► ──────► updateVTerm(area) ────► ║
+ │ │ ║
+ │ putArea(x,y,area) ║
+ │ ────────────────────► ║
+ │ getArea(x,y,area) ║
+ │ ◄──────────────────── ║
+ │ │ ║
+ │ │ ║
+ │ resizeArea(area)│ ║
+ └───────╥──────────────────────────┘ ║
+ ║ ║
+ ║ ║
+ ║ ║
+ ║ │ resizeVTerm()║
+ ╚═══▼═══════════════════════════════════════════════════════╝
+ │
+ │ putVTerm() ┌───────────────┐
+ └───────────────────►│ output_buffer │
+ updateTerminal() └───────┬───────┘
+ │
+ │ flush_out()
+ │ +
+ │ Fputchar(char)
+ │
+ ▼
+ ▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄
+ ▌ ▐
+ ▌ screen ▐
+ ▌ ───────────── ▐
+ ▌ real terminal ▐
+ ▌ ▐
+ ▀▀▀▀▀▀▀███▀▀▀▀▀▀▀
+ ███
+ ▀▀▀▀▀▀▀▀▀
+
diff --git a/doc/calendar-draft.png b/doc/calendar-draft.png
new file mode 100644
index 00000000..7024a4e1
Binary files /dev/null and b/doc/calendar-draft.png differ
diff --git a/doc/class-diagram.txt b/doc/class-diagram.txt
new file mode 100644
index 00000000..46094535
--- /dev/null
+++ b/doc/class-diagram.txt
@@ -0,0 +1,85 @@
+══════════════════════════════════════════════════════════════════════════════
+ Class digramm
+══════════════════════════════════════════════════════════════════════════════
+
+ ┌───────────┐
+ ┌────┤ FKeyEvent │
+ │ └───────────┘
+ │ ┌─────────────┐
+ ├────┤ FMouseEvent │
+ │ └─────────────┘
+ │ ┌─────────────┐
+ ├────┤ FWheelEvent │
+ │ └─────────────┘
+ │ ┌─────────────┐
+ ├────┤ FFocusEvent │
+ │ └─────────────┘
+ │ ┌─────────────┐
+ ┌────────┐ ├────┤ FAccelEvent │
+ │ FEvent │◄─┤ └─────────────┘
+ └────┬───┘ │ ┌──────────────┐
+ │1 ├────┤ FResizeEvent │
+ │ │ └──────────────┘
+ │ │ ┌────────────┐
+ │ ├────┤ FShowEvent │
+ │ │ └────────────┘
+ │ │ ┌────────────┐
+ │ ├────┤ FHideEvent │
+ │ │ └────────────┘
+ │ │ ┌─────────────┐
+ │ ├────┤ FCloseEvent │
+ │ │ └─────────────┘
+ │ │ ┌─────────────┐
+ │ └────┤ FTimerEvent │
+ │ └─────────────┘
+ │
+ │ ┌──────────────┐
+ │ ┌────┤ FApplication │
+ │ │ └──────────────┘
+ │ │ ┌─────────┐1
+ │ ├────┤ FButton ├-----------------------------.
+ │ │ └─────────┘ │
+ │ │ ┌────────┐1 │
+ │ ├────┤ FLabel ├------------------------------┤
+ │ │ └────────┘ │
+ │ │ ┌───────────┐1 │
+ │ ├────┤ FLineEdit ├---------------------------┤
+ │ │ └───────────┘ ┌──────────────┐1 │
+ │ │ ┌───────────────┐ ┌──┤ FRadioButton ├--┤
+ │1 ├────┤ FToggleButton │◄─┤ └──────────────┘ │
+ ┌─────────┐ ┌─────┴───┐ │ └───────────────┘ │ ┌───────────┐1 │
+ │ FObject │◄─┬┤ FWidget │◄─┤ ┌──────────────┐ └──┤ FCheckBox ├-----┤
+ └─────────┘ │└───┬─┬───┘ ├────┤ FButtonGroup │ └───────────┘ │
+ │ │1│1 │ └──────────────┘ │
+ ┌───────┐ │ │ │ │ ┌──────────────┐ │
+ │ FTerm │◄─┘ │ │ ├────┤ FProgressbar │ │ *┌─────────┐
+ └──┬─┬──┘ │ │ │ └──────────────┘ ├---┤ FString │
+ │1│1 │ │ │ ┌────────────┐ │ └─────────┘
+ │ └----------┤ │ ├────┤ FScrollbar │ │
+ │* │ │ │ └────────────┘ │
+ ┌────┴──────┐ │ │ │ ┌───────────┐1 │
+ │ FOptiMove │ │ │ ├────┤ FTextView ├---------------------------┤
+ └───────────┘ │ │ │ └───────────┘ │
+ │ │ │ ┌──────────┐1 *┌──────────────┐1 │
+ │ │ ├────┤ FListBox ├-------┤ FListBoxItem ├-----┤
+ │ │ │ └──────────┘ └──────────────┘ │
+ │ │ │ ┌────────────┐1 *┌────────────┐1 │
+ │ │ ├────┤ FStatusBar ├-----┤ FStatusKey ├-------┤
+ │ │ │ └────┬───────┘ └────────────┘ │
+ │ │ │ 1└----------------------------------┤
+ │ │ │ ┌─────────────┐1 │
+ │ │ ┌───┴─────┐ ┌─────────┐ ┌──┤ FFileDialog ├----┤
+ │ │ │ FWindow │◄─┤ FDialog │◄──┤ └─────────────┘ │
+ │ │ └─────────┘ └────┬────┘ │ ┌─────────────┐1 │
+ │ │ │ └──┤ FMessageBox ├----┤
+ │ │ │ └─────────────┘ │
+ │ │ 1└------------------------------┤
+ │ │ │
+ │ └---------------------------------------------------'
+ │ *┌────────┐
+ ├---┤ FPoint │
+ │ └────────┘
+ │ *┌───────┐
+ └---┤ FRect │
+ └───────┘
+
diff --git a/doc/console_codes-manual.sh b/doc/console_codes-manual.sh
new file mode 100755
index 00000000..da084d69
--- /dev/null
+++ b/doc/console_codes-manual.sh
@@ -0,0 +1,7 @@
+#!/bin/bash
+
+# set the xterm window title
+TERMTITLE="man 4 console_codes"
+echo -ne "\033]0;${TERMTITLE}\007"
+
+man 4 console_codes
diff --git a/doc/console_ioctl-manual.sh b/doc/console_ioctl-manual.sh
new file mode 100755
index 00000000..73d3141a
--- /dev/null
+++ b/doc/console_ioctl-manual.sh
@@ -0,0 +1,7 @@
+#!/bin/bash
+
+# set the xterm window title
+TERMTITLE="man 4 console_ioctl"
+echo -ne "\033]0;${TERMTITLE}\007"
+
+man 4 console_ioctl
diff --git a/doc/fileopen-dialog.png b/doc/fileopen-dialog.png
new file mode 100644
index 00000000..4ae193a7
Binary files /dev/null and b/doc/fileopen-dialog.png differ
diff --git a/doc/menu-draft.png b/doc/menu-draft.png
new file mode 100644
index 00000000..6859b611
Binary files /dev/null and b/doc/menu-draft.png differ
diff --git a/doc/ncurses.supp b/doc/ncurses.supp
new file mode 100644
index 00000000..bca582c0
--- /dev/null
+++ b/doc/ncurses.supp
@@ -0,0 +1,205 @@
+# $Id: ncurses.supp,v 1.7 2008/09/20 18:43:42 tom Exp $
+##############################################################################
+# Copyright (c) 2008 Free Software Foundation, Inc. #
+# #
+# Permission is hereby granted, free of charge, to any person obtaining a #
+# copy of this software and associated documentation files (the "Software"), #
+# to deal in the Software without restriction, including without limitation #
+# the rights to use, copy, modify, merge, publish, distribute, distribute #
+# with modifications, sublicense, and/or sell copies of the Software, and to #
+# permit persons to whom the Software is furnished to do so, subject to the #
+# following conditions: #
+# #
+# The above copyright notice and this permission notice shall be included in #
+# all copies or substantial portions of the Software. #
+# #
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR #
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, #
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL #
+# THE ABOVE COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER #
+# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING #
+# FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER #
+# DEALINGS IN THE SOFTWARE. #
+# #
+# Except as contained in this notice, the name(s) of the above copyright #
+# holders shall not be used in advertising or otherwise to promote the sale, #
+# use or other dealings in this Software without prior written #
+# authorization. #
+##############################################################################
+#
+# This is a warning-suppression file for valgrind and ncurses.
+#
+# ncurses can also be configured using the --disable-leaks option, which
+# allows an application to call _nc_freeall() or _nc_free_and_exit(), to
+# free all of ncurses' "permanent" memory.
+#
+# Some of these leaks can be freed if the application does its own cleanup,
+# for example:
+# delscreen(SP);
+# del_curterm(cur_term);
+# However, few applications do this.
+
+{
+ ncurses_leak__nc_add_to_try
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_add_to_try
+}
+
+{
+ ncurses_leak__nc_home_terminfo
+ Memcheck:Leak
+ fun:malloc
+ fun:_nc_home_terminfo
+}
+
+{
+ ncurses_leak__nc_init_wacs
+ Memcheck:Leak
+ fun:calloc
+ fun:_nc_init_wacs
+}
+
+{
+ ncurses_leak__nc_keyname
+ Memcheck:Leak
+ fun:calloc
+ fun:_nc_keyname
+}
+
+{
+ ncurses_leak__nc_keyname_2
+ Memcheck:Leak
+ fun:malloc
+ fun:strdup
+ fun:_nc_keyname
+}
+
+{
+ ncurses_leak__nc_printf_string
+ Memcheck:Leak
+ fun:malloc
+ fun:_nc_doalloc
+ fun:_nc_printf_string
+}
+
+{
+ ncurses_leak__nc_read_termtype
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_read_termtype
+ fun:_nc_read_file_entry
+}
+
+{
+ ncurses_leak__nc_read_termtype_2
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_doalloc
+ fun:_nc_read_termtype
+ fun:_nc_read_file_entry
+}
+
+{
+ ncurses_leak__nc_scroll_optimize
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_hash_map
+ fun:_nc_scroll_optimize
+}
+
+{
+ ncurses_leak__nc_scroll_optimize_2
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_doalloc
+ fun:_nc_scroll_optimize
+}
+
+{
+ ncurses_leak__nc_setupscreen
+ Memcheck:Leak
+ fun:calloc
+ fun:_nc_setupscreen
+ fun:newterm
+}
+
+{
+ ncurses_leak__nc_setupscreen_2
+ Memcheck:Leak
+ fun:calloc
+ fun:newwin
+ fun:_nc_setupscreen
+}
+
+{
+ ncurses_leak__nc_setupterm_1
+ Memcheck:Leak
+ fun:malloc
+ fun:strdup
+ fun:_nc_setupterm
+}
+
+{
+ ncurses_leak__nc_setupterm
+ Memcheck:Leak
+ fun:calloc
+ fun:_nc_setupterm
+}
+
+{
+ ncurses_leak__nc_setupscreen_3
+ Memcheck:Leak
+ fun:calloc
+ fun:_nc_makenew
+ fun:newwin
+ fun:_nc_setupscreen
+}
+
+{
+ ncurses_leak__nc_set_buffer
+ Memcheck:Leak
+ fun:malloc
+ fun:_nc_set_buffer
+}
+
+{
+ ncurses_leak__nc_tparm_analyze
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_doalloc
+ fun:_nc_tparm_analyze
+}
+
+{
+ ncurses_leak__nc_trace_alloc
+ Memcheck:Leak
+ fun:*alloc
+ fun:_nc_doalloc
+ fun:_nc_trace_alloc
+}
+
+{
+ ncurses_leak_start_color
+ Memcheck:Leak
+ fun:calloc
+ fun:start_color
+}
+
+{
+ ncurses_leak_tparm
+ Memcheck:Leak
+ fun:realloc
+ fun:_nc_doalloc
+ fun:tparm
+}
+
+{
+ ncurses_leak_tparam_internal
+ Memcheck:Leak
+ fun:realloc
+ fun:_nc_doalloc
+ fun:get_space
+ fun:save_number
+ fun:tparam_internal
+}
diff --git a/doc/newfont1.png b/doc/newfont1.png
new file mode 100644
index 00000000..2eeb228b
Binary files /dev/null and b/doc/newfont1.png differ
diff --git a/doc/newfont2.png b/doc/newfont2.png
new file mode 100644
index 00000000..e3034fbb
Binary files /dev/null and b/doc/newfont2.png differ
diff --git a/doc/progress-bar.png b/doc/progress-bar.png
new file mode 100644
index 00000000..0ae03260
Binary files /dev/null and b/doc/progress-bar.png differ
diff --git a/doc/readme.txt b/doc/readme.txt
new file mode 100644
index 00000000..140b0b72
--- /dev/null
+++ b/doc/readme.txt
@@ -0,0 +1,11 @@
+----------------------------------------------------------------------
+ The Final Cut
+----------------------------------------------------------------------
+
+The Final Cut is a programming library and widget toolkit that creates
+a text-based user interface with full mouse support. It supports the
+controlled handling of multiple simultaneous windows.
+The C++ class design is inspired by the Qt framework. It offers common
+user interface elements like dialog windows, push buttons, check boxes,
+radio buttons, input lines, list boxes, status bars and so on.
+
diff --git a/doc/terminfo-capabilities.sh b/doc/terminfo-capabilities.sh
new file mode 100755
index 00000000..0a558de6
--- /dev/null
+++ b/doc/terminfo-capabilities.sh
@@ -0,0 +1,7 @@
+#!/bin/bash
+
+# set the xterm window title
+TERMTITLE="infocmp: $TERM"
+echo -ne "\033]0;${TERMTITLE}\007"
+
+infocmp | less
diff --git a/doc/terminfo-manual.sh b/doc/terminfo-manual.sh
new file mode 100755
index 00000000..67547c33
--- /dev/null
+++ b/doc/terminfo-manual.sh
@@ -0,0 +1,8 @@
+#!/bin/bash
+
+# set the xterm window title
+TERMTITLE="man 5 terminfo"
+echo -ne "\033]0;${TERMTITLE}\007"
+
+man 5 terminfo
+
diff --git a/doc/textview.png b/doc/textview.png
new file mode 100644
index 00000000..4005dab8
Binary files /dev/null and b/doc/textview.png differ
diff --git a/doc/vt100_line_drawing_graphics.png b/doc/vt100_line_drawing_graphics.png
new file mode 100644
index 00000000..0bc664bd
Binary files /dev/null and b/doc/vt100_line_drawing_graphics.png differ
diff --git a/doc/xgraphics b/doc/xgraphics
new file mode 100644
index 00000000..cfd5898f
--- /dev/null
+++ b/doc/xgraphics
@@ -0,0 +1,24 @@
+Unicode Box Drawing graphics
+ ┌─┬─┐ ╭─┬─╮
+ ├─┼─┤ ├─┼─┤
+ │ │ │ │ │ │ │││
+ └─┴─┘ ╰─┴─╯ ╎┆┊
+ ┏━┳━┓ ╔═╦═╗
+ ┣━╋━┫ ╠═╬═╣
+ ┃ ┃ ┃ ║ ║ ║ ┃┃┃ ║
+ ┗━┻━┛ ╚═╩═╝ ╏┇┋ ◆
+
+VT100 line drawing graphics
+(used by xterm, rxvt, ...)
+codes `abcdefghijklmnopqrstuvwxyz{|}~
+with G1 )0`abcdefghijklmnopqrstuvwxyz{|}~
+with G0 (0`abcdefghijklmnopqrstuvwxyz{|}~(B
+
+VGA graphics, switching to "active codepage"
+(used by cygwin console, Linux console)
+[11m
+8x 9x
+Ax Bx
+Cx Dx
+Ex Fx
+[10m
diff --git a/install-sh b/install-sh
new file mode 100755
index 00000000..377bb868
--- /dev/null
+++ b/install-sh
@@ -0,0 +1,527 @@
+#!/bin/sh
+# install - install a program, script, or datafile
+
+scriptversion=2011-11-20.07; # UTC
+
+# This originates from X11R5 (mit/util/scripts/install.sh), which was
+# later released in X11R6 (xc/config/util/install.sh) with the
+# following copyright and license.
+#
+# Copyright (C) 1994 X Consortium
+#
+# Permission is hereby granted, free of charge, to any person obtaining a copy
+# of this software and associated documentation files (the "Software"), to
+# deal in the Software without restriction, including without limitation the
+# rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+# sell copies of the Software, and to permit persons to whom the Software is
+# furnished to do so, subject to the following conditions:
+#
+# The above copyright notice and this permission notice shall be included in
+# all copies or substantial portions of the Software.
+#
+# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+# X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN
+# AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNEC-
+# TION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+#
+# Except as contained in this notice, the name of the X Consortium shall not
+# be used in advertising or otherwise to promote the sale, use or other deal-
+# ings in this Software without prior written authorization from the X Consor-
+# tium.
+#
+#
+# FSF changes to this file are in the public domain.
+#
+# Calling this script install-sh is preferred over install.sh, to prevent
+# 'make' implicit rules from creating a file called install from it
+# when there is no Makefile.
+#
+# This script is compatible with the BSD install script, but was written
+# from scratch.
+
+nl='
+'
+IFS=" "" $nl"
+
+# set DOITPROG to echo to test this script
+
+# Don't use :- since 4.3BSD and earlier shells don't like it.
+doit=${DOITPROG-}
+if test -z "$doit"; then
+ doit_exec=exec
+else
+ doit_exec=$doit
+fi
+
+# Put in absolute file names if you don't have them in your path;
+# or use environment vars.
+
+chgrpprog=${CHGRPPROG-chgrp}
+chmodprog=${CHMODPROG-chmod}
+chownprog=${CHOWNPROG-chown}
+cmpprog=${CMPPROG-cmp}
+cpprog=${CPPROG-cp}
+mkdirprog=${MKDIRPROG-mkdir}
+mvprog=${MVPROG-mv}
+rmprog=${RMPROG-rm}
+stripprog=${STRIPPROG-strip}
+
+posix_glob='?'
+initialize_posix_glob='
+ test "$posix_glob" != "?" || {
+ if (set -f) 2>/dev/null; then
+ posix_glob=
+ else
+ posix_glob=:
+ fi
+ }
+'
+
+posix_mkdir=
+
+# Desired mode of installed file.
+mode=0755
+
+chgrpcmd=
+chmodcmd=$chmodprog
+chowncmd=
+mvcmd=$mvprog
+rmcmd="$rmprog -f"
+stripcmd=
+
+src=
+dst=
+dir_arg=
+dst_arg=
+
+copy_on_change=false
+no_target_directory=
+
+usage="\
+Usage: $0 [OPTION]... [-T] SRCFILE DSTFILE
+ or: $0 [OPTION]... SRCFILES... DIRECTORY
+ or: $0 [OPTION]... -t DIRECTORY SRCFILES...
+ or: $0 [OPTION]... -d DIRECTORIES...
+
+In the 1st form, copy SRCFILE to DSTFILE.
+In the 2nd and 3rd, copy all SRCFILES to DIRECTORY.
+In the 4th, create DIRECTORIES.
+
+Options:
+ --help display this help and exit.
+ --version display version info and exit.
+
+ -c (ignored)
+ -C install only if different (preserve the last data modification time)
+ -d create directories instead of installing files.
+ -g GROUP $chgrpprog installed files to GROUP.
+ -m MODE $chmodprog installed files to MODE.
+ -o USER $chownprog installed files to USER.
+ -s $stripprog installed files.
+ -t DIRECTORY install into DIRECTORY.
+ -T report an error if DSTFILE is a directory.
+
+Environment variables override the default commands:
+ CHGRPPROG CHMODPROG CHOWNPROG CMPPROG CPPROG MKDIRPROG MVPROG
+ RMPROG STRIPPROG
+"
+
+while test $# -ne 0; do
+ case $1 in
+ -c) ;;
+
+ -C) copy_on_change=true;;
+
+ -d) dir_arg=true;;
+
+ -g) chgrpcmd="$chgrpprog $2"
+ shift;;
+
+ --help) echo "$usage"; exit $?;;
+
+ -m) mode=$2
+ case $mode in
+ *' '* | *' '* | *'
+'* | *'*'* | *'?'* | *'['*)
+ echo "$0: invalid mode: $mode" >&2
+ exit 1;;
+ esac
+ shift;;
+
+ -o) chowncmd="$chownprog $2"
+ shift;;
+
+ -s) stripcmd=$stripprog;;
+
+ -t) dst_arg=$2
+ # Protect names problematic for 'test' and other utilities.
+ case $dst_arg in
+ -* | [=\(\)!]) dst_arg=./$dst_arg;;
+ esac
+ shift;;
+
+ -T) no_target_directory=true;;
+
+ --version) echo "$0 $scriptversion"; exit $?;;
+
+ --) shift
+ break;;
+
+ -*) echo "$0: invalid option: $1" >&2
+ exit 1;;
+
+ *) break;;
+ esac
+ shift
+done
+
+if test $# -ne 0 && test -z "$dir_arg$dst_arg"; then
+ # When -d is used, all remaining arguments are directories to create.
+ # When -t is used, the destination is already specified.
+ # Otherwise, the last argument is the destination. Remove it from $@.
+ for arg
+ do
+ if test -n "$dst_arg"; then
+ # $@ is not empty: it contains at least $arg.
+ set fnord "$@" "$dst_arg"
+ shift # fnord
+ fi
+ shift # arg
+ dst_arg=$arg
+ # Protect names problematic for 'test' and other utilities.
+ case $dst_arg in
+ -* | [=\(\)!]) dst_arg=./$dst_arg;;
+ esac
+ done
+fi
+
+if test $# -eq 0; then
+ if test -z "$dir_arg"; then
+ echo "$0: no input file specified." >&2
+ exit 1
+ fi
+ # It's OK to call 'install-sh -d' without argument.
+ # This can happen when creating conditional directories.
+ exit 0
+fi
+
+if test -z "$dir_arg"; then
+ do_exit='(exit $ret); exit $ret'
+ trap "ret=129; $do_exit" 1
+ trap "ret=130; $do_exit" 2
+ trap "ret=141; $do_exit" 13
+ trap "ret=143; $do_exit" 15
+
+ # Set umask so as not to create temps with too-generous modes.
+ # However, 'strip' requires both read and write access to temps.
+ case $mode in
+ # Optimize common cases.
+ *644) cp_umask=133;;
+ *755) cp_umask=22;;
+
+ *[0-7])
+ if test -z "$stripcmd"; then
+ u_plus_rw=
+ else
+ u_plus_rw='% 200'
+ fi
+ cp_umask=`expr '(' 777 - $mode % 1000 ')' $u_plus_rw`;;
+ *)
+ if test -z "$stripcmd"; then
+ u_plus_rw=
+ else
+ u_plus_rw=,u+rw
+ fi
+ cp_umask=$mode$u_plus_rw;;
+ esac
+fi
+
+for src
+do
+ # Protect names problematic for 'test' and other utilities.
+ case $src in
+ -* | [=\(\)!]) src=./$src;;
+ esac
+
+ if test -n "$dir_arg"; then
+ dst=$src
+ dstdir=$dst
+ test -d "$dstdir"
+ dstdir_status=$?
+ else
+
+ # Waiting for this to be detected by the "$cpprog $src $dsttmp" command
+ # might cause directories to be created, which would be especially bad
+ # if $src (and thus $dsttmp) contains '*'.
+ if test ! -f "$src" && test ! -d "$src"; then
+ echo "$0: $src does not exist." >&2
+ exit 1
+ fi
+
+ if test -z "$dst_arg"; then
+ echo "$0: no destination specified." >&2
+ exit 1
+ fi
+ dst=$dst_arg
+
+ # If destination is a directory, append the input filename; won't work
+ # if double slashes aren't ignored.
+ if test -d "$dst"; then
+ if test -n "$no_target_directory"; then
+ echo "$0: $dst_arg: Is a directory" >&2
+ exit 1
+ fi
+ dstdir=$dst
+ dst=$dstdir/`basename "$src"`
+ dstdir_status=0
+ else
+ # Prefer dirname, but fall back on a substitute if dirname fails.
+ dstdir=`
+ (dirname "$dst") 2>/dev/null ||
+ expr X"$dst" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \
+ X"$dst" : 'X\(//\)[^/]' \| \
+ X"$dst" : 'X\(//\)$' \| \
+ X"$dst" : 'X\(/\)' \| . 2>/dev/null ||
+ echo X"$dst" |
+ sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)[^/].*/{
+ s//\1/
+ q
+ }
+ /^X\(\/\/\)$/{
+ s//\1/
+ q
+ }
+ /^X\(\/\).*/{
+ s//\1/
+ q
+ }
+ s/.*/./; q'
+ `
+
+ test -d "$dstdir"
+ dstdir_status=$?
+ fi
+ fi
+
+ obsolete_mkdir_used=false
+
+ if test $dstdir_status != 0; then
+ case $posix_mkdir in
+ '')
+ # Create intermediate dirs using mode 755 as modified by the umask.
+ # This is like FreeBSD 'install' as of 1997-10-28.
+ umask=`umask`
+ case $stripcmd.$umask in
+ # Optimize common cases.
+ *[2367][2367]) mkdir_umask=$umask;;
+ .*0[02][02] | .[02][02] | .[02]) mkdir_umask=22;;
+
+ *[0-7])
+ mkdir_umask=`expr $umask + 22 \
+ - $umask % 100 % 40 + $umask % 20 \
+ - $umask % 10 % 4 + $umask % 2
+ `;;
+ *) mkdir_umask=$umask,go-w;;
+ esac
+
+ # With -d, create the new directory with the user-specified mode.
+ # Otherwise, rely on $mkdir_umask.
+ if test -n "$dir_arg"; then
+ mkdir_mode=-m$mode
+ else
+ mkdir_mode=
+ fi
+
+ posix_mkdir=false
+ case $umask in
+ *[123567][0-7][0-7])
+ # POSIX mkdir -p sets u+wx bits regardless of umask, which
+ # is incompatible with FreeBSD 'install' when (umask & 300) != 0.
+ ;;
+ *)
+ tmpdir=${TMPDIR-/tmp}/ins$RANDOM-$$
+ trap 'ret=$?; rmdir "$tmpdir/d" "$tmpdir" 2>/dev/null; exit $ret' 0
+
+ if (umask $mkdir_umask &&
+ exec $mkdirprog $mkdir_mode -p -- "$tmpdir/d") >/dev/null 2>&1
+ then
+ if test -z "$dir_arg" || {
+ # Check for POSIX incompatibilities with -m.
+ # HP-UX 11.23 and IRIX 6.5 mkdir -m -p sets group- or
+ # other-writable bit of parent directory when it shouldn't.
+ # FreeBSD 6.1 mkdir -m -p sets mode of existing directory.
+ ls_ld_tmpdir=`ls -ld "$tmpdir"`
+ case $ls_ld_tmpdir in
+ d????-?r-*) different_mode=700;;
+ d????-?--*) different_mode=755;;
+ *) false;;
+ esac &&
+ $mkdirprog -m$different_mode -p -- "$tmpdir" && {
+ ls_ld_tmpdir_1=`ls -ld "$tmpdir"`
+ test "$ls_ld_tmpdir" = "$ls_ld_tmpdir_1"
+ }
+ }
+ then posix_mkdir=:
+ fi
+ rmdir "$tmpdir/d" "$tmpdir"
+ else
+ # Remove any dirs left behind by ancient mkdir implementations.
+ rmdir ./$mkdir_mode ./-p ./-- 2>/dev/null
+ fi
+ trap '' 0;;
+ esac;;
+ esac
+
+ if
+ $posix_mkdir && (
+ umask $mkdir_umask &&
+ $doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir"
+ )
+ then :
+ else
+
+ # The umask is ridiculous, or mkdir does not conform to POSIX,
+ # or it failed possibly due to a race condition. Create the
+ # directory the slow way, step by step, checking for races as we go.
+
+ case $dstdir in
+ /*) prefix='/';;
+ [-=\(\)!]*) prefix='./';;
+ *) prefix='';;
+ esac
+
+ eval "$initialize_posix_glob"
+
+ oIFS=$IFS
+ IFS=/
+ $posix_glob set -f
+ set fnord $dstdir
+ shift
+ $posix_glob set +f
+ IFS=$oIFS
+
+ prefixes=
+
+ for d
+ do
+ test X"$d" = X && continue
+
+ prefix=$prefix$d
+ if test -d "$prefix"; then
+ prefixes=
+ else
+ if $posix_mkdir; then
+ (umask=$mkdir_umask &&
+ $doit_exec $mkdirprog $mkdir_mode -p -- "$dstdir") && break
+ # Don't fail if two instances are running concurrently.
+ test -d "$prefix" || exit 1
+ else
+ case $prefix in
+ *\'*) qprefix=`echo "$prefix" | sed "s/'/'\\\\\\\\''/g"`;;
+ *) qprefix=$prefix;;
+ esac
+ prefixes="$prefixes '$qprefix'"
+ fi
+ fi
+ prefix=$prefix/
+ done
+
+ if test -n "$prefixes"; then
+ # Don't fail if two instances are running concurrently.
+ (umask $mkdir_umask &&
+ eval "\$doit_exec \$mkdirprog $prefixes") ||
+ test -d "$dstdir" || exit 1
+ obsolete_mkdir_used=true
+ fi
+ fi
+ fi
+
+ if test -n "$dir_arg"; then
+ { test -z "$chowncmd" || $doit $chowncmd "$dst"; } &&
+ { test -z "$chgrpcmd" || $doit $chgrpcmd "$dst"; } &&
+ { test "$obsolete_mkdir_used$chowncmd$chgrpcmd" = false ||
+ test -z "$chmodcmd" || $doit $chmodcmd $mode "$dst"; } || exit 1
+ else
+
+ # Make a couple of temp file names in the proper directory.
+ dsttmp=$dstdir/_inst.$$_
+ rmtmp=$dstdir/_rm.$$_
+
+ # Trap to clean up those temp files at exit.
+ trap 'ret=$?; rm -f "$dsttmp" "$rmtmp" && exit $ret' 0
+
+ # Copy the file name to the temp name.
+ (umask $cp_umask && $doit_exec $cpprog "$src" "$dsttmp") &&
+
+ # and set any options; do chmod last to preserve setuid bits.
+ #
+ # If any of these fail, we abort the whole thing. If we want to
+ # ignore errors from any of these, just make sure not to ignore
+ # errors from the above "$doit $cpprog $src $dsttmp" command.
+ #
+ { test -z "$chowncmd" || $doit $chowncmd "$dsttmp"; } &&
+ { test -z "$chgrpcmd" || $doit $chgrpcmd "$dsttmp"; } &&
+ { test -z "$stripcmd" || $doit $stripcmd "$dsttmp"; } &&
+ { test -z "$chmodcmd" || $doit $chmodcmd $mode "$dsttmp"; } &&
+
+ # If -C, don't bother to copy if it wouldn't change the file.
+ if $copy_on_change &&
+ old=`LC_ALL=C ls -dlL "$dst" 2>/dev/null` &&
+ new=`LC_ALL=C ls -dlL "$dsttmp" 2>/dev/null` &&
+
+ eval "$initialize_posix_glob" &&
+ $posix_glob set -f &&
+ set X $old && old=:$2:$4:$5:$6 &&
+ set X $new && new=:$2:$4:$5:$6 &&
+ $posix_glob set +f &&
+
+ test "$old" = "$new" &&
+ $cmpprog "$dst" "$dsttmp" >/dev/null 2>&1
+ then
+ rm -f "$dsttmp"
+ else
+ # Rename the file to the real destination.
+ $doit $mvcmd -f "$dsttmp" "$dst" 2>/dev/null ||
+
+ # The rename failed, perhaps because mv can't rename something else
+ # to itself, or perhaps because mv is so ancient that it does not
+ # support -f.
+ {
+ # Now remove or move aside any old file at destination location.
+ # We try this two ways since rm can't unlink itself on some
+ # systems and the destination file might be busy for other
+ # reasons. In this case, the final cleanup might fail but the new
+ # file should still install successfully.
+ {
+ test ! -f "$dst" ||
+ $doit $rmcmd -f "$dst" 2>/dev/null ||
+ { $doit $mvcmd -f "$dst" "$rmtmp" 2>/dev/null &&
+ { $doit $rmcmd -f "$rmtmp" 2>/dev/null; :; }
+ } ||
+ { echo "$0: cannot unlink or rename $dst" >&2
+ (exit 1); exit 1
+ }
+ } &&
+
+ # Now rename the file to the real destination.
+ $doit $mvcmd "$dsttmp" "$dst"
+ }
+ fi || exit 1
+
+ trap '' 0
+ fi
+done
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/ltmain.sh b/ltmain.sh
new file mode 100644
index 00000000..63ae69dc
--- /dev/null
+++ b/ltmain.sh
@@ -0,0 +1,9655 @@
+
+# libtool (GNU libtool) 2.4.2
+# Written by Gordon Matzigkeit , 1996
+
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005, 2006,
+# 2007, 2008, 2009, 2010, 2011 Free Software Foundation, Inc.
+# This is free software; see the source for copying conditions. There is NO
+# warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
+
+# GNU Libtool is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING. If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html,
+# or obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+
+# Usage: $progname [OPTION]... [MODE-ARG]...
+#
+# Provide generalized library-building support services.
+#
+# --config show all configuration variables
+# --debug enable verbose shell tracing
+# -n, --dry-run display commands without modifying any files
+# --features display basic configuration information and exit
+# --mode=MODE use operation mode MODE
+# --preserve-dup-deps don't remove duplicate dependency libraries
+# --quiet, --silent don't print informational messages
+# --no-quiet, --no-silent
+# print informational messages (default)
+# --no-warn don't display warning messages
+# --tag=TAG use configuration variables from tag TAG
+# -v, --verbose print more informational messages than default
+# --no-verbose don't print the extra informational messages
+# --version print version information
+# -h, --help, --help-all print short, long, or detailed help message
+#
+# MODE must be one of the following:
+#
+# clean remove files from the build directory
+# compile compile a source file into a libtool object
+# execute automatically set library path, then run a program
+# finish complete the installation of libtool libraries
+# install install libraries or executables
+# link create a library or an executable
+# uninstall remove libraries from an installed directory
+#
+# MODE-ARGS vary depending on the MODE. When passed as first option,
+# `--mode=MODE' may be abbreviated as `MODE' or a unique abbreviation of that.
+# Try `$progname --help --mode=MODE' for a more detailed description of MODE.
+#
+# When reporting a bug, please describe a test case to reproduce it and
+# include the following information:
+#
+# host-triplet: $host
+# shell: $SHELL
+# compiler: $LTCC
+# compiler flags: $LTCFLAGS
+# linker: $LD (gnu? $with_gnu_ld)
+# $progname: (GNU libtool) 2.4.2
+# automake: $automake_version
+# autoconf: $autoconf_version
+#
+# Report bugs to .
+# GNU libtool home page: .
+# General help using GNU software: .
+
+PROGRAM=libtool
+PACKAGE=libtool
+VERSION=2.4.2
+TIMESTAMP=""
+package_revision=1.3337
+
+# Be Bourne compatible
+if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '${1+"$@"}'='"$@"'
+ setopt NO_GLOB_SUBST
+else
+ case `(set -o) 2>/dev/null` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+$1
+_LTECHO_EOF'
+}
+
+# NLS nuisances: We save the old values to restore during execute mode.
+lt_user_locale=
+lt_safe_locale=
+for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+do
+ eval "if test \"\${$lt_var+set}\" = set; then
+ save_$lt_var=\$$lt_var
+ $lt_var=C
+ export $lt_var
+ lt_user_locale=\"$lt_var=\\\$save_\$lt_var; \$lt_user_locale\"
+ lt_safe_locale=\"$lt_var=C; \$lt_safe_locale\"
+ fi"
+done
+LC_ALL=C
+LANGUAGE=C
+export LANGUAGE LC_ALL
+
+$lt_unset CDPATH
+
+
+# Work around backward compatibility issue on IRIX 6.5. On IRIX 6.4+, sh
+# is ksh but when the shell is invoked as "sh" and the current value of
+# the _XPG environment variable is not equal to 1 (one), the special
+# positional parameter $0, within a function call, is the name of the
+# function.
+progpath="$0"
+
+
+
+: ${CP="cp -f"}
+test "${ECHO+set}" = set || ECHO=${as_echo-'printf %s\n'}
+: ${MAKE="make"}
+: ${MKDIR="mkdir"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+: ${SHELL="${CONFIG_SHELL-/bin/sh}"}
+: ${Xsed="$SED -e 1s/^X//"}
+
+# Global variables:
+EXIT_SUCCESS=0
+EXIT_FAILURE=1
+EXIT_MISMATCH=63 # $? = 63 is used to indicate version mismatch to missing.
+EXIT_SKIP=77 # $? = 77 is used to indicate a skipped test to automake.
+
+exit_status=$EXIT_SUCCESS
+
+# Make sure IFS has a sensible default
+lt_nl='
+'
+IFS=" $lt_nl"
+
+dirname="s,/[^/]*$,,"
+basename="s,^.*/,,"
+
+# func_dirname file append nondir_replacement
+# Compute the dirname of FILE. If nonempty, add APPEND to the result,
+# otherwise set result to NONDIR_REPLACEMENT.
+func_dirname ()
+{
+ func_dirname_result=`$ECHO "${1}" | $SED "$dirname"`
+ if test "X$func_dirname_result" = "X${1}"; then
+ func_dirname_result="${3}"
+ else
+ func_dirname_result="$func_dirname_result${2}"
+ fi
+} # func_dirname may be replaced by extended shell implementation
+
+
+# func_basename file
+func_basename ()
+{
+ func_basename_result=`$ECHO "${1}" | $SED "$basename"`
+} # func_basename may be replaced by extended shell implementation
+
+
+# func_dirname_and_basename file append nondir_replacement
+# perform func_basename and func_dirname in a single function
+# call:
+# dirname: Compute the dirname of FILE. If nonempty,
+# add APPEND to the result, otherwise set result
+# to NONDIR_REPLACEMENT.
+# value returned in "$func_dirname_result"
+# basename: Compute filename of FILE.
+# value retuned in "$func_basename_result"
+# Implementation must be kept synchronized with func_dirname
+# and func_basename. For efficiency, we do not delegate to
+# those functions but instead duplicate the functionality here.
+func_dirname_and_basename ()
+{
+ # Extract subdirectory from the argument.
+ func_dirname_result=`$ECHO "${1}" | $SED -e "$dirname"`
+ if test "X$func_dirname_result" = "X${1}"; then
+ func_dirname_result="${3}"
+ else
+ func_dirname_result="$func_dirname_result${2}"
+ fi
+ func_basename_result=`$ECHO "${1}" | $SED -e "$basename"`
+} # func_dirname_and_basename may be replaced by extended shell implementation
+
+
+# func_stripname prefix suffix name
+# strip PREFIX and SUFFIX off of NAME.
+# PREFIX and SUFFIX must not contain globbing or regex special
+# characters, hashes, percent signs, but SUFFIX may contain a leading
+# dot (in which case that matches only a dot).
+# func_strip_suffix prefix name
+func_stripname ()
+{
+ case ${2} in
+ .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;;
+ *) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;;
+ esac
+} # func_stripname may be replaced by extended shell implementation
+
+
+# These SED scripts presuppose an absolute path with a trailing slash.
+pathcar='s,^/\([^/]*\).*$,\1,'
+pathcdr='s,^/[^/]*,,'
+removedotparts=':dotsl
+ s@/\./@/@g
+ t dotsl
+ s,/\.$,/,'
+collapseslashes='s@/\{1,\}@/@g'
+finalslash='s,/*$,/,'
+
+# func_normal_abspath PATH
+# Remove doubled-up and trailing slashes, "." path components,
+# and cancel out any ".." path components in PATH after making
+# it an absolute path.
+# value returned in "$func_normal_abspath_result"
+func_normal_abspath ()
+{
+ # Start from root dir and reassemble the path.
+ func_normal_abspath_result=
+ func_normal_abspath_tpath=$1
+ func_normal_abspath_altnamespace=
+ case $func_normal_abspath_tpath in
+ "")
+ # Empty path, that just means $cwd.
+ func_stripname '' '/' "`pwd`"
+ func_normal_abspath_result=$func_stripname_result
+ return
+ ;;
+ # The next three entries are used to spot a run of precisely
+ # two leading slashes without using negated character classes;
+ # we take advantage of case's first-match behaviour.
+ ///*)
+ # Unusual form of absolute path, do nothing.
+ ;;
+ //*)
+ # Not necessarily an ordinary path; POSIX reserves leading '//'
+ # and for example Cygwin uses it to access remote file shares
+ # over CIFS/SMB, so we conserve a leading double slash if found.
+ func_normal_abspath_altnamespace=/
+ ;;
+ /*)
+ # Absolute path, do nothing.
+ ;;
+ *)
+ # Relative path, prepend $cwd.
+ func_normal_abspath_tpath=`pwd`/$func_normal_abspath_tpath
+ ;;
+ esac
+ # Cancel out all the simple stuff to save iterations. We also want
+ # the path to end with a slash for ease of parsing, so make sure
+ # there is one (and only one) here.
+ func_normal_abspath_tpath=`$ECHO "$func_normal_abspath_tpath" | $SED \
+ -e "$removedotparts" -e "$collapseslashes" -e "$finalslash"`
+ while :; do
+ # Processed it all yet?
+ if test "$func_normal_abspath_tpath" = / ; then
+ # If we ascended to the root using ".." the result may be empty now.
+ if test -z "$func_normal_abspath_result" ; then
+ func_normal_abspath_result=/
+ fi
+ break
+ fi
+ func_normal_abspath_tcomponent=`$ECHO "$func_normal_abspath_tpath" | $SED \
+ -e "$pathcar"`
+ func_normal_abspath_tpath=`$ECHO "$func_normal_abspath_tpath" | $SED \
+ -e "$pathcdr"`
+ # Figure out what to do with it
+ case $func_normal_abspath_tcomponent in
+ "")
+ # Trailing empty path component, ignore it.
+ ;;
+ ..)
+ # Parent dir; strip last assembled component from result.
+ func_dirname "$func_normal_abspath_result"
+ func_normal_abspath_result=$func_dirname_result
+ ;;
+ *)
+ # Actual path component, append it.
+ func_normal_abspath_result=$func_normal_abspath_result/$func_normal_abspath_tcomponent
+ ;;
+ esac
+ done
+ # Restore leading double-slash if one was found on entry.
+ func_normal_abspath_result=$func_normal_abspath_altnamespace$func_normal_abspath_result
+}
+
+# func_relative_path SRCDIR DSTDIR
+# generates a relative path from SRCDIR to DSTDIR, with a trailing
+# slash if non-empty, suitable for immediately appending a filename
+# without needing to append a separator.
+# value returned in "$func_relative_path_result"
+func_relative_path ()
+{
+ func_relative_path_result=
+ func_normal_abspath "$1"
+ func_relative_path_tlibdir=$func_normal_abspath_result
+ func_normal_abspath "$2"
+ func_relative_path_tbindir=$func_normal_abspath_result
+
+ # Ascend the tree starting from libdir
+ while :; do
+ # check if we have found a prefix of bindir
+ case $func_relative_path_tbindir in
+ $func_relative_path_tlibdir)
+ # found an exact match
+ func_relative_path_tcancelled=
+ break
+ ;;
+ $func_relative_path_tlibdir*)
+ # found a matching prefix
+ func_stripname "$func_relative_path_tlibdir" '' "$func_relative_path_tbindir"
+ func_relative_path_tcancelled=$func_stripname_result
+ if test -z "$func_relative_path_result"; then
+ func_relative_path_result=.
+ fi
+ break
+ ;;
+ *)
+ func_dirname $func_relative_path_tlibdir
+ func_relative_path_tlibdir=${func_dirname_result}
+ if test "x$func_relative_path_tlibdir" = x ; then
+ # Have to descend all the way to the root!
+ func_relative_path_result=../$func_relative_path_result
+ func_relative_path_tcancelled=$func_relative_path_tbindir
+ break
+ fi
+ func_relative_path_result=../$func_relative_path_result
+ ;;
+ esac
+ done
+
+ # Now calculate path; take care to avoid doubling-up slashes.
+ func_stripname '' '/' "$func_relative_path_result"
+ func_relative_path_result=$func_stripname_result
+ func_stripname '/' '/' "$func_relative_path_tcancelled"
+ if test "x$func_stripname_result" != x ; then
+ func_relative_path_result=${func_relative_path_result}/${func_stripname_result}
+ fi
+
+ # Normalisation. If bindir is libdir, return empty string,
+ # else relative path ending with a slash; either way, target
+ # file name can be directly appended.
+ if test ! -z "$func_relative_path_result"; then
+ func_stripname './' '' "$func_relative_path_result/"
+ func_relative_path_result=$func_stripname_result
+ fi
+}
+
+# The name of this program:
+func_dirname_and_basename "$progpath"
+progname=$func_basename_result
+
+# Make sure we have an absolute path for reexecution:
+case $progpath in
+ [\\/]*|[A-Za-z]:\\*) ;;
+ *[\\/]*)
+ progdir=$func_dirname_result
+ progdir=`cd "$progdir" && pwd`
+ progpath="$progdir/$progname"
+ ;;
+ *)
+ save_IFS="$IFS"
+ IFS=${PATH_SEPARATOR-:}
+ for progdir in $PATH; do
+ IFS="$save_IFS"
+ test -x "$progdir/$progname" && break
+ done
+ IFS="$save_IFS"
+ test -n "$progdir" || progdir=`pwd`
+ progpath="$progdir/$progname"
+ ;;
+esac
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed="${SED}"' -e 1s/^X//'
+sed_quote_subst='s/\([`"$\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\(["`\\]\)/\\\1/g'
+
+# Sed substitution that turns a string into a regex matching for the
+# string literally.
+sed_make_literal_regex='s,[].[^$\\*\/],\\&,g'
+
+# Sed substitution that converts a w32 file name or path
+# which contains forward slashes, into one that contains
+# (escaped) backslashes. A very naive implementation.
+lt_sed_naive_backslashify='s|\\\\*|\\|g;s|/|\\|g;s|\\|\\\\|g'
+
+# Re-`\' parameter expansions in output of double_quote_subst that were
+# `\'-ed in input to the same. If an odd number of `\' preceded a '$'
+# in input to double_quote_subst, that '$' was protected from expansion.
+# Since each input `\' is now two `\'s, look for any number of runs of
+# four `\'s followed by two `\'s and then a '$'. `\' that '$'.
+bs='\\'
+bs2='\\\\'
+bs4='\\\\\\\\'
+dollar='\$'
+sed_double_backslash="\
+ s/$bs4/&\\
+/g
+ s/^$bs2$dollar/$bs&/
+ s/\\([^$bs]\\)$bs2$dollar/\\1$bs2$bs$dollar/g
+ s/\n//g"
+
+# Standard options:
+opt_dry_run=false
+opt_help=false
+opt_quiet=false
+opt_verbose=false
+opt_warning=:
+
+# func_echo arg...
+# Echo program name prefixed message, along with the current mode
+# name if it has been set yet.
+func_echo ()
+{
+ $ECHO "$progname: ${opt_mode+$opt_mode: }$*"
+}
+
+# func_verbose arg...
+# Echo program name prefixed message in verbose mode only.
+func_verbose ()
+{
+ $opt_verbose && func_echo ${1+"$@"}
+
+ # A bug in bash halts the script if the last line of a function
+ # fails when set -e is in force, so we need another command to
+ # work around that:
+ :
+}
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+ $ECHO "$*"
+}
+
+# func_error arg...
+# Echo program name prefixed message to standard error.
+func_error ()
+{
+ $ECHO "$progname: ${opt_mode+$opt_mode: }"${1+"$@"} 1>&2
+}
+
+# func_warning arg...
+# Echo program name prefixed warning message to standard error.
+func_warning ()
+{
+ $opt_warning && $ECHO "$progname: ${opt_mode+$opt_mode: }warning: "${1+"$@"} 1>&2
+
+ # bash bug again:
+ :
+}
+
+# func_fatal_error arg...
+# Echo program name prefixed message to standard error, and exit.
+func_fatal_error ()
+{
+ func_error ${1+"$@"}
+ exit $EXIT_FAILURE
+}
+
+# func_fatal_help arg...
+# Echo program name prefixed message to standard error, followed by
+# a help hint, and exit.
+func_fatal_help ()
+{
+ func_error ${1+"$@"}
+ func_fatal_error "$help"
+}
+help="Try \`$progname --help' for more information." ## default
+
+
+# func_grep expression filename
+# Check whether EXPRESSION matches any line of FILENAME, without output.
+func_grep ()
+{
+ $GREP "$1" "$2" >/dev/null 2>&1
+}
+
+
+# func_mkdir_p directory-path
+# Make sure the entire path to DIRECTORY-PATH is available.
+func_mkdir_p ()
+{
+ my_directory_path="$1"
+ my_dir_list=
+
+ if test -n "$my_directory_path" && test "$opt_dry_run" != ":"; then
+
+ # Protect directory names starting with `-'
+ case $my_directory_path in
+ -*) my_directory_path="./$my_directory_path" ;;
+ esac
+
+ # While some portion of DIR does not yet exist...
+ while test ! -d "$my_directory_path"; do
+ # ...make a list in topmost first order. Use a colon delimited
+ # list incase some portion of path contains whitespace.
+ my_dir_list="$my_directory_path:$my_dir_list"
+
+ # If the last portion added has no slash in it, the list is done
+ case $my_directory_path in */*) ;; *) break ;; esac
+
+ # ...otherwise throw away the child directory and loop
+ my_directory_path=`$ECHO "$my_directory_path" | $SED -e "$dirname"`
+ done
+ my_dir_list=`$ECHO "$my_dir_list" | $SED 's,:*$,,'`
+
+ save_mkdir_p_IFS="$IFS"; IFS=':'
+ for my_dir in $my_dir_list; do
+ IFS="$save_mkdir_p_IFS"
+ # mkdir can fail with a `File exist' error if two processes
+ # try to create one of the directories concurrently. Don't
+ # stop in that case!
+ $MKDIR "$my_dir" 2>/dev/null || :
+ done
+ IFS="$save_mkdir_p_IFS"
+
+ # Bail out if we (or some other process) failed to create a directory.
+ test -d "$my_directory_path" || \
+ func_fatal_error "Failed to create \`$1'"
+ fi
+}
+
+
+# func_mktempdir [string]
+# Make a temporary directory that won't clash with other running
+# libtool processes, and avoids race conditions if possible. If
+# given, STRING is the basename for that directory.
+func_mktempdir ()
+{
+ my_template="${TMPDIR-/tmp}/${1-$progname}"
+
+ if test "$opt_dry_run" = ":"; then
+ # Return a directory name, but don't create it in dry-run mode
+ my_tmpdir="${my_template}-$$"
+ else
+
+ # If mktemp works, use that first and foremost
+ my_tmpdir=`mktemp -d "${my_template}-XXXXXXXX" 2>/dev/null`
+
+ if test ! -d "$my_tmpdir"; then
+ # Failing that, at least try and use $RANDOM to avoid a race
+ my_tmpdir="${my_template}-${RANDOM-0}$$"
+
+ save_mktempdir_umask=`umask`
+ umask 0077
+ $MKDIR "$my_tmpdir"
+ umask $save_mktempdir_umask
+ fi
+
+ # If we're not in dry-run mode, bomb out on failure
+ test -d "$my_tmpdir" || \
+ func_fatal_error "cannot create temporary directory \`$my_tmpdir'"
+ fi
+
+ $ECHO "$my_tmpdir"
+}
+
+
+# func_quote_for_eval arg
+# Aesthetically quote ARG to be evaled later.
+# This function returns two values: FUNC_QUOTE_FOR_EVAL_RESULT
+# is double-quoted, suitable for a subsequent eval, whereas
+# FUNC_QUOTE_FOR_EVAL_UNQUOTED_RESULT has merely all characters
+# which are still active within double quotes backslashified.
+func_quote_for_eval ()
+{
+ case $1 in
+ *[\\\`\"\$]*)
+ func_quote_for_eval_unquoted_result=`$ECHO "$1" | $SED "$sed_quote_subst"` ;;
+ *)
+ func_quote_for_eval_unquoted_result="$1" ;;
+ esac
+
+ case $func_quote_for_eval_unquoted_result in
+ # Double-quote args containing shell metacharacters to delay
+ # word splitting, command substitution and and variable
+ # expansion for a subsequent eval.
+ # Many Bourne shells cannot handle close brackets correctly
+ # in scan sets, so we specify it separately.
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ func_quote_for_eval_result="\"$func_quote_for_eval_unquoted_result\""
+ ;;
+ *)
+ func_quote_for_eval_result="$func_quote_for_eval_unquoted_result"
+ esac
+}
+
+
+# func_quote_for_expand arg
+# Aesthetically quote ARG to be evaled later; same as above,
+# but do not quote variable references.
+func_quote_for_expand ()
+{
+ case $1 in
+ *[\\\`\"]*)
+ my_arg=`$ECHO "$1" | $SED \
+ -e "$double_quote_subst" -e "$sed_double_backslash"` ;;
+ *)
+ my_arg="$1" ;;
+ esac
+
+ case $my_arg in
+ # Double-quote args containing shell metacharacters to delay
+ # word splitting and command substitution for a subsequent eval.
+ # Many Bourne shells cannot handle close brackets correctly
+ # in scan sets, so we specify it separately.
+ *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*|"")
+ my_arg="\"$my_arg\""
+ ;;
+ esac
+
+ func_quote_for_expand_result="$my_arg"
+}
+
+
+# func_show_eval cmd [fail_exp]
+# Unless opt_silent is true, then output CMD. Then, if opt_dryrun is
+# not true, evaluate CMD. If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it.
+func_show_eval ()
+{
+ my_cmd="$1"
+ my_fail_exp="${2-:}"
+
+ ${opt_silent-false} || {
+ func_quote_for_expand "$my_cmd"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+
+ if ${opt_dry_run-false}; then :; else
+ eval "$my_cmd"
+ my_status=$?
+ if test "$my_status" -eq 0; then :; else
+ eval "(exit $my_status); $my_fail_exp"
+ fi
+ fi
+}
+
+
+# func_show_eval_locale cmd [fail_exp]
+# Unless opt_silent is true, then output CMD. Then, if opt_dryrun is
+# not true, evaluate CMD. If the evaluation of CMD fails, and FAIL_EXP
+# is given, then evaluate it. Use the saved locale for evaluation.
+func_show_eval_locale ()
+{
+ my_cmd="$1"
+ my_fail_exp="${2-:}"
+
+ ${opt_silent-false} || {
+ func_quote_for_expand "$my_cmd"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+
+ if ${opt_dry_run-false}; then :; else
+ eval "$lt_user_locale
+ $my_cmd"
+ my_status=$?
+ eval "$lt_safe_locale"
+ if test "$my_status" -eq 0; then :; else
+ eval "(exit $my_status); $my_fail_exp"
+ fi
+ fi
+}
+
+# func_tr_sh
+# Turn $1 into a string suitable for a shell variable name.
+# Result is stored in $func_tr_sh_result. All characters
+# not in the set a-zA-Z0-9_ are replaced with '_'. Further,
+# if $1 begins with a digit, a '_' is prepended as well.
+func_tr_sh ()
+{
+ case $1 in
+ [0-9]* | *[!a-zA-Z0-9_]*)
+ func_tr_sh_result=`$ECHO "$1" | $SED 's/^\([0-9]\)/_\1/; s/[^a-zA-Z0-9_]/_/g'`
+ ;;
+ * )
+ func_tr_sh_result=$1
+ ;;
+ esac
+}
+
+
+# func_version
+# Echo version message to standard output and exit.
+func_version ()
+{
+ $opt_debug
+
+ $SED -n '/(C)/!b go
+ :more
+ /\./!{
+ N
+ s/\n# / /
+ b more
+ }
+ :go
+ /^# '$PROGRAM' (GNU /,/# warranty; / {
+ s/^# //
+ s/^# *$//
+ s/\((C)\)[ 0-9,-]*\( [1-9][0-9]*\)/\1\2/
+ p
+ }' < "$progpath"
+ exit $?
+}
+
+# func_usage
+# Echo short help message to standard output and exit.
+func_usage ()
+{
+ $opt_debug
+
+ $SED -n '/^# Usage:/,/^# *.*--help/ {
+ s/^# //
+ s/^# *$//
+ s/\$progname/'$progname'/
+ p
+ }' < "$progpath"
+ echo
+ $ECHO "run \`$progname --help | more' for full usage"
+ exit $?
+}
+
+# func_help [NOEXIT]
+# Echo long help message to standard output and exit,
+# unless 'noexit' is passed as argument.
+func_help ()
+{
+ $opt_debug
+
+ $SED -n '/^# Usage:/,/# Report bugs to/ {
+ :print
+ s/^# //
+ s/^# *$//
+ s*\$progname*'$progname'*
+ s*\$host*'"$host"'*
+ s*\$SHELL*'"$SHELL"'*
+ s*\$LTCC*'"$LTCC"'*
+ s*\$LTCFLAGS*'"$LTCFLAGS"'*
+ s*\$LD*'"$LD"'*
+ s/\$with_gnu_ld/'"$with_gnu_ld"'/
+ s/\$automake_version/'"`(${AUTOMAKE-automake} --version) 2>/dev/null |$SED 1q`"'/
+ s/\$autoconf_version/'"`(${AUTOCONF-autoconf} --version) 2>/dev/null |$SED 1q`"'/
+ p
+ d
+ }
+ /^# .* home page:/b print
+ /^# General help using/b print
+ ' < "$progpath"
+ ret=$?
+ if test -z "$1"; then
+ exit $ret
+ fi
+}
+
+# func_missing_arg argname
+# Echo program name prefixed message to standard error and set global
+# exit_cmd.
+func_missing_arg ()
+{
+ $opt_debug
+
+ func_error "missing argument for $1."
+ exit_cmd=exit
+}
+
+
+# func_split_short_opt shortopt
+# Set func_split_short_opt_name and func_split_short_opt_arg shell
+# variables after splitting SHORTOPT after the 2nd character.
+func_split_short_opt ()
+{
+ my_sed_short_opt='1s/^\(..\).*$/\1/;q'
+ my_sed_short_rest='1s/^..\(.*\)$/\1/;q'
+
+ func_split_short_opt_name=`$ECHO "$1" | $SED "$my_sed_short_opt"`
+ func_split_short_opt_arg=`$ECHO "$1" | $SED "$my_sed_short_rest"`
+} # func_split_short_opt may be replaced by extended shell implementation
+
+
+# func_split_long_opt longopt
+# Set func_split_long_opt_name and func_split_long_opt_arg shell
+# variables after splitting LONGOPT at the `=' sign.
+func_split_long_opt ()
+{
+ my_sed_long_opt='1s/^\(--[^=]*\)=.*/\1/;q'
+ my_sed_long_arg='1s/^--[^=]*=//'
+
+ func_split_long_opt_name=`$ECHO "$1" | $SED "$my_sed_long_opt"`
+ func_split_long_opt_arg=`$ECHO "$1" | $SED "$my_sed_long_arg"`
+} # func_split_long_opt may be replaced by extended shell implementation
+
+exit_cmd=:
+
+
+
+
+
+magic="%%%MAGIC variable%%%"
+magic_exe="%%%MAGIC EXE variable%%%"
+
+# Global variables.
+nonopt=
+preserve_args=
+lo2o="s/\\.lo\$/.${objext}/"
+o2lo="s/\\.${objext}\$/.lo/"
+extracted_archives=
+extracted_serial=0
+
+# If this variable is set in any of the actions, the command in it
+# will be execed at the end. This prevents here-documents from being
+# left over by shells.
+exec_cmd=
+
+# func_append var value
+# Append VALUE to the end of shell variable VAR.
+func_append ()
+{
+ eval "${1}=\$${1}\${2}"
+} # func_append may be replaced by extended shell implementation
+
+# func_append_quoted var value
+# Quote VALUE and append to the end of shell variable VAR, separated
+# by a space.
+func_append_quoted ()
+{
+ func_quote_for_eval "${2}"
+ eval "${1}=\$${1}\\ \$func_quote_for_eval_result"
+} # func_append_quoted may be replaced by extended shell implementation
+
+
+# func_arith arithmetic-term...
+func_arith ()
+{
+ func_arith_result=`expr "${@}"`
+} # func_arith may be replaced by extended shell implementation
+
+
+# func_len string
+# STRING may not start with a hyphen.
+func_len ()
+{
+ func_len_result=`expr "${1}" : ".*" 2>/dev/null || echo $max_cmd_len`
+} # func_len may be replaced by extended shell implementation
+
+
+# func_lo2o object
+func_lo2o ()
+{
+ func_lo2o_result=`$ECHO "${1}" | $SED "$lo2o"`
+} # func_lo2o may be replaced by extended shell implementation
+
+
+# func_xform libobj-or-source
+func_xform ()
+{
+ func_xform_result=`$ECHO "${1}" | $SED 's/\.[^.]*$/.lo/'`
+} # func_xform may be replaced by extended shell implementation
+
+
+# func_fatal_configuration arg...
+# Echo program name prefixed message to standard error, followed by
+# a configuration failure hint, and exit.
+func_fatal_configuration ()
+{
+ func_error ${1+"$@"}
+ func_error "See the $PACKAGE documentation for more information."
+ func_fatal_error "Fatal configuration error."
+}
+
+
+# func_config
+# Display the configuration for all the tags in this script.
+func_config ()
+{
+ re_begincf='^# ### BEGIN LIBTOOL'
+ re_endcf='^# ### END LIBTOOL'
+
+ # Default configuration.
+ $SED "1,/$re_begincf CONFIG/d;/$re_endcf CONFIG/,\$d" < "$progpath"
+
+ # Now print the configurations for the tags.
+ for tagname in $taglist; do
+ $SED -n "/$re_begincf TAG CONFIG: $tagname\$/,/$re_endcf TAG CONFIG: $tagname\$/p" < "$progpath"
+ done
+
+ exit $?
+}
+
+# func_features
+# Display the features supported by this script.
+func_features ()
+{
+ echo "host: $host"
+ if test "$build_libtool_libs" = yes; then
+ echo "enable shared libraries"
+ else
+ echo "disable shared libraries"
+ fi
+ if test "$build_old_libs" = yes; then
+ echo "enable static libraries"
+ else
+ echo "disable static libraries"
+ fi
+
+ exit $?
+}
+
+# func_enable_tag tagname
+# Verify that TAGNAME is valid, and either flag an error and exit, or
+# enable the TAGNAME tag. We also add TAGNAME to the global $taglist
+# variable here.
+func_enable_tag ()
+{
+ # Global variable:
+ tagname="$1"
+
+ re_begincf="^# ### BEGIN LIBTOOL TAG CONFIG: $tagname\$"
+ re_endcf="^# ### END LIBTOOL TAG CONFIG: $tagname\$"
+ sed_extractcf="/$re_begincf/,/$re_endcf/p"
+
+ # Validate tagname.
+ case $tagname in
+ *[!-_A-Za-z0-9,/]*)
+ func_fatal_error "invalid tag name: $tagname"
+ ;;
+ esac
+
+ # Don't test for the "default" C tag, as we know it's
+ # there but not specially marked.
+ case $tagname in
+ CC) ;;
+ *)
+ if $GREP "$re_begincf" "$progpath" >/dev/null 2>&1; then
+ taglist="$taglist $tagname"
+
+ # Evaluate the configuration. Be careful to quote the path
+ # and the sed script, to avoid splitting on whitespace, but
+ # also don't use non-portable quotes within backquotes within
+ # quotes we have to do it in 2 steps:
+ extractedcf=`$SED -n -e "$sed_extractcf" < "$progpath"`
+ eval "$extractedcf"
+ else
+ func_error "ignoring unknown tag $tagname"
+ fi
+ ;;
+ esac
+}
+
+# func_check_version_match
+# Ensure that we are using m4 macros, and libtool script from the same
+# release of libtool.
+func_check_version_match ()
+{
+ if test "$package_revision" != "$macro_revision"; then
+ if test "$VERSION" != "$macro_version"; then
+ if test -z "$macro_version"; then
+ cat >&2 <<_LT_EOF
+$progname: Version mismatch error. This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from an older release.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+ else
+ cat >&2 <<_LT_EOF
+$progname: Version mismatch error. This is $PACKAGE $VERSION, but the
+$progname: definition of this LT_INIT comes from $PACKAGE $macro_version.
+$progname: You should recreate aclocal.m4 with macros from $PACKAGE $VERSION
+$progname: and run autoconf again.
+_LT_EOF
+ fi
+ else
+ cat >&2 <<_LT_EOF
+$progname: Version mismatch error. This is $PACKAGE $VERSION, revision $package_revision,
+$progname: but the definition of this LT_INIT comes from revision $macro_revision.
+$progname: You should recreate aclocal.m4 with macros from revision $package_revision
+$progname: of $PACKAGE $VERSION and run autoconf again.
+_LT_EOF
+ fi
+
+ exit $EXIT_MISMATCH
+ fi
+}
+
+
+# Shorthand for --mode=foo, only valid as the first argument
+case $1 in
+clean|clea|cle|cl)
+ shift; set dummy --mode clean ${1+"$@"}; shift
+ ;;
+compile|compil|compi|comp|com|co|c)
+ shift; set dummy --mode compile ${1+"$@"}; shift
+ ;;
+execute|execut|execu|exec|exe|ex|e)
+ shift; set dummy --mode execute ${1+"$@"}; shift
+ ;;
+finish|finis|fini|fin|fi|f)
+ shift; set dummy --mode finish ${1+"$@"}; shift
+ ;;
+install|instal|insta|inst|ins|in|i)
+ shift; set dummy --mode install ${1+"$@"}; shift
+ ;;
+link|lin|li|l)
+ shift; set dummy --mode link ${1+"$@"}; shift
+ ;;
+uninstall|uninstal|uninsta|uninst|unins|unin|uni|un|u)
+ shift; set dummy --mode uninstall ${1+"$@"}; shift
+ ;;
+esac
+
+
+
+# Option defaults:
+opt_debug=:
+opt_dry_run=false
+opt_config=false
+opt_preserve_dup_deps=false
+opt_features=false
+opt_finish=false
+opt_help=false
+opt_help_all=false
+opt_silent=:
+opt_warning=:
+opt_verbose=:
+opt_silent=false
+opt_verbose=false
+
+
+# Parse options once, thoroughly. This comes as soon as possible in the
+# script to make things like `--version' happen as quickly as we can.
+{
+ # this just eases exit handling
+ while test $# -gt 0; do
+ opt="$1"
+ shift
+ case $opt in
+ --debug|-x) opt_debug='set -x'
+ func_echo "enabling shell trace mode"
+ $opt_debug
+ ;;
+ --dry-run|--dryrun|-n)
+ opt_dry_run=:
+ ;;
+ --config)
+ opt_config=:
+func_config
+ ;;
+ --dlopen|-dlopen)
+ optarg="$1"
+ opt_dlopen="${opt_dlopen+$opt_dlopen
+}$optarg"
+ shift
+ ;;
+ --preserve-dup-deps)
+ opt_preserve_dup_deps=:
+ ;;
+ --features)
+ opt_features=:
+func_features
+ ;;
+ --finish)
+ opt_finish=:
+set dummy --mode finish ${1+"$@"}; shift
+ ;;
+ --help)
+ opt_help=:
+ ;;
+ --help-all)
+ opt_help_all=:
+opt_help=': help-all'
+ ;;
+ --mode)
+ test $# = 0 && func_missing_arg $opt && break
+ optarg="$1"
+ opt_mode="$optarg"
+case $optarg in
+ # Valid mode arguments:
+ clean|compile|execute|finish|install|link|relink|uninstall) ;;
+
+ # Catch anything else as an error
+ *) func_error "invalid argument for $opt"
+ exit_cmd=exit
+ break
+ ;;
+esac
+ shift
+ ;;
+ --no-silent|--no-quiet)
+ opt_silent=false
+func_append preserve_args " $opt"
+ ;;
+ --no-warning|--no-warn)
+ opt_warning=false
+func_append preserve_args " $opt"
+ ;;
+ --no-verbose)
+ opt_verbose=false
+func_append preserve_args " $opt"
+ ;;
+ --silent|--quiet)
+ opt_silent=:
+func_append preserve_args " $opt"
+ opt_verbose=false
+ ;;
+ --verbose|-v)
+ opt_verbose=:
+func_append preserve_args " $opt"
+opt_silent=false
+ ;;
+ --tag)
+ test $# = 0 && func_missing_arg $opt && break
+ optarg="$1"
+ opt_tag="$optarg"
+func_append preserve_args " $opt $optarg"
+func_enable_tag "$optarg"
+ shift
+ ;;
+
+ -\?|-h) func_usage ;;
+ --help) func_help ;;
+ --version) func_version ;;
+
+ # Separate optargs to long options:
+ --*=*)
+ func_split_long_opt "$opt"
+ set dummy "$func_split_long_opt_name" "$func_split_long_opt_arg" ${1+"$@"}
+ shift
+ ;;
+
+ # Separate non-argument short options:
+ -\?*|-h*|-n*|-v*)
+ func_split_short_opt "$opt"
+ set dummy "$func_split_short_opt_name" "-$func_split_short_opt_arg" ${1+"$@"}
+ shift
+ ;;
+
+ --) break ;;
+ -*) func_fatal_help "unrecognized option \`$opt'" ;;
+ *) set dummy "$opt" ${1+"$@"}; shift; break ;;
+ esac
+ done
+
+ # Validate options:
+
+ # save first non-option argument
+ if test "$#" -gt 0; then
+ nonopt="$opt"
+ shift
+ fi
+
+ # preserve --debug
+ test "$opt_debug" = : || func_append preserve_args " --debug"
+
+ case $host in
+ *cygwin* | *mingw* | *pw32* | *cegcc*)
+ # don't eliminate duplications in $postdeps and $predeps
+ opt_duplicate_compiler_generated_deps=:
+ ;;
+ *)
+ opt_duplicate_compiler_generated_deps=$opt_preserve_dup_deps
+ ;;
+ esac
+
+ $opt_help || {
+ # Sanity checks first:
+ func_check_version_match
+
+ if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+ func_fatal_configuration "not configured to build any kind of library"
+ fi
+
+ # Darwin sucks
+ eval std_shrext=\"$shrext_cmds\"
+
+ # Only execute mode is allowed to have -dlopen flags.
+ if test -n "$opt_dlopen" && test "$opt_mode" != execute; then
+ func_error "unrecognized option \`-dlopen'"
+ $ECHO "$help" 1>&2
+ exit $EXIT_FAILURE
+ fi
+
+ # Change the help message to a mode-specific one.
+ generic_help="$help"
+ help="Try \`$progname --help --mode=$opt_mode' for more information."
+ }
+
+
+ # Bail if the options were screwed
+ $exit_cmd $EXIT_FAILURE
+}
+
+
+
+
+## ----------- ##
+## Main. ##
+## ----------- ##
+
+# func_lalib_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_lalib_p ()
+{
+ test -f "$1" &&
+ $SED -e 4q "$1" 2>/dev/null \
+ | $GREP "^# Generated by .*$PACKAGE" > /dev/null 2>&1
+}
+
+# func_lalib_unsafe_p file
+# True iff FILE is a libtool `.la' library or `.lo' object file.
+# This function implements the same check as func_lalib_p without
+# resorting to external programs. To this end, it redirects stdin and
+# closes it afterwards, without saving the original file descriptor.
+# As a safety measure, use it only where a negative result would be
+# fatal anyway. Works if `file' does not exist.
+func_lalib_unsafe_p ()
+{
+ lalib_p=no
+ if test -f "$1" && test -r "$1" && exec 5<&0 <"$1"; then
+ for lalib_p_l in 1 2 3 4
+ do
+ read lalib_p_line
+ case "$lalib_p_line" in
+ \#\ Generated\ by\ *$PACKAGE* ) lalib_p=yes; break;;
+ esac
+ done
+ exec 0<&5 5<&-
+ fi
+ test "$lalib_p" = yes
+}
+
+# func_ltwrapper_script_p file
+# True iff FILE is a libtool wrapper script
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_script_p ()
+{
+ func_lalib_p "$1"
+}
+
+# func_ltwrapper_executable_p file
+# True iff FILE is a libtool wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_executable_p ()
+{
+ func_ltwrapper_exec_suffix=
+ case $1 in
+ *.exe) ;;
+ *) func_ltwrapper_exec_suffix=.exe ;;
+ esac
+ $GREP "$magic_exe" "$1$func_ltwrapper_exec_suffix" >/dev/null 2>&1
+}
+
+# func_ltwrapper_scriptname file
+# Assumes file is an ltwrapper_executable
+# uses $file to determine the appropriate filename for a
+# temporary ltwrapper_script.
+func_ltwrapper_scriptname ()
+{
+ func_dirname_and_basename "$1" "" "."
+ func_stripname '' '.exe' "$func_basename_result"
+ func_ltwrapper_scriptname_result="$func_dirname_result/$objdir/${func_stripname_result}_ltshwrapper"
+}
+
+# func_ltwrapper_p file
+# True iff FILE is a libtool wrapper script or wrapper executable
+# This function is only a basic sanity check; it will hardly flush out
+# determined imposters.
+func_ltwrapper_p ()
+{
+ func_ltwrapper_script_p "$1" || func_ltwrapper_executable_p "$1"
+}
+
+
+# func_execute_cmds commands fail_cmd
+# Execute tilde-delimited COMMANDS.
+# If FAIL_CMD is given, eval that upon failure.
+# FAIL_CMD may read-access the current command in variable CMD!
+func_execute_cmds ()
+{
+ $opt_debug
+ save_ifs=$IFS; IFS='~'
+ for cmd in $1; do
+ IFS=$save_ifs
+ eval cmd=\"$cmd\"
+ func_show_eval "$cmd" "${2-:}"
+ done
+ IFS=$save_ifs
+}
+
+
+# func_source file
+# Source FILE, adding directory component if necessary.
+# Note that it is not necessary on cygwin/mingw to append a dot to
+# FILE even if both FILE and FILE.exe exist: automatic-append-.exe
+# behavior happens only for exec(3), not for open(2)! Also, sourcing
+# `FILE.' does not work on cygwin managed mounts.
+func_source ()
+{
+ $opt_debug
+ case $1 in
+ */* | *\\*) . "$1" ;;
+ *) . "./$1" ;;
+ esac
+}
+
+
+# func_resolve_sysroot PATH
+# Replace a leading = in PATH with a sysroot. Store the result into
+# func_resolve_sysroot_result
+func_resolve_sysroot ()
+{
+ func_resolve_sysroot_result=$1
+ case $func_resolve_sysroot_result in
+ =*)
+ func_stripname '=' '' "$func_resolve_sysroot_result"
+ func_resolve_sysroot_result=$lt_sysroot$func_stripname_result
+ ;;
+ esac
+}
+
+# func_replace_sysroot PATH
+# If PATH begins with the sysroot, replace it with = and
+# store the result into func_replace_sysroot_result.
+func_replace_sysroot ()
+{
+ case "$lt_sysroot:$1" in
+ ?*:"$lt_sysroot"*)
+ func_stripname "$lt_sysroot" '' "$1"
+ func_replace_sysroot_result="=$func_stripname_result"
+ ;;
+ *)
+ # Including no sysroot.
+ func_replace_sysroot_result=$1
+ ;;
+ esac
+}
+
+# func_infer_tag arg
+# Infer tagged configuration to use if any are available and
+# if one wasn't chosen via the "--tag" command line option.
+# Only attempt this if the compiler in the base compile
+# command doesn't match the default compiler.
+# arg is usually of the form 'gcc ...'
+func_infer_tag ()
+{
+ $opt_debug
+ if test -n "$available_tags" && test -z "$tagname"; then
+ CC_quoted=
+ for arg in $CC; do
+ func_append_quoted CC_quoted "$arg"
+ done
+ CC_expanded=`func_echo_all $CC`
+ CC_quoted_expanded=`func_echo_all $CC_quoted`
+ case $@ in
+ # Blanks in the command may have been stripped by the calling shell,
+ # but not from the CC environment variable when configure was run.
+ " $CC "* | "$CC "* | " $CC_expanded "* | "$CC_expanded "* | \
+ " $CC_quoted"* | "$CC_quoted "* | " $CC_quoted_expanded "* | "$CC_quoted_expanded "*) ;;
+ # Blanks at the start of $base_compile will cause this to fail
+ # if we don't check for them as well.
+ *)
+ for z in $available_tags; do
+ if $GREP "^# ### BEGIN LIBTOOL TAG CONFIG: $z$" < "$progpath" > /dev/null; then
+ # Evaluate the configuration.
+ eval "`${SED} -n -e '/^# ### BEGIN LIBTOOL TAG CONFIG: '$z'$/,/^# ### END LIBTOOL TAG CONFIG: '$z'$/p' < $progpath`"
+ CC_quoted=
+ for arg in $CC; do
+ # Double-quote args containing other shell metacharacters.
+ func_append_quoted CC_quoted "$arg"
+ done
+ CC_expanded=`func_echo_all $CC`
+ CC_quoted_expanded=`func_echo_all $CC_quoted`
+ case "$@ " in
+ " $CC "* | "$CC "* | " $CC_expanded "* | "$CC_expanded "* | \
+ " $CC_quoted"* | "$CC_quoted "* | " $CC_quoted_expanded "* | "$CC_quoted_expanded "*)
+ # The compiler in the base compile command matches
+ # the one in the tagged configuration.
+ # Assume this is the tagged configuration we want.
+ tagname=$z
+ break
+ ;;
+ esac
+ fi
+ done
+ # If $tagname still isn't set, then no tagged configuration
+ # was found and let the user know that the "--tag" command
+ # line option must be used.
+ if test -z "$tagname"; then
+ func_echo "unable to infer tagged configuration"
+ func_fatal_error "specify a tag with \`--tag'"
+# else
+# func_verbose "using $tagname tagged configuration"
+ fi
+ ;;
+ esac
+ fi
+}
+
+
+
+# func_write_libtool_object output_name pic_name nonpic_name
+# Create a libtool object file (analogous to a ".la" file),
+# but don't create it if we're doing a dry run.
+func_write_libtool_object ()
+{
+ write_libobj=${1}
+ if test "$build_libtool_libs" = yes; then
+ write_lobj=\'${2}\'
+ else
+ write_lobj=none
+ fi
+
+ if test "$build_old_libs" = yes; then
+ write_oldobj=\'${3}\'
+ else
+ write_oldobj=none
+ fi
+
+ $opt_dry_run || {
+ cat >${write_libobj}T </dev/null`
+ if test "$?" -eq 0 && test -n "${func_convert_core_file_wine_to_w32_tmp}"; then
+ func_convert_core_file_wine_to_w32_result=`$ECHO "$func_convert_core_file_wine_to_w32_tmp" |
+ $SED -e "$lt_sed_naive_backslashify"`
+ else
+ func_convert_core_file_wine_to_w32_result=
+ fi
+ fi
+}
+# end: func_convert_core_file_wine_to_w32
+
+
+# func_convert_core_path_wine_to_w32 ARG
+# Helper function used by path conversion functions when $build is *nix, and
+# $host is mingw, cygwin, or some other w32 environment. Relies on a correctly
+# configured wine environment available, with the winepath program in $build's
+# $PATH. Assumes ARG has no leading or trailing path separator characters.
+#
+# ARG is path to be converted from $build format to win32.
+# Result is available in $func_convert_core_path_wine_to_w32_result.
+# Unconvertible file (directory) names in ARG are skipped; if no directory names
+# are convertible, then the result may be empty.
+func_convert_core_path_wine_to_w32 ()
+{
+ $opt_debug
+ # unfortunately, winepath doesn't convert paths, only file names
+ func_convert_core_path_wine_to_w32_result=""
+ if test -n "$1"; then
+ oldIFS=$IFS
+ IFS=:
+ for func_convert_core_path_wine_to_w32_f in $1; do
+ IFS=$oldIFS
+ func_convert_core_file_wine_to_w32 "$func_convert_core_path_wine_to_w32_f"
+ if test -n "$func_convert_core_file_wine_to_w32_result" ; then
+ if test -z "$func_convert_core_path_wine_to_w32_result"; then
+ func_convert_core_path_wine_to_w32_result="$func_convert_core_file_wine_to_w32_result"
+ else
+ func_append func_convert_core_path_wine_to_w32_result ";$func_convert_core_file_wine_to_w32_result"
+ fi
+ fi
+ done
+ IFS=$oldIFS
+ fi
+}
+# end: func_convert_core_path_wine_to_w32
+
+
+# func_cygpath ARGS...
+# Wrapper around calling the cygpath program via LT_CYGPATH. This is used when
+# when (1) $build is *nix and Cygwin is hosted via a wine environment; or (2)
+# $build is MSYS and $host is Cygwin, or (3) $build is Cygwin. In case (1) or
+# (2), returns the Cygwin file name or path in func_cygpath_result (input
+# file name or path is assumed to be in w32 format, as previously converted
+# from $build's *nix or MSYS format). In case (3), returns the w32 file name
+# or path in func_cygpath_result (input file name or path is assumed to be in
+# Cygwin format). Returns an empty string on error.
+#
+# ARGS are passed to cygpath, with the last one being the file name or path to
+# be converted.
+#
+# Specify the absolute *nix (or w32) name to cygpath in the LT_CYGPATH
+# environment variable; do not put it in $PATH.
+func_cygpath ()
+{
+ $opt_debug
+ if test -n "$LT_CYGPATH" && test -f "$LT_CYGPATH"; then
+ func_cygpath_result=`$LT_CYGPATH "$@" 2>/dev/null`
+ if test "$?" -ne 0; then
+ # on failure, ensure result is empty
+ func_cygpath_result=
+ fi
+ else
+ func_cygpath_result=
+ func_error "LT_CYGPATH is empty or specifies non-existent file: \`$LT_CYGPATH'"
+ fi
+}
+#end: func_cygpath
+
+
+# func_convert_core_msys_to_w32 ARG
+# Convert file name or path ARG from MSYS format to w32 format. Return
+# result in func_convert_core_msys_to_w32_result.
+func_convert_core_msys_to_w32 ()
+{
+ $opt_debug
+ # awkward: cmd appends spaces to result
+ func_convert_core_msys_to_w32_result=`( cmd //c echo "$1" ) 2>/dev/null |
+ $SED -e 's/[ ]*$//' -e "$lt_sed_naive_backslashify"`
+}
+#end: func_convert_core_msys_to_w32
+
+
+# func_convert_file_check ARG1 ARG2
+# Verify that ARG1 (a file name in $build format) was converted to $host
+# format in ARG2. Otherwise, emit an error message, but continue (resetting
+# func_to_host_file_result to ARG1).
+func_convert_file_check ()
+{
+ $opt_debug
+ if test -z "$2" && test -n "$1" ; then
+ func_error "Could not determine host file name corresponding to"
+ func_error " \`$1'"
+ func_error "Continuing, but uninstalled executables may not work."
+ # Fallback:
+ func_to_host_file_result="$1"
+ fi
+}
+# end func_convert_file_check
+
+
+# func_convert_path_check FROM_PATHSEP TO_PATHSEP FROM_PATH TO_PATH
+# Verify that FROM_PATH (a path in $build format) was converted to $host
+# format in TO_PATH. Otherwise, emit an error message, but continue, resetting
+# func_to_host_file_result to a simplistic fallback value (see below).
+func_convert_path_check ()
+{
+ $opt_debug
+ if test -z "$4" && test -n "$3"; then
+ func_error "Could not determine the host path corresponding to"
+ func_error " \`$3'"
+ func_error "Continuing, but uninstalled executables may not work."
+ # Fallback. This is a deliberately simplistic "conversion" and
+ # should not be "improved". See libtool.info.
+ if test "x$1" != "x$2"; then
+ lt_replace_pathsep_chars="s|$1|$2|g"
+ func_to_host_path_result=`echo "$3" |
+ $SED -e "$lt_replace_pathsep_chars"`
+ else
+ func_to_host_path_result="$3"
+ fi
+ fi
+}
+# end func_convert_path_check
+
+
+# func_convert_path_front_back_pathsep FRONTPAT BACKPAT REPL ORIG
+# Modifies func_to_host_path_result by prepending REPL if ORIG matches FRONTPAT
+# and appending REPL if ORIG matches BACKPAT.
+func_convert_path_front_back_pathsep ()
+{
+ $opt_debug
+ case $4 in
+ $1 ) func_to_host_path_result="$3$func_to_host_path_result"
+ ;;
+ esac
+ case $4 in
+ $2 ) func_append func_to_host_path_result "$3"
+ ;;
+ esac
+}
+# end func_convert_path_front_back_pathsep
+
+
+##################################################
+# $build to $host FILE NAME CONVERSION FUNCTIONS #
+##################################################
+# invoked via `$to_host_file_cmd ARG'
+#
+# In each case, ARG is the path to be converted from $build to $host format.
+# Result will be available in $func_to_host_file_result.
+
+
+# func_to_host_file ARG
+# Converts the file name ARG from $build format to $host format. Return result
+# in func_to_host_file_result.
+func_to_host_file ()
+{
+ $opt_debug
+ $to_host_file_cmd "$1"
+}
+# end func_to_host_file
+
+
+# func_to_tool_file ARG LAZY
+# converts the file name ARG from $build format to toolchain format. Return
+# result in func_to_tool_file_result. If the conversion in use is listed
+# in (the comma separated) LAZY, no conversion takes place.
+func_to_tool_file ()
+{
+ $opt_debug
+ case ,$2, in
+ *,"$to_tool_file_cmd",*)
+ func_to_tool_file_result=$1
+ ;;
+ *)
+ $to_tool_file_cmd "$1"
+ func_to_tool_file_result=$func_to_host_file_result
+ ;;
+ esac
+}
+# end func_to_tool_file
+
+
+# func_convert_file_noop ARG
+# Copy ARG to func_to_host_file_result.
+func_convert_file_noop ()
+{
+ func_to_host_file_result="$1"
+}
+# end func_convert_file_noop
+
+
+# func_convert_file_msys_to_w32 ARG
+# Convert file name ARG from (mingw) MSYS to (mingw) w32 format; automatic
+# conversion to w32 is not available inside the cwrapper. Returns result in
+# func_to_host_file_result.
+func_convert_file_msys_to_w32 ()
+{
+ $opt_debug
+ func_to_host_file_result="$1"
+ if test -n "$1"; then
+ func_convert_core_msys_to_w32 "$1"
+ func_to_host_file_result="$func_convert_core_msys_to_w32_result"
+ fi
+ func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_msys_to_w32
+
+
+# func_convert_file_cygwin_to_w32 ARG
+# Convert file name ARG from Cygwin to w32 format. Returns result in
+# func_to_host_file_result.
+func_convert_file_cygwin_to_w32 ()
+{
+ $opt_debug
+ func_to_host_file_result="$1"
+ if test -n "$1"; then
+ # because $build is cygwin, we call "the" cygpath in $PATH; no need to use
+ # LT_CYGPATH in this case.
+ func_to_host_file_result=`cygpath -m "$1"`
+ fi
+ func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_cygwin_to_w32
+
+
+# func_convert_file_nix_to_w32 ARG
+# Convert file name ARG from *nix to w32 format. Requires a wine environment
+# and a working winepath. Returns result in func_to_host_file_result.
+func_convert_file_nix_to_w32 ()
+{
+ $opt_debug
+ func_to_host_file_result="$1"
+ if test -n "$1"; then
+ func_convert_core_file_wine_to_w32 "$1"
+ func_to_host_file_result="$func_convert_core_file_wine_to_w32_result"
+ fi
+ func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_nix_to_w32
+
+
+# func_convert_file_msys_to_cygwin ARG
+# Convert file name ARG from MSYS to Cygwin format. Requires LT_CYGPATH set.
+# Returns result in func_to_host_file_result.
+func_convert_file_msys_to_cygwin ()
+{
+ $opt_debug
+ func_to_host_file_result="$1"
+ if test -n "$1"; then
+ func_convert_core_msys_to_w32 "$1"
+ func_cygpath -u "$func_convert_core_msys_to_w32_result"
+ func_to_host_file_result="$func_cygpath_result"
+ fi
+ func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_msys_to_cygwin
+
+
+# func_convert_file_nix_to_cygwin ARG
+# Convert file name ARG from *nix to Cygwin format. Requires Cygwin installed
+# in a wine environment, working winepath, and LT_CYGPATH set. Returns result
+# in func_to_host_file_result.
+func_convert_file_nix_to_cygwin ()
+{
+ $opt_debug
+ func_to_host_file_result="$1"
+ if test -n "$1"; then
+ # convert from *nix to w32, then use cygpath to convert from w32 to cygwin.
+ func_convert_core_file_wine_to_w32 "$1"
+ func_cygpath -u "$func_convert_core_file_wine_to_w32_result"
+ func_to_host_file_result="$func_cygpath_result"
+ fi
+ func_convert_file_check "$1" "$func_to_host_file_result"
+}
+# end func_convert_file_nix_to_cygwin
+
+
+#############################################
+# $build to $host PATH CONVERSION FUNCTIONS #
+#############################################
+# invoked via `$to_host_path_cmd ARG'
+#
+# In each case, ARG is the path to be converted from $build to $host format.
+# The result will be available in $func_to_host_path_result.
+#
+# Path separators are also converted from $build format to $host format. If
+# ARG begins or ends with a path separator character, it is preserved (but
+# converted to $host format) on output.
+#
+# All path conversion functions are named using the following convention:
+# file name conversion function : func_convert_file_X_to_Y ()
+# path conversion function : func_convert_path_X_to_Y ()
+# where, for any given $build/$host combination the 'X_to_Y' value is the
+# same. If conversion functions are added for new $build/$host combinations,
+# the two new functions must follow this pattern, or func_init_to_host_path_cmd
+# will break.
+
+
+# func_init_to_host_path_cmd
+# Ensures that function "pointer" variable $to_host_path_cmd is set to the
+# appropriate value, based on the value of $to_host_file_cmd.
+to_host_path_cmd=
+func_init_to_host_path_cmd ()
+{
+ $opt_debug
+ if test -z "$to_host_path_cmd"; then
+ func_stripname 'func_convert_file_' '' "$to_host_file_cmd"
+ to_host_path_cmd="func_convert_path_${func_stripname_result}"
+ fi
+}
+
+
+# func_to_host_path ARG
+# Converts the path ARG from $build format to $host format. Return result
+# in func_to_host_path_result.
+func_to_host_path ()
+{
+ $opt_debug
+ func_init_to_host_path_cmd
+ $to_host_path_cmd "$1"
+}
+# end func_to_host_path
+
+
+# func_convert_path_noop ARG
+# Copy ARG to func_to_host_path_result.
+func_convert_path_noop ()
+{
+ func_to_host_path_result="$1"
+}
+# end func_convert_path_noop
+
+
+# func_convert_path_msys_to_w32 ARG
+# Convert path ARG from (mingw) MSYS to (mingw) w32 format; automatic
+# conversion to w32 is not available inside the cwrapper. Returns result in
+# func_to_host_path_result.
+func_convert_path_msys_to_w32 ()
+{
+ $opt_debug
+ func_to_host_path_result="$1"
+ if test -n "$1"; then
+ # Remove leading and trailing path separator characters from ARG. MSYS
+ # behavior is inconsistent here; cygpath turns them into '.;' and ';.';
+ # and winepath ignores them completely.
+ func_stripname : : "$1"
+ func_to_host_path_tmp1=$func_stripname_result
+ func_convert_core_msys_to_w32 "$func_to_host_path_tmp1"
+ func_to_host_path_result="$func_convert_core_msys_to_w32_result"
+ func_convert_path_check : ";" \
+ "$func_to_host_path_tmp1" "$func_to_host_path_result"
+ func_convert_path_front_back_pathsep ":*" "*:" ";" "$1"
+ fi
+}
+# end func_convert_path_msys_to_w32
+
+
+# func_convert_path_cygwin_to_w32 ARG
+# Convert path ARG from Cygwin to w32 format. Returns result in
+# func_to_host_file_result.
+func_convert_path_cygwin_to_w32 ()
+{
+ $opt_debug
+ func_to_host_path_result="$1"
+ if test -n "$1"; then
+ # See func_convert_path_msys_to_w32:
+ func_stripname : : "$1"
+ func_to_host_path_tmp1=$func_stripname_result
+ func_to_host_path_result=`cygpath -m -p "$func_to_host_path_tmp1"`
+ func_convert_path_check : ";" \
+ "$func_to_host_path_tmp1" "$func_to_host_path_result"
+ func_convert_path_front_back_pathsep ":*" "*:" ";" "$1"
+ fi
+}
+# end func_convert_path_cygwin_to_w32
+
+
+# func_convert_path_nix_to_w32 ARG
+# Convert path ARG from *nix to w32 format. Requires a wine environment and
+# a working winepath. Returns result in func_to_host_file_result.
+func_convert_path_nix_to_w32 ()
+{
+ $opt_debug
+ func_to_host_path_result="$1"
+ if test -n "$1"; then
+ # See func_convert_path_msys_to_w32:
+ func_stripname : : "$1"
+ func_to_host_path_tmp1=$func_stripname_result
+ func_convert_core_path_wine_to_w32 "$func_to_host_path_tmp1"
+ func_to_host_path_result="$func_convert_core_path_wine_to_w32_result"
+ func_convert_path_check : ";" \
+ "$func_to_host_path_tmp1" "$func_to_host_path_result"
+ func_convert_path_front_back_pathsep ":*" "*:" ";" "$1"
+ fi
+}
+# end func_convert_path_nix_to_w32
+
+
+# func_convert_path_msys_to_cygwin ARG
+# Convert path ARG from MSYS to Cygwin format. Requires LT_CYGPATH set.
+# Returns result in func_to_host_file_result.
+func_convert_path_msys_to_cygwin ()
+{
+ $opt_debug
+ func_to_host_path_result="$1"
+ if test -n "$1"; then
+ # See func_convert_path_msys_to_w32:
+ func_stripname : : "$1"
+ func_to_host_path_tmp1=$func_stripname_result
+ func_convert_core_msys_to_w32 "$func_to_host_path_tmp1"
+ func_cygpath -u -p "$func_convert_core_msys_to_w32_result"
+ func_to_host_path_result="$func_cygpath_result"
+ func_convert_path_check : : \
+ "$func_to_host_path_tmp1" "$func_to_host_path_result"
+ func_convert_path_front_back_pathsep ":*" "*:" : "$1"
+ fi
+}
+# end func_convert_path_msys_to_cygwin
+
+
+# func_convert_path_nix_to_cygwin ARG
+# Convert path ARG from *nix to Cygwin format. Requires Cygwin installed in a
+# a wine environment, working winepath, and LT_CYGPATH set. Returns result in
+# func_to_host_file_result.
+func_convert_path_nix_to_cygwin ()
+{
+ $opt_debug
+ func_to_host_path_result="$1"
+ if test -n "$1"; then
+ # Remove leading and trailing path separator characters from
+ # ARG. msys behavior is inconsistent here, cygpath turns them
+ # into '.;' and ';.', and winepath ignores them completely.
+ func_stripname : : "$1"
+ func_to_host_path_tmp1=$func_stripname_result
+ func_convert_core_path_wine_to_w32 "$func_to_host_path_tmp1"
+ func_cygpath -u -p "$func_convert_core_path_wine_to_w32_result"
+ func_to_host_path_result="$func_cygpath_result"
+ func_convert_path_check : : \
+ "$func_to_host_path_tmp1" "$func_to_host_path_result"
+ func_convert_path_front_back_pathsep ":*" "*:" : "$1"
+ fi
+}
+# end func_convert_path_nix_to_cygwin
+
+
+# func_mode_compile arg...
+func_mode_compile ()
+{
+ $opt_debug
+ # Get the compilation command and the source file.
+ base_compile=
+ srcfile="$nonopt" # always keep a non-empty value in "srcfile"
+ suppress_opt=yes
+ suppress_output=
+ arg_mode=normal
+ libobj=
+ later=
+ pie_flag=
+
+ for arg
+ do
+ case $arg_mode in
+ arg )
+ # do not "continue". Instead, add this to base_compile
+ lastarg="$arg"
+ arg_mode=normal
+ ;;
+
+ target )
+ libobj="$arg"
+ arg_mode=normal
+ continue
+ ;;
+
+ normal )
+ # Accept any command-line options.
+ case $arg in
+ -o)
+ test -n "$libobj" && \
+ func_fatal_error "you cannot specify \`-o' more than once"
+ arg_mode=target
+ continue
+ ;;
+
+ -pie | -fpie | -fPIE)
+ func_append pie_flag " $arg"
+ continue
+ ;;
+
+ -shared | -static | -prefer-pic | -prefer-non-pic)
+ func_append later " $arg"
+ continue
+ ;;
+
+ -no-suppress)
+ suppress_opt=no
+ continue
+ ;;
+
+ -Xcompiler)
+ arg_mode=arg # the next one goes into the "base_compile" arg list
+ continue # The current "srcfile" will either be retained or
+ ;; # replaced later. I would guess that would be a bug.
+
+ -Wc,*)
+ func_stripname '-Wc,' '' "$arg"
+ args=$func_stripname_result
+ lastarg=
+ save_ifs="$IFS"; IFS=','
+ for arg in $args; do
+ IFS="$save_ifs"
+ func_append_quoted lastarg "$arg"
+ done
+ IFS="$save_ifs"
+ func_stripname ' ' '' "$lastarg"
+ lastarg=$func_stripname_result
+
+ # Add the arguments to base_compile.
+ func_append base_compile " $lastarg"
+ continue
+ ;;
+
+ *)
+ # Accept the current argument as the source file.
+ # The previous "srcfile" becomes the current argument.
+ #
+ lastarg="$srcfile"
+ srcfile="$arg"
+ ;;
+ esac # case $arg
+ ;;
+ esac # case $arg_mode
+
+ # Aesthetically quote the previous argument.
+ func_append_quoted base_compile "$lastarg"
+ done # for arg
+
+ case $arg_mode in
+ arg)
+ func_fatal_error "you must specify an argument for -Xcompile"
+ ;;
+ target)
+ func_fatal_error "you must specify a target with \`-o'"
+ ;;
+ *)
+ # Get the name of the library object.
+ test -z "$libobj" && {
+ func_basename "$srcfile"
+ libobj="$func_basename_result"
+ }
+ ;;
+ esac
+
+ # Recognize several different file suffixes.
+ # If the user specifies -o file.o, it is replaced with file.lo
+ case $libobj in
+ *.[cCFSifmso] | \
+ *.ada | *.adb | *.ads | *.asm | \
+ *.c++ | *.cc | *.ii | *.class | *.cpp | *.cxx | \
+ *.[fF][09]? | *.for | *.java | *.go | *.obj | *.sx | *.cu | *.cup)
+ func_xform "$libobj"
+ libobj=$func_xform_result
+ ;;
+ esac
+
+ case $libobj in
+ *.lo) func_lo2o "$libobj"; obj=$func_lo2o_result ;;
+ *)
+ func_fatal_error "cannot determine name of library object from \`$libobj'"
+ ;;
+ esac
+
+ func_infer_tag $base_compile
+
+ for arg in $later; do
+ case $arg in
+ -shared)
+ test "$build_libtool_libs" != yes && \
+ func_fatal_configuration "can not build a shared library"
+ build_old_libs=no
+ continue
+ ;;
+
+ -static)
+ build_libtool_libs=no
+ build_old_libs=yes
+ continue
+ ;;
+
+ -prefer-pic)
+ pic_mode=yes
+ continue
+ ;;
+
+ -prefer-non-pic)
+ pic_mode=no
+ continue
+ ;;
+ esac
+ done
+
+ func_quote_for_eval "$libobj"
+ test "X$libobj" != "X$func_quote_for_eval_result" \
+ && $ECHO "X$libobj" | $GREP '[]~#^*{};<>?"'"'"' &()|`$[]' \
+ && func_warning "libobj name \`$libobj' may not contain shell special characters."
+ func_dirname_and_basename "$obj" "/" ""
+ objname="$func_basename_result"
+ xdir="$func_dirname_result"
+ lobj=${xdir}$objdir/$objname
+
+ test -z "$base_compile" && \
+ func_fatal_help "you must specify a compilation command"
+
+ # Delete any leftover library objects.
+ if test "$build_old_libs" = yes; then
+ removelist="$obj $lobj $libobj ${libobj}T"
+ else
+ removelist="$lobj $libobj ${libobj}T"
+ fi
+
+ # On Cygwin there's no "real" PIC flag so we must build both object types
+ case $host_os in
+ cygwin* | mingw* | pw32* | os2* | cegcc*)
+ pic_mode=default
+ ;;
+ esac
+ if test "$pic_mode" = no && test "$deplibs_check_method" != pass_all; then
+ # non-PIC code in shared libraries is not supported
+ pic_mode=default
+ fi
+
+ # Calculate the filename of the output object if compiler does
+ # not support -o with -c
+ if test "$compiler_c_o" = no; then
+ output_obj=`$ECHO "$srcfile" | $SED 's%^.*/%%; s%\.[^.]*$%%'`.${objext}
+ lockfile="$output_obj.lock"
+ else
+ output_obj=
+ need_locks=no
+ lockfile=
+ fi
+
+ # Lock this critical section if it is needed
+ # We use this script file to make the link, it avoids creating a new file
+ if test "$need_locks" = yes; then
+ until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do
+ func_echo "Waiting for $lockfile to be removed"
+ sleep 2
+ done
+ elif test "$need_locks" = warn; then
+ if test -f "$lockfile"; then
+ $ECHO "\
+*** ERROR, $lockfile exists and contains:
+`cat $lockfile 2>/dev/null`
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $opt_dry_run || $RM $removelist
+ exit $EXIT_FAILURE
+ fi
+ func_append removelist " $output_obj"
+ $ECHO "$srcfile" > "$lockfile"
+ fi
+
+ $opt_dry_run || $RM $removelist
+ func_append removelist " $lockfile"
+ trap '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE' 1 2 15
+
+ func_to_tool_file "$srcfile" func_convert_file_msys_to_w32
+ srcfile=$func_to_tool_file_result
+ func_quote_for_eval "$srcfile"
+ qsrcfile=$func_quote_for_eval_result
+
+ # Only build a PIC object if we are building libtool libraries.
+ if test "$build_libtool_libs" = yes; then
+ # Without this assignment, base_compile gets emptied.
+ fbsd_hideous_sh_bug=$base_compile
+
+ if test "$pic_mode" != no; then
+ command="$base_compile $qsrcfile $pic_flag"
+ else
+ # Don't build PIC code
+ command="$base_compile $qsrcfile"
+ fi
+
+ func_mkdir_p "$xdir$objdir"
+
+ if test -z "$output_obj"; then
+ # Place PIC objects in $objdir
+ func_append command " -o $lobj"
+ fi
+
+ func_show_eval_locale "$command" \
+ 'test -n "$output_obj" && $RM $removelist; exit $EXIT_FAILURE'
+
+ if test "$need_locks" = warn &&
+ test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+ $ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $opt_dry_run || $RM $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ # Just move the object if needed, then go on to compile the next one
+ if test -n "$output_obj" && test "X$output_obj" != "X$lobj"; then
+ func_show_eval '$MV "$output_obj" "$lobj"' \
+ 'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+ fi
+
+ # Allow error messages only from the first compilation.
+ if test "$suppress_opt" = yes; then
+ suppress_output=' >/dev/null 2>&1'
+ fi
+ fi
+
+ # Only build a position-dependent object if we build old libraries.
+ if test "$build_old_libs" = yes; then
+ if test "$pic_mode" != yes; then
+ # Don't build PIC code
+ command="$base_compile $qsrcfile$pie_flag"
+ else
+ command="$base_compile $qsrcfile $pic_flag"
+ fi
+ if test "$compiler_c_o" = yes; then
+ func_append command " -o $obj"
+ fi
+
+ # Suppress compiler output if we already did a PIC compilation.
+ func_append command "$suppress_output"
+ func_show_eval_locale "$command" \
+ '$opt_dry_run || $RM $removelist; exit $EXIT_FAILURE'
+
+ if test "$need_locks" = warn &&
+ test "X`cat $lockfile 2>/dev/null`" != "X$srcfile"; then
+ $ECHO "\
+*** ERROR, $lockfile contains:
+`cat $lockfile 2>/dev/null`
+
+but it should contain:
+$srcfile
+
+This indicates that another process is trying to use the same
+temporary object file, and libtool could not work around it because
+your compiler does not support \`-c' and \`-o' together. If you
+repeat this compilation, it may succeed, by chance, but you had better
+avoid parallel builds (make -j) in this platform, or get a better
+compiler."
+
+ $opt_dry_run || $RM $removelist
+ exit $EXIT_FAILURE
+ fi
+
+ # Just move the object if needed
+ if test -n "$output_obj" && test "X$output_obj" != "X$obj"; then
+ func_show_eval '$MV "$output_obj" "$obj"' \
+ 'error=$?; $opt_dry_run || $RM $removelist; exit $error'
+ fi
+ fi
+
+ $opt_dry_run || {
+ func_write_libtool_object "$libobj" "$objdir/$objname" "$objname"
+
+ # Unlock the critical section if it was locked
+ if test "$need_locks" != no; then
+ removelist=$lockfile
+ $RM "$lockfile"
+ fi
+ }
+
+ exit $EXIT_SUCCESS
+}
+
+$opt_help || {
+ test "$opt_mode" = compile && func_mode_compile ${1+"$@"}
+}
+
+func_mode_help ()
+{
+ # We need to display help for each of the modes.
+ case $opt_mode in
+ "")
+ # Generic help is extracted from the usage comments
+ # at the start of this file.
+ func_help
+ ;;
+
+ clean)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=clean RM [RM-OPTION]... FILE...
+
+Remove files from the build directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, object or program, all the files associated
+with it are deleted. Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+ compile)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+ -o OUTPUT-FILE set the output file name to OUTPUT-FILE
+ -no-suppress do not suppress compiler output for multiple passes
+ -prefer-pic try to build PIC objects only
+ -prefer-non-pic try to build non-PIC objects only
+ -shared do not build a \`.o' file suitable for static linking
+ -static only build a \`.o' file suitable for static linking
+ -Wc,FLAG pass FLAG directly to the compiler
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+ ;;
+
+ execute)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+ -dlopen FILE add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+ ;;
+
+ finish)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges. Use
+the \`--dry-run' option if you just want to see what would be executed."
+ ;;
+
+ install)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command. The first component should be
+either the \`install' or \`cp' program.
+
+The following components of INSTALL-COMMAND are treated specially:
+
+ -inst-prefix-dir PREFIX-DIR Use PREFIX-DIR as a staging area for installation
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+ ;;
+
+ link)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+ -all-static do not do any dynamic linking at all
+ -avoid-version do not add a version suffix if possible
+ -bindir BINDIR specify path to binaries directory (for systems where
+ libraries must be found in the PATH setting at runtime)
+ -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime
+ -dlpreopen FILE link in FILE and add its symbols to lt_preloaded_symbols
+ -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+ -export-symbols SYMFILE
+ try to export only the symbols listed in SYMFILE
+ -export-symbols-regex REGEX
+ try to export only the symbols matching REGEX
+ -LLIBDIR search LIBDIR for required installed libraries
+ -lNAME OUTPUT-FILE requires the installed library libNAME
+ -module build a library that can dlopened
+ -no-fast-install disable the fast-install mode
+ -no-install link a not-installable executable
+ -no-undefined declare that a library does not refer to external symbols
+ -o OUTPUT-FILE create OUTPUT-FILE from the specified objects
+ -objectlist FILE Use a list of object files found in FILE to specify objects
+ -precious-files-regex REGEX
+ don't remove output files matching REGEX
+ -release RELEASE specify package release information
+ -rpath LIBDIR the created library will eventually be installed in LIBDIR
+ -R[ ]LIBDIR add LIBDIR to the runtime path of programs and libraries
+ -shared only do dynamic linking of libtool libraries
+ -shrext SUFFIX override the standard shared library file extension
+ -static do not do any dynamic linking of uninstalled libtool libraries
+ -static-libtool-libs
+ do not do any dynamic linking of libtool libraries
+ -version-info CURRENT[:REVISION[:AGE]]
+ specify library version info [each variable defaults to 0]
+ -weak LIBNAME declare that the target provides the LIBNAME interface
+ -Wc,FLAG
+ -Xcompiler FLAG pass linker-specific FLAG directly to the compiler
+ -Wl,FLAG
+ -Xlinker FLAG pass linker-specific FLAG directly to the linker
+ -XCClinker FLAG pass link-specific FLAG to the compiler driver (CC)
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename. Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created,
+only library objects (\`.lo' files) may be specified, and \`-rpath' is
+required, except when creating a convenience library.
+
+If OUTPUT-FILE ends in \`.a' or \`.lib', then a standard library is created
+using \`ar' and \`ranlib', or on Windows using \`lib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.${objext}', then a reloadable object file
+is created, otherwise an executable program is created."
+ ;;
+
+ uninstall)
+ $ECHO \
+"Usage: $progname [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+ ;;
+
+ *)
+ func_fatal_help "invalid operation mode \`$opt_mode'"
+ ;;
+ esac
+
+ echo
+ $ECHO "Try \`$progname --help' for more information about other modes."
+}
+
+# Now that we've collected a possible --mode arg, show help if necessary
+if $opt_help; then
+ if test "$opt_help" = :; then
+ func_mode_help
+ else
+ {
+ func_help noexit
+ for opt_mode in compile link execute install finish uninstall clean; do
+ func_mode_help
+ done
+ } | sed -n '1p; 2,$s/^Usage:/ or: /p'
+ {
+ func_help noexit
+ for opt_mode in compile link execute install finish uninstall clean; do
+ echo
+ func_mode_help
+ done
+ } |
+ sed '1d
+ /^When reporting/,/^Report/{
+ H
+ d
+ }
+ $x
+ /information about other modes/d
+ /more detailed .*MODE/d
+ s/^Usage:.*--mode=\([^ ]*\) .*/Description of \1 mode:/'
+ fi
+ exit $?
+fi
+
+
+# func_mode_execute arg...
+func_mode_execute ()
+{
+ $opt_debug
+ # The first argument is the command name.
+ cmd="$nonopt"
+ test -z "$cmd" && \
+ func_fatal_help "you must specify a COMMAND"
+
+ # Handle -dlopen flags immediately.
+ for file in $opt_dlopen; do
+ test -f "$file" \
+ || func_fatal_help "\`$file' is not a file"
+
+ dir=
+ case $file in
+ *.la)
+ func_resolve_sysroot "$file"
+ file=$func_resolve_sysroot_result
+
+ # Check to see that this really is a libtool archive.
+ func_lalib_unsafe_p "$file" \
+ || func_fatal_help "\`$lib' is not a valid libtool archive"
+
+ # Read the libtool library.
+ dlname=
+ library_names=
+ func_source "$file"
+
+ # Skip this library if it cannot be dlopened.
+ if test -z "$dlname"; then
+ # Warn if it was a shared library.
+ test -n "$library_names" && \
+ func_warning "\`$file' was not linked with \`-export-dynamic'"
+ continue
+ fi
+
+ func_dirname "$file" "" "."
+ dir="$func_dirname_result"
+
+ if test -f "$dir/$objdir/$dlname"; then
+ func_append dir "/$objdir"
+ else
+ if test ! -f "$dir/$dlname"; then
+ func_fatal_error "cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'"
+ fi
+ fi
+ ;;
+
+ *.lo)
+ # Just add the directory containing the .lo file.
+ func_dirname "$file" "" "."
+ dir="$func_dirname_result"
+ ;;
+
+ *)
+ func_warning "\`-dlopen' is ignored for non-libtool libraries and objects"
+ continue
+ ;;
+ esac
+
+ # Get the absolute pathname.
+ absdir=`cd "$dir" && pwd`
+ test -n "$absdir" && dir="$absdir"
+
+ # Now add the directory to shlibpath_var.
+ if eval "test -z \"\$$shlibpath_var\""; then
+ eval "$shlibpath_var=\"\$dir\""
+ else
+ eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+ fi
+ done
+
+ # This variable tells wrapper scripts just to set shlibpath_var
+ # rather than running their programs.
+ libtool_execute_magic="$magic"
+
+ # Check if any of the arguments is a wrapper script.
+ args=
+ for file
+ do
+ case $file in
+ -* | *.la | *.lo ) ;;
+ *)
+ # Do a test to see if this is really a libtool program.
+ if func_ltwrapper_script_p "$file"; then
+ func_source "$file"
+ # Transform arg to wrapped name.
+ file="$progdir/$program"
+ elif func_ltwrapper_executable_p "$file"; then
+ func_ltwrapper_scriptname "$file"
+ func_source "$func_ltwrapper_scriptname_result"
+ # Transform arg to wrapped name.
+ file="$progdir/$program"
+ fi
+ ;;
+ esac
+ # Quote arguments (to preserve shell metacharacters).
+ func_append_quoted args "$file"
+ done
+
+ if test "X$opt_dry_run" = Xfalse; then
+ if test -n "$shlibpath_var"; then
+ # Export the shlibpath_var.
+ eval "export $shlibpath_var"
+ fi
+
+ # Restore saved environment variables
+ for lt_var in LANG LANGUAGE LC_ALL LC_CTYPE LC_COLLATE LC_MESSAGES
+ do
+ eval "if test \"\${save_$lt_var+set}\" = set; then
+ $lt_var=\$save_$lt_var; export $lt_var
+ else
+ $lt_unset $lt_var
+ fi"
+ done
+
+ # Now prepare to actually exec the command.
+ exec_cmd="\$cmd$args"
+ else
+ # Display what would be done.
+ if test -n "$shlibpath_var"; then
+ eval "\$ECHO \"\$shlibpath_var=\$$shlibpath_var\""
+ echo "export $shlibpath_var"
+ fi
+ $ECHO "$cmd$args"
+ exit $EXIT_SUCCESS
+ fi
+}
+
+test "$opt_mode" = execute && func_mode_execute ${1+"$@"}
+
+
+# func_mode_finish arg...
+func_mode_finish ()
+{
+ $opt_debug
+ libs=
+ libdirs=
+ admincmds=
+
+ for opt in "$nonopt" ${1+"$@"}
+ do
+ if test -d "$opt"; then
+ func_append libdirs " $opt"
+
+ elif test -f "$opt"; then
+ if func_lalib_unsafe_p "$opt"; then
+ func_append libs " $opt"
+ else
+ func_warning "\`$opt' is not a valid libtool archive"
+ fi
+
+ else
+ func_fatal_error "invalid argument \`$opt'"
+ fi
+ done
+
+ if test -n "$libs"; then
+ if test -n "$lt_sysroot"; then
+ sysroot_regex=`$ECHO "$lt_sysroot" | $SED "$sed_make_literal_regex"`
+ sysroot_cmd="s/\([ ']\)$sysroot_regex/\1/g;"
+ else
+ sysroot_cmd=
+ fi
+
+ # Remove sysroot references
+ if $opt_dry_run; then
+ for lib in $libs; do
+ echo "removing references to $lt_sysroot and \`=' prefixes from $lib"
+ done
+ else
+ tmpdir=`func_mktempdir`
+ for lib in $libs; do
+ sed -e "${sysroot_cmd} s/\([ ']-[LR]\)=/\1/g; s/\([ ']\)=/\1/g" $lib \
+ > $tmpdir/tmp-la
+ mv -f $tmpdir/tmp-la $lib
+ done
+ ${RM}r "$tmpdir"
+ fi
+ fi
+
+ if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+ for libdir in $libdirs; do
+ if test -n "$finish_cmds"; then
+ # Do each command in the finish commands.
+ func_execute_cmds "$finish_cmds" 'admincmds="$admincmds
+'"$cmd"'"'
+ fi
+ if test -n "$finish_eval"; then
+ # Do the single finish_eval.
+ eval cmds=\"$finish_eval\"
+ $opt_dry_run || eval "$cmds" || func_append admincmds "
+ $cmds"
+ fi
+ done
+ fi
+
+ # Exit here if they wanted silent mode.
+ $opt_silent && exit $EXIT_SUCCESS
+
+ if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+ echo "----------------------------------------------------------------------"
+ echo "Libraries have been installed in:"
+ for libdir in $libdirs; do
+ $ECHO " $libdir"
+ done
+ echo
+ echo "If you ever happen to want to link against installed libraries"
+ echo "in a given directory, LIBDIR, you must either use libtool, and"
+ echo "specify the full pathname of the library, or use the \`-LLIBDIR'"
+ echo "flag during linking and do at least one of the following:"
+ if test -n "$shlibpath_var"; then
+ echo " - add LIBDIR to the \`$shlibpath_var' environment variable"
+ echo " during execution"
+ fi
+ if test -n "$runpath_var"; then
+ echo " - add LIBDIR to the \`$runpath_var' environment variable"
+ echo " during linking"
+ fi
+ if test -n "$hardcode_libdir_flag_spec"; then
+ libdir=LIBDIR
+ eval flag=\"$hardcode_libdir_flag_spec\"
+
+ $ECHO " - use the \`$flag' linker flag"
+ fi
+ if test -n "$admincmds"; then
+ $ECHO " - have your system administrator run these commands:$admincmds"
+ fi
+ if test -f /etc/ld.so.conf; then
+ echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+ fi
+ echo
+
+ echo "See any operating system documentation about shared libraries for"
+ case $host in
+ solaris2.[6789]|solaris2.1[0-9])
+ echo "more information, such as the ld(1), crle(1) and ld.so(8) manual"
+ echo "pages."
+ ;;
+ *)
+ echo "more information, such as the ld(1) and ld.so(8) manual pages."
+ ;;
+ esac
+ echo "----------------------------------------------------------------------"
+ fi
+ exit $EXIT_SUCCESS
+}
+
+test "$opt_mode" = finish && func_mode_finish ${1+"$@"}
+
+
+# func_mode_install arg...
+func_mode_install ()
+{
+ $opt_debug
+ # There may be an optional sh(1) argument at the beginning of
+ # install_prog (especially on Windows NT).
+ if test "$nonopt" = "$SHELL" || test "$nonopt" = /bin/sh ||
+ # Allow the use of GNU shtool's install command.
+ case $nonopt in *shtool*) :;; *) false;; esac; then
+ # Aesthetically quote it.
+ func_quote_for_eval "$nonopt"
+ install_prog="$func_quote_for_eval_result "
+ arg=$1
+ shift
+ else
+ install_prog=
+ arg=$nonopt
+ fi
+
+ # The real first argument should be the name of the installation program.
+ # Aesthetically quote it.
+ func_quote_for_eval "$arg"
+ func_append install_prog "$func_quote_for_eval_result"
+ install_shared_prog=$install_prog
+ case " $install_prog " in
+ *[\\\ /]cp\ *) install_cp=: ;;
+ *) install_cp=false ;;
+ esac
+
+ # We need to accept at least all the BSD install flags.
+ dest=
+ files=
+ opts=
+ prev=
+ install_type=
+ isdir=no
+ stripme=
+ no_mode=:
+ for arg
+ do
+ arg2=
+ if test -n "$dest"; then
+ func_append files " $dest"
+ dest=$arg
+ continue
+ fi
+
+ case $arg in
+ -d) isdir=yes ;;
+ -f)
+ if $install_cp; then :; else
+ prev=$arg
+ fi
+ ;;
+ -g | -m | -o)
+ prev=$arg
+ ;;
+ -s)
+ stripme=" -s"
+ continue
+ ;;
+ -*)
+ ;;
+ *)
+ # If the previous option needed an argument, then skip it.
+ if test -n "$prev"; then
+ if test "x$prev" = x-m && test -n "$install_override_mode"; then
+ arg2=$install_override_mode
+ no_mode=false
+ fi
+ prev=
+ else
+ dest=$arg
+ continue
+ fi
+ ;;
+ esac
+
+ # Aesthetically quote the argument.
+ func_quote_for_eval "$arg"
+ func_append install_prog " $func_quote_for_eval_result"
+ if test -n "$arg2"; then
+ func_quote_for_eval "$arg2"
+ fi
+ func_append install_shared_prog " $func_quote_for_eval_result"
+ done
+
+ test -z "$install_prog" && \
+ func_fatal_help "you must specify an install program"
+
+ test -n "$prev" && \
+ func_fatal_help "the \`$prev' option requires an argument"
+
+ if test -n "$install_override_mode" && $no_mode; then
+ if $install_cp; then :; else
+ func_quote_for_eval "$install_override_mode"
+ func_append install_shared_prog " -m $func_quote_for_eval_result"
+ fi
+ fi
+
+ if test -z "$files"; then
+ if test -z "$dest"; then
+ func_fatal_help "no file or destination specified"
+ else
+ func_fatal_help "you must specify a destination"
+ fi
+ fi
+
+ # Strip any trailing slash from the destination.
+ func_stripname '' '/' "$dest"
+ dest=$func_stripname_result
+
+ # Check to see that the destination is a directory.
+ test -d "$dest" && isdir=yes
+ if test "$isdir" = yes; then
+ destdir="$dest"
+ destname=
+ else
+ func_dirname_and_basename "$dest" "" "."
+ destdir="$func_dirname_result"
+ destname="$func_basename_result"
+
+ # Not a directory, so check to see that there is only one file specified.
+ set dummy $files; shift
+ test "$#" -gt 1 && \
+ func_fatal_help "\`$dest' is not a directory"
+ fi
+ case $destdir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ for file in $files; do
+ case $file in
+ *.lo) ;;
+ *)
+ func_fatal_help "\`$destdir' must be an absolute directory name"
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ # This variable tells wrapper scripts just to set variables rather
+ # than running their programs.
+ libtool_install_magic="$magic"
+
+ staticlibs=
+ future_libdirs=
+ current_libdirs=
+ for file in $files; do
+
+ # Do each installation.
+ case $file in
+ *.$libext)
+ # Do the static libraries later.
+ func_append staticlibs " $file"
+ ;;
+
+ *.la)
+ func_resolve_sysroot "$file"
+ file=$func_resolve_sysroot_result
+
+ # Check to see that this really is a libtool archive.
+ func_lalib_unsafe_p "$file" \
+ || func_fatal_help "\`$file' is not a valid libtool archive"
+
+ library_names=
+ old_library=
+ relink_command=
+ func_source "$file"
+
+ # Add the libdir to current_libdirs if it is the destination.
+ if test "X$destdir" = "X$libdir"; then
+ case "$current_libdirs " in
+ *" $libdir "*) ;;
+ *) func_append current_libdirs " $libdir" ;;
+ esac
+ else
+ # Note the libdir as a future libdir.
+ case "$future_libdirs " in
+ *" $libdir "*) ;;
+ *) func_append future_libdirs " $libdir" ;;
+ esac
+ fi
+
+ func_dirname "$file" "/" ""
+ dir="$func_dirname_result"
+ func_append dir "$objdir"
+
+ if test -n "$relink_command"; then
+ # Determine the prefix the user has applied to our future dir.
+ inst_prefix_dir=`$ECHO "$destdir" | $SED -e "s%$libdir\$%%"`
+
+ # Don't allow the user to place us outside of our expected
+ # location b/c this prevents finding dependent libraries that
+ # are installed to the same prefix.
+ # At present, this check doesn't affect windows .dll's that
+ # are installed into $libdir/../bin (currently, that works fine)
+ # but it's something to keep an eye on.
+ test "$inst_prefix_dir" = "$destdir" && \
+ func_fatal_error "error: cannot install \`$file' to a directory not ending in $libdir"
+
+ if test -n "$inst_prefix_dir"; then
+ # Stick the inst_prefix_dir data into the link command.
+ relink_command=`$ECHO "$relink_command" | $SED "s%@inst_prefix_dir@%-inst-prefix-dir $inst_prefix_dir%"`
+ else
+ relink_command=`$ECHO "$relink_command" | $SED "s%@inst_prefix_dir@%%"`
+ fi
+
+ func_warning "relinking \`$file'"
+ func_show_eval "$relink_command" \
+ 'func_fatal_error "error: relink \`$file'\'' with the above command before installing it"'
+ fi
+
+ # See the names of the shared library.
+ set dummy $library_names; shift
+ if test -n "$1"; then
+ realname="$1"
+ shift
+
+ srcname="$realname"
+ test -n "$relink_command" && srcname="$realname"T
+
+ # Install the shared library and build the symlinks.
+ func_show_eval "$install_shared_prog $dir/$srcname $destdir/$realname" \
+ 'exit $?'
+ tstripme="$stripme"
+ case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ case $realname in
+ *.dll.a)
+ tstripme=""
+ ;;
+ esac
+ ;;
+ esac
+ if test -n "$tstripme" && test -n "$striplib"; then
+ func_show_eval "$striplib $destdir/$realname" 'exit $?'
+ fi
+
+ if test "$#" -gt 0; then
+ # Delete the old symlinks, and create new ones.
+ # Try `ln -sf' first, because the `ln' binary might depend on
+ # the symlink we replace! Solaris /bin/ln does not understand -f,
+ # so we also need to try rm && ln -s.
+ for linkname
+ do
+ test "$linkname" != "$realname" \
+ && func_show_eval "(cd $destdir && { $LN_S -f $realname $linkname || { $RM $linkname && $LN_S $realname $linkname; }; })"
+ done
+ fi
+
+ # Do each command in the postinstall commands.
+ lib="$destdir/$realname"
+ func_execute_cmds "$postinstall_cmds" 'exit $?'
+ fi
+
+ # Install the pseudo-library for information purposes.
+ func_basename "$file"
+ name="$func_basename_result"
+ instname="$dir/$name"i
+ func_show_eval "$install_prog $instname $destdir/$name" 'exit $?'
+
+ # Maybe install the static library, too.
+ test -n "$old_library" && func_append staticlibs " $dir/$old_library"
+ ;;
+
+ *.lo)
+ # Install (i.e. copy) a libtool object.
+
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ func_basename "$file"
+ destfile="$func_basename_result"
+ destfile="$destdir/$destfile"
+ fi
+
+ # Deduce the name of the destination old-style object file.
+ case $destfile in
+ *.lo)
+ func_lo2o "$destfile"
+ staticdest=$func_lo2o_result
+ ;;
+ *.$objext)
+ staticdest="$destfile"
+ destfile=
+ ;;
+ *)
+ func_fatal_help "cannot copy a libtool object to \`$destfile'"
+ ;;
+ esac
+
+ # Install the libtool object if requested.
+ test -n "$destfile" && \
+ func_show_eval "$install_prog $file $destfile" 'exit $?'
+
+ # Install the old object if enabled.
+ if test "$build_old_libs" = yes; then
+ # Deduce the name of the old-style object file.
+ func_lo2o "$file"
+ staticobj=$func_lo2o_result
+ func_show_eval "$install_prog \$staticobj \$staticdest" 'exit $?'
+ fi
+ exit $EXIT_SUCCESS
+ ;;
+
+ *)
+ # Figure out destination file name, if it wasn't already specified.
+ if test -n "$destname"; then
+ destfile="$destdir/$destname"
+ else
+ func_basename "$file"
+ destfile="$func_basename_result"
+ destfile="$destdir/$destfile"
+ fi
+
+ # If the file is missing, and there is a .exe on the end, strip it
+ # because it is most likely a libtool script we actually want to
+ # install
+ stripped_ext=""
+ case $file in
+ *.exe)
+ if test ! -f "$file"; then
+ func_stripname '' '.exe' "$file"
+ file=$func_stripname_result
+ stripped_ext=".exe"
+ fi
+ ;;
+ esac
+
+ # Do a test to see if this is really a libtool program.
+ case $host in
+ *cygwin* | *mingw*)
+ if func_ltwrapper_executable_p "$file"; then
+ func_ltwrapper_scriptname "$file"
+ wrapper=$func_ltwrapper_scriptname_result
+ else
+ func_stripname '' '.exe' "$file"
+ wrapper=$func_stripname_result
+ fi
+ ;;
+ *)
+ wrapper=$file
+ ;;
+ esac
+ if func_ltwrapper_script_p "$wrapper"; then
+ notinst_deplibs=
+ relink_command=
+
+ func_source "$wrapper"
+
+ # Check the variables that should have been set.
+ test -z "$generated_by_libtool_version" && \
+ func_fatal_error "invalid libtool wrapper script \`$wrapper'"
+
+ finalize=yes
+ for lib in $notinst_deplibs; do
+ # Check to see that each library is installed.
+ libdir=
+ if test -f "$lib"; then
+ func_source "$lib"
+ fi
+ libfile="$libdir/"`$ECHO "$lib" | $SED 's%^.*/%%g'` ### testsuite: skip nested quoting test
+ if test -n "$libdir" && test ! -f "$libfile"; then
+ func_warning "\`$lib' has not been installed in \`$libdir'"
+ finalize=no
+ fi
+ done
+
+ relink_command=
+ func_source "$wrapper"
+
+ outputname=
+ if test "$fast_install" = no && test -n "$relink_command"; then
+ $opt_dry_run || {
+ if test "$finalize" = yes; then
+ tmpdir=`func_mktempdir`
+ func_basename "$file$stripped_ext"
+ file="$func_basename_result"
+ outputname="$tmpdir/$file"
+ # Replace the output file specification.
+ relink_command=`$ECHO "$relink_command" | $SED 's%@OUTPUT@%'"$outputname"'%g'`
+
+ $opt_silent || {
+ func_quote_for_expand "$relink_command"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+ if eval "$relink_command"; then :
+ else
+ func_error "error: relink \`$file' with the above command before installing it"
+ $opt_dry_run || ${RM}r "$tmpdir"
+ continue
+ fi
+ file="$outputname"
+ else
+ func_warning "cannot relink \`$file'"
+ fi
+ }
+ else
+ # Install the binary that we compiled earlier.
+ file=`$ECHO "$file$stripped_ext" | $SED "s%\([^/]*\)$%$objdir/\1%"`
+ fi
+ fi
+
+ # remove .exe since cygwin /usr/bin/install will append another
+ # one anyway
+ case $install_prog,$host in
+ */usr/bin/install*,*cygwin*)
+ case $file:$destfile in
+ *.exe:*.exe)
+ # this is ok
+ ;;
+ *.exe:*)
+ destfile=$destfile.exe
+ ;;
+ *:*.exe)
+ func_stripname '' '.exe' "$destfile"
+ destfile=$func_stripname_result
+ ;;
+ esac
+ ;;
+ esac
+ func_show_eval "$install_prog\$stripme \$file \$destfile" 'exit $?'
+ $opt_dry_run || if test -n "$outputname"; then
+ ${RM}r "$tmpdir"
+ fi
+ ;;
+ esac
+ done
+
+ for file in $staticlibs; do
+ func_basename "$file"
+ name="$func_basename_result"
+
+ # Set up the ranlib parameters.
+ oldlib="$destdir/$name"
+ func_to_tool_file "$oldlib" func_convert_file_msys_to_w32
+ tool_oldlib=$func_to_tool_file_result
+
+ func_show_eval "$install_prog \$file \$oldlib" 'exit $?'
+
+ if test -n "$stripme" && test -n "$old_striplib"; then
+ func_show_eval "$old_striplib $tool_oldlib" 'exit $?'
+ fi
+
+ # Do each command in the postinstall commands.
+ func_execute_cmds "$old_postinstall_cmds" 'exit $?'
+ done
+
+ test -n "$future_libdirs" && \
+ func_warning "remember to run \`$progname --finish$future_libdirs'"
+
+ if test -n "$current_libdirs"; then
+ # Maybe just do a dry run.
+ $opt_dry_run && current_libdirs=" -n$current_libdirs"
+ exec_cmd='$SHELL $progpath $preserve_args --finish$current_libdirs'
+ else
+ exit $EXIT_SUCCESS
+ fi
+}
+
+test "$opt_mode" = install && func_mode_install ${1+"$@"}
+
+
+# func_generate_dlsyms outputname originator pic_p
+# Extract symbols from dlprefiles and create ${outputname}S.o with
+# a dlpreopen symbol table.
+func_generate_dlsyms ()
+{
+ $opt_debug
+ my_outputname="$1"
+ my_originator="$2"
+ my_pic_p="${3-no}"
+ my_prefix=`$ECHO "$my_originator" | sed 's%[^a-zA-Z0-9]%_%g'`
+ my_dlsyms=
+
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ if test -n "$NM" && test -n "$global_symbol_pipe"; then
+ my_dlsyms="${my_outputname}S.c"
+ else
+ func_error "not configured to extract global symbols from dlpreopened files"
+ fi
+ fi
+
+ if test -n "$my_dlsyms"; then
+ case $my_dlsyms in
+ "") ;;
+ *.c)
+ # Discover the nlist of each of the dlfiles.
+ nlist="$output_objdir/${my_outputname}.nm"
+
+ func_show_eval "$RM $nlist ${nlist}S ${nlist}T"
+
+ # Parse the name list into a source file.
+ func_verbose "creating $output_objdir/$my_dlsyms"
+
+ $opt_dry_run || $ECHO > "$output_objdir/$my_dlsyms" "\
+/* $my_dlsyms - symbol resolution table for \`$my_outputname' dlsym emulation. */
+/* Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+#if defined(__GNUC__) && (((__GNUC__ == 4) && (__GNUC_MINOR__ >= 4)) || (__GNUC__ > 4))
+#pragma GCC diagnostic ignored \"-Wstrict-prototypes\"
+#endif
+
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */
+#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE)
+/* DATA imports from DLLs on WIN32 con't be const, because runtime
+ relocations are performed -- see ld's documentation on pseudo-relocs. */
+# define LT_DLSYM_CONST
+#elif defined(__osf__)
+/* This system does not cope well with relocations in const data. */
+# define LT_DLSYM_CONST
+#else
+# define LT_DLSYM_CONST const
+#endif
+
+/* External symbol declarations for the compiler. */\
+"
+
+ if test "$dlself" = yes; then
+ func_verbose "generating symbol list for \`$output'"
+
+ $opt_dry_run || echo ': @PROGRAM@ ' > "$nlist"
+
+ # Add our own program objects to the symbol list.
+ progfiles=`$ECHO "$objs$old_deplibs" | $SP2NL | $SED "$lo2o" | $NL2SP`
+ for progfile in $progfiles; do
+ func_to_tool_file "$progfile" func_convert_file_msys_to_w32
+ func_verbose "extracting global C symbols from \`$func_to_tool_file_result'"
+ $opt_dry_run || eval "$NM $func_to_tool_file_result | $global_symbol_pipe >> '$nlist'"
+ done
+
+ if test -n "$exclude_expsyms"; then
+ $opt_dry_run || {
+ eval '$EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T'
+ eval '$MV "$nlist"T "$nlist"'
+ }
+ fi
+
+ if test -n "$export_symbols_regex"; then
+ $opt_dry_run || {
+ eval '$EGREP -e "$export_symbols_regex" "$nlist" > "$nlist"T'
+ eval '$MV "$nlist"T "$nlist"'
+ }
+ fi
+
+ # Prepare the list of exported symbols
+ if test -z "$export_symbols"; then
+ export_symbols="$output_objdir/$outputname.exp"
+ $opt_dry_run || {
+ $RM $export_symbols
+ eval "${SED} -n -e '/^: @PROGRAM@ $/d' -e 's/^.* \(.*\)$/\1/p' "'< "$nlist" > "$export_symbols"'
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+ eval 'cat "$export_symbols" >> "$output_objdir/$outputname.def"'
+ ;;
+ esac
+ }
+ else
+ $opt_dry_run || {
+ eval "${SED} -e 's/\([].[*^$]\)/\\\\\1/g' -e 's/^/ /' -e 's/$/$/'"' < "$export_symbols" > "$output_objdir/$outputname.exp"'
+ eval '$GREP -f "$output_objdir/$outputname.exp" < "$nlist" > "$nlist"T'
+ eval '$MV "$nlist"T "$nlist"'
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ eval "echo EXPORTS "'> "$output_objdir/$outputname.def"'
+ eval 'cat "$nlist" >> "$output_objdir/$outputname.def"'
+ ;;
+ esac
+ }
+ fi
+ fi
+
+ for dlprefile in $dlprefiles; do
+ func_verbose "extracting global C symbols from \`$dlprefile'"
+ func_basename "$dlprefile"
+ name="$func_basename_result"
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ # if an import library, we need to obtain dlname
+ if func_win32_import_lib_p "$dlprefile"; then
+ func_tr_sh "$dlprefile"
+ eval "curr_lafile=\$libfile_$func_tr_sh_result"
+ dlprefile_dlbasename=""
+ if test -n "$curr_lafile" && func_lalib_p "$curr_lafile"; then
+ # Use subshell, to avoid clobbering current variable values
+ dlprefile_dlname=`source "$curr_lafile" && echo "$dlname"`
+ if test -n "$dlprefile_dlname" ; then
+ func_basename "$dlprefile_dlname"
+ dlprefile_dlbasename="$func_basename_result"
+ else
+ # no lafile. user explicitly requested -dlpreopen .
+ $sharedlib_from_linklib_cmd "$dlprefile"
+ dlprefile_dlbasename=$sharedlib_from_linklib_result
+ fi
+ fi
+ $opt_dry_run || {
+ if test -n "$dlprefile_dlbasename" ; then
+ eval '$ECHO ": $dlprefile_dlbasename" >> "$nlist"'
+ else
+ func_warning "Could not compute DLL name from $name"
+ eval '$ECHO ": $name " >> "$nlist"'
+ fi
+ func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32
+ eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe |
+ $SED -e '/I __imp/d' -e 's/I __nm_/D /;s/_nm__//' >> '$nlist'"
+ }
+ else # not an import lib
+ $opt_dry_run || {
+ eval '$ECHO ": $name " >> "$nlist"'
+ func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32
+ eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe >> '$nlist'"
+ }
+ fi
+ ;;
+ *)
+ $opt_dry_run || {
+ eval '$ECHO ": $name " >> "$nlist"'
+ func_to_tool_file "$dlprefile" func_convert_file_msys_to_w32
+ eval "$NM \"$func_to_tool_file_result\" 2>/dev/null | $global_symbol_pipe >> '$nlist'"
+ }
+ ;;
+ esac
+ done
+
+ $opt_dry_run || {
+ # Make sure we have at least an empty file.
+ test -f "$nlist" || : > "$nlist"
+
+ if test -n "$exclude_expsyms"; then
+ $EGREP -v " ($exclude_expsyms)$" "$nlist" > "$nlist"T
+ $MV "$nlist"T "$nlist"
+ fi
+
+ # Try sorting and uniquifying the output.
+ if $GREP -v "^: " < "$nlist" |
+ if sort -k 3 /dev/null 2>&1; then
+ sort -k 3
+ else
+ sort +2
+ fi |
+ uniq > "$nlist"S; then
+ :
+ else
+ $GREP -v "^: " < "$nlist" > "$nlist"S
+ fi
+
+ if test -f "$nlist"S; then
+ eval "$global_symbol_to_cdecl"' < "$nlist"S >> "$output_objdir/$my_dlsyms"'
+ else
+ echo '/* NONE */' >> "$output_objdir/$my_dlsyms"
+ fi
+
+ echo >> "$output_objdir/$my_dlsyms" "\
+
+/* The mapping between symbol names and symbols. */
+typedef struct {
+ const char *name;
+ void *address;
+} lt_dlsymlist;
+extern LT_DLSYM_CONST lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[];
+LT_DLSYM_CONST lt_dlsymlist
+lt_${my_prefix}_LTX_preloaded_symbols[] =
+{\
+ { \"$my_originator\", (void *) 0 },"
+
+ case $need_lib_prefix in
+ no)
+ eval "$global_symbol_to_c_name_address" < "$nlist" >> "$output_objdir/$my_dlsyms"
+ ;;
+ *)
+ eval "$global_symbol_to_c_name_address_lib_prefix" < "$nlist" >> "$output_objdir/$my_dlsyms"
+ ;;
+ esac
+ echo >> "$output_objdir/$my_dlsyms" "\
+ {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+ return lt_${my_prefix}_LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif\
+"
+ } # !$opt_dry_run
+
+ pic_flag_for_symtable=
+ case "$compile_command " in
+ *" -static "*) ;;
+ *)
+ case $host in
+ # compiling the symbol table file with pic_flag works around
+ # a FreeBSD bug that causes programs to crash when -lm is
+ # linked before any other PIC object. But we must not use
+ # pic_flag when linking with -static. The problem exists in
+ # FreeBSD 2.2.6 and is fixed in FreeBSD 3.1.
+ *-*-freebsd2.*|*-*-freebsd3.0*|*-*-freebsdelf3.0*)
+ pic_flag_for_symtable=" $pic_flag -DFREEBSD_WORKAROUND" ;;
+ *-*-hpux*)
+ pic_flag_for_symtable=" $pic_flag" ;;
+ *)
+ if test "X$my_pic_p" != Xno; then
+ pic_flag_for_symtable=" $pic_flag"
+ fi
+ ;;
+ esac
+ ;;
+ esac
+ symtab_cflags=
+ for arg in $LTCFLAGS; do
+ case $arg in
+ -pie | -fpie | -fPIE) ;;
+ *) func_append symtab_cflags " $arg" ;;
+ esac
+ done
+
+ # Now compile the dynamic symbol file.
+ func_show_eval '(cd $output_objdir && $LTCC$symtab_cflags -c$no_builtin_flag$pic_flag_for_symtable "$my_dlsyms")' 'exit $?'
+
+ # Clean up the generated files.
+ func_show_eval '$RM "$output_objdir/$my_dlsyms" "$nlist" "${nlist}S" "${nlist}T"'
+
+ # Transform the symbol file into the correct name.
+ symfileobj="$output_objdir/${my_outputname}S.$objext"
+ case $host in
+ *cygwin* | *mingw* | *cegcc* )
+ if test -f "$output_objdir/$my_outputname.def"; then
+ compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+ finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$output_objdir/$my_outputname.def $symfileobj%"`
+ else
+ compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+ finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+ fi
+ ;;
+ *)
+ compile_command=`$ECHO "$compile_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+ finalize_command=`$ECHO "$finalize_command" | $SED "s%@SYMFILE@%$symfileobj%"`
+ ;;
+ esac
+ ;;
+ *)
+ func_fatal_error "unknown suffix for \`$my_dlsyms'"
+ ;;
+ esac
+ else
+ # We keep going just in case the user didn't refer to
+ # lt_preloaded_symbols. The linker will fail if global_symbol_pipe
+ # really was required.
+
+ # Nullify the symbol file.
+ compile_command=`$ECHO "$compile_command" | $SED "s% @SYMFILE@%%"`
+ finalize_command=`$ECHO "$finalize_command" | $SED "s% @SYMFILE@%%"`
+ fi
+}
+
+# func_win32_libid arg
+# return the library type of file 'arg'
+#
+# Need a lot of goo to handle *both* DLLs and import libs
+# Has to be a shell function in order to 'eat' the argument
+# that is supplied when $file_magic_command is called.
+# Despite the name, also deal with 64 bit binaries.
+func_win32_libid ()
+{
+ $opt_debug
+ win32_libid_type="unknown"
+ win32_fileres=`file -L $1 2>/dev/null`
+ case $win32_fileres in
+ *ar\ archive\ import\ library*) # definitely import
+ win32_libid_type="x86 archive import"
+ ;;
+ *ar\ archive*) # could be an import, or static
+ # Keep the egrep pattern in sync with the one in _LT_CHECK_MAGIC_METHOD.
+ if eval $OBJDUMP -f $1 | $SED -e '10q' 2>/dev/null |
+ $EGREP 'file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)' >/dev/null; then
+ func_to_tool_file "$1" func_convert_file_msys_to_w32
+ win32_nmres=`eval $NM -f posix -A \"$func_to_tool_file_result\" |
+ $SED -n -e '
+ 1,100{
+ / I /{
+ s,.*,import,
+ p
+ q
+ }
+ }'`
+ case $win32_nmres in
+ import*) win32_libid_type="x86 archive import";;
+ *) win32_libid_type="x86 archive static";;
+ esac
+ fi
+ ;;
+ *DLL*)
+ win32_libid_type="x86 DLL"
+ ;;
+ *executable*) # but shell scripts are "executable" too...
+ case $win32_fileres in
+ *MS\ Windows\ PE\ Intel*)
+ win32_libid_type="x86 DLL"
+ ;;
+ esac
+ ;;
+ esac
+ $ECHO "$win32_libid_type"
+}
+
+# func_cygming_dll_for_implib ARG
+#
+# Platform-specific function to extract the
+# name of the DLL associated with the specified
+# import library ARG.
+# Invoked by eval'ing the libtool variable
+# $sharedlib_from_linklib_cmd
+# Result is available in the variable
+# $sharedlib_from_linklib_result
+func_cygming_dll_for_implib ()
+{
+ $opt_debug
+ sharedlib_from_linklib_result=`$DLLTOOL --identify-strict --identify "$1"`
+}
+
+# func_cygming_dll_for_implib_fallback_core SECTION_NAME LIBNAMEs
+#
+# The is the core of a fallback implementation of a
+# platform-specific function to extract the name of the
+# DLL associated with the specified import library LIBNAME.
+#
+# SECTION_NAME is either .idata$6 or .idata$7, depending
+# on the platform and compiler that created the implib.
+#
+# Echos the name of the DLL associated with the
+# specified import library.
+func_cygming_dll_for_implib_fallback_core ()
+{
+ $opt_debug
+ match_literal=`$ECHO "$1" | $SED "$sed_make_literal_regex"`
+ $OBJDUMP -s --section "$1" "$2" 2>/dev/null |
+ $SED '/^Contents of section '"$match_literal"':/{
+ # Place marker at beginning of archive member dllname section
+ s/.*/====MARK====/
+ p
+ d
+ }
+ # These lines can sometimes be longer than 43 characters, but
+ # are always uninteresting
+ /:[ ]*file format pe[i]\{,1\}-/d
+ /^In archive [^:]*:/d
+ # Ensure marker is printed
+ /^====MARK====/p
+ # Remove all lines with less than 43 characters
+ /^.\{43\}/!d
+ # From remaining lines, remove first 43 characters
+ s/^.\{43\}//' |
+ $SED -n '
+ # Join marker and all lines until next marker into a single line
+ /^====MARK====/ b para
+ H
+ $ b para
+ b
+ :para
+ x
+ s/\n//g
+ # Remove the marker
+ s/^====MARK====//
+ # Remove trailing dots and whitespace
+ s/[\. \t]*$//
+ # Print
+ /./p' |
+ # we now have a list, one entry per line, of the stringified
+ # contents of the appropriate section of all members of the
+ # archive which possess that section. Heuristic: eliminate
+ # all those which have a first or second character that is
+ # a '.' (that is, objdump's representation of an unprintable
+ # character.) This should work for all archives with less than
+ # 0x302f exports -- but will fail for DLLs whose name actually
+ # begins with a literal '.' or a single character followed by
+ # a '.'.
+ #
+ # Of those that remain, print the first one.
+ $SED -e '/^\./d;/^.\./d;q'
+}
+
+# func_cygming_gnu_implib_p ARG
+# This predicate returns with zero status (TRUE) if
+# ARG is a GNU/binutils-style import library. Returns
+# with nonzero status (FALSE) otherwise.
+func_cygming_gnu_implib_p ()
+{
+ $opt_debug
+ func_to_tool_file "$1" func_convert_file_msys_to_w32
+ func_cygming_gnu_implib_tmp=`$NM "$func_to_tool_file_result" | eval "$global_symbol_pipe" | $EGREP ' (_head_[A-Za-z0-9_]+_[ad]l*|[A-Za-z0-9_]+_[ad]l*_iname)$'`
+ test -n "$func_cygming_gnu_implib_tmp"
+}
+
+# func_cygming_ms_implib_p ARG
+# This predicate returns with zero status (TRUE) if
+# ARG is an MS-style import library. Returns
+# with nonzero status (FALSE) otherwise.
+func_cygming_ms_implib_p ()
+{
+ $opt_debug
+ func_to_tool_file "$1" func_convert_file_msys_to_w32
+ func_cygming_ms_implib_tmp=`$NM "$func_to_tool_file_result" | eval "$global_symbol_pipe" | $GREP '_NULL_IMPORT_DESCRIPTOR'`
+ test -n "$func_cygming_ms_implib_tmp"
+}
+
+# func_cygming_dll_for_implib_fallback ARG
+# Platform-specific function to extract the
+# name of the DLL associated with the specified
+# import library ARG.
+#
+# This fallback implementation is for use when $DLLTOOL
+# does not support the --identify-strict option.
+# Invoked by eval'ing the libtool variable
+# $sharedlib_from_linklib_cmd
+# Result is available in the variable
+# $sharedlib_from_linklib_result
+func_cygming_dll_for_implib_fallback ()
+{
+ $opt_debug
+ if func_cygming_gnu_implib_p "$1" ; then
+ # binutils import library
+ sharedlib_from_linklib_result=`func_cygming_dll_for_implib_fallback_core '.idata$7' "$1"`
+ elif func_cygming_ms_implib_p "$1" ; then
+ # ms-generated import library
+ sharedlib_from_linklib_result=`func_cygming_dll_for_implib_fallback_core '.idata$6' "$1"`
+ else
+ # unknown
+ sharedlib_from_linklib_result=""
+ fi
+}
+
+
+# func_extract_an_archive dir oldlib
+func_extract_an_archive ()
+{
+ $opt_debug
+ f_ex_an_ar_dir="$1"; shift
+ f_ex_an_ar_oldlib="$1"
+ if test "$lock_old_archive_extraction" = yes; then
+ lockfile=$f_ex_an_ar_oldlib.lock
+ until $opt_dry_run || ln "$progpath" "$lockfile" 2>/dev/null; do
+ func_echo "Waiting for $lockfile to be removed"
+ sleep 2
+ done
+ fi
+ func_show_eval "(cd \$f_ex_an_ar_dir && $AR x \"\$f_ex_an_ar_oldlib\")" \
+ 'stat=$?; rm -f "$lockfile"; exit $stat'
+ if test "$lock_old_archive_extraction" = yes; then
+ $opt_dry_run || rm -f "$lockfile"
+ fi
+ if ($AR t "$f_ex_an_ar_oldlib" | sort | sort -uc >/dev/null 2>&1); then
+ :
+ else
+ func_fatal_error "object name conflicts in archive: $f_ex_an_ar_dir/$f_ex_an_ar_oldlib"
+ fi
+}
+
+
+# func_extract_archives gentop oldlib ...
+func_extract_archives ()
+{
+ $opt_debug
+ my_gentop="$1"; shift
+ my_oldlibs=${1+"$@"}
+ my_oldobjs=""
+ my_xlib=""
+ my_xabs=""
+ my_xdir=""
+
+ for my_xlib in $my_oldlibs; do
+ # Extract the objects.
+ case $my_xlib in
+ [\\/]* | [A-Za-z]:[\\/]*) my_xabs="$my_xlib" ;;
+ *) my_xabs=`pwd`"/$my_xlib" ;;
+ esac
+ func_basename "$my_xlib"
+ my_xlib="$func_basename_result"
+ my_xlib_u=$my_xlib
+ while :; do
+ case " $extracted_archives " in
+ *" $my_xlib_u "*)
+ func_arith $extracted_serial + 1
+ extracted_serial=$func_arith_result
+ my_xlib_u=lt$extracted_serial-$my_xlib ;;
+ *) break ;;
+ esac
+ done
+ extracted_archives="$extracted_archives $my_xlib_u"
+ my_xdir="$my_gentop/$my_xlib_u"
+
+ func_mkdir_p "$my_xdir"
+
+ case $host in
+ *-darwin*)
+ func_verbose "Extracting $my_xabs"
+ # Do not bother doing anything if just a dry run
+ $opt_dry_run || {
+ darwin_orig_dir=`pwd`
+ cd $my_xdir || exit $?
+ darwin_archive=$my_xabs
+ darwin_curdir=`pwd`
+ darwin_base_archive=`basename "$darwin_archive"`
+ darwin_arches=`$LIPO -info "$darwin_archive" 2>/dev/null | $GREP Architectures 2>/dev/null || true`
+ if test -n "$darwin_arches"; then
+ darwin_arches=`$ECHO "$darwin_arches" | $SED -e 's/.*are://'`
+ darwin_arch=
+ func_verbose "$darwin_base_archive has multiple architectures $darwin_arches"
+ for darwin_arch in $darwin_arches ; do
+ func_mkdir_p "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+ $LIPO -thin $darwin_arch -output "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}" "${darwin_archive}"
+ cd "unfat-$$/${darwin_base_archive}-${darwin_arch}"
+ func_extract_an_archive "`pwd`" "${darwin_base_archive}"
+ cd "$darwin_curdir"
+ $RM "unfat-$$/${darwin_base_archive}-${darwin_arch}/${darwin_base_archive}"
+ done # $darwin_arches
+ ## Okay now we've a bunch of thin objects, gotta fatten them up :)
+ darwin_filelist=`find unfat-$$ -type f -name \*.o -print -o -name \*.lo -print | $SED -e "$basename" | sort -u`
+ darwin_file=
+ darwin_files=
+ for darwin_file in $darwin_filelist; do
+ darwin_files=`find unfat-$$ -name $darwin_file -print | sort | $NL2SP`
+ $LIPO -create -output "$darwin_file" $darwin_files
+ done # $darwin_filelist
+ $RM -rf unfat-$$
+ cd "$darwin_orig_dir"
+ else
+ cd $darwin_orig_dir
+ func_extract_an_archive "$my_xdir" "$my_xabs"
+ fi # $darwin_arches
+ } # !$opt_dry_run
+ ;;
+ *)
+ func_extract_an_archive "$my_xdir" "$my_xabs"
+ ;;
+ esac
+ my_oldobjs="$my_oldobjs "`find $my_xdir -name \*.$objext -print -o -name \*.lo -print | sort | $NL2SP`
+ done
+
+ func_extract_archives_result="$my_oldobjs"
+}
+
+
+# func_emit_wrapper [arg=no]
+#
+# Emit a libtool wrapper script on stdout.
+# Don't directly open a file because we may want to
+# incorporate the script contents within a cygwin/mingw
+# wrapper executable. Must ONLY be called from within
+# func_mode_link because it depends on a number of variables
+# set therein.
+#
+# ARG is the value that the WRAPPER_SCRIPT_BELONGS_IN_OBJDIR
+# variable will take. If 'yes', then the emitted script
+# will assume that the directory in which it is stored is
+# the $objdir directory. This is a cygwin/mingw-specific
+# behavior.
+func_emit_wrapper ()
+{
+ func_emit_wrapper_arg1=${1-no}
+
+ $ECHO "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$outputname
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of the build directory.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting. It backslashifies
+# metacharacters that are still active within double-quoted strings.
+sed_quote_subst='$sed_quote_subst'
+
+# Be Bourne compatible
+if test -n \"\${ZSH_VERSION+set}\" && (emulate sh) >/dev/null 2>&1; then
+ emulate sh
+ NULLCMD=:
+ # Zsh 3.x and 4.x performs word splitting on \${1+\"\$@\"}, which
+ # is contrary to our usage. Disable this feature.
+ alias -g '\${1+\"\$@\"}'='\"\$@\"'
+ setopt NO_GLOB_SUBST
+else
+ case \`(set -o) 2>/dev/null\` in *posix*) set -o posix;; esac
+fi
+BIN_SH=xpg4; export BIN_SH # for Tru64
+DUALCASE=1; export DUALCASE # for MKS sh
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+relink_command=\"$relink_command\"
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+ # install mode needs the following variables:
+ generated_by_libtool_version='$macro_version'
+ notinst_deplibs='$notinst_deplibs'
+else
+ # When we are sourced in execute mode, \$file and \$ECHO are already set.
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ file=\"\$0\""
+
+ qECHO=`$ECHO "$ECHO" | $SED "$sed_quote_subst"`
+ $ECHO "\
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+\$1
+_LTECHO_EOF'
+}
+ ECHO=\"$qECHO\"
+ fi
+
+# Very basic option parsing. These options are (a) specific to
+# the libtool wrapper, (b) are identical between the wrapper
+# /script/ and the wrapper /executable/ which is used only on
+# windows platforms, and (c) all begin with the string "--lt-"
+# (application programs are unlikely to have options which match
+# this pattern).
+#
+# There are only two supported options: --lt-debug and
+# --lt-dump-script. There is, deliberately, no --lt-help.
+#
+# The first argument to this parsing function should be the
+# script's $0 value, followed by "$@".
+lt_option_debug=
+func_parse_lt_options ()
+{
+ lt_script_arg0=\$0
+ shift
+ for lt_opt
+ do
+ case \"\$lt_opt\" in
+ --lt-debug) lt_option_debug=1 ;;
+ --lt-dump-script)
+ lt_dump_D=\`\$ECHO \"X\$lt_script_arg0\" | $SED -e 's/^X//' -e 's%/[^/]*$%%'\`
+ test \"X\$lt_dump_D\" = \"X\$lt_script_arg0\" && lt_dump_D=.
+ lt_dump_F=\`\$ECHO \"X\$lt_script_arg0\" | $SED -e 's/^X//' -e 's%^.*/%%'\`
+ cat \"\$lt_dump_D/\$lt_dump_F\"
+ exit 0
+ ;;
+ --lt-*)
+ \$ECHO \"Unrecognized --lt- option: '\$lt_opt'\" 1>&2
+ exit 1
+ ;;
+ esac
+ done
+
+ # Print the debug banner immediately:
+ if test -n \"\$lt_option_debug\"; then
+ echo \"${outputname}:${output}:\${LINENO}: libtool wrapper (GNU $PACKAGE$TIMESTAMP) $VERSION\" 1>&2
+ fi
+}
+
+# Used when --lt-debug. Prints its arguments to stdout
+# (redirection is the responsibility of the caller)
+func_lt_dump_args ()
+{
+ lt_dump_args_N=1;
+ for lt_arg
+ do
+ \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[\$lt_dump_args_N]: \$lt_arg\"
+ lt_dump_args_N=\`expr \$lt_dump_args_N + 1\`
+ done
+}
+
+# Core function for launching the target application
+func_exec_program_core ()
+{
+"
+ case $host in
+ # Backslashes separate directories on plain windows
+ *-*-mingw | *-*-os2* | *-cegcc*)
+ $ECHO "\
+ if test -n \"\$lt_option_debug\"; then
+ \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[0]: \$progdir\\\\\$program\" 1>&2
+ func_lt_dump_args \${1+\"\$@\"} 1>&2
+ fi
+ exec \"\$progdir\\\\\$program\" \${1+\"\$@\"}
+"
+ ;;
+
+ *)
+ $ECHO "\
+ if test -n \"\$lt_option_debug\"; then
+ \$ECHO \"${outputname}:${output}:\${LINENO}: newargv[0]: \$progdir/\$program\" 1>&2
+ func_lt_dump_args \${1+\"\$@\"} 1>&2
+ fi
+ exec \"\$progdir/\$program\" \${1+\"\$@\"}
+"
+ ;;
+ esac
+ $ECHO "\
+ \$ECHO \"\$0: cannot exec \$program \$*\" 1>&2
+ exit 1
+}
+
+# A function to encapsulate launching the target application
+# Strips options in the --lt-* namespace from \$@ and
+# launches target application with the remaining arguments.
+func_exec_program ()
+{
+ case \" \$* \" in
+ *\\ --lt-*)
+ for lt_wr_arg
+ do
+ case \$lt_wr_arg in
+ --lt-*) ;;
+ *) set x \"\$@\" \"\$lt_wr_arg\"; shift;;
+ esac
+ shift
+ done ;;
+ esac
+ func_exec_program_core \${1+\"\$@\"}
+}
+
+ # Parse options
+ func_parse_lt_options \"\$0\" \${1+\"\$@\"}
+
+ # Find the directory that this script lives in.
+ thisdir=\`\$ECHO \"\$file\" | $SED 's%/[^/]*$%%'\`
+ test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+ # Follow symbolic links until we get to the real thisdir.
+ file=\`ls -ld \"\$file\" | $SED -n 's/.*-> //p'\`
+ while test -n \"\$file\"; do
+ destdir=\`\$ECHO \"\$file\" | $SED 's%/[^/]*\$%%'\`
+
+ # If there was a directory component, then change thisdir.
+ if test \"x\$destdir\" != \"x\$file\"; then
+ case \"\$destdir\" in
+ [\\\\/]* | [A-Za-z]:[\\\\/]*) thisdir=\"\$destdir\" ;;
+ *) thisdir=\"\$thisdir/\$destdir\" ;;
+ esac
+ fi
+
+ file=\`\$ECHO \"\$file\" | $SED 's%^.*/%%'\`
+ file=\`ls -ld \"\$thisdir/\$file\" | $SED -n 's/.*-> //p'\`
+ done
+
+ # Usually 'no', except on cygwin/mingw when embedded into
+ # the cwrapper.
+ WRAPPER_SCRIPT_BELONGS_IN_OBJDIR=$func_emit_wrapper_arg1
+ if test \"\$WRAPPER_SCRIPT_BELONGS_IN_OBJDIR\" = \"yes\"; then
+ # special case for '.'
+ if test \"\$thisdir\" = \".\"; then
+ thisdir=\`pwd\`
+ fi
+ # remove .libs from thisdir
+ case \"\$thisdir\" in
+ *[\\\\/]$objdir ) thisdir=\`\$ECHO \"\$thisdir\" | $SED 's%[\\\\/][^\\\\/]*$%%'\` ;;
+ $objdir ) thisdir=. ;;
+ esac
+ fi
+
+ # Try to get the absolute directory name.
+ absdir=\`cd \"\$thisdir\" && pwd\`
+ test -n \"\$absdir\" && thisdir=\"\$absdir\"
+"
+
+ if test "$fast_install" = yes; then
+ $ECHO "\
+ program=lt-'$outputname'$exeext
+ progdir=\"\$thisdir/$objdir\"
+
+ if test ! -f \"\$progdir/\$program\" ||
+ { file=\`ls -1dt \"\$progdir/\$program\" \"\$progdir/../\$program\" 2>/dev/null | ${SED} 1q\`; \\
+ test \"X\$file\" != \"X\$progdir/\$program\"; }; then
+
+ file=\"\$\$-\$program\"
+
+ if test ! -d \"\$progdir\"; then
+ $MKDIR \"\$progdir\"
+ else
+ $RM \"\$progdir/\$file\"
+ fi"
+
+ $ECHO "\
+
+ # relink executable if necessary
+ if test -n \"\$relink_command\"; then
+ if relink_command_output=\`eval \$relink_command 2>&1\`; then :
+ else
+ $ECHO \"\$relink_command_output\" >&2
+ $RM \"\$progdir/\$file\"
+ exit 1
+ fi
+ fi
+
+ $MV \"\$progdir/\$file\" \"\$progdir/\$program\" 2>/dev/null ||
+ { $RM \"\$progdir/\$program\";
+ $MV \"\$progdir/\$file\" \"\$progdir/\$program\"; }
+ $RM \"\$progdir/\$file\"
+ fi"
+ else
+ $ECHO "\
+ program='$outputname'
+ progdir=\"\$thisdir/$objdir\"
+"
+ fi
+
+ $ECHO "\
+
+ if test -f \"\$progdir/\$program\"; then"
+
+ # fixup the dll searchpath if we need to.
+ #
+ # Fix the DLL searchpath if we need to. Do this before prepending
+ # to shlibpath, because on Windows, both are PATH and uninstalled
+ # libraries must come first.
+ if test -n "$dllsearchpath"; then
+ $ECHO "\
+ # Add the dll search path components to the executable PATH
+ PATH=$dllsearchpath:\$PATH
+"
+ fi
+
+ # Export our shlibpath_var if we have one.
+ if test "$shlibpath_overrides_runpath" = yes && test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+ $ECHO "\
+ # Add our own library path to $shlibpath_var
+ $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+ # Some systems cannot cope with colon-terminated $shlibpath_var
+ # The second colon is a workaround for a bug in BeOS R4 sed
+ $shlibpath_var=\`\$ECHO \"\$$shlibpath_var\" | $SED 's/::*\$//'\`
+
+ export $shlibpath_var
+"
+ fi
+
+ $ECHO "\
+ if test \"\$libtool_execute_magic\" != \"$magic\"; then
+ # Run the actual program with our arguments.
+ func_exec_program \${1+\"\$@\"}
+ fi
+ else
+ # The program doesn't exist.
+ \$ECHO \"\$0: error: \\\`\$progdir/\$program' does not exist\" 1>&2
+ \$ECHO \"This script is just a wrapper for \$program.\" 1>&2
+ \$ECHO \"See the $PACKAGE documentation for more information.\" 1>&2
+ exit 1
+ fi
+fi\
+"
+}
+
+
+# func_emit_cwrapperexe_src
+# emit the source code for a wrapper executable on stdout
+# Must ONLY be called from within func_mode_link because
+# it depends on a number of variable set therein.
+func_emit_cwrapperexe_src ()
+{
+ cat <
+#include
+#ifdef _MSC_VER
+# include
+# include
+# include
+#else
+# include
+# include
+# ifdef __CYGWIN__
+# include
+# endif
+#endif
+#include
+#include
+#include
+#include
+#include
+#include
+#include
+#include
+
+/* declarations of non-ANSI functions */
+#if defined(__MINGW32__)
+# ifdef __STRICT_ANSI__
+int _putenv (const char *);
+# endif
+#elif defined(__CYGWIN__)
+# ifdef __STRICT_ANSI__
+char *realpath (const char *, char *);
+int putenv (char *);
+int setenv (const char *, const char *, int);
+# endif
+/* #elif defined (other platforms) ... */
+#endif
+
+/* portability defines, excluding path handling macros */
+#if defined(_MSC_VER)
+# define setmode _setmode
+# define stat _stat
+# define chmod _chmod
+# define getcwd _getcwd
+# define putenv _putenv
+# define S_IXUSR _S_IEXEC
+# ifndef _INTPTR_T_DEFINED
+# define _INTPTR_T_DEFINED
+# define intptr_t int
+# endif
+#elif defined(__MINGW32__)
+# define setmode _setmode
+# define stat _stat
+# define chmod _chmod
+# define getcwd _getcwd
+# define putenv _putenv
+#elif defined(__CYGWIN__)
+# define HAVE_SETENV
+# define FOPEN_WB "wb"
+/* #elif defined (other platforms) ... */
+#endif
+
+#if defined(PATH_MAX)
+# define LT_PATHMAX PATH_MAX
+#elif defined(MAXPATHLEN)
+# define LT_PATHMAX MAXPATHLEN
+#else
+# define LT_PATHMAX 1024
+#endif
+
+#ifndef S_IXOTH
+# define S_IXOTH 0
+#endif
+#ifndef S_IXGRP
+# define S_IXGRP 0
+#endif
+
+/* path handling portability macros */
+#ifndef DIR_SEPARATOR
+# define DIR_SEPARATOR '/'
+# define PATH_SEPARATOR ':'
+#endif
+
+#if defined (_WIN32) || defined (__MSDOS__) || defined (__DJGPP__) || \
+ defined (__OS2__)
+# define HAVE_DOS_BASED_FILE_SYSTEM
+# define FOPEN_WB "wb"
+# ifndef DIR_SEPARATOR_2
+# define DIR_SEPARATOR_2 '\\'
+# endif
+# ifndef PATH_SEPARATOR_2
+# define PATH_SEPARATOR_2 ';'
+# endif
+#endif
+
+#ifndef DIR_SEPARATOR_2
+# define IS_DIR_SEPARATOR(ch) ((ch) == DIR_SEPARATOR)
+#else /* DIR_SEPARATOR_2 */
+# define IS_DIR_SEPARATOR(ch) \
+ (((ch) == DIR_SEPARATOR) || ((ch) == DIR_SEPARATOR_2))
+#endif /* DIR_SEPARATOR_2 */
+
+#ifndef PATH_SEPARATOR_2
+# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR)
+#else /* PATH_SEPARATOR_2 */
+# define IS_PATH_SEPARATOR(ch) ((ch) == PATH_SEPARATOR_2)
+#endif /* PATH_SEPARATOR_2 */
+
+#ifndef FOPEN_WB
+# define FOPEN_WB "w"
+#endif
+#ifndef _O_BINARY
+# define _O_BINARY 0
+#endif
+
+#define XMALLOC(type, num) ((type *) xmalloc ((num) * sizeof(type)))
+#define XFREE(stale) do { \
+ if (stale) { free ((void *) stale); stale = 0; } \
+} while (0)
+
+#if defined(LT_DEBUGWRAPPER)
+static int lt_debug = 1;
+#else
+static int lt_debug = 0;
+#endif
+
+const char *program_name = "libtool-wrapper"; /* in case xstrdup fails */
+
+void *xmalloc (size_t num);
+char *xstrdup (const char *string);
+const char *base_name (const char *name);
+char *find_executable (const char *wrapper);
+char *chase_symlinks (const char *pathspec);
+int make_executable (const char *path);
+int check_executable (const char *path);
+char *strendzap (char *str, const char *pat);
+void lt_debugprintf (const char *file, int line, const char *fmt, ...);
+void lt_fatal (const char *file, int line, const char *message, ...);
+static const char *nonnull (const char *s);
+static const char *nonempty (const char *s);
+void lt_setenv (const char *name, const char *value);
+char *lt_extend_str (const char *orig_value, const char *add, int to_end);
+void lt_update_exe_path (const char *name, const char *value);
+void lt_update_lib_path (const char *name, const char *value);
+char **prepare_spawn (char **argv);
+void lt_dump_script (FILE *f);
+EOF
+
+ cat <= 0)
+ && (st.st_mode & (S_IXUSR | S_IXGRP | S_IXOTH)))
+ return 1;
+ else
+ return 0;
+}
+
+int
+make_executable (const char *path)
+{
+ int rval = 0;
+ struct stat st;
+
+ lt_debugprintf (__FILE__, __LINE__, "(make_executable): %s\n",
+ nonempty (path));
+ if ((!path) || (!*path))
+ return 0;
+
+ if (stat (path, &st) >= 0)
+ {
+ rval = chmod (path, st.st_mode | S_IXOTH | S_IXGRP | S_IXUSR);
+ }
+ return rval;
+}
+
+/* Searches for the full path of the wrapper. Returns
+ newly allocated full path name if found, NULL otherwise
+ Does not chase symlinks, even on platforms that support them.
+*/
+char *
+find_executable (const char *wrapper)
+{
+ int has_slash = 0;
+ const char *p;
+ const char *p_next;
+ /* static buffer for getcwd */
+ char tmp[LT_PATHMAX + 1];
+ int tmp_len;
+ char *concat_name;
+
+ lt_debugprintf (__FILE__, __LINE__, "(find_executable): %s\n",
+ nonempty (wrapper));
+
+ if ((wrapper == NULL) || (*wrapper == '\0'))
+ return NULL;
+
+ /* Absolute path? */
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+ if (isalpha ((unsigned char) wrapper[0]) && wrapper[1] == ':')
+ {
+ concat_name = xstrdup (wrapper);
+ if (check_executable (concat_name))
+ return concat_name;
+ XFREE (concat_name);
+ }
+ else
+ {
+#endif
+ if (IS_DIR_SEPARATOR (wrapper[0]))
+ {
+ concat_name = xstrdup (wrapper);
+ if (check_executable (concat_name))
+ return concat_name;
+ XFREE (concat_name);
+ }
+#if defined (HAVE_DOS_BASED_FILE_SYSTEM)
+ }
+#endif
+
+ for (p = wrapper; *p; p++)
+ if (*p == '/')
+ {
+ has_slash = 1;
+ break;
+ }
+ if (!has_slash)
+ {
+ /* no slashes; search PATH */
+ const char *path = getenv ("PATH");
+ if (path != NULL)
+ {
+ for (p = path; *p; p = p_next)
+ {
+ const char *q;
+ size_t p_len;
+ for (q = p; *q; q++)
+ if (IS_PATH_SEPARATOR (*q))
+ break;
+ p_len = q - p;
+ p_next = (*q == '\0' ? q : q + 1);
+ if (p_len == 0)
+ {
+ /* empty path: current directory */
+ if (getcwd (tmp, LT_PATHMAX) == NULL)
+ lt_fatal (__FILE__, __LINE__, "getcwd failed: %s",
+ nonnull (strerror (errno)));
+ tmp_len = strlen (tmp);
+ concat_name =
+ XMALLOC (char, tmp_len + 1 + strlen (wrapper) + 1);
+ memcpy (concat_name, tmp, tmp_len);
+ concat_name[tmp_len] = '/';
+ strcpy (concat_name + tmp_len + 1, wrapper);
+ }
+ else
+ {
+ concat_name =
+ XMALLOC (char, p_len + 1 + strlen (wrapper) + 1);
+ memcpy (concat_name, p, p_len);
+ concat_name[p_len] = '/';
+ strcpy (concat_name + p_len + 1, wrapper);
+ }
+ if (check_executable (concat_name))
+ return concat_name;
+ XFREE (concat_name);
+ }
+ }
+ /* not found in PATH; assume curdir */
+ }
+ /* Relative path | not found in path: prepend cwd */
+ if (getcwd (tmp, LT_PATHMAX) == NULL)
+ lt_fatal (__FILE__, __LINE__, "getcwd failed: %s",
+ nonnull (strerror (errno)));
+ tmp_len = strlen (tmp);
+ concat_name = XMALLOC (char, tmp_len + 1 + strlen (wrapper) + 1);
+ memcpy (concat_name, tmp, tmp_len);
+ concat_name[tmp_len] = '/';
+ strcpy (concat_name + tmp_len + 1, wrapper);
+
+ if (check_executable (concat_name))
+ return concat_name;
+ XFREE (concat_name);
+ return NULL;
+}
+
+char *
+chase_symlinks (const char *pathspec)
+{
+#ifndef S_ISLNK
+ return xstrdup (pathspec);
+#else
+ char buf[LT_PATHMAX];
+ struct stat s;
+ char *tmp_pathspec = xstrdup (pathspec);
+ char *p;
+ int has_symlinks = 0;
+ while (strlen (tmp_pathspec) && !has_symlinks)
+ {
+ lt_debugprintf (__FILE__, __LINE__,
+ "checking path component for symlinks: %s\n",
+ tmp_pathspec);
+ if (lstat (tmp_pathspec, &s) == 0)
+ {
+ if (S_ISLNK (s.st_mode) != 0)
+ {
+ has_symlinks = 1;
+ break;
+ }
+
+ /* search backwards for last DIR_SEPARATOR */
+ p = tmp_pathspec + strlen (tmp_pathspec) - 1;
+ while ((p > tmp_pathspec) && (!IS_DIR_SEPARATOR (*p)))
+ p--;
+ if ((p == tmp_pathspec) && (!IS_DIR_SEPARATOR (*p)))
+ {
+ /* no more DIR_SEPARATORS left */
+ break;
+ }
+ *p = '\0';
+ }
+ else
+ {
+ lt_fatal (__FILE__, __LINE__,
+ "error accessing file \"%s\": %s",
+ tmp_pathspec, nonnull (strerror (errno)));
+ }
+ }
+ XFREE (tmp_pathspec);
+
+ if (!has_symlinks)
+ {
+ return xstrdup (pathspec);
+ }
+
+ tmp_pathspec = realpath (pathspec, buf);
+ if (tmp_pathspec == 0)
+ {
+ lt_fatal (__FILE__, __LINE__,
+ "could not follow symlinks for %s", pathspec);
+ }
+ return xstrdup (tmp_pathspec);
+#endif
+}
+
+char *
+strendzap (char *str, const char *pat)
+{
+ size_t len, patlen;
+
+ assert (str != NULL);
+ assert (pat != NULL);
+
+ len = strlen (str);
+ patlen = strlen (pat);
+
+ if (patlen <= len)
+ {
+ str += len - patlen;
+ if (strcmp (str, pat) == 0)
+ *str = '\0';
+ }
+ return str;
+}
+
+void
+lt_debugprintf (const char *file, int line, const char *fmt, ...)
+{
+ va_list args;
+ if (lt_debug)
+ {
+ (void) fprintf (stderr, "%s:%s:%d: ", program_name, file, line);
+ va_start (args, fmt);
+ (void) vfprintf (stderr, fmt, args);
+ va_end (args);
+ }
+}
+
+static void
+lt_error_core (int exit_status, const char *file,
+ int line, const char *mode,
+ const char *message, va_list ap)
+{
+ fprintf (stderr, "%s:%s:%d: %s: ", program_name, file, line, mode);
+ vfprintf (stderr, message, ap);
+ fprintf (stderr, ".\n");
+
+ if (exit_status >= 0)
+ exit (exit_status);
+}
+
+void
+lt_fatal (const char *file, int line, const char *message, ...)
+{
+ va_list ap;
+ va_start (ap, message);
+ lt_error_core (EXIT_FAILURE, file, line, "FATAL", message, ap);
+ va_end (ap);
+}
+
+static const char *
+nonnull (const char *s)
+{
+ return s ? s : "(null)";
+}
+
+static const char *
+nonempty (const char *s)
+{
+ return (s && !*s) ? "(empty)" : nonnull (s);
+}
+
+void
+lt_setenv (const char *name, const char *value)
+{
+ lt_debugprintf (__FILE__, __LINE__,
+ "(lt_setenv) setting '%s' to '%s'\n",
+ nonnull (name), nonnull (value));
+ {
+#ifdef HAVE_SETENV
+ /* always make a copy, for consistency with !HAVE_SETENV */
+ char *str = xstrdup (value);
+ setenv (name, str, 1);
+#else
+ int len = strlen (name) + 1 + strlen (value) + 1;
+ char *str = XMALLOC (char, len);
+ sprintf (str, "%s=%s", name, value);
+ if (putenv (str) != EXIT_SUCCESS)
+ {
+ XFREE (str);
+ }
+#endif
+ }
+}
+
+char *
+lt_extend_str (const char *orig_value, const char *add, int to_end)
+{
+ char *new_value;
+ if (orig_value && *orig_value)
+ {
+ int orig_value_len = strlen (orig_value);
+ int add_len = strlen (add);
+ new_value = XMALLOC (char, add_len + orig_value_len + 1);
+ if (to_end)
+ {
+ strcpy (new_value, orig_value);
+ strcpy (new_value + orig_value_len, add);
+ }
+ else
+ {
+ strcpy (new_value, add);
+ strcpy (new_value + add_len, orig_value);
+ }
+ }
+ else
+ {
+ new_value = xstrdup (add);
+ }
+ return new_value;
+}
+
+void
+lt_update_exe_path (const char *name, const char *value)
+{
+ lt_debugprintf (__FILE__, __LINE__,
+ "(lt_update_exe_path) modifying '%s' by prepending '%s'\n",
+ nonnull (name), nonnull (value));
+
+ if (name && *name && value && *value)
+ {
+ char *new_value = lt_extend_str (getenv (name), value, 0);
+ /* some systems can't cope with a ':'-terminated path #' */
+ int len = strlen (new_value);
+ while (((len = strlen (new_value)) > 0) && IS_PATH_SEPARATOR (new_value[len-1]))
+ {
+ new_value[len-1] = '\0';
+ }
+ lt_setenv (name, new_value);
+ XFREE (new_value);
+ }
+}
+
+void
+lt_update_lib_path (const char *name, const char *value)
+{
+ lt_debugprintf (__FILE__, __LINE__,
+ "(lt_update_lib_path) modifying '%s' by prepending '%s'\n",
+ nonnull (name), nonnull (value));
+
+ if (name && *name && value && *value)
+ {
+ char *new_value = lt_extend_str (getenv (name), value, 0);
+ lt_setenv (name, new_value);
+ XFREE (new_value);
+ }
+}
+
+EOF
+ case $host_os in
+ mingw*)
+ cat <<"EOF"
+
+/* Prepares an argument vector before calling spawn().
+ Note that spawn() does not by itself call the command interpreter
+ (getenv ("COMSPEC") != NULL ? getenv ("COMSPEC") :
+ ({ OSVERSIONINFO v; v.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
+ GetVersionEx(&v);
+ v.dwPlatformId == VER_PLATFORM_WIN32_NT;
+ }) ? "cmd.exe" : "command.com").
+ Instead it simply concatenates the arguments, separated by ' ', and calls
+ CreateProcess(). We must quote the arguments since Win32 CreateProcess()
+ interprets characters like ' ', '\t', '\\', '"' (but not '<' and '>') in a
+ special way:
+ - Space and tab are interpreted as delimiters. They are not treated as
+ delimiters if they are surrounded by double quotes: "...".
+ - Unescaped double quotes are removed from the input. Their only effect is
+ that within double quotes, space and tab are treated like normal
+ characters.
+ - Backslashes not followed by double quotes are not special.
+ - But 2*n+1 backslashes followed by a double quote become
+ n backslashes followed by a double quote (n >= 0):
+ \" -> "
+ \\\" -> \"
+ \\\\\" -> \\"
+ */
+#define SHELL_SPECIAL_CHARS "\"\\ \001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037"
+#define SHELL_SPACE_CHARS " \001\002\003\004\005\006\007\010\011\012\013\014\015\016\017\020\021\022\023\024\025\026\027\030\031\032\033\034\035\036\037"
+char **
+prepare_spawn (char **argv)
+{
+ size_t argc;
+ char **new_argv;
+ size_t i;
+
+ /* Count number of arguments. */
+ for (argc = 0; argv[argc] != NULL; argc++)
+ ;
+
+ /* Allocate new argument vector. */
+ new_argv = XMALLOC (char *, argc + 1);
+
+ /* Put quoted arguments into the new argument vector. */
+ for (i = 0; i < argc; i++)
+ {
+ const char *string = argv[i];
+
+ if (string[0] == '\0')
+ new_argv[i] = xstrdup ("\"\"");
+ else if (strpbrk (string, SHELL_SPECIAL_CHARS) != NULL)
+ {
+ int quote_around = (strpbrk (string, SHELL_SPACE_CHARS) != NULL);
+ size_t length;
+ unsigned int backslashes;
+ const char *s;
+ char *quoted_string;
+ char *p;
+
+ length = 0;
+ backslashes = 0;
+ if (quote_around)
+ length++;
+ for (s = string; *s != '\0'; s++)
+ {
+ char c = *s;
+ if (c == '"')
+ length += backslashes + 1;
+ length++;
+ if (c == '\\')
+ backslashes++;
+ else
+ backslashes = 0;
+ }
+ if (quote_around)
+ length += backslashes + 1;
+
+ quoted_string = XMALLOC (char, length + 1);
+
+ p = quoted_string;
+ backslashes = 0;
+ if (quote_around)
+ *p++ = '"';
+ for (s = string; *s != '\0'; s++)
+ {
+ char c = *s;
+ if (c == '"')
+ {
+ unsigned int j;
+ for (j = backslashes + 1; j > 0; j--)
+ *p++ = '\\';
+ }
+ *p++ = c;
+ if (c == '\\')
+ backslashes++;
+ else
+ backslashes = 0;
+ }
+ if (quote_around)
+ {
+ unsigned int j;
+ for (j = backslashes; j > 0; j--)
+ *p++ = '\\';
+ *p++ = '"';
+ }
+ *p = '\0';
+
+ new_argv[i] = quoted_string;
+ }
+ else
+ new_argv[i] = (char *) string;
+ }
+ new_argv[argc] = NULL;
+
+ return new_argv;
+}
+EOF
+ ;;
+ esac
+
+ cat <<"EOF"
+void lt_dump_script (FILE* f)
+{
+EOF
+ func_emit_wrapper yes |
+ $SED -n -e '
+s/^\(.\{79\}\)\(..*\)/\1\
+\2/
+h
+s/\([\\"]\)/\\\1/g
+s/$/\\n/
+s/\([^\n]*\).*/ fputs ("\1", f);/p
+g
+D'
+ cat <<"EOF"
+}
+EOF
+}
+# end: func_emit_cwrapperexe_src
+
+# func_win32_import_lib_p ARG
+# True if ARG is an import lib, as indicated by $file_magic_cmd
+func_win32_import_lib_p ()
+{
+ $opt_debug
+ case `eval $file_magic_cmd \"\$1\" 2>/dev/null | $SED -e 10q` in
+ *import*) : ;;
+ *) false ;;
+ esac
+}
+
+# func_mode_link arg...
+func_mode_link ()
+{
+ $opt_debug
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*)
+ # It is impossible to link a dll without this setting, and
+ # we shouldn't force the makefile maintainer to figure out
+ # which system we are compiling for in order to pass an extra
+ # flag for every libtool invocation.
+ # allow_undefined=no
+
+ # FIXME: Unfortunately, there are problems with the above when trying
+ # to make a dll which has undefined symbols, in which case not
+ # even a static library is built. For now, we need to specify
+ # -no-undefined on the libtool link line when we can be certain
+ # that all symbols are satisfied, otherwise we get a static library.
+ allow_undefined=yes
+ ;;
+ *)
+ allow_undefined=yes
+ ;;
+ esac
+ libtool_args=$nonopt
+ base_compile="$nonopt $@"
+ compile_command=$nonopt
+ finalize_command=$nonopt
+
+ compile_rpath=
+ finalize_rpath=
+ compile_shlibpath=
+ finalize_shlibpath=
+ convenience=
+ old_convenience=
+ deplibs=
+ old_deplibs=
+ compiler_flags=
+ linker_flags=
+ dllsearchpath=
+ lib_search_path=`pwd`
+ inst_prefix_dir=
+ new_inherited_linker_flags=
+
+ avoid_version=no
+ bindir=
+ dlfiles=
+ dlprefiles=
+ dlself=no
+ export_dynamic=no
+ export_symbols=
+ export_symbols_regex=
+ generated=
+ libobjs=
+ ltlibs=
+ module=no
+ no_install=no
+ objs=
+ non_pic_objects=
+ precious_files_regex=
+ prefer_static_libs=no
+ preload=no
+ prev=
+ prevarg=
+ release=
+ rpath=
+ xrpath=
+ perm_rpath=
+ temp_rpath=
+ thread_safe=no
+ vinfo=
+ vinfo_number=no
+ weak_libs=
+ single_module="${wl}-single_module"
+ func_infer_tag $base_compile
+
+ # We need to know -static, to get the right output filenames.
+ for arg
+ do
+ case $arg in
+ -shared)
+ test "$build_libtool_libs" != yes && \
+ func_fatal_configuration "can not build a shared library"
+ build_old_libs=no
+ break
+ ;;
+ -all-static | -static | -static-libtool-libs)
+ case $arg in
+ -all-static)
+ if test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then
+ func_warning "complete static linking is impossible in this configuration"
+ fi
+ if test -n "$link_static_flag"; then
+ dlopen_self=$dlopen_self_static
+ fi
+ prefer_static_libs=yes
+ ;;
+ -static)
+ if test -z "$pic_flag" && test -n "$link_static_flag"; then
+ dlopen_self=$dlopen_self_static
+ fi
+ prefer_static_libs=built
+ ;;
+ -static-libtool-libs)
+ if test -z "$pic_flag" && test -n "$link_static_flag"; then
+ dlopen_self=$dlopen_self_static
+ fi
+ prefer_static_libs=yes
+ ;;
+ esac
+ build_libtool_libs=no
+ build_old_libs=yes
+ break
+ ;;
+ esac
+ done
+
+ # See if our shared archives depend on static archives.
+ test -n "$old_archive_from_new_cmds" && build_old_libs=yes
+
+ # Go through the arguments, transforming them on the way.
+ while test "$#" -gt 0; do
+ arg="$1"
+ shift
+ func_quote_for_eval "$arg"
+ qarg=$func_quote_for_eval_unquoted_result
+ func_append libtool_args " $func_quote_for_eval_result"
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$prev"; then
+ case $prev in
+ output)
+ func_append compile_command " @OUTPUT@"
+ func_append finalize_command " @OUTPUT@"
+ ;;
+ esac
+
+ case $prev in
+ bindir)
+ bindir="$arg"
+ prev=
+ continue
+ ;;
+ dlfiles|dlprefiles)
+ if test "$preload" = no; then
+ # Add the symbol object into the linking commands.
+ func_append compile_command " @SYMFILE@"
+ func_append finalize_command " @SYMFILE@"
+ preload=yes
+ fi
+ case $arg in
+ *.la | *.lo) ;; # We handle these cases below.
+ force)
+ if test "$dlself" = no; then
+ dlself=needless
+ export_dynamic=yes
+ fi
+ prev=
+ continue
+ ;;
+ self)
+ if test "$prev" = dlprefiles; then
+ dlself=yes
+ elif test "$prev" = dlfiles && test "$dlopen_self" != yes; then
+ dlself=yes
+ else
+ dlself=needless
+ export_dynamic=yes
+ fi
+ prev=
+ continue
+ ;;
+ *)
+ if test "$prev" = dlfiles; then
+ func_append dlfiles " $arg"
+ else
+ func_append dlprefiles " $arg"
+ fi
+ prev=
+ continue
+ ;;
+ esac
+ ;;
+ expsyms)
+ export_symbols="$arg"
+ test -f "$arg" \
+ || func_fatal_error "symbol file \`$arg' does not exist"
+ prev=
+ continue
+ ;;
+ expsyms_regex)
+ export_symbols_regex="$arg"
+ prev=
+ continue
+ ;;
+ framework)
+ case $host in
+ *-*-darwin*)
+ case "$deplibs " in
+ *" $qarg.ltframework "*) ;;
+ *) func_append deplibs " $qarg.ltframework" # this is fixed later
+ ;;
+ esac
+ ;;
+ esac
+ prev=
+ continue
+ ;;
+ inst_prefix)
+ inst_prefix_dir="$arg"
+ prev=
+ continue
+ ;;
+ objectlist)
+ if test -f "$arg"; then
+ save_arg=$arg
+ moreargs=
+ for fil in `cat "$save_arg"`
+ do
+# func_append moreargs " $fil"
+ arg=$fil
+ # A libtool-controlled object.
+
+ # Check to see that this really is a libtool object.
+ if func_lalib_unsafe_p "$arg"; then
+ pic_object=
+ non_pic_object=
+
+ # Read the .lo file
+ func_source "$arg"
+
+ if test -z "$pic_object" ||
+ test -z "$non_pic_object" ||
+ test "$pic_object" = none &&
+ test "$non_pic_object" = none; then
+ func_fatal_error "cannot find name of object for \`$arg'"
+ fi
+
+ # Extract subdirectory from the argument.
+ func_dirname "$arg" "/" ""
+ xdir="$func_dirname_result"
+
+ if test "$pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ pic_object="$xdir$pic_object"
+
+ if test "$prev" = dlfiles; then
+ if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then
+ func_append dlfiles " $pic_object"
+ prev=
+ continue
+ else
+ # If libtool objects are unsupported, then we need to preload.
+ prev=dlprefiles
+ fi
+ fi
+
+ # CHECK ME: I think I busted this. -Ossama
+ if test "$prev" = dlprefiles; then
+ # Preload the old-style object.
+ func_append dlprefiles " $pic_object"
+ prev=
+ fi
+
+ # A PIC object.
+ func_append libobjs " $pic_object"
+ arg="$pic_object"
+ fi
+
+ # Non-PIC object.
+ if test "$non_pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ non_pic_object="$xdir$non_pic_object"
+
+ # A standard non-PIC object
+ func_append non_pic_objects " $non_pic_object"
+ if test -z "$pic_object" || test "$pic_object" = none ; then
+ arg="$non_pic_object"
+ fi
+ else
+ # If the PIC object exists, use it instead.
+ # $xdir was prepended to $pic_object above.
+ non_pic_object="$pic_object"
+ func_append non_pic_objects " $non_pic_object"
+ fi
+ else
+ # Only an error if not doing a dry-run.
+ if $opt_dry_run; then
+ # Extract subdirectory from the argument.
+ func_dirname "$arg" "/" ""
+ xdir="$func_dirname_result"
+
+ func_lo2o "$arg"
+ pic_object=$xdir$objdir/$func_lo2o_result
+ non_pic_object=$xdir$func_lo2o_result
+ func_append libobjs " $pic_object"
+ func_append non_pic_objects " $non_pic_object"
+ else
+ func_fatal_error "\`$arg' is not a valid libtool object"
+ fi
+ fi
+ done
+ else
+ func_fatal_error "link input file \`$arg' does not exist"
+ fi
+ arg=$save_arg
+ prev=
+ continue
+ ;;
+ precious_regex)
+ precious_files_regex="$arg"
+ prev=
+ continue
+ ;;
+ release)
+ release="-$arg"
+ prev=
+ continue
+ ;;
+ rpath | xrpath)
+ # We need an absolute path.
+ case $arg in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ func_fatal_error "only absolute run-paths are allowed"
+ ;;
+ esac
+ if test "$prev" = rpath; then
+ case "$rpath " in
+ *" $arg "*) ;;
+ *) func_append rpath " $arg" ;;
+ esac
+ else
+ case "$xrpath " in
+ *" $arg "*) ;;
+ *) func_append xrpath " $arg" ;;
+ esac
+ fi
+ prev=
+ continue
+ ;;
+ shrext)
+ shrext_cmds="$arg"
+ prev=
+ continue
+ ;;
+ weak)
+ func_append weak_libs " $arg"
+ prev=
+ continue
+ ;;
+ xcclinker)
+ func_append linker_flags " $qarg"
+ func_append compiler_flags " $qarg"
+ prev=
+ func_append compile_command " $qarg"
+ func_append finalize_command " $qarg"
+ continue
+ ;;
+ xcompiler)
+ func_append compiler_flags " $qarg"
+ prev=
+ func_append compile_command " $qarg"
+ func_append finalize_command " $qarg"
+ continue
+ ;;
+ xlinker)
+ func_append linker_flags " $qarg"
+ func_append compiler_flags " $wl$qarg"
+ prev=
+ func_append compile_command " $wl$qarg"
+ func_append finalize_command " $wl$qarg"
+ continue
+ ;;
+ *)
+ eval "$prev=\"\$arg\""
+ prev=
+ continue
+ ;;
+ esac
+ fi # test -n "$prev"
+
+ prevarg="$arg"
+
+ case $arg in
+ -all-static)
+ if test -n "$link_static_flag"; then
+ # See comment for -static flag below, for more details.
+ func_append compile_command " $link_static_flag"
+ func_append finalize_command " $link_static_flag"
+ fi
+ continue
+ ;;
+
+ -allow-undefined)
+ # FIXME: remove this flag sometime in the future.
+ func_fatal_error "\`-allow-undefined' must not be used because it is the default"
+ ;;
+
+ -avoid-version)
+ avoid_version=yes
+ continue
+ ;;
+
+ -bindir)
+ prev=bindir
+ continue
+ ;;
+
+ -dlopen)
+ prev=dlfiles
+ continue
+ ;;
+
+ -dlpreopen)
+ prev=dlprefiles
+ continue
+ ;;
+
+ -export-dynamic)
+ export_dynamic=yes
+ continue
+ ;;
+
+ -export-symbols | -export-symbols-regex)
+ if test -n "$export_symbols" || test -n "$export_symbols_regex"; then
+ func_fatal_error "more than one -exported-symbols argument is not allowed"
+ fi
+ if test "X$arg" = "X-export-symbols"; then
+ prev=expsyms
+ else
+ prev=expsyms_regex
+ fi
+ continue
+ ;;
+
+ -framework)
+ prev=framework
+ continue
+ ;;
+
+ -inst-prefix-dir)
+ prev=inst_prefix
+ continue
+ ;;
+
+ # The native IRIX linker understands -LANG:*, -LIST:* and -LNO:*
+ # so, if we see these flags be careful not to treat them like -L
+ -L[A-Z][A-Z]*:*)
+ case $with_gcc/$host in
+ no/*-*-irix* | /*-*-irix*)
+ func_append compile_command " $arg"
+ func_append finalize_command " $arg"
+ ;;
+ esac
+ continue
+ ;;
+
+ -L*)
+ func_stripname "-L" '' "$arg"
+ if test -z "$func_stripname_result"; then
+ if test "$#" -gt 0; then
+ func_fatal_error "require no space between \`-L' and \`$1'"
+ else
+ func_fatal_error "need path for \`-L' option"
+ fi
+ fi
+ func_resolve_sysroot "$func_stripname_result"
+ dir=$func_resolve_sysroot_result
+ # We need an absolute path.
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ *)
+ absdir=`cd "$dir" && pwd`
+ test -z "$absdir" && \
+ func_fatal_error "cannot determine absolute directory name of \`$dir'"
+ dir="$absdir"
+ ;;
+ esac
+ case "$deplibs " in
+ *" -L$dir "* | *" $arg "*)
+ # Will only happen for absolute or sysroot arguments
+ ;;
+ *)
+ # Preserve sysroot, but never include relative directories
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]* | =*) func_append deplibs " $arg" ;;
+ *) func_append deplibs " -L$dir" ;;
+ esac
+ func_append lib_search_path " $dir"
+ ;;
+ esac
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*)
+ testbindir=`$ECHO "$dir" | $SED 's*/lib$*/bin*'`
+ case :$dllsearchpath: in
+ *":$dir:"*) ;;
+ ::) dllsearchpath=$dir;;
+ *) func_append dllsearchpath ":$dir";;
+ esac
+ case :$dllsearchpath: in
+ *":$testbindir:"*) ;;
+ ::) dllsearchpath=$testbindir;;
+ *) func_append dllsearchpath ":$testbindir";;
+ esac
+ ;;
+ esac
+ continue
+ ;;
+
+ -l*)
+ if test "X$arg" = "X-lc" || test "X$arg" = "X-lm"; then
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-beos* | *-cegcc* | *-*-haiku*)
+ # These systems don't actually have a C or math library (as such)
+ continue
+ ;;
+ *-*-os2*)
+ # These systems don't actually have a C library (as such)
+ test "X$arg" = "X-lc" && continue
+ ;;
+ *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+ # Do not include libc due to us having libc/libc_r.
+ test "X$arg" = "X-lc" && continue
+ ;;
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # Rhapsody C and math libraries are in the System framework
+ func_append deplibs " System.ltframework"
+ continue
+ ;;
+ *-*-sco3.2v5* | *-*-sco5v6*)
+ # Causes problems with __ctype
+ test "X$arg" = "X-lc" && continue
+ ;;
+ *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*)
+ # Compiler inserts libc in the correct place for threads to work
+ test "X$arg" = "X-lc" && continue
+ ;;
+ esac
+ elif test "X$arg" = "X-lc_r"; then
+ case $host in
+ *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+ # Do not include libc_r directly, use -pthread flag.
+ continue
+ ;;
+ esac
+ fi
+ func_append deplibs " $arg"
+ continue
+ ;;
+
+ -module)
+ module=yes
+ continue
+ ;;
+
+ # Tru64 UNIX uses -model [arg] to determine the layout of C++
+ # classes, name mangling, and exception handling.
+ # Darwin uses the -arch flag to determine output architecture.
+ -model|-arch|-isysroot|--sysroot)
+ func_append compiler_flags " $arg"
+ func_append compile_command " $arg"
+ func_append finalize_command " $arg"
+ prev=xcompiler
+ continue
+ ;;
+
+ -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe \
+ |-threads|-fopenmp|-openmp|-mp|-xopenmp|-omp|-qsmp=*)
+ func_append compiler_flags " $arg"
+ func_append compile_command " $arg"
+ func_append finalize_command " $arg"
+ case "$new_inherited_linker_flags " in
+ *" $arg "*) ;;
+ * ) func_append new_inherited_linker_flags " $arg" ;;
+ esac
+ continue
+ ;;
+
+ -multi_module)
+ single_module="${wl}-multi_module"
+ continue
+ ;;
+
+ -no-fast-install)
+ fast_install=no
+ continue
+ ;;
+
+ -no-install)
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-darwin* | *-cegcc*)
+ # The PATH hackery in wrapper scripts is required on Windows
+ # and Darwin in order for the loader to find any dlls it needs.
+ func_warning "\`-no-install' is ignored for $host"
+ func_warning "assuming \`-no-fast-install' instead"
+ fast_install=no
+ ;;
+ *) no_install=yes ;;
+ esac
+ continue
+ ;;
+
+ -no-undefined)
+ allow_undefined=no
+ continue
+ ;;
+
+ -objectlist)
+ prev=objectlist
+ continue
+ ;;
+
+ -o) prev=output ;;
+
+ -precious-files-regex)
+ prev=precious_regex
+ continue
+ ;;
+
+ -release)
+ prev=release
+ continue
+ ;;
+
+ -rpath)
+ prev=rpath
+ continue
+ ;;
+
+ -R)
+ prev=xrpath
+ continue
+ ;;
+
+ -R*)
+ func_stripname '-R' '' "$arg"
+ dir=$func_stripname_result
+ # We need an absolute path.
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*) ;;
+ =*)
+ func_stripname '=' '' "$dir"
+ dir=$lt_sysroot$func_stripname_result
+ ;;
+ *)
+ func_fatal_error "only absolute run-paths are allowed"
+ ;;
+ esac
+ case "$xrpath " in
+ *" $dir "*) ;;
+ *) func_append xrpath " $dir" ;;
+ esac
+ continue
+ ;;
+
+ -shared)
+ # The effects of -shared are defined in a previous loop.
+ continue
+ ;;
+
+ -shrext)
+ prev=shrext
+ continue
+ ;;
+
+ -static | -static-libtool-libs)
+ # The effects of -static are defined in a previous loop.
+ # We used to do the same as -all-static on platforms that
+ # didn't have a PIC flag, but the assumption that the effects
+ # would be equivalent was wrong. It would break on at least
+ # Digital Unix and AIX.
+ continue
+ ;;
+
+ -thread-safe)
+ thread_safe=yes
+ continue
+ ;;
+
+ -version-info)
+ prev=vinfo
+ continue
+ ;;
+
+ -version-number)
+ prev=vinfo
+ vinfo_number=yes
+ continue
+ ;;
+
+ -weak)
+ prev=weak
+ continue
+ ;;
+
+ -Wc,*)
+ func_stripname '-Wc,' '' "$arg"
+ args=$func_stripname_result
+ arg=
+ save_ifs="$IFS"; IFS=','
+ for flag in $args; do
+ IFS="$save_ifs"
+ func_quote_for_eval "$flag"
+ func_append arg " $func_quote_for_eval_result"
+ func_append compiler_flags " $func_quote_for_eval_result"
+ done
+ IFS="$save_ifs"
+ func_stripname ' ' '' "$arg"
+ arg=$func_stripname_result
+ ;;
+
+ -Wl,*)
+ func_stripname '-Wl,' '' "$arg"
+ args=$func_stripname_result
+ arg=
+ save_ifs="$IFS"; IFS=','
+ for flag in $args; do
+ IFS="$save_ifs"
+ func_quote_for_eval "$flag"
+ func_append arg " $wl$func_quote_for_eval_result"
+ func_append compiler_flags " $wl$func_quote_for_eval_result"
+ func_append linker_flags " $func_quote_for_eval_result"
+ done
+ IFS="$save_ifs"
+ func_stripname ' ' '' "$arg"
+ arg=$func_stripname_result
+ ;;
+
+ -Xcompiler)
+ prev=xcompiler
+ continue
+ ;;
+
+ -Xlinker)
+ prev=xlinker
+ continue
+ ;;
+
+ -XCClinker)
+ prev=xcclinker
+ continue
+ ;;
+
+ # -msg_* for osf cc
+ -msg_*)
+ func_quote_for_eval "$arg"
+ arg="$func_quote_for_eval_result"
+ ;;
+
+ # Flags to be passed through unchanged, with rationale:
+ # -64, -mips[0-9] enable 64-bit mode for the SGI compiler
+ # -r[0-9][0-9]* specify processor for the SGI compiler
+ # -xarch=*, -xtarget=* enable 64-bit mode for the Sun compiler
+ # +DA*, +DD* enable 64-bit mode for the HP compiler
+ # -q* compiler args for the IBM compiler
+ # -m*, -t[45]*, -txscale* architecture-specific flags for GCC
+ # -F/path path to uninstalled frameworks, gcc on darwin
+ # -p, -pg, --coverage, -fprofile-* profiling flags for GCC
+ # @file GCC response files
+ # -tp=* Portland pgcc target processor selection
+ # --sysroot=* for sysroot support
+ # -O*, -flto*, -fwhopr*, -fuse-linker-plugin GCC link-time optimization
+ -64|-mips[0-9]|-r[0-9][0-9]*|-xarch=*|-xtarget=*|+DA*|+DD*|-q*|-m*| \
+ -t[45]*|-txscale*|-p|-pg|--coverage|-fprofile-*|-F*|@*|-tp=*|--sysroot=*| \
+ -O*|-flto*|-fwhopr*|-fuse-linker-plugin)
+ func_quote_for_eval "$arg"
+ arg="$func_quote_for_eval_result"
+ func_append compile_command " $arg"
+ func_append finalize_command " $arg"
+ func_append compiler_flags " $arg"
+ continue
+ ;;
+
+ # Some other compiler flag.
+ -* | +*)
+ func_quote_for_eval "$arg"
+ arg="$func_quote_for_eval_result"
+ ;;
+
+ *.$objext)
+ # A standard object.
+ func_append objs " $arg"
+ ;;
+
+ *.lo)
+ # A libtool-controlled object.
+
+ # Check to see that this really is a libtool object.
+ if func_lalib_unsafe_p "$arg"; then
+ pic_object=
+ non_pic_object=
+
+ # Read the .lo file
+ func_source "$arg"
+
+ if test -z "$pic_object" ||
+ test -z "$non_pic_object" ||
+ test "$pic_object" = none &&
+ test "$non_pic_object" = none; then
+ func_fatal_error "cannot find name of object for \`$arg'"
+ fi
+
+ # Extract subdirectory from the argument.
+ func_dirname "$arg" "/" ""
+ xdir="$func_dirname_result"
+
+ if test "$pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ pic_object="$xdir$pic_object"
+
+ if test "$prev" = dlfiles; then
+ if test "$build_libtool_libs" = yes && test "$dlopen_support" = yes; then
+ func_append dlfiles " $pic_object"
+ prev=
+ continue
+ else
+ # If libtool objects are unsupported, then we need to preload.
+ prev=dlprefiles
+ fi
+ fi
+
+ # CHECK ME: I think I busted this. -Ossama
+ if test "$prev" = dlprefiles; then
+ # Preload the old-style object.
+ func_append dlprefiles " $pic_object"
+ prev=
+ fi
+
+ # A PIC object.
+ func_append libobjs " $pic_object"
+ arg="$pic_object"
+ fi
+
+ # Non-PIC object.
+ if test "$non_pic_object" != none; then
+ # Prepend the subdirectory the object is found in.
+ non_pic_object="$xdir$non_pic_object"
+
+ # A standard non-PIC object
+ func_append non_pic_objects " $non_pic_object"
+ if test -z "$pic_object" || test "$pic_object" = none ; then
+ arg="$non_pic_object"
+ fi
+ else
+ # If the PIC object exists, use it instead.
+ # $xdir was prepended to $pic_object above.
+ non_pic_object="$pic_object"
+ func_append non_pic_objects " $non_pic_object"
+ fi
+ else
+ # Only an error if not doing a dry-run.
+ if $opt_dry_run; then
+ # Extract subdirectory from the argument.
+ func_dirname "$arg" "/" ""
+ xdir="$func_dirname_result"
+
+ func_lo2o "$arg"
+ pic_object=$xdir$objdir/$func_lo2o_result
+ non_pic_object=$xdir$func_lo2o_result
+ func_append libobjs " $pic_object"
+ func_append non_pic_objects " $non_pic_object"
+ else
+ func_fatal_error "\`$arg' is not a valid libtool object"
+ fi
+ fi
+ ;;
+
+ *.$libext)
+ # An archive.
+ func_append deplibs " $arg"
+ func_append old_deplibs " $arg"
+ continue
+ ;;
+
+ *.la)
+ # A libtool-controlled library.
+
+ func_resolve_sysroot "$arg"
+ if test "$prev" = dlfiles; then
+ # This library was specified with -dlopen.
+ func_append dlfiles " $func_resolve_sysroot_result"
+ prev=
+ elif test "$prev" = dlprefiles; then
+ # The library was specified with -dlpreopen.
+ func_append dlprefiles " $func_resolve_sysroot_result"
+ prev=
+ else
+ func_append deplibs " $func_resolve_sysroot_result"
+ fi
+ continue
+ ;;
+
+ # Some other compiler argument.
+ *)
+ # Unknown arguments in both finalize_command and compile_command need
+ # to be aesthetically quoted because they are evaled later.
+ func_quote_for_eval "$arg"
+ arg="$func_quote_for_eval_result"
+ ;;
+ esac # arg
+
+ # Now actually substitute the argument into the commands.
+ if test -n "$arg"; then
+ func_append compile_command " $arg"
+ func_append finalize_command " $arg"
+ fi
+ done # argument parsing loop
+
+ test -n "$prev" && \
+ func_fatal_help "the \`$prevarg' option requires an argument"
+
+ if test "$export_dynamic" = yes && test -n "$export_dynamic_flag_spec"; then
+ eval arg=\"$export_dynamic_flag_spec\"
+ func_append compile_command " $arg"
+ func_append finalize_command " $arg"
+ fi
+
+ oldlibs=
+ # calculate the name of the file, without its directory
+ func_basename "$output"
+ outputname="$func_basename_result"
+ libobjs_save="$libobjs"
+
+ if test -n "$shlibpath_var"; then
+ # get the directories listed in $shlibpath_var
+ eval shlib_search_path=\`\$ECHO \"\${$shlibpath_var}\" \| \$SED \'s/:/ /g\'\`
+ else
+ shlib_search_path=
+ fi
+ eval sys_lib_search_path=\"$sys_lib_search_path_spec\"
+ eval sys_lib_dlsearch_path=\"$sys_lib_dlsearch_path_spec\"
+
+ func_dirname "$output" "/" ""
+ output_objdir="$func_dirname_result$objdir"
+ func_to_tool_file "$output_objdir/"
+ tool_output_objdir=$func_to_tool_file_result
+ # Create the object directory.
+ func_mkdir_p "$output_objdir"
+
+ # Determine the type of output
+ case $output in
+ "")
+ func_fatal_help "you must specify an output file"
+ ;;
+ *.$libext) linkmode=oldlib ;;
+ *.lo | *.$objext) linkmode=obj ;;
+ *.la) linkmode=lib ;;
+ *) linkmode=prog ;; # Anything else should be a program.
+ esac
+
+ specialdeplibs=
+
+ libs=
+ # Find all interdependent deplibs by searching for libraries
+ # that are linked more than once (e.g. -la -lb -la)
+ for deplib in $deplibs; do
+ if $opt_preserve_dup_deps ; then
+ case "$libs " in
+ *" $deplib "*) func_append specialdeplibs " $deplib" ;;
+ esac
+ fi
+ func_append libs " $deplib"
+ done
+
+ if test "$linkmode" = lib; then
+ libs="$predeps $libs $compiler_lib_search_path $postdeps"
+
+ # Compute libraries that are listed more than once in $predeps
+ # $postdeps and mark them as special (i.e., whose duplicates are
+ # not to be eliminated).
+ pre_post_deps=
+ if $opt_duplicate_compiler_generated_deps; then
+ for pre_post_dep in $predeps $postdeps; do
+ case "$pre_post_deps " in
+ *" $pre_post_dep "*) func_append specialdeplibs " $pre_post_deps" ;;
+ esac
+ func_append pre_post_deps " $pre_post_dep"
+ done
+ fi
+ pre_post_deps=
+ fi
+
+ deplibs=
+ newdependency_libs=
+ newlib_search_path=
+ need_relink=no # whether we're linking any uninstalled libtool libraries
+ notinst_deplibs= # not-installed libtool libraries
+ notinst_path= # paths that contain not-installed libtool libraries
+
+ case $linkmode in
+ lib)
+ passes="conv dlpreopen link"
+ for file in $dlfiles $dlprefiles; do
+ case $file in
+ *.la) ;;
+ *)
+ func_fatal_help "libraries can \`-dlopen' only libtool libraries: $file"
+ ;;
+ esac
+ done
+ ;;
+ prog)
+ compile_deplibs=
+ finalize_deplibs=
+ alldeplibs=no
+ newdlfiles=
+ newdlprefiles=
+ passes="conv scan dlopen dlpreopen link"
+ ;;
+ *) passes="conv"
+ ;;
+ esac
+
+ for pass in $passes; do
+ # The preopen pass in lib mode reverses $deplibs; put it back here
+ # so that -L comes before libs that need it for instance...
+ if test "$linkmode,$pass" = "lib,link"; then
+ ## FIXME: Find the place where the list is rebuilt in the wrong
+ ## order, and fix it there properly
+ tmp_deplibs=
+ for deplib in $deplibs; do
+ tmp_deplibs="$deplib $tmp_deplibs"
+ done
+ deplibs="$tmp_deplibs"
+ fi
+
+ if test "$linkmode,$pass" = "lib,link" ||
+ test "$linkmode,$pass" = "prog,scan"; then
+ libs="$deplibs"
+ deplibs=
+ fi
+ if test "$linkmode" = prog; then
+ case $pass in
+ dlopen) libs="$dlfiles" ;;
+ dlpreopen) libs="$dlprefiles" ;;
+ link) libs="$deplibs %DEPLIBS% $dependency_libs" ;;
+ esac
+ fi
+ if test "$linkmode,$pass" = "lib,dlpreopen"; then
+ # Collect and forward deplibs of preopened libtool libs
+ for lib in $dlprefiles; do
+ # Ignore non-libtool-libs
+ dependency_libs=
+ func_resolve_sysroot "$lib"
+ case $lib in
+ *.la) func_source "$func_resolve_sysroot_result" ;;
+ esac
+
+ # Collect preopened libtool deplibs, except any this library
+ # has declared as weak libs
+ for deplib in $dependency_libs; do
+ func_basename "$deplib"
+ deplib_base=$func_basename_result
+ case " $weak_libs " in
+ *" $deplib_base "*) ;;
+ *) func_append deplibs " $deplib" ;;
+ esac
+ done
+ done
+ libs="$dlprefiles"
+ fi
+ if test "$pass" = dlopen; then
+ # Collect dlpreopened libraries
+ save_deplibs="$deplibs"
+ deplibs=
+ fi
+
+ for deplib in $libs; do
+ lib=
+ found=no
+ case $deplib in
+ -mt|-mthreads|-kthread|-Kthread|-pthread|-pthreads|--thread-safe \
+ |-threads|-fopenmp|-openmp|-mp|-xopenmp|-omp|-qsmp=*)
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ func_append compiler_flags " $deplib"
+ if test "$linkmode" = lib ; then
+ case "$new_inherited_linker_flags " in
+ *" $deplib "*) ;;
+ * ) func_append new_inherited_linker_flags " $deplib" ;;
+ esac
+ fi
+ fi
+ continue
+ ;;
+ -l*)
+ if test "$linkmode" != lib && test "$linkmode" != prog; then
+ func_warning "\`-l' is ignored for archives/objects"
+ continue
+ fi
+ func_stripname '-l' '' "$deplib"
+ name=$func_stripname_result
+ if test "$linkmode" = lib; then
+ searchdirs="$newlib_search_path $lib_search_path $compiler_lib_search_dirs $sys_lib_search_path $shlib_search_path"
+ else
+ searchdirs="$newlib_search_path $lib_search_path $sys_lib_search_path $shlib_search_path"
+ fi
+ for searchdir in $searchdirs; do
+ for search_ext in .la $std_shrext .so .a; do
+ # Search the libtool library
+ lib="$searchdir/lib${name}${search_ext}"
+ if test -f "$lib"; then
+ if test "$search_ext" = ".la"; then
+ found=yes
+ else
+ found=no
+ fi
+ break 2
+ fi
+ done
+ done
+ if test "$found" != yes; then
+ # deplib doesn't seem to be a libtool library
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ deplibs="$deplib $deplibs"
+ test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs"
+ fi
+ continue
+ else # deplib is a libtool library
+ # If $allow_libtool_libs_with_static_runtimes && $deplib is a stdlib,
+ # We need to do some special things here, and not later.
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $deplib "*)
+ if func_lalib_p "$lib"; then
+ library_names=
+ old_library=
+ func_source "$lib"
+ for l in $old_library $library_names; do
+ ll="$l"
+ done
+ if test "X$ll" = "X$old_library" ; then # only static version available
+ found=no
+ func_dirname "$lib" "" "."
+ ladir="$func_dirname_result"
+ lib=$ladir/$old_library
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ deplibs="$deplib $deplibs"
+ test "$linkmode" = lib && newdependency_libs="$deplib $newdependency_libs"
+ fi
+ continue
+ fi
+ fi
+ ;;
+ *) ;;
+ esac
+ fi
+ fi
+ ;; # -l
+ *.ltframework)
+ if test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ deplibs="$deplib $deplibs"
+ if test "$linkmode" = lib ; then
+ case "$new_inherited_linker_flags " in
+ *" $deplib "*) ;;
+ * ) func_append new_inherited_linker_flags " $deplib" ;;
+ esac
+ fi
+ fi
+ continue
+ ;;
+ -L*)
+ case $linkmode in
+ lib)
+ deplibs="$deplib $deplibs"
+ test "$pass" = conv && continue
+ newdependency_libs="$deplib $newdependency_libs"
+ func_stripname '-L' '' "$deplib"
+ func_resolve_sysroot "$func_stripname_result"
+ func_append newlib_search_path " $func_resolve_sysroot_result"
+ ;;
+ prog)
+ if test "$pass" = conv; then
+ deplibs="$deplib $deplibs"
+ continue
+ fi
+ if test "$pass" = scan; then
+ deplibs="$deplib $deplibs"
+ else
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ fi
+ func_stripname '-L' '' "$deplib"
+ func_resolve_sysroot "$func_stripname_result"
+ func_append newlib_search_path " $func_resolve_sysroot_result"
+ ;;
+ *)
+ func_warning "\`-L' is ignored for archives/objects"
+ ;;
+ esac # linkmode
+ continue
+ ;; # -L
+ -R*)
+ if test "$pass" = link; then
+ func_stripname '-R' '' "$deplib"
+ func_resolve_sysroot "$func_stripname_result"
+ dir=$func_resolve_sysroot_result
+ # Make sure the xrpath contains only unique directories.
+ case "$xrpath " in
+ *" $dir "*) ;;
+ *) func_append xrpath " $dir" ;;
+ esac
+ fi
+ deplibs="$deplib $deplibs"
+ continue
+ ;;
+ *.la)
+ func_resolve_sysroot "$deplib"
+ lib=$func_resolve_sysroot_result
+ ;;
+ *.$libext)
+ if test "$pass" = conv; then
+ deplibs="$deplib $deplibs"
+ continue
+ fi
+ case $linkmode in
+ lib)
+ # Linking convenience modules into shared libraries is allowed,
+ # but linking other static libraries is non-portable.
+ case " $dlpreconveniencelibs " in
+ *" $deplib "*) ;;
+ *)
+ valid_a_lib=no
+ case $deplibs_check_method in
+ match_pattern*)
+ set dummy $deplibs_check_method; shift
+ match_pattern_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"`
+ if eval "\$ECHO \"$deplib\"" 2>/dev/null | $SED 10q \
+ | $EGREP "$match_pattern_regex" > /dev/null; then
+ valid_a_lib=yes
+ fi
+ ;;
+ pass_all)
+ valid_a_lib=yes
+ ;;
+ esac
+ if test "$valid_a_lib" != yes; then
+ echo
+ $ECHO "*** Warning: Trying to link with static lib archive $deplib."
+ echo "*** I have the capability to make that library automatically link in when"
+ echo "*** you link to this library. But I can only do this if you have a"
+ echo "*** shared version of the library, which you do not appear to have"
+ echo "*** because the file extensions .$libext of this argument makes me believe"
+ echo "*** that it is just a static archive that I should not use here."
+ else
+ echo
+ $ECHO "*** Warning: Linking the shared library $output against the"
+ $ECHO "*** static library $deplib is not portable!"
+ deplibs="$deplib $deplibs"
+ fi
+ ;;
+ esac
+ continue
+ ;;
+ prog)
+ if test "$pass" != link; then
+ deplibs="$deplib $deplibs"
+ else
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ fi
+ continue
+ ;;
+ esac # linkmode
+ ;; # *.$libext
+ *.lo | *.$objext)
+ if test "$pass" = conv; then
+ deplibs="$deplib $deplibs"
+ elif test "$linkmode" = prog; then
+ if test "$pass" = dlpreopen || test "$dlopen_support" != yes || test "$build_libtool_libs" = no; then
+ # If there is no dlopen support or we're linking statically,
+ # we need to preload.
+ func_append newdlprefiles " $deplib"
+ compile_deplibs="$deplib $compile_deplibs"
+ finalize_deplibs="$deplib $finalize_deplibs"
+ else
+ func_append newdlfiles " $deplib"
+ fi
+ fi
+ continue
+ ;;
+ %DEPLIBS%)
+ alldeplibs=yes
+ continue
+ ;;
+ esac # case $deplib
+
+ if test "$found" = yes || test -f "$lib"; then :
+ else
+ func_fatal_error "cannot find the library \`$lib' or unhandled argument \`$deplib'"
+ fi
+
+ # Check to see that this really is a libtool archive.
+ func_lalib_unsafe_p "$lib" \
+ || func_fatal_error "\`$lib' is not a valid libtool archive"
+
+ func_dirname "$lib" "" "."
+ ladir="$func_dirname_result"
+
+ dlname=
+ dlopen=
+ dlpreopen=
+ libdir=
+ library_names=
+ old_library=
+ inherited_linker_flags=
+ # If the library was installed with an old release of libtool,
+ # it will not redefine variables installed, or shouldnotlink
+ installed=yes
+ shouldnotlink=no
+ avoidtemprpath=
+
+
+ # Read the .la file
+ func_source "$lib"
+
+ # Convert "-framework foo" to "foo.ltframework"
+ if test -n "$inherited_linker_flags"; then
+ tmp_inherited_linker_flags=`$ECHO "$inherited_linker_flags" | $SED 's/-framework \([^ $]*\)/\1.ltframework/g'`
+ for tmp_inherited_linker_flag in $tmp_inherited_linker_flags; do
+ case " $new_inherited_linker_flags " in
+ *" $tmp_inherited_linker_flag "*) ;;
+ *) func_append new_inherited_linker_flags " $tmp_inherited_linker_flag";;
+ esac
+ done
+ fi
+ dependency_libs=`$ECHO " $dependency_libs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ if test "$linkmode,$pass" = "lib,link" ||
+ test "$linkmode,$pass" = "prog,scan" ||
+ { test "$linkmode" != prog && test "$linkmode" != lib; }; then
+ test -n "$dlopen" && func_append dlfiles " $dlopen"
+ test -n "$dlpreopen" && func_append dlprefiles " $dlpreopen"
+ fi
+
+ if test "$pass" = conv; then
+ # Only check for convenience libraries
+ deplibs="$lib $deplibs"
+ if test -z "$libdir"; then
+ if test -z "$old_library"; then
+ func_fatal_error "cannot find name of link library for \`$lib'"
+ fi
+ # It is a libtool convenience library, so add in its objects.
+ func_append convenience " $ladir/$objdir/$old_library"
+ func_append old_convenience " $ladir/$objdir/$old_library"
+ elif test "$linkmode" != prog && test "$linkmode" != lib; then
+ func_fatal_error "\`$lib' is not a convenience library"
+ fi
+ tmp_libs=
+ for deplib in $dependency_libs; do
+ deplibs="$deplib $deplibs"
+ if $opt_preserve_dup_deps ; then
+ case "$tmp_libs " in
+ *" $deplib "*) func_append specialdeplibs " $deplib" ;;
+ esac
+ fi
+ func_append tmp_libs " $deplib"
+ done
+ continue
+ fi # $pass = conv
+
+
+ # Get the name of the library we link against.
+ linklib=
+ if test -n "$old_library" &&
+ { test "$prefer_static_libs" = yes ||
+ test "$prefer_static_libs,$installed" = "built,no"; }; then
+ linklib=$old_library
+ else
+ for l in $old_library $library_names; do
+ linklib="$l"
+ done
+ fi
+ if test -z "$linklib"; then
+ func_fatal_error "cannot find name of link library for \`$lib'"
+ fi
+
+ # This library was specified with -dlopen.
+ if test "$pass" = dlopen; then
+ if test -z "$libdir"; then
+ func_fatal_error "cannot -dlopen a convenience library: \`$lib'"
+ fi
+ if test -z "$dlname" ||
+ test "$dlopen_support" != yes ||
+ test "$build_libtool_libs" = no; then
+ # If there is no dlname, no dlopen support or we're linking
+ # statically, we need to preload. We also need to preload any
+ # dependent libraries so libltdl's deplib preloader doesn't
+ # bomb out in the load deplibs phase.
+ func_append dlprefiles " $lib $dependency_libs"
+ else
+ func_append newdlfiles " $lib"
+ fi
+ continue
+ fi # $pass = dlopen
+
+ # We need an absolute path.
+ case $ladir in
+ [\\/]* | [A-Za-z]:[\\/]*) abs_ladir="$ladir" ;;
+ *)
+ abs_ladir=`cd "$ladir" && pwd`
+ if test -z "$abs_ladir"; then
+ func_warning "cannot determine absolute directory name of \`$ladir'"
+ func_warning "passing it literally to the linker, although it might fail"
+ abs_ladir="$ladir"
+ fi
+ ;;
+ esac
+ func_basename "$lib"
+ laname="$func_basename_result"
+
+ # Find the relevant object directory and library name.
+ if test "X$installed" = Xyes; then
+ if test ! -f "$lt_sysroot$libdir/$linklib" && test -f "$abs_ladir/$linklib"; then
+ func_warning "library \`$lib' was moved."
+ dir="$ladir"
+ absdir="$abs_ladir"
+ libdir="$abs_ladir"
+ else
+ dir="$lt_sysroot$libdir"
+ absdir="$lt_sysroot$libdir"
+ fi
+ test "X$hardcode_automatic" = Xyes && avoidtemprpath=yes
+ else
+ if test ! -f "$ladir/$objdir/$linklib" && test -f "$abs_ladir/$linklib"; then
+ dir="$ladir"
+ absdir="$abs_ladir"
+ # Remove this search path later
+ func_append notinst_path " $abs_ladir"
+ else
+ dir="$ladir/$objdir"
+ absdir="$abs_ladir/$objdir"
+ # Remove this search path later
+ func_append notinst_path " $abs_ladir"
+ fi
+ fi # $installed = yes
+ func_stripname 'lib' '.la' "$laname"
+ name=$func_stripname_result
+
+ # This library was specified with -dlpreopen.
+ if test "$pass" = dlpreopen; then
+ if test -z "$libdir" && test "$linkmode" = prog; then
+ func_fatal_error "only libraries may -dlpreopen a convenience library: \`$lib'"
+ fi
+ case "$host" in
+ # special handling for platforms with PE-DLLs.
+ *cygwin* | *mingw* | *cegcc* )
+ # Linker will automatically link against shared library if both
+ # static and shared are present. Therefore, ensure we extract
+ # symbols from the import library if a shared library is present
+ # (otherwise, the dlopen module name will be incorrect). We do
+ # this by putting the import library name into $newdlprefiles.
+ # We recover the dlopen module name by 'saving' the la file
+ # name in a special purpose variable, and (later) extracting the
+ # dlname from the la file.
+ if test -n "$dlname"; then
+ func_tr_sh "$dir/$linklib"
+ eval "libfile_$func_tr_sh_result=\$abs_ladir/\$laname"
+ func_append newdlprefiles " $dir/$linklib"
+ else
+ func_append newdlprefiles " $dir/$old_library"
+ # Keep a list of preopened convenience libraries to check
+ # that they are being used correctly in the link pass.
+ test -z "$libdir" && \
+ func_append dlpreconveniencelibs " $dir/$old_library"
+ fi
+ ;;
+ * )
+ # Prefer using a static library (so that no silly _DYNAMIC symbols
+ # are required to link).
+ if test -n "$old_library"; then
+ func_append newdlprefiles " $dir/$old_library"
+ # Keep a list of preopened convenience libraries to check
+ # that they are being used correctly in the link pass.
+ test -z "$libdir" && \
+ func_append dlpreconveniencelibs " $dir/$old_library"
+ # Otherwise, use the dlname, so that lt_dlopen finds it.
+ elif test -n "$dlname"; then
+ func_append newdlprefiles " $dir/$dlname"
+ else
+ func_append newdlprefiles " $dir/$linklib"
+ fi
+ ;;
+ esac
+ fi # $pass = dlpreopen
+
+ if test -z "$libdir"; then
+ # Link the convenience library
+ if test "$linkmode" = lib; then
+ deplibs="$dir/$old_library $deplibs"
+ elif test "$linkmode,$pass" = "prog,link"; then
+ compile_deplibs="$dir/$old_library $compile_deplibs"
+ finalize_deplibs="$dir/$old_library $finalize_deplibs"
+ else
+ deplibs="$lib $deplibs" # used for prog,scan pass
+ fi
+ continue
+ fi
+
+
+ if test "$linkmode" = prog && test "$pass" != link; then
+ func_append newlib_search_path " $ladir"
+ deplibs="$lib $deplibs"
+
+ linkalldeplibs=no
+ if test "$link_all_deplibs" != no || test -z "$library_names" ||
+ test "$build_libtool_libs" = no; then
+ linkalldeplibs=yes
+ fi
+
+ tmp_libs=
+ for deplib in $dependency_libs; do
+ case $deplib in
+ -L*) func_stripname '-L' '' "$deplib"
+ func_resolve_sysroot "$func_stripname_result"
+ func_append newlib_search_path " $func_resolve_sysroot_result"
+ ;;
+ esac
+ # Need to link against all dependency_libs?
+ if test "$linkalldeplibs" = yes; then
+ deplibs="$deplib $deplibs"
+ else
+ # Need to hardcode shared library paths
+ # or/and link against static libraries
+ newdependency_libs="$deplib $newdependency_libs"
+ fi
+ if $opt_preserve_dup_deps ; then
+ case "$tmp_libs " in
+ *" $deplib "*) func_append specialdeplibs " $deplib" ;;
+ esac
+ fi
+ func_append tmp_libs " $deplib"
+ done # for deplib
+ continue
+ fi # $linkmode = prog...
+
+ if test "$linkmode,$pass" = "prog,link"; then
+ if test -n "$library_names" &&
+ { { test "$prefer_static_libs" = no ||
+ test "$prefer_static_libs,$installed" = "built,yes"; } ||
+ test -z "$old_library"; }; then
+ # We need to hardcode the library path
+ if test -n "$shlibpath_var" && test -z "$avoidtemprpath" ; then
+ # Make sure the rpath contains only unique directories.
+ case "$temp_rpath:" in
+ *"$absdir:"*) ;;
+ *) func_append temp_rpath "$absdir:" ;;
+ esac
+ fi
+
+ # Hardcode the library path.
+ # Skip directories that are in the system default run-time
+ # search path.
+ case " $sys_lib_dlsearch_path " in
+ *" $absdir "*) ;;
+ *)
+ case "$compile_rpath " in
+ *" $absdir "*) ;;
+ *) func_append compile_rpath " $absdir" ;;
+ esac
+ ;;
+ esac
+ case " $sys_lib_dlsearch_path " in
+ *" $libdir "*) ;;
+ *)
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) func_append finalize_rpath " $libdir" ;;
+ esac
+ ;;
+ esac
+ fi # $linkmode,$pass = prog,link...
+
+ if test "$alldeplibs" = yes &&
+ { test "$deplibs_check_method" = pass_all ||
+ { test "$build_libtool_libs" = yes &&
+ test -n "$library_names"; }; }; then
+ # We only need to search for static libraries
+ continue
+ fi
+ fi
+
+ link_static=no # Whether the deplib will be linked statically
+ use_static_libs=$prefer_static_libs
+ if test "$use_static_libs" = built && test "$installed" = yes; then
+ use_static_libs=no
+ fi
+ if test -n "$library_names" &&
+ { test "$use_static_libs" = no || test -z "$old_library"; }; then
+ case $host in
+ *cygwin* | *mingw* | *cegcc*)
+ # No point in relinking DLLs because paths are not encoded
+ func_append notinst_deplibs " $lib"
+ need_relink=no
+ ;;
+ *)
+ if test "$installed" = no; then
+ func_append notinst_deplibs " $lib"
+ need_relink=yes
+ fi
+ ;;
+ esac
+ # This is a shared library
+
+ # Warn about portability, can't link against -module's on some
+ # systems (darwin). Don't bleat about dlopened modules though!
+ dlopenmodule=""
+ for dlpremoduletest in $dlprefiles; do
+ if test "X$dlpremoduletest" = "X$lib"; then
+ dlopenmodule="$dlpremoduletest"
+ break
+ fi
+ done
+ if test -z "$dlopenmodule" && test "$shouldnotlink" = yes && test "$pass" = link; then
+ echo
+ if test "$linkmode" = prog; then
+ $ECHO "*** Warning: Linking the executable $output against the loadable module"
+ else
+ $ECHO "*** Warning: Linking the shared library $output against the loadable module"
+ fi
+ $ECHO "*** $linklib is not portable!"
+ fi
+ if test "$linkmode" = lib &&
+ test "$hardcode_into_libs" = yes; then
+ # Hardcode the library path.
+ # Skip directories that are in the system default run-time
+ # search path.
+ case " $sys_lib_dlsearch_path " in
+ *" $absdir "*) ;;
+ *)
+ case "$compile_rpath " in
+ *" $absdir "*) ;;
+ *) func_append compile_rpath " $absdir" ;;
+ esac
+ ;;
+ esac
+ case " $sys_lib_dlsearch_path " in
+ *" $libdir "*) ;;
+ *)
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) func_append finalize_rpath " $libdir" ;;
+ esac
+ ;;
+ esac
+ fi
+
+ if test -n "$old_archive_from_expsyms_cmds"; then
+ # figure out the soname
+ set dummy $library_names
+ shift
+ realname="$1"
+ shift
+ libname=`eval "\\$ECHO \"$libname_spec\""`
+ # use dlname if we got it. it's perfectly good, no?
+ if test -n "$dlname"; then
+ soname="$dlname"
+ elif test -n "$soname_spec"; then
+ # bleh windows
+ case $host in
+ *cygwin* | mingw* | *cegcc*)
+ func_arith $current - $age
+ major=$func_arith_result
+ versuffix="-$major"
+ ;;
+ esac
+ eval soname=\"$soname_spec\"
+ else
+ soname="$realname"
+ fi
+
+ # Make a new name for the extract_expsyms_cmds to use
+ soroot="$soname"
+ func_basename "$soroot"
+ soname="$func_basename_result"
+ func_stripname 'lib' '.dll' "$soname"
+ newlib=libimp-$func_stripname_result.a
+
+ # If the library has no export list, then create one now
+ if test -f "$output_objdir/$soname-def"; then :
+ else
+ func_verbose "extracting exported symbol list from \`$soname'"
+ func_execute_cmds "$extract_expsyms_cmds" 'exit $?'
+ fi
+
+ # Create $newlib
+ if test -f "$output_objdir/$newlib"; then :; else
+ func_verbose "generating import library for \`$soname'"
+ func_execute_cmds "$old_archive_from_expsyms_cmds" 'exit $?'
+ fi
+ # make sure the library variables are pointing to the new library
+ dir=$output_objdir
+ linklib=$newlib
+ fi # test -n "$old_archive_from_expsyms_cmds"
+
+ if test "$linkmode" = prog || test "$opt_mode" != relink; then
+ add_shlibpath=
+ add_dir=
+ add=
+ lib_linked=yes
+ case $hardcode_action in
+ immediate | unsupported)
+ if test "$hardcode_direct" = no; then
+ add="$dir/$linklib"
+ case $host in
+ *-*-sco3.2v5.0.[024]*) add_dir="-L$dir" ;;
+ *-*-sysv4*uw2*) add_dir="-L$dir" ;;
+ *-*-sysv5OpenUNIX* | *-*-sysv5UnixWare7.[01].[10]* | \
+ *-*-unixware7*) add_dir="-L$dir" ;;
+ *-*-darwin* )
+ # if the lib is a (non-dlopened) module then we can not
+ # link against it, someone is ignoring the earlier warnings
+ if /usr/bin/file -L $add 2> /dev/null |
+ $GREP ": [^:]* bundle" >/dev/null ; then
+ if test "X$dlopenmodule" != "X$lib"; then
+ $ECHO "*** Warning: lib $linklib is a module, not a shared library"
+ if test -z "$old_library" ; then
+ echo
+ echo "*** And there doesn't seem to be a static archive available"
+ echo "*** The link will probably fail, sorry"
+ else
+ add="$dir/$old_library"
+ fi
+ elif test -n "$old_library"; then
+ add="$dir/$old_library"
+ fi
+ fi
+ esac
+ elif test "$hardcode_minus_L" = no; then
+ case $host in
+ *-*-sunos*) add_shlibpath="$dir" ;;
+ esac
+ add_dir="-L$dir"
+ add="-l$name"
+ elif test "$hardcode_shlibpath_var" = no; then
+ add_shlibpath="$dir"
+ add="-l$name"
+ else
+ lib_linked=no
+ fi
+ ;;
+ relink)
+ if test "$hardcode_direct" = yes &&
+ test "$hardcode_direct_absolute" = no; then
+ add="$dir/$linklib"
+ elif test "$hardcode_minus_L" = yes; then
+ add_dir="-L$absdir"
+ # Try looking first in the location we're being installed to.
+ if test -n "$inst_prefix_dir"; then
+ case $libdir in
+ [\\/]*)
+ func_append add_dir " -L$inst_prefix_dir$libdir"
+ ;;
+ esac
+ fi
+ add="-l$name"
+ elif test "$hardcode_shlibpath_var" = yes; then
+ add_shlibpath="$dir"
+ add="-l$name"
+ else
+ lib_linked=no
+ fi
+ ;;
+ *) lib_linked=no ;;
+ esac
+
+ if test "$lib_linked" != yes; then
+ func_fatal_configuration "unsupported hardcode properties"
+ fi
+
+ if test -n "$add_shlibpath"; then
+ case :$compile_shlibpath: in
+ *":$add_shlibpath:"*) ;;
+ *) func_append compile_shlibpath "$add_shlibpath:" ;;
+ esac
+ fi
+ if test "$linkmode" = prog; then
+ test -n "$add_dir" && compile_deplibs="$add_dir $compile_deplibs"
+ test -n "$add" && compile_deplibs="$add $compile_deplibs"
+ else
+ test -n "$add_dir" && deplibs="$add_dir $deplibs"
+ test -n "$add" && deplibs="$add $deplibs"
+ if test "$hardcode_direct" != yes &&
+ test "$hardcode_minus_L" != yes &&
+ test "$hardcode_shlibpath_var" = yes; then
+ case :$finalize_shlibpath: in
+ *":$libdir:"*) ;;
+ *) func_append finalize_shlibpath "$libdir:" ;;
+ esac
+ fi
+ fi
+ fi
+
+ if test "$linkmode" = prog || test "$opt_mode" = relink; then
+ add_shlibpath=
+ add_dir=
+ add=
+ # Finalize command for both is simple: just hardcode it.
+ if test "$hardcode_direct" = yes &&
+ test "$hardcode_direct_absolute" = no; then
+ add="$libdir/$linklib"
+ elif test "$hardcode_minus_L" = yes; then
+ add_dir="-L$libdir"
+ add="-l$name"
+ elif test "$hardcode_shlibpath_var" = yes; then
+ case :$finalize_shlibpath: in
+ *":$libdir:"*) ;;
+ *) func_append finalize_shlibpath "$libdir:" ;;
+ esac
+ add="-l$name"
+ elif test "$hardcode_automatic" = yes; then
+ if test -n "$inst_prefix_dir" &&
+ test -f "$inst_prefix_dir$libdir/$linklib" ; then
+ add="$inst_prefix_dir$libdir/$linklib"
+ else
+ add="$libdir/$linklib"
+ fi
+ else
+ # We cannot seem to hardcode it, guess we'll fake it.
+ add_dir="-L$libdir"
+ # Try looking first in the location we're being installed to.
+ if test -n "$inst_prefix_dir"; then
+ case $libdir in
+ [\\/]*)
+ func_append add_dir " -L$inst_prefix_dir$libdir"
+ ;;
+ esac
+ fi
+ add="-l$name"
+ fi
+
+ if test "$linkmode" = prog; then
+ test -n "$add_dir" && finalize_deplibs="$add_dir $finalize_deplibs"
+ test -n "$add" && finalize_deplibs="$add $finalize_deplibs"
+ else
+ test -n "$add_dir" && deplibs="$add_dir $deplibs"
+ test -n "$add" && deplibs="$add $deplibs"
+ fi
+ fi
+ elif test "$linkmode" = prog; then
+ # Here we assume that one of hardcode_direct or hardcode_minus_L
+ # is not unsupported. This is valid on all known static and
+ # shared platforms.
+ if test "$hardcode_direct" != unsupported; then
+ test -n "$old_library" && linklib="$old_library"
+ compile_deplibs="$dir/$linklib $compile_deplibs"
+ finalize_deplibs="$dir/$linklib $finalize_deplibs"
+ else
+ compile_deplibs="-l$name -L$dir $compile_deplibs"
+ finalize_deplibs="-l$name -L$dir $finalize_deplibs"
+ fi
+ elif test "$build_libtool_libs" = yes; then
+ # Not a shared library
+ if test "$deplibs_check_method" != pass_all; then
+ # We're trying link a shared library against a static one
+ # but the system doesn't support it.
+
+ # Just print a warning and add the library to dependency_libs so
+ # that the program can be linked against the static library.
+ echo
+ $ECHO "*** Warning: This system can not link to static lib archive $lib."
+ echo "*** I have the capability to make that library automatically link in when"
+ echo "*** you link to this library. But I can only do this if you have a"
+ echo "*** shared version of the library, which you do not appear to have."
+ if test "$module" = yes; then
+ echo "*** But as you try to build a module library, libtool will still create "
+ echo "*** a static module, that should work as long as the dlopening application"
+ echo "*** is linked with the -dlopen flag to resolve symbols at runtime."
+ if test -z "$global_symbol_pipe"; then
+ echo
+ echo "*** However, this would only work if libtool was able to extract symbol"
+ echo "*** lists from a program, using \`nm' or equivalent, but libtool could"
+ echo "*** not find such a program. So, this module is probably useless."
+ echo "*** \`nm' from GNU binutils and a full rebuild may help."
+ fi
+ if test "$build_old_libs" = no; then
+ build_libtool_libs=module
+ build_old_libs=yes
+ else
+ build_libtool_libs=no
+ fi
+ fi
+ else
+ deplibs="$dir/$old_library $deplibs"
+ link_static=yes
+ fi
+ fi # link shared/static library?
+
+ if test "$linkmode" = lib; then
+ if test -n "$dependency_libs" &&
+ { test "$hardcode_into_libs" != yes ||
+ test "$build_old_libs" = yes ||
+ test "$link_static" = yes; }; then
+ # Extract -R from dependency_libs
+ temp_deplibs=
+ for libdir in $dependency_libs; do
+ case $libdir in
+ -R*) func_stripname '-R' '' "$libdir"
+ temp_xrpath=$func_stripname_result
+ case " $xrpath " in
+ *" $temp_xrpath "*) ;;
+ *) func_append xrpath " $temp_xrpath";;
+ esac;;
+ *) func_append temp_deplibs " $libdir";;
+ esac
+ done
+ dependency_libs="$temp_deplibs"
+ fi
+
+ func_append newlib_search_path " $absdir"
+ # Link against this library
+ test "$link_static" = no && newdependency_libs="$abs_ladir/$laname $newdependency_libs"
+ # ... and its dependency_libs
+ tmp_libs=
+ for deplib in $dependency_libs; do
+ newdependency_libs="$deplib $newdependency_libs"
+ case $deplib in
+ -L*) func_stripname '-L' '' "$deplib"
+ func_resolve_sysroot "$func_stripname_result";;
+ *) func_resolve_sysroot "$deplib" ;;
+ esac
+ if $opt_preserve_dup_deps ; then
+ case "$tmp_libs " in
+ *" $func_resolve_sysroot_result "*)
+ func_append specialdeplibs " $func_resolve_sysroot_result" ;;
+ esac
+ fi
+ func_append tmp_libs " $func_resolve_sysroot_result"
+ done
+
+ if test "$link_all_deplibs" != no; then
+ # Add the search paths of all dependency libraries
+ for deplib in $dependency_libs; do
+ path=
+ case $deplib in
+ -L*) path="$deplib" ;;
+ *.la)
+ func_resolve_sysroot "$deplib"
+ deplib=$func_resolve_sysroot_result
+ func_dirname "$deplib" "" "."
+ dir=$func_dirname_result
+ # We need an absolute path.
+ case $dir in
+ [\\/]* | [A-Za-z]:[\\/]*) absdir="$dir" ;;
+ *)
+ absdir=`cd "$dir" && pwd`
+ if test -z "$absdir"; then
+ func_warning "cannot determine absolute directory name of \`$dir'"
+ absdir="$dir"
+ fi
+ ;;
+ esac
+ if $GREP "^installed=no" $deplib > /dev/null; then
+ case $host in
+ *-*-darwin*)
+ depdepl=
+ eval deplibrary_names=`${SED} -n -e 's/^library_names=\(.*\)$/\1/p' $deplib`
+ if test -n "$deplibrary_names" ; then
+ for tmp in $deplibrary_names ; do
+ depdepl=$tmp
+ done
+ if test -f "$absdir/$objdir/$depdepl" ; then
+ depdepl="$absdir/$objdir/$depdepl"
+ darwin_install_name=`${OTOOL} -L $depdepl | awk '{if (NR == 2) {print $1;exit}}'`
+ if test -z "$darwin_install_name"; then
+ darwin_install_name=`${OTOOL64} -L $depdepl | awk '{if (NR == 2) {print $1;exit}}'`
+ fi
+ func_append compiler_flags " ${wl}-dylib_file ${wl}${darwin_install_name}:${depdepl}"
+ func_append linker_flags " -dylib_file ${darwin_install_name}:${depdepl}"
+ path=
+ fi
+ fi
+ ;;
+ *)
+ path="-L$absdir/$objdir"
+ ;;
+ esac
+ else
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $deplib`
+ test -z "$libdir" && \
+ func_fatal_error "\`$deplib' is not a valid libtool archive"
+ test "$absdir" != "$libdir" && \
+ func_warning "\`$deplib' seems to be moved"
+
+ path="-L$absdir"
+ fi
+ ;;
+ esac
+ case " $deplibs " in
+ *" $path "*) ;;
+ *) deplibs="$path $deplibs" ;;
+ esac
+ done
+ fi # link_all_deplibs != no
+ fi # linkmode = lib
+ done # for deplib in $libs
+ if test "$pass" = link; then
+ if test "$linkmode" = "prog"; then
+ compile_deplibs="$new_inherited_linker_flags $compile_deplibs"
+ finalize_deplibs="$new_inherited_linker_flags $finalize_deplibs"
+ else
+ compiler_flags="$compiler_flags "`$ECHO " $new_inherited_linker_flags" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ fi
+ fi
+ dependency_libs="$newdependency_libs"
+ if test "$pass" = dlpreopen; then
+ # Link the dlpreopened libraries before other libraries
+ for deplib in $save_deplibs; do
+ deplibs="$deplib $deplibs"
+ done
+ fi
+ if test "$pass" != dlopen; then
+ if test "$pass" != conv; then
+ # Make sure lib_search_path contains only unique directories.
+ lib_search_path=
+ for dir in $newlib_search_path; do
+ case "$lib_search_path " in
+ *" $dir "*) ;;
+ *) func_append lib_search_path " $dir" ;;
+ esac
+ done
+ newlib_search_path=
+ fi
+
+ if test "$linkmode,$pass" != "prog,link"; then
+ vars="deplibs"
+ else
+ vars="compile_deplibs finalize_deplibs"
+ fi
+ for var in $vars dependency_libs; do
+ # Add libraries to $var in reverse order
+ eval tmp_libs=\"\$$var\"
+ new_libs=
+ for deplib in $tmp_libs; do
+ # FIXME: Pedantically, this is the right thing to do, so
+ # that some nasty dependency loop isn't accidentally
+ # broken:
+ #new_libs="$deplib $new_libs"
+ # Pragmatically, this seems to cause very few problems in
+ # practice:
+ case $deplib in
+ -L*) new_libs="$deplib $new_libs" ;;
+ -R*) ;;
+ *)
+ # And here is the reason: when a library appears more
+ # than once as an explicit dependence of a library, or
+ # is implicitly linked in more than once by the
+ # compiler, it is considered special, and multiple
+ # occurrences thereof are not removed. Compare this
+ # with having the same library being listed as a
+ # dependency of multiple other libraries: in this case,
+ # we know (pedantically, we assume) the library does not
+ # need to be listed more than once, so we keep only the
+ # last copy. This is not always right, but it is rare
+ # enough that we require users that really mean to play
+ # such unportable linking tricks to link the library
+ # using -Wl,-lname, so that libtool does not consider it
+ # for duplicate removal.
+ case " $specialdeplibs " in
+ *" $deplib "*) new_libs="$deplib $new_libs" ;;
+ *)
+ case " $new_libs " in
+ *" $deplib "*) ;;
+ *) new_libs="$deplib $new_libs" ;;
+ esac
+ ;;
+ esac
+ ;;
+ esac
+ done
+ tmp_libs=
+ for deplib in $new_libs; do
+ case $deplib in
+ -L*)
+ case " $tmp_libs " in
+ *" $deplib "*) ;;
+ *) func_append tmp_libs " $deplib" ;;
+ esac
+ ;;
+ *) func_append tmp_libs " $deplib" ;;
+ esac
+ done
+ eval $var=\"$tmp_libs\"
+ done # for var
+ fi
+ # Last step: remove runtime libs from dependency_libs
+ # (they stay in deplibs)
+ tmp_libs=
+ for i in $dependency_libs ; do
+ case " $predeps $postdeps $compiler_lib_search_path " in
+ *" $i "*)
+ i=""
+ ;;
+ esac
+ if test -n "$i" ; then
+ func_append tmp_libs " $i"
+ fi
+ done
+ dependency_libs=$tmp_libs
+ done # for pass
+ if test "$linkmode" = prog; then
+ dlfiles="$newdlfiles"
+ fi
+ if test "$linkmode" = prog || test "$linkmode" = lib; then
+ dlprefiles="$newdlprefiles"
+ fi
+
+ case $linkmode in
+ oldlib)
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ func_warning "\`-dlopen' is ignored for archives"
+ fi
+
+ case " $deplibs" in
+ *\ -l* | *\ -L*)
+ func_warning "\`-l' and \`-L' are ignored for archives" ;;
+ esac
+
+ test -n "$rpath" && \
+ func_warning "\`-rpath' is ignored for archives"
+
+ test -n "$xrpath" && \
+ func_warning "\`-R' is ignored for archives"
+
+ test -n "$vinfo" && \
+ func_warning "\`-version-info/-version-number' is ignored for archives"
+
+ test -n "$release" && \
+ func_warning "\`-release' is ignored for archives"
+
+ test -n "$export_symbols$export_symbols_regex" && \
+ func_warning "\`-export-symbols' is ignored for archives"
+
+ # Now set the variables for building old libraries.
+ build_libtool_libs=no
+ oldlibs="$output"
+ func_append objs "$old_deplibs"
+ ;;
+
+ lib)
+ # Make sure we only generate libraries of the form `libNAME.la'.
+ case $outputname in
+ lib*)
+ func_stripname 'lib' '.la' "$outputname"
+ name=$func_stripname_result
+ eval shared_ext=\"$shrext_cmds\"
+ eval libname=\"$libname_spec\"
+ ;;
+ *)
+ test "$module" = no && \
+ func_fatal_help "libtool library \`$output' must begin with \`lib'"
+
+ if test "$need_lib_prefix" != no; then
+ # Add the "lib" prefix for modules if required
+ func_stripname '' '.la' "$outputname"
+ name=$func_stripname_result
+ eval shared_ext=\"$shrext_cmds\"
+ eval libname=\"$libname_spec\"
+ else
+ func_stripname '' '.la' "$outputname"
+ libname=$func_stripname_result
+ fi
+ ;;
+ esac
+
+ if test -n "$objs"; then
+ if test "$deplibs_check_method" != pass_all; then
+ func_fatal_error "cannot build libtool library \`$output' from non-libtool objects on this host:$objs"
+ else
+ echo
+ $ECHO "*** Warning: Linking the shared library $output against the non-libtool"
+ $ECHO "*** objects $objs is not portable!"
+ func_append libobjs " $objs"
+ fi
+ fi
+
+ test "$dlself" != no && \
+ func_warning "\`-dlopen self' is ignored for libtool libraries"
+
+ set dummy $rpath
+ shift
+ test "$#" -gt 1 && \
+ func_warning "ignoring multiple \`-rpath's for a libtool library"
+
+ install_libdir="$1"
+
+ oldlibs=
+ if test -z "$rpath"; then
+ if test "$build_libtool_libs" = yes; then
+ # Building a libtool convenience library.
+ # Some compilers have problems with a `.al' extension so
+ # convenience libraries should have the same extension an
+ # archive normally would.
+ oldlibs="$output_objdir/$libname.$libext $oldlibs"
+ build_libtool_libs=convenience
+ build_old_libs=yes
+ fi
+
+ test -n "$vinfo" && \
+ func_warning "\`-version-info/-version-number' is ignored for convenience libraries"
+
+ test -n "$release" && \
+ func_warning "\`-release' is ignored for convenience libraries"
+ else
+
+ # Parse the version information argument.
+ save_ifs="$IFS"; IFS=':'
+ set dummy $vinfo 0 0 0
+ shift
+ IFS="$save_ifs"
+
+ test -n "$7" && \
+ func_fatal_help "too many parameters to \`-version-info'"
+
+ # convert absolute version numbers to libtool ages
+ # this retains compatibility with .la files and attempts
+ # to make the code below a bit more comprehensible
+
+ case $vinfo_number in
+ yes)
+ number_major="$1"
+ number_minor="$2"
+ number_revision="$3"
+ #
+ # There are really only two kinds -- those that
+ # use the current revision as the major version
+ # and those that subtract age and use age as
+ # a minor version. But, then there is irix
+ # which has an extra 1 added just for fun
+ #
+ case $version_type in
+ # correct linux to gnu/linux during the next big refactor
+ darwin|linux|osf|windows|none)
+ func_arith $number_major + $number_minor
+ current=$func_arith_result
+ age="$number_minor"
+ revision="$number_revision"
+ ;;
+ freebsd-aout|freebsd-elf|qnx|sunos)
+ current="$number_major"
+ revision="$number_minor"
+ age="0"
+ ;;
+ irix|nonstopux)
+ func_arith $number_major + $number_minor
+ current=$func_arith_result
+ age="$number_minor"
+ revision="$number_minor"
+ lt_irix_increment=no
+ ;;
+ esac
+ ;;
+ no)
+ current="$1"
+ revision="$2"
+ age="$3"
+ ;;
+ esac
+
+ # Check that each of the things are valid numbers.
+ case $current in
+ 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+ *)
+ func_error "CURRENT \`$current' must be a nonnegative integer"
+ func_fatal_error "\`$vinfo' is not valid version information"
+ ;;
+ esac
+
+ case $revision in
+ 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+ *)
+ func_error "REVISION \`$revision' must be a nonnegative integer"
+ func_fatal_error "\`$vinfo' is not valid version information"
+ ;;
+ esac
+
+ case $age in
+ 0|[1-9]|[1-9][0-9]|[1-9][0-9][0-9]|[1-9][0-9][0-9][0-9]|[1-9][0-9][0-9][0-9][0-9]) ;;
+ *)
+ func_error "AGE \`$age' must be a nonnegative integer"
+ func_fatal_error "\`$vinfo' is not valid version information"
+ ;;
+ esac
+
+ if test "$age" -gt "$current"; then
+ func_error "AGE \`$age' is greater than the current interface number \`$current'"
+ func_fatal_error "\`$vinfo' is not valid version information"
+ fi
+
+ # Calculate the version variables.
+ major=
+ versuffix=
+ verstring=
+ case $version_type in
+ none) ;;
+
+ darwin)
+ # Like Linux, but with the current version available in
+ # verstring for coding it into the library header
+ func_arith $current - $age
+ major=.$func_arith_result
+ versuffix="$major.$age.$revision"
+ # Darwin ld doesn't like 0 for these options...
+ func_arith $current + 1
+ minor_current=$func_arith_result
+ xlcverstring="${wl}-compatibility_version ${wl}$minor_current ${wl}-current_version ${wl}$minor_current.$revision"
+ verstring="-compatibility_version $minor_current -current_version $minor_current.$revision"
+ ;;
+
+ freebsd-aout)
+ major=".$current"
+ versuffix=".$current.$revision";
+ ;;
+
+ freebsd-elf)
+ major=".$current"
+ versuffix=".$current"
+ ;;
+
+ irix | nonstopux)
+ if test "X$lt_irix_increment" = "Xno"; then
+ func_arith $current - $age
+ else
+ func_arith $current - $age + 1
+ fi
+ major=$func_arith_result
+
+ case $version_type in
+ nonstopux) verstring_prefix=nonstopux ;;
+ *) verstring_prefix=sgi ;;
+ esac
+ verstring="$verstring_prefix$major.$revision"
+
+ # Add in all the interfaces that we are compatible with.
+ loop=$revision
+ while test "$loop" -ne 0; do
+ func_arith $revision - $loop
+ iface=$func_arith_result
+ func_arith $loop - 1
+ loop=$func_arith_result
+ verstring="$verstring_prefix$major.$iface:$verstring"
+ done
+
+ # Before this point, $major must not contain `.'.
+ major=.$major
+ versuffix="$major.$revision"
+ ;;
+
+ linux) # correct to gnu/linux during the next big refactor
+ func_arith $current - $age
+ major=.$func_arith_result
+ versuffix="$major.$age.$revision"
+ ;;
+
+ osf)
+ func_arith $current - $age
+ major=.$func_arith_result
+ versuffix=".$current.$age.$revision"
+ verstring="$current.$age.$revision"
+
+ # Add in all the interfaces that we are compatible with.
+ loop=$age
+ while test "$loop" -ne 0; do
+ func_arith $current - $loop
+ iface=$func_arith_result
+ func_arith $loop - 1
+ loop=$func_arith_result
+ verstring="$verstring:${iface}.0"
+ done
+
+ # Make executables depend on our current version.
+ func_append verstring ":${current}.0"
+ ;;
+
+ qnx)
+ major=".$current"
+ versuffix=".$current"
+ ;;
+
+ sunos)
+ major=".$current"
+ versuffix=".$current.$revision"
+ ;;
+
+ windows)
+ # Use '-' rather than '.', since we only want one
+ # extension on DOS 8.3 filesystems.
+ func_arith $current - $age
+ major=$func_arith_result
+ versuffix="-$major"
+ ;;
+
+ *)
+ func_fatal_configuration "unknown library version type \`$version_type'"
+ ;;
+ esac
+
+ # Clear the version info if we defaulted, and they specified a release.
+ if test -z "$vinfo" && test -n "$release"; then
+ major=
+ case $version_type in
+ darwin)
+ # we can't check for "0.0" in archive_cmds due to quoting
+ # problems, so we reset it completely
+ verstring=
+ ;;
+ *)
+ verstring="0.0"
+ ;;
+ esac
+ if test "$need_version" = no; then
+ versuffix=
+ else
+ versuffix=".0.0"
+ fi
+ fi
+
+ # Remove version info from name if versioning should be avoided
+ if test "$avoid_version" = yes && test "$need_version" = no; then
+ major=
+ versuffix=
+ verstring=""
+ fi
+
+ # Check to see if the archive will have undefined symbols.
+ if test "$allow_undefined" = yes; then
+ if test "$allow_undefined_flag" = unsupported; then
+ func_warning "undefined symbols not allowed in $host shared libraries"
+ build_libtool_libs=no
+ build_old_libs=yes
+ fi
+ else
+ # Don't allow undefined symbols.
+ allow_undefined_flag="$no_undefined_flag"
+ fi
+
+ fi
+
+ func_generate_dlsyms "$libname" "$libname" "yes"
+ func_append libobjs " $symfileobj"
+ test "X$libobjs" = "X " && libobjs=
+
+ if test "$opt_mode" != relink; then
+ # Remove our outputs, but don't remove object files since they
+ # may have been created when compiling PIC objects.
+ removelist=
+ tempremovelist=`$ECHO "$output_objdir/*"`
+ for p in $tempremovelist; do
+ case $p in
+ *.$objext | *.gcno)
+ ;;
+ $output_objdir/$outputname | $output_objdir/$libname.* | $output_objdir/${libname}${release}.*)
+ if test "X$precious_files_regex" != "X"; then
+ if $ECHO "$p" | $EGREP -e "$precious_files_regex" >/dev/null 2>&1
+ then
+ continue
+ fi
+ fi
+ func_append removelist " $p"
+ ;;
+ *) ;;
+ esac
+ done
+ test -n "$removelist" && \
+ func_show_eval "${RM}r \$removelist"
+ fi
+
+ # Now set the variables for building old libraries.
+ if test "$build_old_libs" = yes && test "$build_libtool_libs" != convenience ; then
+ func_append oldlibs " $output_objdir/$libname.$libext"
+
+ # Transform .lo files to .o files.
+ oldobjs="$objs "`$ECHO "$libobjs" | $SP2NL | $SED "/\.${libext}$/d; $lo2o" | $NL2SP`
+ fi
+
+ # Eliminate all temporary directories.
+ #for path in $notinst_path; do
+ # lib_search_path=`$ECHO "$lib_search_path " | $SED "s% $path % %g"`
+ # deplibs=`$ECHO "$deplibs " | $SED "s% -L$path % %g"`
+ # dependency_libs=`$ECHO "$dependency_libs " | $SED "s% -L$path % %g"`
+ #done
+
+ if test -n "$xrpath"; then
+ # If the user specified any rpath flags, then add them.
+ temp_xrpath=
+ for libdir in $xrpath; do
+ func_replace_sysroot "$libdir"
+ func_append temp_xrpath " -R$func_replace_sysroot_result"
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) func_append finalize_rpath " $libdir" ;;
+ esac
+ done
+ if test "$hardcode_into_libs" != yes || test "$build_old_libs" = yes; then
+ dependency_libs="$temp_xrpath $dependency_libs"
+ fi
+ fi
+
+ # Make sure dlfiles contains only unique files that won't be dlpreopened
+ old_dlfiles="$dlfiles"
+ dlfiles=
+ for lib in $old_dlfiles; do
+ case " $dlprefiles $dlfiles " in
+ *" $lib "*) ;;
+ *) func_append dlfiles " $lib" ;;
+ esac
+ done
+
+ # Make sure dlprefiles contains only unique files
+ old_dlprefiles="$dlprefiles"
+ dlprefiles=
+ for lib in $old_dlprefiles; do
+ case "$dlprefiles " in
+ *" $lib "*) ;;
+ *) func_append dlprefiles " $lib" ;;
+ esac
+ done
+
+ if test "$build_libtool_libs" = yes; then
+ if test -n "$rpath"; then
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-*-beos* | *-cegcc* | *-*-haiku*)
+ # these systems don't actually have a c library (as such)!
+ ;;
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # Rhapsody C library is in the System framework
+ func_append deplibs " System.ltframework"
+ ;;
+ *-*-netbsd*)
+ # Don't link with libc until the a.out ld.so is fixed.
+ ;;
+ *-*-openbsd* | *-*-freebsd* | *-*-dragonfly*)
+ # Do not include libc due to us having libc/libc_r.
+ ;;
+ *-*-sco3.2v5* | *-*-sco5v6*)
+ # Causes problems with __ctype
+ ;;
+ *-*-sysv4.2uw2* | *-*-sysv5* | *-*-unixware* | *-*-OpenUNIX*)
+ # Compiler inserts libc in the correct place for threads to work
+ ;;
+ *)
+ # Add libc to deplibs on all other systems if necessary.
+ if test "$build_libtool_need_lc" = "yes"; then
+ func_append deplibs " -lc"
+ fi
+ ;;
+ esac
+ fi
+
+ # Transform deplibs into only deplibs that can be linked in shared.
+ name_save=$name
+ libname_save=$libname
+ release_save=$release
+ versuffix_save=$versuffix
+ major_save=$major
+ # I'm not sure if I'm treating the release correctly. I think
+ # release should show up in the -l (ie -lgmp5) so we don't want to
+ # add it in twice. Is that correct?
+ release=""
+ versuffix=""
+ major=""
+ newdeplibs=
+ droppeddeps=no
+ case $deplibs_check_method in
+ pass_all)
+ # Don't check for shared/static. Everything works.
+ # This might be a little naive. We might want to check
+ # whether the library exists or not. But this is on
+ # osf3 & osf4 and I'm not really sure... Just
+ # implementing what was already the behavior.
+ newdeplibs=$deplibs
+ ;;
+ test_compile)
+ # This code stresses the "libraries are programs" paradigm to its
+ # limits. Maybe even breaks it. We compile a program, linking it
+ # against the deplibs as a proxy for the library. Then we can check
+ # whether they linked in statically or dynamically with ldd.
+ $opt_dry_run || $RM conftest.c
+ cat > conftest.c </dev/null`
+ $nocaseglob
+ else
+ potential_libs=`ls $i/$libnameglob[.-]* 2>/dev/null`
+ fi
+ for potent_lib in $potential_libs; do
+ # Follow soft links.
+ if ls -lLd "$potent_lib" 2>/dev/null |
+ $GREP " -> " >/dev/null; then
+ continue
+ fi
+ # The statement above tries to avoid entering an
+ # endless loop below, in case of cyclic links.
+ # We might still enter an endless loop, since a link
+ # loop can be closed while we follow links,
+ # but so what?
+ potlib="$potent_lib"
+ while test -h "$potlib" 2>/dev/null; do
+ potliblink=`ls -ld $potlib | ${SED} 's/.* -> //'`
+ case $potliblink in
+ [\\/]* | [A-Za-z]:[\\/]*) potlib="$potliblink";;
+ *) potlib=`$ECHO "$potlib" | $SED 's,[^/]*$,,'`"$potliblink";;
+ esac
+ done
+ if eval $file_magic_cmd \"\$potlib\" 2>/dev/null |
+ $SED -e 10q |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ func_append newdeplibs " $a_deplib"
+ a_deplib=""
+ break 2
+ fi
+ done
+ done
+ fi
+ if test -n "$a_deplib" ; then
+ droppeddeps=yes
+ echo
+ $ECHO "*** Warning: linker path does not have real file for library $a_deplib."
+ echo "*** I have the capability to make that library automatically link in when"
+ echo "*** you link to this library. But I can only do this if you have a"
+ echo "*** shared version of the library, which you do not appear to have"
+ echo "*** because I did check the linker path looking for a file starting"
+ if test -z "$potlib" ; then
+ $ECHO "*** with $libname but no candidates were found. (...for file magic test)"
+ else
+ $ECHO "*** with $libname and none of the candidates passed a file format test"
+ $ECHO "*** using a file magic. Last file checked: $potlib"
+ fi
+ fi
+ ;;
+ *)
+ # Add a -L argument.
+ func_append newdeplibs " $a_deplib"
+ ;;
+ esac
+ done # Gone through all deplibs.
+ ;;
+ match_pattern*)
+ set dummy $deplibs_check_method; shift
+ match_pattern_regex=`expr "$deplibs_check_method" : "$1 \(.*\)"`
+ for a_deplib in $deplibs; do
+ case $a_deplib in
+ -l*)
+ func_stripname -l '' "$a_deplib"
+ name=$func_stripname_result
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ case " $predeps $postdeps " in
+ *" $a_deplib "*)
+ func_append newdeplibs " $a_deplib"
+ a_deplib=""
+ ;;
+ esac
+ fi
+ if test -n "$a_deplib" ; then
+ libname=`eval "\\$ECHO \"$libname_spec\""`
+ for i in $lib_search_path $sys_lib_search_path $shlib_search_path; do
+ potential_libs=`ls $i/$libname[.-]* 2>/dev/null`
+ for potent_lib in $potential_libs; do
+ potlib="$potent_lib" # see symlink-check above in file_magic test
+ if eval "\$ECHO \"$potent_lib\"" 2>/dev/null | $SED 10q | \
+ $EGREP "$match_pattern_regex" > /dev/null; then
+ func_append newdeplibs " $a_deplib"
+ a_deplib=""
+ break 2
+ fi
+ done
+ done
+ fi
+ if test -n "$a_deplib" ; then
+ droppeddeps=yes
+ echo
+ $ECHO "*** Warning: linker path does not have real file for library $a_deplib."
+ echo "*** I have the capability to make that library automatically link in when"
+ echo "*** you link to this library. But I can only do this if you have a"
+ echo "*** shared version of the library, which you do not appear to have"
+ echo "*** because I did check the linker path looking for a file starting"
+ if test -z "$potlib" ; then
+ $ECHO "*** with $libname but no candidates were found. (...for regex pattern test)"
+ else
+ $ECHO "*** with $libname and none of the candidates passed a file format test"
+ $ECHO "*** using a regex pattern. Last file checked: $potlib"
+ fi
+ fi
+ ;;
+ *)
+ # Add a -L argument.
+ func_append newdeplibs " $a_deplib"
+ ;;
+ esac
+ done # Gone through all deplibs.
+ ;;
+ none | unknown | *)
+ newdeplibs=""
+ tmp_deplibs=`$ECHO " $deplibs" | $SED 's/ -lc$//; s/ -[LR][^ ]*//g'`
+ if test "X$allow_libtool_libs_with_static_runtimes" = "Xyes" ; then
+ for i in $predeps $postdeps ; do
+ # can't use Xsed below, because $i might contain '/'
+ tmp_deplibs=`$ECHO " $tmp_deplibs" | $SED "s,$i,,"`
+ done
+ fi
+ case $tmp_deplibs in
+ *[!\ \ ]*)
+ echo
+ if test "X$deplibs_check_method" = "Xnone"; then
+ echo "*** Warning: inter-library dependencies are not supported in this platform."
+ else
+ echo "*** Warning: inter-library dependencies are not known to be supported."
+ fi
+ echo "*** All declared inter-library dependencies are being dropped."
+ droppeddeps=yes
+ ;;
+ esac
+ ;;
+ esac
+ versuffix=$versuffix_save
+ major=$major_save
+ release=$release_save
+ libname=$libname_save
+ name=$name_save
+
+ case $host in
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # On Rhapsody replace the C library with the System framework
+ newdeplibs=`$ECHO " $newdeplibs" | $SED 's/ -lc / System.ltframework /'`
+ ;;
+ esac
+
+ if test "$droppeddeps" = yes; then
+ if test "$module" = yes; then
+ echo
+ echo "*** Warning: libtool could not satisfy all declared inter-library"
+ $ECHO "*** dependencies of module $libname. Therefore, libtool will create"
+ echo "*** a static module, that should work as long as the dlopening"
+ echo "*** application is linked with the -dlopen flag."
+ if test -z "$global_symbol_pipe"; then
+ echo
+ echo "*** However, this would only work if libtool was able to extract symbol"
+ echo "*** lists from a program, using \`nm' or equivalent, but libtool could"
+ echo "*** not find such a program. So, this module is probably useless."
+ echo "*** \`nm' from GNU binutils and a full rebuild may help."
+ fi
+ if test "$build_old_libs" = no; then
+ oldlibs="$output_objdir/$libname.$libext"
+ build_libtool_libs=module
+ build_old_libs=yes
+ else
+ build_libtool_libs=no
+ fi
+ else
+ echo "*** The inter-library dependencies that have been dropped here will be"
+ echo "*** automatically added whenever a program is linked with this library"
+ echo "*** or is declared to -dlopen it."
+
+ if test "$allow_undefined" = no; then
+ echo
+ echo "*** Since this library must not contain undefined symbols,"
+ echo "*** because either the platform does not support them or"
+ echo "*** it was explicitly requested with -no-undefined,"
+ echo "*** libtool will only create a static version of it."
+ if test "$build_old_libs" = no; then
+ oldlibs="$output_objdir/$libname.$libext"
+ build_libtool_libs=module
+ build_old_libs=yes
+ else
+ build_libtool_libs=no
+ fi
+ fi
+ fi
+ fi
+ # Done checking deplibs!
+ deplibs=$newdeplibs
+ fi
+ # Time to change all our "foo.ltframework" stuff back to "-framework foo"
+ case $host in
+ *-*-darwin*)
+ newdeplibs=`$ECHO " $newdeplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ new_inherited_linker_flags=`$ECHO " $new_inherited_linker_flags" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ deplibs=`$ECHO " $deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ ;;
+ esac
+
+ # move library search paths that coincide with paths to not yet
+ # installed libraries to the beginning of the library search list
+ new_libs=
+ for path in $notinst_path; do
+ case " $new_libs " in
+ *" -L$path/$objdir "*) ;;
+ *)
+ case " $deplibs " in
+ *" -L$path/$objdir "*)
+ func_append new_libs " -L$path/$objdir" ;;
+ esac
+ ;;
+ esac
+ done
+ for deplib in $deplibs; do
+ case $deplib in
+ -L*)
+ case " $new_libs " in
+ *" $deplib "*) ;;
+ *) func_append new_libs " $deplib" ;;
+ esac
+ ;;
+ *) func_append new_libs " $deplib" ;;
+ esac
+ done
+ deplibs="$new_libs"
+
+ # All the library-specific variables (install_libdir is set above).
+ library_names=
+ old_library=
+ dlname=
+
+ # Test again, we may have decided not to build it any more
+ if test "$build_libtool_libs" = yes; then
+ # Remove ${wl} instances when linking with ld.
+ # FIXME: should test the right _cmds variable.
+ case $archive_cmds in
+ *\$LD\ *) wl= ;;
+ esac
+ if test "$hardcode_into_libs" = yes; then
+ # Hardcode the library paths
+ hardcode_libdirs=
+ dep_rpath=
+ rpath="$finalize_rpath"
+ test "$opt_mode" != relink && rpath="$compile_rpath$rpath"
+ for libdir in $rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ func_replace_sysroot "$libdir"
+ libdir=$func_replace_sysroot_result
+ if test -z "$hardcode_libdirs"; then
+ hardcode_libdirs="$libdir"
+ else
+ # Just accumulate the unique libdirs.
+ case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ func_append hardcode_libdirs "$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ fi
+ else
+ eval flag=\"$hardcode_libdir_flag_spec\"
+ func_append dep_rpath " $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$perm_rpath " in
+ *" $libdir "*) ;;
+ *) func_append perm_rpath " $libdir" ;;
+ esac
+ fi
+ done
+ # Substitute the hardcoded libdirs into the rpath.
+ if test -n "$hardcode_libdir_separator" &&
+ test -n "$hardcode_libdirs"; then
+ libdir="$hardcode_libdirs"
+ eval "dep_rpath=\"$hardcode_libdir_flag_spec\""
+ fi
+ if test -n "$runpath_var" && test -n "$perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $perm_rpath; do
+ func_append rpath "$dir:"
+ done
+ eval "$runpath_var='$rpath\$$runpath_var'; export $runpath_var"
+ fi
+ test -n "$dep_rpath" && deplibs="$dep_rpath $deplibs"
+ fi
+
+ shlibpath="$finalize_shlibpath"
+ test "$opt_mode" != relink && shlibpath="$compile_shlibpath$shlibpath"
+ if test -n "$shlibpath"; then
+ eval "$shlibpath_var='$shlibpath\$$shlibpath_var'; export $shlibpath_var"
+ fi
+
+ # Get the real and link names of the library.
+ eval shared_ext=\"$shrext_cmds\"
+ eval library_names=\"$library_names_spec\"
+ set dummy $library_names
+ shift
+ realname="$1"
+ shift
+
+ if test -n "$soname_spec"; then
+ eval soname=\"$soname_spec\"
+ else
+ soname="$realname"
+ fi
+ if test -z "$dlname"; then
+ dlname=$soname
+ fi
+
+ lib="$output_objdir/$realname"
+ linknames=
+ for link
+ do
+ func_append linknames " $link"
+ done
+
+ # Use standard objects if they are pic
+ test -z "$pic_flag" && libobjs=`$ECHO "$libobjs" | $SP2NL | $SED "$lo2o" | $NL2SP`
+ test "X$libobjs" = "X " && libobjs=
+
+ delfiles=
+ if test -n "$export_symbols" && test -n "$include_expsyms"; then
+ $opt_dry_run || cp "$export_symbols" "$output_objdir/$libname.uexp"
+ export_symbols="$output_objdir/$libname.uexp"
+ func_append delfiles " $export_symbols"
+ fi
+
+ orig_export_symbols=
+ case $host_os in
+ cygwin* | mingw* | cegcc*)
+ if test -n "$export_symbols" && test -z "$export_symbols_regex"; then
+ # exporting using user supplied symfile
+ if test "x`$SED 1q $export_symbols`" != xEXPORTS; then
+ # and it's NOT already a .def file. Must figure out
+ # which of the given symbols are data symbols and tag
+ # them as such. So, trigger use of export_symbols_cmds.
+ # export_symbols gets reassigned inside the "prepare
+ # the list of exported symbols" if statement, so the
+ # include_expsyms logic still works.
+ orig_export_symbols="$export_symbols"
+ export_symbols=
+ always_export_symbols=yes
+ fi
+ fi
+ ;;
+ esac
+
+ # Prepare the list of exported symbols
+ if test -z "$export_symbols"; then
+ if test "$always_export_symbols" = yes || test -n "$export_symbols_regex"; then
+ func_verbose "generating symbol list for \`$libname.la'"
+ export_symbols="$output_objdir/$libname.exp"
+ $opt_dry_run || $RM $export_symbols
+ cmds=$export_symbols_cmds
+ save_ifs="$IFS"; IFS='~'
+ for cmd1 in $cmds; do
+ IFS="$save_ifs"
+ # Take the normal branch if the nm_file_list_spec branch
+ # doesn't work or if tool conversion is not needed.
+ case $nm_file_list_spec~$to_tool_file_cmd in
+ *~func_convert_file_noop | *~func_convert_file_msys_to_w32 | ~*)
+ try_normal_branch=yes
+ eval cmd=\"$cmd1\"
+ func_len " $cmd"
+ len=$func_len_result
+ ;;
+ *)
+ try_normal_branch=no
+ ;;
+ esac
+ if test "$try_normal_branch" = yes \
+ && { test "$len" -lt "$max_cmd_len" \
+ || test "$max_cmd_len" -le -1; }
+ then
+ func_show_eval "$cmd" 'exit $?'
+ skipped_export=false
+ elif test -n "$nm_file_list_spec"; then
+ func_basename "$output"
+ output_la=$func_basename_result
+ save_libobjs=$libobjs
+ save_output=$output
+ output=${output_objdir}/${output_la}.nm
+ func_to_tool_file "$output"
+ libobjs=$nm_file_list_spec$func_to_tool_file_result
+ func_append delfiles " $output"
+ func_verbose "creating $NM input file list: $output"
+ for obj in $save_libobjs; do
+ func_to_tool_file "$obj"
+ $ECHO "$func_to_tool_file_result"
+ done > "$output"
+ eval cmd=\"$cmd1\"
+ func_show_eval "$cmd" 'exit $?'
+ output=$save_output
+ libobjs=$save_libobjs
+ skipped_export=false
+ else
+ # The command line is too long to execute in one step.
+ func_verbose "using reloadable object file for export list..."
+ skipped_export=:
+ # Break out early, otherwise skipped_export may be
+ # set to false by a later but shorter cmd.
+ break
+ fi
+ done
+ IFS="$save_ifs"
+ if test -n "$export_symbols_regex" && test "X$skipped_export" != "X:"; then
+ func_show_eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"'
+ func_show_eval '$MV "${export_symbols}T" "$export_symbols"'
+ fi
+ fi
+ fi
+
+ if test -n "$export_symbols" && test -n "$include_expsyms"; then
+ tmp_export_symbols="$export_symbols"
+ test -n "$orig_export_symbols" && tmp_export_symbols="$orig_export_symbols"
+ $opt_dry_run || eval '$ECHO "$include_expsyms" | $SP2NL >> "$tmp_export_symbols"'
+ fi
+
+ if test "X$skipped_export" != "X:" && test -n "$orig_export_symbols"; then
+ # The given exports_symbols file has to be filtered, so filter it.
+ func_verbose "filter symbol list for \`$libname.la' to tag DATA exports"
+ # FIXME: $output_objdir/$libname.filter potentially contains lots of
+ # 's' commands which not all seds can handle. GNU sed should be fine
+ # though. Also, the filter scales superlinearly with the number of
+ # global variables. join(1) would be nice here, but unfortunately
+ # isn't a blessed tool.
+ $opt_dry_run || $SED -e '/[ ,]DATA/!d;s,\(.*\)\([ \,].*\),s|^\1$|\1\2|,' < $export_symbols > $output_objdir/$libname.filter
+ func_append delfiles " $export_symbols $output_objdir/$libname.filter"
+ export_symbols=$output_objdir/$libname.def
+ $opt_dry_run || $SED -f $output_objdir/$libname.filter < $orig_export_symbols > $export_symbols
+ fi
+
+ tmp_deplibs=
+ for test_deplib in $deplibs; do
+ case " $convenience " in
+ *" $test_deplib "*) ;;
+ *)
+ func_append tmp_deplibs " $test_deplib"
+ ;;
+ esac
+ done
+ deplibs="$tmp_deplibs"
+
+ if test -n "$convenience"; then
+ if test -n "$whole_archive_flag_spec" &&
+ test "$compiler_needs_object" = yes &&
+ test -z "$libobjs"; then
+ # extract the archives, so we have objects to list.
+ # TODO: could optimize this to just extract one archive.
+ whole_archive_flag_spec=
+ fi
+ if test -n "$whole_archive_flag_spec"; then
+ save_libobjs=$libobjs
+ eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+ test "X$libobjs" = "X " && libobjs=
+ else
+ gentop="$output_objdir/${outputname}x"
+ func_append generated " $gentop"
+
+ func_extract_archives $gentop $convenience
+ func_append libobjs " $func_extract_archives_result"
+ test "X$libobjs" = "X " && libobjs=
+ fi
+ fi
+
+ if test "$thread_safe" = yes && test -n "$thread_safe_flag_spec"; then
+ eval flag=\"$thread_safe_flag_spec\"
+ func_append linker_flags " $flag"
+ fi
+
+ # Make a backup of the uninstalled library when relinking
+ if test "$opt_mode" = relink; then
+ $opt_dry_run || eval '(cd $output_objdir && $RM ${realname}U && $MV $realname ${realname}U)' || exit $?
+ fi
+
+ # Do each of the archive commands.
+ if test "$module" = yes && test -n "$module_cmds" ; then
+ if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then
+ eval test_cmds=\"$module_expsym_cmds\"
+ cmds=$module_expsym_cmds
+ else
+ eval test_cmds=\"$module_cmds\"
+ cmds=$module_cmds
+ fi
+ else
+ if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then
+ eval test_cmds=\"$archive_expsym_cmds\"
+ cmds=$archive_expsym_cmds
+ else
+ eval test_cmds=\"$archive_cmds\"
+ cmds=$archive_cmds
+ fi
+ fi
+
+ if test "X$skipped_export" != "X:" &&
+ func_len " $test_cmds" &&
+ len=$func_len_result &&
+ test "$len" -lt "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+ :
+ else
+ # The command line is too long to link in one step, link piecewise
+ # or, if using GNU ld and skipped_export is not :, use a linker
+ # script.
+
+ # Save the value of $output and $libobjs because we want to
+ # use them later. If we have whole_archive_flag_spec, we
+ # want to use save_libobjs as it was before
+ # whole_archive_flag_spec was expanded, because we can't
+ # assume the linker understands whole_archive_flag_spec.
+ # This may have to be revisited, in case too many
+ # convenience libraries get linked in and end up exceeding
+ # the spec.
+ if test -z "$convenience" || test -z "$whole_archive_flag_spec"; then
+ save_libobjs=$libobjs
+ fi
+ save_output=$output
+ func_basename "$output"
+ output_la=$func_basename_result
+
+ # Clear the reloadable object creation command queue and
+ # initialize k to one.
+ test_cmds=
+ concat_cmds=
+ objlist=
+ last_robj=
+ k=1
+
+ if test -n "$save_libobjs" && test "X$skipped_export" != "X:" && test "$with_gnu_ld" = yes; then
+ output=${output_objdir}/${output_la}.lnkscript
+ func_verbose "creating GNU ld script: $output"
+ echo 'INPUT (' > $output
+ for obj in $save_libobjs
+ do
+ func_to_tool_file "$obj"
+ $ECHO "$func_to_tool_file_result" >> $output
+ done
+ echo ')' >> $output
+ func_append delfiles " $output"
+ func_to_tool_file "$output"
+ output=$func_to_tool_file_result
+ elif test -n "$save_libobjs" && test "X$skipped_export" != "X:" && test "X$file_list_spec" != X; then
+ output=${output_objdir}/${output_la}.lnk
+ func_verbose "creating linker input file list: $output"
+ : > $output
+ set x $save_libobjs
+ shift
+ firstobj=
+ if test "$compiler_needs_object" = yes; then
+ firstobj="$1 "
+ shift
+ fi
+ for obj
+ do
+ func_to_tool_file "$obj"
+ $ECHO "$func_to_tool_file_result" >> $output
+ done
+ func_append delfiles " $output"
+ func_to_tool_file "$output"
+ output=$firstobj\"$file_list_spec$func_to_tool_file_result\"
+ else
+ if test -n "$save_libobjs"; then
+ func_verbose "creating reloadable object files..."
+ output=$output_objdir/$output_la-${k}.$objext
+ eval test_cmds=\"$reload_cmds\"
+ func_len " $test_cmds"
+ len0=$func_len_result
+ len=$len0
+
+ # Loop over the list of objects to be linked.
+ for obj in $save_libobjs
+ do
+ func_len " $obj"
+ func_arith $len + $func_len_result
+ len=$func_arith_result
+ if test "X$objlist" = X ||
+ test "$len" -lt "$max_cmd_len"; then
+ func_append objlist " $obj"
+ else
+ # The command $test_cmds is almost too long, add a
+ # command to the queue.
+ if test "$k" -eq 1 ; then
+ # The first file doesn't have a previous command to add.
+ reload_objs=$objlist
+ eval concat_cmds=\"$reload_cmds\"
+ else
+ # All subsequent reloadable object files will link in
+ # the last one created.
+ reload_objs="$objlist $last_robj"
+ eval concat_cmds=\"\$concat_cmds~$reload_cmds~\$RM $last_robj\"
+ fi
+ last_robj=$output_objdir/$output_la-${k}.$objext
+ func_arith $k + 1
+ k=$func_arith_result
+ output=$output_objdir/$output_la-${k}.$objext
+ objlist=" $obj"
+ func_len " $last_robj"
+ func_arith $len0 + $func_len_result
+ len=$func_arith_result
+ fi
+ done
+ # Handle the remaining objects by creating one last
+ # reloadable object file. All subsequent reloadable object
+ # files will link in the last one created.
+ test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+ reload_objs="$objlist $last_robj"
+ eval concat_cmds=\"\${concat_cmds}$reload_cmds\"
+ if test -n "$last_robj"; then
+ eval concat_cmds=\"\${concat_cmds}~\$RM $last_robj\"
+ fi
+ func_append delfiles " $output"
+
+ else
+ output=
+ fi
+
+ if ${skipped_export-false}; then
+ func_verbose "generating symbol list for \`$libname.la'"
+ export_symbols="$output_objdir/$libname.exp"
+ $opt_dry_run || $RM $export_symbols
+ libobjs=$output
+ # Append the command to create the export file.
+ test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+ eval concat_cmds=\"\$concat_cmds$export_symbols_cmds\"
+ if test -n "$last_robj"; then
+ eval concat_cmds=\"\$concat_cmds~\$RM $last_robj\"
+ fi
+ fi
+
+ test -n "$save_libobjs" &&
+ func_verbose "creating a temporary reloadable object file: $output"
+
+ # Loop through the commands generated above and execute them.
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $concat_cmds; do
+ IFS="$save_ifs"
+ $opt_silent || {
+ func_quote_for_expand "$cmd"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+ $opt_dry_run || eval "$cmd" || {
+ lt_exit=$?
+
+ # Restore the uninstalled library and exit
+ if test "$opt_mode" = relink; then
+ ( cd "$output_objdir" && \
+ $RM "${realname}T" && \
+ $MV "${realname}U" "$realname" )
+ fi
+
+ exit $lt_exit
+ }
+ done
+ IFS="$save_ifs"
+
+ if test -n "$export_symbols_regex" && ${skipped_export-false}; then
+ func_show_eval '$EGREP -e "$export_symbols_regex" "$export_symbols" > "${export_symbols}T"'
+ func_show_eval '$MV "${export_symbols}T" "$export_symbols"'
+ fi
+ fi
+
+ if ${skipped_export-false}; then
+ if test -n "$export_symbols" && test -n "$include_expsyms"; then
+ tmp_export_symbols="$export_symbols"
+ test -n "$orig_export_symbols" && tmp_export_symbols="$orig_export_symbols"
+ $opt_dry_run || eval '$ECHO "$include_expsyms" | $SP2NL >> "$tmp_export_symbols"'
+ fi
+
+ if test -n "$orig_export_symbols"; then
+ # The given exports_symbols file has to be filtered, so filter it.
+ func_verbose "filter symbol list for \`$libname.la' to tag DATA exports"
+ # FIXME: $output_objdir/$libname.filter potentially contains lots of
+ # 's' commands which not all seds can handle. GNU sed should be fine
+ # though. Also, the filter scales superlinearly with the number of
+ # global variables. join(1) would be nice here, but unfortunately
+ # isn't a blessed tool.
+ $opt_dry_run || $SED -e '/[ ,]DATA/!d;s,\(.*\)\([ \,].*\),s|^\1$|\1\2|,' < $export_symbols > $output_objdir/$libname.filter
+ func_append delfiles " $export_symbols $output_objdir/$libname.filter"
+ export_symbols=$output_objdir/$libname.def
+ $opt_dry_run || $SED -f $output_objdir/$libname.filter < $orig_export_symbols > $export_symbols
+ fi
+ fi
+
+ libobjs=$output
+ # Restore the value of output.
+ output=$save_output
+
+ if test -n "$convenience" && test -n "$whole_archive_flag_spec"; then
+ eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+ test "X$libobjs" = "X " && libobjs=
+ fi
+ # Expand the library linking commands again to reset the
+ # value of $libobjs for piecewise linking.
+
+ # Do each of the archive commands.
+ if test "$module" = yes && test -n "$module_cmds" ; then
+ if test -n "$export_symbols" && test -n "$module_expsym_cmds"; then
+ cmds=$module_expsym_cmds
+ else
+ cmds=$module_cmds
+ fi
+ else
+ if test -n "$export_symbols" && test -n "$archive_expsym_cmds"; then
+ cmds=$archive_expsym_cmds
+ else
+ cmds=$archive_cmds
+ fi
+ fi
+ fi
+
+ if test -n "$delfiles"; then
+ # Append the command to remove temporary files to $cmds.
+ eval cmds=\"\$cmds~\$RM $delfiles\"
+ fi
+
+ # Add any objects from preloaded convenience libraries
+ if test -n "$dlprefiles"; then
+ gentop="$output_objdir/${outputname}x"
+ func_append generated " $gentop"
+
+ func_extract_archives $gentop $dlprefiles
+ func_append libobjs " $func_extract_archives_result"
+ test "X$libobjs" = "X " && libobjs=
+ fi
+
+ save_ifs="$IFS"; IFS='~'
+ for cmd in $cmds; do
+ IFS="$save_ifs"
+ eval cmd=\"$cmd\"
+ $opt_silent || {
+ func_quote_for_expand "$cmd"
+ eval "func_echo $func_quote_for_expand_result"
+ }
+ $opt_dry_run || eval "$cmd" || {
+ lt_exit=$?
+
+ # Restore the uninstalled library and exit
+ if test "$opt_mode" = relink; then
+ ( cd "$output_objdir" && \
+ $RM "${realname}T" && \
+ $MV "${realname}U" "$realname" )
+ fi
+
+ exit $lt_exit
+ }
+ done
+ IFS="$save_ifs"
+
+ # Restore the uninstalled library and exit
+ if test "$opt_mode" = relink; then
+ $opt_dry_run || eval '(cd $output_objdir && $RM ${realname}T && $MV $realname ${realname}T && $MV ${realname}U $realname)' || exit $?
+
+ if test -n "$convenience"; then
+ if test -z "$whole_archive_flag_spec"; then
+ func_show_eval '${RM}r "$gentop"'
+ fi
+ fi
+
+ exit $EXIT_SUCCESS
+ fi
+
+ # Create links to the real library.
+ for linkname in $linknames; do
+ if test "$realname" != "$linkname"; then
+ func_show_eval '(cd "$output_objdir" && $RM "$linkname" && $LN_S "$realname" "$linkname")' 'exit $?'
+ fi
+ done
+
+ # If -module or -export-dynamic was specified, set the dlname.
+ if test "$module" = yes || test "$export_dynamic" = yes; then
+ # On all known operating systems, these are identical.
+ dlname="$soname"
+ fi
+ fi
+ ;;
+
+ obj)
+ if test -n "$dlfiles$dlprefiles" || test "$dlself" != no; then
+ func_warning "\`-dlopen' is ignored for objects"
+ fi
+
+ case " $deplibs" in
+ *\ -l* | *\ -L*)
+ func_warning "\`-l' and \`-L' are ignored for objects" ;;
+ esac
+
+ test -n "$rpath" && \
+ func_warning "\`-rpath' is ignored for objects"
+
+ test -n "$xrpath" && \
+ func_warning "\`-R' is ignored for objects"
+
+ test -n "$vinfo" && \
+ func_warning "\`-version-info' is ignored for objects"
+
+ test -n "$release" && \
+ func_warning "\`-release' is ignored for objects"
+
+ case $output in
+ *.lo)
+ test -n "$objs$old_deplibs" && \
+ func_fatal_error "cannot build library object \`$output' from non-libtool objects"
+
+ libobj=$output
+ func_lo2o "$libobj"
+ obj=$func_lo2o_result
+ ;;
+ *)
+ libobj=
+ obj="$output"
+ ;;
+ esac
+
+ # Delete the old objects.
+ $opt_dry_run || $RM $obj $libobj
+
+ # Objects from convenience libraries. This assumes
+ # single-version convenience libraries. Whenever we create
+ # different ones for PIC/non-PIC, this we'll have to duplicate
+ # the extraction.
+ reload_conv_objs=
+ gentop=
+ # reload_cmds runs $LD directly, so let us get rid of
+ # -Wl from whole_archive_flag_spec and hope we can get by with
+ # turning comma into space..
+ wl=
+
+ if test -n "$convenience"; then
+ if test -n "$whole_archive_flag_spec"; then
+ eval tmp_whole_archive_flags=\"$whole_archive_flag_spec\"
+ reload_conv_objs=$reload_objs\ `$ECHO "$tmp_whole_archive_flags" | $SED 's|,| |g'`
+ else
+ gentop="$output_objdir/${obj}x"
+ func_append generated " $gentop"
+
+ func_extract_archives $gentop $convenience
+ reload_conv_objs="$reload_objs $func_extract_archives_result"
+ fi
+ fi
+
+ # If we're not building shared, we need to use non_pic_objs
+ test "$build_libtool_libs" != yes && libobjs="$non_pic_objects"
+
+ # Create the old-style object.
+ reload_objs="$objs$old_deplibs "`$ECHO "$libobjs" | $SP2NL | $SED "/\.${libext}$/d; /\.lib$/d; $lo2o" | $NL2SP`" $reload_conv_objs" ### testsuite: skip nested quoting test
+
+ output="$obj"
+ func_execute_cmds "$reload_cmds" 'exit $?'
+
+ # Exit if we aren't doing a library object file.
+ if test -z "$libobj"; then
+ if test -n "$gentop"; then
+ func_show_eval '${RM}r "$gentop"'
+ fi
+
+ exit $EXIT_SUCCESS
+ fi
+
+ if test "$build_libtool_libs" != yes; then
+ if test -n "$gentop"; then
+ func_show_eval '${RM}r "$gentop"'
+ fi
+
+ # Create an invalid libtool object if no PIC, so that we don't
+ # accidentally link it into a program.
+ # $show "echo timestamp > $libobj"
+ # $opt_dry_run || eval "echo timestamp > $libobj" || exit $?
+ exit $EXIT_SUCCESS
+ fi
+
+ if test -n "$pic_flag" || test "$pic_mode" != default; then
+ # Only do commands if we really have different PIC objects.
+ reload_objs="$libobjs $reload_conv_objs"
+ output="$libobj"
+ func_execute_cmds "$reload_cmds" 'exit $?'
+ fi
+
+ if test -n "$gentop"; then
+ func_show_eval '${RM}r "$gentop"'
+ fi
+
+ exit $EXIT_SUCCESS
+ ;;
+
+ prog)
+ case $host in
+ *cygwin*) func_stripname '' '.exe' "$output"
+ output=$func_stripname_result.exe;;
+ esac
+ test -n "$vinfo" && \
+ func_warning "\`-version-info' is ignored for programs"
+
+ test -n "$release" && \
+ func_warning "\`-release' is ignored for programs"
+
+ test "$preload" = yes \
+ && test "$dlopen_support" = unknown \
+ && test "$dlopen_self" = unknown \
+ && test "$dlopen_self_static" = unknown && \
+ func_warning "\`LT_INIT([dlopen])' not used. Assuming no dlopen support."
+
+ case $host in
+ *-*-rhapsody* | *-*-darwin1.[012])
+ # On Rhapsody replace the C library is the System framework
+ compile_deplibs=`$ECHO " $compile_deplibs" | $SED 's/ -lc / System.ltframework /'`
+ finalize_deplibs=`$ECHO " $finalize_deplibs" | $SED 's/ -lc / System.ltframework /'`
+ ;;
+ esac
+
+ case $host in
+ *-*-darwin*)
+ # Don't allow lazy linking, it breaks C++ global constructors
+ # But is supposedly fixed on 10.4 or later (yay!).
+ if test "$tagname" = CXX ; then
+ case ${MACOSX_DEPLOYMENT_TARGET-10.0} in
+ 10.[0123])
+ func_append compile_command " ${wl}-bind_at_load"
+ func_append finalize_command " ${wl}-bind_at_load"
+ ;;
+ esac
+ fi
+ # Time to change all our "foo.ltframework" stuff back to "-framework foo"
+ compile_deplibs=`$ECHO " $compile_deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ finalize_deplibs=`$ECHO " $finalize_deplibs" | $SED 's% \([^ $]*\).ltframework% -framework \1%g'`
+ ;;
+ esac
+
+
+ # move library search paths that coincide with paths to not yet
+ # installed libraries to the beginning of the library search list
+ new_libs=
+ for path in $notinst_path; do
+ case " $new_libs " in
+ *" -L$path/$objdir "*) ;;
+ *)
+ case " $compile_deplibs " in
+ *" -L$path/$objdir "*)
+ func_append new_libs " -L$path/$objdir" ;;
+ esac
+ ;;
+ esac
+ done
+ for deplib in $compile_deplibs; do
+ case $deplib in
+ -L*)
+ case " $new_libs " in
+ *" $deplib "*) ;;
+ *) func_append new_libs " $deplib" ;;
+ esac
+ ;;
+ *) func_append new_libs " $deplib" ;;
+ esac
+ done
+ compile_deplibs="$new_libs"
+
+
+ func_append compile_command " $compile_deplibs"
+ func_append finalize_command " $finalize_deplibs"
+
+ if test -n "$rpath$xrpath"; then
+ # If the user specified any rpath flags, then add them.
+ for libdir in $rpath $xrpath; do
+ # This is the magic to use -rpath.
+ case "$finalize_rpath " in
+ *" $libdir "*) ;;
+ *) func_append finalize_rpath " $libdir" ;;
+ esac
+ done
+ fi
+
+ # Now hardcode the library paths
+ rpath=
+ hardcode_libdirs=
+ for libdir in $compile_rpath $finalize_rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ hardcode_libdirs="$libdir"
+ else
+ # Just accumulate the unique libdirs.
+ case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ func_append hardcode_libdirs "$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ fi
+ else
+ eval flag=\"$hardcode_libdir_flag_spec\"
+ func_append rpath " $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$perm_rpath " in
+ *" $libdir "*) ;;
+ *) func_append perm_rpath " $libdir" ;;
+ esac
+ fi
+ case $host in
+ *-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-os2* | *-cegcc*)
+ testbindir=`${ECHO} "$libdir" | ${SED} -e 's*/lib$*/bin*'`
+ case :$dllsearchpath: in
+ *":$libdir:"*) ;;
+ ::) dllsearchpath=$libdir;;
+ *) func_append dllsearchpath ":$libdir";;
+ esac
+ case :$dllsearchpath: in
+ *":$testbindir:"*) ;;
+ ::) dllsearchpath=$testbindir;;
+ *) func_append dllsearchpath ":$testbindir";;
+ esac
+ ;;
+ esac
+ done
+ # Substitute the hardcoded libdirs into the rpath.
+ if test -n "$hardcode_libdir_separator" &&
+ test -n "$hardcode_libdirs"; then
+ libdir="$hardcode_libdirs"
+ eval rpath=\" $hardcode_libdir_flag_spec\"
+ fi
+ compile_rpath="$rpath"
+
+ rpath=
+ hardcode_libdirs=
+ for libdir in $finalize_rpath; do
+ if test -n "$hardcode_libdir_flag_spec"; then
+ if test -n "$hardcode_libdir_separator"; then
+ if test -z "$hardcode_libdirs"; then
+ hardcode_libdirs="$libdir"
+ else
+ # Just accumulate the unique libdirs.
+ case $hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator in
+ *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+ ;;
+ *)
+ func_append hardcode_libdirs "$hardcode_libdir_separator$libdir"
+ ;;
+ esac
+ fi
+ else
+ eval flag=\"$hardcode_libdir_flag_spec\"
+ func_append rpath " $flag"
+ fi
+ elif test -n "$runpath_var"; then
+ case "$finalize_perm_rpath " in
+ *" $libdir "*) ;;
+ *) func_append finalize_perm_rpath " $libdir" ;;
+ esac
+ fi
+ done
+ # Substitute the hardcoded libdirs into the rpath.
+ if test -n "$hardcode_libdir_separator" &&
+ test -n "$hardcode_libdirs"; then
+ libdir="$hardcode_libdirs"
+ eval rpath=\" $hardcode_libdir_flag_spec\"
+ fi
+ finalize_rpath="$rpath"
+
+ if test -n "$libobjs" && test "$build_old_libs" = yes; then
+ # Transform all the library objects into standard objects.
+ compile_command=`$ECHO "$compile_command" | $SP2NL | $SED "$lo2o" | $NL2SP`
+ finalize_command=`$ECHO "$finalize_command" | $SP2NL | $SED "$lo2o" | $NL2SP`
+ fi
+
+ func_generate_dlsyms "$outputname" "@PROGRAM@" "no"
+
+ # template prelinking step
+ if test -n "$prelink_cmds"; then
+ func_execute_cmds "$prelink_cmds" 'exit $?'
+ fi
+
+ wrappers_required=yes
+ case $host in
+ *cegcc* | *mingw32ce*)
+ # Disable wrappers for cegcc and mingw32ce hosts, we are cross compiling anyway.
+ wrappers_required=no
+ ;;
+ *cygwin* | *mingw* )
+ if test "$build_libtool_libs" != yes; then
+ wrappers_required=no
+ fi
+ ;;
+ *)
+ if test "$need_relink" = no || test "$build_libtool_libs" != yes; then
+ wrappers_required=no
+ fi
+ ;;
+ esac
+ if test "$wrappers_required" = no; then
+ # Replace the output file specification.
+ compile_command=`$ECHO "$compile_command" | $SED 's%@OUTPUT@%'"$output"'%g'`
+ link_command="$compile_command$compile_rpath"
+
+ # We have no uninstalled library dependencies, so finalize right now.
+ exit_status=0
+ func_show_eval "$link_command" 'exit_status=$?'
+
+ if test -n "$postlink_cmds"; then
+ func_to_tool_file "$output"
+ postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'`
+ func_execute_cmds "$postlink_cmds" 'exit $?'
+ fi
+
+ # Delete the generated files.
+ if test -f "$output_objdir/${outputname}S.${objext}"; then
+ func_show_eval '$RM "$output_objdir/${outputname}S.${objext}"'
+ fi
+
+ exit $exit_status
+ fi
+
+ if test -n "$compile_shlibpath$finalize_shlibpath"; then
+ compile_command="$shlibpath_var=\"$compile_shlibpath$finalize_shlibpath\$$shlibpath_var\" $compile_command"
+ fi
+ if test -n "$finalize_shlibpath"; then
+ finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command"
+ fi
+
+ compile_var=
+ finalize_var=
+ if test -n "$runpath_var"; then
+ if test -n "$perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $perm_rpath; do
+ func_append rpath "$dir:"
+ done
+ compile_var="$runpath_var=\"$rpath\$$runpath_var\" "
+ fi
+ if test -n "$finalize_perm_rpath"; then
+ # We should set the runpath_var.
+ rpath=
+ for dir in $finalize_perm_rpath; do
+ func_append rpath "$dir:"
+ done
+ finalize_var="$runpath_var=\"$rpath\$$runpath_var\" "
+ fi
+ fi
+
+ if test "$no_install" = yes; then
+ # We don't need to create a wrapper script.
+ link_command="$compile_var$compile_command$compile_rpath"
+ # Replace the output file specification.
+ link_command=`$ECHO "$link_command" | $SED 's%@OUTPUT@%'"$output"'%g'`
+ # Delete the old output file.
+ $opt_dry_run || $RM $output
+ # Link the executable and exit
+ func_show_eval "$link_command" 'exit $?'
+
+ if test -n "$postlink_cmds"; then
+ func_to_tool_file "$output"
+ postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'`
+ func_execute_cmds "$postlink_cmds" 'exit $?'
+ fi
+
+ exit $EXIT_SUCCESS
+ fi
+
+ if test "$hardcode_action" = relink; then
+ # Fast installation is not supported
+ link_command="$compile_var$compile_command$compile_rpath"
+ relink_command="$finalize_var$finalize_command$finalize_rpath"
+
+ func_warning "this platform does not like uninstalled shared libraries"
+ func_warning "\`$output' will be relinked during installation"
+ else
+ if test "$fast_install" != no; then
+ link_command="$finalize_var$compile_command$finalize_rpath"
+ if test "$fast_install" = yes; then
+ relink_command=`$ECHO "$compile_var$compile_command$compile_rpath" | $SED 's%@OUTPUT@%\$progdir/\$file%g'`
+ else
+ # fast_install is set to needless
+ relink_command=
+ fi
+ else
+ link_command="$compile_var$compile_command$compile_rpath"
+ relink_command="$finalize_var$finalize_command$finalize_rpath"
+ fi
+ fi
+
+ # Replace the output file specification.
+ link_command=`$ECHO "$link_command" | $SED 's%@OUTPUT@%'"$output_objdir/$outputname"'%g'`
+
+ # Delete the old output files.
+ $opt_dry_run || $RM $output $output_objdir/$outputname $output_objdir/lt-$outputname
+
+ func_show_eval "$link_command" 'exit $?'
+
+ if test -n "$postlink_cmds"; then
+ func_to_tool_file "$output_objdir/$outputname"
+ postlink_cmds=`func_echo_all "$postlink_cmds" | $SED -e 's%@OUTPUT@%'"$output_objdir/$outputname"'%g' -e 's%@TOOL_OUTPUT@%'"$func_to_tool_file_result"'%g'`
+ func_execute_cmds "$postlink_cmds" 'exit $?'
+ fi
+
+ # Now create the wrapper script.
+ func_verbose "creating $output"
+
+ # Quote the relink command for shipping.
+ if test -n "$relink_command"; then
+ # Preserve any variables that may affect compiler behavior
+ for var in $variables_saved_for_relink; do
+ if eval test -z \"\${$var+set}\"; then
+ relink_command="{ test -z \"\${$var+set}\" || $lt_unset $var || { $var=; export $var; }; }; $relink_command"
+ elif eval var_value=\$$var; test -z "$var_value"; then
+ relink_command="$var=; export $var; $relink_command"
+ else
+ func_quote_for_eval "$var_value"
+ relink_command="$var=$func_quote_for_eval_result; export $var; $relink_command"
+ fi
+ done
+ relink_command="(cd `pwd`; $relink_command)"
+ relink_command=`$ECHO "$relink_command" | $SED "$sed_quote_subst"`
+ fi
+
+ # Only actually do things if not in dry run mode.
+ $opt_dry_run || {
+ # win32 will think the script is a binary if it has
+ # a .exe suffix, so we strip it off here.
+ case $output in
+ *.exe) func_stripname '' '.exe' "$output"
+ output=$func_stripname_result ;;
+ esac
+ # test for cygwin because mv fails w/o .exe extensions
+ case $host in
+ *cygwin*)
+ exeext=.exe
+ func_stripname '' '.exe' "$outputname"
+ outputname=$func_stripname_result ;;
+ *) exeext= ;;
+ esac
+ case $host in
+ *cygwin* | *mingw* )
+ func_dirname_and_basename "$output" "" "."
+ output_name=$func_basename_result
+ output_path=$func_dirname_result
+ cwrappersource="$output_path/$objdir/lt-$output_name.c"
+ cwrapper="$output_path/$output_name.exe"
+ $RM $cwrappersource $cwrapper
+ trap "$RM $cwrappersource $cwrapper; exit $EXIT_FAILURE" 1 2 15
+
+ func_emit_cwrapperexe_src > $cwrappersource
+
+ # The wrapper executable is built using the $host compiler,
+ # because it contains $host paths and files. If cross-
+ # compiling, it, like the target executable, must be
+ # executed on the $host or under an emulation environment.
+ $opt_dry_run || {
+ $LTCC $LTCFLAGS -o $cwrapper $cwrappersource
+ $STRIP $cwrapper
+ }
+
+ # Now, create the wrapper script for func_source use:
+ func_ltwrapper_scriptname $cwrapper
+ $RM $func_ltwrapper_scriptname_result
+ trap "$RM $func_ltwrapper_scriptname_result; exit $EXIT_FAILURE" 1 2 15
+ $opt_dry_run || {
+ # note: this script will not be executed, so do not chmod.
+ if test "x$build" = "x$host" ; then
+ $cwrapper --lt-dump-script > $func_ltwrapper_scriptname_result
+ else
+ func_emit_wrapper no > $func_ltwrapper_scriptname_result
+ fi
+ }
+ ;;
+ * )
+ $RM $output
+ trap "$RM $output; exit $EXIT_FAILURE" 1 2 15
+
+ func_emit_wrapper no > $output
+ chmod +x $output
+ ;;
+ esac
+ }
+ exit $EXIT_SUCCESS
+ ;;
+ esac
+
+ # See if we need to build an old-fashioned archive.
+ for oldlib in $oldlibs; do
+
+ if test "$build_libtool_libs" = convenience; then
+ oldobjs="$libobjs_save $symfileobj"
+ addlibs="$convenience"
+ build_libtool_libs=no
+ else
+ if test "$build_libtool_libs" = module; then
+ oldobjs="$libobjs_save"
+ build_libtool_libs=no
+ else
+ oldobjs="$old_deplibs $non_pic_objects"
+ if test "$preload" = yes && test -f "$symfileobj"; then
+ func_append oldobjs " $symfileobj"
+ fi
+ fi
+ addlibs="$old_convenience"
+ fi
+
+ if test -n "$addlibs"; then
+ gentop="$output_objdir/${outputname}x"
+ func_append generated " $gentop"
+
+ func_extract_archives $gentop $addlibs
+ func_append oldobjs " $func_extract_archives_result"
+ fi
+
+ # Do each command in the archive commands.
+ if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then
+ cmds=$old_archive_from_new_cmds
+ else
+
+ # Add any objects from preloaded convenience libraries
+ if test -n "$dlprefiles"; then
+ gentop="$output_objdir/${outputname}x"
+ func_append generated " $gentop"
+
+ func_extract_archives $gentop $dlprefiles
+ func_append oldobjs " $func_extract_archives_result"
+ fi
+
+ # POSIX demands no paths to be encoded in archives. We have
+ # to avoid creating archives with duplicate basenames if we
+ # might have to extract them afterwards, e.g., when creating a
+ # static archive out of a convenience library, or when linking
+ # the entirety of a libtool archive into another (currently
+ # not supported by libtool).
+ if (for obj in $oldobjs
+ do
+ func_basename "$obj"
+ $ECHO "$func_basename_result"
+ done | sort | sort -uc >/dev/null 2>&1); then
+ :
+ else
+ echo "copying selected object files to avoid basename conflicts..."
+ gentop="$output_objdir/${outputname}x"
+ func_append generated " $gentop"
+ func_mkdir_p "$gentop"
+ save_oldobjs=$oldobjs
+ oldobjs=
+ counter=1
+ for obj in $save_oldobjs
+ do
+ func_basename "$obj"
+ objbase="$func_basename_result"
+ case " $oldobjs " in
+ " ") oldobjs=$obj ;;
+ *[\ /]"$objbase "*)
+ while :; do
+ # Make sure we don't pick an alternate name that also
+ # overlaps.
+ newobj=lt$counter-$objbase
+ func_arith $counter + 1
+ counter=$func_arith_result
+ case " $oldobjs " in
+ *[\ /]"$newobj "*) ;;
+ *) if test ! -f "$gentop/$newobj"; then break; fi ;;
+ esac
+ done
+ func_show_eval "ln $obj $gentop/$newobj || cp $obj $gentop/$newobj"
+ func_append oldobjs " $gentop/$newobj"
+ ;;
+ *) func_append oldobjs " $obj" ;;
+ esac
+ done
+ fi
+ func_to_tool_file "$oldlib" func_convert_file_msys_to_w32
+ tool_oldlib=$func_to_tool_file_result
+ eval cmds=\"$old_archive_cmds\"
+
+ func_len " $cmds"
+ len=$func_len_result
+ if test "$len" -lt "$max_cmd_len" || test "$max_cmd_len" -le -1; then
+ cmds=$old_archive_cmds
+ elif test -n "$archiver_list_spec"; then
+ func_verbose "using command file archive linking..."
+ for obj in $oldobjs
+ do
+ func_to_tool_file "$obj"
+ $ECHO "$func_to_tool_file_result"
+ done > $output_objdir/$libname.libcmd
+ func_to_tool_file "$output_objdir/$libname.libcmd"
+ oldobjs=" $archiver_list_spec$func_to_tool_file_result"
+ cmds=$old_archive_cmds
+ else
+ # the command line is too long to link in one step, link in parts
+ func_verbose "using piecewise archive linking..."
+ save_RANLIB=$RANLIB
+ RANLIB=:
+ objlist=
+ concat_cmds=
+ save_oldobjs=$oldobjs
+ oldobjs=
+ # Is there a better way of finding the last object in the list?
+ for obj in $save_oldobjs
+ do
+ last_oldobj=$obj
+ done
+ eval test_cmds=\"$old_archive_cmds\"
+ func_len " $test_cmds"
+ len0=$func_len_result
+ len=$len0
+ for obj in $save_oldobjs
+ do
+ func_len " $obj"
+ func_arith $len + $func_len_result
+ len=$func_arith_result
+ func_append objlist " $obj"
+ if test "$len" -lt "$max_cmd_len"; then
+ :
+ else
+ # the above command should be used before it gets too long
+ oldobjs=$objlist
+ if test "$obj" = "$last_oldobj" ; then
+ RANLIB=$save_RANLIB
+ fi
+ test -z "$concat_cmds" || concat_cmds=$concat_cmds~
+ eval concat_cmds=\"\${concat_cmds}$old_archive_cmds\"
+ objlist=
+ len=$len0
+ fi
+ done
+ RANLIB=$save_RANLIB
+ oldobjs=$objlist
+ if test "X$oldobjs" = "X" ; then
+ eval cmds=\"\$concat_cmds\"
+ else
+ eval cmds=\"\$concat_cmds~\$old_archive_cmds\"
+ fi
+ fi
+ fi
+ func_execute_cmds "$cmds" 'exit $?'
+ done
+
+ test -n "$generated" && \
+ func_show_eval "${RM}r$generated"
+
+ # Now create the libtool archive.
+ case $output in
+ *.la)
+ old_library=
+ test "$build_old_libs" = yes && old_library="$libname.$libext"
+ func_verbose "creating $output"
+
+ # Preserve any variables that may affect compiler behavior
+ for var in $variables_saved_for_relink; do
+ if eval test -z \"\${$var+set}\"; then
+ relink_command="{ test -z \"\${$var+set}\" || $lt_unset $var || { $var=; export $var; }; }; $relink_command"
+ elif eval var_value=\$$var; test -z "$var_value"; then
+ relink_command="$var=; export $var; $relink_command"
+ else
+ func_quote_for_eval "$var_value"
+ relink_command="$var=$func_quote_for_eval_result; export $var; $relink_command"
+ fi
+ done
+ # Quote the link command for shipping.
+ relink_command="(cd `pwd`; $SHELL $progpath $preserve_args --mode=relink $libtool_args @inst_prefix_dir@)"
+ relink_command=`$ECHO "$relink_command" | $SED "$sed_quote_subst"`
+ if test "$hardcode_automatic" = yes ; then
+ relink_command=
+ fi
+
+ # Only create the output if not a dry run.
+ $opt_dry_run || {
+ for installed in no yes; do
+ if test "$installed" = yes; then
+ if test -z "$install_libdir"; then
+ break
+ fi
+ output="$output_objdir/$outputname"i
+ # Replace all uninstalled libtool libraries with the installed ones
+ newdependency_libs=
+ for deplib in $dependency_libs; do
+ case $deplib in
+ *.la)
+ func_basename "$deplib"
+ name="$func_basename_result"
+ func_resolve_sysroot "$deplib"
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $func_resolve_sysroot_result`
+ test -z "$libdir" && \
+ func_fatal_error "\`$deplib' is not a valid libtool archive"
+ func_append newdependency_libs " ${lt_sysroot:+=}$libdir/$name"
+ ;;
+ -L*)
+ func_stripname -L '' "$deplib"
+ func_replace_sysroot "$func_stripname_result"
+ func_append newdependency_libs " -L$func_replace_sysroot_result"
+ ;;
+ -R*)
+ func_stripname -R '' "$deplib"
+ func_replace_sysroot "$func_stripname_result"
+ func_append newdependency_libs " -R$func_replace_sysroot_result"
+ ;;
+ *) func_append newdependency_libs " $deplib" ;;
+ esac
+ done
+ dependency_libs="$newdependency_libs"
+ newdlfiles=
+
+ for lib in $dlfiles; do
+ case $lib in
+ *.la)
+ func_basename "$lib"
+ name="$func_basename_result"
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib`
+ test -z "$libdir" && \
+ func_fatal_error "\`$lib' is not a valid libtool archive"
+ func_append newdlfiles " ${lt_sysroot:+=}$libdir/$name"
+ ;;
+ *) func_append newdlfiles " $lib" ;;
+ esac
+ done
+ dlfiles="$newdlfiles"
+ newdlprefiles=
+ for lib in $dlprefiles; do
+ case $lib in
+ *.la)
+ # Only pass preopened files to the pseudo-archive (for
+ # eventual linking with the app. that links it) if we
+ # didn't already link the preopened objects directly into
+ # the library:
+ func_basename "$lib"
+ name="$func_basename_result"
+ eval libdir=`${SED} -n -e 's/^libdir=\(.*\)$/\1/p' $lib`
+ test -z "$libdir" && \
+ func_fatal_error "\`$lib' is not a valid libtool archive"
+ func_append newdlprefiles " ${lt_sysroot:+=}$libdir/$name"
+ ;;
+ esac
+ done
+ dlprefiles="$newdlprefiles"
+ else
+ newdlfiles=
+ for lib in $dlfiles; do
+ case $lib in
+ [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;;
+ *) abs=`pwd`"/$lib" ;;
+ esac
+ func_append newdlfiles " $abs"
+ done
+ dlfiles="$newdlfiles"
+ newdlprefiles=
+ for lib in $dlprefiles; do
+ case $lib in
+ [\\/]* | [A-Za-z]:[\\/]*) abs="$lib" ;;
+ *) abs=`pwd`"/$lib" ;;
+ esac
+ func_append newdlprefiles " $abs"
+ done
+ dlprefiles="$newdlprefiles"
+ fi
+ $RM $output
+ # place dlname in correct position for cygwin
+ # In fact, it would be nice if we could use this code for all target
+ # systems that can't hard-code library paths into their executables
+ # and that have no shared library path variable independent of PATH,
+ # but it turns out we can't easily determine that from inspecting
+ # libtool variables, so we have to hard-code the OSs to which it
+ # applies here; at the moment, that means platforms that use the PE
+ # object format with DLL files. See the long comment at the top of
+ # tests/bindir.at for full details.
+ tdlname=$dlname
+ case $host,$output,$installed,$module,$dlname in
+ *cygwin*,*lai,yes,no,*.dll | *mingw*,*lai,yes,no,*.dll | *cegcc*,*lai,yes,no,*.dll)
+ # If a -bindir argument was supplied, place the dll there.
+ if test "x$bindir" != x ;
+ then
+ func_relative_path "$install_libdir" "$bindir"
+ tdlname=$func_relative_path_result$dlname
+ else
+ # Otherwise fall back on heuristic.
+ tdlname=../bin/$dlname
+ fi
+ ;;
+ esac
+ $ECHO > $output "\
+# $outputname - a libtool library file
+# Generated by $PROGRAM (GNU $PACKAGE$TIMESTAMP) $VERSION
+#
+# Please DO NOT delete this file!
+# It is necessary for linking the library.
+
+# The name that we can dlopen(3).
+dlname='$tdlname'
+
+# Names of this library.
+library_names='$library_names'
+
+# The name of the static archive.
+old_library='$old_library'
+
+# Linker flags that can not go in dependency_libs.
+inherited_linker_flags='$new_inherited_linker_flags'
+
+# Libraries that this one depends upon.
+dependency_libs='$dependency_libs'
+
+# Names of additional weak libraries provided by this library
+weak_library_names='$weak_libs'
+
+# Version information for $libname.
+current=$current
+age=$age
+revision=$revision
+
+# Is this an already installed library?
+installed=$installed
+
+# Should we warn about portability when linking against -modules?
+shouldnotlink=$module
+
+# Files to dlopen/dlpreopen
+dlopen='$dlfiles'
+dlpreopen='$dlprefiles'
+
+# Directory that this library needs to be installed in:
+libdir='$install_libdir'"
+ if test "$installed" = no && test "$need_relink" = yes; then
+ $ECHO >> $output "\
+relink_command=\"$relink_command\""
+ fi
+ done
+ }
+
+ # Do a symbolic link so that the libtool archive can be found in
+ # LD_LIBRARY_PATH before the program is installed.
+ func_show_eval '( cd "$output_objdir" && $RM "$outputname" && $LN_S "../$outputname" "$outputname" )' 'exit $?'
+ ;;
+ esac
+ exit $EXIT_SUCCESS
+}
+
+{ test "$opt_mode" = link || test "$opt_mode" = relink; } &&
+ func_mode_link ${1+"$@"}
+
+
+# func_mode_uninstall arg...
+func_mode_uninstall ()
+{
+ $opt_debug
+ RM="$nonopt"
+ files=
+ rmforce=
+ exit_status=0
+
+ # This variable tells wrapper scripts just to set variables rather
+ # than running their programs.
+ libtool_install_magic="$magic"
+
+ for arg
+ do
+ case $arg in
+ -f) func_append RM " $arg"; rmforce=yes ;;
+ -*) func_append RM " $arg" ;;
+ *) func_append files " $arg" ;;
+ esac
+ done
+
+ test -z "$RM" && \
+ func_fatal_help "you must specify an RM program"
+
+ rmdirs=
+
+ for file in $files; do
+ func_dirname "$file" "" "."
+ dir="$func_dirname_result"
+ if test "X$dir" = X.; then
+ odir="$objdir"
+ else
+ odir="$dir/$objdir"
+ fi
+ func_basename "$file"
+ name="$func_basename_result"
+ test "$opt_mode" = uninstall && odir="$dir"
+
+ # Remember odir for removal later, being careful to avoid duplicates
+ if test "$opt_mode" = clean; then
+ case " $rmdirs " in
+ *" $odir "*) ;;
+ *) func_append rmdirs " $odir" ;;
+ esac
+ fi
+
+ # Don't error if the file doesn't exist and rm -f was used.
+ if { test -L "$file"; } >/dev/null 2>&1 ||
+ { test -h "$file"; } >/dev/null 2>&1 ||
+ test -f "$file"; then
+ :
+ elif test -d "$file"; then
+ exit_status=1
+ continue
+ elif test "$rmforce" = yes; then
+ continue
+ fi
+
+ rmfiles="$file"
+
+ case $name in
+ *.la)
+ # Possibly a libtool archive, so verify it.
+ if func_lalib_p "$file"; then
+ func_source $dir/$name
+
+ # Delete the libtool libraries and symlinks.
+ for n in $library_names; do
+ func_append rmfiles " $odir/$n"
+ done
+ test -n "$old_library" && func_append rmfiles " $odir/$old_library"
+
+ case "$opt_mode" in
+ clean)
+ case " $library_names " in
+ *" $dlname "*) ;;
+ *) test -n "$dlname" && func_append rmfiles " $odir/$dlname" ;;
+ esac
+ test -n "$libdir" && func_append rmfiles " $odir/$name $odir/${name}i"
+ ;;
+ uninstall)
+ if test -n "$library_names"; then
+ # Do each command in the postuninstall commands.
+ func_execute_cmds "$postuninstall_cmds" 'test "$rmforce" = yes || exit_status=1'
+ fi
+
+ if test -n "$old_library"; then
+ # Do each command in the old_postuninstall commands.
+ func_execute_cmds "$old_postuninstall_cmds" 'test "$rmforce" = yes || exit_status=1'
+ fi
+ # FIXME: should reinstall the best remaining shared library.
+ ;;
+ esac
+ fi
+ ;;
+
+ *.lo)
+ # Possibly a libtool object, so verify it.
+ if func_lalib_p "$file"; then
+
+ # Read the .lo file
+ func_source $dir/$name
+
+ # Add PIC object to the list of files to remove.
+ if test -n "$pic_object" &&
+ test "$pic_object" != none; then
+ func_append rmfiles " $dir/$pic_object"
+ fi
+
+ # Add non-PIC object to the list of files to remove.
+ if test -n "$non_pic_object" &&
+ test "$non_pic_object" != none; then
+ func_append rmfiles " $dir/$non_pic_object"
+ fi
+ fi
+ ;;
+
+ *)
+ if test "$opt_mode" = clean ; then
+ noexename=$name
+ case $file in
+ *.exe)
+ func_stripname '' '.exe' "$file"
+ file=$func_stripname_result
+ func_stripname '' '.exe' "$name"
+ noexename=$func_stripname_result
+ # $file with .exe has already been added to rmfiles,
+ # add $file without .exe
+ func_append rmfiles " $file"
+ ;;
+ esac
+ # Do a test to see if this is a libtool program.
+ if func_ltwrapper_p "$file"; then
+ if func_ltwrapper_executable_p "$file"; then
+ func_ltwrapper_scriptname "$file"
+ relink_command=
+ func_source $func_ltwrapper_scriptname_result
+ func_append rmfiles " $func_ltwrapper_scriptname_result"
+ else
+ relink_command=
+ func_source $dir/$noexename
+ fi
+
+ # note $name still contains .exe if it was in $file originally
+ # as does the version of $file that was added into $rmfiles
+ func_append rmfiles " $odir/$name $odir/${name}S.${objext}"
+ if test "$fast_install" = yes && test -n "$relink_command"; then
+ func_append rmfiles " $odir/lt-$name"
+ fi
+ if test "X$noexename" != "X$name" ; then
+ func_append rmfiles " $odir/lt-${noexename}.c"
+ fi
+ fi
+ fi
+ ;;
+ esac
+ func_show_eval "$RM $rmfiles" 'exit_status=1'
+ done
+
+ # Try to remove the ${objdir}s in the directories where we deleted files
+ for dir in $rmdirs; do
+ if test -d "$dir"; then
+ func_show_eval "rmdir $dir >/dev/null 2>&1"
+ fi
+ done
+
+ exit $exit_status
+}
+
+{ test "$opt_mode" = uninstall || test "$opt_mode" = clean; } &&
+ func_mode_uninstall ${1+"$@"}
+
+test -z "$opt_mode" && {
+ help="$generic_help"
+ func_fatal_help "you must specify a MODE"
+}
+
+test -z "$exec_cmd" && \
+ func_fatal_help "invalid operation mode \`$opt_mode'"
+
+if test -n "$exec_cmd"; then
+ eval exec "$exec_cmd"
+ exit $EXIT_FAILURE
+fi
+
+exit $exit_status
+
+
+# The TAGs below are defined such that we never get into a situation
+# in which we disable both kinds of libraries. Given conflicting
+# choices, we go for a static library, that is the most portable,
+# since we can't tell whether shared libraries were disabled because
+# the user asked for that or because the platform doesn't support
+# them. This is particularly important on AIX, because we don't
+# support having both static and shared libraries enabled at the same
+# time on that platform, so we default to a shared-only configuration.
+# If a disable-shared tag is given, we'll fallback to a static-only
+# configuration. But we'll never go from static-only to shared-only.
+
+# ### BEGIN LIBTOOL TAG CONFIG: disable-shared
+build_libtool_libs=no
+build_old_libs=yes
+# ### END LIBTOOL TAG CONFIG: disable-shared
+
+# ### BEGIN LIBTOOL TAG CONFIG: disable-static
+build_old_libs=`case $build_libtool_libs in yes) echo no;; *) echo yes;; esac`
+# ### END LIBTOOL TAG CONFIG: disable-static
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
+# vi:sw=2
+
diff --git a/m4/libtool.m4 b/m4/libtool.m4
new file mode 100644
index 00000000..256661f4
--- /dev/null
+++ b/m4/libtool.m4
@@ -0,0 +1,7988 @@
+# libtool.m4 - Configure libtool for the host system. -*-Autoconf-*-
+#
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+# 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+# Foundation, Inc.
+# Written by Gordon Matzigkeit, 1996
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+m4_define([_LT_COPYING], [dnl
+# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2003, 2004, 2005,
+# 2006, 2007, 2008, 2009, 2010, 2011 Free Software
+# Foundation, Inc.
+# Written by Gordon Matzigkeit, 1996
+#
+# This file is part of GNU Libtool.
+#
+# GNU Libtool is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# As a special exception to the GNU General Public License,
+# if you distribute this file as part of a program or library that
+# is built using GNU Libtool, you may include this file under the
+# same distribution terms that you use for the rest of that program.
+#
+# GNU Libtool is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Libtool; see the file COPYING. If not, a copy
+# can be downloaded from http://www.gnu.org/licenses/gpl.html, or
+# obtained by writing to the Free Software Foundation, Inc.,
+# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA.
+])
+
+# serial 57 LT_INIT
+
+
+# LT_PREREQ(VERSION)
+# ------------------
+# Complain and exit if this libtool version is less that VERSION.
+m4_defun([LT_PREREQ],
+[m4_if(m4_version_compare(m4_defn([LT_PACKAGE_VERSION]), [$1]), -1,
+ [m4_default([$3],
+ [m4_fatal([Libtool version $1 or higher is required],
+ 63)])],
+ [$2])])
+
+
+# _LT_CHECK_BUILDDIR
+# ------------------
+# Complain if the absolute build directory name contains unusual characters
+m4_defun([_LT_CHECK_BUILDDIR],
+[case `pwd` in
+ *\ * | *\ *)
+ AC_MSG_WARN([Libtool does not cope well with whitespace in `pwd`]) ;;
+esac
+])
+
+
+# LT_INIT([OPTIONS])
+# ------------------
+AC_DEFUN([LT_INIT],
+[AC_PREREQ([2.58])dnl We use AC_INCLUDES_DEFAULT
+AC_REQUIRE([AC_CONFIG_AUX_DIR_DEFAULT])dnl
+AC_BEFORE([$0], [LT_LANG])dnl
+AC_BEFORE([$0], [LT_OUTPUT])dnl
+AC_BEFORE([$0], [LTDL_INIT])dnl
+m4_require([_LT_CHECK_BUILDDIR])dnl
+
+dnl Autoconf doesn't catch unexpanded LT_ macros by default:
+m4_pattern_forbid([^_?LT_[A-Z_]+$])dnl
+m4_pattern_allow([^(_LT_EOF|LT_DLGLOBAL|LT_DLLAZY_OR_NOW|LT_MULTI_MODULE)$])dnl
+dnl aclocal doesn't pull ltoptions.m4, ltsugar.m4, or ltversion.m4
+dnl unless we require an AC_DEFUNed macro:
+AC_REQUIRE([LTOPTIONS_VERSION])dnl
+AC_REQUIRE([LTSUGAR_VERSION])dnl
+AC_REQUIRE([LTVERSION_VERSION])dnl
+AC_REQUIRE([LTOBSOLETE_VERSION])dnl
+m4_require([_LT_PROG_LTMAIN])dnl
+
+_LT_SHELL_INIT([SHELL=${CONFIG_SHELL-/bin/sh}])
+
+dnl Parse OPTIONS
+_LT_SET_OPTIONS([$0], [$1])
+
+# This can be used to rebuild libtool when needed
+LIBTOOL_DEPS="$ltmain"
+
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+AC_SUBST(LIBTOOL)dnl
+
+_LT_SETUP
+
+# Only expand once:
+m4_define([LT_INIT])
+])# LT_INIT
+
+# Old names:
+AU_ALIAS([AC_PROG_LIBTOOL], [LT_INIT])
+AU_ALIAS([AM_PROG_LIBTOOL], [LT_INIT])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_PROG_LIBTOOL], [])
+dnl AC_DEFUN([AM_PROG_LIBTOOL], [])
+
+
+# _LT_CC_BASENAME(CC)
+# -------------------
+# Calculate cc_basename. Skip known compiler wrappers and cross-prefix.
+m4_defun([_LT_CC_BASENAME],
+[for cc_temp in $1""; do
+ case $cc_temp in
+ compile | *[[\\/]]compile | ccache | *[[\\/]]ccache ) ;;
+ distcc | *[[\\/]]distcc | purify | *[[\\/]]purify ) ;;
+ \-*) ;;
+ *) break;;
+ esac
+done
+cc_basename=`$ECHO "$cc_temp" | $SED "s%.*/%%; s%^$host_alias-%%"`
+])
+
+
+# _LT_FILEUTILS_DEFAULTS
+# ----------------------
+# It is okay to use these file commands and assume they have been set
+# sensibly after `m4_require([_LT_FILEUTILS_DEFAULTS])'.
+m4_defun([_LT_FILEUTILS_DEFAULTS],
+[: ${CP="cp -f"}
+: ${MV="mv -f"}
+: ${RM="rm -f"}
+])# _LT_FILEUTILS_DEFAULTS
+
+
+# _LT_SETUP
+# ---------
+m4_defun([_LT_SETUP],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+AC_REQUIRE([_LT_PREPARE_SED_QUOTE_VARS])dnl
+AC_REQUIRE([_LT_PROG_ECHO_BACKSLASH])dnl
+
+_LT_DECL([], [PATH_SEPARATOR], [1], [The PATH separator for the build system])dnl
+dnl
+_LT_DECL([], [host_alias], [0], [The host system])dnl
+_LT_DECL([], [host], [0])dnl
+_LT_DECL([], [host_os], [0])dnl
+dnl
+_LT_DECL([], [build_alias], [0], [The build system])dnl
+_LT_DECL([], [build], [0])dnl
+_LT_DECL([], [build_os], [0])dnl
+dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([LT_PATH_LD])dnl
+AC_REQUIRE([LT_PATH_NM])dnl
+dnl
+AC_REQUIRE([AC_PROG_LN_S])dnl
+test -z "$LN_S" && LN_S="ln -s"
+_LT_DECL([], [LN_S], [1], [Whether we need soft or hard links])dnl
+dnl
+AC_REQUIRE([LT_CMD_MAX_LEN])dnl
+_LT_DECL([objext], [ac_objext], [0], [Object file suffix (normally "o")])dnl
+_LT_DECL([], [exeext], [0], [Executable file suffix (normally "")])dnl
+dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_CHECK_SHELL_FEATURES])dnl
+m4_require([_LT_PATH_CONVERSION_FUNCTIONS])dnl
+m4_require([_LT_CMD_RELOAD])dnl
+m4_require([_LT_CHECK_MAGIC_METHOD])dnl
+m4_require([_LT_CHECK_SHAREDLIB_FROM_LINKLIB])dnl
+m4_require([_LT_CMD_OLD_ARCHIVE])dnl
+m4_require([_LT_CMD_GLOBAL_SYMBOLS])dnl
+m4_require([_LT_WITH_SYSROOT])dnl
+
+_LT_CONFIG_LIBTOOL_INIT([
+# See if we are running on zsh, and set the options which allow our
+# commands through without removal of \ escapes INIT.
+if test -n "\${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+fi
+])
+if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+fi
+
+_LT_CHECK_OBJDIR
+
+m4_require([_LT_TAG_COMPILER])dnl
+
+case $host_os in
+aix3*)
+ # AIX sometimes has problems with the GCC collect2 program. For some
+ # reason, if we set the COLLECT_NAMES environment variable, the problems
+ # vanish in a puff of smoke.
+ if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+ fi
+ ;;
+esac
+
+# Global variables:
+ofile=libtool
+can_build_shared=yes
+
+# All known linkers require a `.a' archive for static linking (except MSVC,
+# which needs '.lib').
+libext=a
+
+with_gnu_ld="$lt_cv_prog_gnu_ld"
+
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+
+# Set sane defaults for various variables
+test -z "$CC" && CC=cc
+test -z "$LTCC" && LTCC=$CC
+test -z "$LTCFLAGS" && LTCFLAGS=$CFLAGS
+test -z "$LD" && LD=ld
+test -z "$ac_objext" && ac_objext=o
+
+_LT_CC_BASENAME([$compiler])
+
+# Only perform the check for file, if the check method requires it
+test -z "$MAGIC_CMD" && MAGIC_CMD=file
+case $deplibs_check_method in
+file_magic*)
+ if test "$file_magic_cmd" = '$MAGIC_CMD'; then
+ _LT_PATH_MAGIC
+ fi
+ ;;
+esac
+
+# Use C for the default configuration in the libtool script
+LT_SUPPORTED_TAG([CC])
+_LT_LANG_C_CONFIG
+_LT_LANG_DEFAULT_CONFIG
+_LT_CONFIG_COMMANDS
+])# _LT_SETUP
+
+
+# _LT_PREPARE_SED_QUOTE_VARS
+# --------------------------
+# Define a few sed substitution that help us do robust quoting.
+m4_defun([_LT_PREPARE_SED_QUOTE_VARS],
+[# Backslashify metacharacters that are still active within
+# double-quoted strings.
+sed_quote_subst='s/\([["`$\\]]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\([["`\\]]\)/\\\1/g'
+
+# Sed substitution to delay expansion of an escaped shell variable in a
+# double_quote_subst'ed string.
+delay_variable_subst='s/\\\\\\\\\\\$/\\\\\\$/g'
+
+# Sed substitution to delay expansion of an escaped single quote.
+delay_single_quote_subst='s/'\''/'\'\\\\\\\'\''/g'
+
+# Sed substitution to avoid accidental globbing in evaled expressions
+no_glob_subst='s/\*/\\\*/g'
+])
+
+# _LT_PROG_LTMAIN
+# ---------------
+# Note that this code is called both from `configure', and `config.status'
+# now that we use AC_CONFIG_COMMANDS to generate libtool. Notably,
+# `config.status' has no value for ac_aux_dir unless we are using Automake,
+# so we pass a copy along to make sure it has a sensible value anyway.
+m4_defun([_LT_PROG_LTMAIN],
+[m4_ifdef([AC_REQUIRE_AUX_FILE], [AC_REQUIRE_AUX_FILE([ltmain.sh])])dnl
+_LT_CONFIG_LIBTOOL_INIT([ac_aux_dir='$ac_aux_dir'])
+ltmain="$ac_aux_dir/ltmain.sh"
+])# _LT_PROG_LTMAIN
+
+
+## ------------------------------------- ##
+## Accumulate code for creating libtool. ##
+## ------------------------------------- ##
+
+# So that we can recreate a full libtool script including additional
+# tags, we accumulate the chunks of code to send to AC_CONFIG_COMMANDS
+# in macros and then make a single call at the end using the `libtool'
+# label.
+
+
+# _LT_CONFIG_LIBTOOL_INIT([INIT-COMMANDS])
+# ----------------------------------------
+# Register INIT-COMMANDS to be passed to AC_CONFIG_COMMANDS later.
+m4_define([_LT_CONFIG_LIBTOOL_INIT],
+[m4_ifval([$1],
+ [m4_append([_LT_OUTPUT_LIBTOOL_INIT],
+ [$1
+])])])
+
+# Initialize.
+m4_define([_LT_OUTPUT_LIBTOOL_INIT])
+
+
+# _LT_CONFIG_LIBTOOL([COMMANDS])
+# ------------------------------
+# Register COMMANDS to be passed to AC_CONFIG_COMMANDS later.
+m4_define([_LT_CONFIG_LIBTOOL],
+[m4_ifval([$1],
+ [m4_append([_LT_OUTPUT_LIBTOOL_COMMANDS],
+ [$1
+])])])
+
+# Initialize.
+m4_define([_LT_OUTPUT_LIBTOOL_COMMANDS])
+
+
+# _LT_CONFIG_SAVE_COMMANDS([COMMANDS], [INIT_COMMANDS])
+# -----------------------------------------------------
+m4_defun([_LT_CONFIG_SAVE_COMMANDS],
+[_LT_CONFIG_LIBTOOL([$1])
+_LT_CONFIG_LIBTOOL_INIT([$2])
+])
+
+
+# _LT_FORMAT_COMMENT([COMMENT])
+# -----------------------------
+# Add leading comment marks to the start of each line, and a trailing
+# full-stop to the whole comment if one is not present already.
+m4_define([_LT_FORMAT_COMMENT],
+[m4_ifval([$1], [
+m4_bpatsubst([m4_bpatsubst([$1], [^ *], [# ])],
+ [['`$\]], [\\\&])]m4_bmatch([$1], [[!?.]$], [], [.])
+)])
+
+
+
+## ------------------------ ##
+## FIXME: Eliminate VARNAME ##
+## ------------------------ ##
+
+
+# _LT_DECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION], [IS-TAGGED?])
+# -------------------------------------------------------------------
+# CONFIGNAME is the name given to the value in the libtool script.
+# VARNAME is the (base) name used in the configure script.
+# VALUE may be 0, 1 or 2 for a computed quote escaped value based on
+# VARNAME. Any other value will be used directly.
+m4_define([_LT_DECL],
+[lt_if_append_uniq([lt_decl_varnames], [$2], [, ],
+ [lt_dict_add_subkey([lt_decl_dict], [$2], [libtool_name],
+ [m4_ifval([$1], [$1], [$2])])
+ lt_dict_add_subkey([lt_decl_dict], [$2], [value], [$3])
+ m4_ifval([$4],
+ [lt_dict_add_subkey([lt_decl_dict], [$2], [description], [$4])])
+ lt_dict_add_subkey([lt_decl_dict], [$2],
+ [tagged?], [m4_ifval([$5], [yes], [no])])])
+])
+
+
+# _LT_TAGDECL([CONFIGNAME], VARNAME, VALUE, [DESCRIPTION])
+# --------------------------------------------------------
+m4_define([_LT_TAGDECL], [_LT_DECL([$1], [$2], [$3], [$4], [yes])])
+
+
+# lt_decl_tag_varnames([SEPARATOR], [VARNAME1...])
+# ------------------------------------------------
+m4_define([lt_decl_tag_varnames],
+[_lt_decl_filter([tagged?], [yes], $@)])
+
+
+# _lt_decl_filter(SUBKEY, VALUE, [SEPARATOR], [VARNAME1..])
+# ---------------------------------------------------------
+m4_define([_lt_decl_filter],
+[m4_case([$#],
+ [0], [m4_fatal([$0: too few arguments: $#])],
+ [1], [m4_fatal([$0: too few arguments: $#: $1])],
+ [2], [lt_dict_filter([lt_decl_dict], [$1], [$2], [], lt_decl_varnames)],
+ [3], [lt_dict_filter([lt_decl_dict], [$1], [$2], [$3], lt_decl_varnames)],
+ [lt_dict_filter([lt_decl_dict], $@)])[]dnl
+])
+
+
+# lt_decl_quote_varnames([SEPARATOR], [VARNAME1...])
+# --------------------------------------------------
+m4_define([lt_decl_quote_varnames],
+[_lt_decl_filter([value], [1], $@)])
+
+
+# lt_decl_dquote_varnames([SEPARATOR], [VARNAME1...])
+# ---------------------------------------------------
+m4_define([lt_decl_dquote_varnames],
+[_lt_decl_filter([value], [2], $@)])
+
+
+# lt_decl_varnames_tagged([SEPARATOR], [VARNAME1...])
+# ---------------------------------------------------
+m4_define([lt_decl_varnames_tagged],
+[m4_assert([$# <= 2])dnl
+_$0(m4_quote(m4_default([$1], [[, ]])),
+ m4_ifval([$2], [[$2]], [m4_dquote(lt_decl_tag_varnames)]),
+ m4_split(m4_normalize(m4_quote(_LT_TAGS)), [ ]))])
+m4_define([_lt_decl_varnames_tagged],
+[m4_ifval([$3], [lt_combine([$1], [$2], [_], $3)])])
+
+
+# lt_decl_all_varnames([SEPARATOR], [VARNAME1...])
+# ------------------------------------------------
+m4_define([lt_decl_all_varnames],
+[_$0(m4_quote(m4_default([$1], [[, ]])),
+ m4_if([$2], [],
+ m4_quote(lt_decl_varnames),
+ m4_quote(m4_shift($@))))[]dnl
+])
+m4_define([_lt_decl_all_varnames],
+[lt_join($@, lt_decl_varnames_tagged([$1],
+ lt_decl_tag_varnames([[, ]], m4_shift($@))))dnl
+])
+
+
+# _LT_CONFIG_STATUS_DECLARE([VARNAME])
+# ------------------------------------
+# Quote a variable value, and forward it to `config.status' so that its
+# declaration there will have the same value as in `configure'. VARNAME
+# must have a single quote delimited value for this to work.
+m4_define([_LT_CONFIG_STATUS_DECLARE],
+[$1='`$ECHO "$][$1" | $SED "$delay_single_quote_subst"`'])
+
+
+# _LT_CONFIG_STATUS_DECLARATIONS
+# ------------------------------
+# We delimit libtool config variables with single quotes, so when
+# we write them to config.status, we have to be sure to quote all
+# embedded single quotes properly. In configure, this macro expands
+# each variable declared with _LT_DECL (and _LT_TAGDECL) into:
+#
+# ='`$ECHO "$" | $SED "$delay_single_quote_subst"`'
+m4_defun([_LT_CONFIG_STATUS_DECLARATIONS],
+[m4_foreach([_lt_var], m4_quote(lt_decl_all_varnames),
+ [m4_n([_LT_CONFIG_STATUS_DECLARE(_lt_var)])])])
+
+
+# _LT_LIBTOOL_TAGS
+# ----------------
+# Output comment and list of tags supported by the script
+m4_defun([_LT_LIBTOOL_TAGS],
+[_LT_FORMAT_COMMENT([The names of the tagged configurations supported by this script])dnl
+available_tags="_LT_TAGS"dnl
+])
+
+
+# _LT_LIBTOOL_DECLARE(VARNAME, [TAG])
+# -----------------------------------
+# Extract the dictionary values for VARNAME (optionally with TAG) and
+# expand to a commented shell variable setting:
+#
+# # Some comment about what VAR is for.
+# visible_name=$lt_internal_name
+m4_define([_LT_LIBTOOL_DECLARE],
+[_LT_FORMAT_COMMENT(m4_quote(lt_dict_fetch([lt_decl_dict], [$1],
+ [description])))[]dnl
+m4_pushdef([_libtool_name],
+ m4_quote(lt_dict_fetch([lt_decl_dict], [$1], [libtool_name])))[]dnl
+m4_case(m4_quote(lt_dict_fetch([lt_decl_dict], [$1], [value])),
+ [0], [_libtool_name=[$]$1],
+ [1], [_libtool_name=$lt_[]$1],
+ [2], [_libtool_name=$lt_[]$1],
+ [_libtool_name=lt_dict_fetch([lt_decl_dict], [$1], [value])])[]dnl
+m4_ifval([$2], [_$2])[]m4_popdef([_libtool_name])[]dnl
+])
+
+
+# _LT_LIBTOOL_CONFIG_VARS
+# -----------------------
+# Produce commented declarations of non-tagged libtool config variables
+# suitable for insertion in the LIBTOOL CONFIG section of the `libtool'
+# script. Tagged libtool config variables (even for the LIBTOOL CONFIG
+# section) are produced by _LT_LIBTOOL_TAG_VARS.
+m4_defun([_LT_LIBTOOL_CONFIG_VARS],
+[m4_foreach([_lt_var],
+ m4_quote(_lt_decl_filter([tagged?], [no], [], lt_decl_varnames)),
+ [m4_n([_LT_LIBTOOL_DECLARE(_lt_var)])])])
+
+
+# _LT_LIBTOOL_TAG_VARS(TAG)
+# -------------------------
+m4_define([_LT_LIBTOOL_TAG_VARS],
+[m4_foreach([_lt_var], m4_quote(lt_decl_tag_varnames),
+ [m4_n([_LT_LIBTOOL_DECLARE(_lt_var, [$1])])])])
+
+
+# _LT_TAGVAR(VARNAME, [TAGNAME])
+# ------------------------------
+m4_define([_LT_TAGVAR], [m4_ifval([$2], [$1_$2], [$1])])
+
+
+# _LT_CONFIG_COMMANDS
+# -------------------
+# Send accumulated output to $CONFIG_STATUS. Thanks to the lists of
+# variables for single and double quote escaping we saved from calls
+# to _LT_DECL, we can put quote escaped variables declarations
+# into `config.status', and then the shell code to quote escape them in
+# for loops in `config.status'. Finally, any additional code accumulated
+# from calls to _LT_CONFIG_LIBTOOL_INIT is expanded.
+m4_defun([_LT_CONFIG_COMMANDS],
+[AC_PROVIDE_IFELSE([LT_OUTPUT],
+ dnl If the libtool generation code has been placed in $CONFIG_LT,
+ dnl instead of duplicating it all over again into config.status,
+ dnl then we will have config.status run $CONFIG_LT later, so it
+ dnl needs to know what name is stored there:
+ [AC_CONFIG_COMMANDS([libtool],
+ [$SHELL $CONFIG_LT || AS_EXIT(1)], [CONFIG_LT='$CONFIG_LT'])],
+ dnl If the libtool generation code is destined for config.status,
+ dnl expand the accumulated commands and init code now:
+ [AC_CONFIG_COMMANDS([libtool],
+ [_LT_OUTPUT_LIBTOOL_COMMANDS], [_LT_OUTPUT_LIBTOOL_COMMANDS_INIT])])
+])#_LT_CONFIG_COMMANDS
+
+
+# Initialize.
+m4_define([_LT_OUTPUT_LIBTOOL_COMMANDS_INIT],
+[
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+(unset CDPATH) >/dev/null 2>&1 && unset CDPATH
+
+sed_quote_subst='$sed_quote_subst'
+double_quote_subst='$double_quote_subst'
+delay_variable_subst='$delay_variable_subst'
+_LT_CONFIG_STATUS_DECLARATIONS
+LTCC='$LTCC'
+LTCFLAGS='$LTCFLAGS'
+compiler='$compiler_DEFAULT'
+
+# A function that is used when there is no print builtin or printf.
+func_fallback_echo ()
+{
+ eval 'cat <<_LTECHO_EOF
+\$[]1
+_LTECHO_EOF'
+}
+
+# Quote evaled strings.
+for var in lt_decl_all_varnames([[ \
+]], lt_decl_quote_varnames); do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[[\\\\\\\`\\"\\\$]]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED \\"\\\$sed_quote_subst\\"\\\`\\\\\\""
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+# Double-quote double-evaled strings.
+for var in lt_decl_all_varnames([[ \
+]], lt_decl_dquote_varnames); do
+ case \`eval \\\\\$ECHO \\\\""\\\\\$\$var"\\\\"\` in
+ *[[\\\\\\\`\\"\\\$]]*)
+ eval "lt_\$var=\\\\\\"\\\`\\\$ECHO \\"\\\$\$var\\" | \\\$SED -e \\"\\\$double_quote_subst\\" -e \\"\\\$sed_quote_subst\\" -e \\"\\\$delay_variable_subst\\"\\\`\\\\\\""
+ ;;
+ *)
+ eval "lt_\$var=\\\\\\"\\\$\$var\\\\\\""
+ ;;
+ esac
+done
+
+_LT_OUTPUT_LIBTOOL_INIT
+])
+
+# _LT_GENERATED_FILE_INIT(FILE, [COMMENT])
+# ------------------------------------
+# Generate a child script FILE with all initialization necessary to
+# reuse the environment learned by the parent script, and make the
+# file executable. If COMMENT is supplied, it is inserted after the
+# `#!' sequence but before initialization text begins. After this
+# macro, additional text can be appended to FILE to form the body of
+# the child script. The macro ends with non-zero status if the
+# file could not be fully written (such as if the disk is full).
+m4_ifdef([AS_INIT_GENERATED],
+[m4_defun([_LT_GENERATED_FILE_INIT],[AS_INIT_GENERATED($@)])],
+[m4_defun([_LT_GENERATED_FILE_INIT],
+[m4_require([AS_PREPARE])]dnl
+[m4_pushdef([AS_MESSAGE_LOG_FD])]dnl
+[lt_write_fail=0
+cat >$1 <<_ASEOF || lt_write_fail=1
+#! $SHELL
+# Generated by $as_me.
+$2
+SHELL=\${CONFIG_SHELL-$SHELL}
+export SHELL
+_ASEOF
+cat >>$1 <<\_ASEOF || lt_write_fail=1
+AS_SHELL_SANITIZE
+_AS_PREPARE
+exec AS_MESSAGE_FD>&1
+_ASEOF
+test $lt_write_fail = 0 && chmod +x $1[]dnl
+m4_popdef([AS_MESSAGE_LOG_FD])])])# _LT_GENERATED_FILE_INIT
+
+# LT_OUTPUT
+# ---------
+# This macro allows early generation of the libtool script (before
+# AC_OUTPUT is called), incase it is used in configure for compilation
+# tests.
+AC_DEFUN([LT_OUTPUT],
+[: ${CONFIG_LT=./config.lt}
+AC_MSG_NOTICE([creating $CONFIG_LT])
+_LT_GENERATED_FILE_INIT(["$CONFIG_LT"],
+[# Run this file to recreate a libtool stub with the current configuration.])
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+lt_cl_silent=false
+exec AS_MESSAGE_LOG_FD>>config.log
+{
+ echo
+ AS_BOX([Running $as_me.])
+} >&AS_MESSAGE_LOG_FD
+
+lt_cl_help="\
+\`$as_me' creates a local libtool stub from the current configuration,
+for use in further configure time tests before the real libtool is
+generated.
+
+Usage: $[0] [[OPTIONS]]
+
+ -h, --help print this help, then exit
+ -V, --version print version number, then exit
+ -q, --quiet do not print progress messages
+ -d, --debug don't remove temporary files
+
+Report bugs to ."
+
+lt_cl_version="\
+m4_ifset([AC_PACKAGE_NAME], [AC_PACKAGE_NAME ])config.lt[]dnl
+m4_ifset([AC_PACKAGE_VERSION], [ AC_PACKAGE_VERSION])
+configured by $[0], generated by m4_PACKAGE_STRING.
+
+Copyright (C) 2011 Free Software Foundation, Inc.
+This config.lt script is free software; the Free Software Foundation
+gives unlimited permision to copy, distribute and modify it."
+
+while test $[#] != 0
+do
+ case $[1] in
+ --version | --v* | -V )
+ echo "$lt_cl_version"; exit 0 ;;
+ --help | --h* | -h )
+ echo "$lt_cl_help"; exit 0 ;;
+ --debug | --d* | -d )
+ debug=: ;;
+ --quiet | --q* | --silent | --s* | -q )
+ lt_cl_silent=: ;;
+
+ -*) AC_MSG_ERROR([unrecognized option: $[1]
+Try \`$[0] --help' for more information.]) ;;
+
+ *) AC_MSG_ERROR([unrecognized argument: $[1]
+Try \`$[0] --help' for more information.]) ;;
+ esac
+ shift
+done
+
+if $lt_cl_silent; then
+ exec AS_MESSAGE_FD>/dev/null
+fi
+_LTEOF
+
+cat >>"$CONFIG_LT" <<_LTEOF
+_LT_OUTPUT_LIBTOOL_COMMANDS_INIT
+_LTEOF
+
+cat >>"$CONFIG_LT" <<\_LTEOF
+AC_MSG_NOTICE([creating $ofile])
+_LT_OUTPUT_LIBTOOL_COMMANDS
+AS_EXIT(0)
+_LTEOF
+chmod +x "$CONFIG_LT"
+
+# configure is writing to config.log, but config.lt does its own redirection,
+# appending to config.log, which fails on DOS, as config.log is still kept
+# open by configure. Here we exec the FD to /dev/null, effectively closing
+# config.log, so it can be properly (re)opened and appended to by config.lt.
+lt_cl_success=:
+test "$silent" = yes &&
+ lt_config_lt_args="$lt_config_lt_args --quiet"
+exec AS_MESSAGE_LOG_FD>/dev/null
+$SHELL "$CONFIG_LT" $lt_config_lt_args || lt_cl_success=false
+exec AS_MESSAGE_LOG_FD>>config.log
+$lt_cl_success || AS_EXIT(1)
+])# LT_OUTPUT
+
+
+# _LT_CONFIG(TAG)
+# ---------------
+# If TAG is the built-in tag, create an initial libtool script with a
+# default configuration from the untagged config vars. Otherwise add code
+# to config.status for appending the configuration named by TAG from the
+# matching tagged config vars.
+m4_defun([_LT_CONFIG],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+_LT_CONFIG_SAVE_COMMANDS([
+ m4_define([_LT_TAG], m4_if([$1], [], [C], [$1]))dnl
+ m4_if(_LT_TAG, [C], [
+ # See if we are running on zsh, and set the options which allow our
+ # commands through without removal of \ escapes.
+ if test -n "${ZSH_VERSION+set}" ; then
+ setopt NO_GLOB_SUBST
+ fi
+
+ cfgfile="${ofile}T"
+ trap "$RM \"$cfgfile\"; exit 1" 1 2 15
+ $RM "$cfgfile"
+
+ cat <<_LT_EOF >> "$cfgfile"
+#! $SHELL
+
+# `$ECHO "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $as_me ($PACKAGE$TIMESTAMP) $VERSION
+# Libtool was configured on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+# NOTE: Changes made to this file will be lost: look at ltmain.sh.
+#
+_LT_COPYING
+_LT_LIBTOOL_TAGS
+
+# ### BEGIN LIBTOOL CONFIG
+_LT_LIBTOOL_CONFIG_VARS
+_LT_LIBTOOL_TAG_VARS
+# ### END LIBTOOL CONFIG
+
+_LT_EOF
+
+ case $host_os in
+ aix3*)
+ cat <<\_LT_EOF >> "$cfgfile"
+# AIX sometimes has problems with the GCC collect2 program. For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "X${COLLECT_NAMES+set}" != Xset; then
+ COLLECT_NAMES=
+ export COLLECT_NAMES
+fi
+_LT_EOF
+ ;;
+ esac
+
+ _LT_PROG_LTMAIN
+
+ # We use sed instead of cat because bash on DJGPP gets confused if
+ # if finds mixed CR/LF and LF-only lines. Since sed operates in
+ # text mode, it properly converts lines to CR/LF. This bash problem
+ # is reportedly fixed, but why not run on old versions too?
+ sed '$q' "$ltmain" >> "$cfgfile" \
+ || (rm -f "$cfgfile"; exit 1)
+
+ _LT_PROG_REPLACE_SHELLFNS
+
+ mv -f "$cfgfile" "$ofile" ||
+ (rm -f "$ofile" && cp "$cfgfile" "$ofile" && rm -f "$cfgfile")
+ chmod +x "$ofile"
+],
+[cat <<_LT_EOF >> "$ofile"
+
+dnl Unfortunately we have to use $1 here, since _LT_TAG is not expanded
+dnl in a comment (ie after a #).
+# ### BEGIN LIBTOOL TAG CONFIG: $1
+_LT_LIBTOOL_TAG_VARS(_LT_TAG)
+# ### END LIBTOOL TAG CONFIG: $1
+_LT_EOF
+])dnl /m4_if
+],
+[m4_if([$1], [], [
+ PACKAGE='$PACKAGE'
+ VERSION='$VERSION'
+ TIMESTAMP='$TIMESTAMP'
+ RM='$RM'
+ ofile='$ofile'], [])
+])dnl /_LT_CONFIG_SAVE_COMMANDS
+])# _LT_CONFIG
+
+
+# LT_SUPPORTED_TAG(TAG)
+# ---------------------
+# Trace this macro to discover what tags are supported by the libtool
+# --tag option, using:
+# autoconf --trace 'LT_SUPPORTED_TAG:$1'
+AC_DEFUN([LT_SUPPORTED_TAG], [])
+
+
+# C support is built-in for now
+m4_define([_LT_LANG_C_enabled], [])
+m4_define([_LT_TAGS], [])
+
+
+# LT_LANG(LANG)
+# -------------
+# Enable libtool support for the given language if not already enabled.
+AC_DEFUN([LT_LANG],
+[AC_BEFORE([$0], [LT_OUTPUT])dnl
+m4_case([$1],
+ [C], [_LT_LANG(C)],
+ [C++], [_LT_LANG(CXX)],
+ [Go], [_LT_LANG(GO)],
+ [Java], [_LT_LANG(GCJ)],
+ [Fortran 77], [_LT_LANG(F77)],
+ [Fortran], [_LT_LANG(FC)],
+ [Windows Resource], [_LT_LANG(RC)],
+ [m4_ifdef([_LT_LANG_]$1[_CONFIG],
+ [_LT_LANG($1)],
+ [m4_fatal([$0: unsupported language: "$1"])])])dnl
+])# LT_LANG
+
+
+# _LT_LANG(LANGNAME)
+# ------------------
+m4_defun([_LT_LANG],
+[m4_ifdef([_LT_LANG_]$1[_enabled], [],
+ [LT_SUPPORTED_TAG([$1])dnl
+ m4_append([_LT_TAGS], [$1 ])dnl
+ m4_define([_LT_LANG_]$1[_enabled], [])dnl
+ _LT_LANG_$1_CONFIG($1)])dnl
+])# _LT_LANG
+
+
+m4_ifndef([AC_PROG_GO], [
+############################################################
+# NOTE: This macro has been submitted for inclusion into #
+# GNU Autoconf as AC_PROG_GO. When it is available in #
+# a released version of Autoconf we should remove this #
+# macro and use it instead. #
+############################################################
+m4_defun([AC_PROG_GO],
+[AC_LANG_PUSH(Go)dnl
+AC_ARG_VAR([GOC], [Go compiler command])dnl
+AC_ARG_VAR([GOFLAGS], [Go compiler flags])dnl
+_AC_ARG_VAR_LDFLAGS()dnl
+AC_CHECK_TOOL(GOC, gccgo)
+if test -z "$GOC"; then
+ if test -n "$ac_tool_prefix"; then
+ AC_CHECK_PROG(GOC, [${ac_tool_prefix}gccgo], [${ac_tool_prefix}gccgo])
+ fi
+fi
+if test -z "$GOC"; then
+ AC_CHECK_PROG(GOC, gccgo, gccgo, false)
+fi
+])#m4_defun
+])#m4_ifndef
+
+
+# _LT_LANG_DEFAULT_CONFIG
+# -----------------------
+m4_defun([_LT_LANG_DEFAULT_CONFIG],
+[AC_PROVIDE_IFELSE([AC_PROG_CXX],
+ [LT_LANG(CXX)],
+ [m4_define([AC_PROG_CXX], defn([AC_PROG_CXX])[LT_LANG(CXX)])])
+
+AC_PROVIDE_IFELSE([AC_PROG_F77],
+ [LT_LANG(F77)],
+ [m4_define([AC_PROG_F77], defn([AC_PROG_F77])[LT_LANG(F77)])])
+
+AC_PROVIDE_IFELSE([AC_PROG_FC],
+ [LT_LANG(FC)],
+ [m4_define([AC_PROG_FC], defn([AC_PROG_FC])[LT_LANG(FC)])])
+
+dnl The call to [A][M_PROG_GCJ] is quoted like that to stop aclocal
+dnl pulling things in needlessly.
+AC_PROVIDE_IFELSE([AC_PROG_GCJ],
+ [LT_LANG(GCJ)],
+ [AC_PROVIDE_IFELSE([A][M_PROG_GCJ],
+ [LT_LANG(GCJ)],
+ [AC_PROVIDE_IFELSE([LT_PROG_GCJ],
+ [LT_LANG(GCJ)],
+ [m4_ifdef([AC_PROG_GCJ],
+ [m4_define([AC_PROG_GCJ], defn([AC_PROG_GCJ])[LT_LANG(GCJ)])])
+ m4_ifdef([A][M_PROG_GCJ],
+ [m4_define([A][M_PROG_GCJ], defn([A][M_PROG_GCJ])[LT_LANG(GCJ)])])
+ m4_ifdef([LT_PROG_GCJ],
+ [m4_define([LT_PROG_GCJ], defn([LT_PROG_GCJ])[LT_LANG(GCJ)])])])])])
+
+AC_PROVIDE_IFELSE([AC_PROG_GO],
+ [LT_LANG(GO)],
+ [m4_define([AC_PROG_GO], defn([AC_PROG_GO])[LT_LANG(GO)])])
+
+AC_PROVIDE_IFELSE([LT_PROG_RC],
+ [LT_LANG(RC)],
+ [m4_define([LT_PROG_RC], defn([LT_PROG_RC])[LT_LANG(RC)])])
+])# _LT_LANG_DEFAULT_CONFIG
+
+# Obsolete macros:
+AU_DEFUN([AC_LIBTOOL_CXX], [LT_LANG(C++)])
+AU_DEFUN([AC_LIBTOOL_F77], [LT_LANG(Fortran 77)])
+AU_DEFUN([AC_LIBTOOL_FC], [LT_LANG(Fortran)])
+AU_DEFUN([AC_LIBTOOL_GCJ], [LT_LANG(Java)])
+AU_DEFUN([AC_LIBTOOL_RC], [LT_LANG(Windows Resource)])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_CXX], [])
+dnl AC_DEFUN([AC_LIBTOOL_F77], [])
+dnl AC_DEFUN([AC_LIBTOOL_FC], [])
+dnl AC_DEFUN([AC_LIBTOOL_GCJ], [])
+dnl AC_DEFUN([AC_LIBTOOL_RC], [])
+
+
+# _LT_TAG_COMPILER
+# ----------------
+m4_defun([_LT_TAG_COMPILER],
+[AC_REQUIRE([AC_PROG_CC])dnl
+
+_LT_DECL([LTCC], [CC], [1], [A C compiler])dnl
+_LT_DECL([LTCFLAGS], [CFLAGS], [1], [LTCC compiler flags])dnl
+_LT_TAGDECL([CC], [compiler], [1], [A language specific compiler])dnl
+_LT_TAGDECL([with_gcc], [GCC], [0], [Is the compiler the GNU compiler?])dnl
+
+# If no C compiler was specified, use CC.
+LTCC=${LTCC-"$CC"}
+
+# If no C compiler flags were specified, use CFLAGS.
+LTCFLAGS=${LTCFLAGS-"$CFLAGS"}
+
+# Allow CC to be a program name with arguments.
+compiler=$CC
+])# _LT_TAG_COMPILER
+
+
+# _LT_COMPILER_BOILERPLATE
+# ------------------------
+# Check for compiler boilerplate output or warnings with
+# the simple compiler test code.
+m4_defun([_LT_COMPILER_BOILERPLATE],
+[m4_require([_LT_DECL_SED])dnl
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_compile_test_code" >conftest.$ac_ext
+eval "$ac_compile" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_compiler_boilerplate=`cat conftest.err`
+$RM conftest*
+])# _LT_COMPILER_BOILERPLATE
+
+
+# _LT_LINKER_BOILERPLATE
+# ----------------------
+# Check for linker boilerplate output or warnings with
+# the simple link test code.
+m4_defun([_LT_LINKER_BOILERPLATE],
+[m4_require([_LT_DECL_SED])dnl
+ac_outfile=conftest.$ac_objext
+echo "$lt_simple_link_test_code" >conftest.$ac_ext
+eval "$ac_link" 2>&1 >/dev/null | $SED '/^$/d; /^ *+/d' >conftest.err
+_lt_linker_boilerplate=`cat conftest.err`
+$RM -r conftest*
+])# _LT_LINKER_BOILERPLATE
+
+# _LT_REQUIRED_DARWIN_CHECKS
+# -------------------------
+m4_defun_once([_LT_REQUIRED_DARWIN_CHECKS],[
+ case $host_os in
+ rhapsody* | darwin*)
+ AC_CHECK_TOOL([DSYMUTIL], [dsymutil], [:])
+ AC_CHECK_TOOL([NMEDIT], [nmedit], [:])
+ AC_CHECK_TOOL([LIPO], [lipo], [:])
+ AC_CHECK_TOOL([OTOOL], [otool], [:])
+ AC_CHECK_TOOL([OTOOL64], [otool64], [:])
+ _LT_DECL([], [DSYMUTIL], [1],
+ [Tool to manipulate archived DWARF debug symbol files on Mac OS X])
+ _LT_DECL([], [NMEDIT], [1],
+ [Tool to change global to local symbols on Mac OS X])
+ _LT_DECL([], [LIPO], [1],
+ [Tool to manipulate fat objects and archives on Mac OS X])
+ _LT_DECL([], [OTOOL], [1],
+ [ldd/readelf like tool for Mach-O binaries on Mac OS X])
+ _LT_DECL([], [OTOOL64], [1],
+ [ldd/readelf like tool for 64 bit Mach-O binaries on Mac OS X 10.4])
+
+ AC_CACHE_CHECK([for -single_module linker flag],[lt_cv_apple_cc_single_mod],
+ [lt_cv_apple_cc_single_mod=no
+ if test -z "${LT_MULTI_MODULE}"; then
+ # By default we will add the -single_module flag. You can override
+ # by either setting the environment variable LT_MULTI_MODULE
+ # non-empty at configure time, or by adding -multi_module to the
+ # link flags.
+ rm -rf libconftest.dylib*
+ echo "int foo(void){return 1;}" > conftest.c
+ echo "$LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+-dynamiclib -Wl,-single_module conftest.c" >&AS_MESSAGE_LOG_FD
+ $LTCC $LTCFLAGS $LDFLAGS -o libconftest.dylib \
+ -dynamiclib -Wl,-single_module conftest.c 2>conftest.err
+ _lt_result=$?
+ # If there is a non-empty error log, and "single_module"
+ # appears in it, assume the flag caused a linker warning
+ if test -s conftest.err && $GREP single_module conftest.err; then
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ # Otherwise, if the output was created with a 0 exit code from
+ # the compiler, it worked.
+ elif test -f libconftest.dylib && test $_lt_result -eq 0; then
+ lt_cv_apple_cc_single_mod=yes
+ else
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ fi
+ rm -rf libconftest.dylib*
+ rm -f conftest.*
+ fi])
+
+ AC_CACHE_CHECK([for -exported_symbols_list linker flag],
+ [lt_cv_ld_exported_symbols_list],
+ [lt_cv_ld_exported_symbols_list=no
+ save_LDFLAGS=$LDFLAGS
+ echo "_main" > conftest.sym
+ LDFLAGS="$LDFLAGS -Wl,-exported_symbols_list,conftest.sym"
+ AC_LINK_IFELSE([AC_LANG_PROGRAM([],[])],
+ [lt_cv_ld_exported_symbols_list=yes],
+ [lt_cv_ld_exported_symbols_list=no])
+ LDFLAGS="$save_LDFLAGS"
+ ])
+
+ AC_CACHE_CHECK([for -force_load linker flag],[lt_cv_ld_force_load],
+ [lt_cv_ld_force_load=no
+ cat > conftest.c << _LT_EOF
+int forced_loaded() { return 2;}
+_LT_EOF
+ echo "$LTCC $LTCFLAGS -c -o conftest.o conftest.c" >&AS_MESSAGE_LOG_FD
+ $LTCC $LTCFLAGS -c -o conftest.o conftest.c 2>&AS_MESSAGE_LOG_FD
+ echo "$AR cru libconftest.a conftest.o" >&AS_MESSAGE_LOG_FD
+ $AR cru libconftest.a conftest.o 2>&AS_MESSAGE_LOG_FD
+ echo "$RANLIB libconftest.a" >&AS_MESSAGE_LOG_FD
+ $RANLIB libconftest.a 2>&AS_MESSAGE_LOG_FD
+ cat > conftest.c << _LT_EOF
+int main() { return 0;}
+_LT_EOF
+ echo "$LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a" >&AS_MESSAGE_LOG_FD
+ $LTCC $LTCFLAGS $LDFLAGS -o conftest conftest.c -Wl,-force_load,./libconftest.a 2>conftest.err
+ _lt_result=$?
+ if test -s conftest.err && $GREP force_load conftest.err; then
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ elif test -f conftest && test $_lt_result -eq 0 && $GREP forced_load conftest >/dev/null 2>&1 ; then
+ lt_cv_ld_force_load=yes
+ else
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ fi
+ rm -f conftest.err libconftest.a conftest conftest.c
+ rm -rf conftest.dSYM
+ ])
+ case $host_os in
+ rhapsody* | darwin1.[[012]])
+ _lt_dar_allow_undefined='${wl}-undefined ${wl}suppress' ;;
+ darwin1.*)
+ _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+ darwin*) # darwin 5.x on
+ # if running on 10.5 or later, the deployment target defaults
+ # to the OS version, if on x86, and 10.4, the deployment
+ # target defaults to 10.4. Don't you love it?
+ case ${MACOSX_DEPLOYMENT_TARGET-10.0},$host in
+ 10.0,*86*-darwin8*|10.0,*-darwin[[91]]*)
+ _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+ 10.[[012]]*)
+ _lt_dar_allow_undefined='${wl}-flat_namespace ${wl}-undefined ${wl}suppress' ;;
+ 10.*)
+ _lt_dar_allow_undefined='${wl}-undefined ${wl}dynamic_lookup' ;;
+ esac
+ ;;
+ esac
+ if test "$lt_cv_apple_cc_single_mod" = "yes"; then
+ _lt_dar_single_mod='$single_module'
+ fi
+ if test "$lt_cv_ld_exported_symbols_list" = "yes"; then
+ _lt_dar_export_syms=' ${wl}-exported_symbols_list,$output_objdir/${libname}-symbols.expsym'
+ else
+ _lt_dar_export_syms='~$NMEDIT -s $output_objdir/${libname}-symbols.expsym ${lib}'
+ fi
+ if test "$DSYMUTIL" != ":" && test "$lt_cv_ld_force_load" = "no"; then
+ _lt_dsymutil='~$DSYMUTIL $lib || :'
+ else
+ _lt_dsymutil=
+ fi
+ ;;
+ esac
+])
+
+
+# _LT_DARWIN_LINKER_FEATURES([TAG])
+# ---------------------------------
+# Checks for linker and compiler features on darwin
+m4_defun([_LT_DARWIN_LINKER_FEATURES],
+[
+ m4_require([_LT_REQUIRED_DARWIN_CHECKS])
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ _LT_TAGVAR(hardcode_automatic, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+ if test "$lt_cv_ld_force_load" = "yes"; then
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience ${wl}-force_load,$conv\"; done; func_echo_all \"$new_convenience\"`'
+ m4_case([$1], [F77], [_LT_TAGVAR(compiler_needs_object, $1)=yes],
+ [FC], [_LT_TAGVAR(compiler_needs_object, $1)=yes])
+ else
+ _LT_TAGVAR(whole_archive_flag_spec, $1)=''
+ fi
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_TAGVAR(allow_undefined_flag, $1)="$_lt_dar_allow_undefined"
+ case $cc_basename in
+ ifort*) _lt_dar_can_shared=yes ;;
+ *) _lt_dar_can_shared=$GCC ;;
+ esac
+ if test "$_lt_dar_can_shared" = "yes"; then
+ output_verbose_link_cmd=func_echo_all
+ _LT_TAGVAR(archive_cmds, $1)="\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring $_lt_dar_single_mod${_lt_dsymutil}"
+ _LT_TAGVAR(module_cmds, $1)="\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dsymutil}"
+ _LT_TAGVAR(archive_expsym_cmds, $1)="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \$libobjs \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring ${_lt_dar_single_mod}${_lt_dar_export_syms}${_lt_dsymutil}"
+ _LT_TAGVAR(module_expsym_cmds, $1)="sed -e 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC \$allow_undefined_flag -o \$lib -bundle \$libobjs \$deplibs \$compiler_flags${_lt_dar_export_syms}${_lt_dsymutil}"
+ m4_if([$1], [CXX],
+[ if test "$lt_cv_apple_cc_single_mod" != "yes"; then
+ _LT_TAGVAR(archive_cmds, $1)="\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dsymutil}"
+ _LT_TAGVAR(archive_expsym_cmds, $1)="sed 's,^,_,' < \$export_symbols > \$output_objdir/\${libname}-symbols.expsym~\$CC -r -keep_private_externs -nostdlib -o \${lib}-master.o \$libobjs~\$CC -dynamiclib \$allow_undefined_flag -o \$lib \${lib}-master.o \$deplibs \$compiler_flags -install_name \$rpath/\$soname \$verstring${_lt_dar_export_syms}${_lt_dsymutil}"
+ fi
+],[])
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+])
+
+# _LT_SYS_MODULE_PATH_AIX([TAGNAME])
+# ----------------------------------
+# Links a minimal program and checks the executable
+# for the system default hardcoded library path. In most cases,
+# this is /usr/lib:/lib, but when the MPI compilers are used
+# the location of the communication and MPI libs are included too.
+# If we don't find anything, use the default library path according
+# to the aix ld manual.
+# Store the results from the different compilers for each TAGNAME.
+# Allow to override them for all tags through lt_cv_aix_libpath.
+m4_defun([_LT_SYS_MODULE_PATH_AIX],
+[m4_require([_LT_DECL_SED])dnl
+if test "${lt_cv_aix_libpath+set}" = set; then
+ aix_libpath=$lt_cv_aix_libpath
+else
+ AC_CACHE_VAL([_LT_TAGVAR([lt_cv_aix_libpath_], [$1])],
+ [AC_LINK_IFELSE([AC_LANG_PROGRAM],[
+ lt_aix_libpath_sed='[
+ /Import File Strings/,/^$/ {
+ /^0/ {
+ s/^0 *\([^ ]*\) *$/\1/
+ p
+ }
+ }]'
+ _LT_TAGVAR([lt_cv_aix_libpath_], [$1])=`dump -H conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ # Check for a 64-bit object if we didn't find anything.
+ if test -z "$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])"; then
+ _LT_TAGVAR([lt_cv_aix_libpath_], [$1])=`dump -HX64 conftest$ac_exeext 2>/dev/null | $SED -n -e "$lt_aix_libpath_sed"`
+ fi],[])
+ if test -z "$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])"; then
+ _LT_TAGVAR([lt_cv_aix_libpath_], [$1])="/usr/lib:/lib"
+ fi
+ ])
+ aix_libpath=$_LT_TAGVAR([lt_cv_aix_libpath_], [$1])
+fi
+])# _LT_SYS_MODULE_PATH_AIX
+
+
+# _LT_SHELL_INIT(ARG)
+# -------------------
+m4_define([_LT_SHELL_INIT],
+[m4_divert_text([M4SH-INIT], [$1
+])])# _LT_SHELL_INIT
+
+
+
+# _LT_PROG_ECHO_BACKSLASH
+# -----------------------
+# Find how we can fake an echo command that does not interpret backslash.
+# In particular, with Autoconf 2.60 or later we add some code to the start
+# of the generated configure script which will find a shell with a builtin
+# printf (which we can use as an echo command).
+m4_defun([_LT_PROG_ECHO_BACKSLASH],
+[ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+
+AC_MSG_CHECKING([how to print strings])
+# Test print first, because it will be a builtin if present.
+if test "X`( print -r -- -n ) 2>/dev/null`" = X-n && \
+ test "X`print -r -- $ECHO 2>/dev/null`" = "X$ECHO"; then
+ ECHO='print -r --'
+elif test "X`printf %s $ECHO 2>/dev/null`" = "X$ECHO"; then
+ ECHO='printf %s\n'
+else
+ # Use this function as a fallback that always works.
+ func_fallback_echo ()
+ {
+ eval 'cat <<_LTECHO_EOF
+$[]1
+_LTECHO_EOF'
+ }
+ ECHO='func_fallback_echo'
+fi
+
+# func_echo_all arg...
+# Invoke $ECHO with all args, space-separated.
+func_echo_all ()
+{
+ $ECHO "$*"
+}
+
+case "$ECHO" in
+ printf*) AC_MSG_RESULT([printf]) ;;
+ print*) AC_MSG_RESULT([print -r]) ;;
+ *) AC_MSG_RESULT([cat]) ;;
+esac
+
+m4_ifdef([_AS_DETECT_SUGGESTED],
+[_AS_DETECT_SUGGESTED([
+ test -n "${ZSH_VERSION+set}${BASH_VERSION+set}" || (
+ ECHO='\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\'
+ ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO
+ ECHO=$ECHO$ECHO$ECHO$ECHO$ECHO$ECHO
+ PATH=/empty FPATH=/empty; export PATH FPATH
+ test "X`printf %s $ECHO`" = "X$ECHO" \
+ || test "X`print -r -- $ECHO`" = "X$ECHO" )])])
+
+_LT_DECL([], [SHELL], [1], [Shell to use when invoking shell scripts])
+_LT_DECL([], [ECHO], [1], [An echo program that protects backslashes])
+])# _LT_PROG_ECHO_BACKSLASH
+
+
+# _LT_WITH_SYSROOT
+# ----------------
+AC_DEFUN([_LT_WITH_SYSROOT],
+[AC_MSG_CHECKING([for sysroot])
+AC_ARG_WITH([sysroot],
+[ --with-sysroot[=DIR] Search for dependent libraries within DIR
+ (or the compiler's sysroot if not specified).],
+[], [with_sysroot=no])
+
+dnl lt_sysroot will always be passed unquoted. We quote it here
+dnl in case the user passed a directory name.
+lt_sysroot=
+case ${with_sysroot} in #(
+ yes)
+ if test "$GCC" = yes; then
+ lt_sysroot=`$CC --print-sysroot 2>/dev/null`
+ fi
+ ;; #(
+ /*)
+ lt_sysroot=`echo "$with_sysroot" | sed -e "$sed_quote_subst"`
+ ;; #(
+ no|'')
+ ;; #(
+ *)
+ AC_MSG_RESULT([${with_sysroot}])
+ AC_MSG_ERROR([The sysroot must be an absolute path.])
+ ;;
+esac
+
+ AC_MSG_RESULT([${lt_sysroot:-no}])
+_LT_DECL([], [lt_sysroot], [0], [The root where to search for ]dnl
+[dependent libraries, and in which our libraries should be installed.])])
+
+# _LT_ENABLE_LOCK
+# ---------------
+m4_defun([_LT_ENABLE_LOCK],
+[AC_ARG_ENABLE([libtool-lock],
+ [AS_HELP_STRING([--disable-libtool-lock],
+ [avoid locking (might break parallel builds)])])
+test "x$enable_libtool_lock" != xno && enable_libtool_lock=yes
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case $host in
+ia64-*-hpux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *ELF-32*)
+ HPUX_IA64_MODE="32"
+ ;;
+ *ELF-64*)
+ HPUX_IA64_MODE="64"
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+*-*-irix6*)
+ # Find out which ABI we are using.
+ echo '[#]line '$LINENO' "configure"' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -melf32bsmip"
+ ;;
+ *N32*)
+ LD="${LD-ld} -melf32bmipn32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -melf64bmip"
+ ;;
+ esac
+ else
+ case `/usr/bin/file conftest.$ac_objext` in
+ *32-bit*)
+ LD="${LD-ld} -32"
+ ;;
+ *N32*)
+ LD="${LD-ld} -n32"
+ ;;
+ *64-bit*)
+ LD="${LD-ld} -64"
+ ;;
+ esac
+ fi
+ fi
+ rm -rf conftest*
+ ;;
+
+x86_64-*kfreebsd*-gnu|x86_64-*linux*|powerpc*-*linux*| \
+s390*-*linux*|s390*-*tpf*|sparc*-*linux*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.o` in
+ *32-bit*)
+ case $host in
+ x86_64-*kfreebsd*-gnu)
+ LD="${LD-ld} -m elf_i386_fbsd"
+ ;;
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_i386"
+ ;;
+ powerpc64le-*linux*)
+ LD="${LD-ld} -m elf32lppclinux"
+ ;;
+ powerpc64-*linux*)
+ LD="${LD-ld} -m elf32ppclinux"
+ ;;
+ s390x-*linux*)
+ LD="${LD-ld} -m elf_s390"
+ ;;
+ sparc64-*linux*)
+ LD="${LD-ld} -m elf32_sparc"
+ ;;
+ esac
+ ;;
+ *64-bit*)
+ case $host in
+ x86_64-*kfreebsd*-gnu)
+ LD="${LD-ld} -m elf_x86_64_fbsd"
+ ;;
+ x86_64-*linux*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ powerpcle-*linux*)
+ LD="${LD-ld} -m elf64lppc"
+ ;;
+ powerpc-*linux*)
+ LD="${LD-ld} -m elf64ppc"
+ ;;
+ s390*-*linux*|s390*-*tpf*)
+ LD="${LD-ld} -m elf64_s390"
+ ;;
+ sparc*-*linux*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+
+*-*-sco3.2v5*)
+ # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+ SAVE_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -belf"
+ AC_CACHE_CHECK([whether the C compiler needs -belf], lt_cv_cc_needs_belf,
+ [AC_LANG_PUSH(C)
+ AC_LINK_IFELSE([AC_LANG_PROGRAM([[]],[[]])],[lt_cv_cc_needs_belf=yes],[lt_cv_cc_needs_belf=no])
+ AC_LANG_POP])
+ if test x"$lt_cv_cc_needs_belf" != x"yes"; then
+ # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf
+ CFLAGS="$SAVE_CFLAGS"
+ fi
+ ;;
+*-*solaris*)
+ # Find out which ABI we are using.
+ echo 'int i;' > conftest.$ac_ext
+ if AC_TRY_EVAL(ac_compile); then
+ case `/usr/bin/file conftest.o` in
+ *64-bit*)
+ case $lt_cv_prog_gnu_ld in
+ yes*)
+ case $host in
+ i?86-*-solaris*)
+ LD="${LD-ld} -m elf_x86_64"
+ ;;
+ sparc*-*-solaris*)
+ LD="${LD-ld} -m elf64_sparc"
+ ;;
+ esac
+ # GNU ld 2.21 introduced _sol2 emulations. Use them if available.
+ if ${LD-ld} -V | grep _sol2 >/dev/null 2>&1; then
+ LD="${LD-ld}_sol2"
+ fi
+ ;;
+ *)
+ if ${LD-ld} -64 -r -o conftest2.o conftest.o >/dev/null 2>&1; then
+ LD="${LD-ld} -64"
+ fi
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ rm -rf conftest*
+ ;;
+esac
+
+need_locks="$enable_libtool_lock"
+])# _LT_ENABLE_LOCK
+
+
+# _LT_PROG_AR
+# -----------
+m4_defun([_LT_PROG_AR],
+[AC_CHECK_TOOLS(AR, [ar], false)
+: ${AR=ar}
+: ${AR_FLAGS=cru}
+_LT_DECL([], [AR], [1], [The archiver])
+_LT_DECL([], [AR_FLAGS], [1], [Flags to create an archive])
+
+AC_CACHE_CHECK([for archiver @FILE support], [lt_cv_ar_at_file],
+ [lt_cv_ar_at_file=no
+ AC_COMPILE_IFELSE([AC_LANG_PROGRAM],
+ [echo conftest.$ac_objext > conftest.lst
+ lt_ar_try='$AR $AR_FLAGS libconftest.a @conftest.lst >&AS_MESSAGE_LOG_FD'
+ AC_TRY_EVAL([lt_ar_try])
+ if test "$ac_status" -eq 0; then
+ # Ensure the archiver fails upon bogus file names.
+ rm -f conftest.$ac_objext libconftest.a
+ AC_TRY_EVAL([lt_ar_try])
+ if test "$ac_status" -ne 0; then
+ lt_cv_ar_at_file=@
+ fi
+ fi
+ rm -f conftest.* libconftest.a
+ ])
+ ])
+
+if test "x$lt_cv_ar_at_file" = xno; then
+ archiver_list_spec=
+else
+ archiver_list_spec=$lt_cv_ar_at_file
+fi
+_LT_DECL([], [archiver_list_spec], [1],
+ [How to feed a file listing to the archiver])
+])# _LT_PROG_AR
+
+
+# _LT_CMD_OLD_ARCHIVE
+# -------------------
+m4_defun([_LT_CMD_OLD_ARCHIVE],
+[_LT_PROG_AR
+
+AC_CHECK_TOOL(STRIP, strip, :)
+test -z "$STRIP" && STRIP=:
+_LT_DECL([], [STRIP], [1], [A symbol stripping program])
+
+AC_CHECK_TOOL(RANLIB, ranlib, :)
+test -z "$RANLIB" && RANLIB=:
+_LT_DECL([], [RANLIB], [1],
+ [Commands used to install an old-style archive])
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR $AR_FLAGS $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+if test -n "$RANLIB"; then
+ case $host_os in
+ openbsd*)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB -t \$tool_oldlib"
+ ;;
+ *)
+ old_postinstall_cmds="$old_postinstall_cmds~\$RANLIB \$tool_oldlib"
+ ;;
+ esac
+ old_archive_cmds="$old_archive_cmds~\$RANLIB \$tool_oldlib"
+fi
+
+case $host_os in
+ darwin*)
+ lock_old_archive_extraction=yes ;;
+ *)
+ lock_old_archive_extraction=no ;;
+esac
+_LT_DECL([], [old_postinstall_cmds], [2])
+_LT_DECL([], [old_postuninstall_cmds], [2])
+_LT_TAGDECL([], [old_archive_cmds], [2],
+ [Commands used to build an old-style archive])
+_LT_DECL([], [lock_old_archive_extraction], [0],
+ [Whether to use a lock for old archive extraction])
+])# _LT_CMD_OLD_ARCHIVE
+
+
+# _LT_COMPILER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS,
+# [OUTPUT-FILE], [ACTION-SUCCESS], [ACTION-FAILURE])
+# ----------------------------------------------------------------
+# Check whether the given compiler option works
+AC_DEFUN([_LT_COMPILER_OPTION],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_SED])dnl
+AC_CACHE_CHECK([$1], [$2],
+ [$2=no
+ m4_if([$4], , [ac_outfile=conftest.$ac_objext], [ac_outfile=$4])
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+ lt_compiler_flag="$3"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ # The option is referenced via a variable to avoid confusing sed.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&AS_MESSAGE_LOG_FD)
+ (eval "$lt_compile" 2>conftest.err)
+ ac_status=$?
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+ if (exit $ac_status) && test -s "$ac_outfile"; then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings other than the usual output.
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' >conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if test ! -s conftest.er2 || diff conftest.exp conftest.er2 >/dev/null; then
+ $2=yes
+ fi
+ fi
+ $RM conftest*
+])
+
+if test x"[$]$2" = xyes; then
+ m4_if([$5], , :, [$5])
+else
+ m4_if([$6], , :, [$6])
+fi
+])# _LT_COMPILER_OPTION
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_COMPILER_OPTION], [_LT_COMPILER_OPTION])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_COMPILER_OPTION], [])
+
+
+# _LT_LINKER_OPTION(MESSAGE, VARIABLE-NAME, FLAGS,
+# [ACTION-SUCCESS], [ACTION-FAILURE])
+# ----------------------------------------------------
+# Check whether the given linker option works
+AC_DEFUN([_LT_LINKER_OPTION],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_SED])dnl
+AC_CACHE_CHECK([$1], [$2],
+ [$2=no
+ save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS $3"
+ echo "$lt_simple_link_test_code" > conftest.$ac_ext
+ if (eval $ac_link 2>conftest.err) && test -s conftest$ac_exeext; then
+ # The linker can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ if test -s conftest.err; then
+ # Append any errors to the config.log.
+ cat conftest.err 1>&AS_MESSAGE_LOG_FD
+ $ECHO "$_lt_linker_boilerplate" | $SED '/^$/d' > conftest.exp
+ $SED '/^$/d; /^ *+/d' conftest.err >conftest.er2
+ if diff conftest.exp conftest.er2 >/dev/null; then
+ $2=yes
+ fi
+ else
+ $2=yes
+ fi
+ fi
+ $RM -r conftest*
+ LDFLAGS="$save_LDFLAGS"
+])
+
+if test x"[$]$2" = xyes; then
+ m4_if([$4], , :, [$4])
+else
+ m4_if([$5], , :, [$5])
+fi
+])# _LT_LINKER_OPTION
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_LINKER_OPTION], [_LT_LINKER_OPTION])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_LINKER_OPTION], [])
+
+
+# LT_CMD_MAX_LEN
+#---------------
+AC_DEFUN([LT_CMD_MAX_LEN],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+# find the maximum length of command line arguments
+AC_MSG_CHECKING([the maximum length of command line arguments])
+AC_CACHE_VAL([lt_cv_sys_max_cmd_len], [dnl
+ i=0
+ teststring="ABCD"
+
+ case $build_os in
+ msdosdjgpp*)
+ # On DJGPP, this test can blow up pretty badly due to problems in libc
+ # (any single argument exceeding 2000 bytes causes a buffer overrun
+ # during glob expansion). Even if it were fixed, the result of this
+ # check would be larger than it should be.
+ lt_cv_sys_max_cmd_len=12288; # 12K is about right
+ ;;
+
+ gnu*)
+ # Under GNU Hurd, this test is not required because there is
+ # no limit to the length of command line arguments.
+ # Libtool will interpret -1 as no limit whatsoever
+ lt_cv_sys_max_cmd_len=-1;
+ ;;
+
+ cygwin* | mingw* | cegcc*)
+ # On Win9x/ME, this test blows up -- it succeeds, but takes
+ # about 5 minutes as the teststring grows exponentially.
+ # Worse, since 9x/ME are not pre-emptively multitasking,
+ # you end up with a "frozen" computer, even though with patience
+ # the test eventually succeeds (with a max line length of 256k).
+ # Instead, let's just punt: use the minimum linelength reported by
+ # all of the supported platforms: 8192 (on NT/2K/XP).
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ mint*)
+ # On MiNT this can take a long time and run out of memory.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ amigaos*)
+ # On AmigaOS with pdksh, this test takes hours, literally.
+ # So we just punt and use a minimum line length of 8192.
+ lt_cv_sys_max_cmd_len=8192;
+ ;;
+
+ netbsd* | freebsd* | openbsd* | darwin* | dragonfly*)
+ # This has been around since 386BSD, at least. Likely further.
+ if test -x /sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax`
+ elif test -x /usr/sbin/sysctl; then
+ lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax`
+ else
+ lt_cv_sys_max_cmd_len=65536 # usable default for all BSDs
+ fi
+ # And add a safety zone
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ ;;
+
+ interix*)
+ # We know the value 262144 and hardcode it with a safety zone (like BSD)
+ lt_cv_sys_max_cmd_len=196608
+ ;;
+
+ os2*)
+ # The test takes a long time on OS/2.
+ lt_cv_sys_max_cmd_len=8192
+ ;;
+
+ osf*)
+ # Dr. Hans Ekkehard Plesser reports seeing a kernel panic running configure
+ # due to this test when exec_disable_arg_limit is 1 on Tru64. It is not
+ # nice to cause kernel panics so lets avoid the loop below.
+ # First set a reasonable default.
+ lt_cv_sys_max_cmd_len=16384
+ #
+ if test -x /sbin/sysconfig; then
+ case `/sbin/sysconfig -q proc exec_disable_arg_limit` in
+ *1*) lt_cv_sys_max_cmd_len=-1 ;;
+ esac
+ fi
+ ;;
+ sco3.2v5*)
+ lt_cv_sys_max_cmd_len=102400
+ ;;
+ sysv5* | sco5v6* | sysv4.2uw2*)
+ kargmax=`grep ARG_MAX /etc/conf/cf.d/stune 2>/dev/null`
+ if test -n "$kargmax"; then
+ lt_cv_sys_max_cmd_len=`echo $kargmax | sed 's/.*[[ ]]//'`
+ else
+ lt_cv_sys_max_cmd_len=32768
+ fi
+ ;;
+ *)
+ lt_cv_sys_max_cmd_len=`(getconf ARG_MAX) 2> /dev/null`
+ if test -n "$lt_cv_sys_max_cmd_len"; then
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4`
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3`
+ else
+ # Make teststring a little bigger before we do anything with it.
+ # a 1K string should be a reasonable start.
+ for i in 1 2 3 4 5 6 7 8 ; do
+ teststring=$teststring$teststring
+ done
+ SHELL=${SHELL-${CONFIG_SHELL-/bin/sh}}
+ # If test is not a shell built-in, we'll probably end up computing a
+ # maximum length that is only half of the actual maximum length, but
+ # we can't tell.
+ while { test "X"`env echo "$teststring$teststring" 2>/dev/null` \
+ = "X$teststring$teststring"; } >/dev/null 2>&1 &&
+ test $i != 17 # 1/2 MB should be enough
+ do
+ i=`expr $i + 1`
+ teststring=$teststring$teststring
+ done
+ # Only check the string length outside the loop.
+ lt_cv_sys_max_cmd_len=`expr "X$teststring" : ".*" 2>&1`
+ teststring=
+ # Add a significant safety factor because C++ compilers can tack on
+ # massive amounts of additional arguments before passing them to the
+ # linker. It appears as though 1/2 is a usable value.
+ lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 2`
+ fi
+ ;;
+ esac
+])
+if test -n $lt_cv_sys_max_cmd_len ; then
+ AC_MSG_RESULT($lt_cv_sys_max_cmd_len)
+else
+ AC_MSG_RESULT(none)
+fi
+max_cmd_len=$lt_cv_sys_max_cmd_len
+_LT_DECL([], [max_cmd_len], [0],
+ [What is the maximum length of a command?])
+])# LT_CMD_MAX_LEN
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_SYS_MAX_CMD_LEN], [LT_CMD_MAX_LEN])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_SYS_MAX_CMD_LEN], [])
+
+
+# _LT_HEADER_DLFCN
+# ----------------
+m4_defun([_LT_HEADER_DLFCN],
+[AC_CHECK_HEADERS([dlfcn.h], [], [], [AC_INCLUDES_DEFAULT])dnl
+])# _LT_HEADER_DLFCN
+
+
+# _LT_TRY_DLOPEN_SELF (ACTION-IF-TRUE, ACTION-IF-TRUE-W-USCORE,
+# ACTION-IF-FALSE, ACTION-IF-CROSS-COMPILING)
+# ----------------------------------------------------------------
+m4_defun([_LT_TRY_DLOPEN_SELF],
+[m4_require([_LT_HEADER_DLFCN])dnl
+if test "$cross_compiling" = yes; then :
+ [$4]
+else
+ lt_dlunknown=0; lt_dlno_uscore=1; lt_dlneed_uscore=2
+ lt_status=$lt_dlunknown
+ cat > conftest.$ac_ext <<_LT_EOF
+[#line $LINENO "configure"
+#include "confdefs.h"
+
+#if HAVE_DLFCN_H
+#include
+#endif
+
+#include
+
+#ifdef RTLD_GLOBAL
+# define LT_DLGLOBAL RTLD_GLOBAL
+#else
+# ifdef DL_GLOBAL
+# define LT_DLGLOBAL DL_GLOBAL
+# else
+# define LT_DLGLOBAL 0
+# endif
+#endif
+
+/* We may have to define LT_DLLAZY_OR_NOW in the command line if we
+ find out it does not work in some platform. */
+#ifndef LT_DLLAZY_OR_NOW
+# ifdef RTLD_LAZY
+# define LT_DLLAZY_OR_NOW RTLD_LAZY
+# else
+# ifdef DL_LAZY
+# define LT_DLLAZY_OR_NOW DL_LAZY
+# else
+# ifdef RTLD_NOW
+# define LT_DLLAZY_OR_NOW RTLD_NOW
+# else
+# ifdef DL_NOW
+# define LT_DLLAZY_OR_NOW DL_NOW
+# else
+# define LT_DLLAZY_OR_NOW 0
+# endif
+# endif
+# endif
+# endif
+#endif
+
+/* When -fvisbility=hidden is used, assume the code has been annotated
+ correspondingly for the symbols needed. */
+#if defined(__GNUC__) && (((__GNUC__ == 3) && (__GNUC_MINOR__ >= 3)) || (__GNUC__ > 3))
+int fnord () __attribute__((visibility("default")));
+#endif
+
+int fnord () { return 42; }
+int main ()
+{
+ void *self = dlopen (0, LT_DLGLOBAL|LT_DLLAZY_OR_NOW);
+ int status = $lt_dlunknown;
+
+ if (self)
+ {
+ if (dlsym (self,"fnord")) status = $lt_dlno_uscore;
+ else
+ {
+ if (dlsym( self,"_fnord")) status = $lt_dlneed_uscore;
+ else puts (dlerror ());
+ }
+ /* dlclose (self); */
+ }
+ else
+ puts (dlerror ());
+
+ return status;
+}]
+_LT_EOF
+ if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext} 2>/dev/null; then
+ (./conftest; exit; ) >&AS_MESSAGE_LOG_FD 2>/dev/null
+ lt_status=$?
+ case x$lt_status in
+ x$lt_dlno_uscore) $1 ;;
+ x$lt_dlneed_uscore) $2 ;;
+ x$lt_dlunknown|x*) $3 ;;
+ esac
+ else :
+ # compilation failed
+ $3
+ fi
+fi
+rm -fr conftest*
+])# _LT_TRY_DLOPEN_SELF
+
+
+# LT_SYS_DLOPEN_SELF
+# ------------------
+AC_DEFUN([LT_SYS_DLOPEN_SELF],
+[m4_require([_LT_HEADER_DLFCN])dnl
+if test "x$enable_dlopen" != xyes; then
+ enable_dlopen=unknown
+ enable_dlopen_self=unknown
+ enable_dlopen_self_static=unknown
+else
+ lt_cv_dlopen=no
+ lt_cv_dlopen_libs=
+
+ case $host_os in
+ beos*)
+ lt_cv_dlopen="load_add_on"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ;;
+
+ mingw* | pw32* | cegcc*)
+ lt_cv_dlopen="LoadLibrary"
+ lt_cv_dlopen_libs=
+ ;;
+
+ cygwin*)
+ lt_cv_dlopen="dlopen"
+ lt_cv_dlopen_libs=
+ ;;
+
+ darwin*)
+ # if libdl is installed we need to link against it
+ AC_CHECK_LIB([dl], [dlopen],
+ [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],[
+ lt_cv_dlopen="dyld"
+ lt_cv_dlopen_libs=
+ lt_cv_dlopen_self=yes
+ ])
+ ;;
+
+ *)
+ AC_CHECK_FUNC([shl_load],
+ [lt_cv_dlopen="shl_load"],
+ [AC_CHECK_LIB([dld], [shl_load],
+ [lt_cv_dlopen="shl_load" lt_cv_dlopen_libs="-ldld"],
+ [AC_CHECK_FUNC([dlopen],
+ [lt_cv_dlopen="dlopen"],
+ [AC_CHECK_LIB([dl], [dlopen],
+ [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-ldl"],
+ [AC_CHECK_LIB([svld], [dlopen],
+ [lt_cv_dlopen="dlopen" lt_cv_dlopen_libs="-lsvld"],
+ [AC_CHECK_LIB([dld], [dld_link],
+ [lt_cv_dlopen="dld_link" lt_cv_dlopen_libs="-ldld"])
+ ])
+ ])
+ ])
+ ])
+ ])
+ ;;
+ esac
+
+ if test "x$lt_cv_dlopen" != xno; then
+ enable_dlopen=yes
+ else
+ enable_dlopen=no
+ fi
+
+ case $lt_cv_dlopen in
+ dlopen)
+ save_CPPFLAGS="$CPPFLAGS"
+ test "x$ac_cv_header_dlfcn_h" = xyes && CPPFLAGS="$CPPFLAGS -DHAVE_DLFCN_H"
+
+ save_LDFLAGS="$LDFLAGS"
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $export_dynamic_flag_spec\"
+
+ save_LIBS="$LIBS"
+ LIBS="$lt_cv_dlopen_libs $LIBS"
+
+ AC_CACHE_CHECK([whether a program can dlopen itself],
+ lt_cv_dlopen_self, [dnl
+ _LT_TRY_DLOPEN_SELF(
+ lt_cv_dlopen_self=yes, lt_cv_dlopen_self=yes,
+ lt_cv_dlopen_self=no, lt_cv_dlopen_self=cross)
+ ])
+
+ if test "x$lt_cv_dlopen_self" = xyes; then
+ wl=$lt_prog_compiler_wl eval LDFLAGS=\"\$LDFLAGS $lt_prog_compiler_static\"
+ AC_CACHE_CHECK([whether a statically linked program can dlopen itself],
+ lt_cv_dlopen_self_static, [dnl
+ _LT_TRY_DLOPEN_SELF(
+ lt_cv_dlopen_self_static=yes, lt_cv_dlopen_self_static=yes,
+ lt_cv_dlopen_self_static=no, lt_cv_dlopen_self_static=cross)
+ ])
+ fi
+
+ CPPFLAGS="$save_CPPFLAGS"
+ LDFLAGS="$save_LDFLAGS"
+ LIBS="$save_LIBS"
+ ;;
+ esac
+
+ case $lt_cv_dlopen_self in
+ yes|no) enable_dlopen_self=$lt_cv_dlopen_self ;;
+ *) enable_dlopen_self=unknown ;;
+ esac
+
+ case $lt_cv_dlopen_self_static in
+ yes|no) enable_dlopen_self_static=$lt_cv_dlopen_self_static ;;
+ *) enable_dlopen_self_static=unknown ;;
+ esac
+fi
+_LT_DECL([dlopen_support], [enable_dlopen], [0],
+ [Whether dlopen is supported])
+_LT_DECL([dlopen_self], [enable_dlopen_self], [0],
+ [Whether dlopen of programs is supported])
+_LT_DECL([dlopen_self_static], [enable_dlopen_self_static], [0],
+ [Whether dlopen of statically linked programs is supported])
+])# LT_SYS_DLOPEN_SELF
+
+# Old name:
+AU_ALIAS([AC_LIBTOOL_DLOPEN_SELF], [LT_SYS_DLOPEN_SELF])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_DLOPEN_SELF], [])
+
+
+# _LT_COMPILER_C_O([TAGNAME])
+# ---------------------------
+# Check to see if options -c and -o are simultaneously supported by compiler.
+# This macro does not hard code the compiler like AC_PROG_CC_C_O.
+m4_defun([_LT_COMPILER_C_O],
+[m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_TAG_COMPILER])dnl
+AC_CACHE_CHECK([if $compiler supports -c -o file.$ac_objext],
+ [_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)],
+ [_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=no
+ $RM -r conftest 2>/dev/null
+ mkdir conftest
+ cd conftest
+ mkdir out
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ lt_compiler_flag="-o out/conftest2.$ac_objext"
+ # Insert the option either (1) after the last *FLAGS variable, or
+ # (2) before a word containing "conftest.", or (3) at the end.
+ # Note that $ac_compile itself does not contain backslashes and begins
+ # with a dollar sign (not a hyphen), so the echo should work correctly.
+ lt_compile=`echo "$ac_compile" | $SED \
+ -e 's:.*FLAGS}\{0,1\} :&$lt_compiler_flag :; t' \
+ -e 's: [[^ ]]*conftest\.: $lt_compiler_flag&:; t' \
+ -e 's:$: $lt_compiler_flag:'`
+ (eval echo "\"\$as_me:$LINENO: $lt_compile\"" >&AS_MESSAGE_LOG_FD)
+ (eval "$lt_compile" 2>out/conftest.err)
+ ac_status=$?
+ cat out/conftest.err >&AS_MESSAGE_LOG_FD
+ echo "$as_me:$LINENO: \$? = $ac_status" >&AS_MESSAGE_LOG_FD
+ if (exit $ac_status) && test -s out/conftest2.$ac_objext
+ then
+ # The compiler can only warn and ignore the option if not recognized
+ # So say no if there are warnings
+ $ECHO "$_lt_compiler_boilerplate" | $SED '/^$/d' > out/conftest.exp
+ $SED '/^$/d; /^ *+/d' out/conftest.err >out/conftest.er2
+ if test ! -s out/conftest.er2 || diff out/conftest.exp out/conftest.er2 >/dev/null; then
+ _LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes
+ fi
+ fi
+ chmod u+w . 2>&AS_MESSAGE_LOG_FD
+ $RM conftest*
+ # SGI C++ compiler will create directory out/ii_files/ for
+ # template instantiation
+ test -d out/ii_files && $RM out/ii_files/* && rmdir out/ii_files
+ $RM out/* && rmdir out
+ cd ..
+ $RM -r conftest
+ $RM conftest*
+])
+_LT_TAGDECL([compiler_c_o], [lt_cv_prog_compiler_c_o], [1],
+ [Does compiler simultaneously support -c and -o options?])
+])# _LT_COMPILER_C_O
+
+
+# _LT_COMPILER_FILE_LOCKS([TAGNAME])
+# ----------------------------------
+# Check to see if we can do hard links to lock some files if needed
+m4_defun([_LT_COMPILER_FILE_LOCKS],
+[m4_require([_LT_ENABLE_LOCK])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+_LT_COMPILER_C_O([$1])
+
+hard_links="nottested"
+if test "$_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)" = no && test "$need_locks" != no; then
+ # do not overwrite the value of need_locks provided by the user
+ AC_MSG_CHECKING([if we can lock with hard links])
+ hard_links=yes
+ $RM conftest*
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ touch conftest.a
+ ln conftest.a conftest.b 2>&5 || hard_links=no
+ ln conftest.a conftest.b 2>/dev/null && hard_links=no
+ AC_MSG_RESULT([$hard_links])
+ if test "$hard_links" = no; then
+ AC_MSG_WARN([`$CC' does not support `-c -o', so `make -j' may be unsafe])
+ need_locks=warn
+ fi
+else
+ need_locks=no
+fi
+_LT_DECL([], [need_locks], [1], [Must we lock files when doing compilation?])
+])# _LT_COMPILER_FILE_LOCKS
+
+
+# _LT_CHECK_OBJDIR
+# ----------------
+m4_defun([_LT_CHECK_OBJDIR],
+[AC_CACHE_CHECK([for objdir], [lt_cv_objdir],
+[rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+ lt_cv_objdir=.libs
+else
+ # MS-DOS does not allow filenames that begin with a dot.
+ lt_cv_objdir=_libs
+fi
+rmdir .libs 2>/dev/null])
+objdir=$lt_cv_objdir
+_LT_DECL([], [objdir], [0],
+ [The name of the directory that contains temporary libtool files])dnl
+m4_pattern_allow([LT_OBJDIR])dnl
+AC_DEFINE_UNQUOTED(LT_OBJDIR, "$lt_cv_objdir/",
+ [Define to the sub-directory in which libtool stores uninstalled libraries.])
+])# _LT_CHECK_OBJDIR
+
+
+# _LT_LINKER_HARDCODE_LIBPATH([TAGNAME])
+# --------------------------------------
+# Check hardcoding attributes.
+m4_defun([_LT_LINKER_HARDCODE_LIBPATH],
+[AC_MSG_CHECKING([how to hardcode library paths into programs])
+_LT_TAGVAR(hardcode_action, $1)=
+if test -n "$_LT_TAGVAR(hardcode_libdir_flag_spec, $1)" ||
+ test -n "$_LT_TAGVAR(runpath_var, $1)" ||
+ test "X$_LT_TAGVAR(hardcode_automatic, $1)" = "Xyes" ; then
+
+ # We can hardcode non-existent directories.
+ if test "$_LT_TAGVAR(hardcode_direct, $1)" != no &&
+ # If the only mechanism to avoid hardcoding is shlibpath_var, we
+ # have to relink, otherwise we might link with an installed library
+ # when we should be linking with a yet-to-be-installed one
+ ## test "$_LT_TAGVAR(hardcode_shlibpath_var, $1)" != no &&
+ test "$_LT_TAGVAR(hardcode_minus_L, $1)" != no; then
+ # Linking always hardcodes the temporary library directory.
+ _LT_TAGVAR(hardcode_action, $1)=relink
+ else
+ # We can link without hardcoding, and we can hardcode nonexisting dirs.
+ _LT_TAGVAR(hardcode_action, $1)=immediate
+ fi
+else
+ # We cannot hardcode anything, or else we can only hardcode existing
+ # directories.
+ _LT_TAGVAR(hardcode_action, $1)=unsupported
+fi
+AC_MSG_RESULT([$_LT_TAGVAR(hardcode_action, $1)])
+
+if test "$_LT_TAGVAR(hardcode_action, $1)" = relink ||
+ test "$_LT_TAGVAR(inherit_rpath, $1)" = yes; then
+ # Fast installation is not supported
+ enable_fast_install=no
+elif test "$shlibpath_overrides_runpath" = yes ||
+ test "$enable_shared" = no; then
+ # Fast installation is not necessary
+ enable_fast_install=needless
+fi
+_LT_TAGDECL([], [hardcode_action], [0],
+ [How to hardcode a shared library path into an executable])
+])# _LT_LINKER_HARDCODE_LIBPATH
+
+
+# _LT_CMD_STRIPLIB
+# ----------------
+m4_defun([_LT_CMD_STRIPLIB],
+[m4_require([_LT_DECL_EGREP])
+striplib=
+old_striplib=
+AC_MSG_CHECKING([whether stripping libraries is possible])
+if test -n "$STRIP" && $STRIP -V 2>&1 | $GREP "GNU strip" >/dev/null; then
+ test -z "$old_striplib" && old_striplib="$STRIP --strip-debug"
+ test -z "$striplib" && striplib="$STRIP --strip-unneeded"
+ AC_MSG_RESULT([yes])
+else
+# FIXME - insert some real tests, host_os isn't really good enough
+ case $host_os in
+ darwin*)
+ if test -n "$STRIP" ; then
+ striplib="$STRIP -x"
+ old_striplib="$STRIP -S"
+ AC_MSG_RESULT([yes])
+ else
+ AC_MSG_RESULT([no])
+ fi
+ ;;
+ *)
+ AC_MSG_RESULT([no])
+ ;;
+ esac
+fi
+_LT_DECL([], [old_striplib], [1], [Commands to strip libraries])
+_LT_DECL([], [striplib], [1])
+])# _LT_CMD_STRIPLIB
+
+
+# _LT_SYS_DYNAMIC_LINKER([TAG])
+# -----------------------------
+# PORTME Fill in your ld.so characteristics
+m4_defun([_LT_SYS_DYNAMIC_LINKER],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_OBJDUMP])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_CHECK_SHELL_FEATURES])dnl
+AC_MSG_CHECKING([dynamic linker characteristics])
+m4_if([$1],
+ [], [
+if test "$GCC" = yes; then
+ case $host_os in
+ darwin*) lt_awk_arg="/^libraries:/,/LR/" ;;
+ *) lt_awk_arg="/^libraries:/" ;;
+ esac
+ case $host_os in
+ mingw* | cegcc*) lt_sed_strip_eq="s,=\([[A-Za-z]]:\),\1,g" ;;
+ *) lt_sed_strip_eq="s,=/,/,g" ;;
+ esac
+ lt_search_path_spec=`$CC -print-search-dirs | awk $lt_awk_arg | $SED -e "s/^libraries://" -e $lt_sed_strip_eq`
+ case $lt_search_path_spec in
+ *\;*)
+ # if the path contains ";" then we assume it to be the separator
+ # otherwise default to the standard path separator (i.e. ":") - it is
+ # assumed that no part of a normal pathname contains ";" but that should
+ # okay in the real world where ";" in dirpaths is itself problematic.
+ lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED 's/;/ /g'`
+ ;;
+ *)
+ lt_search_path_spec=`$ECHO "$lt_search_path_spec" | $SED "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ esac
+ # Ok, now we have the path, separated by spaces, we can step through it
+ # and add multilib dir if necessary.
+ lt_tmp_lt_search_path_spec=
+ lt_multi_os_dir=`$CC $CPPFLAGS $CFLAGS $LDFLAGS -print-multi-os-directory 2>/dev/null`
+ for lt_sys_path in $lt_search_path_spec; do
+ if test -d "$lt_sys_path/$lt_multi_os_dir"; then
+ lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path/$lt_multi_os_dir"
+ else
+ test -d "$lt_sys_path" && \
+ lt_tmp_lt_search_path_spec="$lt_tmp_lt_search_path_spec $lt_sys_path"
+ fi
+ done
+ lt_search_path_spec=`$ECHO "$lt_tmp_lt_search_path_spec" | awk '
+BEGIN {RS=" "; FS="/|\n";} {
+ lt_foo="";
+ lt_count=0;
+ for (lt_i = NF; lt_i > 0; lt_i--) {
+ if ($lt_i != "" && $lt_i != ".") {
+ if ($lt_i == "..") {
+ lt_count++;
+ } else {
+ if (lt_count == 0) {
+ lt_foo="/" $lt_i lt_foo;
+ } else {
+ lt_count--;
+ }
+ }
+ }
+ }
+ if (lt_foo != "") { lt_freq[[lt_foo]]++; }
+ if (lt_freq[[lt_foo]] == 1) { print lt_foo; }
+}'`
+ # AWK program above erroneously prepends '/' to C:/dos/paths
+ # for these hosts.
+ case $host_os in
+ mingw* | cegcc*) lt_search_path_spec=`$ECHO "$lt_search_path_spec" |\
+ $SED 's,/\([[A-Za-z]]:\),\1,g'` ;;
+ esac
+ sys_lib_search_path_spec=`$ECHO "$lt_search_path_spec" | $lt_NL2SP`
+else
+ sys_lib_search_path_spec="/lib /usr/lib /usr/local/lib"
+fi])
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+shrext_cmds=".so"
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+shlibpath_overrides_runpath=unknown
+version_type=none
+dynamic_linker="$host_os ld.so"
+sys_lib_dlsearch_path_spec="/lib /usr/lib"
+need_lib_prefix=unknown
+hardcode_into_libs=no
+
+# when you set need_version to no, make sure it does not cause -set_version
+# flags to be left without arguments
+need_version=unknown
+
+case $host_os in
+aix3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname.a'
+ shlibpath_var=LIBPATH
+
+ # AIX 3 has no versioning support, so we append a major version to the name.
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+
+aix[[4-9]]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ hardcode_into_libs=yes
+ if test "$host_cpu" = ia64; then
+ # AIX 5 supports IA64
+ library_names_spec='${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext}$versuffix $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ else
+ # With GCC up to 2.95.x, collect2 would create an import file
+ # for dependence libraries. The import file would start with
+ # the line `#! .'. This would cause the generated library to
+ # depend on `.', always an invalid library. This was fixed in
+ # development snapshots of GCC prior to 3.0.
+ case $host_os in
+ aix4 | aix4.[[01]] | aix4.[[01]].*)
+ if { echo '#if __GNUC__ > 2 || (__GNUC__ == 2 && __GNUC_MINOR__ >= 97)'
+ echo ' yes '
+ echo '#endif'; } | ${CC} -E - | $GREP yes > /dev/null; then
+ :
+ else
+ can_build_shared=no
+ fi
+ ;;
+ esac
+ # AIX (on Power*) has no versioning support, so currently we can not hardcode correct
+ # soname into executable. Probably we can add versioning support to
+ # collect2, so additional links can be useful in future.
+ if test "$aix_use_runtimelinking" = yes; then
+ # If using run time linking (on AIX 4.2 or later) use lib.so
+ # instead of lib.a to let people know that these are not
+ # typical AIX shared libraries.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ else
+ # We preserve .a as extension for shared libraries through AIX4.2
+ # and later when we are not doing run time linking.
+ library_names_spec='${libname}${release}.a $libname.a'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ fi
+ shlibpath_var=LIBPATH
+ fi
+ ;;
+
+amigaos*)
+ case $host_cpu in
+ powerpc)
+ # Since July 2007 AmigaOS4 officially supports .so libraries.
+ # When compiling the executable, add -use-dynld -Lsobjs: to the compileline.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ ;;
+ m68k)
+ library_names_spec='$libname.ixlibrary $libname.a'
+ # Create ${libname}_ixlibrary.a entries in /sys/libs.
+ finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`func_echo_all "$lib" | $SED '\''s%^.*/\([[^/]]*\)\.ixlibrary$%\1%'\''`; test $RM /sys/libs/${libname}_ixlibrary.a; $show "cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a"; cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a || exit 1; done'
+ ;;
+ esac
+ ;;
+
+beos*)
+ library_names_spec='${libname}${shared_ext}'
+ dynamic_linker="$host_os ld.so"
+ shlibpath_var=LIBRARY_PATH
+ ;;
+
+bsdi[[45]]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/shlib /usr/lib /usr/X11/lib /usr/contrib/lib /lib /usr/local/lib"
+ sys_lib_dlsearch_path_spec="/shlib /usr/lib /usr/local/lib"
+ # the default ld.so.conf also contains /usr/contrib/lib and
+ # /usr/X11R6/lib (/usr/X11 is a link to /usr/X11R6), but let us allow
+ # libtool to hard-code these into programs
+ ;;
+
+cygwin* | mingw* | pw32* | cegcc*)
+ version_type=windows
+ shrext_cmds=".dll"
+ need_version=no
+ need_lib_prefix=no
+
+ case $GCC,$cc_basename in
+ yes,*)
+ # gcc
+ library_names_spec='$libname.dll.a'
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname~
+ chmod a+x \$dldir/$dlname~
+ if test -n '\''$stripme'\'' && test -n '\''$striplib'\''; then
+ eval '\''$striplib \$dldir/$dlname'\'' || exit \$?;
+ fi'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+
+ case $host_os in
+ cygwin*)
+ # Cygwin DLLs use 'cyg' prefix rather than 'lib'
+ soname_spec='`echo ${libname} | sed -e 's/^lib/cyg/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+m4_if([$1], [],[
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/lib/w32api"])
+ ;;
+ mingw* | cegcc*)
+ # MinGW DLLs use traditional 'lib' prefix
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ pw32*)
+ # pw32 DLLs use 'pw' prefix rather than 'lib'
+ library_names_spec='`echo ${libname} | sed -e 's/^lib/pw/'``echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+ ;;
+ esac
+ dynamic_linker='Win32 ld.exe'
+ ;;
+
+ *,cl*)
+ # Native MSVC
+ libname_spec='$name'
+ soname_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext}'
+ library_names_spec='${libname}.dll.lib'
+
+ case $build_os in
+ mingw*)
+ sys_lib_search_path_spec=
+ lt_save_ifs=$IFS
+ IFS=';'
+ for lt_path in $LIB
+ do
+ IFS=$lt_save_ifs
+ # Let DOS variable expansion print the short 8.3 style file name.
+ lt_path=`cd "$lt_path" 2>/dev/null && cmd //C "for %i in (".") do @echo %~si"`
+ sys_lib_search_path_spec="$sys_lib_search_path_spec $lt_path"
+ done
+ IFS=$lt_save_ifs
+ # Convert to MSYS style.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | sed -e 's|\\\\|/|g' -e 's| \\([[a-zA-Z]]\\):| /\\1|g' -e 's|^ ||'`
+ ;;
+ cygwin*)
+ # Convert to unix form, then to dos form, then back to unix form
+ # but this time dos style (no spaces!) so that the unix form looks
+ # like /cygdrive/c/PROGRA~1:/cygdr...
+ sys_lib_search_path_spec=`cygpath --path --unix "$LIB"`
+ sys_lib_search_path_spec=`cygpath --path --dos "$sys_lib_search_path_spec" 2>/dev/null`
+ sys_lib_search_path_spec=`cygpath --path --unix "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ ;;
+ *)
+ sys_lib_search_path_spec="$LIB"
+ if $ECHO "$sys_lib_search_path_spec" | [$GREP ';[c-zC-Z]:/' >/dev/null]; then
+ # It is most probably a Windows format PATH.
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e 's/;/ /g'`
+ else
+ sys_lib_search_path_spec=`$ECHO "$sys_lib_search_path_spec" | $SED -e "s/$PATH_SEPARATOR/ /g"`
+ fi
+ # FIXME: find the short name or the path components, as spaces are
+ # common. (e.g. "Program Files" -> "PROGRA~1")
+ ;;
+ esac
+
+ # DLL is installed to $(libdir)/../bin by postinstall_cmds
+ postinstall_cmds='base_file=`basename \${file}`~
+ dlpath=`$SHELL 2>&1 -c '\''. $dir/'\''\${base_file}'\''i; echo \$dlname'\''`~
+ dldir=$destdir/`dirname \$dlpath`~
+ test -d \$dldir || mkdir -p \$dldir~
+ $install_prog $dir/$dlname \$dldir/$dlname'
+ postuninstall_cmds='dldll=`$SHELL 2>&1 -c '\''. $file; echo \$dlname'\''`~
+ dlpath=$dir/\$dldll~
+ $RM \$dlpath'
+ shlibpath_overrides_runpath=yes
+ dynamic_linker='Win32 link.exe'
+ ;;
+
+ *)
+ # Assume MSVC wrapper
+ library_names_spec='${libname}`echo ${release} | $SED -e 's/[[.]]/-/g'`${versuffix}${shared_ext} $libname.lib'
+ dynamic_linker='Win32 ld.exe'
+ ;;
+ esac
+ # FIXME: first we should search . and the directory the executable is in
+ shlibpath_var=PATH
+ ;;
+
+darwin* | rhapsody*)
+ dynamic_linker="$host_os dyld"
+ version_type=darwin
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${major}$shared_ext ${libname}$shared_ext'
+ soname_spec='${libname}${release}${major}$shared_ext'
+ shlibpath_overrides_runpath=yes
+ shlibpath_var=DYLD_LIBRARY_PATH
+ shrext_cmds='`test .$module = .yes && echo .so || echo .dylib`'
+m4_if([$1], [],[
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /usr/local/lib"])
+ sys_lib_dlsearch_path_spec='/usr/local/lib /lib /usr/lib'
+ ;;
+
+dgux*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname$shared_ext'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+freebsd* | dragonfly*)
+ # DragonFly does not have aout. When/if they implement a new
+ # versioning mechanism, adjust this.
+ if test -x /usr/bin/objformat; then
+ objformat=`/usr/bin/objformat`
+ else
+ case $host_os in
+ freebsd[[23]].*) objformat=aout ;;
+ *) objformat=elf ;;
+ esac
+ fi
+ version_type=freebsd-$objformat
+ case $version_type in
+ freebsd-elf*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ need_version=no
+ need_lib_prefix=no
+ ;;
+ freebsd-*)
+ library_names_spec='${libname}${release}${shared_ext}$versuffix $libname${shared_ext}$versuffix'
+ need_version=yes
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_os in
+ freebsd2.*)
+ shlibpath_overrides_runpath=yes
+ ;;
+ freebsd3.[[01]]* | freebsdelf3.[[01]]*)
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ freebsd3.[[2-9]]* | freebsdelf3.[[2-9]]* | \
+ freebsd4.[[0-5]] | freebsdelf4.[[0-5]] | freebsd4.1.1 | freebsdelf4.1.1)
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+ *) # from 4.6 on, and DragonFly
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+ esac
+ ;;
+
+gnu*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+haiku*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ dynamic_linker="$host_os runtime_loader"
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}${major} ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ sys_lib_dlsearch_path_spec='/boot/home/config/lib /boot/common/lib /boot/system/lib'
+ hardcode_into_libs=yes
+ ;;
+
+hpux9* | hpux10* | hpux11*)
+ # Give a soname corresponding to the major version so that dld.sl refuses to
+ # link against other versions.
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ case $host_cpu in
+ ia64*)
+ shrext_cmds='.so'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.so"
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ if test "X$HPUX_IA64_MODE" = X32; then
+ sys_lib_search_path_spec="/usr/lib/hpux32 /usr/local/lib/hpux32 /usr/local/lib"
+ else
+ sys_lib_search_path_spec="/usr/lib/hpux64 /usr/local/lib/hpux64"
+ fi
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ hppa*64*)
+ shrext_cmds='.sl'
+ hardcode_into_libs=yes
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=LD_LIBRARY_PATH # How should we handle SHLIB_PATH
+ shlibpath_overrides_runpath=yes # Unless +noenvvar is specified.
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ sys_lib_search_path_spec="/usr/lib/pa20_64 /usr/ccs/lib/pa20_64"
+ sys_lib_dlsearch_path_spec=$sys_lib_search_path_spec
+ ;;
+ *)
+ shrext_cmds='.sl'
+ dynamic_linker="$host_os dld.sl"
+ shlibpath_var=SHLIB_PATH
+ shlibpath_overrides_runpath=no # +s is required to enable SHLIB_PATH
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ ;;
+ esac
+ # HP-UX runs *really* slowly unless shared libraries are mode 555, ...
+ postinstall_cmds='chmod 555 $lib'
+ # or fails outright, so override atomically:
+ install_override_mode=555
+ ;;
+
+interix[[3-9]]*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='Interix 3.x ld.so.1 (PE, like ELF)'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $host_os in
+ nonstopux*) version_type=nonstopux ;;
+ *)
+ if test "$lt_cv_prog_gnu_ld" = yes; then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ else
+ version_type=irix
+ fi ;;
+ esac
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${release}${shared_ext} $libname${shared_ext}'
+ case $host_os in
+ irix5* | nonstopux*)
+ libsuff= shlibsuff=
+ ;;
+ *)
+ case $LD in # libtool.m4 will add one of these switches to LD
+ *-32|*"-32 "|*-melf32bsmip|*"-melf32bsmip ")
+ libsuff= shlibsuff= libmagic=32-bit;;
+ *-n32|*"-n32 "|*-melf32bmipn32|*"-melf32bmipn32 ")
+ libsuff=32 shlibsuff=N32 libmagic=N32;;
+ *-64|*"-64 "|*-melf64bmip|*"-melf64bmip ")
+ libsuff=64 shlibsuff=64 libmagic=64-bit;;
+ *) libsuff= shlibsuff= libmagic=never-match;;
+ esac
+ ;;
+ esac
+ shlibpath_var=LD_LIBRARY${shlibsuff}_PATH
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec="/usr/lib${libsuff} /lib${libsuff} /usr/local/lib${libsuff}"
+ sys_lib_dlsearch_path_spec="/usr/lib${libsuff} /lib${libsuff}"
+ hardcode_into_libs=yes
+ ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux*oldld* | linux*aout* | linux*coff*)
+ dynamic_linker=no
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+
+ # Some binutils ld are patched to set DT_RUNPATH
+ AC_CACHE_VAL([lt_cv_shlibpath_overrides_runpath],
+ [lt_cv_shlibpath_overrides_runpath=no
+ save_LDFLAGS=$LDFLAGS
+ save_libdir=$libdir
+ eval "libdir=/foo; wl=\"$_LT_TAGVAR(lt_prog_compiler_wl, $1)\"; \
+ LDFLAGS=\"\$LDFLAGS $_LT_TAGVAR(hardcode_libdir_flag_spec, $1)\""
+ AC_LINK_IFELSE([AC_LANG_PROGRAM([],[])],
+ [AS_IF([ ($OBJDUMP -p conftest$ac_exeext) 2>/dev/null | grep "RUNPATH.*$libdir" >/dev/null],
+ [lt_cv_shlibpath_overrides_runpath=yes])])
+ LDFLAGS=$save_LDFLAGS
+ libdir=$save_libdir
+ ])
+ shlibpath_overrides_runpath=$lt_cv_shlibpath_overrides_runpath
+
+ # This implies no fast_install, which is unacceptable.
+ # Some rework will be needed to allow for fast_install
+ # before this can be enabled.
+ hardcode_into_libs=yes
+
+ # Append ld.so.conf contents to the search path
+ if test -f /etc/ld.so.conf; then
+ lt_ld_extra=`awk '/^include / { system(sprintf("cd /etc; cat %s 2>/dev/null", \[$]2)); skip = 1; } { if (!skip) print \[$]0; skip = 0; }' < /etc/ld.so.conf | $SED -e 's/#.*//;/^[ ]*hwcap[ ]/d;s/[:, ]/ /g;s/=[^=]*$//;s/=[^= ]* / /g;s/"//g;/^$/d' | tr '\n' ' '`
+ sys_lib_dlsearch_path_spec="/lib /usr/lib $lt_ld_extra"
+ fi
+
+ # We used to test for /lib/ld.so.1 and disable shared libraries on
+ # powerpc, because MkLinux only supported shared libraries with the
+ # GNU dynamic linker. Since this was broken with cross compilers,
+ # most powerpc-linux boxes support dynamic linking these days and
+ # people can always --disable-shared, the test was removed, and we
+ # assume the GNU/Linux dynamic linker is in use.
+ dynamic_linker='GNU/Linux ld.so'
+ ;;
+
+netbsd*)
+ version_type=sunos
+ need_lib_prefix=no
+ need_version=no
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ dynamic_linker='NetBSD (a.out) ld.so'
+ else
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major ${libname}${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ dynamic_linker='NetBSD ld.elf_so'
+ fi
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ ;;
+
+newsos6)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ ;;
+
+*nto* | *qnx*)
+ version_type=qnx
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ dynamic_linker='ldqnx.so'
+ ;;
+
+openbsd*)
+ version_type=sunos
+ sys_lib_dlsearch_path_spec="/usr/lib"
+ need_lib_prefix=no
+ # Some older versions of OpenBSD (3.3 at least) *do* need versioned libs.
+ case $host_os in
+ openbsd3.3 | openbsd3.3.*) need_version=yes ;;
+ *) need_version=no ;;
+ esac
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ case $host_os in
+ openbsd2.[[89]] | openbsd2.[[89]].*)
+ shlibpath_overrides_runpath=no
+ ;;
+ *)
+ shlibpath_overrides_runpath=yes
+ ;;
+ esac
+ else
+ shlibpath_overrides_runpath=yes
+ fi
+ ;;
+
+os2*)
+ libname_spec='$name'
+ shrext_cmds=".dll"
+ need_lib_prefix=no
+ library_names_spec='$libname${shared_ext} $libname.a'
+ dynamic_linker='OS/2 ld.exe'
+ shlibpath_var=LIBPATH
+ ;;
+
+osf3* | osf4* | osf5*)
+ version_type=osf
+ need_lib_prefix=no
+ need_version=no
+ soname_spec='${libname}${release}${shared_ext}$major'
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ sys_lib_search_path_spec="/usr/shlib /usr/ccs/lib /usr/lib/cmplrs/cc /usr/lib /usr/local/lib /var/shlib"
+ sys_lib_dlsearch_path_spec="$sys_lib_search_path_spec"
+ ;;
+
+rdos*)
+ dynamic_linker=no
+ ;;
+
+solaris*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ # ldd complains unless libraries are executable
+ postinstall_cmds='chmod +x $lib'
+ ;;
+
+sunos4*)
+ version_type=sunos
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${shared_ext}$versuffix'
+ finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ if test "$with_gnu_ld" = yes; then
+ need_lib_prefix=no
+ fi
+ need_version=yes
+ ;;
+
+sysv4 | sysv4.3*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ case $host_vendor in
+ sni)
+ shlibpath_overrides_runpath=no
+ need_lib_prefix=no
+ runpath_var=LD_RUN_PATH
+ ;;
+ siemens)
+ need_lib_prefix=no
+ ;;
+ motorola)
+ need_lib_prefix=no
+ need_version=no
+ shlibpath_overrides_runpath=no
+ sys_lib_search_path_spec='/lib /usr/lib /usr/ccs/lib'
+ ;;
+ esac
+ ;;
+
+sysv4*MP*)
+ if test -d /usr/nec ;then
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='$libname${shared_ext}.$versuffix $libname${shared_ext}.$major $libname${shared_ext}'
+ soname_spec='$libname${shared_ext}.$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ fi
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ version_type=freebsd-elf
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext} $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=yes
+ hardcode_into_libs=yes
+ if test "$with_gnu_ld" = yes; then
+ sys_lib_search_path_spec='/usr/local/lib /usr/gnu/lib /usr/ccs/lib /usr/lib /lib'
+ else
+ sys_lib_search_path_spec='/usr/ccs/lib /usr/lib'
+ case $host_os in
+ sco3.2v5*)
+ sys_lib_search_path_spec="$sys_lib_search_path_spec /lib"
+ ;;
+ esac
+ fi
+ sys_lib_dlsearch_path_spec='/usr/lib'
+ ;;
+
+tpf*)
+ # TPF is a cross-target only. Preferred cross-host = GNU/Linux.
+ version_type=linux # correct to gnu/linux during the next big refactor
+ need_lib_prefix=no
+ need_version=no
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ shlibpath_var=LD_LIBRARY_PATH
+ shlibpath_overrides_runpath=no
+ hardcode_into_libs=yes
+ ;;
+
+uts4*)
+ version_type=linux # correct to gnu/linux during the next big refactor
+ library_names_spec='${libname}${release}${shared_ext}$versuffix ${libname}${release}${shared_ext}$major $libname${shared_ext}'
+ soname_spec='${libname}${release}${shared_ext}$major'
+ shlibpath_var=LD_LIBRARY_PATH
+ ;;
+
+*)
+ dynamic_linker=no
+ ;;
+esac
+AC_MSG_RESULT([$dynamic_linker])
+test "$dynamic_linker" = no && can_build_shared=no
+
+variables_saved_for_relink="PATH $shlibpath_var $runpath_var"
+if test "$GCC" = yes; then
+ variables_saved_for_relink="$variables_saved_for_relink GCC_EXEC_PREFIX COMPILER_PATH LIBRARY_PATH"
+fi
+
+if test "${lt_cv_sys_lib_search_path_spec+set}" = set; then
+ sys_lib_search_path_spec="$lt_cv_sys_lib_search_path_spec"
+fi
+if test "${lt_cv_sys_lib_dlsearch_path_spec+set}" = set; then
+ sys_lib_dlsearch_path_spec="$lt_cv_sys_lib_dlsearch_path_spec"
+fi
+
+_LT_DECL([], [variables_saved_for_relink], [1],
+ [Variables whose values should be saved in libtool wrapper scripts and
+ restored at link time])
+_LT_DECL([], [need_lib_prefix], [0],
+ [Do we need the "lib" prefix for modules?])
+_LT_DECL([], [need_version], [0], [Do we need a version for libraries?])
+_LT_DECL([], [version_type], [0], [Library versioning type])
+_LT_DECL([], [runpath_var], [0], [Shared library runtime path variable])
+_LT_DECL([], [shlibpath_var], [0],[Shared library path variable])
+_LT_DECL([], [shlibpath_overrides_runpath], [0],
+ [Is shlibpath searched before the hard-coded library search path?])
+_LT_DECL([], [libname_spec], [1], [Format of library name prefix])
+_LT_DECL([], [library_names_spec], [1],
+ [[List of archive names. First name is the real one, the rest are links.
+ The last name is the one that the linker finds with -lNAME]])
+_LT_DECL([], [soname_spec], [1],
+ [[The coded name of the library, if different from the real name]])
+_LT_DECL([], [install_override_mode], [1],
+ [Permission mode override for installation of shared libraries])
+_LT_DECL([], [postinstall_cmds], [2],
+ [Command to use after installation of a shared archive])
+_LT_DECL([], [postuninstall_cmds], [2],
+ [Command to use after uninstallation of a shared archive])
+_LT_DECL([], [finish_cmds], [2],
+ [Commands used to finish a libtool library installation in a directory])
+_LT_DECL([], [finish_eval], [1],
+ [[As "finish_cmds", except a single script fragment to be evaled but
+ not shown]])
+_LT_DECL([], [hardcode_into_libs], [0],
+ [Whether we should hardcode library paths into libraries])
+_LT_DECL([], [sys_lib_search_path_spec], [2],
+ [Compile-time system search path for libraries])
+_LT_DECL([], [sys_lib_dlsearch_path_spec], [2],
+ [Run-time system search path for libraries])
+])# _LT_SYS_DYNAMIC_LINKER
+
+
+# _LT_PATH_TOOL_PREFIX(TOOL)
+# --------------------------
+# find a file program which can recognize shared library
+AC_DEFUN([_LT_PATH_TOOL_PREFIX],
+[m4_require([_LT_DECL_EGREP])dnl
+AC_MSG_CHECKING([for $1])
+AC_CACHE_VAL(lt_cv_path_MAGIC_CMD,
+[case $MAGIC_CMD in
+[[\\/*] | ?:[\\/]*])
+ lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path.
+ ;;
+*)
+ lt_save_MAGIC_CMD="$MAGIC_CMD"
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+dnl $ac_dummy forces splitting on constant user-supplied paths.
+dnl POSIX.2 word splitting is done only on the output of word expansions,
+dnl not every word. This closes a longstanding sh security hole.
+ ac_dummy="m4_if([$2], , $PATH, [$2])"
+ for ac_dir in $ac_dummy; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/$1; then
+ lt_cv_path_MAGIC_CMD="$ac_dir/$1"
+ if test -n "$file_magic_test_file"; then
+ case $deplibs_check_method in
+ "file_magic "*)
+ file_magic_regex=`expr "$deplibs_check_method" : "file_magic \(.*\)"`
+ MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+ if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null |
+ $EGREP "$file_magic_regex" > /dev/null; then
+ :
+ else
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the command libtool uses to detect shared libraries,
+*** $file_magic_cmd, produces output that libtool cannot recognize.
+*** The result is that libtool may fail to recognize shared libraries
+*** as such. This will affect the creation of libtool libraries that
+*** depend on shared libraries, but programs linked with such libtool
+*** libraries will work regardless of this problem. Nevertheless, you
+*** may want to report the problem to your system manager and/or to
+*** bug-libtool@gnu.org
+
+_LT_EOF
+ fi ;;
+ esac
+ fi
+ break
+ fi
+ done
+ IFS="$lt_save_ifs"
+ MAGIC_CMD="$lt_save_MAGIC_CMD"
+ ;;
+esac])
+MAGIC_CMD="$lt_cv_path_MAGIC_CMD"
+if test -n "$MAGIC_CMD"; then
+ AC_MSG_RESULT($MAGIC_CMD)
+else
+ AC_MSG_RESULT(no)
+fi
+_LT_DECL([], [MAGIC_CMD], [0],
+ [Used to examine libraries when file_magic_cmd begins with "file"])dnl
+])# _LT_PATH_TOOL_PREFIX
+
+# Old name:
+AU_ALIAS([AC_PATH_TOOL_PREFIX], [_LT_PATH_TOOL_PREFIX])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_PATH_TOOL_PREFIX], [])
+
+
+# _LT_PATH_MAGIC
+# --------------
+# find a file program which can recognize a shared library
+m4_defun([_LT_PATH_MAGIC],
+[_LT_PATH_TOOL_PREFIX(${ac_tool_prefix}file, /usr/bin$PATH_SEPARATOR$PATH)
+if test -z "$lt_cv_path_MAGIC_CMD"; then
+ if test -n "$ac_tool_prefix"; then
+ _LT_PATH_TOOL_PREFIX(file, /usr/bin$PATH_SEPARATOR$PATH)
+ else
+ MAGIC_CMD=:
+ fi
+fi
+])# _LT_PATH_MAGIC
+
+
+# LT_PATH_LD
+# ----------
+# find the pathname to the GNU or non-GNU linker
+AC_DEFUN([LT_PATH_LD],
+[AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_PROG_ECHO_BACKSLASH])dnl
+
+AC_ARG_WITH([gnu-ld],
+ [AS_HELP_STRING([--with-gnu-ld],
+ [assume the C compiler uses GNU ld @<:@default=no@:>@])],
+ [test "$withval" = no || with_gnu_ld=yes],
+ [with_gnu_ld=no])dnl
+
+ac_prog=ld
+if test "$GCC" = yes; then
+ # Check if gcc -print-prog-name=ld gives a path.
+ AC_MSG_CHECKING([for ld used by $CC])
+ case $host in
+ *-*-mingw*)
+ # gcc leaves a trailing carriage return which upsets mingw
+ ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;;
+ *)
+ ac_prog=`($CC -print-prog-name=ld) 2>&5` ;;
+ esac
+ case $ac_prog in
+ # Accept absolute paths.
+ [[\\/]]* | ?:[[\\/]]*)
+ re_direlt='/[[^/]][[^/]]*/\.\./'
+ # Canonicalize the pathname of ld
+ ac_prog=`$ECHO "$ac_prog"| $SED 's%\\\\%/%g'`
+ while $ECHO "$ac_prog" | $GREP "$re_direlt" > /dev/null 2>&1; do
+ ac_prog=`$ECHO $ac_prog| $SED "s%$re_direlt%/%"`
+ done
+ test -z "$LD" && LD="$ac_prog"
+ ;;
+ "")
+ # If it fails, then pretend we aren't using GCC.
+ ac_prog=ld
+ ;;
+ *)
+ # If it is relative, then search for the first ld in PATH.
+ with_gnu_ld=unknown
+ ;;
+ esac
+elif test "$with_gnu_ld" = yes; then
+ AC_MSG_CHECKING([for GNU ld])
+else
+ AC_MSG_CHECKING([for non-GNU ld])
+fi
+AC_CACHE_VAL(lt_cv_path_LD,
+[if test -z "$LD"; then
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then
+ lt_cv_path_LD="$ac_dir/$ac_prog"
+ # Check to see if the program is GNU ld. I'd rather use --version,
+ # but apparently some variants of GNU ld only accept -v.
+ # Break only if it was the GNU/non-GNU ld that we prefer.
+ case `"$lt_cv_path_LD" -v 2>&1 &1 /dev/null 2>&1; then
+ lt_cv_deplibs_check_method='file_magic ^x86 archive import|^x86 DLL'
+ lt_cv_file_magic_cmd='func_win32_libid'
+ else
+ # Keep this pattern in sync with the one in func_win32_libid.
+ lt_cv_deplibs_check_method='file_magic file format (pei*-i386(.*architecture: i386)?|pe-arm-wince|pe-x86-64)'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ fi
+ ;;
+
+cegcc*)
+ # use the weaker test based on 'objdump'. See mingw*.
+ lt_cv_deplibs_check_method='file_magic file format pe-arm-.*little(.*architecture: arm)?'
+ lt_cv_file_magic_cmd='$OBJDUMP -f'
+ ;;
+
+darwin* | rhapsody*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+freebsd* | dragonfly*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+ case $host_cpu in
+ i*86 )
+ # Not sure whether the presence of OpenBSD here was a mistake.
+ # Let's accept both of them until this is cleared up.
+ lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD|DragonFly)/i[[3-9]]86 (compact )?demand paged shared library'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*`
+ ;;
+ esac
+ else
+ lt_cv_deplibs_check_method=pass_all
+ fi
+ ;;
+
+gnu*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+haiku*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+hpux10.20* | hpux11*)
+ lt_cv_file_magic_cmd=/usr/bin/file
+ case $host_cpu in
+ ia64*)
+ lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|ELF-[[0-9]][[0-9]]) shared object file - IA64'
+ lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so
+ ;;
+ hppa*64*)
+ [lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF[ -][0-9][0-9])(-bit)?( [LM]SB)? shared object( file)?[, -]* PA-RISC [0-9]\.[0-9]']
+ lt_cv_file_magic_test_file=/usr/lib/pa20_64/libc.sl
+ ;;
+ *)
+ lt_cv_deplibs_check_method='file_magic (s[[0-9]][[0-9]][[0-9]]|PA-RISC[[0-9]]\.[[0-9]]) shared library'
+ lt_cv_file_magic_test_file=/usr/lib/libc.sl
+ ;;
+ esac
+ ;;
+
+interix[[3-9]]*)
+ # PIC code is broken on Interix 3.x, that's why |\.a not |_pic\.a here
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|\.a)$'
+ ;;
+
+irix5* | irix6* | nonstopux*)
+ case $LD in
+ *-32|*"-32 ") libmagic=32-bit;;
+ *-n32|*"-n32 ") libmagic=N32;;
+ *-64|*"-64 ") libmagic=64-bit;;
+ *) libmagic=never-match;;
+ esac
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+# This must be glibc/ELF.
+linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ > /dev/null; then
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so|_pic\.a)$'
+ fi
+ ;;
+
+newos6*)
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (executable|dynamic lib)'
+ lt_cv_file_magic_cmd=/usr/bin/file
+ lt_cv_file_magic_test_file=/usr/lib/libnls.so
+ ;;
+
+*nto* | *qnx*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+openbsd*)
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|\.so|_pic\.a)$'
+ else
+ lt_cv_deplibs_check_method='match_pattern /lib[[^/]]+(\.so\.[[0-9]]+\.[[0-9]]+|_pic\.a)$'
+ fi
+ ;;
+
+osf3* | osf4* | osf5*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+rdos*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+solaris*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX* | sysv4*uw2*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+
+sysv4 | sysv4.3*)
+ case $host_vendor in
+ motorola)
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[ML]]SB (shared object|dynamic lib) M[[0-9]][[0-9]]* Version [[0-9]]'
+ lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*`
+ ;;
+ ncr)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ sequent)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method='file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB (shared object|dynamic lib )'
+ ;;
+ sni)
+ lt_cv_file_magic_cmd='/bin/file'
+ lt_cv_deplibs_check_method="file_magic ELF [[0-9]][[0-9]]*-bit [[LM]]SB dynamic lib"
+ lt_cv_file_magic_test_file=/lib/libc.so
+ ;;
+ siemens)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ pc)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+ esac
+ ;;
+
+tpf*)
+ lt_cv_deplibs_check_method=pass_all
+ ;;
+esac
+])
+
+file_magic_glob=
+want_nocaseglob=no
+if test "$build" = "$host"; then
+ case $host_os in
+ mingw* | pw32*)
+ if ( shopt | grep nocaseglob ) >/dev/null 2>&1; then
+ want_nocaseglob=yes
+ else
+ file_magic_glob=`echo aAbBcCdDeEfFgGhHiIjJkKlLmMnNoOpPqQrRsStTuUvVwWxXyYzZ | $SED -e "s/\(..\)/s\/[[\1]]\/[[\1]]\/g;/g"`
+ fi
+ ;;
+ esac
+fi
+
+file_magic_cmd=$lt_cv_file_magic_cmd
+deplibs_check_method=$lt_cv_deplibs_check_method
+test -z "$deplibs_check_method" && deplibs_check_method=unknown
+
+_LT_DECL([], [deplibs_check_method], [1],
+ [Method to check whether dependent libraries are shared objects])
+_LT_DECL([], [file_magic_cmd], [1],
+ [Command to use when deplibs_check_method = "file_magic"])
+_LT_DECL([], [file_magic_glob], [1],
+ [How to find potential files when deplibs_check_method = "file_magic"])
+_LT_DECL([], [want_nocaseglob], [1],
+ [Find potential files using nocaseglob when deplibs_check_method = "file_magic"])
+])# _LT_CHECK_MAGIC_METHOD
+
+
+# LT_PATH_NM
+# ----------
+# find the pathname to a BSD- or MS-compatible name lister
+AC_DEFUN([LT_PATH_NM],
+[AC_REQUIRE([AC_PROG_CC])dnl
+AC_CACHE_CHECK([for BSD- or MS-compatible name lister (nm)], lt_cv_path_NM,
+[if test -n "$NM"; then
+ # Let the user override the test.
+ lt_cv_path_NM="$NM"
+else
+ lt_nm_to_check="${ac_tool_prefix}nm"
+ if test -n "$ac_tool_prefix" && test "$build" = "$host"; then
+ lt_nm_to_check="$lt_nm_to_check nm"
+ fi
+ for lt_tmp_nm in $lt_nm_to_check; do
+ lt_save_ifs="$IFS"; IFS=$PATH_SEPARATOR
+ for ac_dir in $PATH /usr/ccs/bin/elf /usr/ccs/bin /usr/ucb /bin; do
+ IFS="$lt_save_ifs"
+ test -z "$ac_dir" && ac_dir=.
+ tmp_nm="$ac_dir/$lt_tmp_nm"
+ if test -f "$tmp_nm" || test -f "$tmp_nm$ac_exeext" ; then
+ # Check to see if the nm accepts a BSD-compat flag.
+ # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+ # nm: unknown option "B" ignored
+ # Tru64's nm complains that /dev/null is an invalid object file
+ case `"$tmp_nm" -B /dev/null 2>&1 | sed '1q'` in
+ */dev/null* | *'Invalid file or object type'*)
+ lt_cv_path_NM="$tmp_nm -B"
+ break
+ ;;
+ *)
+ case `"$tmp_nm" -p /dev/null 2>&1 | sed '1q'` in
+ */dev/null*)
+ lt_cv_path_NM="$tmp_nm -p"
+ break
+ ;;
+ *)
+ lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but
+ continue # so that we can try to find one that supports BSD flags
+ ;;
+ esac
+ ;;
+ esac
+ fi
+ done
+ IFS="$lt_save_ifs"
+ done
+ : ${lt_cv_path_NM=no}
+fi])
+if test "$lt_cv_path_NM" != "no"; then
+ NM="$lt_cv_path_NM"
+else
+ # Didn't find any BSD compatible name lister, look for dumpbin.
+ if test -n "$DUMPBIN"; then :
+ # Let the user override the test.
+ else
+ AC_CHECK_TOOLS(DUMPBIN, [dumpbin "link -dump"], :)
+ case `$DUMPBIN -symbols /dev/null 2>&1 | sed '1q'` in
+ *COFF*)
+ DUMPBIN="$DUMPBIN -symbols"
+ ;;
+ *)
+ DUMPBIN=:
+ ;;
+ esac
+ fi
+ AC_SUBST([DUMPBIN])
+ if test "$DUMPBIN" != ":"; then
+ NM="$DUMPBIN"
+ fi
+fi
+test -z "$NM" && NM=nm
+AC_SUBST([NM])
+_LT_DECL([], [NM], [1], [A BSD- or MS-compatible name lister])dnl
+
+AC_CACHE_CHECK([the name lister ($NM) interface], [lt_cv_nm_interface],
+ [lt_cv_nm_interface="BSD nm"
+ echo "int some_variable = 0;" > conftest.$ac_ext
+ (eval echo "\"\$as_me:$LINENO: $ac_compile\"" >&AS_MESSAGE_LOG_FD)
+ (eval "$ac_compile" 2>conftest.err)
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ (eval echo "\"\$as_me:$LINENO: $NM \\\"conftest.$ac_objext\\\"\"" >&AS_MESSAGE_LOG_FD)
+ (eval "$NM \"conftest.$ac_objext\"" 2>conftest.err > conftest.out)
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ (eval echo "\"\$as_me:$LINENO: output\"" >&AS_MESSAGE_LOG_FD)
+ cat conftest.out >&AS_MESSAGE_LOG_FD
+ if $GREP 'External.*some_variable' conftest.out > /dev/null; then
+ lt_cv_nm_interface="MS dumpbin"
+ fi
+ rm -f conftest*])
+])# LT_PATH_NM
+
+# Old names:
+AU_ALIAS([AM_PROG_NM], [LT_PATH_NM])
+AU_ALIAS([AC_PROG_NM], [LT_PATH_NM])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_PROG_NM], [])
+dnl AC_DEFUN([AC_PROG_NM], [])
+
+# _LT_CHECK_SHAREDLIB_FROM_LINKLIB
+# --------------------------------
+# how to determine the name of the shared library
+# associated with a specific link library.
+# -- PORTME fill in with the dynamic library characteristics
+m4_defun([_LT_CHECK_SHAREDLIB_FROM_LINKLIB],
+[m4_require([_LT_DECL_EGREP])
+m4_require([_LT_DECL_OBJDUMP])
+m4_require([_LT_DECL_DLLTOOL])
+AC_CACHE_CHECK([how to associate runtime and link libraries],
+lt_cv_sharedlib_from_linklib_cmd,
+[lt_cv_sharedlib_from_linklib_cmd='unknown'
+
+case $host_os in
+cygwin* | mingw* | pw32* | cegcc*)
+ # two different shell functions defined in ltmain.sh
+ # decide which to use based on capabilities of $DLLTOOL
+ case `$DLLTOOL --help 2>&1` in
+ *--identify-strict*)
+ lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib
+ ;;
+ *)
+ lt_cv_sharedlib_from_linklib_cmd=func_cygming_dll_for_implib_fallback
+ ;;
+ esac
+ ;;
+*)
+ # fallback: assume linklib IS sharedlib
+ lt_cv_sharedlib_from_linklib_cmd="$ECHO"
+ ;;
+esac
+])
+sharedlib_from_linklib_cmd=$lt_cv_sharedlib_from_linklib_cmd
+test -z "$sharedlib_from_linklib_cmd" && sharedlib_from_linklib_cmd=$ECHO
+
+_LT_DECL([], [sharedlib_from_linklib_cmd], [1],
+ [Command to associate shared and link libraries])
+])# _LT_CHECK_SHAREDLIB_FROM_LINKLIB
+
+
+# _LT_PATH_MANIFEST_TOOL
+# ----------------------
+# locate the manifest tool
+m4_defun([_LT_PATH_MANIFEST_TOOL],
+[AC_CHECK_TOOL(MANIFEST_TOOL, mt, :)
+test -z "$MANIFEST_TOOL" && MANIFEST_TOOL=mt
+AC_CACHE_CHECK([if $MANIFEST_TOOL is a manifest tool], [lt_cv_path_mainfest_tool],
+ [lt_cv_path_mainfest_tool=no
+ echo "$as_me:$LINENO: $MANIFEST_TOOL '-?'" >&AS_MESSAGE_LOG_FD
+ $MANIFEST_TOOL '-?' 2>conftest.err > conftest.out
+ cat conftest.err >&AS_MESSAGE_LOG_FD
+ if $GREP 'Manifest Tool' conftest.out > /dev/null; then
+ lt_cv_path_mainfest_tool=yes
+ fi
+ rm -f conftest*])
+if test "x$lt_cv_path_mainfest_tool" != xyes; then
+ MANIFEST_TOOL=:
+fi
+_LT_DECL([], [MANIFEST_TOOL], [1], [Manifest tool])dnl
+])# _LT_PATH_MANIFEST_TOOL
+
+
+# LT_LIB_M
+# --------
+# check for math library
+AC_DEFUN([LT_LIB_M],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+LIBM=
+case $host in
+*-*-beos* | *-*-cegcc* | *-*-cygwin* | *-*-haiku* | *-*-pw32* | *-*-darwin*)
+ # These system don't have libm, or don't need it
+ ;;
+*-ncr-sysv4.3*)
+ AC_CHECK_LIB(mw, _mwvalidcheckl, LIBM="-lmw")
+ AC_CHECK_LIB(m, cos, LIBM="$LIBM -lm")
+ ;;
+*)
+ AC_CHECK_LIB(m, cos, LIBM="-lm")
+ ;;
+esac
+AC_SUBST([LIBM])
+])# LT_LIB_M
+
+# Old name:
+AU_ALIAS([AC_CHECK_LIBM], [LT_LIB_M])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_CHECK_LIBM], [])
+
+
+# _LT_COMPILER_NO_RTTI([TAGNAME])
+# -------------------------------
+m4_defun([_LT_COMPILER_NO_RTTI],
+[m4_require([_LT_TAG_COMPILER])dnl
+
+_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=
+
+if test "$GCC" = yes; then
+ case $cc_basename in
+ nvcc*)
+ _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -Xcompiler -fno-builtin' ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin' ;;
+ esac
+
+ _LT_COMPILER_OPTION([if $compiler supports -fno-rtti -fno-exceptions],
+ lt_cv_prog_compiler_rtti_exceptions,
+ [-fno-rtti -fno-exceptions], [],
+ [_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)="$_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1) -fno-rtti -fno-exceptions"])
+fi
+_LT_TAGDECL([no_builtin_flag], [lt_prog_compiler_no_builtin_flag], [1],
+ [Compiler flag to turn off builtin functions])
+])# _LT_COMPILER_NO_RTTI
+
+
+# _LT_CMD_GLOBAL_SYMBOLS
+# ----------------------
+m4_defun([_LT_CMD_GLOBAL_SYMBOLS],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AC_PROG_AWK])dnl
+AC_REQUIRE([LT_PATH_NM])dnl
+AC_REQUIRE([LT_PATH_LD])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_TAG_COMPILER])dnl
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+AC_MSG_CHECKING([command to parse $NM output from $compiler object])
+AC_CACHE_VAL([lt_cv_sys_global_symbol_pipe],
+[
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix. What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[[BCDEGRST]]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([[_A-Za-z]][[_A-Za-z0-9]]*\)'
+
+# Define system-specific variables.
+case $host_os in
+aix*)
+ symcode='[[BCDT]]'
+ ;;
+cygwin* | mingw* | pw32* | cegcc*)
+ symcode='[[ABCDGISTW]]'
+ ;;
+hpux*)
+ if test "$host_cpu" = ia64; then
+ symcode='[[ABCDEGRST]]'
+ fi
+ ;;
+irix* | nonstopux*)
+ symcode='[[BCDEGRST]]'
+ ;;
+osf*)
+ symcode='[[BCDEGQRST]]'
+ ;;
+solaris*)
+ symcode='[[BDRT]]'
+ ;;
+sco3.2v5*)
+ symcode='[[DT]]'
+ ;;
+sysv4.2uw2*)
+ symcode='[[DT]]'
+ ;;
+sysv5* | sco5v6* | unixware* | OpenUNIX*)
+ symcode='[[ABDT]]'
+ ;;
+sysv4)
+ symcode='[[DFNSTU]]'
+ ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+case `$NM -V 2>&1` in
+*GNU* | *'with BFD'*)
+ symcode='[[ABCDGIRSTW]]' ;;
+esac
+
+# Transform an extracted symbol line into a proper C declaration.
+# Some systems (esp. on ia64) link data and code symbols differently,
+# so use this general approach.
+lt_cv_sys_global_symbol_to_cdecl="sed -n -e 's/^T .* \(.*\)$/extern int \1();/p' -e 's/^$symcode* .* \(.*\)$/extern char \1;/p'"
+
+# Transform an extracted symbol line into symbol name and symbol address
+lt_cv_sys_global_symbol_to_c_name_address="sed -n -e 's/^: \([[^ ]]*\)[[ ]]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"\2\", (void *) \&\2},/p'"
+lt_cv_sys_global_symbol_to_c_name_address_lib_prefix="sed -n -e 's/^: \([[^ ]]*\)[[ ]]*$/ {\\\"\1\\\", (void *) 0},/p' -e 's/^$symcode* \([[^ ]]*\) \(lib[[^ ]]*\)$/ {\"\2\", (void *) \&\2},/p' -e 's/^$symcode* \([[^ ]]*\) \([[^ ]]*\)$/ {\"lib\2\", (void *) \&\2},/p'"
+
+# Handle CRLF in mingw tool chain
+opt_cr=
+case $build_os in
+mingw*)
+ opt_cr=`$ECHO 'x\{0,1\}' | tr x '\015'` # option cr in regexp
+ ;;
+esac
+
+# Try without a prefix underscore, then with it.
+for ac_symprfx in "" "_"; do
+
+ # Transform symcode, sympat, and symprfx into a raw symbol and a C symbol.
+ symxfrm="\\1 $ac_symprfx\\2 \\2"
+
+ # Write the raw and C identifiers.
+ if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ # Fake it for dumpbin and say T for any non-static function
+ # and D for any global variable.
+ # Also find C++ and __fastcall symbols from MSVC++,
+ # which start with @ or ?.
+ lt_cv_sys_global_symbol_pipe="$AWK ['"\
+" {last_section=section; section=\$ 3};"\
+" /^COFF SYMBOL TABLE/{for(i in hide) delete hide[i]};"\
+" /Section length .*#relocs.*(pick any)/{hide[last_section]=1};"\
+" \$ 0!~/External *\|/{next};"\
+" / 0+ UNDEF /{next}; / UNDEF \([^|]\)*()/{next};"\
+" {if(hide[section]) next};"\
+" {f=0}; \$ 0~/\(\).*\|/{f=1}; {printf f ? \"T \" : \"D \"};"\
+" {split(\$ 0, a, /\||\r/); split(a[2], s)};"\
+" s[1]~/^[@?]/{print s[1], s[1]; next};"\
+" s[1]~prfx {split(s[1],t,\"@\"); print t[1], substr(t[1],length(prfx))}"\
+" ' prfx=^$ac_symprfx]"
+ else
+ lt_cv_sys_global_symbol_pipe="sed -n -e 's/^.*[[ ]]\($symcode$symcode*\)[[ ]][[ ]]*$ac_symprfx$sympat$opt_cr$/$symxfrm/p'"
+ fi
+ lt_cv_sys_global_symbol_pipe="$lt_cv_sys_global_symbol_pipe | sed '/ __gnu_lto/d'"
+
+ # Check to see that the pipe works correctly.
+ pipe_works=no
+
+ rm -f conftest*
+ cat > conftest.$ac_ext <<_LT_EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(void);
+void nm_test_func(void){}
+#ifdef __cplusplus
+}
+#endif
+int main(){nm_test_var='a';nm_test_func();return(0);}
+_LT_EOF
+
+ if AC_TRY_EVAL(ac_compile); then
+ # Now try to grab the symbols.
+ nlist=conftest.nm
+ if AC_TRY_EVAL(NM conftest.$ac_objext \| "$lt_cv_sys_global_symbol_pipe" \> $nlist) && test -s "$nlist"; then
+ # Try sorting and uniquifying the output.
+ if sort "$nlist" | uniq > "$nlist"T; then
+ mv -f "$nlist"T "$nlist"
+ else
+ rm -f "$nlist"T
+ fi
+
+ # Make sure that we snagged all the symbols we need.
+ if $GREP ' nm_test_var$' "$nlist" >/dev/null; then
+ if $GREP ' nm_test_func$' "$nlist" >/dev/null; then
+ cat <<_LT_EOF > conftest.$ac_ext
+/* Keep this code in sync between libtool.m4, ltmain, lt_system.h, and tests. */
+#if defined(_WIN32) || defined(__CYGWIN__) || defined(_WIN32_WCE)
+/* DATA imports from DLLs on WIN32 con't be const, because runtime
+ relocations are performed -- see ld's documentation on pseudo-relocs. */
+# define LT@&t@_DLSYM_CONST
+#elif defined(__osf__)
+/* This system does not cope well with relocations in const data. */
+# define LT@&t@_DLSYM_CONST
+#else
+# define LT@&t@_DLSYM_CONST const
+#endif
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+_LT_EOF
+ # Now generate the symbol file.
+ eval "$lt_cv_sys_global_symbol_to_cdecl"' < "$nlist" | $GREP -v main >> conftest.$ac_ext'
+
+ cat <<_LT_EOF >> conftest.$ac_ext
+
+/* The mapping between symbol names and symbols. */
+LT@&t@_DLSYM_CONST struct {
+ const char *name;
+ void *address;
+}
+lt__PROGRAM__LTX_preloaded_symbols[[]] =
+{
+ { "@PROGRAM@", (void *) 0 },
+_LT_EOF
+ $SED "s/^$symcode$symcode* \(.*\) \(.*\)$/ {\"\2\", (void *) \&\2},/" < "$nlist" | $GREP -v main >> conftest.$ac_ext
+ cat <<\_LT_EOF >> conftest.$ac_ext
+ {0, (void *) 0}
+};
+
+/* This works around a problem in FreeBSD linker */
+#ifdef FREEBSD_WORKAROUND
+static const void *lt_preloaded_setup() {
+ return lt__PROGRAM__LTX_preloaded_symbols;
+}
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+_LT_EOF
+ # Now try linking the two files.
+ mv conftest.$ac_objext conftstm.$ac_objext
+ lt_globsym_save_LIBS=$LIBS
+ lt_globsym_save_CFLAGS=$CFLAGS
+ LIBS="conftstm.$ac_objext"
+ CFLAGS="$CFLAGS$_LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)"
+ if AC_TRY_EVAL(ac_link) && test -s conftest${ac_exeext}; then
+ pipe_works=yes
+ fi
+ LIBS=$lt_globsym_save_LIBS
+ CFLAGS=$lt_globsym_save_CFLAGS
+ else
+ echo "cannot find nm_test_func in $nlist" >&AS_MESSAGE_LOG_FD
+ fi
+ else
+ echo "cannot find nm_test_var in $nlist" >&AS_MESSAGE_LOG_FD
+ fi
+ else
+ echo "cannot run $lt_cv_sys_global_symbol_pipe" >&AS_MESSAGE_LOG_FD
+ fi
+ else
+ echo "$progname: failed program was:" >&AS_MESSAGE_LOG_FD
+ cat conftest.$ac_ext >&5
+ fi
+ rm -rf conftest* conftst*
+
+ # Do not use the global_symbol_pipe unless it works.
+ if test "$pipe_works" = yes; then
+ break
+ else
+ lt_cv_sys_global_symbol_pipe=
+ fi
+done
+])
+if test -z "$lt_cv_sys_global_symbol_pipe"; then
+ lt_cv_sys_global_symbol_to_cdecl=
+fi
+if test -z "$lt_cv_sys_global_symbol_pipe$lt_cv_sys_global_symbol_to_cdecl"; then
+ AC_MSG_RESULT(failed)
+else
+ AC_MSG_RESULT(ok)
+fi
+
+# Response file support.
+if test "$lt_cv_nm_interface" = "MS dumpbin"; then
+ nm_file_list_spec='@'
+elif $NM --help 2>/dev/null | grep '[[@]]FILE' >/dev/null; then
+ nm_file_list_spec='@'
+fi
+
+_LT_DECL([global_symbol_pipe], [lt_cv_sys_global_symbol_pipe], [1],
+ [Take the output of nm and produce a listing of raw symbols and C names])
+_LT_DECL([global_symbol_to_cdecl], [lt_cv_sys_global_symbol_to_cdecl], [1],
+ [Transform the output of nm in a proper C declaration])
+_LT_DECL([global_symbol_to_c_name_address],
+ [lt_cv_sys_global_symbol_to_c_name_address], [1],
+ [Transform the output of nm in a C name address pair])
+_LT_DECL([global_symbol_to_c_name_address_lib_prefix],
+ [lt_cv_sys_global_symbol_to_c_name_address_lib_prefix], [1],
+ [Transform the output of nm in a C name address pair when lib prefix is needed])
+_LT_DECL([], [nm_file_list_spec], [1],
+ [Specify filename containing input files for $NM])
+]) # _LT_CMD_GLOBAL_SYMBOLS
+
+
+# _LT_COMPILER_PIC([TAGNAME])
+# ---------------------------
+m4_defun([_LT_COMPILER_PIC],
+[m4_require([_LT_TAG_COMPILER])dnl
+_LT_TAGVAR(lt_prog_compiler_wl, $1)=
+_LT_TAGVAR(lt_prog_compiler_pic, $1)=
+_LT_TAGVAR(lt_prog_compiler_static, $1)=
+
+m4_if([$1], [CXX], [
+ # C++ specific cases for pic, static, wl, etc.
+ if test "$GXX" = yes; then
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ m68k)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ esac
+ ;;
+
+ beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+ mingw* | cygwin* | os2* | pw32* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ # Although the cygwin gcc ignores -fPIC, still need this for old-style
+ # (--disable-auto-import) libraries
+ m4_if([$1], [GCJ], [],
+ [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+ ;;
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common'
+ ;;
+ *djgpp*)
+ # DJGPP does not support shared libraries at all
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+ ;;
+ haiku*)
+ # PIC is the default for Haiku.
+ # The "-static" flag exists, but is broken.
+ _LT_TAGVAR(lt_prog_compiler_static, $1)=
+ ;;
+ interix[[3-9]]*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic
+ fi
+ ;;
+ hpux*)
+ # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+ # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag
+ # sets the default TLS model and affects inlining.
+ case $host_cpu in
+ hppa*64*)
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ ;;
+ *qnx* | *nto*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ else
+ case $host_os in
+ aix[[4-9]]*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ else
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+ chorus*)
+ case $cc_basename in
+ cxch68*)
+ # Green Hills C++ Compiler
+ # _LT_TAGVAR(lt_prog_compiler_static, $1)="--no_auto_instantiation -u __main -u __premain -u _abort -r $COOL_DIR/lib/libOrb.a $MVME_DIR/lib/CC/libC.a $MVME_DIR/lib/classix/libcx.s.a"
+ ;;
+ esac
+ ;;
+ mingw* | cygwin* | os2* | pw32* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ m4_if([$1], [GCJ], [],
+ [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+ ;;
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ freebsd* | dragonfly*)
+ # FreeBSD uses GNU C++
+ ;;
+ hpux9* | hpux10* | hpux11*)
+ case $cc_basename in
+ CC*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+ if test "$host_cpu" != ia64; then
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+ fi
+ ;;
+ aCC*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+ ;;
+ esac
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ interix*)
+ # This is c89, which is MS Visual C++ (no shared libs)
+ # Anyone wants to do a port?
+ ;;
+ irix5* | irix6* | nonstopux*)
+ case $cc_basename in
+ CC*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ # CC pic flag -KPIC is the default.
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ case $cc_basename in
+ KCC*)
+ # KAI C++ Compiler
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ ecpc* )
+ # old Intel C++ for x86_64 which still supported -KPIC.
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ icpc* )
+ # Intel C++, used to be incompatible with GCC.
+ # ICC 10 doesn't accept -KPIC any more.
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ pgCC* | pgcpp*)
+ # Portland Group C++ compiler
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ cxx*)
+ # Compaq C++
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+ xlc* | xlC* | bgxl[[cC]]* | mpixl[[cC]]*)
+ # IBM XL 8.0, 9.0 on PPC and BlueGene
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-qpic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-qstaticlink'
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ # Sun C++ 5.9
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+ lynxos*)
+ ;;
+ m88k*)
+ ;;
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-W c,exportall'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ netbsd*)
+ ;;
+ *qnx* | *nto*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+ ;;
+ osf3* | osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='--backend -Wl,'
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ ;;
+ cxx*)
+ # Digital/Compaq C++
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # Make sure the PIC flag is empty. It appears that all Alpha
+ # Linux and Compaq Tru64 Unix objects are PIC.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ psos*)
+ ;;
+ solaris*)
+ case $cc_basename in
+ CC* | sunCC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ lcc*)
+ # Lucid
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ case $cc_basename in
+ CC*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ esac
+ ;;
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ ;;
+ *)
+ ;;
+ esac
+ ;;
+ vxworks*)
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ ;;
+ esac
+ fi
+],
+[
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+
+ case $host_os in
+ aix*)
+ # All AIX code is PIC.
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ m68k)
+ # FIXME: we need at least 68020 code to build shared libraries, but
+ # adding the `-m68020' flag to GCC prevents building anything better,
+ # like `-m68040'.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-m68020 -resident32 -malways-restore-a4'
+ ;;
+ esac
+ ;;
+
+ beos* | irix5* | irix6* | nonstopux* | osf3* | osf4* | osf5*)
+ # PIC is the default for these OSes.
+ ;;
+
+ mingw* | cygwin* | pw32* | os2* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ # Although the cygwin gcc ignores -fPIC, still need this for old-style
+ # (--disable-auto-import) libraries
+ m4_if([$1], [GCJ], [],
+ [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+ ;;
+
+ darwin* | rhapsody*)
+ # PIC is the default on this platform
+ # Common symbols not allowed in MH_DYLIB files
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fno-common'
+ ;;
+
+ haiku*)
+ # PIC is the default for Haiku.
+ # The "-static" flag exists, but is broken.
+ _LT_TAGVAR(lt_prog_compiler_static, $1)=
+ ;;
+
+ hpux*)
+ # PIC is the default for 64-bit PA HP-UX, but not for 32-bit
+ # PA HP-UX. On IA64 HP-UX, PIC is the default but the pic flag
+ # sets the default TLS model and affects inlining.
+ case $host_cpu in
+ hppa*64*)
+ # +Z the default
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+ ;;
+
+ interix[[3-9]]*)
+ # Interix 3.x gcc -fpic/-fPIC options generate broken code.
+ # Instead, we relocate shared libraries at runtime.
+ ;;
+
+ msdosdjgpp*)
+ # Just because we use GCC doesn't mean we suddenly get shared libraries
+ # on systems that don't support them.
+ _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ enable_shared=no
+ ;;
+
+ *nto* | *qnx*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)=-Kconform_pic
+ fi
+ ;;
+
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ ;;
+ esac
+
+ case $cc_basename in
+ nvcc*) # Cuda Compiler Driver 2.2
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Xlinker '
+ if test -n "$_LT_TAGVAR(lt_prog_compiler_pic, $1)"; then
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)="-Xcompiler $_LT_TAGVAR(lt_prog_compiler_pic, $1)"
+ fi
+ ;;
+ esac
+ else
+ # PORTME Check for flag to pass linker flags through the system compiler.
+ case $host_os in
+ aix*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ if test "$host_cpu" = ia64; then
+ # AIX 5 now supports IA64 processor
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ else
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-bnso -bI:/lib/syscalls.exp'
+ fi
+ ;;
+
+ mingw* | cygwin* | pw32* | os2* | cegcc*)
+ # This hack is so that the source file can tell whether it is being
+ # built for inclusion in a dll (and should export symbols for example).
+ m4_if([$1], [GCJ], [],
+ [_LT_TAGVAR(lt_prog_compiler_pic, $1)='-DDLL_EXPORT'])
+ ;;
+
+ hpux9* | hpux10* | hpux11*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # PIC is the default for IA64 HP-UX and 64-bit HP-UX, but
+ # not for PA HP-UX.
+ case $host_cpu in
+ hppa*64*|ia64*)
+ # +Z the default
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='+Z'
+ ;;
+ esac
+ # Is there a better lt_prog_compiler_static that works with the bundled CC?
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='${wl}-a ${wl}archive'
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # PIC (with -KPIC) is the default.
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+
+ linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ case $cc_basename in
+ # old Intel for x86_64 which still supported -KPIC.
+ ecc*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ # icc used to be incompatible with GCC.
+ # ICC 10 doesn't accept -KPIC any more.
+ icc* | ifort*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ # Lahey Fortran 8.1.
+ lf95*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='--shared'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='--static'
+ ;;
+ nagfor*)
+ # NAG Fortran compiler
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,-Wl,,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ pgcc* | pgf77* | pgf90* | pgf95* | pgfortran*)
+ # Portland Group compilers (*not* the Pentium gcc compiler,
+ # which looks to be a dead project)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ ccc*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # All Alpha code is PIC.
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+ xl* | bgxl* | bgf* | mpixl*)
+ # IBM XL C 8.0/Fortran 10.1, 11.1 on PPC and BlueGene
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-qpic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-qstaticlink'
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ Ceres\ Fortran* | *Sun*Fortran*\ [[1-7]].* | *Sun*Fortran*\ 8.[[0-3]]*)
+ # Sun Fortran 8.3 passes all unrecognized flags to the linker
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)=''
+ ;;
+ *Sun\ F* | *Sun*Fortran*)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+ ;;
+ *Sun\ C*)
+ # Sun C 5.9
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ ;;
+ *Intel*\ [[CF]]*Compiler*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-static'
+ ;;
+ *Portland\ Group*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fpic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+
+ newsos6)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ *nto* | *qnx*)
+ # QNX uses GNU C++, but need to define -shared option too, otherwise
+ # it will coredump.
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-fPIC -shared'
+ ;;
+
+ osf3* | osf4* | osf5*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ # All OSF/1 code is PIC.
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+
+ rdos*)
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-non_shared'
+ ;;
+
+ solaris*)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ case $cc_basename in
+ f77* | f90* | f95* | sunf77* | sunf90* | sunf95*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld ';;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,';;
+ esac
+ ;;
+
+ sunos4*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Qoption ld '
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-PIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ sysv4 | sysv4.2uw2* | sysv4.3*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec ;then
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-Kconform_pic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ fi
+ ;;
+
+ sysv5* | unixware* | sco3.2v5* | sco5v6* | OpenUNIX*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-KPIC'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ unicos*)
+ _LT_TAGVAR(lt_prog_compiler_wl, $1)='-Wl,'
+ _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ ;;
+
+ uts4*)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)='-pic'
+ _LT_TAGVAR(lt_prog_compiler_static, $1)='-Bstatic'
+ ;;
+
+ *)
+ _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no
+ ;;
+ esac
+ fi
+])
+case $host_os in
+ # For platforms which do not support PIC, -DPIC is meaningless:
+ *djgpp*)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)=
+ ;;
+ *)
+ _LT_TAGVAR(lt_prog_compiler_pic, $1)="$_LT_TAGVAR(lt_prog_compiler_pic, $1)@&t@m4_if([$1],[],[ -DPIC],[m4_if([$1],[CXX],[ -DPIC],[])])"
+ ;;
+esac
+
+AC_CACHE_CHECK([for $compiler option to produce PIC],
+ [_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)],
+ [_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)=$_LT_TAGVAR(lt_prog_compiler_pic, $1)])
+_LT_TAGVAR(lt_prog_compiler_pic, $1)=$_LT_TAGVAR(lt_cv_prog_compiler_pic, $1)
+
+#
+# Check to make sure the PIC flag actually works.
+#
+if test -n "$_LT_TAGVAR(lt_prog_compiler_pic, $1)"; then
+ _LT_COMPILER_OPTION([if $compiler PIC flag $_LT_TAGVAR(lt_prog_compiler_pic, $1) works],
+ [_LT_TAGVAR(lt_cv_prog_compiler_pic_works, $1)],
+ [$_LT_TAGVAR(lt_prog_compiler_pic, $1)@&t@m4_if([$1],[],[ -DPIC],[m4_if([$1],[CXX],[ -DPIC],[])])], [],
+ [case $_LT_TAGVAR(lt_prog_compiler_pic, $1) in
+ "" | " "*) ;;
+ *) _LT_TAGVAR(lt_prog_compiler_pic, $1)=" $_LT_TAGVAR(lt_prog_compiler_pic, $1)" ;;
+ esac],
+ [_LT_TAGVAR(lt_prog_compiler_pic, $1)=
+ _LT_TAGVAR(lt_prog_compiler_can_build_shared, $1)=no])
+fi
+_LT_TAGDECL([pic_flag], [lt_prog_compiler_pic], [1],
+ [Additional compiler flags for building library objects])
+
+_LT_TAGDECL([wl], [lt_prog_compiler_wl], [1],
+ [How to pass a linker flag through the compiler])
+#
+# Check to make sure the static flag actually works.
+#
+wl=$_LT_TAGVAR(lt_prog_compiler_wl, $1) eval lt_tmp_static_flag=\"$_LT_TAGVAR(lt_prog_compiler_static, $1)\"
+_LT_LINKER_OPTION([if $compiler static flag $lt_tmp_static_flag works],
+ _LT_TAGVAR(lt_cv_prog_compiler_static_works, $1),
+ $lt_tmp_static_flag,
+ [],
+ [_LT_TAGVAR(lt_prog_compiler_static, $1)=])
+_LT_TAGDECL([link_static_flag], [lt_prog_compiler_static], [1],
+ [Compiler flag to prevent dynamic linking])
+])# _LT_COMPILER_PIC
+
+
+# _LT_LINKER_SHLIBS([TAGNAME])
+# ----------------------------
+# See if the linker supports building shared libraries.
+m4_defun([_LT_LINKER_SHLIBS],
+[AC_REQUIRE([LT_PATH_LD])dnl
+AC_REQUIRE([LT_PATH_NM])dnl
+m4_require([_LT_PATH_MANIFEST_TOOL])dnl
+m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_DECL_SED])dnl
+m4_require([_LT_CMD_GLOBAL_SYMBOLS])dnl
+m4_require([_LT_TAG_COMPILER])dnl
+AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries])
+m4_if([$1], [CXX], [
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ _LT_TAGVAR(exclude_expsyms, $1)=['_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*']
+ case $host_os in
+ aix[[4-9]]*)
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ # Also, AIX nm treats weak defined symbols like other global defined
+ # symbols, whereas GNU nm marks them as "W".
+ if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ else
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ fi
+ ;;
+ pw32*)
+ _LT_TAGVAR(export_symbols_cmds, $1)="$ltdll_cmds"
+ ;;
+ cygwin* | mingw* | cegcc*)
+ case $cc_basename in
+ cl*)
+ _LT_TAGVAR(exclude_expsyms, $1)='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+ ;;
+ *)
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1 DATA/;s/^.*[[ ]]__nm__\([[^ ]]*\)[[ ]][[^ ]]*/\1 DATA/;/^I[[ ]]/d;/^[[AITW]][[ ]]/s/.* //'\'' | sort | uniq > $export_symbols'
+ _LT_TAGVAR(exclude_expsyms, $1)=['[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname']
+ ;;
+ esac
+ ;;
+ *)
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ ;;
+ esac
+], [
+ runpath_var=
+ _LT_TAGVAR(allow_undefined_flag, $1)=
+ _LT_TAGVAR(always_export_symbols, $1)=no
+ _LT_TAGVAR(archive_cmds, $1)=
+ _LT_TAGVAR(archive_expsym_cmds, $1)=
+ _LT_TAGVAR(compiler_needs_object, $1)=no
+ _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)=
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED '\''s/.* //'\'' | sort | uniq > $export_symbols'
+ _LT_TAGVAR(hardcode_automatic, $1)=no
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=no
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=
+ _LT_TAGVAR(hardcode_minus_L, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+ _LT_TAGVAR(inherit_rpath, $1)=no
+ _LT_TAGVAR(link_all_deplibs, $1)=unknown
+ _LT_TAGVAR(module_cmds, $1)=
+ _LT_TAGVAR(module_expsym_cmds, $1)=
+ _LT_TAGVAR(old_archive_from_new_cmds, $1)=
+ _LT_TAGVAR(old_archive_from_expsyms_cmds, $1)=
+ _LT_TAGVAR(thread_safe_flag_spec, $1)=
+ _LT_TAGVAR(whole_archive_flag_spec, $1)=
+ # include_expsyms should be a list of space-separated symbols to be *always*
+ # included in the symbol list
+ _LT_TAGVAR(include_expsyms, $1)=
+ # exclude_expsyms can be an extended regexp of symbols to exclude
+ # it will be wrapped by ` (' and `)$', so one must not match beginning or
+ # end of line. Example: `a|bc|.*d.*' will exclude the symbols `a' and `bc',
+ # as well as any symbol that contains `d'.
+ _LT_TAGVAR(exclude_expsyms, $1)=['_GLOBAL_OFFSET_TABLE_|_GLOBAL__F[ID]_.*']
+ # Although _GLOBAL_OFFSET_TABLE_ is a valid symbol C name, most a.out
+ # platforms (ab)use it in PIC code, but their linkers get confused if
+ # the symbol is explicitly referenced. Since portable code cannot
+ # rely on this symbol name, it's probably fine to never include it in
+ # preloaded symbol tables.
+ # Exclude shared library initialization/finalization symbols.
+dnl Note also adjust exclude_expsyms for C++ above.
+ extract_expsyms_cmds=
+
+ case $host_os in
+ cygwin* | mingw* | pw32* | cegcc*)
+ # FIXME: the MSVC++ port hasn't been tested in a loooong time
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ if test "$GCC" != yes; then
+ with_gnu_ld=no
+ fi
+ ;;
+ interix*)
+ # we just hope/assume this is gcc and not c89 (= MSVC++)
+ with_gnu_ld=yes
+ ;;
+ openbsd*)
+ with_gnu_ld=no
+ ;;
+ esac
+
+ _LT_TAGVAR(ld_shlibs, $1)=yes
+
+ # On some targets, GNU ld is compatible enough with the native linker
+ # that we're better off using the native interface for both.
+ lt_use_gnu_ld_interface=no
+ if test "$with_gnu_ld" = yes; then
+ case $host_os in
+ aix*)
+ # The AIX port of GNU ld has always aspired to compatibility
+ # with the native linker. However, as the warning in the GNU ld
+ # block says, versions before 2.19.5* couldn't really create working
+ # shared libraries, regardless of the interface used.
+ case `$LD -v 2>&1` in
+ *\ \(GNU\ Binutils\)\ 2.19.5*) ;;
+ *\ \(GNU\ Binutils\)\ 2.[[2-9]]*) ;;
+ *\ \(GNU\ Binutils\)\ [[3-9]]*) ;;
+ *)
+ lt_use_gnu_ld_interface=yes
+ ;;
+ esac
+ ;;
+ *)
+ lt_use_gnu_ld_interface=yes
+ ;;
+ esac
+ fi
+
+ if test "$lt_use_gnu_ld_interface" = yes; then
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ wlarc='${wl}'
+
+ # Set some defaults for GNU ld with shared library support. These
+ # are reset later if shared libraries are not supported. Putting them
+ # here allows them to be overridden if necessary.
+ runpath_var=LD_RUN_PATH
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if $LD --help 2>&1 | $GREP 'no-whole-archive' > /dev/null; then
+ _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ _LT_TAGVAR(whole_archive_flag_spec, $1)=
+ fi
+ supports_anon_versioning=no
+ case `$LD -v 2>&1` in
+ *GNU\ gold*) supports_anon_versioning=yes ;;
+ *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.10.*) ;; # catch versions < 2.11
+ *\ 2.11.93.0.2\ *) supports_anon_versioning=yes ;; # RH7.3 ...
+ *\ 2.11.92.0.12\ *) supports_anon_versioning=yes ;; # Mandrake 8.2 ...
+ *\ 2.11.*) ;; # other 2.11 versions
+ *) supports_anon_versioning=yes ;;
+ esac
+
+ # See if GNU ld supports shared libraries.
+ case $host_os in
+ aix[[3-9]]*)
+ # On AIX/PPC, the GNU linker is very broken
+ if test "$host_cpu" != ia64; then
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: the GNU linker, at least up to release 2.19, is reported
+*** to be unable to reliably create shared libraries on AIX.
+*** Therefore, libtool is disabling shared libraries support. If you
+*** really care for shared libraries, you may want to install binutils
+*** 2.20 or above, or modify your PATH so that a non-GNU linker is found.
+*** You will then need to restart the configuration process.
+
+_LT_EOF
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)=''
+ ;;
+ m68k)
+ _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ ;;
+ esac
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ # Joseph Beckenbach says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ _LT_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ # _LT_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless,
+ # as there is no search path for DLLs.
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-all-symbols'
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_TAGVAR(always_export_symbols, $1)=no
+ _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1 DATA/;s/^.*[[ ]]__nm__\([[^ ]]*\)[[ ]][[^ ]]*/\1 DATA/;/^I[[ ]]/d;/^[[AITW]][[ ]]/s/.* //'\'' | sort | uniq > $export_symbols'
+ _LT_TAGVAR(exclude_expsyms, $1)=['[_]+GLOBAL_OFFSET_TABLE_|[_]+GLOBAL__[FID]_.*|[_]+head_[A-Za-z0-9_]+_dll|[A-Za-z0-9_]+_dll_iname']
+
+ if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared $output_objdir/$soname.def $libobjs $deplibs $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ haiku*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+
+ interix[[3-9]]*)
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+
+ gnu* | linux* | tpf* | k*bsd*-gnu | kopensolaris*-gnu)
+ tmp_diet=no
+ if test "$host_os" = linux-dietlibc; then
+ case $cc_basename in
+ diet\ *) tmp_diet=yes;; # linux-dietlibc with static linking (!diet-dyn)
+ esac
+ fi
+ if $LD --help 2>&1 | $EGREP ': supported targets:.* elf' > /dev/null \
+ && test "$tmp_diet" = no
+ then
+ tmp_addflag=' $pic_flag'
+ tmp_sharedflag='-shared'
+ case $cc_basename,$host_cpu in
+ pgcc*) # Portland Group C compiler
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag'
+ ;;
+ pgf77* | pgf90* | pgf95* | pgfortran*)
+ # Portland Group f77 and f90 compilers
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ tmp_addflag=' $pic_flag -Mnomain' ;;
+ ecc*,ia64* | icc*,ia64*) # Intel C compiler on ia64
+ tmp_addflag=' -i_dynamic' ;;
+ efc*,ia64* | ifort*,ia64*) # Intel Fortran compiler on ia64
+ tmp_addflag=' -i_dynamic -nofor_main' ;;
+ ifc* | ifort*) # Intel Fortran compiler
+ tmp_addflag=' -nofor_main' ;;
+ lf95*) # Lahey Fortran 8.1
+ _LT_TAGVAR(whole_archive_flag_spec, $1)=
+ tmp_sharedflag='--shared' ;;
+ xl[[cC]]* | bgxl[[cC]]* | mpixl[[cC]]*) # IBM XL C 8.0 on PPC (deal with xlf below)
+ tmp_sharedflag='-qmkshrobj'
+ tmp_addflag= ;;
+ nvcc*) # Cuda Compiler Driver 2.2
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ _LT_TAGVAR(compiler_needs_object, $1)=yes
+ ;;
+ esac
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*) # Sun C 5.9
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ _LT_TAGVAR(compiler_needs_object, $1)=yes
+ tmp_sharedflag='-G' ;;
+ *Sun\ F*) # Sun Fortran 8.3
+ tmp_sharedflag='-G' ;;
+ esac
+ _LT_TAGVAR(archive_cmds, $1)='$CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+
+ if test "x$supports_anon_versioning" = xyes; then
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC '"$tmp_sharedflag""$tmp_addflag"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+
+ case $cc_basename in
+ xlf* | bgf* | bgxlf* | mpixlf*)
+ # IBM XL Fortran 10.1 on PPC cannot create shared libs itself
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='--whole-archive$convenience --no-whole-archive'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(archive_cmds, $1)='$LD -shared $libobjs $deplibs $linker_flags -soname $soname -o $lib'
+ if test "x$supports_anon_versioning" = xyes; then
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $LD -shared $libobjs $deplibs $linker_flags -soname $soname -version-script $output_objdir/$libname.ver -o $lib'
+ fi
+ ;;
+ esac
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable $libobjs $deplibs $linker_flags -o $lib'
+ wlarc=
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ fi
+ ;;
+
+ solaris*)
+ if $LD -v 2>&1 | $GREP 'BFD 2\.8' > /dev/null; then
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: The releases 2.8.* of the GNU linker cannot reliably
+*** create shared libraries on Solaris systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.9.1 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ elif $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6* | unixware* | OpenUNIX*)
+ case `$LD -v 2>&1` in
+ *\ [[01]].* | *\ 2.[[0-9]].* | *\ 2.1[[0-5]].*)
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ cat <<_LT_EOF 1>&2
+
+*** Warning: Releases of the GNU linker prior to 2.16.91.0.3 can not
+*** reliably create shared libraries on SCO systems. Therefore, libtool
+*** is disabling shared libraries support. We urge you to upgrade GNU
+*** binutils to release 2.16.91.0.3 or newer. Another option is to modify
+*** your PATH or compiler configuration so that the native linker is
+*** used, and then restart.
+
+_LT_EOF
+ ;;
+ *)
+ # For security reasons, it is highly recommended that you always
+ # use absolute paths for naming shared libraries, and exclude the
+ # DT_RUNPATH tag from executables and libraries. But doing so
+ # requires that you compile everything twice, which is a pain.
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+
+ sunos4*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ wlarc=
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ *)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+
+ if test "$_LT_TAGVAR(ld_shlibs, $1)" = no; then
+ runpath_var=
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)=
+ _LT_TAGVAR(whole_archive_flag_spec, $1)=
+ fi
+ else
+ # PORTME fill in a description of your system's linker (not GNU ld)
+ case $host_os in
+ aix3*)
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_TAGVAR(always_export_symbols, $1)=yes
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$LD -o $output_objdir/$soname $libobjs $deplibs $linker_flags -bE:$export_symbols -T512 -H512 -bM:SRE~$AR $AR_FLAGS $lib $output_objdir/$soname'
+ # Note: this linker hardcodes the directories in LIBPATH if there
+ # are no directories specified by -L.
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ if test "$GCC" = yes && test -z "$lt_prog_compiler_static"; then
+ # Neither direct hardcoding nor static linking is supported with a
+ # broken collect2.
+ _LT_TAGVAR(hardcode_direct, $1)=unsupported
+ fi
+ ;;
+
+ aix[[4-9]]*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ # If we're using GNU nm, then we don't want the "-C" option.
+ # -C means demangle to AIX nm, but means don't demangle with GNU nm
+ # Also, AIX nm treats weak defined symbols like other global
+ # defined symbols, whereas GNU nm marks them as "W".
+ if $NM -V 2>&1 | $GREP 'GNU' > /dev/null; then
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM -Bpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B") || (\$ 2 == "W")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ else
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM -BCpg $libobjs $convenience | awk '\''{ if (((\$ 2 == "T") || (\$ 2 == "D") || (\$ 2 == "B")) && ([substr](\$ 3,1,1) != ".")) { print \$ 3 } }'\'' | sort -u > $export_symbols'
+ fi
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[[23]]|aix4.[[23]].*|aix[[5-9]]*)
+ for ld_flag in $LDFLAGS; do
+ if (test $ld_flag = "-brtl" || test $ld_flag = "-Wl,-brtl"); then
+ aix_use_runtimelinking=yes
+ break
+ fi
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ _LT_TAGVAR(archive_cmds, $1)=''
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_TAGVAR(file_list_spec, $1)='${wl}-f,'
+
+ if test "$GCC" = yes; then
+ case $host_os in aix4.[[012]]|aix4.[[012]].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" &&
+ strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ :
+ else
+ # We have old collect2
+ _LT_TAGVAR(hardcode_direct, $1)=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=
+ fi
+ ;;
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-bexpall'
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to export.
+ _LT_TAGVAR(always_export_symbols, $1)=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ _LT_TAGVAR(allow_undefined_flag, $1)='-berok'
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ _LT_SYS_MODULE_PATH_AIX([$1])
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib'
+ _LT_TAGVAR(allow_undefined_flag, $1)="-z nodefs"
+ _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ _LT_SYS_MODULE_PATH_AIX([$1])
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok'
+ _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok'
+ if test "$with_gnu_ld" = yes; then
+ # We only use this code for GNU lds that support --whole-archive.
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ else
+ # Exported symbols can be pulled into shared objects from archives
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='$convenience'
+ fi
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+ # This is similar to how AIX traditionally builds its shared libraries.
+ _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ amigaos*)
+ case $host_cpu in
+ powerpc)
+ # see comment about AmigaOS4 .so support
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)=''
+ ;;
+ m68k)
+ _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/a2ixlibrary.data~$ECHO "#define NAME $libname" > $output_objdir/a2ixlibrary.data~$ECHO "#define LIBRARY_ID 1" >> $output_objdir/a2ixlibrary.data~$ECHO "#define VERSION $major" >> $output_objdir/a2ixlibrary.data~$ECHO "#define REVISION $revision" >> $output_objdir/a2ixlibrary.data~$AR $AR_FLAGS $lib $libobjs~$RANLIB $lib~(cd $output_objdir && a2ixlibrary -32)'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ ;;
+ esac
+ ;;
+
+ bsdi[[45]]*)
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)=-rdynamic
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ # When not using gcc, we currently assume that we are using
+ # Microsoft Visual C++.
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ case $cc_basename in
+ cl*)
+ # Native MSVC
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_TAGVAR(always_export_symbols, $1)=yes
+ _LT_TAGVAR(file_list_spec, $1)='@'
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+ _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ sed -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+ else
+ sed -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+ fi~
+ $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+ linknames='
+ # The linker will not automatically build a static lib if we build a DLL.
+ # _LT_TAGVAR(old_archive_from_new_cmds, $1)='true'
+ _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+ _LT_TAGVAR(exclude_expsyms, $1)='_NULL_IMPORT_DESCRIPTOR|_IMPORT_DESCRIPTOR_.*'
+ _LT_TAGVAR(export_symbols_cmds, $1)='$NM $libobjs $convenience | $global_symbol_pipe | $SED -e '\''/^[[BCDGRS]][[ ]]/s/.*[[ ]]\([[^ ]]*\)/\1,DATA/'\'' | $SED -e '\''/^[[AITW]][[ ]]/s/.*[[ ]]//'\'' | sort | uniq > $export_symbols'
+ # Don't use ranlib
+ _LT_TAGVAR(old_postinstall_cmds, $1)='chmod 644 $oldlib'
+ _LT_TAGVAR(postlink_cmds, $1)='lt_outputfile="@OUTPUT@"~
+ lt_tool_outputfile="@TOOL_OUTPUT@"~
+ case $lt_outputfile in
+ *.exe|*.EXE) ;;
+ *)
+ lt_outputfile="$lt_outputfile.exe"
+ lt_tool_outputfile="$lt_tool_outputfile.exe"
+ ;;
+ esac~
+ if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+ $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+ $RM "$lt_outputfile.manifest";
+ fi'
+ ;;
+ *)
+ # Assume MSVC wrapper
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -o $lib $libobjs $compiler_flags `func_echo_all "$deplibs" | $SED '\''s/ -lc$//'\''` -link -dll~linknames='
+ # The linker will automatically build a .lib file if we build a DLL.
+ _LT_TAGVAR(old_archive_from_new_cmds, $1)='true'
+ # FIXME: Should let the user specify the lib program.
+ _LT_TAGVAR(old_archive_cmds, $1)='lib -OUT:$oldlib$oldobjs$old_deplibs'
+ _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+ ;;
+ esac
+ ;;
+
+ darwin* | rhapsody*)
+ _LT_DARWIN_LINKER_FEATURES($1)
+ ;;
+
+ dgux*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+ # support. Future versions do this automatically, but an explicit c++rt0.o
+ # does not break anything, and helps significantly (at the cost of a little
+ # extra space).
+ freebsd2.2*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags /usr/lib/c++rt0.o'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+ freebsd2.*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ # FreeBSD 3 and greater uses gcc -shared to do shared libraries.
+ freebsd* | dragonfly*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ hpux9*)
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -shared $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $libobjs $deplibs $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$LD -b +b $install_libdir -o $output_objdir/$soname $libobjs $deplibs $linker_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ fi
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ ;;
+
+ hpux10*)
+ if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ if test "$with_gnu_ld" = no; then
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ fi
+ ;;
+
+ hpux11*)
+ if test "$GCC" = yes && test "$with_gnu_ld" = no; then
+ case $host_cpu in
+ hppa*64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ else
+ case $host_cpu in
+ hppa*64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ ia64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ m4_if($1, [], [
+ # Older versions of the 11.00 compiler do not understand -b yet
+ # (HP92453-01 A.11.01.20 doesn't, HP92453-01 B.11.X.35175-35176.GP does)
+ _LT_LINKER_OPTION([if $CC understands -b],
+ _LT_TAGVAR(lt_cv_prog_compiler__b, $1), [-b],
+ [_LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'],
+ [_LT_TAGVAR(archive_cmds, $1)='$LD -b +h $soname +b $install_libdir -o $lib $libobjs $deplibs $linker_flags'])],
+ [_LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $libobjs $deplibs $compiler_flags'])
+ ;;
+ esac
+ fi
+ if test "$with_gnu_ld" = no; then
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+ *)
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+
+ # hardcode_minus_L: Not really in the search PATH,
+ # but as the default location of the library.
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ ;;
+ esac
+ fi
+ ;;
+
+ irix5* | irix6* | nonstopux*)
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ # Try to use the -exported_symbol ld option, if it does not
+ # work, assume that -exports_file does not work either and
+ # implicitly export all symbols.
+ # This should be the same for all languages, so no per-tag cache variable.
+ AC_CACHE_CHECK([whether the $host_os linker accepts -exported_symbol],
+ [lt_cv_irix_exported_symbol],
+ [save_LDFLAGS="$LDFLAGS"
+ LDFLAGS="$LDFLAGS -shared ${wl}-exported_symbol ${wl}foo ${wl}-update_registry ${wl}/dev/null"
+ AC_LINK_IFELSE(
+ [AC_LANG_SOURCE(
+ [AC_LANG_CASE([C], [[int foo (void) { return 0; }]],
+ [C++], [[int foo (void) { return 0; }]],
+ [Fortran 77], [[
+ subroutine foo
+ end]],
+ [Fortran], [[
+ subroutine foo
+ end]])])],
+ [lt_cv_irix_exported_symbol=yes],
+ [lt_cv_irix_exported_symbol=no])
+ LDFLAGS="$save_LDFLAGS"])
+ if test "$lt_cv_irix_exported_symbol" = yes; then
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations ${wl}-exports_file ${wl}$export_symbols -o $lib'
+ fi
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -exports_file $export_symbols -o $lib'
+ fi
+ _LT_TAGVAR(archive_cmds_need_lc, $1)='no'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_TAGVAR(inherit_rpath, $1)=yes
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags' # a.out
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$LD -shared -o $lib $libobjs $deplibs $linker_flags' # ELF
+ fi
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ newsos6)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ *nto* | *qnx*)
+ ;;
+
+ openbsd*)
+ if test -f /usr/libexec/ld.so; then
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ if test -z "`echo __ELF__ | $CC -E - | $GREP __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags ${wl}-retain-symbols-file,$export_symbols'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ else
+ case $host_os in
+ openbsd[[01]].* | openbsd2.[[0-7]] | openbsd2.[[0-7]].*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ ;;
+ esac
+ fi
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ os2*)
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_TAGVAR(archive_cmds, $1)='$ECHO "LIBRARY $libname INITINSTANCE" > $output_objdir/$libname.def~$ECHO "DESCRIPTION \"$libname\"" >> $output_objdir/$libname.def~echo DATA >> $output_objdir/$libname.def~echo " SINGLE NONSHARED" >> $output_objdir/$libname.def~echo EXPORTS >> $output_objdir/$libname.def~emxexp $libobjs >> $output_objdir/$libname.def~$CC -Zdll -Zcrtdll -o $lib $libobjs $deplibs $compiler_flags $output_objdir/$libname.def'
+ _LT_TAGVAR(old_archive_from_new_cmds, $1)='emximp -o $output_objdir/$libname.a $output_objdir/$libname.def'
+ ;;
+
+ osf3*)
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ fi
+ _LT_TAGVAR(archive_cmds_need_lc, $1)='no'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ ;;
+
+ osf4* | osf5*) # as osf3* with the addition of -msym flag
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $pic_flag $libobjs $deplibs $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ else
+ _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $libobjs $deplibs $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done; printf "%s\\n" "-hidden">> $lib.exp~
+ $CC -shared${allow_undefined_flag} ${wl}-input ${wl}$lib.exp $compiler_flags $libobjs $deplibs -soname $soname `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~$RM $lib.exp'
+
+ # Both c and cxx compiler support -rpath directly
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+ fi
+ _LT_TAGVAR(archive_cmds_need_lc, $1)='no'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ ;;
+
+ solaris*)
+ _LT_TAGVAR(no_undefined_flag, $1)=' -z defs'
+ if test "$GCC" = yes; then
+ wlarc='${wl}'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -shared $pic_flag ${wl}-z ${wl}text ${wl}-M ${wl}$lib.exp ${wl}-h ${wl}$soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+ else
+ case `$CC -V 2>&1` in
+ *"Compilers 5.0"*)
+ wlarc=''
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $LD -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $linker_flags~$RM $lib.exp'
+ ;;
+ *)
+ wlarc='${wl}'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G${allow_undefined_flag} -M $lib.exp -h $soname -o $lib $libobjs $deplibs $compiler_flags~$RM $lib.exp'
+ ;;
+ esac
+ fi
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ case $host_os in
+ solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+ *)
+ # The compiler driver will combine and reorder linker options,
+ # but understands `-z linker_flag'. GCC discards it without `$wl',
+ # but is careful enough not to reorder.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+ else
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract'
+ fi
+ ;;
+ esac
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+
+ sunos4*)
+ if test "x$host_vendor" = xsequent; then
+ # Use $CC to link under sequent, because it throws in some extra .o
+ # files that make .init and .fini sections work.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h $soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$LD -assert pure-text -Bstatic -o $lib $libobjs $deplibs $linker_flags'
+ fi
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ sysv4)
+ case $host_vendor in
+ sni)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_direct, $1)=yes # is this really true???
+ ;;
+ siemens)
+ ## LD is ld it makes a PLAMLIB
+ ## CC just makes a GrossModule.
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(reload_cmds, $1)='$CC -r -o $output$reload_objs'
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ ;;
+ motorola)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_direct, $1)=no #Motorola manual says yes, but my tests say they lie
+ ;;
+ esac
+ runpath_var='LD_RUN_PATH'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ sysv4.3*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='-Bexport'
+ ;;
+
+ sysv4*MP*)
+ if test -d /usr/nec; then
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ runpath_var=LD_RUN_PATH
+ hardcode_runpath_var=yes
+ _LT_TAGVAR(ld_shlibs, $1)=yes
+ fi
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*)
+ _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs'
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R,$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ if test "$GCC" = yes; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ fi
+ ;;
+
+ uts4*)
+ _LT_TAGVAR(archive_cmds, $1)='$LD -G -h $soname -o $lib $libobjs $deplibs $linker_flags'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+
+ *)
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+
+ if test x$host_vendor = xsni; then
+ case $host in
+ sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*)
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Blargedynsym'
+ ;;
+ esac
+ fi
+ fi
+])
+AC_MSG_RESULT([$_LT_TAGVAR(ld_shlibs, $1)])
+test "$_LT_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no
+
+_LT_TAGVAR(with_gnu_ld, $1)=$with_gnu_ld
+
+_LT_DECL([], [libext], [0], [Old archive suffix (normally "a")])dnl
+_LT_DECL([], [shrext_cmds], [1], [Shared library suffix (normally ".so")])dnl
+_LT_DECL([], [extract_expsyms_cmds], [2],
+ [The commands to extract the exported symbol list from a shared archive])
+
+#
+# Do we need to explicitly link libc?
+#
+case "x$_LT_TAGVAR(archive_cmds_need_lc, $1)" in
+x|xyes)
+ # Assume -lc should be added
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+
+ if test "$enable_shared" = yes && test "$GCC" = yes; then
+ case $_LT_TAGVAR(archive_cmds, $1) in
+ *'~'*)
+ # FIXME: we may have to deal with multi-command sequences.
+ ;;
+ '$CC '*)
+ # Test whether the compiler implicitly links with -lc since on some
+ # systems, -lgcc has to come before -lc. If gcc already passes -lc
+ # to ld, don't add -lc before -lgcc.
+ AC_CACHE_CHECK([whether -lc should be explicitly linked in],
+ [lt_cv_]_LT_TAGVAR(archive_cmds_need_lc, $1),
+ [$RM conftest*
+ echo "$lt_simple_compile_test_code" > conftest.$ac_ext
+
+ if AC_TRY_EVAL(ac_compile) 2>conftest.err; then
+ soname=conftest
+ lib=conftest
+ libobjs=conftest.$ac_objext
+ deplibs=
+ wl=$_LT_TAGVAR(lt_prog_compiler_wl, $1)
+ pic_flag=$_LT_TAGVAR(lt_prog_compiler_pic, $1)
+ compiler_flags=-v
+ linker_flags=-v
+ verstring=
+ output_objdir=.
+ libname=conftest
+ lt_save_allow_undefined_flag=$_LT_TAGVAR(allow_undefined_flag, $1)
+ _LT_TAGVAR(allow_undefined_flag, $1)=
+ if AC_TRY_EVAL(_LT_TAGVAR(archive_cmds, $1) 2\>\&1 \| $GREP \" -lc \" \>/dev/null 2\>\&1)
+ then
+ lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ else
+ lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+ fi
+ _LT_TAGVAR(allow_undefined_flag, $1)=$lt_save_allow_undefined_flag
+ else
+ cat conftest.err 1>&5
+ fi
+ $RM conftest*
+ ])
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=$lt_cv_[]_LT_TAGVAR(archive_cmds_need_lc, $1)
+ ;;
+ esac
+ fi
+ ;;
+esac
+
+_LT_TAGDECL([build_libtool_need_lc], [archive_cmds_need_lc], [0],
+ [Whether or not to add -lc for building shared libraries])
+_LT_TAGDECL([allow_libtool_libs_with_static_runtimes],
+ [enable_shared_with_static_runtimes], [0],
+ [Whether or not to disallow shared libs when runtime libs are static])
+_LT_TAGDECL([], [export_dynamic_flag_spec], [1],
+ [Compiler flag to allow reflexive dlopens])
+_LT_TAGDECL([], [whole_archive_flag_spec], [1],
+ [Compiler flag to generate shared objects directly from archives])
+_LT_TAGDECL([], [compiler_needs_object], [1],
+ [Whether the compiler copes with passing no objects directly])
+_LT_TAGDECL([], [old_archive_from_new_cmds], [2],
+ [Create an old-style archive from a shared archive])
+_LT_TAGDECL([], [old_archive_from_expsyms_cmds], [2],
+ [Create a temporary old-style archive to link instead of a shared archive])
+_LT_TAGDECL([], [archive_cmds], [2], [Commands used to build a shared archive])
+_LT_TAGDECL([], [archive_expsym_cmds], [2])
+_LT_TAGDECL([], [module_cmds], [2],
+ [Commands used to build a loadable module if different from building
+ a shared archive.])
+_LT_TAGDECL([], [module_expsym_cmds], [2])
+_LT_TAGDECL([], [with_gnu_ld], [1],
+ [Whether we are building with GNU ld or not])
+_LT_TAGDECL([], [allow_undefined_flag], [1],
+ [Flag that allows shared libraries with undefined symbols to be built])
+_LT_TAGDECL([], [no_undefined_flag], [1],
+ [Flag that enforces no undefined symbols])
+_LT_TAGDECL([], [hardcode_libdir_flag_spec], [1],
+ [Flag to hardcode $libdir into a binary during linking.
+ This must work even if $libdir does not exist])
+_LT_TAGDECL([], [hardcode_libdir_separator], [1],
+ [Whether we need a single "-rpath" flag with a separated argument])
+_LT_TAGDECL([], [hardcode_direct], [0],
+ [Set to "yes" if using DIR/libNAME${shared_ext} during linking hardcodes
+ DIR into the resulting binary])
+_LT_TAGDECL([], [hardcode_direct_absolute], [0],
+ [Set to "yes" if using DIR/libNAME${shared_ext} during linking hardcodes
+ DIR into the resulting binary and the resulting library dependency is
+ "absolute", i.e impossible to change by setting ${shlibpath_var} if the
+ library is relocated])
+_LT_TAGDECL([], [hardcode_minus_L], [0],
+ [Set to "yes" if using the -LDIR flag during linking hardcodes DIR
+ into the resulting binary])
+_LT_TAGDECL([], [hardcode_shlibpath_var], [0],
+ [Set to "yes" if using SHLIBPATH_VAR=DIR during linking hardcodes DIR
+ into the resulting binary])
+_LT_TAGDECL([], [hardcode_automatic], [0],
+ [Set to "yes" if building a shared library automatically hardcodes DIR
+ into the library and all subsequent libraries and executables linked
+ against it])
+_LT_TAGDECL([], [inherit_rpath], [0],
+ [Set to yes if linker adds runtime paths of dependent libraries
+ to runtime path list])
+_LT_TAGDECL([], [link_all_deplibs], [0],
+ [Whether libtool must link a program against all its dependency libraries])
+_LT_TAGDECL([], [always_export_symbols], [0],
+ [Set to "yes" if exported symbols are required])
+_LT_TAGDECL([], [export_symbols_cmds], [2],
+ [The commands to list exported symbols])
+_LT_TAGDECL([], [exclude_expsyms], [1],
+ [Symbols that should not be listed in the preloaded symbols])
+_LT_TAGDECL([], [include_expsyms], [1],
+ [Symbols that must always be exported])
+_LT_TAGDECL([], [prelink_cmds], [2],
+ [Commands necessary for linking programs (against libraries) with templates])
+_LT_TAGDECL([], [postlink_cmds], [2],
+ [Commands necessary for finishing linking programs])
+_LT_TAGDECL([], [file_list_spec], [1],
+ [Specify filename containing input files])
+dnl FIXME: Not yet implemented
+dnl _LT_TAGDECL([], [thread_safe_flag_spec], [1],
+dnl [Compiler flag to generate thread safe objects])
+])# _LT_LINKER_SHLIBS
+
+
+# _LT_LANG_C_CONFIG([TAG])
+# ------------------------
+# Ensure that the configuration variables for a C compiler are suitably
+# defined. These variables are subsequently used by _LT_CONFIG to write
+# the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_C_CONFIG],
+[m4_require([_LT_DECL_EGREP])dnl
+lt_save_CC="$CC"
+AC_LANG_PUSH(C)
+
+# Source file extension for C test sources.
+ac_ext=c
+
+# Object file extension for compiled C test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="int some_variable = 0;"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='int main(){return(0);}'
+
+_LT_TAG_COMPILER
+# Save the default compiler, since it gets overwritten when the other
+# tags are being tested, and _LT_TAGVAR(compiler, []) is a NOP.
+compiler_DEFAULT=$CC
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+## CAVEAT EMPTOR:
+## There is no encapsulation within the following macros, do not change
+## the running order or otherwise move them around unless you know exactly
+## what you are doing...
+if test -n "$compiler"; then
+ _LT_COMPILER_NO_RTTI($1)
+ _LT_COMPILER_PIC($1)
+ _LT_COMPILER_C_O($1)
+ _LT_COMPILER_FILE_LOCKS($1)
+ _LT_LINKER_SHLIBS($1)
+ _LT_SYS_DYNAMIC_LINKER($1)
+ _LT_LINKER_HARDCODE_LIBPATH($1)
+ LT_SYS_DLOPEN_SELF
+ _LT_CMD_STRIPLIB
+
+ # Report which library types will actually be built
+ AC_MSG_CHECKING([if libtool supports shared libraries])
+ AC_MSG_RESULT([$can_build_shared])
+
+ AC_MSG_CHECKING([whether to build shared libraries])
+ test "$can_build_shared" = "no" && enable_shared=no
+
+ # On AIX, shared libraries and static libraries use the same namespace, and
+ # are all built from PIC.
+ case $host_os in
+ aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+
+ aix[[4-9]]*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+ esac
+ AC_MSG_RESULT([$enable_shared])
+
+ AC_MSG_CHECKING([whether to build static libraries])
+ # Make sure either enable_shared or enable_static is yes.
+ test "$enable_shared" = yes || enable_static=yes
+ AC_MSG_RESULT([$enable_static])
+
+ _LT_CONFIG($1)
+fi
+AC_LANG_POP
+CC="$lt_save_CC"
+])# _LT_LANG_C_CONFIG
+
+
+# _LT_LANG_CXX_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for a C++ compiler are suitably
+# defined. These variables are subsequently used by _LT_CONFIG to write
+# the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_CXX_CONFIG],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+m4_require([_LT_DECL_EGREP])dnl
+m4_require([_LT_PATH_MANIFEST_TOOL])dnl
+if test -n "$CXX" && ( test "X$CXX" != "Xno" &&
+ ( (test "X$CXX" = "Xg++" && `g++ -v >/dev/null 2>&1` ) ||
+ (test "X$CXX" != "Xg++"))) ; then
+ AC_PROG_CXXCPP
+else
+ _lt_caught_CXX_error=yes
+fi
+
+AC_LANG_PUSH(C++)
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_TAGVAR(allow_undefined_flag, $1)=
+_LT_TAGVAR(always_export_symbols, $1)=no
+_LT_TAGVAR(archive_expsym_cmds, $1)=
+_LT_TAGVAR(compiler_needs_object, $1)=no
+_LT_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_TAGVAR(hardcode_direct, $1)=no
+_LT_TAGVAR(hardcode_direct_absolute, $1)=no
+_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_TAGVAR(hardcode_minus_L, $1)=no
+_LT_TAGVAR(hardcode_shlibpath_var, $1)=unsupported
+_LT_TAGVAR(hardcode_automatic, $1)=no
+_LT_TAGVAR(inherit_rpath, $1)=no
+_LT_TAGVAR(module_cmds, $1)=
+_LT_TAGVAR(module_expsym_cmds, $1)=
+_LT_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+_LT_TAGVAR(no_undefined_flag, $1)=
+_LT_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for C++ test sources.
+ac_ext=cpp
+
+# Object file extension for compiled C++ test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# No sense in running all these tests if we already determined that
+# the CXX compiler isn't working. Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_caught_CXX_error" != yes; then
+ # Code to be used in simple compile tests
+ lt_simple_compile_test_code="int some_variable = 0;"
+
+ # Code to be used in simple link tests
+ lt_simple_link_test_code='int main(int, char *[[]]) { return(0); }'
+
+ # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+ _LT_TAG_COMPILER
+
+ # save warnings/boilerplate of simple test code
+ _LT_COMPILER_BOILERPLATE
+ _LT_LINKER_BOILERPLATE
+
+ # Allow CC to be a program name with arguments.
+ lt_save_CC=$CC
+ lt_save_CFLAGS=$CFLAGS
+ lt_save_LD=$LD
+ lt_save_GCC=$GCC
+ GCC=$GXX
+ lt_save_with_gnu_ld=$with_gnu_ld
+ lt_save_path_LD=$lt_cv_path_LD
+ if test -n "${lt_cv_prog_gnu_ldcxx+set}"; then
+ lt_cv_prog_gnu_ld=$lt_cv_prog_gnu_ldcxx
+ else
+ $as_unset lt_cv_prog_gnu_ld
+ fi
+ if test -n "${lt_cv_path_LDCXX+set}"; then
+ lt_cv_path_LD=$lt_cv_path_LDCXX
+ else
+ $as_unset lt_cv_path_LD
+ fi
+ test -z "${LDCXX+set}" || LD=$LDCXX
+ CC=${CXX-"c++"}
+ CFLAGS=$CXXFLAGS
+ compiler=$CC
+ _LT_TAGVAR(compiler, $1)=$CC
+ _LT_CC_BASENAME([$compiler])
+
+ if test -n "$compiler"; then
+ # We don't want -fno-exception when compiling C++ code, so set the
+ # no_builtin_flag separately
+ if test "$GXX" = yes; then
+ _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=' -fno-builtin'
+ else
+ _LT_TAGVAR(lt_prog_compiler_no_builtin_flag, $1)=
+ fi
+
+ if test "$GXX" = yes; then
+ # Set up default GNU C++ configuration
+
+ LT_PATH_LD
+
+ # Check if GNU C++ uses GNU ld as the underlying linker, since the
+ # archiving commands below assume that GNU ld is being used.
+ if test "$with_gnu_ld" = yes; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC $pic_flag -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+
+ # If archive_cmds runs LD, not CC, wlarc should be empty
+ # XXX I think wlarc can be eliminated in ltcf-cxx, but I need to
+ # investigate it a little bit more. (MM)
+ wlarc='${wl}'
+
+ # ancient GNU ld didn't support --whole-archive et. al.
+ if eval "`$CC -print-prog-name=ld` --help 2>&1" |
+ $GREP 'no-whole-archive' > /dev/null; then
+ _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ else
+ _LT_TAGVAR(whole_archive_flag_spec, $1)=
+ fi
+ else
+ with_gnu_ld=no
+ wlarc=
+
+ # A generic and very simple default shared library creation
+ # command for GNU C++ for the case where it uses the native
+ # linker, instead of GNU ld. If possible, this setting should
+ # overridden to take advantage of the native linker features on
+ # the platform it is being used on.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ fi
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+
+ else
+ GXX=no
+ with_gnu_ld=no
+ wlarc=
+ fi
+
+ # PORTME: fill in a description of your system's C++ link characteristics
+ AC_MSG_CHECKING([whether the $compiler linker ($LD) supports shared libraries])
+ _LT_TAGVAR(ld_shlibs, $1)=yes
+ case $host_os in
+ aix3*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ aix[[4-9]]*)
+ if test "$host_cpu" = ia64; then
+ # On IA64, the linker does run time linking by default, so we don't
+ # have to do anything special.
+ aix_use_runtimelinking=no
+ exp_sym_flag='-Bexport'
+ no_entry_flag=""
+ else
+ aix_use_runtimelinking=no
+
+ # Test if we are trying to use run time linking or normal
+ # AIX style linking. If -brtl is somewhere in LDFLAGS, we
+ # need to do runtime linking.
+ case $host_os in aix4.[[23]]|aix4.[[23]].*|aix[[5-9]]*)
+ for ld_flag in $LDFLAGS; do
+ case $ld_flag in
+ *-brtl*)
+ aix_use_runtimelinking=yes
+ break
+ ;;
+ esac
+ done
+ ;;
+ esac
+
+ exp_sym_flag='-bexport'
+ no_entry_flag='-bnoentry'
+ fi
+
+ # When large executables or shared objects are built, AIX ld can
+ # have problems creating the table of contents. If linking a library
+ # or program results in "error TOC overflow" add -mminimal-toc to
+ # CXXFLAGS/CFLAGS for g++/gcc. In the cases where that is not
+ # enough to fix the problem, add -Wl,-bbigtoc to LDFLAGS.
+
+ _LT_TAGVAR(archive_cmds, $1)=''
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_TAGVAR(file_list_spec, $1)='${wl}-f,'
+
+ if test "$GXX" = yes; then
+ case $host_os in aix4.[[012]]|aix4.[[012]].*)
+ # We only want to do this on AIX 4.2 and lower, the check
+ # below for broken collect2 doesn't work under 4.3+
+ collect2name=`${CC} -print-prog-name=collect2`
+ if test -f "$collect2name" &&
+ strings "$collect2name" | $GREP resolve_lib_name >/dev/null
+ then
+ # We have reworked collect2
+ :
+ else
+ # We have old collect2
+ _LT_TAGVAR(hardcode_direct, $1)=unsupported
+ # It fails to find uninstalled libraries when the uninstalled
+ # path is not listed in the libpath. Setting hardcode_minus_L
+ # to unsupported forces relinking
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=
+ fi
+ esac
+ shared_flag='-shared'
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag="$shared_flag "'${wl}-G'
+ fi
+ else
+ # not using gcc
+ if test "$host_cpu" = ia64; then
+ # VisualAge C++, Version 5.5 for AIX 5L for IA-64, Beta 3 Release
+ # chokes on -Wl,-G. The following line is correct:
+ shared_flag='-G'
+ else
+ if test "$aix_use_runtimelinking" = yes; then
+ shared_flag='${wl}-G'
+ else
+ shared_flag='${wl}-bM:SRE'
+ fi
+ fi
+ fi
+
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-bexpall'
+ # It seems that -bexpall does not export symbols beginning with
+ # underscore (_), so it is better to generate a list of symbols to
+ # export.
+ _LT_TAGVAR(always_export_symbols, $1)=yes
+ if test "$aix_use_runtimelinking" = yes; then
+ # Warning - without using the other runtime loading flags (-brtl),
+ # -berok will link without error, but may produce a broken library.
+ _LT_TAGVAR(allow_undefined_flag, $1)='-berok'
+ # Determine the default libpath from the value encoded in an empty
+ # executable.
+ _LT_SYS_MODULE_PATH_AIX([$1])
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags `if test "x${allow_undefined_flag}" != "x"; then func_echo_all "${wl}${allow_undefined_flag}"; else :; fi` '"\${wl}$exp_sym_flag:\$export_symbols $shared_flag"
+ else
+ if test "$host_cpu" = ia64; then
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $libdir:/usr/lib:/lib'
+ _LT_TAGVAR(allow_undefined_flag, $1)="-z nodefs"
+ _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs '"\${wl}$no_entry_flag"' $compiler_flags ${wl}${allow_undefined_flag} '"\${wl}$exp_sym_flag:\$export_symbols"
+ else
+ # Determine the default libpath from the value encoded in an
+ # empty executable.
+ _LT_SYS_MODULE_PATH_AIX([$1])
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-blibpath:$libdir:'"$aix_libpath"
+ # Warning - without using the other run time loading flags,
+ # -berok will link without error, but may produce a broken library.
+ _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-bernotok'
+ _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-berok'
+ if test "$with_gnu_ld" = yes; then
+ # We only use this code for GNU lds that support --whole-archive.
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ else
+ # Exported symbols can be pulled into shared objects from archives
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='$convenience'
+ fi
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=yes
+ # This is similar to how AIX traditionally builds its shared
+ # libraries.
+ _LT_TAGVAR(archive_expsym_cmds, $1)="\$CC $shared_flag"' -o $output_objdir/$soname $libobjs $deplibs ${wl}-bnoentry $compiler_flags ${wl}-bE:$export_symbols${allow_undefined_flag}~$AR $AR_FLAGS $output_objdir/$libname$release.a $output_objdir/$soname'
+ fi
+ fi
+ ;;
+
+ beos*)
+ if $LD --help 2>&1 | $GREP ': supported targets:.* elf' > /dev/null; then
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ # Joseph Beckenbach says some releases of gcc
+ # support --undefined. This deserves some investigation. FIXME
+ _LT_TAGVAR(archive_cmds, $1)='$CC -nostart $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ chorus*)
+ case $cc_basename in
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+
+ cygwin* | mingw* | pw32* | cegcc*)
+ case $GXX,$cc_basename in
+ ,cl* | no,cl*)
+ # Native MSVC
+ # hardcode_libdir_flag_spec is actually meaningless, as there is
+ # no search path for DLLs.
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)=' '
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_TAGVAR(always_export_symbols, $1)=yes
+ _LT_TAGVAR(file_list_spec, $1)='@'
+ # Tell ltmain to make .lib files, not .a files.
+ libext=lib
+ # Tell ltmain to make .dll files, not .so files.
+ shrext_cmds=".dll"
+ # FIXME: Setting linknames here is a bad hack.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -o $output_objdir/$soname $libobjs $compiler_flags $deplibs -Wl,-dll~linknames='
+ _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ $SED -n -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' -e '1\\\!p' < $export_symbols > $output_objdir/$soname.exp;
+ else
+ $SED -e 's/\\\\\\\(.*\\\\\\\)/-link\\\ -EXPORT:\\\\\\\1/' < $export_symbols > $output_objdir/$soname.exp;
+ fi~
+ $CC -o $tool_output_objdir$soname $libobjs $compiler_flags $deplibs "@$tool_output_objdir$soname.exp" -Wl,-DLL,-IMPLIB:"$tool_output_objdir$libname.dll.lib"~
+ linknames='
+ # The linker will not automatically build a static lib if we build a DLL.
+ # _LT_TAGVAR(old_archive_from_new_cmds, $1)='true'
+ _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+ # Don't use ranlib
+ _LT_TAGVAR(old_postinstall_cmds, $1)='chmod 644 $oldlib'
+ _LT_TAGVAR(postlink_cmds, $1)='lt_outputfile="@OUTPUT@"~
+ lt_tool_outputfile="@TOOL_OUTPUT@"~
+ case $lt_outputfile in
+ *.exe|*.EXE) ;;
+ *)
+ lt_outputfile="$lt_outputfile.exe"
+ lt_tool_outputfile="$lt_tool_outputfile.exe"
+ ;;
+ esac~
+ func_to_tool_file "$lt_outputfile"~
+ if test "$MANIFEST_TOOL" != ":" && test -f "$lt_outputfile.manifest"; then
+ $MANIFEST_TOOL -manifest "$lt_tool_outputfile.manifest" -outputresource:"$lt_tool_outputfile" || exit 1;
+ $RM "$lt_outputfile.manifest";
+ fi'
+ ;;
+ *)
+ # g++
+ # _LT_TAGVAR(hardcode_libdir_flag_spec, $1) is actually meaningless,
+ # as there is no search path for DLLs.
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-L$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-all-symbols'
+ _LT_TAGVAR(allow_undefined_flag, $1)=unsupported
+ _LT_TAGVAR(always_export_symbols, $1)=no
+ _LT_TAGVAR(enable_shared_with_static_runtimes, $1)=yes
+
+ if $LD --help 2>&1 | $GREP 'auto-import' > /dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ # If the export-symbols file already is a .def file (1st line
+ # is EXPORTS), use it as is; otherwise, prepend...
+ _LT_TAGVAR(archive_expsym_cmds, $1)='if test "x`$SED 1q $export_symbols`" = xEXPORTS; then
+ cp $export_symbols $output_objdir/$soname.def;
+ else
+ echo EXPORTS > $output_objdir/$soname.def;
+ cat $export_symbols >> $output_objdir/$soname.def;
+ fi~
+ $CC -shared -nostdlib $output_objdir/$soname.def $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $output_objdir/$soname ${wl}--enable-auto-image-base -Xlinker --out-implib -Xlinker $lib'
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+ darwin* | rhapsody*)
+ _LT_DARWIN_LINKER_FEATURES($1)
+ ;;
+
+ dgux*)
+ case $cc_basename in
+ ec++*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ ghcx*)
+ # Green Hills C++ Compiler
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+
+ freebsd2.*)
+ # C++ shared libraries reported to be fairly broken before
+ # switch to ELF
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ freebsd-elf*)
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ ;;
+
+ freebsd* | dragonfly*)
+ # FreeBSD 3 and later use GNU C++ and GNU ld with standard ELF
+ # conventions
+ _LT_TAGVAR(ld_shlibs, $1)=yes
+ ;;
+
+ gnu*)
+ ;;
+
+ haiku*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+
+ hpux9*)
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ aCC*)
+ _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -b ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $EGREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ _LT_TAGVAR(archive_cmds, $1)='$RM $output_objdir/$soname~$CC -shared -nostdlib $pic_flag ${wl}+b ${wl}$install_libdir -o $output_objdir/$soname $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~test $output_objdir/$soname = $lib || mv $output_objdir/$soname $lib'
+ else
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+
+ hpux10*|hpux11*)
+ if test $with_gnu_ld = no; then
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}+b ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ case $host_cpu in
+ hppa*64*|ia64*)
+ ;;
+ *)
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ ;;
+ esac
+ fi
+ case $host_cpu in
+ hppa*64*|ia64*)
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ ;;
+ *)
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ _LT_TAGVAR(hardcode_minus_L, $1)=yes # Not in the search PATH,
+ # but as the default
+ # location of the library.
+ ;;
+ esac
+
+ case $cc_basename in
+ CC*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ aCC*)
+ case $host_cpu in
+ hppa*64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -b ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`($CC -b $CFLAGS -v conftest.$objext 2>&1) | $GREP "\-L"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test $with_gnu_ld = no; then
+ case $host_cpu in
+ hppa*64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib -fPIC ${wl}+h ${wl}$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ ia64*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+nodefaultrpath -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib $pic_flag ${wl}+h ${wl}$soname ${wl}+b ${wl}$install_libdir -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ ;;
+ esac
+ fi
+ else
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+
+ interix[[3-9]]*)
+ _LT_TAGVAR(hardcode_direct, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ # Hack: On Interix 3.x, we cannot compile PIC because of a broken gcc.
+ # Instead, shared libraries are loaded at an image base (0x10000000 by
+ # default) and relocated if they conflict, which is a slow very memory
+ # consuming and fragmenting process. To avoid this, we pick a random,
+ # 256 KiB-aligned image base between 0x50000000 and 0x6FFC0000 at link
+ # time. Moving up from 0x10000000 also allows more sbrk(2) space.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='sed "s,^,_," $export_symbols >$output_objdir/$soname.expsym~$CC -shared $pic_flag $libobjs $deplibs $compiler_flags ${wl}-h,$soname ${wl}--retain-symbols-file,$output_objdir/$soname.expsym ${wl}--image-base,`expr ${RANDOM-$$} % 4096 / 2 \* 262144 + 1342177280` -o $lib'
+ ;;
+ irix5* | irix6*)
+ case $cc_basename in
+ CC*)
+ # SGI C++
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -all -multigot $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+
+ # Archives containing C++ object files must be created using
+ # "CC -ar", where "CC" is the IRIX C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ _LT_TAGVAR(old_archive_cmds, $1)='$CC -ar -WR,-u -o $oldlib $oldobjs'
+ ;;
+ *)
+ if test "$GXX" = yes; then
+ if test "$with_gnu_ld" = no; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ else
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` -o $lib'
+ fi
+ fi
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ ;;
+ esac
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+ _LT_TAGVAR(inherit_rpath, $1)=yes
+ ;;
+
+ linux* | k*bsd*-gnu | kopensolaris*-gnu)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ _LT_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo $lib | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib ${wl}-retain-symbols-file,$export_symbols; mv \$templib $lib'
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1 | $GREP "ld"`; rm -f libconftest$shared_ext; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+
+ # Archives containing C++ object files must be created using
+ # "CC -Bstatic", where "CC" is the KAI C++ compiler.
+ _LT_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs'
+ ;;
+ icpc* | ecpc* )
+ # Intel C++
+ with_gnu_ld=yes
+ # version 8.0 and above of icpc choke on multiply defined symbols
+ # if we add $predep_objects and $postdep_objects, however 7.1 and
+ # earlier do not add the objects themselves.
+ case `$CC -V 2>&1` in
+ *"Version 7."*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ *) # Version 8.0 or newer
+ tmp_idyn=
+ case $host_cpu in
+ ia64*) tmp_idyn=' -i_dynamic';;
+ esac
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared'"$tmp_idyn"' $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-retain-symbols-file $wl$export_symbols -o $lib'
+ ;;
+ esac
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+ ;;
+ pgCC* | pgcpp*)
+ # Portland Group C++ compiler
+ case `$CC -V` in
+ *pgCC\ [[1-5]].* | *pgcpp\ [[1-5]].*)
+ _LT_TAGVAR(prelink_cmds, $1)='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $objs $libobjs $compile_deplibs~
+ compile_command="$compile_command `find $tpldir -name \*.o | sort | $NL2SP`"'
+ _LT_TAGVAR(old_archive_cmds, $1)='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $oldobjs$old_deplibs~
+ $AR $AR_FLAGS $oldlib$oldobjs$old_deplibs `find $tpldir -name \*.o | sort | $NL2SP`~
+ $RANLIB $oldlib'
+ _LT_TAGVAR(archive_cmds, $1)='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~
+ $CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='tpldir=Template.dir~
+ rm -rf $tpldir~
+ $CC --prelink_objects --instantiation_dir $tpldir $predep_objects $libobjs $deplibs $convenience $postdep_objects~
+ $CC -shared $pic_flag $predep_objects $libobjs $deplibs `find $tpldir -name \*.o | sort | $NL2SP` $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+ ;;
+ *) # Version 6 and above use weak symbols
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname ${wl}-retain-symbols-file ${wl}$export_symbols -o $lib'
+ ;;
+ esac
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}--rpath ${wl}$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`for conv in $convenience\"\"; do test -n \"$conv\" && new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ ;;
+ cxx*)
+ # Compaq C++
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $wl$soname -o $lib ${wl}-retain-symbols-file $wl$export_symbols'
+
+ runpath_var=LD_RUN_PATH
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld .*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "X$list" | $Xsed'
+ ;;
+ xl* | mpixl* | bgxl*)
+ # IBM XL 8.0 on PPC, with GNU ld
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}--export-dynamic'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname -o $lib'
+ if test "x$supports_anon_versioning" = xyes; then
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $output_objdir/$libname.ver~
+ cat $export_symbols | sed -e "s/\(.*\)/\1;/" >> $output_objdir/$libname.ver~
+ echo "local: *; };" >> $output_objdir/$libname.ver~
+ $CC -qmkshrobj $libobjs $deplibs $compiler_flags ${wl}-soname $wl$soname ${wl}-version-script ${wl}$output_objdir/$libname.ver -o $lib'
+ fi
+ ;;
+ *)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ # Sun C++ 5.9
+ _LT_TAGVAR(no_undefined_flag, $1)=' -zdefs'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file ${wl}$export_symbols'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}--whole-archive`new_convenience=; for conv in $convenience\"\"; do test -z \"$conv\" || new_convenience=\"$new_convenience,$conv\"; done; func_echo_all \"$new_convenience\"` ${wl}--no-whole-archive'
+ _LT_TAGVAR(compiler_needs_object, $1)=yes
+
+ # Not sure whether something based on
+ # $CC $CFLAGS -v conftest.$objext -o libconftest$shared_ext 2>&1
+ # would be better.
+ output_verbose_link_cmd='func_echo_all'
+
+ # Archives containing C++ object files must be created using
+ # "CC -xar", where "CC" is the Sun C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ _LT_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs'
+ ;;
+ esac
+ ;;
+ esac
+ ;;
+
+ lynxos*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ m88k*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ mvs*)
+ case $cc_basename in
+ cxx*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+
+ netbsd*)
+ if echo __ELF__ | $CC -E - | $GREP __ELF__ >/dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$LD -Bshareable -o $lib $predep_objects $libobjs $deplibs $postdep_objects $linker_flags'
+ wlarc=
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ fi
+ # Workaround some broken pre-1.5 toolchains
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP conftest.$objext | $SED -e "s:-lgcc -lc -lgcc::"'
+ ;;
+
+ *nto* | *qnx*)
+ _LT_TAGVAR(ld_shlibs, $1)=yes
+ ;;
+
+ openbsd2*)
+ # C++ shared libraries are fairly broken
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ openbsd*)
+ if test -f /usr/libexec/ld.so; then
+ _LT_TAGVAR(hardcode_direct, $1)=yes
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(hardcode_direct_absolute, $1)=yes
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -o $lib'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ if test -z "`echo __ELF__ | $CC -E - | grep __ELF__`" || test "$host_os-$host_cpu" = "openbsd2.8-powerpc"; then
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared $pic_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-retain-symbols-file,$export_symbols -o $lib'
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-E'
+ _LT_TAGVAR(whole_archive_flag_spec, $1)="$wlarc"'--whole-archive$convenience '"$wlarc"'--no-whole-archive'
+ fi
+ output_verbose_link_cmd=func_echo_all
+ else
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+
+ osf3* | osf4* | osf5*)
+ case $cc_basename in
+ KCC*)
+ # Kuck and Associates, Inc. (KAI) C++ Compiler
+
+ # KCC will only create a shared library if the output file
+ # ends with ".so" (or ".sl" for HP-UX), so rename the library
+ # to its proper name (with version) after linking.
+ _LT_TAGVAR(archive_cmds, $1)='tempext=`echo $shared_ext | $SED -e '\''s/\([[^()0-9A-Za-z{}]]\)/\\\\\1/g'\''`; templib=`echo "$lib" | $SED -e "s/\${tempext}\..*/.so/"`; $CC $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags --soname $soname -o \$templib; mv \$templib $lib'
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath,$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Archives containing C++ object files must be created using
+ # the KAI C++ compiler.
+ case $host in
+ osf3*) _LT_TAGVAR(old_archive_cmds, $1)='$CC -Bstatic -o $oldlib $oldobjs' ;;
+ *) _LT_TAGVAR(old_archive_cmds, $1)='$CC -o $oldlib $oldobjs' ;;
+ esac
+ ;;
+ RCC*)
+ # Rational C++ 2.4.1
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ cxx*)
+ case $host in
+ osf3*)
+ _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname $soname `test -n "$verstring" && func_echo_all "${wl}-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ ;;
+ *)
+ _LT_TAGVAR(allow_undefined_flag, $1)=' -expect_unresolved \*'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname `test -n "$verstring" && func_echo_all "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='for i in `cat $export_symbols`; do printf "%s %s\\n" -exported_symbol "\$i" >> $lib.exp; done~
+ echo "-hidden">> $lib.exp~
+ $CC -shared$allow_undefined_flag $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags -msym -soname $soname ${wl}-input ${wl}$lib.exp `test -n "$verstring" && $ECHO "-set_version $verstring"` -update_registry ${output_objdir}/so_locations -o $lib~
+ $RM $lib.exp'
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-rpath $libdir'
+ ;;
+ esac
+
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ #
+ # There doesn't appear to be a way to prevent this compiler from
+ # explicitly linking system object files so we need to strip them
+ # from the output so that they don't get included in the library
+ # dependencies.
+ output_verbose_link_cmd='templist=`$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP "ld" | $GREP -v "ld:"`; templist=`func_echo_all "$templist" | $SED "s/\(^.*ld.*\)\( .*ld.*$\)/\1/"`; list=""; for z in $templist; do case $z in conftest.$objext) list="$list $z";; *.$objext);; *) list="$list $z";;esac; done; func_echo_all "$list"'
+ ;;
+ *)
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ _LT_TAGVAR(allow_undefined_flag, $1)=' ${wl}-expect_unresolved ${wl}\*'
+ case $host in
+ osf3*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib ${allow_undefined_flag} $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-msym ${wl}-soname ${wl}$soname `test -n "$verstring" && func_echo_all "${wl}-set_version ${wl}$verstring"` ${wl}-update_registry ${wl}${output_objdir}/so_locations -o $lib'
+ ;;
+ esac
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-rpath ${wl}$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=:
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+
+ else
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ fi
+ ;;
+ esac
+ ;;
+
+ psos*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ sunos4*)
+ case $cc_basename in
+ CC*)
+ # Sun C++ 4.x
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ lcc*)
+ # Lucid
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+
+ solaris*)
+ case $cc_basename in
+ CC* | sunCC*)
+ # Sun C++ 4.2, 5.x and Centerline C++
+ _LT_TAGVAR(archive_cmds_need_lc,$1)=yes
+ _LT_TAGVAR(no_undefined_flag, $1)=' -zdefs'
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G${allow_undefined_flag} -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G${allow_undefined_flag} ${wl}-M ${wl}$lib.exp -h$soname -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='-R$libdir'
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ case $host_os in
+ solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+ *)
+ # The compiler driver will combine and reorder linker options,
+ # but understands `-z linker_flag'.
+ # Supported since Solaris 2.6 (maybe 2.5.1?)
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='-z allextract$convenience -z defaultextract'
+ ;;
+ esac
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+
+ output_verbose_link_cmd='func_echo_all'
+
+ # Archives containing C++ object files must be created using
+ # "CC -xar", where "CC" is the Sun C++ compiler. This is
+ # necessary to make sure instantiated templates are included
+ # in the archive.
+ _LT_TAGVAR(old_archive_cmds, $1)='$CC -xar -o $oldlib $oldobjs'
+ ;;
+ gcx*)
+ # Green Hills C++ Compiler
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+
+ # The C++ compiler must be used to create the archive.
+ _LT_TAGVAR(old_archive_cmds, $1)='$CC $LDFLAGS -archive -o $oldlib $oldobjs'
+ ;;
+ *)
+ # GNU C++ compiler with Solaris linker
+ if test "$GXX" = yes && test "$with_gnu_ld" = no; then
+ _LT_TAGVAR(no_undefined_flag, $1)=' ${wl}-z ${wl}defs'
+ if $CC --version | $GREP -v '^2\.7' > /dev/null; then
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared $pic_flag -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -shared $pic_flag -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -shared $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+ else
+ # g++ 2.7 appears to require `-G' NOT `-shared' on this
+ # platform.
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G -nostdlib $LDFLAGS $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags ${wl}-h $wl$soname -o $lib'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='echo "{ global:" > $lib.exp~cat $export_symbols | $SED -e "s/\(.*\)/\1;/" >> $lib.exp~echo "local: *; };" >> $lib.exp~
+ $CC -G -nostdlib ${wl}-M $wl$lib.exp -o $lib $predep_objects $libobjs $deplibs $postdep_objects $compiler_flags~$RM $lib.exp'
+
+ # Commands to make compiler produce verbose output that lists
+ # what "hidden" libraries, object files and flags are used when
+ # linking a shared library.
+ output_verbose_link_cmd='$CC -G $CFLAGS -v conftest.$objext 2>&1 | $GREP -v "^Configured with:" | $GREP "\-L"'
+ fi
+
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R $wl$libdir'
+ case $host_os in
+ solaris2.[[0-5]] | solaris2.[[0-5]].*) ;;
+ *)
+ _LT_TAGVAR(whole_archive_flag_spec, $1)='${wl}-z ${wl}allextract$convenience ${wl}-z ${wl}defaultextract'
+ ;;
+ esac
+ fi
+ ;;
+ esac
+ ;;
+
+ sysv4*uw2* | sysv5OpenUNIX* | sysv5UnixWare7.[[01]].[[10]]* | unixware7* | sco3.2v5.0.[[024]]*)
+ _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+
+ sysv5* | sco3.2v5* | sco5v6*)
+ # Note: We can NOT use -z defs as we might desire, because we do not
+ # link with -lc, and that would cause any symbols used from libc to
+ # always be unresolved, which means just about no library would
+ # ever link correctly. If we're not using GNU ld we use -z text
+ # though, which does catch some bad symbols but isn't as heavy-handed
+ # as -z defs.
+ _LT_TAGVAR(no_undefined_flag, $1)='${wl}-z,text'
+ _LT_TAGVAR(allow_undefined_flag, $1)='${wl}-z,nodefs'
+ _LT_TAGVAR(archive_cmds_need_lc, $1)=no
+ _LT_TAGVAR(hardcode_shlibpath_var, $1)=no
+ _LT_TAGVAR(hardcode_libdir_flag_spec, $1)='${wl}-R,$libdir'
+ _LT_TAGVAR(hardcode_libdir_separator, $1)=':'
+ _LT_TAGVAR(link_all_deplibs, $1)=yes
+ _LT_TAGVAR(export_dynamic_flag_spec, $1)='${wl}-Bexport'
+ runpath_var='LD_RUN_PATH'
+
+ case $cc_basename in
+ CC*)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -G ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -G ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(old_archive_cmds, $1)='$CC -Tprelink_objects $oldobjs~
+ '"$_LT_TAGVAR(old_archive_cmds, $1)"
+ _LT_TAGVAR(reload_cmds, $1)='$CC -Tprelink_objects $reload_objs~
+ '"$_LT_TAGVAR(reload_cmds, $1)"
+ ;;
+ *)
+ _LT_TAGVAR(archive_cmds, $1)='$CC -shared ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ _LT_TAGVAR(archive_expsym_cmds, $1)='$CC -shared ${wl}-Bexport:$export_symbols ${wl}-h,$soname -o $lib $libobjs $deplibs $compiler_flags'
+ ;;
+ esac
+ ;;
+
+ tandem*)
+ case $cc_basename in
+ NCC*)
+ # NonStop-UX NCC 3.20
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+ ;;
+
+ vxworks*)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+
+ *)
+ # FIXME: insert proper C++ library support
+ _LT_TAGVAR(ld_shlibs, $1)=no
+ ;;
+ esac
+
+ AC_MSG_RESULT([$_LT_TAGVAR(ld_shlibs, $1)])
+ test "$_LT_TAGVAR(ld_shlibs, $1)" = no && can_build_shared=no
+
+ _LT_TAGVAR(GCC, $1)="$GXX"
+ _LT_TAGVAR(LD, $1)="$LD"
+
+ ## CAVEAT EMPTOR:
+ ## There is no encapsulation within the following macros, do not change
+ ## the running order or otherwise move them around unless you know exactly
+ ## what you are doing...
+ _LT_SYS_HIDDEN_LIBDEPS($1)
+ _LT_COMPILER_PIC($1)
+ _LT_COMPILER_C_O($1)
+ _LT_COMPILER_FILE_LOCKS($1)
+ _LT_LINKER_SHLIBS($1)
+ _LT_SYS_DYNAMIC_LINKER($1)
+ _LT_LINKER_HARDCODE_LIBPATH($1)
+
+ _LT_CONFIG($1)
+ fi # test -n "$compiler"
+
+ CC=$lt_save_CC
+ CFLAGS=$lt_save_CFLAGS
+ LDCXX=$LD
+ LD=$lt_save_LD
+ GCC=$lt_save_GCC
+ with_gnu_ld=$lt_save_with_gnu_ld
+ lt_cv_path_LDCXX=$lt_cv_path_LD
+ lt_cv_path_LD=$lt_save_path_LD
+ lt_cv_prog_gnu_ldcxx=$lt_cv_prog_gnu_ld
+ lt_cv_prog_gnu_ld=$lt_save_with_gnu_ld
+fi # test "$_lt_caught_CXX_error" != yes
+
+AC_LANG_POP
+])# _LT_LANG_CXX_CONFIG
+
+
+# _LT_FUNC_STRIPNAME_CNF
+# ----------------------
+# func_stripname_cnf prefix suffix name
+# strip PREFIX and SUFFIX off of NAME.
+# PREFIX and SUFFIX must not contain globbing or regex special
+# characters, hashes, percent signs, but SUFFIX may contain a leading
+# dot (in which case that matches only a dot).
+#
+# This function is identical to the (non-XSI) version of func_stripname,
+# except this one can be used by m4 code that may be executed by configure,
+# rather than the libtool script.
+m4_defun([_LT_FUNC_STRIPNAME_CNF],[dnl
+AC_REQUIRE([_LT_DECL_SED])
+AC_REQUIRE([_LT_PROG_ECHO_BACKSLASH])
+func_stripname_cnf ()
+{
+ case ${2} in
+ .*) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%\\\\${2}\$%%"`;;
+ *) func_stripname_result=`$ECHO "${3}" | $SED "s%^${1}%%; s%${2}\$%%"`;;
+ esac
+} # func_stripname_cnf
+])# _LT_FUNC_STRIPNAME_CNF
+
+# _LT_SYS_HIDDEN_LIBDEPS([TAGNAME])
+# ---------------------------------
+# Figure out "hidden" library dependencies from verbose
+# compiler output when linking a shared library.
+# Parse the compiler output and extract the necessary
+# objects, libraries and library flags.
+m4_defun([_LT_SYS_HIDDEN_LIBDEPS],
+[m4_require([_LT_FILEUTILS_DEFAULTS])dnl
+AC_REQUIRE([_LT_FUNC_STRIPNAME_CNF])dnl
+# Dependencies to place before and after the object being linked:
+_LT_TAGVAR(predep_objects, $1)=
+_LT_TAGVAR(postdep_objects, $1)=
+_LT_TAGVAR(predeps, $1)=
+_LT_TAGVAR(postdeps, $1)=
+_LT_TAGVAR(compiler_lib_search_path, $1)=
+
+dnl we can't use the lt_simple_compile_test_code here,
+dnl because it contains code intended for an executable,
+dnl not a library. It's possible we should let each
+dnl tag define a new lt_????_link_test_code variable,
+dnl but it's only used here...
+m4_if([$1], [], [cat > conftest.$ac_ext <<_LT_EOF
+int a;
+void foo (void) { a = 0; }
+_LT_EOF
+], [$1], [CXX], [cat > conftest.$ac_ext <<_LT_EOF
+class Foo
+{
+public:
+ Foo (void) { a = 0; }
+private:
+ int a;
+};
+_LT_EOF
+], [$1], [F77], [cat > conftest.$ac_ext <<_LT_EOF
+ subroutine foo
+ implicit none
+ integer*4 a
+ a=0
+ return
+ end
+_LT_EOF
+], [$1], [FC], [cat > conftest.$ac_ext <<_LT_EOF
+ subroutine foo
+ implicit none
+ integer a
+ a=0
+ return
+ end
+_LT_EOF
+], [$1], [GCJ], [cat > conftest.$ac_ext <<_LT_EOF
+public class foo {
+ private int a;
+ public void bar (void) {
+ a = 0;
+ }
+};
+_LT_EOF
+], [$1], [GO], [cat > conftest.$ac_ext <<_LT_EOF
+package foo
+func foo() {
+}
+_LT_EOF
+])
+
+_lt_libdeps_save_CFLAGS=$CFLAGS
+case "$CC $CFLAGS " in #(
+*\ -flto*\ *) CFLAGS="$CFLAGS -fno-lto" ;;
+*\ -fwhopr*\ *) CFLAGS="$CFLAGS -fno-whopr" ;;
+*\ -fuse-linker-plugin*\ *) CFLAGS="$CFLAGS -fno-use-linker-plugin" ;;
+esac
+
+dnl Parse the compiler output and extract the necessary
+dnl objects, libraries and library flags.
+if AC_TRY_EVAL(ac_compile); then
+ # Parse the compiler output and extract the necessary
+ # objects, libraries and library flags.
+
+ # Sentinel used to keep track of whether or not we are before
+ # the conftest object file.
+ pre_test_object_deps_done=no
+
+ for p in `eval "$output_verbose_link_cmd"`; do
+ case ${prev}${p} in
+
+ -L* | -R* | -l*)
+ # Some compilers place space between "-{L,R}" and the path.
+ # Remove the space.
+ if test $p = "-L" ||
+ test $p = "-R"; then
+ prev=$p
+ continue
+ fi
+
+ # Expand the sysroot to ease extracting the directories later.
+ if test -z "$prev"; then
+ case $p in
+ -L*) func_stripname_cnf '-L' '' "$p"; prev=-L; p=$func_stripname_result ;;
+ -R*) func_stripname_cnf '-R' '' "$p"; prev=-R; p=$func_stripname_result ;;
+ -l*) func_stripname_cnf '-l' '' "$p"; prev=-l; p=$func_stripname_result ;;
+ esac
+ fi
+ case $p in
+ =*) func_stripname_cnf '=' '' "$p"; p=$lt_sysroot$func_stripname_result ;;
+ esac
+ if test "$pre_test_object_deps_done" = no; then
+ case ${prev} in
+ -L | -R)
+ # Internal compiler library paths should come after those
+ # provided the user. The postdeps already come after the
+ # user supplied libs so there is no need to process them.
+ if test -z "$_LT_TAGVAR(compiler_lib_search_path, $1)"; then
+ _LT_TAGVAR(compiler_lib_search_path, $1)="${prev}${p}"
+ else
+ _LT_TAGVAR(compiler_lib_search_path, $1)="${_LT_TAGVAR(compiler_lib_search_path, $1)} ${prev}${p}"
+ fi
+ ;;
+ # The "-l" case would never come before the object being
+ # linked, so don't bother handling this case.
+ esac
+ else
+ if test -z "$_LT_TAGVAR(postdeps, $1)"; then
+ _LT_TAGVAR(postdeps, $1)="${prev}${p}"
+ else
+ _LT_TAGVAR(postdeps, $1)="${_LT_TAGVAR(postdeps, $1)} ${prev}${p}"
+ fi
+ fi
+ prev=
+ ;;
+
+ *.lto.$objext) ;; # Ignore GCC LTO objects
+ *.$objext)
+ # This assumes that the test object file only shows up
+ # once in the compiler output.
+ if test "$p" = "conftest.$objext"; then
+ pre_test_object_deps_done=yes
+ continue
+ fi
+
+ if test "$pre_test_object_deps_done" = no; then
+ if test -z "$_LT_TAGVAR(predep_objects, $1)"; then
+ _LT_TAGVAR(predep_objects, $1)="$p"
+ else
+ _LT_TAGVAR(predep_objects, $1)="$_LT_TAGVAR(predep_objects, $1) $p"
+ fi
+ else
+ if test -z "$_LT_TAGVAR(postdep_objects, $1)"; then
+ _LT_TAGVAR(postdep_objects, $1)="$p"
+ else
+ _LT_TAGVAR(postdep_objects, $1)="$_LT_TAGVAR(postdep_objects, $1) $p"
+ fi
+ fi
+ ;;
+
+ *) ;; # Ignore the rest.
+
+ esac
+ done
+
+ # Clean up.
+ rm -f a.out a.exe
+else
+ echo "libtool.m4: error: problem compiling $1 test program"
+fi
+
+$RM -f confest.$objext
+CFLAGS=$_lt_libdeps_save_CFLAGS
+
+# PORTME: override above test on systems where it is broken
+m4_if([$1], [CXX],
+[case $host_os in
+interix[[3-9]]*)
+ # Interix 3.5 installs completely hosed .la files for C++, so rather than
+ # hack all around it, let's just trust "g++" to DTRT.
+ _LT_TAGVAR(predep_objects,$1)=
+ _LT_TAGVAR(postdep_objects,$1)=
+ _LT_TAGVAR(postdeps,$1)=
+ ;;
+
+linux*)
+ case `$CC -V 2>&1 | sed 5q` in
+ *Sun\ C*)
+ # Sun C++ 5.9
+
+ # The more standards-conforming stlport4 library is
+ # incompatible with the Cstd library. Avoid specifying
+ # it if it's in CXXFLAGS. Ignore libCrun as
+ # -library=stlport4 depends on it.
+ case " $CXX $CXXFLAGS " in
+ *" -library=stlport4 "*)
+ solaris_use_stlport4=yes
+ ;;
+ esac
+
+ if test "$solaris_use_stlport4" != yes; then
+ _LT_TAGVAR(postdeps,$1)='-library=Cstd -library=Crun'
+ fi
+ ;;
+ esac
+ ;;
+
+solaris*)
+ case $cc_basename in
+ CC* | sunCC*)
+ # The more standards-conforming stlport4 library is
+ # incompatible with the Cstd library. Avoid specifying
+ # it if it's in CXXFLAGS. Ignore libCrun as
+ # -library=stlport4 depends on it.
+ case " $CXX $CXXFLAGS " in
+ *" -library=stlport4 "*)
+ solaris_use_stlport4=yes
+ ;;
+ esac
+
+ # Adding this requires a known-good setup of shared libraries for
+ # Sun compiler versions before 5.6, else PIC objects from an old
+ # archive will be linked into the output, leading to subtle bugs.
+ if test "$solaris_use_stlport4" != yes; then
+ _LT_TAGVAR(postdeps,$1)='-library=Cstd -library=Crun'
+ fi
+ ;;
+ esac
+ ;;
+esac
+])
+
+case " $_LT_TAGVAR(postdeps, $1) " in
+*" -lc "*) _LT_TAGVAR(archive_cmds_need_lc, $1)=no ;;
+esac
+ _LT_TAGVAR(compiler_lib_search_dirs, $1)=
+if test -n "${_LT_TAGVAR(compiler_lib_search_path, $1)}"; then
+ _LT_TAGVAR(compiler_lib_search_dirs, $1)=`echo " ${_LT_TAGVAR(compiler_lib_search_path, $1)}" | ${SED} -e 's! -L! !g' -e 's!^ !!'`
+fi
+_LT_TAGDECL([], [compiler_lib_search_dirs], [1],
+ [The directories searched by this compiler when creating a shared library])
+_LT_TAGDECL([], [predep_objects], [1],
+ [Dependencies to place before and after the objects being linked to
+ create a shared library])
+_LT_TAGDECL([], [postdep_objects], [1])
+_LT_TAGDECL([], [predeps], [1])
+_LT_TAGDECL([], [postdeps], [1])
+_LT_TAGDECL([], [compiler_lib_search_path], [1],
+ [The library search path used internally by the compiler when linking
+ a shared library])
+])# _LT_SYS_HIDDEN_LIBDEPS
+
+
+# _LT_LANG_F77_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for a Fortran 77 compiler are
+# suitably defined. These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_F77_CONFIG],
+[AC_LANG_PUSH(Fortran 77)
+if test -z "$F77" || test "X$F77" = "Xno"; then
+ _lt_disable_F77=yes
+fi
+
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_TAGVAR(allow_undefined_flag, $1)=
+_LT_TAGVAR(always_export_symbols, $1)=no
+_LT_TAGVAR(archive_expsym_cmds, $1)=
+_LT_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_TAGVAR(hardcode_direct, $1)=no
+_LT_TAGVAR(hardcode_direct_absolute, $1)=no
+_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_TAGVAR(hardcode_minus_L, $1)=no
+_LT_TAGVAR(hardcode_automatic, $1)=no
+_LT_TAGVAR(inherit_rpath, $1)=no
+_LT_TAGVAR(module_cmds, $1)=
+_LT_TAGVAR(module_expsym_cmds, $1)=
+_LT_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+_LT_TAGVAR(no_undefined_flag, $1)=
+_LT_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for f77 test sources.
+ac_ext=f
+
+# Object file extension for compiled f77 test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# No sense in running all these tests if we already determined that
+# the F77 compiler isn't working. Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_disable_F77" != yes; then
+ # Code to be used in simple compile tests
+ lt_simple_compile_test_code="\
+ subroutine t
+ return
+ end
+"
+
+ # Code to be used in simple link tests
+ lt_simple_link_test_code="\
+ program t
+ end
+"
+
+ # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+ _LT_TAG_COMPILER
+
+ # save warnings/boilerplate of simple test code
+ _LT_COMPILER_BOILERPLATE
+ _LT_LINKER_BOILERPLATE
+
+ # Allow CC to be a program name with arguments.
+ lt_save_CC="$CC"
+ lt_save_GCC=$GCC
+ lt_save_CFLAGS=$CFLAGS
+ CC=${F77-"f77"}
+ CFLAGS=$FFLAGS
+ compiler=$CC
+ _LT_TAGVAR(compiler, $1)=$CC
+ _LT_CC_BASENAME([$compiler])
+ GCC=$G77
+ if test -n "$compiler"; then
+ AC_MSG_CHECKING([if libtool supports shared libraries])
+ AC_MSG_RESULT([$can_build_shared])
+
+ AC_MSG_CHECKING([whether to build shared libraries])
+ test "$can_build_shared" = "no" && enable_shared=no
+
+ # On AIX, shared libraries and static libraries use the same namespace, and
+ # are all built from PIC.
+ case $host_os in
+ aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+ aix[[4-9]]*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+ esac
+ AC_MSG_RESULT([$enable_shared])
+
+ AC_MSG_CHECKING([whether to build static libraries])
+ # Make sure either enable_shared or enable_static is yes.
+ test "$enable_shared" = yes || enable_static=yes
+ AC_MSG_RESULT([$enable_static])
+
+ _LT_TAGVAR(GCC, $1)="$G77"
+ _LT_TAGVAR(LD, $1)="$LD"
+
+ ## CAVEAT EMPTOR:
+ ## There is no encapsulation within the following macros, do not change
+ ## the running order or otherwise move them around unless you know exactly
+ ## what you are doing...
+ _LT_COMPILER_PIC($1)
+ _LT_COMPILER_C_O($1)
+ _LT_COMPILER_FILE_LOCKS($1)
+ _LT_LINKER_SHLIBS($1)
+ _LT_SYS_DYNAMIC_LINKER($1)
+ _LT_LINKER_HARDCODE_LIBPATH($1)
+
+ _LT_CONFIG($1)
+ fi # test -n "$compiler"
+
+ GCC=$lt_save_GCC
+ CC="$lt_save_CC"
+ CFLAGS="$lt_save_CFLAGS"
+fi # test "$_lt_disable_F77" != yes
+
+AC_LANG_POP
+])# _LT_LANG_F77_CONFIG
+
+
+# _LT_LANG_FC_CONFIG([TAG])
+# -------------------------
+# Ensure that the configuration variables for a Fortran compiler are
+# suitably defined. These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_FC_CONFIG],
+[AC_LANG_PUSH(Fortran)
+
+if test -z "$FC" || test "X$FC" = "Xno"; then
+ _lt_disable_FC=yes
+fi
+
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+_LT_TAGVAR(allow_undefined_flag, $1)=
+_LT_TAGVAR(always_export_symbols, $1)=no
+_LT_TAGVAR(archive_expsym_cmds, $1)=
+_LT_TAGVAR(export_dynamic_flag_spec, $1)=
+_LT_TAGVAR(hardcode_direct, $1)=no
+_LT_TAGVAR(hardcode_direct_absolute, $1)=no
+_LT_TAGVAR(hardcode_libdir_flag_spec, $1)=
+_LT_TAGVAR(hardcode_libdir_separator, $1)=
+_LT_TAGVAR(hardcode_minus_L, $1)=no
+_LT_TAGVAR(hardcode_automatic, $1)=no
+_LT_TAGVAR(inherit_rpath, $1)=no
+_LT_TAGVAR(module_cmds, $1)=
+_LT_TAGVAR(module_expsym_cmds, $1)=
+_LT_TAGVAR(link_all_deplibs, $1)=unknown
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+_LT_TAGVAR(no_undefined_flag, $1)=
+_LT_TAGVAR(whole_archive_flag_spec, $1)=
+_LT_TAGVAR(enable_shared_with_static_runtimes, $1)=no
+
+# Source file extension for fc test sources.
+ac_ext=${ac_fc_srcext-f}
+
+# Object file extension for compiled fc test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# No sense in running all these tests if we already determined that
+# the FC compiler isn't working. Some variables (like enable_shared)
+# are currently assumed to apply to all compilers on this platform,
+# and will be corrupted by setting them based on a non-working compiler.
+if test "$_lt_disable_FC" != yes; then
+ # Code to be used in simple compile tests
+ lt_simple_compile_test_code="\
+ subroutine t
+ return
+ end
+"
+
+ # Code to be used in simple link tests
+ lt_simple_link_test_code="\
+ program t
+ end
+"
+
+ # ltmain only uses $CC for tagged configurations so make sure $CC is set.
+ _LT_TAG_COMPILER
+
+ # save warnings/boilerplate of simple test code
+ _LT_COMPILER_BOILERPLATE
+ _LT_LINKER_BOILERPLATE
+
+ # Allow CC to be a program name with arguments.
+ lt_save_CC="$CC"
+ lt_save_GCC=$GCC
+ lt_save_CFLAGS=$CFLAGS
+ CC=${FC-"f95"}
+ CFLAGS=$FCFLAGS
+ compiler=$CC
+ GCC=$ac_cv_fc_compiler_gnu
+
+ _LT_TAGVAR(compiler, $1)=$CC
+ _LT_CC_BASENAME([$compiler])
+
+ if test -n "$compiler"; then
+ AC_MSG_CHECKING([if libtool supports shared libraries])
+ AC_MSG_RESULT([$can_build_shared])
+
+ AC_MSG_CHECKING([whether to build shared libraries])
+ test "$can_build_shared" = "no" && enable_shared=no
+
+ # On AIX, shared libraries and static libraries use the same namespace, and
+ # are all built from PIC.
+ case $host_os in
+ aix3*)
+ test "$enable_shared" = yes && enable_static=no
+ if test -n "$RANLIB"; then
+ archive_cmds="$archive_cmds~\$RANLIB \$lib"
+ postinstall_cmds='$RANLIB $lib'
+ fi
+ ;;
+ aix[[4-9]]*)
+ if test "$host_cpu" != ia64 && test "$aix_use_runtimelinking" = no ; then
+ test "$enable_shared" = yes && enable_static=no
+ fi
+ ;;
+ esac
+ AC_MSG_RESULT([$enable_shared])
+
+ AC_MSG_CHECKING([whether to build static libraries])
+ # Make sure either enable_shared or enable_static is yes.
+ test "$enable_shared" = yes || enable_static=yes
+ AC_MSG_RESULT([$enable_static])
+
+ _LT_TAGVAR(GCC, $1)="$ac_cv_fc_compiler_gnu"
+ _LT_TAGVAR(LD, $1)="$LD"
+
+ ## CAVEAT EMPTOR:
+ ## There is no encapsulation within the following macros, do not change
+ ## the running order or otherwise move them around unless you know exactly
+ ## what you are doing...
+ _LT_SYS_HIDDEN_LIBDEPS($1)
+ _LT_COMPILER_PIC($1)
+ _LT_COMPILER_C_O($1)
+ _LT_COMPILER_FILE_LOCKS($1)
+ _LT_LINKER_SHLIBS($1)
+ _LT_SYS_DYNAMIC_LINKER($1)
+ _LT_LINKER_HARDCODE_LIBPATH($1)
+
+ _LT_CONFIG($1)
+ fi # test -n "$compiler"
+
+ GCC=$lt_save_GCC
+ CC=$lt_save_CC
+ CFLAGS=$lt_save_CFLAGS
+fi # test "$_lt_disable_FC" != yes
+
+AC_LANG_POP
+])# _LT_LANG_FC_CONFIG
+
+
+# _LT_LANG_GCJ_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for the GNU Java Compiler compiler
+# are suitably defined. These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_GCJ_CONFIG],
+[AC_REQUIRE([LT_PROG_GCJ])dnl
+AC_LANG_SAVE
+
+# Source file extension for Java test sources.
+ac_ext=java
+
+# Object file extension for compiled Java test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="class foo {}"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='public class conftest { public static void main(String[[]] argv) {}; }'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_TAG_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC=$CC
+lt_save_CFLAGS=$CFLAGS
+lt_save_GCC=$GCC
+GCC=yes
+CC=${GCJ-"gcj"}
+CFLAGS=$GCJFLAGS
+compiler=$CC
+_LT_TAGVAR(compiler, $1)=$CC
+_LT_TAGVAR(LD, $1)="$LD"
+_LT_CC_BASENAME([$compiler])
+
+# GCJ did not exist at the time GCC didn't implicitly link libc in.
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+
+## CAVEAT EMPTOR:
+## There is no encapsulation within the following macros, do not change
+## the running order or otherwise move them around unless you know exactly
+## what you are doing...
+if test -n "$compiler"; then
+ _LT_COMPILER_NO_RTTI($1)
+ _LT_COMPILER_PIC($1)
+ _LT_COMPILER_C_O($1)
+ _LT_COMPILER_FILE_LOCKS($1)
+ _LT_LINKER_SHLIBS($1)
+ _LT_LINKER_HARDCODE_LIBPATH($1)
+
+ _LT_CONFIG($1)
+fi
+
+AC_LANG_RESTORE
+
+GCC=$lt_save_GCC
+CC=$lt_save_CC
+CFLAGS=$lt_save_CFLAGS
+])# _LT_LANG_GCJ_CONFIG
+
+
+# _LT_LANG_GO_CONFIG([TAG])
+# --------------------------
+# Ensure that the configuration variables for the GNU Go compiler
+# are suitably defined. These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_GO_CONFIG],
+[AC_REQUIRE([LT_PROG_GO])dnl
+AC_LANG_SAVE
+
+# Source file extension for Go test sources.
+ac_ext=go
+
+# Object file extension for compiled Go test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code="package main; func main() { }"
+
+# Code to be used in simple link tests
+lt_simple_link_test_code='package main; func main() { }'
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_TAG_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC=$CC
+lt_save_CFLAGS=$CFLAGS
+lt_save_GCC=$GCC
+GCC=yes
+CC=${GOC-"gccgo"}
+CFLAGS=$GOFLAGS
+compiler=$CC
+_LT_TAGVAR(compiler, $1)=$CC
+_LT_TAGVAR(LD, $1)="$LD"
+_LT_CC_BASENAME([$compiler])
+
+# Go did not exist at the time GCC didn't implicitly link libc in.
+_LT_TAGVAR(archive_cmds_need_lc, $1)=no
+
+_LT_TAGVAR(old_archive_cmds, $1)=$old_archive_cmds
+_LT_TAGVAR(reload_flag, $1)=$reload_flag
+_LT_TAGVAR(reload_cmds, $1)=$reload_cmds
+
+## CAVEAT EMPTOR:
+## There is no encapsulation within the following macros, do not change
+## the running order or otherwise move them around unless you know exactly
+## what you are doing...
+if test -n "$compiler"; then
+ _LT_COMPILER_NO_RTTI($1)
+ _LT_COMPILER_PIC($1)
+ _LT_COMPILER_C_O($1)
+ _LT_COMPILER_FILE_LOCKS($1)
+ _LT_LINKER_SHLIBS($1)
+ _LT_LINKER_HARDCODE_LIBPATH($1)
+
+ _LT_CONFIG($1)
+fi
+
+AC_LANG_RESTORE
+
+GCC=$lt_save_GCC
+CC=$lt_save_CC
+CFLAGS=$lt_save_CFLAGS
+])# _LT_LANG_GO_CONFIG
+
+
+# _LT_LANG_RC_CONFIG([TAG])
+# -------------------------
+# Ensure that the configuration variables for the Windows resource compiler
+# are suitably defined. These variables are subsequently used by _LT_CONFIG
+# to write the compiler configuration to `libtool'.
+m4_defun([_LT_LANG_RC_CONFIG],
+[AC_REQUIRE([LT_PROG_RC])dnl
+AC_LANG_SAVE
+
+# Source file extension for RC test sources.
+ac_ext=rc
+
+# Object file extension for compiled RC test sources.
+objext=o
+_LT_TAGVAR(objext, $1)=$objext
+
+# Code to be used in simple compile tests
+lt_simple_compile_test_code='sample MENU { MENUITEM "&Soup", 100, CHECKED }'
+
+# Code to be used in simple link tests
+lt_simple_link_test_code="$lt_simple_compile_test_code"
+
+# ltmain only uses $CC for tagged configurations so make sure $CC is set.
+_LT_TAG_COMPILER
+
+# save warnings/boilerplate of simple test code
+_LT_COMPILER_BOILERPLATE
+_LT_LINKER_BOILERPLATE
+
+# Allow CC to be a program name with arguments.
+lt_save_CC="$CC"
+lt_save_CFLAGS=$CFLAGS
+lt_save_GCC=$GCC
+GCC=
+CC=${RC-"windres"}
+CFLAGS=
+compiler=$CC
+_LT_TAGVAR(compiler, $1)=$CC
+_LT_CC_BASENAME([$compiler])
+_LT_TAGVAR(lt_cv_prog_compiler_c_o, $1)=yes
+
+if test -n "$compiler"; then
+ :
+ _LT_CONFIG($1)
+fi
+
+GCC=$lt_save_GCC
+AC_LANG_RESTORE
+CC=$lt_save_CC
+CFLAGS=$lt_save_CFLAGS
+])# _LT_LANG_RC_CONFIG
+
+
+# LT_PROG_GCJ
+# -----------
+AC_DEFUN([LT_PROG_GCJ],
+[m4_ifdef([AC_PROG_GCJ], [AC_PROG_GCJ],
+ [m4_ifdef([A][M_PROG_GCJ], [A][M_PROG_GCJ],
+ [AC_CHECK_TOOL(GCJ, gcj,)
+ test "x${GCJFLAGS+set}" = xset || GCJFLAGS="-g -O2"
+ AC_SUBST(GCJFLAGS)])])[]dnl
+])
+
+# Old name:
+AU_ALIAS([LT_AC_PROG_GCJ], [LT_PROG_GCJ])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([LT_AC_PROG_GCJ], [])
+
+
+# LT_PROG_GO
+# ----------
+AC_DEFUN([LT_PROG_GO],
+[AC_CHECK_TOOL(GOC, gccgo,)
+])
+
+
+# LT_PROG_RC
+# ----------
+AC_DEFUN([LT_PROG_RC],
+[AC_CHECK_TOOL(RC, windres,)
+])
+
+# Old name:
+AU_ALIAS([LT_AC_PROG_RC], [LT_PROG_RC])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([LT_AC_PROG_RC], [])
+
+
+# _LT_DECL_EGREP
+# --------------
+# If we don't have a new enough Autoconf to choose the best grep
+# available, choose the one first in the user's PATH.
+m4_defun([_LT_DECL_EGREP],
+[AC_REQUIRE([AC_PROG_EGREP])dnl
+AC_REQUIRE([AC_PROG_FGREP])dnl
+test -z "$GREP" && GREP=grep
+_LT_DECL([], [GREP], [1], [A grep program that handles long lines])
+_LT_DECL([], [EGREP], [1], [An ERE matcher])
+_LT_DECL([], [FGREP], [1], [A literal string matcher])
+dnl Non-bleeding-edge autoconf doesn't subst GREP, so do it here too
+AC_SUBST([GREP])
+])
+
+
+# _LT_DECL_OBJDUMP
+# --------------
+# If we don't have a new enough Autoconf to choose the best objdump
+# available, choose the one first in the user's PATH.
+m4_defun([_LT_DECL_OBJDUMP],
+[AC_CHECK_TOOL(OBJDUMP, objdump, false)
+test -z "$OBJDUMP" && OBJDUMP=objdump
+_LT_DECL([], [OBJDUMP], [1], [An object symbol dumper])
+AC_SUBST([OBJDUMP])
+])
+
+# _LT_DECL_DLLTOOL
+# ----------------
+# Ensure DLLTOOL variable is set.
+m4_defun([_LT_DECL_DLLTOOL],
+[AC_CHECK_TOOL(DLLTOOL, dlltool, false)
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+_LT_DECL([], [DLLTOOL], [1], [DLL creation program])
+AC_SUBST([DLLTOOL])
+])
+
+# _LT_DECL_SED
+# ------------
+# Check for a fully-functional sed program, that truncates
+# as few characters as possible. Prefer GNU sed if found.
+m4_defun([_LT_DECL_SED],
+[AC_PROG_SED
+test -z "$SED" && SED=sed
+Xsed="$SED -e 1s/^X//"
+_LT_DECL([], [SED], [1], [A sed program that does not truncate output])
+_LT_DECL([], [Xsed], ["\$SED -e 1s/^X//"],
+ [Sed that helps us avoid accidentally triggering echo(1) options like -n])
+])# _LT_DECL_SED
+
+m4_ifndef([AC_PROG_SED], [
+############################################################
+# NOTE: This macro has been submitted for inclusion into #
+# GNU Autoconf as AC_PROG_SED. When it is available in #
+# a released version of Autoconf we should remove this #
+# macro and use it instead. #
+############################################################
+
+m4_defun([AC_PROG_SED],
+[AC_MSG_CHECKING([for a sed that does not truncate output])
+AC_CACHE_VAL(lt_cv_path_SED,
+[# Loop through the user's path and test for sed and gsed.
+# Then use that list of sed's as ones to test for truncation.
+as_save_IFS=$IFS; IFS=$PATH_SEPARATOR
+for as_dir in $PATH
+do
+ IFS=$as_save_IFS
+ test -z "$as_dir" && as_dir=.
+ for lt_ac_prog in sed gsed; do
+ for ac_exec_ext in '' $ac_executable_extensions; do
+ if $as_executable_p "$as_dir/$lt_ac_prog$ac_exec_ext"; then
+ lt_ac_sed_list="$lt_ac_sed_list $as_dir/$lt_ac_prog$ac_exec_ext"
+ fi
+ done
+ done
+done
+IFS=$as_save_IFS
+lt_ac_max=0
+lt_ac_count=0
+# Add /usr/xpg4/bin/sed as it is typically found on Solaris
+# along with /bin/sed that truncates output.
+for lt_ac_sed in $lt_ac_sed_list /usr/xpg4/bin/sed; do
+ test ! -f $lt_ac_sed && continue
+ cat /dev/null > conftest.in
+ lt_ac_count=0
+ echo $ECHO_N "0123456789$ECHO_C" >conftest.in
+ # Check for GNU sed and select it if it is found.
+ if "$lt_ac_sed" --version 2>&1 < /dev/null | grep 'GNU' > /dev/null; then
+ lt_cv_path_SED=$lt_ac_sed
+ break
+ fi
+ while true; do
+ cat conftest.in conftest.in >conftest.tmp
+ mv conftest.tmp conftest.in
+ cp conftest.in conftest.nl
+ echo >>conftest.nl
+ $lt_ac_sed -e 's/a$//' < conftest.nl >conftest.out || break
+ cmp -s conftest.out conftest.nl || break
+ # 10000 chars as input seems more than enough
+ test $lt_ac_count -gt 10 && break
+ lt_ac_count=`expr $lt_ac_count + 1`
+ if test $lt_ac_count -gt $lt_ac_max; then
+ lt_ac_max=$lt_ac_count
+ lt_cv_path_SED=$lt_ac_sed
+ fi
+ done
+done
+])
+SED=$lt_cv_path_SED
+AC_SUBST([SED])
+AC_MSG_RESULT([$SED])
+])#AC_PROG_SED
+])#m4_ifndef
+
+# Old name:
+AU_ALIAS([LT_AC_PROG_SED], [AC_PROG_SED])
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([LT_AC_PROG_SED], [])
+
+
+# _LT_CHECK_SHELL_FEATURES
+# ------------------------
+# Find out whether the shell is Bourne or XSI compatible,
+# or has some other useful features.
+m4_defun([_LT_CHECK_SHELL_FEATURES],
+[AC_MSG_CHECKING([whether the shell understands some XSI constructs])
+# Try some XSI features
+xsi_shell=no
+( _lt_dummy="a/b/c"
+ test "${_lt_dummy##*/},${_lt_dummy%/*},${_lt_dummy#??}"${_lt_dummy%"$_lt_dummy"}, \
+ = c,a/b,b/c, \
+ && eval 'test $(( 1 + 1 )) -eq 2 \
+ && test "${#_lt_dummy}" -eq 5' ) >/dev/null 2>&1 \
+ && xsi_shell=yes
+AC_MSG_RESULT([$xsi_shell])
+_LT_CONFIG_LIBTOOL_INIT([xsi_shell='$xsi_shell'])
+
+AC_MSG_CHECKING([whether the shell understands "+="])
+lt_shell_append=no
+( foo=bar; set foo baz; eval "$[1]+=\$[2]" && test "$foo" = barbaz ) \
+ >/dev/null 2>&1 \
+ && lt_shell_append=yes
+AC_MSG_RESULT([$lt_shell_append])
+_LT_CONFIG_LIBTOOL_INIT([lt_shell_append='$lt_shell_append'])
+
+if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then
+ lt_unset=unset
+else
+ lt_unset=false
+fi
+_LT_DECL([], [lt_unset], [0], [whether the shell understands "unset"])dnl
+
+# test EBCDIC or ASCII
+case `echo X|tr X '\101'` in
+ A) # ASCII based system
+ # \n is not interpreted correctly by Solaris 8 /usr/ucb/tr
+ lt_SP2NL='tr \040 \012'
+ lt_NL2SP='tr \015\012 \040\040'
+ ;;
+ *) # EBCDIC based system
+ lt_SP2NL='tr \100 \n'
+ lt_NL2SP='tr \r\n \100\100'
+ ;;
+esac
+_LT_DECL([SP2NL], [lt_SP2NL], [1], [turn spaces into newlines])dnl
+_LT_DECL([NL2SP], [lt_NL2SP], [1], [turn newlines into spaces])dnl
+])# _LT_CHECK_SHELL_FEATURES
+
+
+# _LT_PROG_FUNCTION_REPLACE (FUNCNAME, REPLACEMENT-BODY)
+# ------------------------------------------------------
+# In `$cfgfile', look for function FUNCNAME delimited by `^FUNCNAME ()$' and
+# '^} FUNCNAME ', and replace its body with REPLACEMENT-BODY.
+m4_defun([_LT_PROG_FUNCTION_REPLACE],
+[dnl {
+sed -e '/^$1 ()$/,/^} # $1 /c\
+$1 ()\
+{\
+m4_bpatsubsts([$2], [$], [\\], [^\([ ]\)], [\\\1])
+} # Extended-shell $1 implementation' "$cfgfile" > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+test 0 -eq $? || _lt_function_replace_fail=:
+])
+
+
+# _LT_PROG_REPLACE_SHELLFNS
+# -------------------------
+# Replace existing portable implementations of several shell functions with
+# equivalent extended shell implementations where those features are available..
+m4_defun([_LT_PROG_REPLACE_SHELLFNS],
+[if test x"$xsi_shell" = xyes; then
+ _LT_PROG_FUNCTION_REPLACE([func_dirname], [dnl
+ case ${1} in
+ */*) func_dirname_result="${1%/*}${2}" ;;
+ * ) func_dirname_result="${3}" ;;
+ esac])
+
+ _LT_PROG_FUNCTION_REPLACE([func_basename], [dnl
+ func_basename_result="${1##*/}"])
+
+ _LT_PROG_FUNCTION_REPLACE([func_dirname_and_basename], [dnl
+ case ${1} in
+ */*) func_dirname_result="${1%/*}${2}" ;;
+ * ) func_dirname_result="${3}" ;;
+ esac
+ func_basename_result="${1##*/}"])
+
+ _LT_PROG_FUNCTION_REPLACE([func_stripname], [dnl
+ # pdksh 5.2.14 does not do ${X%$Y} correctly if both X and Y are
+ # positional parameters, so assign one to ordinary parameter first.
+ func_stripname_result=${3}
+ func_stripname_result=${func_stripname_result#"${1}"}
+ func_stripname_result=${func_stripname_result%"${2}"}])
+
+ _LT_PROG_FUNCTION_REPLACE([func_split_long_opt], [dnl
+ func_split_long_opt_name=${1%%=*}
+ func_split_long_opt_arg=${1#*=}])
+
+ _LT_PROG_FUNCTION_REPLACE([func_split_short_opt], [dnl
+ func_split_short_opt_arg=${1#??}
+ func_split_short_opt_name=${1%"$func_split_short_opt_arg"}])
+
+ _LT_PROG_FUNCTION_REPLACE([func_lo2o], [dnl
+ case ${1} in
+ *.lo) func_lo2o_result=${1%.lo}.${objext} ;;
+ *) func_lo2o_result=${1} ;;
+ esac])
+
+ _LT_PROG_FUNCTION_REPLACE([func_xform], [ func_xform_result=${1%.*}.lo])
+
+ _LT_PROG_FUNCTION_REPLACE([func_arith], [ func_arith_result=$(( $[*] ))])
+
+ _LT_PROG_FUNCTION_REPLACE([func_len], [ func_len_result=${#1}])
+fi
+
+if test x"$lt_shell_append" = xyes; then
+ _LT_PROG_FUNCTION_REPLACE([func_append], [ eval "${1}+=\\${2}"])
+
+ _LT_PROG_FUNCTION_REPLACE([func_append_quoted], [dnl
+ func_quote_for_eval "${2}"
+dnl m4 expansion turns \\\\ into \\, and then the shell eval turns that into \
+ eval "${1}+=\\\\ \\$func_quote_for_eval_result"])
+
+ # Save a `func_append' function call where possible by direct use of '+='
+ sed -e 's%func_append \([[a-zA-Z_]]\{1,\}\) "%\1+="%g' $cfgfile > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+ test 0 -eq $? || _lt_function_replace_fail=:
+else
+ # Save a `func_append' function call even when '+=' is not available
+ sed -e 's%func_append \([[a-zA-Z_]]\{1,\}\) "%\1="$\1%g' $cfgfile > $cfgfile.tmp \
+ && mv -f "$cfgfile.tmp" "$cfgfile" \
+ || (rm -f "$cfgfile" && cp "$cfgfile.tmp" "$cfgfile" && rm -f "$cfgfile.tmp")
+ test 0 -eq $? || _lt_function_replace_fail=:
+fi
+
+if test x"$_lt_function_replace_fail" = x":"; then
+ AC_MSG_WARN([Unable to substitute extended shell functions in $ofile])
+fi
+])
+
+# _LT_PATH_CONVERSION_FUNCTIONS
+# -----------------------------
+# Determine which file name conversion functions should be used by
+# func_to_host_file (and, implicitly, by func_to_host_path). These are needed
+# for certain cross-compile configurations and native mingw.
+m4_defun([_LT_PATH_CONVERSION_FUNCTIONS],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_CANONICAL_BUILD])dnl
+AC_MSG_CHECKING([how to convert $build file names to $host format])
+AC_CACHE_VAL(lt_cv_to_host_file_cmd,
+[case $host in
+ *-*-mingw* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_host_file_cmd=func_convert_file_msys_to_w32
+ ;;
+ *-*-cygwin* )
+ lt_cv_to_host_file_cmd=func_convert_file_cygwin_to_w32
+ ;;
+ * ) # otherwise, assume *nix
+ lt_cv_to_host_file_cmd=func_convert_file_nix_to_w32
+ ;;
+ esac
+ ;;
+ *-*-cygwin* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_host_file_cmd=func_convert_file_msys_to_cygwin
+ ;;
+ *-*-cygwin* )
+ lt_cv_to_host_file_cmd=func_convert_file_noop
+ ;;
+ * ) # otherwise, assume *nix
+ lt_cv_to_host_file_cmd=func_convert_file_nix_to_cygwin
+ ;;
+ esac
+ ;;
+ * ) # unhandled hosts (and "normal" native builds)
+ lt_cv_to_host_file_cmd=func_convert_file_noop
+ ;;
+esac
+])
+to_host_file_cmd=$lt_cv_to_host_file_cmd
+AC_MSG_RESULT([$lt_cv_to_host_file_cmd])
+_LT_DECL([to_host_file_cmd], [lt_cv_to_host_file_cmd],
+ [0], [convert $build file names to $host format])dnl
+
+AC_MSG_CHECKING([how to convert $build file names to toolchain format])
+AC_CACHE_VAL(lt_cv_to_tool_file_cmd,
+[#assume ordinary cross tools, or native build.
+lt_cv_to_tool_file_cmd=func_convert_file_noop
+case $host in
+ *-*-mingw* )
+ case $build in
+ *-*-mingw* ) # actually msys
+ lt_cv_to_tool_file_cmd=func_convert_file_msys_to_w32
+ ;;
+ esac
+ ;;
+esac
+])
+to_tool_file_cmd=$lt_cv_to_tool_file_cmd
+AC_MSG_RESULT([$lt_cv_to_tool_file_cmd])
+_LT_DECL([to_tool_file_cmd], [lt_cv_to_tool_file_cmd],
+ [0], [convert $build files to toolchain format])dnl
+])# _LT_PATH_CONVERSION_FUNCTIONS
diff --git a/m4/ltoptions.m4 b/m4/ltoptions.m4
new file mode 100644
index 00000000..5d9acd8e
--- /dev/null
+++ b/m4/ltoptions.m4
@@ -0,0 +1,384 @@
+# Helper functions for option handling. -*- Autoconf -*-
+#
+# Copyright (C) 2004, 2005, 2007, 2008, 2009 Free Software Foundation,
+# Inc.
+# Written by Gary V. Vaughan, 2004
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# serial 7 ltoptions.m4
+
+# This is to help aclocal find these macros, as it can't see m4_define.
+AC_DEFUN([LTOPTIONS_VERSION], [m4_if([1])])
+
+
+# _LT_MANGLE_OPTION(MACRO-NAME, OPTION-NAME)
+# ------------------------------------------
+m4_define([_LT_MANGLE_OPTION],
+[[_LT_OPTION_]m4_bpatsubst($1__$2, [[^a-zA-Z0-9_]], [_])])
+
+
+# _LT_SET_OPTION(MACRO-NAME, OPTION-NAME)
+# ---------------------------------------
+# Set option OPTION-NAME for macro MACRO-NAME, and if there is a
+# matching handler defined, dispatch to it. Other OPTION-NAMEs are
+# saved as a flag.
+m4_define([_LT_SET_OPTION],
+[m4_define(_LT_MANGLE_OPTION([$1], [$2]))dnl
+m4_ifdef(_LT_MANGLE_DEFUN([$1], [$2]),
+ _LT_MANGLE_DEFUN([$1], [$2]),
+ [m4_warning([Unknown $1 option `$2'])])[]dnl
+])
+
+
+# _LT_IF_OPTION(MACRO-NAME, OPTION-NAME, IF-SET, [IF-NOT-SET])
+# ------------------------------------------------------------
+# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise.
+m4_define([_LT_IF_OPTION],
+[m4_ifdef(_LT_MANGLE_OPTION([$1], [$2]), [$3], [$4])])
+
+
+# _LT_UNLESS_OPTIONS(MACRO-NAME, OPTION-LIST, IF-NOT-SET)
+# -------------------------------------------------------
+# Execute IF-NOT-SET unless all options in OPTION-LIST for MACRO-NAME
+# are set.
+m4_define([_LT_UNLESS_OPTIONS],
+[m4_foreach([_LT_Option], m4_split(m4_normalize([$2])),
+ [m4_ifdef(_LT_MANGLE_OPTION([$1], _LT_Option),
+ [m4_define([$0_found])])])[]dnl
+m4_ifdef([$0_found], [m4_undefine([$0_found])], [$3
+])[]dnl
+])
+
+
+# _LT_SET_OPTIONS(MACRO-NAME, OPTION-LIST)
+# ----------------------------------------
+# OPTION-LIST is a space-separated list of Libtool options associated
+# with MACRO-NAME. If any OPTION has a matching handler declared with
+# LT_OPTION_DEFINE, dispatch to that macro; otherwise complain about
+# the unknown option and exit.
+m4_defun([_LT_SET_OPTIONS],
+[# Set options
+m4_foreach([_LT_Option], m4_split(m4_normalize([$2])),
+ [_LT_SET_OPTION([$1], _LT_Option)])
+
+m4_if([$1],[LT_INIT],[
+ dnl
+ dnl Simply set some default values (i.e off) if boolean options were not
+ dnl specified:
+ _LT_UNLESS_OPTIONS([LT_INIT], [dlopen], [enable_dlopen=no
+ ])
+ _LT_UNLESS_OPTIONS([LT_INIT], [win32-dll], [enable_win32_dll=no
+ ])
+ dnl
+ dnl If no reference was made to various pairs of opposing options, then
+ dnl we run the default mode handler for the pair. For example, if neither
+ dnl `shared' nor `disable-shared' was passed, we enable building of shared
+ dnl archives by default:
+ _LT_UNLESS_OPTIONS([LT_INIT], [shared disable-shared], [_LT_ENABLE_SHARED])
+ _LT_UNLESS_OPTIONS([LT_INIT], [static disable-static], [_LT_ENABLE_STATIC])
+ _LT_UNLESS_OPTIONS([LT_INIT], [pic-only no-pic], [_LT_WITH_PIC])
+ _LT_UNLESS_OPTIONS([LT_INIT], [fast-install disable-fast-install],
+ [_LT_ENABLE_FAST_INSTALL])
+ ])
+])# _LT_SET_OPTIONS
+
+
+## --------------------------------- ##
+## Macros to handle LT_INIT options. ##
+## --------------------------------- ##
+
+# _LT_MANGLE_DEFUN(MACRO-NAME, OPTION-NAME)
+# -----------------------------------------
+m4_define([_LT_MANGLE_DEFUN],
+[[_LT_OPTION_DEFUN_]m4_bpatsubst(m4_toupper([$1__$2]), [[^A-Z0-9_]], [_])])
+
+
+# LT_OPTION_DEFINE(MACRO-NAME, OPTION-NAME, CODE)
+# -----------------------------------------------
+m4_define([LT_OPTION_DEFINE],
+[m4_define(_LT_MANGLE_DEFUN([$1], [$2]), [$3])[]dnl
+])# LT_OPTION_DEFINE
+
+
+# dlopen
+# ------
+LT_OPTION_DEFINE([LT_INIT], [dlopen], [enable_dlopen=yes
+])
+
+AU_DEFUN([AC_LIBTOOL_DLOPEN],
+[_LT_SET_OPTION([LT_INIT], [dlopen])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you
+put the `dlopen' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_DLOPEN], [])
+
+
+# win32-dll
+# ---------
+# Declare package support for building win32 dll's.
+LT_OPTION_DEFINE([LT_INIT], [win32-dll],
+[enable_win32_dll=yes
+
+case $host in
+*-*-cygwin* | *-*-mingw* | *-*-pw32* | *-*-cegcc*)
+ AC_CHECK_TOOL(AS, as, false)
+ AC_CHECK_TOOL(DLLTOOL, dlltool, false)
+ AC_CHECK_TOOL(OBJDUMP, objdump, false)
+ ;;
+esac
+
+test -z "$AS" && AS=as
+_LT_DECL([], [AS], [1], [Assembler program])dnl
+
+test -z "$DLLTOOL" && DLLTOOL=dlltool
+_LT_DECL([], [DLLTOOL], [1], [DLL creation program])dnl
+
+test -z "$OBJDUMP" && OBJDUMP=objdump
+_LT_DECL([], [OBJDUMP], [1], [Object dumper program])dnl
+])# win32-dll
+
+AU_DEFUN([AC_LIBTOOL_WIN32_DLL],
+[AC_REQUIRE([AC_CANONICAL_HOST])dnl
+_LT_SET_OPTION([LT_INIT], [win32-dll])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you
+put the `win32-dll' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_WIN32_DLL], [])
+
+
+# _LT_ENABLE_SHARED([DEFAULT])
+# ----------------------------
+# implement the --enable-shared flag, and supports the `shared' and
+# `disable-shared' LT_INIT options.
+# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'.
+m4_define([_LT_ENABLE_SHARED],
+[m4_define([_LT_ENABLE_SHARED_DEFAULT], [m4_if($1, no, no, yes)])dnl
+AC_ARG_ENABLE([shared],
+ [AS_HELP_STRING([--enable-shared@<:@=PKGS@:>@],
+ [build shared libraries @<:@default=]_LT_ENABLE_SHARED_DEFAULT[@:>@])],
+ [p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_shared=yes ;;
+ no) enable_shared=no ;;
+ *)
+ enable_shared=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_shared=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [enable_shared=]_LT_ENABLE_SHARED_DEFAULT)
+
+ _LT_DECL([build_libtool_libs], [enable_shared], [0],
+ [Whether or not to build shared libraries])
+])# _LT_ENABLE_SHARED
+
+LT_OPTION_DEFINE([LT_INIT], [shared], [_LT_ENABLE_SHARED([yes])])
+LT_OPTION_DEFINE([LT_INIT], [disable-shared], [_LT_ENABLE_SHARED([no])])
+
+# Old names:
+AC_DEFUN([AC_ENABLE_SHARED],
+[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[shared])
+])
+
+AC_DEFUN([AC_DISABLE_SHARED],
+[_LT_SET_OPTION([LT_INIT], [disable-shared])
+])
+
+AU_DEFUN([AM_ENABLE_SHARED], [AC_ENABLE_SHARED($@)])
+AU_DEFUN([AM_DISABLE_SHARED], [AC_DISABLE_SHARED($@)])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_ENABLE_SHARED], [])
+dnl AC_DEFUN([AM_DISABLE_SHARED], [])
+
+
+
+# _LT_ENABLE_STATIC([DEFAULT])
+# ----------------------------
+# implement the --enable-static flag, and support the `static' and
+# `disable-static' LT_INIT options.
+# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'.
+m4_define([_LT_ENABLE_STATIC],
+[m4_define([_LT_ENABLE_STATIC_DEFAULT], [m4_if($1, no, no, yes)])dnl
+AC_ARG_ENABLE([static],
+ [AS_HELP_STRING([--enable-static@<:@=PKGS@:>@],
+ [build static libraries @<:@default=]_LT_ENABLE_STATIC_DEFAULT[@:>@])],
+ [p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_static=yes ;;
+ no) enable_static=no ;;
+ *)
+ enable_static=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_static=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [enable_static=]_LT_ENABLE_STATIC_DEFAULT)
+
+ _LT_DECL([build_old_libs], [enable_static], [0],
+ [Whether or not to build static libraries])
+])# _LT_ENABLE_STATIC
+
+LT_OPTION_DEFINE([LT_INIT], [static], [_LT_ENABLE_STATIC([yes])])
+LT_OPTION_DEFINE([LT_INIT], [disable-static], [_LT_ENABLE_STATIC([no])])
+
+# Old names:
+AC_DEFUN([AC_ENABLE_STATIC],
+[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[static])
+])
+
+AC_DEFUN([AC_DISABLE_STATIC],
+[_LT_SET_OPTION([LT_INIT], [disable-static])
+])
+
+AU_DEFUN([AM_ENABLE_STATIC], [AC_ENABLE_STATIC($@)])
+AU_DEFUN([AM_DISABLE_STATIC], [AC_DISABLE_STATIC($@)])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AM_ENABLE_STATIC], [])
+dnl AC_DEFUN([AM_DISABLE_STATIC], [])
+
+
+
+# _LT_ENABLE_FAST_INSTALL([DEFAULT])
+# ----------------------------------
+# implement the --enable-fast-install flag, and support the `fast-install'
+# and `disable-fast-install' LT_INIT options.
+# DEFAULT is either `yes' or `no'. If omitted, it defaults to `yes'.
+m4_define([_LT_ENABLE_FAST_INSTALL],
+[m4_define([_LT_ENABLE_FAST_INSTALL_DEFAULT], [m4_if($1, no, no, yes)])dnl
+AC_ARG_ENABLE([fast-install],
+ [AS_HELP_STRING([--enable-fast-install@<:@=PKGS@:>@],
+ [optimize for fast installation @<:@default=]_LT_ENABLE_FAST_INSTALL_DEFAULT[@:>@])],
+ [p=${PACKAGE-default}
+ case $enableval in
+ yes) enable_fast_install=yes ;;
+ no) enable_fast_install=no ;;
+ *)
+ enable_fast_install=no
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for pkg in $enableval; do
+ IFS="$lt_save_ifs"
+ if test "X$pkg" = "X$p"; then
+ enable_fast_install=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [enable_fast_install=]_LT_ENABLE_FAST_INSTALL_DEFAULT)
+
+_LT_DECL([fast_install], [enable_fast_install], [0],
+ [Whether or not to optimize for fast installation])dnl
+])# _LT_ENABLE_FAST_INSTALL
+
+LT_OPTION_DEFINE([LT_INIT], [fast-install], [_LT_ENABLE_FAST_INSTALL([yes])])
+LT_OPTION_DEFINE([LT_INIT], [disable-fast-install], [_LT_ENABLE_FAST_INSTALL([no])])
+
+# Old names:
+AU_DEFUN([AC_ENABLE_FAST_INSTALL],
+[_LT_SET_OPTION([LT_INIT], m4_if([$1], [no], [disable-])[fast-install])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you put
+the `fast-install' option into LT_INIT's first parameter.])
+])
+
+AU_DEFUN([AC_DISABLE_FAST_INSTALL],
+[_LT_SET_OPTION([LT_INIT], [disable-fast-install])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you put
+the `disable-fast-install' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_ENABLE_FAST_INSTALL], [])
+dnl AC_DEFUN([AM_DISABLE_FAST_INSTALL], [])
+
+
+# _LT_WITH_PIC([MODE])
+# --------------------
+# implement the --with-pic flag, and support the `pic-only' and `no-pic'
+# LT_INIT options.
+# MODE is either `yes' or `no'. If omitted, it defaults to `both'.
+m4_define([_LT_WITH_PIC],
+[AC_ARG_WITH([pic],
+ [AS_HELP_STRING([--with-pic@<:@=PKGS@:>@],
+ [try to use only PIC/non-PIC objects @<:@default=use both@:>@])],
+ [lt_p=${PACKAGE-default}
+ case $withval in
+ yes|no) pic_mode=$withval ;;
+ *)
+ pic_mode=default
+ # Look at the argument we got. We use all the common list separators.
+ lt_save_ifs="$IFS"; IFS="${IFS}$PATH_SEPARATOR,"
+ for lt_pkg in $withval; do
+ IFS="$lt_save_ifs"
+ if test "X$lt_pkg" = "X$lt_p"; then
+ pic_mode=yes
+ fi
+ done
+ IFS="$lt_save_ifs"
+ ;;
+ esac],
+ [pic_mode=default])
+
+test -z "$pic_mode" && pic_mode=m4_default([$1], [default])
+
+_LT_DECL([], [pic_mode], [0], [What type of objects to build])dnl
+])# _LT_WITH_PIC
+
+LT_OPTION_DEFINE([LT_INIT], [pic-only], [_LT_WITH_PIC([yes])])
+LT_OPTION_DEFINE([LT_INIT], [no-pic], [_LT_WITH_PIC([no])])
+
+# Old name:
+AU_DEFUN([AC_LIBTOOL_PICMODE],
+[_LT_SET_OPTION([LT_INIT], [pic-only])
+AC_DIAGNOSE([obsolete],
+[$0: Remove this warning and the call to _LT_SET_OPTION when you
+put the `pic-only' option into LT_INIT's first parameter.])
+])
+
+dnl aclocal-1.4 backwards compatibility:
+dnl AC_DEFUN([AC_LIBTOOL_PICMODE], [])
+
+## ----------------- ##
+## LTDL_INIT Options ##
+## ----------------- ##
+
+m4_define([_LTDL_MODE], [])
+LT_OPTION_DEFINE([LTDL_INIT], [nonrecursive],
+ [m4_define([_LTDL_MODE], [nonrecursive])])
+LT_OPTION_DEFINE([LTDL_INIT], [recursive],
+ [m4_define([_LTDL_MODE], [recursive])])
+LT_OPTION_DEFINE([LTDL_INIT], [subproject],
+ [m4_define([_LTDL_MODE], [subproject])])
+
+m4_define([_LTDL_TYPE], [])
+LT_OPTION_DEFINE([LTDL_INIT], [installable],
+ [m4_define([_LTDL_TYPE], [installable])])
+LT_OPTION_DEFINE([LTDL_INIT], [convenience],
+ [m4_define([_LTDL_TYPE], [convenience])])
diff --git a/m4/ltsugar.m4 b/m4/ltsugar.m4
new file mode 100644
index 00000000..9000a057
--- /dev/null
+++ b/m4/ltsugar.m4
@@ -0,0 +1,123 @@
+# ltsugar.m4 -- libtool m4 base layer. -*-Autoconf-*-
+#
+# Copyright (C) 2004, 2005, 2007, 2008 Free Software Foundation, Inc.
+# Written by Gary V. Vaughan, 2004
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# serial 6 ltsugar.m4
+
+# This is to help aclocal find these macros, as it can't see m4_define.
+AC_DEFUN([LTSUGAR_VERSION], [m4_if([0.1])])
+
+
+# lt_join(SEP, ARG1, [ARG2...])
+# -----------------------------
+# Produce ARG1SEPARG2...SEPARGn, omitting [] arguments and their
+# associated separator.
+# Needed until we can rely on m4_join from Autoconf 2.62, since all earlier
+# versions in m4sugar had bugs.
+m4_define([lt_join],
+[m4_if([$#], [1], [],
+ [$#], [2], [[$2]],
+ [m4_if([$2], [], [], [[$2]_])$0([$1], m4_shift(m4_shift($@)))])])
+m4_define([_lt_join],
+[m4_if([$#$2], [2], [],
+ [m4_if([$2], [], [], [[$1$2]])$0([$1], m4_shift(m4_shift($@)))])])
+
+
+# lt_car(LIST)
+# lt_cdr(LIST)
+# ------------
+# Manipulate m4 lists.
+# These macros are necessary as long as will still need to support
+# Autoconf-2.59 which quotes differently.
+m4_define([lt_car], [[$1]])
+m4_define([lt_cdr],
+[m4_if([$#], 0, [m4_fatal([$0: cannot be called without arguments])],
+ [$#], 1, [],
+ [m4_dquote(m4_shift($@))])])
+m4_define([lt_unquote], $1)
+
+
+# lt_append(MACRO-NAME, STRING, [SEPARATOR])
+# ------------------------------------------
+# Redefine MACRO-NAME to hold its former content plus `SEPARATOR'`STRING'.
+# Note that neither SEPARATOR nor STRING are expanded; they are appended
+# to MACRO-NAME as is (leaving the expansion for when MACRO-NAME is invoked).
+# No SEPARATOR is output if MACRO-NAME was previously undefined (different
+# than defined and empty).
+#
+# This macro is needed until we can rely on Autoconf 2.62, since earlier
+# versions of m4sugar mistakenly expanded SEPARATOR but not STRING.
+m4_define([lt_append],
+[m4_define([$1],
+ m4_ifdef([$1], [m4_defn([$1])[$3]])[$2])])
+
+
+
+# lt_combine(SEP, PREFIX-LIST, INFIX, SUFFIX1, [SUFFIX2...])
+# ----------------------------------------------------------
+# Produce a SEP delimited list of all paired combinations of elements of
+# PREFIX-LIST with SUFFIX1 through SUFFIXn. Each element of the list
+# has the form PREFIXmINFIXSUFFIXn.
+# Needed until we can rely on m4_combine added in Autoconf 2.62.
+m4_define([lt_combine],
+[m4_if(m4_eval([$# > 3]), [1],
+ [m4_pushdef([_Lt_sep], [m4_define([_Lt_sep], m4_defn([lt_car]))])]]dnl
+[[m4_foreach([_Lt_prefix], [$2],
+ [m4_foreach([_Lt_suffix],
+ ]m4_dquote(m4_dquote(m4_shift(m4_shift(m4_shift($@)))))[,
+ [_Lt_sep([$1])[]m4_defn([_Lt_prefix])[$3]m4_defn([_Lt_suffix])])])])])
+
+
+# lt_if_append_uniq(MACRO-NAME, VARNAME, [SEPARATOR], [UNIQ], [NOT-UNIQ])
+# -----------------------------------------------------------------------
+# Iff MACRO-NAME does not yet contain VARNAME, then append it (delimited
+# by SEPARATOR if supplied) and expand UNIQ, else NOT-UNIQ.
+m4_define([lt_if_append_uniq],
+[m4_ifdef([$1],
+ [m4_if(m4_index([$3]m4_defn([$1])[$3], [$3$2$3]), [-1],
+ [lt_append([$1], [$2], [$3])$4],
+ [$5])],
+ [lt_append([$1], [$2], [$3])$4])])
+
+
+# lt_dict_add(DICT, KEY, VALUE)
+# -----------------------------
+m4_define([lt_dict_add],
+[m4_define([$1($2)], [$3])])
+
+
+# lt_dict_add_subkey(DICT, KEY, SUBKEY, VALUE)
+# --------------------------------------------
+m4_define([lt_dict_add_subkey],
+[m4_define([$1($2:$3)], [$4])])
+
+
+# lt_dict_fetch(DICT, KEY, [SUBKEY])
+# ----------------------------------
+m4_define([lt_dict_fetch],
+[m4_ifval([$3],
+ m4_ifdef([$1($2:$3)], [m4_defn([$1($2:$3)])]),
+ m4_ifdef([$1($2)], [m4_defn([$1($2)])]))])
+
+
+# lt_if_dict_fetch(DICT, KEY, [SUBKEY], VALUE, IF-TRUE, [IF-FALSE])
+# -----------------------------------------------------------------
+m4_define([lt_if_dict_fetch],
+[m4_if(lt_dict_fetch([$1], [$2], [$3]), [$4],
+ [$5],
+ [$6])])
+
+
+# lt_dict_filter(DICT, [SUBKEY], VALUE, [SEPARATOR], KEY, [...])
+# --------------------------------------------------------------
+m4_define([lt_dict_filter],
+[m4_if([$5], [], [],
+ [lt_join(m4_quote(m4_default([$4], [[, ]])),
+ lt_unquote(m4_split(m4_normalize(m4_foreach(_Lt_key, lt_car([m4_shiftn(4, $@)]),
+ [lt_if_dict_fetch([$1], _Lt_key, [$2], [$3], [_Lt_key ])])))))])[]dnl
+])
diff --git a/m4/ltversion.m4 b/m4/ltversion.m4
new file mode 100644
index 00000000..07a8602d
--- /dev/null
+++ b/m4/ltversion.m4
@@ -0,0 +1,23 @@
+# ltversion.m4 -- version numbers -*- Autoconf -*-
+#
+# Copyright (C) 2004 Free Software Foundation, Inc.
+# Written by Scott James Remnant, 2004
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# @configure_input@
+
+# serial 3337 ltversion.m4
+# This file is part of GNU Libtool
+
+m4_define([LT_PACKAGE_VERSION], [2.4.2])
+m4_define([LT_PACKAGE_REVISION], [1.3337])
+
+AC_DEFUN([LTVERSION_VERSION],
+[macro_version='2.4.2'
+macro_revision='1.3337'
+_LT_DECL(, macro_version, 0, [Which release of libtool.m4 was used?])
+_LT_DECL(, macro_revision, 0)
+])
diff --git a/m4/lt~obsolete.m4 b/m4/lt~obsolete.m4
new file mode 100644
index 00000000..c573da90
--- /dev/null
+++ b/m4/lt~obsolete.m4
@@ -0,0 +1,98 @@
+# lt~obsolete.m4 -- aclocal satisfying obsolete definitions. -*-Autoconf-*-
+#
+# Copyright (C) 2004, 2005, 2007, 2009 Free Software Foundation, Inc.
+# Written by Scott James Remnant, 2004.
+#
+# This file is free software; the Free Software Foundation gives
+# unlimited permission to copy and/or distribute it, with or without
+# modifications, as long as this notice is preserved.
+
+# serial 5 lt~obsolete.m4
+
+# These exist entirely to fool aclocal when bootstrapping libtool.
+#
+# In the past libtool.m4 has provided macros via AC_DEFUN (or AU_DEFUN)
+# which have later been changed to m4_define as they aren't part of the
+# exported API, or moved to Autoconf or Automake where they belong.
+#
+# The trouble is, aclocal is a bit thick. It'll see the old AC_DEFUN
+# in /usr/share/aclocal/libtool.m4 and remember it, then when it sees us
+# using a macro with the same name in our local m4/libtool.m4 it'll
+# pull the old libtool.m4 in (it doesn't see our shiny new m4_define
+# and doesn't know about Autoconf macros at all.)
+#
+# So we provide this file, which has a silly filename so it's always
+# included after everything else. This provides aclocal with the
+# AC_DEFUNs it wants, but when m4 processes it, it doesn't do anything
+# because those macros already exist, or will be overwritten later.
+# We use AC_DEFUN over AU_DEFUN for compatibility with aclocal-1.6.
+#
+# Anytime we withdraw an AC_DEFUN or AU_DEFUN, remember to add it here.
+# Yes, that means every name once taken will need to remain here until
+# we give up compatibility with versions before 1.7, at which point
+# we need to keep only those names which we still refer to.
+
+# This is to help aclocal find these macros, as it can't see m4_define.
+AC_DEFUN([LTOBSOLETE_VERSION], [m4_if([1])])
+
+m4_ifndef([AC_LIBTOOL_LINKER_OPTION], [AC_DEFUN([AC_LIBTOOL_LINKER_OPTION])])
+m4_ifndef([AC_PROG_EGREP], [AC_DEFUN([AC_PROG_EGREP])])
+m4_ifndef([_LT_AC_PROG_ECHO_BACKSLASH], [AC_DEFUN([_LT_AC_PROG_ECHO_BACKSLASH])])
+m4_ifndef([_LT_AC_SHELL_INIT], [AC_DEFUN([_LT_AC_SHELL_INIT])])
+m4_ifndef([_LT_AC_SYS_LIBPATH_AIX], [AC_DEFUN([_LT_AC_SYS_LIBPATH_AIX])])
+m4_ifndef([_LT_PROG_LTMAIN], [AC_DEFUN([_LT_PROG_LTMAIN])])
+m4_ifndef([_LT_AC_TAGVAR], [AC_DEFUN([_LT_AC_TAGVAR])])
+m4_ifndef([AC_LTDL_ENABLE_INSTALL], [AC_DEFUN([AC_LTDL_ENABLE_INSTALL])])
+m4_ifndef([AC_LTDL_PREOPEN], [AC_DEFUN([AC_LTDL_PREOPEN])])
+m4_ifndef([_LT_AC_SYS_COMPILER], [AC_DEFUN([_LT_AC_SYS_COMPILER])])
+m4_ifndef([_LT_AC_LOCK], [AC_DEFUN([_LT_AC_LOCK])])
+m4_ifndef([AC_LIBTOOL_SYS_OLD_ARCHIVE], [AC_DEFUN([AC_LIBTOOL_SYS_OLD_ARCHIVE])])
+m4_ifndef([_LT_AC_TRY_DLOPEN_SELF], [AC_DEFUN([_LT_AC_TRY_DLOPEN_SELF])])
+m4_ifndef([AC_LIBTOOL_PROG_CC_C_O], [AC_DEFUN([AC_LIBTOOL_PROG_CC_C_O])])
+m4_ifndef([AC_LIBTOOL_SYS_HARD_LINK_LOCKS], [AC_DEFUN([AC_LIBTOOL_SYS_HARD_LINK_LOCKS])])
+m4_ifndef([AC_LIBTOOL_OBJDIR], [AC_DEFUN([AC_LIBTOOL_OBJDIR])])
+m4_ifndef([AC_LTDL_OBJDIR], [AC_DEFUN([AC_LTDL_OBJDIR])])
+m4_ifndef([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH], [AC_DEFUN([AC_LIBTOOL_PROG_LD_HARDCODE_LIBPATH])])
+m4_ifndef([AC_LIBTOOL_SYS_LIB_STRIP], [AC_DEFUN([AC_LIBTOOL_SYS_LIB_STRIP])])
+m4_ifndef([AC_PATH_MAGIC], [AC_DEFUN([AC_PATH_MAGIC])])
+m4_ifndef([AC_PROG_LD_GNU], [AC_DEFUN([AC_PROG_LD_GNU])])
+m4_ifndef([AC_PROG_LD_RELOAD_FLAG], [AC_DEFUN([AC_PROG_LD_RELOAD_FLAG])])
+m4_ifndef([AC_DEPLIBS_CHECK_METHOD], [AC_DEFUN([AC_DEPLIBS_CHECK_METHOD])])
+m4_ifndef([AC_LIBTOOL_PROG_COMPILER_NO_RTTI], [AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_NO_RTTI])])
+m4_ifndef([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE], [AC_DEFUN([AC_LIBTOOL_SYS_GLOBAL_SYMBOL_PIPE])])
+m4_ifndef([AC_LIBTOOL_PROG_COMPILER_PIC], [AC_DEFUN([AC_LIBTOOL_PROG_COMPILER_PIC])])
+m4_ifndef([AC_LIBTOOL_PROG_LD_SHLIBS], [AC_DEFUN([AC_LIBTOOL_PROG_LD_SHLIBS])])
+m4_ifndef([AC_LIBTOOL_POSTDEP_PREDEP], [AC_DEFUN([AC_LIBTOOL_POSTDEP_PREDEP])])
+m4_ifndef([LT_AC_PROG_EGREP], [AC_DEFUN([LT_AC_PROG_EGREP])])
+m4_ifndef([LT_AC_PROG_SED], [AC_DEFUN([LT_AC_PROG_SED])])
+m4_ifndef([_LT_CC_BASENAME], [AC_DEFUN([_LT_CC_BASENAME])])
+m4_ifndef([_LT_COMPILER_BOILERPLATE], [AC_DEFUN([_LT_COMPILER_BOILERPLATE])])
+m4_ifndef([_LT_LINKER_BOILERPLATE], [AC_DEFUN([_LT_LINKER_BOILERPLATE])])
+m4_ifndef([_AC_PROG_LIBTOOL], [AC_DEFUN([_AC_PROG_LIBTOOL])])
+m4_ifndef([AC_LIBTOOL_SETUP], [AC_DEFUN([AC_LIBTOOL_SETUP])])
+m4_ifndef([_LT_AC_CHECK_DLFCN], [AC_DEFUN([_LT_AC_CHECK_DLFCN])])
+m4_ifndef([AC_LIBTOOL_SYS_DYNAMIC_LINKER], [AC_DEFUN([AC_LIBTOOL_SYS_DYNAMIC_LINKER])])
+m4_ifndef([_LT_AC_TAGCONFIG], [AC_DEFUN([_LT_AC_TAGCONFIG])])
+m4_ifndef([AC_DISABLE_FAST_INSTALL], [AC_DEFUN([AC_DISABLE_FAST_INSTALL])])
+m4_ifndef([_LT_AC_LANG_CXX], [AC_DEFUN([_LT_AC_LANG_CXX])])
+m4_ifndef([_LT_AC_LANG_F77], [AC_DEFUN([_LT_AC_LANG_F77])])
+m4_ifndef([_LT_AC_LANG_GCJ], [AC_DEFUN([_LT_AC_LANG_GCJ])])
+m4_ifndef([AC_LIBTOOL_LANG_C_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_C_CONFIG])])
+m4_ifndef([_LT_AC_LANG_C_CONFIG], [AC_DEFUN([_LT_AC_LANG_C_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_CXX_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_CXX_CONFIG])])
+m4_ifndef([_LT_AC_LANG_CXX_CONFIG], [AC_DEFUN([_LT_AC_LANG_CXX_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_F77_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_F77_CONFIG])])
+m4_ifndef([_LT_AC_LANG_F77_CONFIG], [AC_DEFUN([_LT_AC_LANG_F77_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_GCJ_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_GCJ_CONFIG])])
+m4_ifndef([_LT_AC_LANG_GCJ_CONFIG], [AC_DEFUN([_LT_AC_LANG_GCJ_CONFIG])])
+m4_ifndef([AC_LIBTOOL_LANG_RC_CONFIG], [AC_DEFUN([AC_LIBTOOL_LANG_RC_CONFIG])])
+m4_ifndef([_LT_AC_LANG_RC_CONFIG], [AC_DEFUN([_LT_AC_LANG_RC_CONFIG])])
+m4_ifndef([AC_LIBTOOL_CONFIG], [AC_DEFUN([AC_LIBTOOL_CONFIG])])
+m4_ifndef([_LT_AC_FILE_LTDLL_C], [AC_DEFUN([_LT_AC_FILE_LTDLL_C])])
+m4_ifndef([_LT_REQUIRED_DARWIN_CHECKS], [AC_DEFUN([_LT_REQUIRED_DARWIN_CHECKS])])
+m4_ifndef([_LT_AC_PROG_CXXCPP], [AC_DEFUN([_LT_AC_PROG_CXXCPP])])
+m4_ifndef([_LT_PREPARE_SED_QUOTE_VARS], [AC_DEFUN([_LT_PREPARE_SED_QUOTE_VARS])])
+m4_ifndef([_LT_PROG_ECHO_BACKSLASH], [AC_DEFUN([_LT_PROG_ECHO_BACKSLASH])])
+m4_ifndef([_LT_PROG_F77], [AC_DEFUN([_LT_PROG_F77])])
+m4_ifndef([_LT_PROG_FC], [AC_DEFUN([_LT_PROG_FC])])
+m4_ifndef([_LT_PROG_CXX], [AC_DEFUN([_LT_PROG_CXX])])
diff --git a/missing b/missing
new file mode 100755
index 00000000..cdea5149
--- /dev/null
+++ b/missing
@@ -0,0 +1,215 @@
+#! /bin/sh
+# Common wrapper for a few potentially missing GNU programs.
+
+scriptversion=2012-06-26.16; # UTC
+
+# Copyright (C) 1996-2013 Free Software Foundation, Inc.
+# Originally written by Fran,cois Pinard , 1996.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program. If not, see .
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+if test $# -eq 0; then
+ echo 1>&2 "Try '$0 --help' for more information"
+ exit 1
+fi
+
+case $1 in
+
+ --is-lightweight)
+ # Used by our autoconf macros to check whether the available missing
+ # script is modern enough.
+ exit 0
+ ;;
+
+ --run)
+ # Back-compat with the calling convention used by older automake.
+ shift
+ ;;
+
+ -h|--h|--he|--hel|--help)
+ echo "\
+$0 [OPTION]... PROGRAM [ARGUMENT]...
+
+Run 'PROGRAM [ARGUMENT]...', returning a proper advice when this fails due
+to PROGRAM being missing or too old.
+
+Options:
+ -h, --help display this help and exit
+ -v, --version output version information and exit
+
+Supported PROGRAM values:
+ aclocal autoconf autoheader autom4te automake makeinfo
+ bison yacc flex lex help2man
+
+Version suffixes to PROGRAM as well as the prefixes 'gnu-', 'gnu', and
+'g' are ignored when checking the name.
+
+Send bug reports to ."
+ exit $?
+ ;;
+
+ -v|--v|--ve|--ver|--vers|--versi|--versio|--version)
+ echo "missing $scriptversion (GNU Automake)"
+ exit $?
+ ;;
+
+ -*)
+ echo 1>&2 "$0: unknown '$1' option"
+ echo 1>&2 "Try '$0 --help' for more information"
+ exit 1
+ ;;
+
+esac
+
+# Run the given program, remember its exit status.
+"$@"; st=$?
+
+# If it succeeded, we are done.
+test $st -eq 0 && exit 0
+
+# Also exit now if we it failed (or wasn't found), and '--version' was
+# passed; such an option is passed most likely to detect whether the
+# program is present and works.
+case $2 in --version|--help) exit $st;; esac
+
+# Exit code 63 means version mismatch. This often happens when the user
+# tries to use an ancient version of a tool on a file that requires a
+# minimum version.
+if test $st -eq 63; then
+ msg="probably too old"
+elif test $st -eq 127; then
+ # Program was missing.
+ msg="missing on your system"
+else
+ # Program was found and executed, but failed. Give up.
+ exit $st
+fi
+
+perl_URL=http://www.perl.org/
+flex_URL=http://flex.sourceforge.net/
+gnu_software_URL=http://www.gnu.org/software
+
+program_details ()
+{
+ case $1 in
+ aclocal|automake)
+ echo "The '$1' program is part of the GNU Automake package:"
+ echo "<$gnu_software_URL/automake>"
+ echo "It also requires GNU Autoconf, GNU m4 and Perl in order to run:"
+ echo "<$gnu_software_URL/autoconf>"
+ echo "<$gnu_software_URL/m4/>"
+ echo "<$perl_URL>"
+ ;;
+ autoconf|autom4te|autoheader)
+ echo "The '$1' program is part of the GNU Autoconf package:"
+ echo "<$gnu_software_URL/autoconf/>"
+ echo "It also requires GNU m4 and Perl in order to run:"
+ echo "<$gnu_software_URL/m4/>"
+ echo "<$perl_URL>"
+ ;;
+ esac
+}
+
+give_advice ()
+{
+ # Normalize program name to check for.
+ normalized_program=`echo "$1" | sed '
+ s/^gnu-//; t
+ s/^gnu//; t
+ s/^g//; t'`
+
+ printf '%s\n' "'$1' is $msg."
+
+ configure_deps="'configure.ac' or m4 files included by 'configure.ac'"
+ case $normalized_program in
+ autoconf*)
+ echo "You should only need it if you modified 'configure.ac',"
+ echo "or m4 files included by it."
+ program_details 'autoconf'
+ ;;
+ autoheader*)
+ echo "You should only need it if you modified 'acconfig.h' or"
+ echo "$configure_deps."
+ program_details 'autoheader'
+ ;;
+ automake*)
+ echo "You should only need it if you modified 'Makefile.am' or"
+ echo "$configure_deps."
+ program_details 'automake'
+ ;;
+ aclocal*)
+ echo "You should only need it if you modified 'acinclude.m4' or"
+ echo "$configure_deps."
+ program_details 'aclocal'
+ ;;
+ autom4te*)
+ echo "You might have modified some maintainer files that require"
+ echo "the 'automa4te' program to be rebuilt."
+ program_details 'autom4te'
+ ;;
+ bison*|yacc*)
+ echo "You should only need it if you modified a '.y' file."
+ echo "You may want to install the GNU Bison package:"
+ echo "<$gnu_software_URL/bison/>"
+ ;;
+ lex*|flex*)
+ echo "You should only need it if you modified a '.l' file."
+ echo "You may want to install the Fast Lexical Analyzer package:"
+ echo "<$flex_URL>"
+ ;;
+ help2man*)
+ echo "You should only need it if you modified a dependency" \
+ "of a man page."
+ echo "You may want to install the GNU Help2man package:"
+ echo "<$gnu_software_URL/help2man/>"
+ ;;
+ makeinfo*)
+ echo "You should only need it if you modified a '.texi' file, or"
+ echo "any other file indirectly affecting the aspect of the manual."
+ echo "You might want to install the Texinfo package:"
+ echo "<$gnu_software_URL/texinfo/>"
+ echo "The spurious makeinfo call might also be the consequence of"
+ echo "using a buggy 'make' (AIX, DU, IRIX), in which case you might"
+ echo "want to install GNU make:"
+ echo "<$gnu_software_URL/make/>"
+ ;;
+ *)
+ echo "You might have modified some files without having the proper"
+ echo "tools for further handling them. Check the 'README' file, it"
+ echo "often tells you about the needed prerequisites for installing"
+ echo "this package. You may also peek at any GNU archive site, in"
+ echo "case some other package contains this missing '$1' program."
+ ;;
+ esac
+}
+
+give_advice "$1" | sed -e '1s/^/WARNING: /' \
+ -e '2,$s/^/ /' >&2
+
+# Propagate the correct exit status (expected to be 127 for a program
+# not found, 63 for a program that failed due to version mismatch).
+exit $st
+
+# Local variables:
+# eval: (add-hook 'write-file-hooks 'time-stamp)
+# time-stamp-start: "scriptversion="
+# time-stamp-format: "%:y-%02m-%02d.%02H"
+# time-stamp-time-zone: "UTC"
+# time-stamp-end: "; # UTC"
+# End:
diff --git a/scripts/cppcheck.sh b/scripts/cppcheck.sh
new file mode 100755
index 00000000..0cbcee74
--- /dev/null
+++ b/scripts/cppcheck.sh
@@ -0,0 +1,9 @@
+#!/bin/bash
+
+if [ $# -gt 0 ]
+then
+ eval cppcheck --enable=all "$@"
+else
+ eval cppcheck --enable=all ../src/ ../test/
+fi
+
diff --git a/scripts/cpuprofile.sh b/scripts/cpuprofile.sh
new file mode 100755
index 00000000..9557adb5
--- /dev/null
+++ b/scripts/cpuprofile.sh
@@ -0,0 +1,5 @@
+#!/bin/bash
+
+LD_PRELOAD="/usr/lib64/libprofiler.so.0" CPUPROFILE=../text/ui.prof ../test/ui
+pprof --gv ../test/ui ../test/ui.prof
+
diff --git a/scripts/disassemble.sh b/scripts/disassemble.sh
new file mode 100755
index 00000000..93abc6ed
--- /dev/null
+++ b/scripts/disassemble.sh
@@ -0,0 +1,3 @@
+#!/bin/sh
+
+hte ../test/.libs/ui
diff --git a/scripts/library_calls.sh b/scripts/library_calls.sh
new file mode 100755
index 00000000..e8d17c4c
--- /dev/null
+++ b/scripts/library_calls.sh
@@ -0,0 +1,10 @@
+#!/bin/bash
+
+# Protokoliert Funktionsaufrufe in dynamisch hinzugelinkten Bibliotheken
+
+PROG="ui"
+
+ltrace -o ./$PROG.ltrace ../test/.libs/$PROG
+less ./$PROG.ltrace
+rm -f ./$PROG.ltrace
+
diff --git a/scripts/profile.sh b/scripts/profile.sh
new file mode 100755
index 00000000..a6511725
--- /dev/null
+++ b/scripts/profile.sh
@@ -0,0 +1,12 @@
+#!/bin/bash
+
+DIR="$PWD"
+cd ../src
+make clean
+make profile
+./finalcut
+gprof ./finalcut >./profile.txt
+rm ./gmon.out
+less ./profile.txt
+rm ./profile.txt
+cd "$DIR"
diff --git a/scripts/remove_eol_spaces.sh b/scripts/remove_eol_spaces.sh
new file mode 100755
index 00000000..88c4dadd
--- /dev/null
+++ b/scripts/remove_eol_spaces.sh
@@ -0,0 +1,8 @@
+#!/bin/bash
+
+find ../src/ \
+ ../test/ \
+ -regextype posix-egrep \
+ -regex ".*\.(cpp|h)$" \
+ -exec sed -i 's/ *$//' "{}" \;
+
diff --git a/scripts/show_graph_font.sh b/scripts/show_graph_font.sh
new file mode 100755
index 00000000..adfcab15
--- /dev/null
+++ b/scripts/show_graph_font.sh
@@ -0,0 +1,3 @@
+#!/bin/bash
+xfd -center -columns 16 -fn -misc-8x16graph-medium-r-normal--16-160-75-75-C-80-iso8859-1
+
diff --git a/scripts/showconsolefont.sh b/scripts/showconsolefont.sh
new file mode 100755
index 00000000..4b722fe8
--- /dev/null
+++ b/scripts/showconsolefont.sh
@@ -0,0 +1,3 @@
+#!/bin/sh
+showconsolefont
+
diff --git a/scripts/syscall_statistic.sh b/scripts/syscall_statistic.sh
new file mode 100755
index 00000000..87392e7f
--- /dev/null
+++ b/scripts/syscall_statistic.sh
@@ -0,0 +1,3 @@
+#!/bin/sh
+strace -c ../test/.libs/ui
+
diff --git a/scripts/valgrind.sh b/scripts/valgrind.sh
new file mode 100755
index 00000000..e6827a25
--- /dev/null
+++ b/scripts/valgrind.sh
@@ -0,0 +1,7 @@
+#!/bin/bash
+
+# Findet uninitialisiertem Speicher, Pufferüberläufe, Speicherlecks und entdeckt Speicherzugriffe auf freigegebene Bereiche
+
+LD_LIBRARY_PATH=../src/.libs/ valgrind --tool=memcheck --suppressions=../doc/ncurses.supp --leak-check=yes --show-reachable=yes --num-callers=20 --track-fds=yes --track-origins=yes --log-file=./valgrind.txt ../test/.libs/ui "$@"
+less ./valgrind.txt
+rm -f ./valgrind.txt
diff --git a/scripts/xterm-latin1.sh b/scripts/xterm-latin1.sh
new file mode 100755
index 00000000..7e238337
--- /dev/null
+++ b/scripts/xterm-latin1.sh
@@ -0,0 +1,3 @@
+#!/bin/sh
+luit -encoding POSIX ../test/ui
+
diff --git a/src/Makefile.am b/src/Makefile.am
new file mode 100644
index 00000000..d2e02392
--- /dev/null
+++ b/src/Makefile.am
@@ -0,0 +1,76 @@
+#----------------------------------------------------------------------
+# Makefile.am - The Final Cut library
+#----------------------------------------------------------------------
+
+SUBDIRS = fonts
+
+AM_CPPFLAGS = -Wall -Werror
+
+lib_LTLIBRARIES = libfinal.la
+
+libfinal_la_SOURCES = \
+ fstring.cpp \
+ fpoint.cpp \
+ frect.cpp \
+ fscrollbar.cpp \
+ fprogressbar.cpp \
+ flineedit.cpp \
+ fbutton.cpp \
+ fbuttongroup.cpp \
+ ftogglebutton.cpp \
+ fradiobutton.cpp \
+ fcheckbox.cpp \
+ flabel.cpp \
+ flistbox.cpp \
+ fdialog.cpp \
+ fwindow.cpp \
+ fmessagebox.cpp \
+ ffiledialog.cpp \
+ ftextview.cpp \
+ fstatusbar.cpp \
+ fterm.cpp \
+ fevent.cpp \
+ foptimove.cpp \
+ fapp.cpp \
+ fwidget.cpp \
+ fobject.cpp
+
+libfinal_la_LDFLAGS = -version-info @SO_VERSION@
+
+finalcutincludedir = $(includedir)/final
+
+finalcutinclude_HEADERS = \
+ fapp.h \
+ fbutton.h \
+ fbuttongroup.h \
+ fcharmap.h \
+ fcheckbox.h \
+ fdialog.h \
+ fenum.h \
+ fevent.h \
+ ffiledialog.h \
+ final.h \
+ fkey_map.h \
+ flabel.h \
+ flineedit.h \
+ flistbox.h \
+ fmessagebox.h \
+ fobject.h \
+ foptimove.h \
+ fpoint.h \
+ fprogressbar.h \
+ fradiobutton.h \
+ frect.h \
+ fscrollbar.h \
+ fstatusbar.h \
+ fstring.h \
+ ftcap_map.h \
+ fterm.h \
+ ftextview.h \
+ ftogglebutton.h \
+ fwidget.h \
+ fwindow.h
+
+#uninstall:
+# rm -R -f $(includedir)/final
+
diff --git a/src/Makefile.clang b/src/Makefile.clang
new file mode 100644
index 00000000..f6deac01
--- /dev/null
+++ b/src/Makefile.clang
@@ -0,0 +1,129 @@
+#-----------------------------------------------------------------------------
+# Makefile for Final Cut
+#-----------------------------------------------------------------------------
+
+# This is where make install will install the library
+LIBDIR = /usr/local/lib64
+INCLUDEDIR = /usr/local/include/final
+INCLUDE_HEADERS = fapp.h \
+ fbuttongroup.h \
+ fbutton.h \
+ fcheckbox.h \
+ fdialog.h \
+ fevent.h \
+ ffiledialog.h \
+ final.h \
+ flabel.h \
+ flineedit.h \
+ flistbox.h \
+ fmessagebox.h \
+ fobject.h \
+ foptimove.h \
+ fpoint.h \
+ fprogressbar.h \
+ fradiobutton.h \
+ frect.h \
+ fscrollbar.h \
+ fstatusbar.h \
+ fstring.h \
+ fterm.h \
+ ftextview.h \
+ ftogglebutton.h \
+ fwidget.h \
+ fwindow.h
+
+# compiler parameter
+CXX = clang++
+CCXFLAGS = $(OPTIMIZE) $(PROFILE) $(DEBUG) $(GPM) -march=x86-64 -frtti -fexceptions
+MAKEFILE = -f Makefile.clang
+LDFLAGS = $(TERMCAP) -lgpm
+INCLUDES = -I./
+GPM = -D HAVE_LIBGPM
+RM = rm -f
+LIB = libfinal.so
+OBJS = fstring.o \
+ fpoint.o \
+ frect.o \
+ fscrollbar.o \
+ fprogressbar.o \
+ flineedit.o \
+ fbutton.o \
+ fbuttongroup.o \
+ ftogglebutton.o \
+ fradiobutton.o \
+ fcheckbox.o \
+ flabel.o \
+ flistbox.o \
+ fdialog.o \
+ fwindow.o \
+ fmessagebox.o \
+ ffiledialog.o \
+ ftextview.o \
+ fstatusbar.o \
+ fterm.o \
+ fevent.o \
+ foptimove.o \
+ fapp.o \
+ fwidget.o \
+ fobject.o
+
+TERMCAP := $(shell test -n "$$(ldd {/usr,}/lib64/libncursesw.so.5 2>/dev/null | grep libtinfo)" && echo "-ltinfo" || echo "-lncurses")
+
+ifdef DEBUG
+ OPTIMIZE = -O0
+else
+ OPTIMIZE = -O2
+endif
+
+.SUFFIXES: .cpp
+
+# $@ = name of the targets
+# $< = the first dependency
+.cpp.o:
+ $(CXX) -c $(CCXFLAGS) -fpic -o $@ $<
+
+all: dep $(OBJS)
+ $(CXX) $(CCXFLAGS) $(INCLUDES) $(LDFLAGS) -shared -Wl,-soname,$(LIB).0 -o $(LIB).0.1.0 $(OBJS)
+ ln -s -f $(LIB).0.1.0 libfinal.so.0
+ ln -s -f $(LIB).0 libfinal.so
+
+$(LIB): all
+
+debug:
+ $(MAKE) $(MAKEFILE) DEBUG="-g -D DEBUG -W -Wall -Weverything -Wpadded -pedantic"
+
+profile:
+ $(MAKE) $(MAKEFILE) PROFILE="-pg"
+
+install: $(LIB)
+ mkdir -p $(LIBDIR)
+ install -c $(LIB).0.1.0 $(LIBDIR)/$(LIB).0.1.0
+ ln -s -f $(LIB).0.1.0 $(LIBDIR)/libfinal.so.0
+ ln -s -f $(LIB).0 $(LIBDIR)/libfinal.so
+ ldconfig
+ mkdir -p $(INCLUDEDIR)
+ @list='$(INCLUDE_HEADERS)'; for h in $$list; \
+ do \
+ install -m 644 $$h $(INCLUDEDIR)/$$h; \
+ done
+
+uninstall: $(INCLUDE_HEADERS)
+ $(RM) $(LIBDIR)/$(LIB).0.1.0 $(LIBDIR)/libfinal.so.0 $(LIBDIR)/libfinal.so
+ @list='$(INCLUDE_HEADERS)'; for h in $$list; \
+ do \
+ $(RM) $(INCLUDEDIR)/$$h; \
+ done
+ rmdir $(INCLUDEDIR)
+
+.PHONY: clean dep
+clean:
+ $(RM) $(LIB)* $(OBJS) .depend *.gch *.plist *~
+
+dep:
+ $(CXX) -MM *.cpp >.depend
+
+#
+# include .depend if it exists
+#
+
+-include .depend
diff --git a/src/Makefile.gcc b/src/Makefile.gcc
new file mode 100644
index 00000000..51dabfa8
--- /dev/null
+++ b/src/Makefile.gcc
@@ -0,0 +1,129 @@
+#-----------------------------------------------------------------------------
+# Makefile for Final Cut
+#-----------------------------------------------------------------------------
+
+# This is where make install will install the library
+LIBDIR = /usr/local/lib64
+INCLUDEDIR = /usr/local/include/final
+INCLUDE_HEADERS = fapp.h \
+ fbuttongroup.h \
+ fbutton.h \
+ fcheckbox.h \
+ fdialog.h \
+ fevent.h \
+ ffiledialog.h \
+ final.h \
+ flabel.h \
+ flineedit.h \
+ flistbox.h \
+ fmessagebox.h \
+ fobject.h \
+ foptimove.h \
+ fpoint.h \
+ fprogressbar.h \
+ fradiobutton.h \
+ frect.h \
+ fscrollbar.h \
+ fstatusbar.h \
+ fstring.h \
+ fterm.h \
+ ftextview.h \
+ ftogglebutton.h \
+ fwidget.h \
+ fwindow.h
+
+# compiler parameter
+CXX = g++
+CCXFLAGS = $(OPTIMIZE) $(PROFILE) $(DEBUG) $(GPM) -march=x86-64 -frtti -fexceptions
+MAKEFILE = -f Makefile.gcc
+LDFLAGS = $(TERMCAP) -lgpm
+INCLUDES = -I./
+GPM = -D HAVE_LIBGPM
+RM = rm -f
+LIB = libfinal.so
+OBJS = fstring.o \
+ fpoint.o \
+ frect.o \
+ fscrollbar.o \
+ fprogressbar.o \
+ flineedit.o \
+ fbutton.o \
+ fbuttongroup.o \
+ ftogglebutton.o \
+ fradiobutton.o \
+ fcheckbox.o \
+ flabel.o \
+ flistbox.o \
+ fdialog.o \
+ fwindow.o \
+ fmessagebox.o \
+ ffiledialog.o \
+ ftextview.o \
+ fstatusbar.o \
+ fterm.o \
+ fevent.o \
+ foptimove.o \
+ fapp.o \
+ fwidget.o \
+ fobject.o
+
+TERMCAP := $(shell test -n "$$(ldd {/usr,}/lib64/libncursesw.so.5 2>/dev/null | grep libtinfo)" && echo "-ltinfo" || echo "-lncurses")
+
+ifdef DEBUG
+ OPTIMIZE = -O0
+else
+ OPTIMIZE = -O2
+endif
+
+.SUFFIXES: .cpp
+
+# $@ = name of the targets
+# $< = the first dependency
+.cpp.o:
+ $(CXX) -c $(CCXFLAGS) -fpic -o $@ $<
+
+all: dep $(OBJS)
+ $(CXX) $(CCXFLAGS) $(INCLUDES) $(LDFLAGS) -shared -Wl,-soname,$(LIB).0 -o $(LIB).0.1.0 $(OBJS)
+ ln -s -f $(LIB).0.1.0 libfinal.so.0
+ ln -s -f $(LIB).0 libfinal.so
+
+$(LIB): all
+
+debug:
+ $(MAKE) $(MAKEFILE) DEBUG="-g -D DEBUG -W -Wall -pedantic"
+
+profile:
+ $(MAKE) $(MAKEFILE) PROFILE="-pg"
+
+install: $(LIB)
+ mkdir -p $(LIBDIR)
+ install -c $(LIB).0.1.0 $(LIBDIR)/$(LIB).0.1.0
+ ln -s -f $(LIB).0.1.0 $(LIBDIR)/libfinal.so.0
+ ln -s -f $(LIB).0 $(LIBDIR)/libfinal.so
+ ldconfig
+ mkdir -p $(INCLUDEDIR)
+ @list='$(INCLUDE_HEADERS)'; for h in $$list; \
+ do \
+ install -m 644 $$h $(INCLUDEDIR)/$$h; \
+ done
+
+uninstall: $(INCLUDE_HEADERS)
+ $(RM) $(LIBDIR)/$(LIB).0.1.0 $(LIBDIR)/libfinal.so.0 $(LIBDIR)/libfinal.so
+ @list='$(INCLUDE_HEADERS)'; for h in $$list; \
+ do \
+ $(RM) $(INCLUDEDIR)/$$h; \
+ done
+ rmdir $(INCLUDEDIR)
+
+.PHONY: clean dep
+clean:
+ $(RM) $(LIB)* $(OBJS) .depend *.prof *~
+
+dep:
+ $(CXX) -MM *.cpp >.depend
+
+#
+# include .depend if it exists
+#
+
+-include .depend
diff --git a/src/Makefile.in b/src/Makefile.in
new file mode 100644
index 00000000..2dcee849
--- /dev/null
+++ b/src/Makefile.in
@@ -0,0 +1,875 @@
+# Makefile.in generated by automake 1.13.4 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+#----------------------------------------------------------------------
+# Makefile.am - The Final Cut library
+#----------------------------------------------------------------------
+
+
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = src
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am \
+ $(top_srcdir)/depcomp $(finalcutinclude_HEADERS)
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/libtool.m4 \
+ $(top_srcdir)/m4/ltoptions.m4 $(top_srcdir)/m4/ltsugar.m4 \
+ $(top_srcdir)/m4/ltversion.m4 $(top_srcdir)/m4/lt~obsolete.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
+am__vpath_adj = case $$p in \
+ $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \
+ *) f=$$p;; \
+ esac;
+am__strip_dir = f=`echo $$p | sed -e 's|^.*/||'`;
+am__install_max = 40
+am__nobase_strip_setup = \
+ srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*|]/\\\\&/g'`
+am__nobase_strip = \
+ for p in $$list; do echo "$$p"; done | sed -e "s|$$srcdirstrip/||"
+am__nobase_list = $(am__nobase_strip_setup); \
+ for p in $$list; do echo "$$p $$p"; done | \
+ sed "s| $$srcdirstrip/| |;"' / .*\//!s/ .*/ ./; s,\( .*\)/[^/]*$$,\1,' | \
+ $(AWK) 'BEGIN { files["."] = "" } { files[$$2] = files[$$2] " " $$1; \
+ if (++n[$$2] == $(am__install_max)) \
+ { print $$2, files[$$2]; n[$$2] = 0; files[$$2] = "" } } \
+ END { for (dir in files) print dir, files[dir] }'
+am__base_list = \
+ sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
+ sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+ test -z "$$files" \
+ || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+ || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+ $(am__cd) "$$dir" && rm -f $$files; }; \
+ }
+am__installdirs = "$(DESTDIR)$(libdir)" \
+ "$(DESTDIR)$(finalcutincludedir)"
+LTLIBRARIES = $(lib_LTLIBRARIES)
+libfinal_la_LIBADD =
+am_libfinal_la_OBJECTS = fstring.lo fpoint.lo frect.lo fscrollbar.lo \
+ fprogressbar.lo flineedit.lo fbutton.lo fbuttongroup.lo \
+ ftogglebutton.lo fradiobutton.lo fcheckbox.lo flabel.lo \
+ flistbox.lo fdialog.lo fwindow.lo fmessagebox.lo \
+ ffiledialog.lo ftextview.lo fstatusbar.lo fterm.lo fevent.lo \
+ foptimove.lo fapp.lo fwidget.lo fobject.lo
+libfinal_la_OBJECTS = $(am_libfinal_la_OBJECTS)
+AM_V_lt = $(am__v_lt_@AM_V@)
+am__v_lt_ = $(am__v_lt_@AM_DEFAULT_V@)
+am__v_lt_0 = --silent
+am__v_lt_1 =
+libfinal_la_LINK = $(LIBTOOL) $(AM_V_lt) --tag=CXX $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=link $(CXXLD) $(AM_CXXFLAGS) \
+ $(CXXFLAGS) $(libfinal_la_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+DEFAULT_INCLUDES = -I.@am__isrc@
+depcomp = $(SHELL) $(top_srcdir)/depcomp
+am__depfiles_maybe = depfiles
+am__mv = mv -f
+CXXCOMPILE = $(CXX) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) \
+ $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CXXFLAGS) $(CXXFLAGS)
+LTCXXCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CXX $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=compile $(CXX) $(DEFS) \
+ $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \
+ $(AM_CXXFLAGS) $(CXXFLAGS)
+AM_V_CXX = $(am__v_CXX_@AM_V@)
+am__v_CXX_ = $(am__v_CXX_@AM_DEFAULT_V@)
+am__v_CXX_0 = @echo " CXX " $@;
+am__v_CXX_1 =
+CXXLD = $(CXX)
+CXXLINK = $(LIBTOOL) $(AM_V_lt) --tag=CXX $(AM_LIBTOOLFLAGS) \
+ $(LIBTOOLFLAGS) --mode=link $(CXXLD) $(AM_CXXFLAGS) \
+ $(CXXFLAGS) $(AM_LDFLAGS) $(LDFLAGS) -o $@
+AM_V_CXXLD = $(am__v_CXXLD_@AM_V@)
+am__v_CXXLD_ = $(am__v_CXXLD_@AM_DEFAULT_V@)
+am__v_CXXLD_0 = @echo " CXXLD " $@;
+am__v_CXXLD_1 =
+SOURCES = $(libfinal_la_SOURCES)
+DIST_SOURCES = $(libfinal_la_SOURCES)
+RECURSIVE_TARGETS = all-recursive check-recursive cscopelist-recursive \
+ ctags-recursive dvi-recursive html-recursive info-recursive \
+ install-data-recursive install-dvi-recursive \
+ install-exec-recursive install-html-recursive \
+ install-info-recursive install-pdf-recursive \
+ install-ps-recursive install-recursive installcheck-recursive \
+ installdirs-recursive pdf-recursive ps-recursive \
+ tags-recursive uninstall-recursive
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+HEADERS = $(finalcutinclude_HEADERS)
+RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive \
+ distclean-recursive maintainer-clean-recursive
+am__recursive_targets = \
+ $(RECURSIVE_TARGETS) \
+ $(RECURSIVE_CLEAN_TARGETS) \
+ $(am__extra_recursive_targets)
+AM_RECURSIVE_TARGETS = $(am__recursive_targets:-recursive=) TAGS CTAGS \
+ distdir
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+# Read a list of newline-separated strings from the standard input,
+# and print each of them once, without duplicates. Input order is
+# *not* preserved.
+am__uniquify_input = $(AWK) '\
+ BEGIN { nonempty = 0; } \
+ { items[$$0] = 1; nonempty = 1; } \
+ END { if (nonempty) { for (i in items) print i; }; } \
+'
+# Make sure the list of sources is unique. This is necessary because,
+# e.g., the same source file might be shared among _SOURCES variables
+# for different programs/libraries.
+am__define_uniq_tagged_files = \
+ list='$(am__tagged_files)'; \
+ unique=`for i in $$list; do \
+ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \
+ done | $(am__uniquify_input)`
+ETAGS = etags
+CTAGS = ctags
+DIST_SUBDIRS = $(SUBDIRS)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+am__relativize = \
+ dir0=`pwd`; \
+ sed_first='s,^\([^/]*\)/.*$$,\1,'; \
+ sed_rest='s,^[^/]*/*,,'; \
+ sed_last='s,^.*/\([^/]*\)$$,\1,'; \
+ sed_butlast='s,/*[^/]*$$,,'; \
+ while test -n "$$dir1"; do \
+ first=`echo "$$dir1" | sed -e "$$sed_first"`; \
+ if test "$$first" != "."; then \
+ if test "$$first" = ".."; then \
+ dir2=`echo "$$dir0" | sed -e "$$sed_last"`/"$$dir2"; \
+ dir0=`echo "$$dir0" | sed -e "$$sed_butlast"`; \
+ else \
+ first2=`echo "$$dir2" | sed -e "$$sed_first"`; \
+ if test "$$first2" = "$$first"; then \
+ dir2=`echo "$$dir2" | sed -e "$$sed_rest"`; \
+ else \
+ dir2="../$$dir2"; \
+ fi; \
+ dir0="$$dir0"/"$$first"; \
+ fi; \
+ fi; \
+ dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \
+ done; \
+ reldir="$$dir2"
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIBTOOL_DEPS = @LIBTOOL_DEPS@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+SO_VERSION = @SO_VERSION@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+SUBDIRS = fonts
+AM_CPPFLAGS = -Wall -Werror
+lib_LTLIBRARIES = libfinal.la
+libfinal_la_SOURCES = \
+ fstring.cpp \
+ fpoint.cpp \
+ frect.cpp \
+ fscrollbar.cpp \
+ fprogressbar.cpp \
+ flineedit.cpp \
+ fbutton.cpp \
+ fbuttongroup.cpp \
+ ftogglebutton.cpp \
+ fradiobutton.cpp \
+ fcheckbox.cpp \
+ flabel.cpp \
+ flistbox.cpp \
+ fdialog.cpp \
+ fwindow.cpp \
+ fmessagebox.cpp \
+ ffiledialog.cpp \
+ ftextview.cpp \
+ fstatusbar.cpp \
+ fterm.cpp \
+ fevent.cpp \
+ foptimove.cpp \
+ fapp.cpp \
+ fwidget.cpp \
+ fobject.cpp
+
+libfinal_la_LDFLAGS = -version-info @SO_VERSION@
+finalcutincludedir = $(includedir)/final
+finalcutinclude_HEADERS = \
+ fapp.h \
+ fbutton.h \
+ fbuttongroup.h \
+ fcharmap.h \
+ fcheckbox.h \
+ fdialog.h \
+ fenum.h \
+ fevent.h \
+ ffiledialog.h \
+ final.h \
+ fkey_map.h \
+ flabel.h \
+ flineedit.h \
+ flistbox.h \
+ fmessagebox.h \
+ fobject.h \
+ foptimove.h \
+ fpoint.h \
+ fprogressbar.h \
+ fradiobutton.h \
+ frect.h \
+ fscrollbar.h \
+ fstatusbar.h \
+ fstring.h \
+ ftcap_map.h \
+ fterm.h \
+ ftextview.h \
+ ftogglebutton.h \
+ fwidget.h \
+ fwindow.h
+
+all: all-recursive
+
+.SUFFIXES:
+.SUFFIXES: .cpp .lo .o .obj
+$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu src/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --gnu src/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+install-libLTLIBRARIES: $(lib_LTLIBRARIES)
+ @$(NORMAL_INSTALL)
+ @list='$(lib_LTLIBRARIES)'; test -n "$(libdir)" || list=; \
+ list2=; for p in $$list; do \
+ if test -f $$p; then \
+ list2="$$list2 $$p"; \
+ else :; fi; \
+ done; \
+ test -z "$$list2" || { \
+ echo " $(MKDIR_P) '$(DESTDIR)$(libdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(libdir)" || exit 1; \
+ echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 '$(DESTDIR)$(libdir)'"; \
+ $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=install $(INSTALL) $(INSTALL_STRIP_FLAG) $$list2 "$(DESTDIR)$(libdir)"; \
+ }
+
+uninstall-libLTLIBRARIES:
+ @$(NORMAL_UNINSTALL)
+ @list='$(lib_LTLIBRARIES)'; test -n "$(libdir)" || list=; \
+ for p in $$list; do \
+ $(am__strip_dir) \
+ echo " $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f '$(DESTDIR)$(libdir)/$$f'"; \
+ $(LIBTOOL) $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=uninstall rm -f "$(DESTDIR)$(libdir)/$$f"; \
+ done
+
+clean-libLTLIBRARIES:
+ -test -z "$(lib_LTLIBRARIES)" || rm -f $(lib_LTLIBRARIES)
+ @list='$(lib_LTLIBRARIES)'; \
+ locs=`for p in $$list; do echo $$p; done | \
+ sed 's|^[^/]*$$|.|; s|/[^/]*$$||; s|$$|/so_locations|' | \
+ sort -u`; \
+ test -z "$$locs" || { \
+ echo rm -f $${locs}; \
+ rm -f $${locs}; \
+ }
+
+libfinal.la: $(libfinal_la_OBJECTS) $(libfinal_la_DEPENDENCIES) $(EXTRA_libfinal_la_DEPENDENCIES)
+ $(AM_V_CXXLD)$(libfinal_la_LINK) -rpath $(libdir) $(libfinal_la_OBJECTS) $(libfinal_la_LIBADD) $(LIBS)
+
+mostlyclean-compile:
+ -rm -f *.$(OBJEXT)
+
+distclean-compile:
+ -rm -f *.tab.c
+
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fapp.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fbutton.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fbuttongroup.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fcheckbox.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fdialog.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fevent.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ffiledialog.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/flabel.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/flineedit.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/flistbox.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fmessagebox.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fobject.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/foptimove.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fpoint.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fprogressbar.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fradiobutton.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/frect.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fscrollbar.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fstatusbar.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fstring.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fterm.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ftextview.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ftogglebutton.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fwidget.Plo@am__quote@
+@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/fwindow.Plo@am__quote@
+
+.cpp.o:
+@am__fastdepCXX_TRUE@ $(AM_V_CXX)$(CXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCXX_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCXX_FALSE@ $(AM_V_CXX)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCXX_FALSE@ DEPDIR=$(DEPDIR) $(CXXDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCXX_FALSE@ $(AM_V_CXX@am__nodep@)$(CXXCOMPILE) -c -o $@ $<
+
+.cpp.obj:
+@am__fastdepCXX_TRUE@ $(AM_V_CXX)$(CXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'`
+@am__fastdepCXX_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po
+@AMDEP_TRUE@@am__fastdepCXX_FALSE@ $(AM_V_CXX)source='$<' object='$@' libtool=no @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCXX_FALSE@ DEPDIR=$(DEPDIR) $(CXXDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCXX_FALSE@ $(AM_V_CXX@am__nodep@)$(CXXCOMPILE) -c -o $@ `$(CYGPATH_W) '$<'`
+
+.cpp.lo:
+@am__fastdepCXX_TRUE@ $(AM_V_CXX)$(LTCXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $<
+@am__fastdepCXX_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo
+@AMDEP_TRUE@@am__fastdepCXX_FALSE@ $(AM_V_CXX)source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@
+@AMDEP_TRUE@@am__fastdepCXX_FALSE@ DEPDIR=$(DEPDIR) $(CXXDEPMODE) $(depcomp) @AMDEPBACKSLASH@
+@am__fastdepCXX_FALSE@ $(AM_V_CXX@am__nodep@)$(LTCXXCOMPILE) -c -o $@ $<
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+install-finalcutincludeHEADERS: $(finalcutinclude_HEADERS)
+ @$(NORMAL_INSTALL)
+ @list='$(finalcutinclude_HEADERS)'; test -n "$(finalcutincludedir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(finalcutincludedir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(finalcutincludedir)" || exit 1; \
+ fi; \
+ for p in $$list; do \
+ if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
+ echo "$$d$$p"; \
+ done | $(am__base_list) | \
+ while read files; do \
+ echo " $(INSTALL_HEADER) $$files '$(DESTDIR)$(finalcutincludedir)'"; \
+ $(INSTALL_HEADER) $$files "$(DESTDIR)$(finalcutincludedir)" || exit $$?; \
+ done
+
+uninstall-finalcutincludeHEADERS:
+ @$(NORMAL_UNINSTALL)
+ @list='$(finalcutinclude_HEADERS)'; test -n "$(finalcutincludedir)" || list=; \
+ files=`for p in $$list; do echo $$p; done | sed -e 's|^.*/||'`; \
+ dir='$(DESTDIR)$(finalcutincludedir)'; $(am__uninstall_files_from_dir)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run 'make' without going through this Makefile.
+# To change the values of 'make' variables: instead of editing Makefiles,
+# (1) if the variable is set in 'config.status', edit 'config.status'
+# (which will cause the Makefiles to be regenerated when you run 'make');
+# (2) otherwise, pass the desired values on the 'make' command line.
+$(am__recursive_targets):
+ @fail=; \
+ if $(am__make_keepgoing); then \
+ failcom='fail=yes'; \
+ else \
+ failcom='exit 1'; \
+ fi; \
+ dot_seen=no; \
+ target=`echo $@ | sed s/-recursive//`; \
+ case "$@" in \
+ distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \
+ *) list='$(SUBDIRS)' ;; \
+ esac; \
+ for subdir in $$list; do \
+ echo "Making $$target in $$subdir"; \
+ if test "$$subdir" = "."; then \
+ dot_seen=yes; \
+ local_target="$$target-am"; \
+ else \
+ local_target="$$target"; \
+ fi; \
+ ($(am__cd) $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \
+ || eval $$failcom; \
+ done; \
+ if test "$$dot_seen" = "no"; then \
+ $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \
+ fi; test -z "$$fail"
+
+ID: $(am__tagged_files)
+ $(am__define_uniq_tagged_files); mkid -fID $$unique
+tags: tags-recursive
+TAGS: tags
+
+tags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ set x; \
+ here=`pwd`; \
+ if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \
+ include_option=--etags-include; \
+ empty_fix=.; \
+ else \
+ include_option=--include; \
+ empty_fix=; \
+ fi; \
+ list='$(SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ test ! -f $$subdir/TAGS || \
+ set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \
+ fi; \
+ done; \
+ $(am__define_uniq_tagged_files); \
+ shift; \
+ if test -z "$(ETAGS_ARGS)$$*$$unique"; then :; else \
+ test -n "$$unique" || unique=$$empty_fix; \
+ if test $$# -gt 0; then \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ "$$@" $$unique; \
+ else \
+ $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \
+ $$unique; \
+ fi; \
+ fi
+ctags: ctags-recursive
+
+CTAGS: ctags
+ctags-am: $(TAGS_DEPENDENCIES) $(am__tagged_files)
+ $(am__define_uniq_tagged_files); \
+ test -z "$(CTAGS_ARGS)$$unique" \
+ || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \
+ $$unique
+
+GTAGS:
+ here=`$(am__cd) $(top_builddir) && pwd` \
+ && $(am__cd) $(top_srcdir) \
+ && gtags -i $(GTAGS_ARGS) "$$here"
+cscopelist: cscopelist-recursive
+
+cscopelist-am: $(am__tagged_files)
+ list='$(am__tagged_files)'; \
+ case "$(srcdir)" in \
+ [\\/]* | ?:[\\/]*) sdir="$(srcdir)" ;; \
+ *) sdir=$(subdir)/$(srcdir) ;; \
+ esac; \
+ for i in $$list; do \
+ if test -f "$$i"; then \
+ echo "$(subdir)/$$i"; \
+ else \
+ echo "$$sdir/$$i"; \
+ fi; \
+ done >> $(top_builddir)/cscope.files
+
+distclean-tags:
+ -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags
+
+distdir: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+ @list='$(DIST_SUBDIRS)'; for subdir in $$list; do \
+ if test "$$subdir" = .; then :; else \
+ $(am__make_dryrun) \
+ || test -d "$(distdir)/$$subdir" \
+ || $(MKDIR_P) "$(distdir)/$$subdir" \
+ || exit 1; \
+ dir1=$$subdir; dir2="$(distdir)/$$subdir"; \
+ $(am__relativize); \
+ new_distdir=$$reldir; \
+ dir1=$$subdir; dir2="$(top_distdir)"; \
+ $(am__relativize); \
+ new_top_distdir=$$reldir; \
+ echo " (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir="$$new_top_distdir" distdir="$$new_distdir" \\"; \
+ echo " am__remove_distdir=: am__skip_length_check=: am__skip_mode_fix=: distdir)"; \
+ ($(am__cd) $$subdir && \
+ $(MAKE) $(AM_MAKEFLAGS) \
+ top_distdir="$$new_top_distdir" \
+ distdir="$$new_distdir" \
+ am__remove_distdir=: \
+ am__skip_length_check=: \
+ am__skip_mode_fix=: \
+ distdir) \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-recursive
+all-am: Makefile $(LTLIBRARIES) $(HEADERS)
+installdirs: installdirs-recursive
+installdirs-am:
+ for dir in "$(DESTDIR)$(libdir)" "$(DESTDIR)$(finalcutincludedir)"; do \
+ test -z "$$dir" || $(MKDIR_P) "$$dir"; \
+ done
+install: install-recursive
+install-exec: install-exec-recursive
+install-data: install-data-recursive
+uninstall: uninstall-recursive
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-recursive
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-recursive
+
+clean-am: clean-generic clean-libLTLIBRARIES clean-libtool \
+ mostlyclean-am
+
+distclean: distclean-recursive
+ -rm -rf ./$(DEPDIR)
+ -rm -f Makefile
+distclean-am: clean-am distclean-compile distclean-generic \
+ distclean-tags
+
+dvi: dvi-recursive
+
+dvi-am:
+
+html: html-recursive
+
+html-am:
+
+info: info-recursive
+
+info-am:
+
+install-data-am: install-finalcutincludeHEADERS
+
+install-dvi: install-dvi-recursive
+
+install-dvi-am:
+
+install-exec-am: install-libLTLIBRARIES
+
+install-html: install-html-recursive
+
+install-html-am:
+
+install-info: install-info-recursive
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-recursive
+
+install-pdf-am:
+
+install-ps: install-ps-recursive
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-recursive
+ -rm -rf ./$(DEPDIR)
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-recursive
+
+mostlyclean-am: mostlyclean-compile mostlyclean-generic \
+ mostlyclean-libtool
+
+pdf: pdf-recursive
+
+pdf-am:
+
+ps: ps-recursive
+
+ps-am:
+
+uninstall-am: uninstall-finalcutincludeHEADERS \
+ uninstall-libLTLIBRARIES
+
+.MAKE: $(am__recursive_targets) install-am install-strip
+
+.PHONY: $(am__recursive_targets) CTAGS GTAGS TAGS all all-am check \
+ check-am clean clean-generic clean-libLTLIBRARIES \
+ clean-libtool cscopelist-am ctags ctags-am distclean \
+ distclean-compile distclean-generic distclean-libtool \
+ distclean-tags distdir dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am install-dvi \
+ install-dvi-am install-exec install-exec-am \
+ install-finalcutincludeHEADERS install-html install-html-am \
+ install-info install-info-am install-libLTLIBRARIES \
+ install-man install-pdf install-pdf-am install-ps \
+ install-ps-am install-strip installcheck installcheck-am \
+ installdirs installdirs-am maintainer-clean \
+ maintainer-clean-generic mostlyclean mostlyclean-compile \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags tags-am uninstall uninstall-am \
+ uninstall-finalcutincludeHEADERS uninstall-libLTLIBRARIES
+
+
+#uninstall:
+# rm -R -f $(includedir)/final
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/src/fapp.cpp b/src/fapp.cpp
new file mode 100644
index 00000000..770f720e
--- /dev/null
+++ b/src/fapp.cpp
@@ -0,0 +1,1349 @@
+// fapplication.cpp
+// class FApplication
+
+#include "fapp.h"
+#include "fwindow.h"
+
+// global application object
+static FApplication* rootObj = 0;
+
+// flag to exit local loop
+static bool app_exit_loop = false;
+
+// static attributes
+int FApplication::loop_level = 0; // event loop level
+FWidget* FApplication::main_widget = 0; // main application widget
+FWidget* FApplication::active_window = 0; // the active window
+FWidget* FApplication::focus_widget = 0; // has keyboard input focus
+FWidget* FApplication::clicked_widget = 0; // is focused by click
+FPoint* FApplication::zero_point = 0; // zero point (x=0, y=0)
+int FApplication::quit_code = 0;
+bool FApplication::quit_now = false;
+std::deque* FApplication::event_queue = 0;
+
+//----------------------------------------------------------------------
+// class FApplication
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FApplication::FApplication (int &argc, char* argv[])
+{
+ assert ( ! rootObj
+ && "FApplication: There should be only one application object" );
+
+ rootObj = this;
+ static char* empty = const_cast("");
+
+ if ( argc == 0 || argv == 0 )
+ {
+ argc = 0;
+ argv = ∅
+ }
+
+ init(argc, argv);
+}
+
+//----------------------------------------------------------------------
+FApplication::~FApplication() // destructor
+{
+ if ( zero_point )
+ delete zero_point;
+ if ( event_queue )
+ delete event_queue;
+ rootObj = 0;
+}
+
+
+// private methods of FApplication
+//----------------------------------------------------------------------
+void FApplication::init (int argc, char* argv[])
+{
+ app_argc = argc;
+ app_argv = argv;
+
+ // init keyboard values
+ key = 0;
+ key_timeout = 100000; // 100 ms
+ dblclick_interval = 500000; // 500 ms
+ time_keypressed.tv_sec = 0;
+ time_keypressed.tv_usec = 0;
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ fifo_offset = 0;
+ fifo_in_use = false;
+ fifo_buf_size = sizeof(fifo_buf);
+ x11_button_state = 0x23;
+#ifdef HAVE_LIBGPM
+ gpmMouseEvent = false;
+ gpm_ev.x = -1;
+#endif
+ zero_point = new FPoint(0,0);
+ event_queue = new std::deque;
+ // init arrays with '\0'
+ std::fill_n (k_buf, sizeof(k_buf), '\0');
+ std::fill_n (fifo_buf, fifo_buf_size, '\0');
+ std::fill_n (x11_mouse, sizeof(x11_mouse), '\0');
+ std::fill_n (sgr_mouse, sizeof(sgr_mouse), '\0');
+ std::fill_n (urxvt_mouse, sizeof(urxvt_mouse), '\0');
+ // init bit field with 0
+ memset(&b_state, 0x00, sizeof(b_state));
+ // interpret the command line options
+ cmd_options();
+}
+
+//----------------------------------------------------------------------
+void FApplication::cmd_options ()
+{
+ while ( true )
+ {
+ int c, idx = 0;
+ static struct option long_options[] =
+ {
+ {"encoding", required_argument, 0, 0 },
+ {"vgafont", no_argument, 0, 0 },
+ {"newfont", no_argument, 0, 0 },
+ {0, 0, 0, 0 }
+ };
+ opterr = 0;
+ c = getopt_long ( app_argc, app_argv, "",
+ long_options, &idx );
+ if ( c == -1 )
+ break;
+ if ( c == 0 )
+ {
+ if ( strcmp(long_options[idx].name, "encoding") == 0 )
+ {
+ FString encoding(optarg);
+ encoding = encoding.toUpper();
+ if ( encoding.includes("UTF8")
+ || encoding.includes("VT100")
+ || encoding.includes("PC")
+ || encoding.includes("ASCII") )
+ {
+ setEncoding(encoding.c_str());
+ }
+ }
+ if ( strcmp(long_options[idx].name, "vgafont") == 0 )
+ setVGAFont();
+ if ( strcmp(long_options[idx].name, "newfont") == 0 )
+ setNewFont();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+#ifdef HAVE_LIBGPM
+inline int FApplication::gpmEvent(void)
+{
+ register int result;
+ register int max = (gpm_fd > stdin_no) ? gpm_fd : stdin_no;
+ fd_set ifds;
+ struct timeval tv;
+
+ FD_ZERO(&ifds);
+ FD_SET(stdin_no, &ifds);
+ FD_SET(gpm_fd, &ifds);
+ tv.tv_sec = 0;
+ tv.tv_usec = 100000; // 100 ms
+ result = select (max+1, &ifds, 0, 0, &tv);
+ if ( FD_ISSET(stdin_no, &ifds) )
+ {
+ FD_CLR (stdin_no, &ifds);
+ return keyboard_event;
+ }
+ if ( FD_ISSET(gpm_fd, &ifds) )
+ FD_CLR (gpm_fd, &ifds);
+ if (result > 0)
+ return mouse_event;
+ else
+ return no_event;
+}
+#endif // HAVE_LIBGPM
+
+//----------------------------------------------------------------------
+inline bool FApplication::KeyPressed()
+{
+ register int result;
+ fd_set ifds;
+ struct timeval tv;
+
+ FD_ZERO(&ifds);
+ FD_SET(stdin_no, &ifds);
+ tv.tv_sec = 0;
+ tv.tv_usec = 100000; // 100 ms
+ result = select (stdin_no+1, &ifds, 0, 0, &tv);
+ if ( FD_ISSET(stdin_no, &ifds) )
+ FD_CLR (stdin_no, &ifds);
+ return (result > 0);
+}
+
+//----------------------------------------------------------------------
+inline ssize_t FApplication::readKey()
+{
+ register ssize_t bytes;
+ setNonBlockingInput();
+ bytes = read(stdin_no, &k_buf, sizeof(k_buf)-1);
+ unsetNonBlockingInput();
+ return bytes;
+}
+
+//----------------------------------------------------------------------
+void FApplication::processKeyboardEvent()
+{
+ bool isKeyPressed = false;
+ FWidget* widget = 0;
+
+ if ( focus_widget )
+ widget = static_cast(focus_widget);
+ else
+ {
+ widget = static_cast(main_widget);
+ if ( widget->numOfChildren() >= 1 )
+ widget->focusFirstChild();
+ }
+
+ // empty the buffer on timeout
+ if ( fifo_in_use && widget->isKeyTimeout(&time_keypressed, key_timeout) )
+ {
+ fifo_offset = 0;
+ key = 0;
+ std::fill_n (fifo_buf, fifo_buf_size, '\0');
+ fifo_in_use = false;
+ }
+
+#ifdef HAVE_LIBGPM
+ if ( gpm_mouse_enabled )
+ {
+ gpmMouseEvent = false;
+ int type = gpmEvent();
+ switch ( type )
+ {
+ case mouse_event:
+ gpmMouseEvent = true;
+ break;
+ case keyboard_event:
+ isKeyPressed = true;
+ }
+ }
+ else
+ isKeyPressed = KeyPressed();
+#else // without gpm
+ isKeyPressed = KeyPressed();
+#endif // HAVE_LIBGPM
+
+ if ( isKeyPressed )
+ {
+ register ssize_t bytesread;
+ widget->getCurrentTime(time_keypressed);
+ x11_mouse[0] = sgr_mouse[0] = urxvt_mouse[0] = '\0';
+
+ if ( quit_now || app_exit_loop )
+ return;
+
+ while ( (bytesread = readKey()) > 0 )
+ {
+ if ( bytesread+fifo_offset-1 < fifo_buf_size )
+ {
+ for (int i=0; i < bytesread; i++)
+ {
+ fifo_buf[fifo_offset] = k_buf[i];
+ fifo_offset++;
+ }
+ fifo_in_use = true;
+ }
+
+ // read the rest from the fifo buffer
+ while ( ! widget->isKeyTimeout(&time_keypressed, key_timeout)
+ && fifo_offset
+ && key != NEED_MORE_DATA )
+ {
+ key = FTerm::parseKeyString(fifo_buf, fifo_buf_size, &time_keypressed);
+
+ if ( key != NEED_MORE_DATA )
+ {
+ if ( key == 0x0c ) // Ctrl-L (redraw the screen)
+ this->redraw();
+
+ if ( key == fc::Fkey_mouse )
+ {
+ int n, len;
+ x11_mouse[0] = fifo_buf[3];
+ x11_mouse[1] = fifo_buf[4];
+ x11_mouse[2] = fifo_buf[5];
+ x11_mouse[3] = '\0';
+ len = int(strlen(fifo_buf));
+ n = len;
+
+ for (; n < fifo_buf_size; n++)
+ fifo_buf[n-len] = fifo_buf[n]; // remove the founded entry
+ for (; n-len < len; n++)
+ fifo_buf[n-len] = '\0';
+ }
+ else if ( key == fc::Fkey_extended_mouse )
+ {
+ int n = 3;
+ int len = int(strlen(fifo_buf));
+
+ for (; n < len && n < fifo_buf_size; n++)
+ sgr_mouse[n-3] = fifo_buf[n];
+ sgr_mouse[n-3] = '\0';
+ for (n=len; n < fifo_buf_size; n++)
+ fifo_buf[n-len] = fifo_buf[n]; // remove the founded entry
+ for (; n-len < len; n++)
+ fifo_buf[n-len] = '\0';
+ }
+ else if ( key == fc::Fkey_urxvt_mouse )
+ {
+ int n = 2;
+ int len = int(strlen(fifo_buf));
+
+ for (; n < len && n < fifo_buf_size; n++)
+ urxvt_mouse[n-2] = fifo_buf[n];
+ urxvt_mouse[n-2] = '\0';
+ for (n=len; n < fifo_buf_size; n++)
+ fifo_buf[n-len] = fifo_buf[n]; // remove the founded entry
+ for (; n-len < len; n++)
+ fifo_buf[n-len] = '\0';
+ }
+ else
+ {
+ FKeyEvent k_down_ev(KeyDown_Event, key);
+ sendEvent(widget, &k_down_ev);
+ FKeyEvent k_press_ev(KeyPress_Event, key);
+ sendEvent(widget, &k_press_ev);
+
+ if ( ! k_press_ev.isAccepted() && ! k_down_ev.isAccepted() )
+ {
+ // keyboard accelerator
+ FWidget* window = static_cast(active_window);
+ if ( ! window )
+ window = getRootWidget();
+ if ( window
+ && window->accelerator_list
+ && ! window->accelerator_list->empty() )
+ {
+ FWidget::Accelerators::const_iterator iter, end;
+ iter = window->accelerator_list->begin();
+ end = window->accelerator_list->end();
+
+ while ( iter != end )
+ {
+ if ( quit_now || app_exit_loop )
+ break;
+ if ( iter->key == key )
+ {
+ FAccelEvent a_ev(Accelerator_Event, focus_widget);
+ sendEvent(iter->object, &a_ev);
+ break;
+ };
+ ++iter;
+ }
+ }
+ }
+ } // end of else
+ }
+ fifo_offset = int(strlen(fifo_buf));
+ }
+ FKeyEvent k_up_ev(KeyUp_Event, key);
+ sendEvent(widget, &k_up_ev);
+ key = 0;
+ }
+ std::fill_n (k_buf, sizeof(k_buf), '\0');
+ }
+ // special case: Esc key
+ if ( fifo_in_use
+ && fifo_offset == 1
+ && fifo_buf[0] == 0x1b
+ && fifo_buf[1] == 0x00
+ && isKeyTimeout(&time_keypressed, key_timeout) )
+ {
+ FKeyEvent k_press_ev(KeyPress_Event, fc::Fkey_escape);
+ sendEvent(widget, &k_press_ev);
+ }
+}
+
+//----------------------------------------------------------------------
+bool FApplication::parseX11Mouse()
+{
+ uChar x, y;
+
+ enum x11_btn_states
+ {
+ key_shift = 0x04,
+ key_meta = 0x08,
+ key_ctrl = 0x10,
+ key_button_mask = 0x1c,
+ button1_pressed = 0x20,
+ button2_pressed = 0x21,
+ button3_pressed = 0x22,
+ all_buttons_released = 0x23,
+ button1_pressed_move = 0x40,
+ button2_pressed_move = 0x41,
+ button3_pressed_move = 0x42,
+ button_mask = 0x63,
+ button_up = 0x60,
+ button_down = 0x61
+ };
+
+ x = uChar(x11_mouse[1]) - 0x20;
+ y = uChar(x11_mouse[2]) - 0x20;
+ newMousePosition.setPoint(x,y);
+ memset(&b_state, 0x00, sizeof(b_state));
+
+ if ( (x11_mouse[0] & key_shift) == key_shift )
+ b_state.shift_button = Pressed;
+ if ( (x11_mouse[0] & key_meta) == key_meta )
+ b_state.meta_button = Pressed;
+ if ( (x11_mouse[0] & key_ctrl) == key_ctrl )
+ b_state.control_button = Pressed;
+
+ if ( (x11_mouse[0] & button_mask) >= button1_pressed_move
+ && (x11_mouse[0] & button_mask) <= button3_pressed_move
+ && *mouse != *zero_point )
+ {
+ b_state.mouse_moved = true;
+ }
+
+ switch ( x11_mouse[0] & button_mask )
+ {
+ case button1_pressed:
+ case button1_pressed_move:
+ if ( *mouse == newMousePosition
+ && x11_button_state == all_buttons_released
+ && ! isKeyTimeout(&time_mousepressed, dblclick_interval) )
+ {
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.left_button = DoubleClick;
+ }
+ else
+ {
+ time_mousepressed = time_keypressed; // save click time
+ b_state.left_button = Pressed;
+ }
+ break;
+
+ case button2_pressed:
+ case button2_pressed_move:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.middle_button = Pressed;
+ break;
+
+ case button3_pressed:
+ case button3_pressed_move:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.right_button = Pressed;
+ break;
+
+ case all_buttons_released:
+ switch ( x11_button_state & button_mask )
+ {
+ case button1_pressed:
+ case button1_pressed_move:
+ b_state.left_button = Released;
+ break;
+
+ case button2_pressed:
+ case button2_pressed_move:
+ b_state.middle_button = Released;
+ break;
+
+ case button3_pressed:
+ case button3_pressed_move:
+ b_state.right_button = Released;
+ break;
+ }
+ break;
+
+ case button_up:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.wheel_up = Pressed;
+ break;
+
+ case button_down:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.wheel_down = Pressed;
+ break;
+ }
+ if ( uChar(x11_mouse[1]) == mouse->getX() + 0x20
+ && uChar(x11_mouse[2]) == mouse->getY() + 0x20
+ && b_state.wheel_up != Pressed
+ && b_state.wheel_down != Pressed
+ && uChar(x11_mouse[0]) == x11_button_state )
+ {
+ return false;
+ }
+ mouse->setPoint(x,y);
+ x11_button_state = uChar(x11_mouse[0]);
+ x11_mouse[0] = '\0';
+ return true;
+}
+
+//----------------------------------------------------------------------
+bool FApplication::parseSGRMouse()
+{
+ register char* p;
+ int button;
+ uChar x, y;
+
+ enum x11_ext_btn_states
+ {
+ key_shift = 0x04,
+ key_meta = 0x08,
+ key_ctrl = 0x10,
+ key_button_mask = 0x1c,
+ button1 = 0x00,
+ button2 = 0x01,
+ button3 = 0x02,
+ button1_move = 0x20,
+ button2_move = 0x21,
+ button3_move = 0x22,
+ button_mask = 0x63,
+ button_up = 0x40,
+ button_down = 0x41,
+ pressed = 'M',
+ released = 'm'
+ };
+ x = 0;
+ y = 0;
+ button = 0;
+
+ // parse the SGR mouse string
+ p = sgr_mouse;
+
+ while ( *p && *p != ';' )
+ {
+ if ( *p < '0' || *p > '9')
+ return false;
+ button = 10 * button + (*p - '0');
+ p++;
+ }
+
+ while ( *p++ && *p != ';' )
+ {
+ if ( *p < '0' || *p > '9')
+ return false;
+ x = uChar(10 * x + (*p - '0'));
+ }
+
+ while ( *p++ && *p != 'M' && *p != 'm' )
+ {
+ if ( *p < '0' || *p > '9')
+ return false;
+ y = uChar(10 * y + (*p - '0'));
+ }
+
+ newMousePosition.setPoint(x,y);
+ memset(&b_state, 0x00, sizeof(b_state));
+
+ if ( (button & key_shift) == key_shift )
+ b_state.shift_button = Pressed;
+ if ( (button & key_meta) == key_meta )
+ b_state.meta_button = Pressed;
+ if ( (button & key_ctrl) == key_ctrl )
+ b_state.control_button = Pressed;
+
+ if ( (button & button_mask) >= button1_move
+ && (button & button_mask) <= button3_move
+ && *mouse != *zero_point )
+ {
+ b_state.mouse_moved = true;
+ }
+
+ if ( *p == pressed )
+ {
+ switch ( button & button_mask )
+ {
+ case button1:
+ case button1_move:
+ if ( *mouse == newMousePosition
+ && (((x11_button_state & 0x80) >> 2) + 'M') == released
+ && ! isKeyTimeout(&time_mousepressed, dblclick_interval) )
+ {
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.left_button = DoubleClick;
+ }
+ else
+ {
+ time_mousepressed = time_keypressed; // save click time
+ b_state.left_button = Pressed;
+ }
+ break;
+
+ case button2:
+ case button2_move:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.middle_button = Pressed;
+ break;
+
+ case button3:
+ case button3_move:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.right_button = Pressed;
+ break;
+
+ case button_up:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.wheel_up = Pressed;
+ break;
+
+ case button_down:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.wheel_down = Pressed;
+ break;
+ }
+ }
+ else // *p == released
+ {
+ switch ( button & button_mask )
+ {
+ case button1:
+ case button1_move:
+ b_state.left_button = Released;
+ break;
+
+ case button2:
+ case button2_move:
+ b_state.middle_button = Released;
+ break;
+
+ case button3:
+ case button3_move:
+ b_state.right_button = Released;
+ break;
+ }
+ }
+ if ( *mouse == newMousePosition
+ && b_state.wheel_up != Pressed
+ && b_state.wheel_down != Pressed
+ && x11_button_state == uChar(((*p & 0x20) << 2) + button) )
+ {
+ return false;
+ }
+ mouse->setPoint(x,y);
+ x11_button_state = uChar(((*p & 0x20) << 2) + button);
+ sgr_mouse[0] = '\0';
+ return true;
+}
+
+//----------------------------------------------------------------------
+bool FApplication::parseUrxvtMouse()
+{
+ register char* p;
+ register bool x_neg;
+ register bool y_neg;
+ int button;
+ uChar x, y;
+
+ enum urxvt_btn_states
+ {
+ key_shift = 0x04,
+ key_meta = 0x08,
+ key_ctrl = 0x10,
+ key_button_mask = 0x1c,
+ button1_pressed = 0x20,
+ button2_pressed = 0x21,
+ button3_pressed = 0x22,
+ all_buttons_released = 0x23,
+ button1_pressed_move = 0x40,
+ button2_pressed_move = 0x41,
+ button3_pressed_move = 0x42,
+ button_mask = 0x63,
+ button_up = 0x60,
+ button_down = 0x61,
+ button_up_move = 0x60,
+ button_down_move = 0x61
+ };
+ x = 0;
+ y = 0;
+ button = 0;
+
+ // parse the SGR mouse string
+ p = urxvt_mouse;
+ x_neg = false;
+ y_neg = false;
+
+ while ( *p && *p != ';' )
+ {
+ if ( *p < '0' || *p > '9')
+ return false;
+ button = 10 * button + (*p - '0');
+ p++;
+ }
+
+ if ( *++p == '-' )
+ {
+ p++;
+ x_neg = true;
+ }
+ while ( *p && *p != ';' )
+ {
+ if ( *p < '0' || *p > '9')
+ return false;
+ x = uChar(10 * x + (*p - '0'));
+ p++;
+ }
+
+ if ( *++p == '-' )
+ {
+ p++;
+ y_neg = true;
+ }
+ while ( *p && *p != 'M' )
+ {
+ if ( *p < '0' || *p > '9')
+ return false;
+ y = uChar(10 * y + (*p - '0'));
+ p++;
+ }
+
+ if ( x_neg || x == 0 )
+ x = 1;
+ if ( y_neg || y == 0 )
+ y = 1;
+ if ( x > term->getWidth() )
+ x = uChar(term->getWidth());
+ if ( y > term->getHeight() )
+ y = uChar(term->getHeight());
+
+ newMousePosition.setPoint(x,y);
+ memset(&b_state, 0x00, sizeof(b_state));
+
+ if ( (button & key_shift) == key_shift )
+ b_state.shift_button = Pressed;
+ if ( (button & key_meta) == key_meta )
+ b_state.meta_button = Pressed;
+ if ( (button & key_ctrl) == key_ctrl )
+ b_state.control_button = Pressed;
+
+ if ( (button & button_mask) >= button1_pressed_move
+ && (button & button_mask) <= button3_pressed_move
+ && *mouse != *zero_point )
+ {
+ b_state.mouse_moved = true;
+ }
+
+ switch ( button & button_mask )
+ {
+ case button1_pressed:
+ case button1_pressed_move:
+ if ( *mouse == newMousePosition
+ && x11_button_state == all_buttons_released
+ && ! isKeyTimeout(&time_mousepressed, dblclick_interval) )
+ {
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.left_button = DoubleClick;
+ }
+ else
+ {
+ time_mousepressed = time_keypressed; // save click time
+ b_state.left_button = Pressed;
+ }
+ break;
+
+ case button2_pressed:
+ case button2_pressed_move:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.middle_button = Pressed;
+ break;
+
+ case button3_pressed:
+ case button3_pressed_move:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.right_button = Pressed;
+ break;
+
+ case all_buttons_released:
+ switch ( x11_button_state & button_mask )
+ {
+ case button1_pressed:
+ case button1_pressed_move:
+ b_state.left_button = Released;
+ break;
+
+ case button2_pressed:
+ case button2_pressed_move:
+ b_state.middle_button = Released;
+ break;
+
+ case button3_pressed:
+ case button3_pressed_move:
+ b_state.right_button = Released;
+ break;
+ }
+ break;
+
+ case button_up:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.wheel_up = Pressed;
+ break;
+
+ case button_down:
+ time_mousepressed.tv_sec = 0;
+ time_mousepressed.tv_usec = 0;
+ b_state.wheel_down = Pressed;
+ break;
+ }
+ if ( *mouse == newMousePosition
+ && b_state.wheel_up != Pressed
+ && b_state.wheel_down != Pressed
+ && x11_button_state == uChar(button) )
+ {
+ return false;
+ }
+ mouse->setPoint(x,y);
+ x11_button_state = uChar(button);
+ urxvt_mouse[0] = '\0';
+ return true;
+}
+
+//----------------------------------------------------------------------
+#ifdef HAVE_LIBGPM
+bool FApplication::processGpmEvent()
+{
+ memset(&b_state, 0x00, sizeof(b_state));
+
+ if ( Gpm_GetEvent(&gpm_ev) == 1 )
+ {
+ Gpm_FitEvent (&gpm_ev);
+ if ( gpm_ev.type & GPM_DRAG && gpm_ev.wdx == 0 && gpm_ev.wdy == 0 )
+ b_state.mouse_moved = true;
+
+ if ( gpm_ev.wdy > 0)
+ b_state.wheel_up = Pressed;
+ else if ( gpm_ev.wdy < 0)
+ b_state.wheel_down = Pressed;
+
+ switch ( gpm_ev.type & 0x0f )
+ {
+ case GPM_DOWN:
+ case GPM_DRAG:
+ if ( gpm_ev.buttons & GPM_B_LEFT )
+ {
+ if ( gpm_ev.type & GPM_DOUBLE )
+ b_state.left_button = DoubleClick;
+ else
+ b_state.left_button = Pressed;
+ }
+ if ( gpm_ev.buttons & GPM_B_MIDDLE )
+ b_state.middle_button = Pressed;
+ if ( gpm_ev.buttons & GPM_B_RIGHT )
+ b_state.right_button = Pressed;
+ if ( gpm_ev.buttons & GPM_B_UP )
+ b_state.wheel_up = Pressed;
+ if ( gpm_ev.buttons & GPM_B_DOWN )
+ b_state.wheel_down = Pressed;
+
+ // keyboard modifiers
+ if ( gpm_ev.modifiers & (1 << KG_SHIFT) )
+ b_state.shift_button = Pressed;
+ if ( gpm_ev.modifiers & ((1 << KG_ALT) | (1 << KG_ALTGR)) )
+ b_state.meta_button = Pressed;
+ if ( gpm_ev.modifiers & (1 << KG_CTRL) )
+ b_state.control_button = Pressed;
+ break;
+
+ case GPM_UP:
+ if ( gpm_ev.buttons & GPM_B_LEFT )
+ b_state.left_button = Released;
+ if ( gpm_ev.buttons & GPM_B_MIDDLE )
+ b_state.middle_button = Released;
+ if ( gpm_ev.buttons & GPM_B_RIGHT )
+ b_state.right_button = Released;
+ }
+ mouse->setPoint(gpm_ev.x, gpm_ev.y);
+ flush_out();
+ GPM_DRAWPOINTER(&gpm_ev);
+ return true;
+ }
+ return false;
+}
+#endif // HAVE_LIBGPM
+
+//----------------------------------------------------------------------
+void FApplication::processMouseEvent()
+{
+ bool event = false;
+
+ if ( ! gpmMouseEvent
+ && x11_mouse[0] == '\0'
+ && sgr_mouse[0] == '\0'
+ && urxvt_mouse[0] == '\0' )
+ return;
+
+#ifdef HAVE_LIBGPM
+ if ( gpmMouseEvent )
+ event = processGpmEvent();
+#endif
+
+ if ( x11_mouse[0] )
+ event = parseX11Mouse();
+
+ if ( sgr_mouse[0] )
+ event = parseSGRMouse();
+
+ if ( urxvt_mouse[0] )
+ event = parseUrxvtMouse();
+
+ if ( ! event )
+ return;
+
+ if ( ! clicked_widget
+ && ( b_state.left_button == Pressed
+ || b_state.left_button == DoubleClick
+ || b_state.right_button == Pressed
+ || b_state.middle_button == Pressed
+ || b_state.wheel_up == Pressed
+ || b_state.wheel_down == Pressed ) )
+ {
+ FWidget* window = FWindow::windowWidgetAt ( mouse->getX(),
+ mouse->getY() );
+ if ( window )
+ {
+ FWidget* child = childWidgetAt ( window,
+ mouse->getX(),
+ mouse->getY() );
+ clicked_widget = (child != 0) ? child : window;
+ }
+ }
+ if ( clicked_widget )
+ {
+ FPoint localMousePos;
+ int key_state = 0;
+
+ if ( b_state.shift_button == Pressed )
+ key_state |= ShiftButton;
+ if ( b_state.meta_button == Pressed )
+ key_state |= MetaButton;
+ if ( b_state.control_button == Pressed )
+ key_state |= ControlButton;
+
+ localMousePos = clicked_widget->globalToLocalPos(*mouse);
+
+ if ( b_state.mouse_moved )
+ {
+ if ( b_state.left_button == Pressed )
+ {
+ FMouseEvent m_down_ev (MouseMove_Event,
+ localMousePos,
+ *mouse,
+ LeftButton | key_state);
+ sendEvent(clicked_widget, &m_down_ev);
+ }
+ if ( b_state.right_button == Pressed )
+ {
+ FMouseEvent m_down_ev (MouseMove_Event,
+ localMousePos,
+ *mouse,
+ RightButton | key_state);
+ sendEvent(clicked_widget, &m_down_ev);
+ }
+ if ( b_state.middle_button == Pressed )
+ {
+ FMouseEvent m_down_ev (MouseMove_Event,
+ localMousePos,
+ *mouse,
+ MiddleButton | key_state);
+ sendEvent(clicked_widget, &m_down_ev);
+ }
+ }
+ else
+ {
+ if ( b_state.left_button == DoubleClick )
+ {
+ FMouseEvent m_dblclick_ev (MouseDoubleClick_Event,
+ localMousePos,
+ *mouse,
+ LeftButton | key_state);
+ sendEvent(clicked_widget, &m_dblclick_ev);
+ }
+ else if ( b_state.left_button == Pressed )
+ {
+ FMouseEvent m_down_ev (MouseDown_Event,
+ localMousePos,
+ *mouse,
+ LeftButton | key_state);
+ sendEvent(clicked_widget, &m_down_ev);
+ }
+ else if ( b_state.left_button == Released )
+ {
+ FMouseEvent m_up_ev (MouseUp_Event,
+ localMousePos,
+ *mouse,
+ LeftButton | key_state);
+ FWidget* released_widget = clicked_widget;
+ clicked_widget = 0;
+ sendEvent(released_widget, &m_up_ev);
+ }
+
+ if ( b_state.right_button == Pressed )
+ {
+ FMouseEvent m_down_ev (MouseDown_Event,
+ localMousePos,
+ *mouse,
+ RightButton | key_state);
+ sendEvent(clicked_widget, &m_down_ev);
+ }
+ else if ( b_state.right_button == Released )
+ {
+ FMouseEvent m_up_ev (MouseUp_Event,
+ localMousePos,
+ *mouse,
+ RightButton | key_state);
+ FWidget* released_widget = clicked_widget;
+ clicked_widget = 0;
+ sendEvent(released_widget, &m_up_ev);
+ }
+
+ if ( b_state.middle_button == Pressed )
+ {
+ FMouseEvent m_down_ev (MouseDown_Event,
+ localMousePos,
+ *mouse,
+ MiddleButton | key_state);
+ sendEvent(clicked_widget, &m_down_ev);
+ // gnome-terminal sends no released on middle click
+ if ( gnome_terminal )
+ clicked_widget = 0;
+ }
+ else if ( b_state.middle_button == Released )
+ {
+ FMouseEvent m_up_ev (MouseUp_Event,
+ localMousePos,
+ *mouse,
+ MiddleButton | key_state);
+ FWidget* released_widget = clicked_widget;
+ clicked_widget = 0;
+ sendEvent(released_widget, &m_up_ev);
+ }
+ }
+ if ( b_state.wheel_up == Pressed )
+ {
+ FWheelEvent wheel_ev (MouseWheel_Event,
+ localMousePos,
+ *mouse,
+ WheelUp);
+ FWidget* scroll_over_widget = clicked_widget;
+ clicked_widget = 0;
+ sendEvent(scroll_over_widget, &wheel_ev);
+ }
+ if ( b_state.wheel_down == Pressed )
+ {
+ FWheelEvent wheel_ev (MouseWheel_Event,
+ localMousePos,
+ *mouse,
+ WheelDown);
+ FWidget* scroll_over_widget = clicked_widget;
+ clicked_widget = 0;
+ sendEvent(scroll_over_widget, &wheel_ev);
+ }
+ }
+ flush_out();
+
+ if ( gpm_mouse_enabled && gpm_ev.x != -1 )
+ GPM_DRAWPOINTER(&gpm_ev);
+}
+
+//----------------------------------------------------------------------
+void FApplication::processResizeEvent()
+{
+ if ( resize_term )
+ {
+ FResizeEvent r_ev(Resize_Event);
+ sendEvent(rootObj, &r_ev);
+
+ if ( r_ev.isAccepted() )
+ resize_term = false;
+ }
+}
+
+//----------------------------------------------------------------------
+int FApplication::processTimerEvent()
+{
+ FObject::TimerList::iterator iter, end;
+ timeval currentTime;
+ int activated = 0;
+
+ getCurrentTime (currentTime);
+
+ if ( modify_timer )
+ return 0;
+
+ if ( ! timer_list )
+ return 0;
+ if ( timer_list->empty() )
+ return 0;
+
+ iter = timer_list->begin();
+ end = timer_list->end();
+
+ while ( iter != end )
+ {
+ if ( (*iter).id == 0
+ || (*iter).object == 0
+ || currentTime < (*iter).timeout ) // no timer expired
+ break;
+
+ (*iter).timeout += (*iter).interval;
+
+ if ( (*iter).timeout < currentTime )
+ (*iter).timeout = currentTime + (*iter).interval;
+
+ if ( (*iter).interval.tv_usec > 0 || (*iter).interval.tv_sec > 0 )
+ activated++;
+
+ FTimerEvent t_ev(Timer_Event, (*iter).id);
+ sendEvent((*iter).object, &t_ev);
+
+ ++iter;
+ }
+
+ return activated;
+}
+
+//----------------------------------------------------------------------
+bool FApplication::processNextEvent()
+{
+ int num_events = 0;
+
+ processKeyboardEvent();
+ processMouseEvent();
+ processResizeEvent();
+
+ if ( close_widget && ! close_widget->empty() )
+ {
+ widgetList::iterator iter;
+ iter = close_widget->begin();
+
+ while ( iter != close_widget->end() )
+ {
+ delete(*iter);
+ close_widget->erase(iter);
+ }
+ }
+
+ sendQueuedEvents();
+ num_events += processTimerEvent();
+
+ return (num_events > 0);
+}
+
+
+// public methods of FApplication
+//----------------------------------------------------------------------
+void FApplication::print_cmd_Options ()
+{
+ ::printf("\nFinalCut Options:\n"
+ " --encoding Sets the character encoding mode\n"
+ " {UTF8, VT100, PC, ASCII}\n"
+ " --vgafont Set the standard vga 8x16 font\n"
+ " --newfont Enables the graphical font\n");
+}
+
+//----------------------------------------------------------------------
+void FApplication::setMainWidget (FWidget* widget)
+{
+ main_widget = widget;
+
+ if ( widget && ! getFocusWidget() )
+ rootObj->focusFirstChild();
+}
+
+//----------------------------------------------------------------------
+int FApplication::exec() // run
+{
+ quit_now = false;
+ quit_code = 0;
+
+ // set the cursor to the focus widget
+ if ( getFocusWidget()
+ && getFocusWidget()->isVisible()
+ && getFocusWidget()->hasVisibleCursor() )
+ {
+ getFocusWidget()->setCursor();
+ showCursor();
+ flush_out();
+ }
+ enter_loop();
+ return quit_code;
+}
+
+//----------------------------------------------------------------------
+int FApplication::enter_loop() // event loop
+{
+ bool old_app_exit_loop;
+ loop_level++;
+ quit_now = false;
+
+ old_app_exit_loop = app_exit_loop;
+ app_exit_loop = false;
+ while ( ! quit_now && ! app_exit_loop )
+ processNextEvent();
+ app_exit_loop = old_app_exit_loop;
+
+ loop_level--;
+
+ return 0;
+}
+
+//----------------------------------------------------------------------
+void FApplication::exit_loop()
+{
+ app_exit_loop = true;
+}
+
+//----------------------------------------------------------------------
+void FApplication::exit (int retcode)
+{
+ if ( ! rootObj ) // no global app object
+ return;
+ if ( quit_now ) // don't overwrite quit code
+ return;
+ quit_now = true;
+ quit_code = retcode;
+}
+
+//----------------------------------------------------------------------
+void FApplication::quit()
+{
+ FApplication::exit(0);
+}
+
+//----------------------------------------------------------------------
+bool FApplication::isQuit()
+{
+ if ( rootObj )
+ return quit_now;
+ else
+ return true;
+}
+
+//----------------------------------------------------------------------
+bool FApplication::sendEvent(FObject* receiver, FEvent* event)
+{
+ FWidget* widget;
+
+ if ( quit_now || app_exit_loop )
+ return false;
+
+ if ( receiver == 0 )
+ return false;
+
+ widget = static_cast(receiver);
+
+ if ( modal_dialogs > 0 )
+ {
+ FWidget* window;
+ if ( widget->isWindow() )
+ window = widget;
+ else
+ window = FWindow::getWindowWidget(widget);
+
+ // block events for widgets in non modal windows
+ if ( window && (window->getFlags() & MODAL) == 0 )
+ {
+ switch ( event->type() )
+ {
+ case KeyPress_Event:
+ case KeyUp_Event:
+ case KeyDown_Event:
+ case MouseDown_Event:
+ case MouseUp_Event:
+ case MouseDoubleClick_Event:
+ case MouseWheel_Event:
+ case MouseMove_Event:
+ case FocusIn_Event:
+ case FocusOut_Event:
+ case Accelerator_Event:
+ return false;
+ }
+ }
+ }
+
+ // throw away mouse events to disabled widgets
+ if ( event->type() >= MouseDown_Event
+ && event->type() <= MouseMove_Event
+ && ! widget->isEnabled() )
+ return false;
+
+ // sends event event directly to receiver
+ return widget->event(event);
+}
+
+//----------------------------------------------------------------------
+void FApplication::queueEvent (FObject* receiver, FEvent* event)
+{
+ if ( receiver == 0 )
+ return;
+
+ // queue this event
+ eventPair Event (receiver, event);
+ event_queue->push_back(Event);
+}
+
+//----------------------------------------------------------------------
+void FApplication::sendQueuedEvents()
+{
+ std::deque* events;
+
+ if ( ! eventInQueue() )
+ return;
+
+ events = event_queue;
+
+ while ( ! eventInQueue() )
+ {
+ sendEvent(events->front().first, events->front().second);
+ events->pop_front();
+ }
+}
+
+//----------------------------------------------------------------------
+bool FApplication::eventInQueue()
+{
+ if ( rootObj )
+ return ( ! event_queue->empty() );
+ else
+ return false;
+}
+
+//----------------------------------------------------------------------
+bool FApplication::removeQueuedEvent(FObject* receiver)
+{
+ bool retval;
+ std::deque::iterator iter;
+
+ if ( ! eventInQueue() )
+ return false;
+ if ( receiver == 0 )
+ return false;
+
+ retval = false;
+ iter = event_queue->begin();
+
+ while ( iter != event_queue->end() )
+ {
+ if ( iter->first == receiver )
+ {
+ iter = event_queue->erase(iter);
+ retval = true;
+ }
+ else
+ ++iter;
+ }
+ return retval;
+}
diff --git a/src/fapp.h b/src/fapp.h
new file mode 100644
index 00000000..098de631
--- /dev/null
+++ b/src/fapp.h
@@ -0,0 +1,162 @@
+// fapplication.h
+// class FApplication
+
+#ifndef _FAPPLICATION_H
+#define _FAPPLICATION_H
+
+#include // need for gpm keyboard modifiers
+#include // need for gettimeofday
+#include
+#include
+
+#include "fevent.h"
+#include "fwidget.h"
+
+
+//----------------------------------------------------------------------
+// class FApplication
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FApplication : public FWidget
+{
+ public:
+ typedef std::pair eventPair;
+ static std::deque* event_queue;
+
+ private:
+ int app_argc;
+ char** app_argv;
+ static int quit_code;
+ static bool quit_now;
+ static int loop_level;
+ static bool process_timer_event;
+ static FPoint* zero_point;
+ int key;
+ char k_buf[1024];
+ char x11_mouse[4];
+ char sgr_mouse[13];
+ char urxvt_mouse[13];
+
+#ifdef HAVE_LIBGPM
+ Gpm_Event gpm_ev;
+ bool gpmMouseEvent;
+ enum gpmEventType
+ {
+ no_event = 0,
+ keyboard_event = 1,
+ mouse_event = 2
+ };
+#endif
+
+ enum btn_state
+ {
+ Pressed = 1,
+ Released = 2,
+ DoubleClick = 3
+ };
+
+ struct button_state // bit field
+ {
+ uChar left_button : 2; // 0..3
+ uChar right_button : 2; // 0..3
+ uChar middle_button : 2; // 0..3
+ uChar shift_button : 1; // 0..1
+ uChar control_button : 1; // 0..1
+ uChar meta_button : 1; // 0..1
+ uChar wheel_up : 1; // 0..1
+ uChar wheel_down : 1; // 0..1
+ uChar mouse_moved : 1; // 0..1
+ uChar : 4; // padding bits
+ } b_state;
+
+ char fifo_buf[512];
+ int fifo_offset;
+ bool fifo_in_use;
+ int fifo_buf_size;
+ long key_timeout;
+ long dblclick_interval;
+ struct timeval time_keypressed;
+ struct timeval time_mousepressed;
+ FPoint newMousePosition;
+ static FWidget* main_widget;
+ static FWidget* active_window;
+ static FWidget* focus_widget;
+ static FWidget* clicked_widget;
+
+ private:
+ FApplication (const FApplication&); // Disabled copy constructor
+ FApplication& operator = (const FApplication&); // and operator '='
+
+ void init (int argc, char* argv[]);
+ void cmd_options();
+ bool KeyPressed();
+ ssize_t readKey();
+ void processKeyboardEvent();
+ bool parseX11Mouse();
+ bool parseSGRMouse();
+ bool parseUrxvtMouse();
+
+#ifdef HAVE_LIBGPM
+ int gpmEvent();
+ bool processGpmEvent();
+#endif
+
+ void processMouseEvent();
+ void processResizeEvent();
+ int processTimerEvent();
+ bool processNextEvent();
+ friend class FWidget;
+ friend class FWindow;
+ friend class FDialog;
+
+ public:
+ FApplication (int &argc, char* argv[]); // constructor
+ virtual ~FApplication(); // destructor
+
+ const char* getClassName() const;
+ int argc() const;
+ char** argv() const;
+ FWidget* mainWidget() const;
+ FWidget* focusWidget() const;
+ static void print_cmd_Options();
+ void setMainWidget (FWidget*);
+ int exec(); // run
+ int enter_loop();
+ void exit_loop();
+ static void exit (int retcode=0);
+ void quit();
+ bool isQuit();
+ static bool sendEvent (FObject*, FEvent*);
+ static void queueEvent (FObject*, FEvent*);
+ static void sendQueuedEvents ();
+ static bool eventInQueue();
+ static bool removeQueuedEvent(FObject*);
+};
+#pragma pack(pop)
+
+
+// FApplication inline functions
+//----------------------------------------------------------------------
+inline int FApplication::argc() const
+{ return app_argc; }
+
+//----------------------------------------------------------------------
+inline char** FApplication::argv() const
+{ return app_argv; }
+
+//----------------------------------------------------------------------
+inline FWidget* FApplication::mainWidget() const
+{ return main_widget; }
+
+//----------------------------------------------------------------------
+inline FWidget* FApplication::focusWidget() const
+{ return focus_widget; }
+
+//----------------------------------------------------------------------
+inline const char* FApplication::getClassName() const
+{ return "FApplication"; }
+
+#endif // _FAPPLICATION_H
diff --git a/src/fbutton.cpp b/src/fbutton.cpp
new file mode 100644
index 00000000..8d8b5449
--- /dev/null
+++ b/src/fbutton.cpp
@@ -0,0 +1,608 @@
+// fbutton.cpp
+// class FButton
+
+#include "fapp.h"
+#include "fbutton.h"
+#include "fstatusbar.h"
+
+
+//----------------------------------------------------------------------
+// class FButton
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FButton::FButton(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FButton::FButton (const FString& txt, FWidget* parent) : FWidget(parent)
+{
+ this->init();
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FButton::~FButton() // destructor
+{
+ delAccelerator (this);
+}
+
+
+// private methods of FButton
+//----------------------------------------------------------------------
+void FButton::init()
+{
+ flags = 0;
+ button_down = false;
+ this->text = "";
+
+ if ( hasFocus() )
+ this->flags = FOCUS;
+
+ if ( isEnabled() )
+ {
+ this->flags |= ACTIVE;
+
+ if ( hasFocus() )
+ {
+ foregroundColor = wc.button_active_focus_fg;
+ backgroundColor = wc.button_active_focus_bg;
+ }
+ else
+ {
+ foregroundColor = wc.button_active_fg;
+ backgroundColor = wc.button_active_bg;
+ }
+ }
+ else // inactive
+ {
+ foregroundColor = wc.button_inactive_fg;
+ backgroundColor = wc.button_inactive_bg;
+ }
+}
+
+//----------------------------------------------------------------------
+uChar FButton::getHotkey()
+{
+ int length;
+
+ if ( text.isEmpty() )
+ return 0;
+
+ length = int(text.getLength());
+
+ for (int i=0; i < length; i++)
+ if ( (i+1 < length) && (text[uInt(i)] == '&') )
+ return uChar(text[uInt(++i)]);
+ return 0;
+}
+
+//----------------------------------------------------------------------
+void FButton::setHotkeyAccelerator()
+{
+ int hotkey = getHotkey();
+ if ( hotkey )
+ {
+ if ( isalpha(hotkey) || isdigit(hotkey) )
+ {
+ addAccelerator (tolower(hotkey), this);
+ addAccelerator (toupper(hotkey), this);
+ // Meta + hotkey
+ addAccelerator (0x20000e0+tolower(hotkey), this);
+ }
+ else
+ addAccelerator (getHotkey(), this);
+ }
+ else
+ delAccelerator(this);
+}
+
+//----------------------------------------------------------------------
+void FButton::draw()
+{
+ register wchar_t* src;
+ register wchar_t* dest;
+ wchar_t* ButtonText;
+ FString txt;
+ int d, i, j, x, mono_offset, margin;
+ int length, hotkeypos, hotkey_offset, space;
+ int button_fg, button_bg;
+ bool isActiveFocus, isActive, isFocus, isFlat;
+ bool isNonFlatShadow, isNoUnderline;
+
+ if ( text.isNull() || text.isEmpty() )
+ return;
+
+ length = int(text.getLength());
+ hotkeypos = -1;
+ hotkey_offset = 0;
+ space = int(' ');
+
+ if ( isMonochron() )
+ ButtonText = new wchar_t[length+3];
+ else
+ ButtonText = new wchar_t[length+1];
+
+ txt = this->text;
+ src = const_cast(txt.wc_str());
+ dest = const_cast(ButtonText);
+
+ isActiveFocus = (flags & (ACTIVE+FOCUS)) == (ACTIVE+FOCUS);
+ isActive = ((flags & ACTIVE) != 0);
+ isFocus = ((flags & FOCUS) != 0);
+ isFlat = ((flags & FLAT) != 0);
+ isNonFlatShadow = ((flags & (SHADOW+FLAT)) == SHADOW);
+ isNoUnderline = ((flags & NO_UNDERLINE) != 0);
+
+ setUpdateVTerm(false);
+ if ( button_down )
+ {
+ // noshadow + indent one character to the right
+ if ( isFlat )
+ clearFlatBorder();
+ clearShadow();
+ setColor ( parentWidget()->getForegroundColor(),
+ parentWidget()->getBackgroundColor() );
+ for (int y=1; y <= height; y++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-2+y);
+ print (' '); // clear one left █
+ }
+ d = 1;
+ }
+ else
+ d = 0;
+
+ if ( ! isActive && (isMonochron() || getMaxColor() < 16) )
+ space = fc::MediumShade; // ▒
+
+ if ( isMonochron() && isActiveFocus )
+ {
+ txt = "<" + txt + ">";
+ length = int(txt.getLength());
+ src = const_cast(txt.wc_str());
+ mono_offset = 2;
+ }
+ else
+ mono_offset = 0;
+
+ // find hotkey position in string
+ // + generate a new string without the '&'-sign
+ for (i=0; i < length; i++)
+ {
+ if ( (i < length) && (txt[uInt(i)] == '&') && (hotkeypos == -1) )
+ {
+ hotkeypos = i;
+ i++;
+ src++;
+ }
+ *dest++ = *src++;
+ }
+ if ( hotkeypos != -1 )
+ hotkey_offset = 1;
+
+ if ( (length - hotkey_offset + mono_offset - hotkey_offset) <= width )
+ margin = 1;
+ else
+ margin = 0;
+
+ button_fg = foregroundColor;
+ button_bg = backgroundColor;
+
+ if ( isMonochron() && (isActive || isFocus) )
+ setReverse(true);
+
+ if ( isFlat )
+ {
+ if ( margin == 1 )
+ {
+ setColor (wc.button_active_fg, button_bg);
+ for (int y=0; y <= height-1; y++)
+ {
+ gotoxy (xpos+xmin-1+d, ypos+ymin-1+y);
+ print (space); // full block █
+ }
+ }
+ if ( ! button_down )
+ drawFlatBorder();
+ }
+ else if ( ! isMonochron() )
+ {
+ if ( ! isActive && getMaxColor() < 16 )
+ setColor (button_fg, button_bg);
+ else
+ setColor (button_bg, parentWidget()->getBackgroundColor());
+ gotoxy (xpos+xmin-1+d, ypos+ymin-1);
+ for (int y=1; y <= height; y++)
+ {
+ // Cygwin terminal use IBM Codepage 850
+ if ( this->isCygwinTerminal() )
+ print (fc::FullBlock); // █
+ else
+ print (fc::RightHalfBlock); // ▐
+ gotoxy (xpos+xmin-1+d, ypos+ymin-1+y);
+ }
+ }
+
+ if ( ! button_down
+ && ! isNewFont()
+ && (isFlat || ! hasShadow() || isMonochron()) )
+ {
+ // clear the right █ from button down
+ setColor ( parentWidget()->getForegroundColor(),
+ parentWidget()->getBackgroundColor() );
+ for (int y=1; y <= height; y++)
+ {
+ if ( isMonochron() )
+ setReverse(false);
+ gotoxy (xpos+xmin-1+width, ypos+ymin-2+y);
+ print (' '); // clear right
+ if ( isMonochron() )
+ setReverse(true);
+ }
+ }
+
+ if ( hotkeypos != -1 )
+ length--;
+
+ i = width - length - 1;
+ i = int(i / 2);
+
+ if ( height > 1 )
+ j = int((height-1) / 2);
+ else
+ j=0;
+
+ gotoxy (xpos+xmin-1+margin+d, ypos+ymin-1+j);
+ setColor (button_fg, button_bg);
+
+ for (x=0; x < i; x++)
+ print (space); // █
+
+ if ( hotkeypos == -1 )
+ setCursorPos ( xpos+xmin-1+margin+i,
+ ypos+ymin-1+j ); // first character
+ else
+ setCursorPos ( xpos+xmin-1+margin+i+hotkeypos,
+ ypos+ymin-1+j ); // hotkey
+
+ if ( isMonochron() && isActiveFocus )
+ setBold();
+ for (int z=0; x < i+length && z < width; z++,x++)
+ {
+ if ( (z == hotkeypos) && isActive )
+ {
+ setColor (wc.button_hotkey_fg, button_bg);
+ if ( ! isNoUnderline )
+ setUnderline();
+ print ( ButtonText[z] );
+ if ( ! isNoUnderline )
+ unsetUnderline();
+ setColor (button_fg, button_bg);
+ }
+ else
+ {
+ print ( ButtonText[z] );
+ }
+ }
+ if ( isMonochron() && isActiveFocus )
+ unsetBold();
+ for (x=i+length; x < width-1; x++)
+ print (space); // █
+
+ if ( height > 1 )
+ {
+ for (i=0; i < j; i++)
+ {
+ gotoxy (xpos+xmin+d, ypos+ymin-1+i);
+ for (int z=1; z <= width-1; z++)
+ print (space); // █
+ }
+ for (i=j+1; i < height; i++)
+ {
+ gotoxy (xpos+xmin+d, ypos+ymin-1+i);
+ for (int z=1; z <= width-1; z++)
+ print (space); // █
+ }
+ }
+
+ if ( isMonochron() )
+ setReverse(false);
+
+ if ( isNonFlatShadow && ! button_down )
+ {
+ setColor ( parentWidget()->getForegroundColor(),
+ parentWidget()->getBackgroundColor() );
+ print(' '); // restore background after button down
+ drawShadow();
+ }
+
+ setUpdateVTerm(true);
+ delete[] ButtonText;
+
+ if ( isFocus && statusBar() )
+ {
+ FString msg = getStatusbarMessage();
+ FString curMsg = statusBar()->getMessage();
+ if ( curMsg != msg )
+ {
+ statusBar()->setMessage(msg);
+ statusBar()->drawMessage();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FButton::processClick()
+{
+ emitCallback("clicked");
+}
+
+
+// public methods of FButton
+//----------------------------------------------------------------------
+void FButton::hide()
+{
+ int fg, bg, s, f, size;
+ char* blank;
+
+ FWidget::hide();
+
+ fg = parentWidget()->getForegroundColor();
+ bg = parentWidget()->getBackgroundColor();
+ setColor (fg, bg);
+
+ s = hasShadow() ? 1 : 0;
+ f = isFlat() ? 1 : 0;
+ size = width + s + (f << 1);
+ blank = new char[size+1];
+ memset(blank, ' ', uLong(size));
+ blank[size] = '\0';
+ for (int y=0; y < height+s+(f << 1); y++)
+ {
+ gotoxy (xpos+xmin-1-f, ypos+ymin-1+y-f);
+ print (blank);
+ }
+ delete[] blank;
+}
+
+//----------------------------------------------------------------------
+bool FButton::setNoUnderline(bool on)
+{
+ if ( on )
+ this->flags |= NO_UNDERLINE;
+ else
+ this->flags &= ~NO_UNDERLINE;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FButton::setEnable(bool on)
+{
+ FWidget::setEnable(on);
+
+ if ( on )
+ {
+ this->flags |= ACTIVE;
+ setHotkeyAccelerator();
+ if ( hasFocus() )
+ {
+ foregroundColor = wc.button_active_focus_fg;
+ backgroundColor = wc.button_active_focus_bg;
+ }
+ else
+ {
+ foregroundColor = wc.button_active_fg;
+ backgroundColor = wc.button_active_bg;
+ }
+ }
+ else
+ {
+ this->flags &= ~ACTIVE;
+ delAccelerator (this);
+ foregroundColor = wc.button_inactive_fg;
+ backgroundColor = wc.button_inactive_bg;
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FButton::setFocus(bool on)
+{
+ FWidget::setFocus(on);
+
+ if ( on )
+ {
+ this->flags |= FOCUS;
+
+ if ( isEnabled() )
+ {
+ foregroundColor = wc.button_active_focus_fg;
+ backgroundColor = wc.button_active_focus_bg;
+ if ( statusBar() )
+ {
+ FString msg = getStatusbarMessage();
+ FString curMsg = statusBar()->getMessage();
+ if ( curMsg != msg )
+ statusBar()->setMessage(msg);
+ }
+ }
+ }
+ else
+ {
+ this->flags &= ~FOCUS;
+
+ if ( isEnabled() )
+ {
+ foregroundColor = wc.button_active_fg;
+ backgroundColor = wc.button_active_bg;
+ if ( statusBar() )
+ statusBar()->clearMessage();
+ }
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FButton::setFlat(bool on)
+{
+ if ( on )
+ this->flags |= FLAT;
+ else
+ this->flags &= ~FLAT;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FButton::setShadow(bool on)
+{
+ if ( on && Encoding != fc::VT100 && Encoding != fc::ASCII )
+ this->flags |= SHADOW;
+ else
+ this->flags &= ~SHADOW;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FButton::setDown(bool on)
+{
+ if ( button_down != on )
+ {
+ button_down = on;
+ redraw();
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+void FButton::onKeyPress (FKeyEvent* event)
+{
+ int key;
+
+ if ( ! isEnabled() )
+ return;
+
+ key = event->key();
+
+ switch ( key )
+ {
+ case fc::Fkey_return:
+ case fc::Fkey_enter:
+ case fc::Fkey_space:
+ setDown();
+ usleep(150000);
+ setUp();
+ processClick();
+ event->accept();
+ break;
+ }
+}
+
+//----------------------------------------------------------------------
+void FButton::onMouseDown (FMouseEvent* event)
+{
+ if ( event->getButton() != LeftButton )
+ {
+ setUp();
+ return;
+ }
+
+ if ( ! hasFocus() )
+ {
+ FWidget* focused_widget = getFocusWidget();
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ this->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ if ( statusBar() )
+ statusBar()->drawMessage();
+ }
+ FPoint gPos = event->getGlobalPos();
+ if ( getGeometryGlobal().contains(gPos) )
+ setDown();
+}
+
+//----------------------------------------------------------------------
+void FButton::onMouseUp (FMouseEvent* event)
+{
+ if ( event->getButton() != LeftButton )
+ return;
+
+ if ( button_down )
+ {
+ setUp();
+ if ( getGeometryGlobal().contains(event->getGlobalPos()) )
+ processClick();
+ }
+}
+
+//----------------------------------------------------------------------
+void FButton::onMouseMove (FMouseEvent* event)
+{
+ if ( event->getButton() != LeftButton )
+ return;
+
+ FPoint gPos = event->getGlobalPos();
+ if ( getGeometryGlobal().contains(gPos) )
+ setDown();
+ else
+ setUp();
+}
+
+//----------------------------------------------------------------------
+void FButton::onAccel (FAccelEvent* event)
+{
+ if ( isEnabled() )
+ {
+ if ( ! hasFocus() )
+ {
+ FWidget* focused_widget = static_cast(event->focusedWidget());
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ setDown();
+ if ( statusBar() )
+ statusBar()->drawMessage();
+ }
+ else
+ setDown();
+ usleep(150000);
+ setUp();
+ processClick();
+ event->accept();
+ }
+}
+
+//----------------------------------------------------------------------
+void FButton::onFocusIn (FFocusEvent*)
+{
+ if ( statusBar() )
+ statusBar()->drawMessage();
+}
+
+//----------------------------------------------------------------------
+void FButton::onFocusOut (FFocusEvent*)
+{
+ if ( statusBar() )
+ {
+ statusBar()->clearMessage();
+ statusBar()->drawMessage();
+ }
+}
+
+//----------------------------------------------------------------------
+void FButton::setText (const FString& txt)
+{
+ this->text = txt;
+ if ( isEnabled() )
+ {
+ delAccelerator (this);
+ setHotkeyAccelerator();
+ }
+}
diff --git a/src/fbutton.h b/src/fbutton.h
new file mode 100644
index 00000000..d110bfc2
--- /dev/null
+++ b/src/fbutton.h
@@ -0,0 +1,153 @@
+// fbutton.h
+// class FButton
+
+#ifndef _FBUTTON_H
+#define _FBUTTON_H
+
+#include "fwidget.h"
+
+
+//----------------------------------------------------------------------
+// class FButton
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FButton : public FWidget
+{
+ private:
+ FString text;
+ bool button_down;
+
+ private:
+ FButton (const FButton&);
+ FButton& operator = (const FButton&);
+ void init();
+ uChar getHotkey();
+ void setHotkeyAccelerator();
+ void draw();
+ void processClick();
+ friend class FDialog;
+
+ public:
+ FButton (FWidget* parent=0); // constructor
+ FButton (const FString&, FWidget* parent=0); // constructor
+ virtual ~FButton(); // destructor
+
+ const char* getClassName() const;
+
+ void hide();
+
+ void onKeyPress (FKeyEvent*);
+ void onMouseDown (FMouseEvent*);
+ void onMouseUp (FMouseEvent*);
+ void onMouseMove (FMouseEvent*);
+ void onAccel (FAccelEvent*);
+ void onFocusIn (FFocusEvent*);
+ void onFocusOut (FFocusEvent*);
+
+ bool setNoUnderline(bool);
+ bool setNoUnderline();
+ bool unsetNoUnderline();
+
+ bool setEnable(bool);
+ bool setEnable();
+ bool unsetEnable();
+ bool setDisable();
+ bool setFocus(bool);
+ bool setFocus();
+ bool unsetFocus();
+ bool setFlat(bool);
+ bool setFlat();
+ bool unsetFlat();
+ bool isFlat() const;
+ bool setShadow(bool);
+ bool setShadow();
+ bool unsetShadow();
+ bool hasShadow() const;
+ bool setDown(bool);
+ bool setDown();
+ bool setUp();
+ bool isDown() const;
+
+ void setText (const FString&);
+ FString& getText();
+};
+#pragma pack(pop)
+
+
+// FButton inline functions
+//----------------------------------------------------------------------
+inline const char* FButton::getClassName() const
+{ return "FButton"; }
+
+//----------------------------------------------------------------------
+inline bool FButton::setNoUnderline()
+{ return setNoUnderline(true); }
+
+//----------------------------------------------------------------------
+inline bool FButton::unsetNoUnderline()
+{ return setNoUnderline(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setEnable()
+{ return setEnable(true); }
+
+//----------------------------------------------------------------------
+inline bool FButton::unsetEnable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setDisable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setFocus()
+{ return setFocus(true); }
+
+//----------------------------------------------------------------------
+inline bool FButton::unsetFocus()
+{ return setFocus(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setFlat()
+{ return setFlat(true); }
+
+//----------------------------------------------------------------------
+inline bool FButton::unsetFlat()
+{ return setFlat(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::isFlat() const
+{ return ((flags & FLAT) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setShadow()
+{ return setShadow(true); }
+
+//----------------------------------------------------------------------
+inline bool FButton::unsetShadow()
+{ return setShadow(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::hasShadow() const
+{ return ((flags & SHADOW) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setDown()
+{ return setDown(true); }
+
+//----------------------------------------------------------------------
+inline bool FButton::setUp()
+{ return setDown(false); }
+
+//----------------------------------------------------------------------
+inline bool FButton::isDown() const
+{ return button_down; }
+
+//----------------------------------------------------------------------
+inline FString& FButton::getText()
+{ return this->text; }
+
+#endif // _FBUTTON_H
diff --git a/src/fbuttongroup.cpp b/src/fbuttongroup.cpp
new file mode 100644
index 00000000..d30f603e
--- /dev/null
+++ b/src/fbuttongroup.cpp
@@ -0,0 +1,541 @@
+// fbuttongroup.cpp
+// class FButtonGroup
+
+#include "fapp.h"
+#include "fbuttongroup.h"
+#include "fstatusbar.h"
+#include "ftogglebutton.h"
+
+
+//----------------------------------------------------------------------
+// class FButtonGroup
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FButtonGroup::FButtonGroup(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+ text = "";
+}
+
+//----------------------------------------------------------------------
+FButtonGroup::FButtonGroup ( const FString& txt,
+ FWidget* parent ) : FWidget(parent)
+{
+ this->init();
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FButtonGroup::~FButtonGroup() // destructor
+{
+ FButtonGroup::FButtonList::iterator iter;
+
+ if ( buttonlist.empty() )
+ return;
+
+ iter = buttonlist.begin();
+
+ while ( iter != buttonlist.end() )
+ {
+ (*iter)->setGroup(0);
+ iter = buttonlist.erase(iter);
+ }
+}
+
+// private methods of FButtonGroup
+//----------------------------------------------------------------------
+void FButtonGroup::init()
+{
+ flags = 0;
+ border = true;
+ top_padding = 1;
+ left_padding = 1;
+ bottom_padding = 1;
+ right_padding = 1;
+
+ if ( isEnabled() )
+ this->flags |= ACTIVE;
+
+ foregroundColor = wc.label_fg;
+ backgroundColor = wc.label_bg;
+
+ buttonlist.clear(); // no buttons yet
+}
+
+//----------------------------------------------------------------------
+bool FButtonGroup::isRadioButton(FToggleButton* button) const
+{
+ return bool ( strcmp ( button->getClassName(),
+ const_cast("FRadioButton") ) == 0 );
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::directFocus()
+{
+ if ( ! hasFocusedButton() )
+ {
+ bool found_checked = false;
+
+ if ( hasCheckedButton() && ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, end;
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter)->isChecked() )
+ {
+ if ( isRadioButton(*iter) )
+ {
+ found_checked = true;
+ FWidget* focused_widget = getFocusWidget();
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ (*iter)->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ getFocusWidget()->redraw();
+ }
+ break;
+ }
+ ++iter;
+ }
+ }
+
+ if ( ! found_checked )
+ {
+ FWidget* focused_widget = getFocusWidget();
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ focusFirstChild();
+ if ( focused_widget )
+ focused_widget->redraw();
+ getFocusWidget()->redraw();
+ }
+ }
+
+ if ( statusBar() )
+ {
+ statusBar()->drawMessage();
+ updateTerminal();
+ flush_out();
+ }
+}
+
+// protected methods of FButtonGroup
+//----------------------------------------------------------------------
+void FButtonGroup::draw()
+{
+ setUpdateVTerm(false);
+ setColor (foregroundColor, backgroundColor);
+ if ( border )
+ drawBorder();
+ drawLabel();
+ setUpdateVTerm(true);
+}
+
+//----------------------------------------------------------------------
+uChar FButtonGroup::getHotkey()
+{
+ uInt length;
+
+ if ( text.isEmpty() )
+ return 0;
+
+ length = text.getLength();
+
+ for (uInt i=0; i < length; i++)
+ if ( (i+1 < length) && (text[i] == '&') )
+ return uChar(text[++i]);
+ return 0;
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::setHotkeyAccelerator()
+{
+ int hotkey = getHotkey();
+
+ if ( hotkey )
+ {
+ if ( isalpha(hotkey) || isdigit(hotkey) )
+ {
+ addAccelerator (tolower(hotkey), this);
+ addAccelerator (toupper(hotkey), this);
+ // Meta + hotkey
+ addAccelerator (0x20000e0 + tolower(hotkey), this);
+ }
+ else
+ addAccelerator (getHotkey(), this);
+ }
+ else
+ delAccelerator(this);
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::drawLabel()
+{
+ wchar_t* LabelText;
+ register wchar_t* src;
+ register wchar_t* dest;
+ FString txt;
+ uInt length;
+ int hotkeypos;
+ bool isActive, isNoUnderline;
+
+ if ( text.isNull() || text.isEmpty() )
+ return;
+
+ txt = " " + this->text + " ";
+ length = txt.getLength();
+ hotkeypos = -1;
+ LabelText = new wchar_t[length+1];
+ src = const_cast(txt.wc_str());
+ dest = const_cast(LabelText);
+
+ isActive = ((flags & ACTIVE) != 0);
+ isNoUnderline = ((flags & NO_UNDERLINE) != 0);
+
+ // find hotkey position in string
+ // + generate a new string without the '&'-sign
+ for (uInt i=0; i < length; i++)
+ {
+ if ( (i < length) && (txt[i] == '&') && (hotkeypos == -1) )
+ {
+ hotkeypos = int(i);
+ i++;
+ src++;
+ }
+ *dest++ = *src++;
+ }
+
+ if ( hotkeypos != -1 )
+ length--;
+
+ if ( border )
+ gotoxy (xpos+xmin, ypos+ymin-1);
+ else
+ gotoxy (xpos+xmin-2, ypos+ymin-1);
+
+ if ( isEnabled() )
+ setColor(wc.label_emphasis_fg, wc.label_bg);
+ else
+ setColor(wc.label_inactive_fg, wc.label_inactive_bg);
+
+ for (int z=0; z < int(length); z++)
+ {
+ if ( (z == hotkeypos) && isActive )
+ {
+ setColor (wc.label_hotkey_fg, wc.label_hotkey_bg);
+ if ( ! isNoUnderline )
+ setUnderline();
+ print ( LabelText[z] );
+ if ( ! isNoUnderline )
+ unsetUnderline();
+ setColor (wc.label_emphasis_fg, wc.label_bg);
+ }
+ else
+ print ( LabelText[z] );
+ }
+ delete[] LabelText;
+}
+
+// public methods of FButtonGroup
+//----------------------------------------------------------------------
+void FButtonGroup::hide()
+{
+ int fg, bg, size;
+ char* blank;
+ FWidget::hide();
+ if ( ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, end;
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ (*iter)->hide();
+ ++iter;
+ }
+ }
+
+ fg = parentWidget()->getForegroundColor();
+ bg = parentWidget()->getBackgroundColor();
+ setColor (fg, bg);
+
+ size = width;
+ blank = new char[size+1];
+ memset(blank, ' ', uLong(size));
+ blank[size] = '\0';
+ for (int y=0; y < height; y++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+y);
+ print (blank);
+ }
+ delete[] blank;
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::insert(FToggleButton* button)
+{
+ if ( button->group() )
+ button->group()->remove(button);
+
+ // setChecked the first FRadioButton
+ if ( buttonlist.size() == 1 && isRadioButton(*buttonlist.begin()) )
+ (*buttonlist.begin())->setChecked();
+
+ button->setGroup(this);
+ buttonlist.push_back(button);
+
+ button->addCallback
+ (
+ "toggled",
+ this,
+ reinterpret_cast(&FButtonGroup::cb_buttonToggled),
+ null
+ );
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::remove(FToggleButton* button)
+{
+ FButtonGroup::FButtonList::iterator iter;
+
+ if ( buttonlist.empty() )
+ return;
+
+ iter = buttonlist.begin();
+
+ while ( iter != buttonlist.end() )
+ {
+ if ( (*iter) == button )
+ {
+ iter = buttonlist.erase(iter);
+ button->setGroup(0);
+
+ button->delCallback(this);
+ break;
+ }
+ else
+ ++iter;
+ }
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::cb_buttonToggled (FWidget* widget, void*)
+{
+ FToggleButton* button = static_cast(widget);
+ FButtonGroup::FButtonList::const_iterator iter, end;
+
+ if ( ! button->isChecked() )
+ return;
+ if ( buttonlist.empty() )
+ return;
+
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter) != button
+ && (*iter)->isChecked()
+ && isRadioButton(*iter) )
+ {
+ (*iter)->unsetChecked();
+ if ( (*iter)->isVisible() && (*iter)->isShown() )
+ (*iter)->redraw();
+ }
+ ++iter;
+ }
+}
+
+//----------------------------------------------------------------------
+FToggleButton* FButtonGroup::getFirstButton()
+{
+ if ( ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, end;
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter)->isEnabled() && (*iter)->acceptFocus() )
+ return (*iter);
+ ++iter;
+ }
+ }
+ return 0;
+}
+
+//----------------------------------------------------------------------
+FToggleButton* FButtonGroup::getLastButton()
+{
+ if ( ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, begin;
+ begin = buttonlist.begin();
+ iter = buttonlist.end();
+ do
+ {
+ --iter;
+ if ( (*iter)->isEnabled() && (*iter)->acceptFocus() )
+ return (*iter);
+ }
+ while ( iter != begin );
+ }
+ return 0;
+}
+
+//----------------------------------------------------------------------
+bool FButtonGroup::hasFocusedButton()
+{
+ if ( ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, end;
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter)->hasFocus() )
+ return true;
+ ++iter;
+ }
+ }
+ return false;
+}
+
+//----------------------------------------------------------------------
+bool FButtonGroup::hasCheckedButton()
+{
+ if ( ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, end;
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter)->isChecked() )
+ return true;
+ ++iter;
+ }
+ }
+ return false;
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::onMouseDown (FMouseEvent* event)
+{
+ if ( event->getButton() != LeftButton )
+ return;
+ directFocus();
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::onAccel (FAccelEvent*)
+{
+ directFocus();
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::onFocusIn (FFocusEvent* in_ev)
+{
+ if ( hasCheckedButton() && ! buttonlist.empty() )
+ {
+ FButtonGroup::FButtonList::const_iterator iter, end;
+ iter = buttonlist.begin();
+ end = buttonlist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter)->isChecked() )
+ {
+ if ( isRadioButton(*iter) )
+ {
+ in_ev->ignore();
+ FWidget* prev_element = getFocusWidget();
+ (*iter)->setFocus();
+ prev_element->redraw();
+ (*iter)->redraw();
+ }
+ break;
+ }
+ ++iter;
+ }
+ }
+ if ( in_ev->isAccepted() )
+ {
+ if ( in_ev->getFocusType() == FocusNextWidget )
+ {
+ in_ev->ignore();
+ FWidget* prev_element = getFocusWidget();
+ focusFirstChild();
+ prev_element->redraw();
+ getFocusWidget()->redraw();
+ }
+ else if ( in_ev->getFocusType() == FocusPreviousWidget )
+ {
+ in_ev->ignore();
+ FWidget* prev_element = getFocusWidget();
+ focusLastChild();
+ prev_element->redraw();
+ getFocusWidget()->redraw();
+ }
+ }
+ if ( statusBar() )
+ {
+ statusBar()->drawMessage();
+ updateTerminal();
+ flush_out();
+ }
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::onFocusOut (FFocusEvent*)
+{
+}
+
+//----------------------------------------------------------------------
+bool FButtonGroup::setEnable (bool on)
+{
+ FWidget::setEnable(on);
+
+ if ( on )
+ {
+ this->flags |= ACTIVE;
+ setHotkeyAccelerator();
+ }
+ else
+ {
+ this->flags &= ~ACTIVE;
+ delAccelerator (this);
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FButtonGroup::setBorder(bool on)
+{
+ if ( on )
+ border = true;
+ else
+ border = false;
+ return on;
+}
+
+//----------------------------------------------------------------------
+void FButtonGroup::setText (const FString& txt)
+{
+ this->text = txt;
+ if ( isEnabled() )
+ {
+ delAccelerator (this);
+ setHotkeyAccelerator();
+ }
+}
diff --git a/src/fbuttongroup.h b/src/fbuttongroup.h
new file mode 100644
index 00000000..a4d6c572
--- /dev/null
+++ b/src/fbuttongroup.h
@@ -0,0 +1,104 @@
+// fbuttongroup.h
+// class FButtonGroup
+
+#ifndef _FBUTTONGROUP_H
+#define _FBUTTONGROUP_H
+
+#include "fwidget.h"
+
+
+class FToggleButton;
+
+//----------------------------------------------------------------------
+// class FButtonGroup
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FButtonGroup : public FWidget
+{
+ private:
+ FString text;
+ bool border;
+ typedef std::vector FButtonList;
+ FButtonGroup::FButtonList buttonlist;
+
+ private:
+ FButtonGroup (const FButtonGroup&);
+ FButtonGroup& operator = (const FButtonGroup&);
+ void init();
+ bool isRadioButton(FToggleButton*) const;
+ void directFocus();
+
+ protected:
+ virtual void draw();
+ uChar getHotkey();
+ void setHotkeyAccelerator();
+ void drawLabel();
+
+ public:
+ FButtonGroup (FWidget* parent=0); // constructor
+ FButtonGroup (const FString&, FWidget* parent=0); // constructor
+ virtual ~FButtonGroup(); // destructor
+ const char* getClassName() const;
+
+ void hide();
+
+ FToggleButton* getFirstButton();
+ FToggleButton* getLastButton();
+ bool hasFocusedButton();
+ bool hasCheckedButton();
+ void onMouseDown (FMouseEvent*);
+ void onAccel (FAccelEvent*);
+ void onFocusIn (FFocusEvent*);
+ void onFocusOut (FFocusEvent*);
+
+ void insert (FToggleButton*);
+ void remove (FToggleButton*);
+
+ void cb_buttonToggled (FWidget*, void*);
+
+ bool setEnable(bool);
+ bool setEnable();
+ bool unsetEnable();
+ bool setDisable();
+ bool setBorder(bool);
+ bool setBorder();
+ bool unsetBorder();
+ void setText (const FString&);
+ FString& getText();
+};
+#pragma pack(pop)
+
+
+// FButtonGroup inline functions
+//----------------------------------------------------------------------
+inline const char* FButtonGroup::getClassName() const
+{ return "FButtonGroup"; }
+
+//----------------------------------------------------------------------
+inline bool FButtonGroup::setEnable()
+{ return setEnable(true); }
+
+//----------------------------------------------------------------------
+inline bool FButtonGroup::unsetEnable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FButtonGroup::setDisable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FButtonGroup::setBorder()
+{ return setBorder(true); }
+
+//----------------------------------------------------------------------
+inline bool FButtonGroup::unsetBorder()
+{ return setBorder(false); }
+
+//----------------------------------------------------------------------
+inline FString& FButtonGroup::getText()
+{ return this->text; }
+
+#endif // _FBUTTONGROUP_H
diff --git a/src/fcharmap.h b/src/fcharmap.h
new file mode 100644
index 00000000..26b761ef
--- /dev/null
+++ b/src/fcharmap.h
@@ -0,0 +1,293 @@
+// fcharmap.h
+
+#ifndef _FCHARMAP_H
+#define _FCHARMAP_H
+
+static uInt character[][fc::NUM_OF_ENCODINGS] =
+{
+ // .--------------------- Unicode (UTF-8)
+ // | .--------------- VT100
+ // | | .--------- PC (IBM-437)
+ // | | | .---- ASCII (7-Bit)
+ // | | | |
+ {0x00f6,0xf6, 0x94, 'o'}, // ö - o-umlaut
+ {0x00e4,0xe4, 0x84, 'a'}, // ä - a-umlaut
+ {0x00fc,0xfc, 0x81, 'u'}, // ü - u-umlaut
+ {0x00d6,0xd6, 0x99, 'O'}, // Ö - O-umlaut
+ {0x00c4,0xc4, 0x8e, 'A'}, // Ä - A-umlaut
+ {0x00dc,0xdc, 0x9a, 'U'}, // Ü - U-umlaut
+ {0x00df,0xdf, 0xe1, 's'}, // ß - sz-ligature
+ {0x20ac, 'E', 0xee, 'E'}, // € - Euro
+ {0x00a3, '}', 0x9c, 'P'}, // £ - Pound
+ {0x03c0, '{', 0xe3, 'n'}, // π - Pi
+ {0x207F, 'I', 0xfc, ' '}, // ⁿ - SuperscriptLatinSmallLetterN
+ {0x2265, 'z', 0xf2, '>'}, // ≥ - GreaterThanOrEqualTo
+ {0x2264, 'y', 0xf3, '<'}, // ≤ - LessThanOrEqualTo
+ {0x2260, '|', 0xd8, '!'}, // ≠ - NotEqualTo
+ {0x00b1, 'g', 0xf1, '#'}, // ± - PlusMinus
+ {0x00b0, 'f', 0xb0, 'o'}, // ° - Degree
+ {0x2022, '`', 0x04, '*'}, // • - Bullet
+ {0x00b7, '`', 0xf9, '*'}, // · - small Bullet
+ {0x25c6, '`', 0x04, '*'}, // ◆ - BlackDiamond
+ {0x2424, 'h', ' ', ' '}, //  - SymbolForNewline
+ {0x240b, 'i', ' ', ' '}, // ␋ - SymbolForVerticalTab
+ {0x2409, 'b', ' ', ' '}, // ␉ - SymbolForHorizontalTab
+ {0x240c, 'c', ' ', ' '}, // ␌ - SymbolForFormFeed
+ {0x240d, 'd', ' ', ' '}, // ␍ - SymbolForCarriageReturn
+ {0x240a, 'e', ' ', ' '}, // ␊ - SymbolForLineFeed
+ {0x2592, 'a', 0xb0, '#'}, // ▒ - MediumShade
+ {0x2588, '0', 0xdb, '#'}, // █ - FullBlock
+ {0x25ae, '_', 0xfe, '#'}, // ▮ - BlackVerticalRectangle
+ {0x258c, 0 , 0xdd, ' '}, // ▌ - LeftHalfBlock
+ {0x2590, 0 , 0xde, ' '}, // ▐ - RightHalfBlock
+ {0x2584, 0 , 0xdc, ' '}, // ▄ - LowerHalfBlock
+ {0x2580, 0 , 0xdf, ' '}, // ▀ - UpperHalfBlock
+ {0x2500, 'q', 0xc4, '-'}, // ─ - BoxDrawingsHorizontal
+ {0x2502, 'x', 0xb3, '|'}, // │ - BoxDrawingsVertical
+ {0x250c, 'l', 0xda, '.'}, // ┌ - BoxDrawingsDownAndRight
+ {0x2510, 'k', 0xbf, '.'}, // ┐ - BoxDrawingsDownAndLeft
+ {0x2514, 'm', 0xc0, '`'}, // └ - BoxDrawingsUpAndRight
+ {0x2518, 'j', 0xd9, '\''}, // ┘ - BoxDrawingsUpAndLeft
+ {0x253c, 'n', 0xc5, '+'}, // ┼ - BoxDrawingsCross
+ {0x252c, 'w', 0xc2, '+'}, // ┬ - BoxDrawingsDownAndHorizontal
+ {0x2524, 'u', 0xb4, '+'}, // ┤ - BoxDrawingsVerticalAndLeft
+ {0x251c, 't', 0xc3, '+'}, // ├ - BoxDrawingsVerticalAndRight
+ {0x2534, 'v', 0xc1, '+'}, // ┴ - BoxDrawingsUpAndHorizontal
+ {0x23ba, 'o', '~', '~'}, // ⎺ - HorizontalScanLine1
+ {0x23bb, 'p', 0xc4, '-'}, // ⎻ - HorizontalScanLine3
+ {0x23bc, 'r', 0xc4, '-'}, // ⎼ - HorizontalScanLine7
+ {0x23bd, 's', '_', '_'}, // ⎽ - HorizontalScanLine9
+ {0x25b2, '-', 0x1e, '^'}, // ▲ - BlackUpPointingTriangle
+ {0x25bc, '.', 0x1f, 'v'}, // ▼ - BlackDownPointingTriangle
+ {0x25ba, '+', 0x10, '>'}, // ► - BlackRightPointingPointer
+ {0x25c4, ',', 0x11, '<'}, // ◄ - BlackLeftPointingPointer
+ {0x1ab4, 0, 0xb4, 0}, // ⊐ - NF_rev_left_arrow2
+ {0x1ab5, 0, 0xb5, 0}, // ► - NF_rev_right_arrow2
+ {0x1ab7, 0, 0xb7, 0}, // ) - NF_radio_button3
+ {0x1ab8, 0, 0xb8, 0}, // ⎤ - NF_rev_border_corner_upper_right
+ {0x1ab9, 0, 0xb9, 0}, // ⎹ - NF_rev_border_line_right
+ {0x1aba, 0, 0xba, 0}, // ┤ - NF_rev_border_line_vertical_left
+ {0x1abb, 0, 0xbb, 0}, // ⎦ - NF_rev_border_corner_lower_right
+ {0x1abc, 0, 0xbc, 0}, // ⎸ - NF_border_line_left
+ {0x1abd, 0, 0xbd, 0}, //⎹◣ - NF_rev_up_arrow2
+ {0x1abe, 0, 0xbe, 0}, //⎹◤ - NF_rev_down_arrow2
+ {0x1ac0, 0, 0xc0, 0}, // └ - NF_border_corner_middle_lower_left
+ {0x1ac1, 0, 0xc1, 0}, // ◢⎸ - NF_rev_up_arrow1
+ {0x1ac2, 0, 0xc2, 0}, // ◥⎸ - NF_rev_down_arrow1
+ {0x1ac3, 0, 0xc3, 0}, // ├ - NF_border_line_vertical_right
+ {0x1ac5, 0, 0xc5, 0}, // = - NF_border_line_up_and_down
+ {0x1ac6, 0, 0xc6, 0}, // = - NF_shadow_box_middle
+ {0x1ac7, 0, 0xc7, 0}, // = - NF_shadow_box_hdd
+ {0x1ac8, 0, 0xc8, 0}, // ◄ - NF_rev_left_arrow1
+ {0x1ac9, 0, 0xc9, 0}, // ⊏ - NF_rev_right_arrow1
+ {0x1aca, 0, 0xca, 0}, // [ - NF_rev_menu_button1
+ {0x1acb, 0, 0xcb, 0}, // - - NF_rev_menu_button2
+ {0x1acc, 0, 0xcc, 0}, // ┌ - NF_border_corner_middle_upper_left
+ {0x1acd, 0, 0xcd, 0}, // = - NF_shadow_box_cd
+ {0x1ace, 0, 0xce, 0}, // [ - NF_shadow_box_left
+ {0x1acf, 0, 0xcf, 0}, // ┘ - NF_border_corner_middle_lower_right
+ {0x1ad0, 0, 0xd0, 0}, // ┐ - NF_border_corner_middle_upper_right
+ {0x1ad1, 0, 0xd1, 0}, // = - NF_shadow_box_net
+ {0x1ad2, 0, 0xd2, 0}, // ◢ - NF_rev_up_pointing_triangle1
+ {0x1ad3, 0, 0xd3, 0}, // ⎣ - NF_border_corner_lower_left
+ {0x1ad4, 0, 0xd4, 0}, // _ - NF_border_line_bottom
+ {0x1ad5, 0, 0xd5, 0}, // O - NF_radio_button2
+ {0x1ad6, 0, 0xd6, 0}, // ● - NF_radio_button2_checked
+ {0x1ad7, 0, 0xd7, 0}, // ◥ - NF_rev_down_pointing_triangle1
+ {0x1ad8, 0, 0xd8, 0}, // ¯ - NF_border_line_upper
+ {0x1ad9, 0, 0xd9, 0}, // ( - NF_radio_button1
+ {0x1ada, 0, 0xda, 0}, // ⎡ - NF_border_corner_upper_left
+ {0x1adc, 0, 0xdc, 0}, // ✓ - NF_shadow_box_checked
+ {0x1ae8, 0, 0xe8, 0}, // ◣ - NF_rev_up_pointing_triangle2
+ {0x1ae9, 0, 0xe9, 0}, // ◤ - NF_rev_down_pointing_triangle2
+ {0x1af4, 0, 0xf4, 0}, // ] - NF_rev_menu_button3
+ {0x1af5, 0, 0xf5, 0}, // ] - NF_shadow_box_right
+ {0x1afb, 0, 0xfb, 0} // ✓ - NF_check_mark
+};
+
+const int lastCharItem = (sizeof(character) / sizeof(character[0])) - 1;
+
+
+static int vt100_key_to_utf8[][2] =
+{
+ {fc::vt100_key_rarrow , fc::BlackRightPointingPointer}, // ►
+ {fc::vt100_key_larrow , fc::BlackLeftPointingPointer}, // ◄
+ {fc::vt100_key_uarrow , fc::BlackUpPointingTriangle}, // ▲
+ {fc::vt100_key_darrow , fc::BlackDownPointingTriangle}, // ▼
+ {fc::vt100_key_block , fc::FullBlock}, // █
+ {fc::vt100_key_nsup , fc::SuperscriptLatinSmallLetterN}, // ⁿ
+ {fc::vt100_key_blackrect, fc::BlackVerticalRectangle}, // ▮
+ {fc::vt100_key_diamond , fc::BlackDiamond}, // ◆
+ {fc::vt100_key_ckboard , fc::MediumShade}, // ▒
+ {fc::vt100_key_htab , fc::SymbolForHorizontalTab}, // ␉
+ {fc::vt100_key_ff , fc::SymbolForFormFeed}, // ␌
+ {fc::vt100_key_cr , fc::SymbolForCarriageReturn}, // ␍
+ {fc::vt100_key_lf , fc::SymbolForLineFeed}, // ␊
+ {fc::vt100_key_degree , fc::Degree}, // °
+ {fc::vt100_key_plminus , fc::PlusMinus}, // ±
+ {fc::vt100_key_board , fc::SymbolForNewline}, // 
+ {fc::vt100_key_lantern , fc::SymbolForVerticalTab}, // ␋
+ {fc::vt100_key_lrcorner , fc::BoxDrawingsUpAndLeft}, // ┘
+ {fc::vt100_key_urcorner , fc::BoxDrawingsDownAndLeft}, // ┐
+ {fc::vt100_key_ulcorner , fc::BoxDrawingsDownAndRight}, // ┌
+ {fc::vt100_key_llcorner , fc::BoxDrawingsUpAndRight}, // └
+ {fc::vt100_key_plus , fc::BoxDrawingsCross}, // ┼
+ {fc::vt100_key_s1 , fc::HorizontalScanLine1}, // ⎺
+ {fc::vt100_key_s3 , fc::HorizontalScanLine3}, // ⎻
+ {fc::vt100_key_hline , fc::BoxDrawingsHorizontal}, // ─
+ {fc::vt100_key_s7 , fc::HorizontalScanLine7}, // ⎼
+ {fc::vt100_key_s9 , fc::HorizontalScanLine9}, // ⎽
+ {fc::vt100_key_ltee , fc::BoxDrawingsVerticalAndRight}, // ├
+ {fc::vt100_key_rtee , fc::BoxDrawingsVerticalAndLeft}, // ┤
+ {fc::vt100_key_btee , fc::BoxDrawingsUpAndHorizontal}, // ┴
+ {fc::vt100_key_ttee , fc::BoxDrawingsDownAndHorizontal}, // ┬
+ {fc::vt100_key_vline , fc::BoxDrawingsVertical}, // │
+ {fc::vt100_key_lequal , fc::LessThanOrEqualTo}, // ≤
+ {fc::vt100_key_gequal , fc::GreaterThanOrEqualTo}, // ≥
+ {fc::vt100_key_pi , fc::Pi}, // π
+ {fc::vt100_key_nequal , fc::NotEqualTo}, // ≠
+ {fc::vt100_key_sterling , fc::Pound}, // £
+ {fc::vt100_key_bullet , fc::SmallBullet}, // ·
+ {fc::vt100_key_diamond , fc::Bullet} // ◆
+};
+
+const int lastKeyItem = ( sizeof(vt100_key_to_utf8) /
+ sizeof(vt100_key_to_utf8[0]) ) - 1;
+
+
+static uInt cp437_to_ucs[][2] =
+{
+ {0x80, 0x00c7}, // latin capital letter c with cedilla
+ {0x81, 0x00fc}, // latin small letter u with diaeresis
+ {0x82, 0x00e9}, // latin small letter e with acute
+ {0x83, 0x00e2}, // latin small letter a with circumflex
+ {0x84, 0x00e4}, // latin small letter a with diaeresis
+ {0x85, 0x00e0}, // latin small letter a with grave
+ {0x86, 0x00e5}, // latin small letter a with ring above
+ {0x87, 0x00e7}, // latin small letter c with cedilla
+ {0x88, 0x00ea}, // latin small letter e with circumflex
+ {0x89, 0x00eb}, // latin small letter e with diaeresis
+ {0x8a, 0x00e8}, // latin small letter e with grave
+ {0x8b, 0x00ef}, // latin small letter i with diaeresis
+ {0x8c, 0x00ee}, // latin small letter i with circumflex
+ {0x8d, 0x00ec}, // latin small letter i with grave
+ {0x8e, 0x00c4}, // latin capital letter a with diaeresis
+ {0x8f, 0x00c5}, // latin capital letter a with ring above
+ {0x90, 0x00c9}, // latin capital letter e with acute
+ {0x91, 0x00e6}, // latin small ligature ae
+ {0x92, 0x00c6}, // latin capital ligature ae
+ {0x93, 0x00f4}, // latin small letter o with circumflex
+ {0x94, 0x00f6}, // latin small letter o with diaeresis
+ {0x95, 0x00f2}, // latin small letter o with grave
+ {0x96, 0x00fb}, // latin small letter u with circumflex
+ {0x97, 0x00f9}, // latin small letter u with grave
+ {0x98, 0x00ff}, // latin small letter y with diaeresis
+ {0x99, 0x00d6}, // latin capital letter o with diaeresis
+ {0x9a, 0x00dc}, // latin capital letter u with diaeresis
+ {0x9b, 0x00a2}, // cent sign
+ {0x9c, 0x00a3}, // pound sign
+ {0x9d, 0x00a5}, // yen sign
+ {0x9e, 0x20a7}, // peseta sign
+ {0x9f, 0x0192}, // latin small letter f with hook
+ {0xa0, 0x00e1}, // latin small letter a with acute
+ {0xa1, 0x00ed}, // latin small letter i with acute
+ {0xa2, 0x00f3}, // latin small letter o with acute
+ {0xa3, 0x00fa}, // latin small letter u with acute
+ {0xa4, 0x00f1}, // latin small letter n with tilde
+ {0xa5, 0x00d1}, // latin capital letter n with tilde
+ {0xa6, 0x00aa}, // feminine ordinal indicator
+ {0xa7, 0x00ba}, // masculine ordinal indicator
+ {0xa8, 0x00bf}, // inverted question mark
+ {0xa9, 0x2310}, // reversed not sign
+ {0xaa, 0x00ac}, // not sign
+ {0xab, 0x00bd}, // vulgar fraction one half
+ {0xac, 0x00bc}, // vulgar fraction one quarter
+ {0xad, 0x00a1}, // inverted exclamation mark
+ {0xae, 0x00ab}, // left-pointing double angle quotation mark
+ {0xaf, 0x00bb}, // right-pointing double angle quotation mark
+ {0xb0, 0x2591}, // light shade
+ {0xb1, 0x2592}, // medium shade
+ {0xb2, 0x2593}, // dark shade
+ {0xb3, 0x2502}, // box drawings light vertical
+ {0xb4, 0x2524}, // box drawings light vertical and left
+ {0xb5, 0x2561}, // box drawings vertical single and left double
+ {0xb6, 0x2562}, // box drawings vertical double and left single
+ {0xb7, 0x2556}, // box drawings down double and left single
+ {0xb8, 0x2555}, // box drawings down single and left double
+ {0xb9, 0x2563}, // box drawings double vertical and left
+ {0xba, 0x2551}, // box drawings double vertical
+ {0xbb, 0x2557}, // box drawings double down and left
+ {0xbc, 0x255d}, // box drawings double up and left
+ {0xbd, 0x255c}, // box drawings up double and left single
+ {0xbe, 0x255b}, // box drawings up single and left double
+ {0xbf, 0x2510}, // box drawings light down and left
+ {0xc0, 0x2514}, // box drawings light up and right
+ {0xc1, 0x2534}, // box drawings light up and horizontal
+ {0xc2, 0x252c}, // box drawings light down and horizontal
+ {0xc3, 0x251c}, // box drawings light vertical and right
+ {0xc4, 0x2500}, // box drawings light horizontal
+ {0xc5, 0x253c}, // box drawings light vertical and horizontal
+ {0xc6, 0x255e}, // box drawings vertical single and right double
+ {0xc7, 0x255f}, // box drawings vertical double and right single
+ {0xc8, 0x255a}, // box drawings double up and right
+ {0xc9, 0x2554}, // box drawings double down and right
+ {0xca, 0x2569}, // box drawings double up and horizontal
+ {0xcb, 0x2566}, // box drawings double down and horizontal
+ {0xcc, 0x2560}, // box drawings double vertical and right
+ {0xcd, 0x2550}, // box drawings double horizontal
+ {0xce, 0x256c}, // box drawings double vertical and horizontal
+ {0xcf, 0x2567}, // box drawings up single and horizontal double
+ {0xd0, 0x2568}, // box drawings up double and horizontal single
+ {0xd1, 0x2564}, // box drawings down single and horizontal double
+ {0xd2, 0x2565}, // box drawings down double and horizontal single
+ {0xd3, 0x2559}, // box drawings up double and right single
+ {0xd4, 0x2558}, // box drawings up single and right double
+ {0xd5, 0x2552}, // box drawings down single and right double
+ {0xd6, 0x2553}, // box drawings down double and right single
+ {0xd7, 0x256b}, // box drawings vertical double and horizontal single
+ {0xd8, 0x256a}, // box drawings vertical single and horizontal double
+ {0xd9, 0x2518}, // box drawings light up and left
+ {0xda, 0x250c}, // box drawings light down and right
+ {0xdb, 0x2588}, // full block
+ {0xdc, 0x2584}, // lower half block
+ {0xdd, 0x258c}, // left half block
+ {0xde, 0x2590}, // right half block
+ {0xdf, 0x2580}, // upper half block
+ {0xe0, 0x03b1}, // greek small letter alpha
+ {0xe1, 0x00df}, // latin small letter sharp s
+ {0xe2, 0x0393}, // greek capital letter gamma
+ {0xe3, 0x03c0}, // greek small letter pi
+ {0xe4, 0x03a3}, // greek capital letter sigma
+ {0xe5, 0x03c3}, // greek small letter sigma
+ {0xe6, 0x00b5}, // micro sign
+ {0xe7, 0x03c4}, // greek small letter tau
+ {0xe8, 0x03a6}, // greek capital letter phi
+ {0xe9, 0x0398}, // greek capital letter theta
+ {0xea, 0x03a9}, // greek capital letter omega
+ {0xeb, 0x03b4}, // greek small letter delta
+ {0xec, 0x221e}, // infinity
+ {0xed, 0x03c6}, // greek small letter phi
+ {0xee, 0x03b5}, // greek small letter epsilon
+ {0xef, 0x2229}, // intersection
+ {0xf0, 0x2261}, // identical to
+ {0xf1, 0x00b1}, // plus-minus sign
+ {0xf2, 0x2265}, // greater-than or equal to
+ {0xf3, 0x2264}, // less-than or equal to
+ {0xf4, 0x2320}, // top half integral
+ {0xf5, 0x2321}, // bottom half integral
+ {0xf6, 0x00f7}, // division sign
+ {0xf7, 0x2248}, // almost equal to
+ {0xf8, 0x00b0}, // degree sign
+ {0xf9, 0x2219}, // bullet operator
+ {0xfa, 0x00b7}, // middle dot
+ {0xfb, 0x221a}, // square root
+ {0xfc, 0x207f}, // superscript latin small letter n
+ {0xfd, 0x00b2}, // superscript two
+ {0xfe, 0x25a0}, // black square
+ {0xff, 0x00a0} // no-break space
+};
+
+const uInt lastCP437Item = (sizeof(cp437_to_ucs) / sizeof(cp437_to_ucs[0])) - 1;
+
+
+#endif // _FCHARMAP_H
diff --git a/src/fcheckbox.cpp b/src/fcheckbox.cpp
new file mode 100644
index 00000000..0f99f396
--- /dev/null
+++ b/src/fcheckbox.cpp
@@ -0,0 +1,70 @@
+// fcheckbox.cpp
+// class FCheckBox
+
+#include "fcheckbox.h"
+
+
+//----------------------------------------------------------------------
+// class FCheckBox
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FCheckBox::FCheckBox(FWidget* parent) : FToggleButton(parent)
+{
+}
+
+//----------------------------------------------------------------------
+FCheckBox::FCheckBox ( const FString& txt,
+ FWidget* parent ) : FToggleButton(txt, parent)
+{
+}
+
+//----------------------------------------------------------------------
+FCheckBox::~FCheckBox() // destructor
+{
+}
+
+
+// private methods of FCheckBox
+//----------------------------------------------------------------------
+void FCheckBox::draw()
+{
+ setUpdateVTerm(false);
+ drawCheckButton();
+ drawLabel();
+ setUpdateVTerm(true);
+
+ FToggleButton::draw();
+}
+
+//----------------------------------------------------------------------
+void FCheckBox::drawCheckButton()
+{
+ if ( ! isVisible() )
+ return;
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ setColor (foregroundColor, backgroundColor);
+ if ( checked )
+ {
+ if ( isNewFont() )
+ print (CHECKBOX_ON);
+ else
+ {
+ print ('[');
+ print ('x');
+ print (']');
+ }
+ }
+ else
+ {
+ if ( isNewFont() )
+ print (CHECKBOX);
+ else
+ {
+ print ('[');
+ print (' ');
+ print (']');
+ }
+ }
+}
diff --git a/src/fcheckbox.h b/src/fcheckbox.h
new file mode 100644
index 00000000..02bc40aa
--- /dev/null
+++ b/src/fcheckbox.h
@@ -0,0 +1,39 @@
+// fcheckbox.h
+// class FCheckBox
+
+#ifndef _FCHECKBOX_H
+#define _FCHECKBOX_H
+
+#include "ftogglebutton.h"
+
+
+//----------------------------------------------------------------------
+// class FCheckBox
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FCheckBox : public FToggleButton
+{
+ private:
+ FCheckBox (const FCheckBox&);
+ FCheckBox& operator = (const FCheckBox&);
+ void draw();
+ void drawCheckButton();
+
+ public:
+ FCheckBox (FWidget* parent=0); // constructor
+ FCheckBox (const FString&, FWidget* parent=0); // constructor
+ virtual ~FCheckBox(); // destructor
+ const char* getClassName() const;
+};
+#pragma pack(pop)
+
+
+// FCheckBox inline functions
+//----------------------------------------------------------------------
+inline const char* FCheckBox::getClassName() const
+{ return "FCheckBox"; }
+
+#endif // _FCHECKBOX_H
diff --git a/src/fdialog.cpp b/src/fdialog.cpp
new file mode 100644
index 00000000..7cf1eecc
--- /dev/null
+++ b/src/fdialog.cpp
@@ -0,0 +1,914 @@
+// fdialog.cpp
+// class FDialog
+
+#include "fapp.h"
+#include "fdialog.h"
+#include "fstatusbar.h"
+
+
+//----------------------------------------------------------------------
+// class FDialog
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FDialog::FDialog(FWidget* parent) : FWindow(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FDialog::FDialog (const FString& txt, FWidget* parent) : FWindow(parent)
+{
+ this->init();
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FDialog::~FDialog() // destructor
+{
+ delete accelerator_list;
+ accelerator_list = 0;
+ activatePrevWindow();
+ delWindow(this);
+
+ FApplication* fapp = static_cast(getRootWidget());
+ if ( ! fapp->quit_now )
+ {
+ const FRect& geometry = getGeometryGlobalShadow();
+ restoreVTerm (geometry);
+
+ parentWidget()->redraw();
+ }
+
+ if ( window_list && ! window_list->empty() )
+ {
+ widgetList::const_iterator iter, end;
+ iter = window_list->begin();
+ end = window_list->end();
+
+ while ( iter != end )
+ {
+ putArea ((*iter)->getGlobalPos(), (*iter)->getVWin());
+ if ( ! maximized && ((*iter)->getFlags() & SHADOW) != 0 )
+ static_cast(*iter)->drawDialogShadow();
+ ++iter;
+ }
+ setFocusWidget(0);
+ updateTerminal();
+ flush_out();
+ }
+
+ if ( vwin != 0 )
+ {
+ if ( vwin->changes != 0 )
+ delete[] vwin->changes;
+ if ( vwin->text != 0 )
+ delete[] vwin->text;
+ delete vwin;
+ }
+ if ( isModal() )
+ unsetModal();
+}
+
+// private methods of FDialog
+//----------------------------------------------------------------------
+void FDialog::init()
+{
+ flags = 0;
+ result_code = FDialog::Reject;
+ width = 10;
+ height = 10;
+ xmin = 1;
+ ymin = 1;
+ xmax = width;
+ ymax = height;
+ client_xmin = 1;
+ client_ymin = 1;
+ client_xmax = width;
+ client_ymax = height;
+ top_padding = 2;
+ left_padding = 1;
+ bottom_padding = 1;
+ right_padding = 1;
+ createArea (vwin);
+ setGeometry (1, 1, 10, 10, false); // initialize geometry values
+ focus_widget = 0;
+ this->text = "";
+ maximized = false;
+ ignore_padding = true;
+ window_object = true;
+ addWindow(this);
+ setActiveWindow(this);
+
+ foregroundColor = wc.dialog_fg;
+ backgroundColor = wc.dialog_bg;
+
+ if ( hasFocus() )
+ this->flags |= FOCUS;
+ if ( isEnabled() )
+ this->flags |= ACTIVE;
+
+ FWidget* old_focus = FWidget::getFocusWidget();
+ setFocus();
+ if ( old_focus )
+ old_focus->redraw();
+ accelerator_list = new Accelerators;
+}
+
+//----------------------------------------------------------------------
+void FDialog::drawBorder()
+{
+ int x1, x2, y1, y2;
+ x1 = xpos+xmin-1;
+ x2 = xpos+xmin-2+width;
+ y1 = ypos+ymin;
+ y2 = ypos+ymin-2+height;
+
+ if ( isNewFont() )
+ {
+ int fg;
+ if ( ! isRootWidget() )
+ fg = parentWidget()->getForegroundColor();
+ else
+ fg = wc.term_fg;
+ for (int y=y1; y <= y2; y++)
+ {
+ setColor (fg, backgroundColor);
+ gotoxy (x1, y);
+ // border left ⎸
+ print (fc::NF_border_line_left);
+ gotoxy (x2, y);
+ // border right⎹
+ print (fc::NF_rev_border_line_right);
+ }
+ if ( (flags & SHADOW) == 0 )
+ {
+ setColor (fg, backgroundColor);
+ gotoxy (x1, y2);
+ // lower left corner border ⎣
+ print (fc::NF_border_corner_lower_left);
+ for (int x=1; x < width-1; x++) // low line _
+ print (fc::NF_border_line_bottom);
+ gotoxy (x2, y2);
+ // lower right corner border ⎦
+ print (fc::NF_rev_border_corner_lower_right);
+ }
+ }
+ else
+ {
+ gotoxy (x1, y1);
+ print (fc::BoxDrawingsDownAndRight); // ┌
+ for (int x=x1+1; x < x2; x++)
+ print (fc::BoxDrawingsHorizontal); // ─
+ print (fc::BoxDrawingsDownAndLeft); // ┐
+
+ gotoxy (x1, y2);
+ print (fc::BoxDrawingsUpAndRight); // └
+ for (int x=x1+1; x < x2; x++)
+ print (fc::BoxDrawingsHorizontal); // ─
+ print (fc::BoxDrawingsUpAndLeft); // ┘
+
+ for (int y=y1+1; y < y2; y++)
+ {
+ gotoxy (x1, y);
+ print (fc::BoxDrawingsVertical); // │
+ gotoxy (x2, y);
+ print (fc::BoxDrawingsVertical); // │
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::drawTitleBar()
+{
+ int i,x;
+ uInt length = text.getLength();
+
+ // draw the title button
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ setColor (wc.titlebar_button_fg, wc.titlebar_button_bg);
+ if ( isNewFont() )
+ {
+ print (fc::NF_rev_menu_button1);
+ print (fc::NF_rev_menu_button2);
+ print (fc::NF_rev_menu_button3);
+ }
+ else
+ print (" - ");
+
+ // fill with spaces (left of the title)
+ if ( isActiveWindow() )
+ setColor (wc.titlebar_active_fg, wc.titlebar_active_bg);
+ else
+ setColor (wc.titlebar_inactive_fg, wc.titlebar_inactive_bg);
+
+ if ( isMonochron() )
+ setReverse(true);
+
+ i = width - 3 - int(length);
+ i = int(i/2);
+
+ for (x=1; x <= i; x++)
+ print (' ');
+
+ // the title bar text
+ print (text);
+
+ // fill the rest of the bar
+ for (; x+1+int(length) <= width-2; x++)
+ print (' ');
+
+ if ( isMonochron() )
+ setReverse(false);
+
+/* print the number of window in stack */
+//gotoxy(xpos+xmin+width-4, ypos+ymin-1);
+//printf ("(%d)", getWindowLayer(this));
+
+}
+
+// protected methods of FDialog
+//----------------------------------------------------------------------
+void FDialog::done(int result)
+{
+ hide();
+ result_code = result;
+}
+
+//----------------------------------------------------------------------
+void FDialog::drawDialogShadow()
+{
+ if ((flags & TRANS_SHADOW) != 0)
+ {
+ // transparent shadow
+ drawShadow();
+ if ( isNewFont() && ((flags & SCROLLABLE) == 0) )
+ {
+ FTerm::char_data ch;
+ // left of the shaddow ▀▀
+ gotoxy (xpos+xmin-1, ypos+ymin-1+height);
+ for (int x=0; x <= 1; x++)
+ {
+ ch = getCoveredCharacter (xpos+xmin-1+x, ypos+ymin-1+height, this);
+ setColor (wc.shadow_fg, ch.bg_color);
+ // high line ⎺
+ print (fc::NF_border_line_upper);
+ }
+ }
+ }
+ else
+ {
+ drawShadow();
+ FTerm::char_data ch;
+ ch = getCoveredCharacter (xpos+xmin-1, ypos+ymin-1+height, this);
+ // left of the shaddow ▀▀
+ gotoxy (xpos+xmin-1, ypos+ymin-1+height);
+
+ if ( isNewFont() && ((flags & SCROLLABLE) == 0) )
+ {
+ setColor (wc.shadow_fg, ch.bg_color);
+ // high line ⎺
+ print (fc::NF_border_line_upper);
+ }
+ else
+ {
+ setColor(ch.fg_color, ch.bg_color);
+
+ if ( ch.bold )
+ setBold();
+ if ( ch.reverse )
+ setReverse();
+ if ( ch.underline )
+ setUnderline();
+
+ print (ch.code);
+
+ if ( ch.underline )
+ unsetUnderline();
+ if ( ch.reverse )
+ unsetReverse();
+ if ( ch.bold )
+ unsetBold();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::draw()
+{
+ if ( maximized && ! isRootWidget() )
+ {
+ xpos = 1;
+ ypos = 1;
+ width = xmax;
+ height = ymax;
+ }
+ // fill the background
+ setColor (foregroundColor, backgroundColor);
+ setUpdateVTerm(false);
+ clrscr();
+ drawBorder();
+ drawTitleBar();
+
+ if ( ! maximized && (flags & SHADOW) != 0 )
+ drawDialogShadow();
+
+ if ( (flags & RESIZEABLE) != 0 )
+ {
+ if ( maximized )
+ {
+ if ( isNewFont() )
+ {
+ gotoxy (xpos+xmin+width-3, ypos+ymin-1);
+ setColor (wc.titlebar_button_fg, wc.titlebar_button_bg);
+ print (fc::NF_rev_down_pointing_triangle1);
+ print (fc::NF_rev_down_pointing_triangle2);
+ }
+ else
+ {
+ gotoxy (xpos+xmin+width-4, ypos+ymin-1);
+ setColor (wc.titlebar_button_fg, wc.titlebar_button_bg);
+ print (' ');
+ print (fc::BlackDownPointingTriangle); // ▼
+ print (' ');
+ }
+ }
+ else
+ {
+ if ( isNewFont() )
+ {
+ gotoxy (xpos+xmin+width-3, ypos+ymin-1);
+ setColor (wc.titlebar_button_fg, wc.titlebar_button_bg);
+ print (fc::NF_rev_up_pointing_triangle1);
+ print (fc::NF_rev_up_pointing_triangle2);
+ }
+ else
+ {
+ gotoxy (xpos+xmin+width-4, ypos+ymin-1);
+ setColor (wc.titlebar_button_fg, wc.titlebar_button_bg);
+ print (' ');
+ print (fc::BlackUpPointingTriangle); // ▲
+ print (' ');
+ }
+ }
+ }
+ setUpdateVTerm(true);
+}
+
+//----------------------------------------------------------------------
+void FDialog::onShow (FShowEvent*)
+{
+}
+
+//----------------------------------------------------------------------
+void FDialog::onHide (FHideEvent*)
+{
+}
+
+//----------------------------------------------------------------------
+void FDialog::onClose (FCloseEvent* event)
+{
+ event->accept();
+ result_code = FDialog::Reject;
+}
+
+// public methods of FDialog
+//----------------------------------------------------------------------
+void FDialog::onKeyPress (FKeyEvent* event)
+{
+ if ( ! isEnabled() || this == getMainWidget() )
+ return;
+
+ if ( event->key() == fc::Fkey_escape
+ || event->key() == fc::Fkey_escape_mintty )
+ {
+ event->accept();
+ if ( isModal() )
+ done (FDialog::Reject);
+ else
+ close();
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onMouseDown (FMouseEvent* event)
+{
+ int mouse_x = event->getX();
+ int mouse_y = event->getY();
+
+ if ( event->getButton() == LeftButton )
+ {
+ // click on titlebar or window: raise + activate
+ if ( mouse_x >= 4 && mouse_x <= width && mouse_y == 1 )
+ TitleBarClickPos.setPoint (event->getGlobalX(), event->getGlobalY());
+ else
+ TitleBarClickPos.setPoint (0,0);
+
+ bool has_raised = raiseWindow();
+
+ if ( ! isActiveWindow() )
+ {
+ FWidget* old_focus = FWidget::getFocusWidget();
+ setActiveWindow(this);
+ if ( focus_widget )
+ {
+ focus_widget->setFocus();
+ focus_widget->redraw();
+ if ( old_focus )
+ old_focus->redraw();
+ }
+ else if ( focusFirstChild() )
+ if ( old_focus )
+ old_focus->redraw();
+ }
+ if ( has_raised )
+ redraw();
+ }
+
+ if ( event->getButton() == RightButton )
+ {
+ // click on titlebar: just activate
+ if ( mouse_x >= 4 && mouse_x <= width && mouse_y == 1 )
+ {
+ if ( ! isActiveWindow() )
+ {
+ FWidget* old_focus = FWidget::getFocusWidget();
+ setActiveWindow(this);
+ if ( focus_widget )
+ {
+ focus_widget->setFocus();
+ focus_widget->redraw();
+ if ( old_focus )
+ old_focus->redraw();
+ }
+ else if ( focusFirstChild() )
+ if ( old_focus )
+ old_focus->redraw();
+ }
+ }
+ }
+
+ if ( event->getButton() == MiddleButton )
+ {
+ // click on titlebar: lower + activate
+ if ( mouse_x >= 4 && mouse_x <= width && mouse_y == 1 )
+ {
+ bool has_lowered = lowerWindow();
+
+ if ( ! isActiveWindow() )
+ {
+ FWidget* old_focus = FWidget::getFocusWidget();
+ setActiveWindow(this);
+ if ( focus_widget )
+ {
+ focus_widget->setFocus();
+ focus_widget->redraw();
+ if ( old_focus )
+ old_focus->redraw();
+ }
+ else if ( focusFirstChild() )
+ if ( old_focus )
+ old_focus->redraw();
+ };
+
+ if ( has_lowered )
+ updateTerminal();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onMouseUp (FMouseEvent* event)
+{
+ int titlebar_x = TitleBarClickPos.getX();
+ int titlebar_y = TitleBarClickPos.getY();
+
+ if ( event->getButton() == LeftButton )
+ {
+ if ( ! TitleBarClickPos.isNull()
+ && titlebar_x >= xpos+xmin+3
+ && titlebar_x <= xpos+xmin-1+width
+ && titlebar_y == ypos+ymin-1 )
+ {
+ FPoint currentPos(getGeometry().getX(), getGeometry().getY());
+ FPoint deltaPos = event->getGlobalPos() - TitleBarClickPos;
+ move (currentPos + deltaPos);
+ TitleBarClickPos = event->getGlobalPos();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onMouseMove (FMouseEvent* event)
+{
+ int titlebar_x = TitleBarClickPos.getX();
+ int titlebar_y = TitleBarClickPos.getY();
+
+ if ( event->getButton() == LeftButton )
+ {
+ if ( ! TitleBarClickPos.isNull()
+ && titlebar_x >= xpos+xmin+3
+ && titlebar_x <= xpos+xmin-1+width
+ && titlebar_y == ypos+ymin-1 )
+ {
+ FPoint currentPos(getGeometry().getX(), getGeometry().getY());
+ FPoint deltaPos = event->getGlobalPos() - TitleBarClickPos;
+ move (currentPos + deltaPos);
+ TitleBarClickPos = event->getGlobalPos();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onMouseDoubleClick (FMouseEvent* event)
+{
+ int x, y;
+
+ if ( event->getButton() != LeftButton )
+ return;
+
+ x = xpos + xmin - 1;
+ y = ypos + ymin - 1;
+ FRect title_button(x, y, 3, 1);
+
+ FPoint gPos = event->getGlobalPos();
+ if ( title_button.contains(gPos) )
+ {
+ setClickedWidget(0);
+ close();
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onWindowActive (FEvent*)
+{
+ if ( isVisible() && isShown() )
+ drawTitleBar();
+
+ if ( ! FWidget::getFocusWidget() )
+ {
+ if ( focus_widget && focus_widget->isVisible() && focus_widget->isShown() )
+ {
+ focus_widget->setFocus();
+ focus_widget->redraw();
+ statusBar()->drawMessage();
+ }
+ else
+ focusFirstChild();
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onWindowInactive (FEvent*)
+{
+ if ( isVisible() && isEnabled() )
+ drawTitleBar();
+}
+
+//----------------------------------------------------------------------
+void FDialog::onWindowRaised (FEvent*)
+{
+ widgetList::const_iterator iter, end;
+ putArea (getGlobalPos(), vwin);
+
+ if ( ! window_list )
+ return;
+ if ( window_list->empty() )
+ return;
+
+ // redraw shaddow of the other windows
+ iter = window_list->begin();
+ end = window_list->end();
+
+ while ( iter != end )
+ {
+ if ( *iter != this
+ && ! maximized
+ && ((*iter)->getFlags() & SHADOW) != 0 )
+ static_cast(*iter)->drawDialogShadow();
+ ++iter;
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::onWindowLowered (FEvent*)
+{
+ widgetList::const_iterator iter, end;
+
+ if ( ! window_list )
+ return;
+ if ( window_list->empty() )
+ return;
+
+ iter = window_list->begin();
+ end = window_list->end();
+
+ while ( iter != end )
+ {
+ putArea ((*iter)->getGlobalPos(), (*iter)->getVWin());
+ if ( ! maximized && ((*iter)->getFlags() & SHADOW) != 0 )
+ static_cast(*iter)->drawDialogShadow();
+ ++iter;
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::show()
+{
+ if ( ! isVisible() )
+ return;
+
+ FWidget::show();
+
+ // set the cursor to the focus widget
+ if ( FWidget::getFocusWidget()
+ && FWidget::getFocusWidget()->isVisible()
+ && FWidget::getFocusWidget()->hasVisibleCursor()
+ && FWidget::getFocusWidget()->isCursorInside() )
+ {
+ FWidget::getFocusWidget()->setCursor();
+ showCursor();
+ flush_out();
+ }
+
+ if ( isModal() )
+ {
+ FApplication* fapp = static_cast(getRootWidget());
+ fapp->enter_loop();
+
+ if ( this == getMainWidget() )
+ fapp->quit();
+ }
+}
+
+//----------------------------------------------------------------------
+void FDialog::hide()
+{
+ FWidget::hide();
+
+ if ( isModal() )
+ {
+ FApplication* fapp = static_cast(getRootWidget());
+ fapp->exit_loop();
+ }
+}
+
+//----------------------------------------------------------------------
+int FDialog::exec()
+{
+ result_code = FDialog::Reject;
+ show();
+ return result_code;
+}
+
+//----------------------------------------------------------------------
+void FDialog::move (const FPoint& pos)
+{
+ move( pos.getX(), pos.getY() );
+}
+
+//----------------------------------------------------------------------
+void FDialog::move (int x, int y)
+{
+ int dx, dy, old_x, old_y;
+
+ if ( x == xpos && y == ypos )
+ return;
+ if ( x+width < 1 || x > getColumnNumber() || y < 1 || y > getLineNumber() )
+ return;
+
+ dx = xpos - x;
+ dy = ypos - y;
+ old_x = xpos;
+ old_y = ypos;
+ short& rsw = shadow.x_ref(); // right shadow width;
+ short& bsh = shadow.y_ref(); // bottom shadow height
+ oldGeometry = getGeometryShadow();
+
+ FWidget::move(x,y);
+ xpos = x;
+ ypos = y;
+
+ putArea (x, y, vwin);
+
+ if ( getGeometry().overlap(oldGeometry) )
+ {
+ // dx > 0 : move left
+ // dx = 0 : move vertical
+ // dx < 0 : move right
+ // dy > 0 : move up
+ // dy = 0 : move horizontal
+ // dy < 0 : move down
+
+ if ( dx > 0 )
+ {
+ if ( dy > 0 )
+ restoreVTerm (old_x+width+rsw-dx, old_y, dx, height+bsh-dy);
+ else
+ restoreVTerm (old_x+width+rsw-dx, old_y+abs(dy), dx, height+bsh-abs(dy));
+ }
+ else
+ {
+ if ( dy > 0 )
+ restoreVTerm (old_x, old_y, abs(dx), height+bsh-dy);
+ else
+ restoreVTerm (old_x, old_y+abs(dy), abs(dx), height+bsh-abs(dy));
+ }
+ if ( dy > 0 )
+ restoreVTerm (old_x, old_y+height+bsh-dy, width+rsw, dy);
+ else
+ restoreVTerm (old_x, old_y, width+rsw, abs(dy));
+ }
+ else
+ {
+ restoreVTerm (old_x, old_y, width+rsw, height+bsh);
+ }
+
+ if ( ! maximized && (flags & SHADOW) != 0 )
+ drawDialogShadow();
+
+ // handle overlaid windows
+ if ( window_list && ! window_list->empty() )
+ {
+ bool overlaid = false;
+ widgetList::const_iterator iter, end;
+ iter = window_list->begin();
+ end = window_list->end();
+
+ while ( iter != end )
+ {
+ if ( overlaid )
+ {
+ putArea ((*iter)->getGlobalPos(), (*iter)->getVWin());
+ if ( ! maximized && ((*iter)->getFlags() & SHADOW) != 0 )
+ static_cast(*iter)->drawDialogShadow();
+ }
+ if ( vwin == (*iter)->getVWin() )
+ overlaid = true;
+ ++iter;
+ }
+ }
+
+ FWidget::adjustSize();
+
+ // set the cursor to the focus widget
+ if ( FWidget::getFocusWidget()
+ && FWidget::getFocusWidget()->isVisible()
+ && FWidget::getFocusWidget()->hasVisibleCursor() )
+ {
+ FPoint cursor_pos = FWidget::getFocusWidget()->getCursorPos();
+ cursor_pos -= FPoint(dx,dy);
+ if ( ! FWidget::getFocusWidget()->setCursorPos(cursor_pos) )
+ hideCursor();
+ }
+ updateTerminal();
+}
+
+//----------------------------------------------------------------------
+void FDialog::setWidth (int w, bool adjust)
+{
+ int old_width = width;
+ FWidget::setWidth (w, adjust);
+ if ( vwin && width != old_width )
+ resizeArea (vwin);
+}
+
+//----------------------------------------------------------------------
+void FDialog::setHeight (int h, bool adjust)
+{
+ int old_height = height;
+ FWidget::setHeight (h, adjust);
+ if ( vwin && height != old_height )
+ resizeArea (vwin);
+}
+
+//----------------------------------------------------------------------
+void FDialog::setGeometry (int x, int y, int w, int h, bool adjust)
+{
+ int old_width = width;
+ int old_height = height;
+ FWidget::setGeometry (x, y, w, h, adjust);
+ if ( vwin && (width != old_width || height != old_height) )
+ resizeArea (vwin);
+}
+
+//----------------------------------------------------------------------
+FWidget* FDialog::getFocusWidget() const
+{
+ return static_cast(focus_widget);
+}
+
+//----------------------------------------------------------------------
+void FDialog::setFocusWidget (FWidget* obj)
+{
+ focus_widget = obj;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setFocus (bool on)
+{
+ FWidget::setFocus(on);
+
+ if ( on )
+ this->flags |= FOCUS;
+ else
+ this->flags &= ~FOCUS;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setModal (bool on)
+{
+ if ( isModal() == on )
+ return true;
+
+ if ( on )
+ {
+ this->flags |= MODAL;
+ modal_dialogs++;
+ }
+ else
+ {
+ this->flags &= ~MODAL;
+ modal_dialogs--;
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setTransparentShadow (bool on)
+{
+ if ( on )
+ {
+ this->flags |= SHADOW;
+ this->flags |= TRANS_SHADOW;
+ shadow.setPoint(2,1);
+ adjustWidgetSizeShadow = getGeometry() + getShadow();
+ adjustWidgetSizeGlobalShadow = getGeometryGlobal() + getShadow();
+ }
+ else
+ {
+ this->flags &= ~SHADOW;
+ this->flags &= ~TRANS_SHADOW;
+ shadow.setPoint(0,0);
+ adjustWidgetSizeShadow = getGeometry() + getShadow();
+ adjustWidgetSizeGlobalShadow = getGeometryGlobal() + getShadow();
+ }
+ resizeArea (vwin);
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setShadow (bool on)
+{
+ if ( on )
+ {
+ this->flags |= SHADOW;
+ this->flags &= ~TRANS_SHADOW;
+ shadow.setPoint(1,1);
+ adjustWidgetSizeShadow = getGeometry() + getShadow();
+ adjustWidgetSizeGlobalShadow = getGeometryGlobal() + getShadow();
+ }
+ else
+ {
+ this->flags &= ~SHADOW;
+ this->flags &= ~TRANS_SHADOW;
+ shadow.setPoint(0,0);
+ adjustWidgetSizeShadow = getGeometry() + getShadow();
+ adjustWidgetSizeGlobalShadow = getGeometryGlobal() + getShadow();
+ }
+ resizeArea (vwin);
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setScrollable (bool on)
+{
+ if ( on )
+ this->flags |= SCROLLABLE;
+ else
+ this->flags &= ~SCROLLABLE;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setResizeable (bool on)
+{
+ if ( on )
+ this->flags |= RESIZEABLE;
+ else
+ this->flags &= ~RESIZEABLE;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FDialog::setMaximized()
+{
+ if ( maximized )
+ return true;
+
+ maximized = true;
+ // setGeometry(1, 1, xmax, ymax);
+ return maximized;
+}
diff --git a/src/fdialog.h b/src/fdialog.h
new file mode 100644
index 00000000..f7bb73f1
--- /dev/null
+++ b/src/fdialog.h
@@ -0,0 +1,190 @@
+// fdialog.h
+// class FDialog
+
+#ifndef _FDIALOG_H
+#define _FDIALOG_H
+
+#include "fwindow.h"
+
+
+//----------------------------------------------------------------------
+// class FDialog
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FDialog : public FWindow
+{
+ public:
+ enum DialogCode
+ {
+ Reject = 0,
+ Accept = 1
+ };
+
+ private:
+ FString text;
+ int result_code;
+ bool maximized;
+ FPoint TitleBarClickPos;
+ FRect oldGeometry; // required by move()
+ FWidget* focus_widget;
+
+ private:
+ FDialog (const FDialog&);
+ FDialog& operator = (const FDialog&);
+ void init();
+ void drawBorder();
+ void drawTitleBar();
+
+ protected:
+ virtual void done (int);
+ virtual void draw();
+ virtual void onShow (FShowEvent*);
+ virtual void onHide (FHideEvent*);
+ virtual void onClose (FCloseEvent*);
+
+ public:
+ FDialog (FWidget* parent=0); // constructor
+ FDialog (const FString&, FWidget* parent=0); // constructor
+ virtual ~FDialog(); // destructor
+ virtual const char* getClassName() const;
+
+ void onKeyPress (FKeyEvent*);
+ void onMouseDown (FMouseEvent*);
+ void onMouseUp (FMouseEvent*);
+ void onMouseMove (FMouseEvent*);
+ void onMouseDoubleClick (FMouseEvent*);
+ void onWindowActive (FEvent*);
+ void onWindowInactive (FEvent*);
+ void onWindowRaised (FEvent*);
+ void onWindowLowered (FEvent*);
+
+ void drawDialogShadow();
+ void show();
+ void hide();
+ int exec();
+ void move (const FPoint&);
+ void move (int, int);
+ void setWidth (int, bool adjust=true);
+ void setHeight (int, bool adjust=true);
+ void setGeometry (int, int, int, int, bool adjust=true);
+ FWidget* getFocusWidget() const;
+ void setFocusWidget (FWidget*);
+ bool setFocus(bool);
+ bool setFocus();
+ bool unsetFocus();
+ bool setModal(bool);
+ bool setModal();
+ bool unsetModal();
+ bool isModal();
+ bool setScrollable(bool);
+ bool setScrollable();
+ bool unsetScrollable();
+ bool isScrollable();
+ bool setResizeable(bool);
+ bool setResizeable();
+ bool unsetResizeable();
+ bool isResizeable();
+ bool setMaximized();
+ bool isMaximized() const;
+ bool setTransparentShadow(bool);
+ bool setTransparentShadow();
+ bool unsetTransparentShadow();
+ bool hasTransparentShadow();
+ bool setShadow(bool);
+ bool setShadow();
+ bool unsetShadow();
+ bool hasShadow();
+ void setText (const FString);
+ FString getText() const;
+};
+#pragma pack(pop)
+
+// FDialog inline functions
+//----------------------------------------------------------------------
+inline const char* FDialog::getClassName() const
+{ return "FDialog"; }
+
+//----------------------------------------------------------------------
+inline bool FDialog::setFocus()
+{ return setFocus(true); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::unsetFocus()
+{ return setFocus(false); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::setModal()
+{ return setModal(true); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::unsetModal()
+{ return setModal(false); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::isModal()
+{ return ((flags & MODAL) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::setScrollable()
+{ return setScrollable(true); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::unsetScrollable()
+{ return setScrollable(false); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::isScrollable()
+{ return ((flags & SCROLLABLE) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::setResizeable()
+{ return setResizeable(true); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::unsetResizeable()
+{ return setResizeable(false); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::isResizeable()
+{ return ((flags & RESIZEABLE) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::isMaximized() const
+{ return maximized; }
+
+//----------------------------------------------------------------------
+inline bool FDialog::setTransparentShadow()
+{ return setTransparentShadow(true); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::unsetTransparentShadow()
+{ return setTransparentShadow(false); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::hasTransparentShadow()
+{ return ((flags & TRANS_SHADOW) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::setShadow()
+{ return setShadow(true); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::unsetShadow()
+{ return setShadow(false); }
+
+//----------------------------------------------------------------------
+inline bool FDialog::hasShadow()
+{ return ((flags & SHADOW) != 0); }
+
+//----------------------------------------------------------------------
+inline void FDialog::setText (FString txt)
+{ this->text = txt; }
+
+//----------------------------------------------------------------------
+inline FString FDialog::getText() const
+{ return this->text; }
+
+#endif // _FDIALOG_H
diff --git a/src/fenum.h b/src/fenum.h
new file mode 100644
index 00000000..c48f4e43
--- /dev/null
+++ b/src/fenum.h
@@ -0,0 +1,840 @@
+// fenum.h
+// class fc
+
+#ifndef _FENUM_H
+#define _FENUM_H
+
+//----------------------------------------------------------------------
+// class fc
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class fc
+{
+ public:
+
+ // internal character encoding
+ enum encoding
+ {
+ UTF8,
+ VT100,
+ PC,
+ ASCII,
+ NUM_OF_ENCODINGS // number of items
+ };
+
+ // VT100 line graphic keys
+ enum vt100_keys
+ {
+ vt100_key_rarrow = '+', // ► - arrow pointing right
+ vt100_key_larrow = ',', // ◄ - arrow pointing left
+ vt100_key_uarrow = '-', // ▲ - arrow pointing up
+ vt100_key_darrow = '.', // ▼ - arrow pointing down
+ vt100_key_block = '0', // █ - solid square block
+ vt100_key_nsup = 'I', // ⁿ - superscript letter n
+ vt100_key_blackrect = '_', // ▮ - black vertical rectangle
+ vt100_key_diamond = '`', // ◆ - diamond
+ vt100_key_ckboard = 'a', // ▒ - checker board (stipple)
+ vt100_key_htab = 'b', // ␉ - horizontal tab symbol
+ vt100_key_ff = 'c', // ␌ - form feed symbol
+ vt100_key_cr = 'd', // ␍ - carriage return symbol
+ vt100_key_lf = 'e', // ␊ - line feed symbol
+ vt100_key_degree = 'f', // ° - degree symbol
+ vt100_key_plminus = 'g', // ± - plus/minus
+ vt100_key_board = 'h', //  - board of squares
+ vt100_key_lantern = 'i', // ␋ - lantern symbol
+ vt100_key_lrcorner = 'j', // ┘ - lower right corner
+ vt100_key_urcorner = 'k', // ┐ - upper right corner
+ vt100_key_ulcorner = 'l', // ┌ - upper left corner
+ vt100_key_llcorner = 'm', // └ - lower left corner
+ vt100_key_plus = 'n', // ┼ - large plus or crossover
+ vt100_key_s1 = 'o', // ⎺ - scan line 1
+ vt100_key_s3 = 'p', // ⎻ - scan line 3
+ vt100_key_hline = 'q', // ─ - horizontal line
+ vt100_key_s7 = 'r', // ⎼ - scan line 7
+ vt100_key_s9 = 's', // ⎽ - scan line 9
+ vt100_key_ltee = 't', // ├ - tee pointing right
+ vt100_key_rtee = 'u', // ┤ - tee pointing left
+ vt100_key_btee = 'v', // ┴ - tee pointing up
+ vt100_key_ttee = 'w', // ┬ - tee pointing down
+ vt100_key_vline = 'x', // │ - vertical line
+ vt100_key_lequal = 'y', // ≤ - less-than-or-equal-to
+ vt100_key_gequal = 'z', // ≥ - greater-than-or-equal-to
+ vt100_key_pi = '{', // π - greek pi
+ vt100_key_nequal = '|', // ≠ - not-equal
+ vt100_key_sterling = '}', // £ - UK pound sign
+ vt100_key_bullet = '~' // · - bullet
+ };
+
+ // unicode characters
+ enum SpecialCharacter
+ {
+ Euro = 0x20ac, // €
+ Pound = 0x00a3, // £
+ Pi = 0x03c0, // π
+ SuperscriptLatinSmallLetterN = 0x207F, // ⁿ
+ GreaterThanOrEqualTo = 0x2265, // ≥
+ LessThanOrEqualTo = 0x2264, // ≤
+ NotEqualTo = 0x2260, // ≠
+ PlusMinus = 0x00b1, // ±
+ Degree = 0x00b0, // °
+ BlackVerticalRectangle = 0x25ae, // ▮
+ SmallBullet = 0x00b7, // ·
+ BlackDiamond = 0x25c6, // ◆
+ SymbolForNewline = 0x2424, // 
+ SymbolForVerticalTab = 0x240b, // ␋
+ SymbolForHorizontalTab = 0x2409, // ␉
+ SymbolForFormFeed = 0x240c, // ␌
+ SymbolForCarriageReturn = 0x240d, // ␍
+ SymbolForLineFeed = 0x240a, // ␊
+ MediumShade = 0x2592, // ▒
+ BoxDrawingsHorizontal = 0x2500, // ─
+ BoxDrawingsVertical = 0x2502, // │
+ BoxDrawingsDownAndRight = 0x250c, // ┌
+ BoxDrawingsDownAndLeft = 0x2510, // ┐
+ BoxDrawingsUpAndRight = 0x2514, // └
+ BoxDrawingsUpAndLeft = 0x2518, // ┘
+ BoxDrawingsCross = 0x253c, // ┼
+ BoxDrawingsDownAndHorizontal = 0x252c, // ┬
+ BoxDrawingsVerticalAndLeft = 0x2524, // ┤
+ BoxDrawingsVerticalAndRight = 0x251c, // ├
+ BoxDrawingsUpAndHorizontal = 0x2534, // ┴
+ HorizontalScanLine1 = 0x23ba, // ⎺
+ HorizontalScanLine3 = 0x23bb, // ⎻
+ HorizontalScanLine7 = 0x23bc, // ⎼
+ HorizontalScanLine9 = 0x23bd, // ⎽
+ BlackUpPointingTriangle = 0x25b2, // ▲
+ BlackDownPointingTriangle = 0x25bc, // ▼
+ BlackRightPointingPointer = 0x25ba, // ►
+ BlackLeftPointingPointer = 0x25c4, // ◄
+ Bullet = 0x2022, // •
+ FullBlock = 0x2588, // █
+ UpperHalfBlock = 0x2580, // ▀
+ LowerHalfBlock = 0x2584, // ▄
+ LeftHalfBlock = 0x258c, // ▌
+ RightHalfBlock = 0x2590, // ▐
+ NF_rev_left_arrow2 = 0x1ab4, // ⊐
+ NF_rev_right_arrow2 = 0x1ab5, // ►
+ NF_radio_button3 = 0x1ab7, // )
+ NF_rev_border_corner_upper_right = 0x1ab8, // ⎤
+ NF_rev_border_line_right = 0x1ab9, // ⎹
+ NF_rev_border_line_vertical_left = 0x1aba, // ┤
+ NF_rev_border_corner_lower_right = 0x1abb, // ⎦
+ NF_border_line_left = 0x1abc, // ⎸
+ NF_rev_up_arrow2 = 0x1abd, //⎹◣
+ NF_rev_down_arrow2 = 0x1abe, //⎹◤
+ NF_border_corner_middle_lower_left = 0x1ac0, // └
+ NF_rev_up_arrow1 = 0x1ac1, // ◢⎸
+ NF_rev_down_arrow1 = 0x1ac2, // ◥⎸
+ NF_border_line_vertical_right = 0x1ac3, // ├
+ NF_border_line_up_and_down = 0x1ac5, // ニ
+ NF_shadow_box_middle = 0x1ac6, // ニ
+ NF_shadow_box_hdd = 0x1ac7, // ニ
+ NF_rev_left_arrow1 = 0x1ac8, // ◄
+ NF_rev_right_arrow1 = 0x1ac9, // ⊏
+ NF_rev_menu_button1 = 0x1aca, // [
+ NF_rev_menu_button2 = 0x1acb, // -
+ NF_border_corner_middle_upper_left = 0x1acc, // ┌
+ NF_shadow_box_cd = 0x1acd, // ニ
+ NF_shadow_box_left = 0x1ace, // [
+ NF_border_corner_middle_lower_right = 0x1acf, // ┘
+ NF_border_corner_middle_upper_right = 0x1ad0, // ┐
+ NF_shadow_box_net = 0x1ad1, // ニ
+ NF_rev_up_pointing_triangle1 = 0x1ad2, // ◢
+ NF_border_corner_lower_left = 0x1ad3, // ⎣
+ NF_border_line_bottom = 0x1ad4, // _
+ NF_radio_button2 = 0x1ad5, // ⁐
+ NF_radio_button2_checked = 0x1ad6, // ●
+ NF_rev_down_pointing_triangle1 = 0x1ad7, // ◥
+ NF_border_line_upper = 0x1ad8, // ¯
+ NF_radio_button1 = 0x1ad9, // (
+ NF_border_corner_upper_left = 0x1ada, // ⎡
+ NF_shadow_box_checked = 0x1adc, // ✓
+ NF_rev_up_pointing_triangle2 = 0x1ae8, // ◣
+ NF_rev_down_pointing_triangle2 = 0x1ae9, // ◤
+ NF_rev_menu_button3 = 0x1af4, // ]
+ NF_shadow_box_right = 0x1af5, // ]
+ NF_check_mark = 0x1afb // ✓
+ };
+
+ // keyboard - single keys
+ enum keys
+ {
+ Fkey_erase = 0x0000008,
+ Fkey_tab = 0x0000009,
+ Fkey_return = 0x000000d,
+ Fkey_escape = 0x000001b,
+ Fkey_space = 0x0000020,
+ Fkey_backspace = 0x1000100,
+ Fkey_catab = 0x1000101,
+ Fkey_clear = 0x1000102,
+ Fkey_ctab = 0x1000103,
+ Fkey_dc = 0x1000104,
+ Fkey_dl = 0x1000105,
+ Fkey_down = 0x1000106,
+ Fkey_eic = 0x1000107,
+ Fkey_eol = 0x1000108,
+ Fkey_eos = 0x1000109,
+ Fkey_f0 = 0x100010a,
+ Fkey_f1 = 0x100010b,
+ Fkey_f2 = 0x100010c,
+ Fkey_f3 = 0x100010d,
+ Fkey_f4 = 0x100010e,
+ Fkey_f5 = 0x100010f,
+ Fkey_f6 = 0x1000110,
+ Fkey_f7 = 0x1000111,
+ Fkey_f8 = 0x1000112,
+ Fkey_f9 = 0x1000113,
+ Fkey_f10 = 0x1000114,
+ Fkey_home = 0x1000115,
+ Fkey_ic = 0x1000116, // insert key
+ Fkey_il = 0x1000117,
+ Fkey_left = 0x1000118,
+ Fkey_ll = 0x1000119,
+ Fkey_npage = 0x100011a,
+ Fkey_ppage = 0x100011b,
+ Fkey_right = 0x100011c,
+ Fkey_sf = 0x100011d,
+ Fkey_sr = 0x100011e,
+ Fkey_stab = 0x100011f,
+ Fkey_up = 0x1000120,
+ Fkey_a1 = 0x1000121,
+ Fkey_a3 = 0x1000122,
+ Fkey_b2 = 0x1000123,
+ Fkey_c1 = 0x1000124,
+ Fkey_c3 = 0x1000125,
+ Fkey_btab = 0x1000126,
+ Fkey_beg = 0x1000127,
+ Fkey_cancel = 0x1000128,
+ Fkey_close = 0x1000129,
+ Fkey_command = 0x100012a,
+ Fkey_copy = 0x100012b,
+ Fkey_create = 0x100012c,
+ Fkey_end = 0x100012d,
+ Fkey_enter = 0x100012e,
+ Fkey_exit = 0x100012f,
+ Fkey_find = 0x1000130,
+ Fkey_help = 0x1000131,
+ Fkey_mark = 0x1000132,
+ Fkey_message = 0x1000133,
+ Fkey_move = 0x1000134,
+ Fkey_next = 0x1000135,
+ Fkey_open = 0x1000136,
+ Fkey_options = 0x1000137,
+ Fkey_previous = 0x1000138,
+ Fkey_print = 0x1000139,
+ Fkey_redo = 0x100013a,
+ Fkey_reference = 0x100013b,
+ Fkey_refresh = 0x100013c,
+ Fkey_replace = 0x100013d,
+ Fkey_restart = 0x100013e,
+ Fkey_resume = 0x100013f,
+ Fkey_save = 0x1000140,
+ Fkey_suspend = 0x1000141,
+ Fkey_undo = 0x1000142,
+ Fkey_sbeg = 0x1000143,
+ Fkey_scancel = 0x1000144,
+ Fkey_scommand = 0x1000145,
+ Fkey_scopy = 0x1000146,
+ Fkey_screate = 0x1000147,
+ Fkey_sdc = 0x1000148,
+ Fkey_sdl = 0x1000149,
+ Fkey_select = 0x100014a,
+ Fkey_send = 0x100014b,
+ Fkey_seol = 0x100014c,
+ Fkey_sexit = 0x100014d,
+ Fkey_sfind = 0x100014e,
+ Fkey_shelp = 0x100014f,
+ Fkey_shome = 0x1000150,
+ Fkey_sic = 0x1000151,
+ Fkey_sleft = 0x1000152,
+ Fkey_smessage = 0x1000153,
+ Fkey_smove = 0x1000154,
+ Fkey_snext = 0x1000155,
+ Fkey_soptions = 0x1000156,
+ Fkey_sprevious = 0x1000157,
+ Fkey_sprint = 0x1000158,
+ Fkey_sredo = 0x1000159,
+ Fkey_sreplace = 0x100015a,
+ Fkey_sright = 0x100015b,
+ Fkey_srsume = 0x100015c,
+ Fkey_ssave = 0x100015d,
+ Fkey_ssuspend = 0x100015e,
+ Fkey_sundo = 0x100015f,
+ Fkey_f11 = 0x1000160,
+ Fkey_f12 = 0x1000161,
+ Fkey_f13 = 0x1000162,
+ Fkey_f14 = 0x1000163,
+ Fkey_f15 = 0x1000164,
+ Fkey_f16 = 0x1000165,
+ Fkey_f17 = 0x1000166,
+ Fkey_f18 = 0x1000167,
+ Fkey_f19 = 0x1000168,
+ Fkey_f20 = 0x1000169,
+ Fkey_f21 = 0x100016a,
+ Fkey_f22 = 0x100016b,
+ Fkey_f23 = 0x100016c,
+ Fkey_f24 = 0x100016d,
+ Fkey_f25 = 0x100016e,
+ Fkey_f26 = 0x100016f,
+ Fkey_f27 = 0x1000170,
+ Fkey_f28 = 0x1000171,
+ Fkey_f29 = 0x1000172,
+ Fkey_f30 = 0x1000173,
+ Fkey_f31 = 0x1000174,
+ Fkey_f32 = 0x1000175,
+ Fkey_f33 = 0x1000176,
+ Fkey_f34 = 0x1000177,
+ Fkey_f35 = 0x1000178,
+ Fkey_f36 = 0x1000179,
+ Fkey_f37 = 0x100017a,
+ Fkey_f38 = 0x100017b,
+ Fkey_f39 = 0x100017c,
+ Fkey_f40 = 0x100017d,
+ Fkey_f41 = 0x100017e,
+ Fkey_f42 = 0x100017f,
+ Fkey_f43 = 0x1000180,
+ Fkey_f44 = 0x1000181,
+ Fkey_f45 = 0x1000182,
+ Fkey_f46 = 0x1000183,
+ Fkey_f47 = 0x1000184,
+ Fkey_f48 = 0x1000185,
+ Fkey_f49 = 0x1000186,
+ Fkey_f50 = 0x1000187,
+ Fkey_f51 = 0x1000188,
+ Fkey_f52 = 0x1000189,
+ Fkey_f53 = 0x100018a,
+ Fkey_f54 = 0x100018b,
+ Fkey_f55 = 0x100018c,
+ Fkey_f56 = 0x100018d,
+ Fkey_f57 = 0x100018e,
+ Fkey_f58 = 0x100018f,
+ Fkey_f59 = 0x1000190,
+ Fkey_f60 = 0x1000191,
+ Fkey_f61 = 0x1000192,
+ Fkey_f62 = 0x1000193,
+ Fkey_f63 = 0x1000194
+ };
+
+ // keyboard - modifier key combinations
+ enum metakeys
+ {
+ Fmkey_ic = 0x1500100, // M-insert
+ Fmkey_dc = 0x1500101, // M-delete
+ Fmkey_home = 0x1500102, // M-home
+ Fmkey_end = 0x1500103, // M-end
+ Fmkey_ppage = 0x1500104, // M-prev-page
+ Fmkey_npage = 0x1500105, // M-next-page
+ Fmkey_f1 = 0x1500106, // M-f1
+ Fmkey_f2 = 0x1500107, // M-f2
+ Fmkey_f3 = 0x1500108, // M-f3
+ Fmkey_f4 = 0x1500109, // M-f4
+ Fmkey_f5 = 0x150010a, // M-f5
+ Fmkey_f6 = 0x150010b, // M-F6
+ Fmkey_f7 = 0x150010c, // M-f7
+ Fmkey_f8 = 0x150010d, // M-f8
+ Fmkey_f9 = 0x150010e, // M-f9
+ Fmkey_f10 = 0x150010f, // M-f10
+ Fmkey_f11 = 0x1500110, // M-f11
+ Fmkey_f12 = 0x1500111, // M-f12
+ Fmkey_up = 0x1500112, // M-up
+ Fmkey_down = 0x1500113, // M-down
+ Fmkey_right = 0x1500114, // M-right
+ Fmkey_left = 0x1500115, // M-left
+ Fmkey_sic = 0x1500116, // shifted M-Insert
+ Fmkey_sdc = 0x1500117, // shifted M-Delete
+ Fmkey_shome = 0x1500118, // shifted M-Home
+ Fmkey_send = 0x1500119, // shifted M-End
+ Fmkey_sppage = 0x150011a, // shifted M-Page_Up
+ Fmkey_snpage = 0x150011b, // shifted M-Page_Down
+ Fmkey_sf1 = 0x150011c, // shifted M-F1
+ Fmkey_sf2 = 0x150011d, // shifted M-F2
+ Fmkey_sf3 = 0x150011e, // shifted M-F3
+ Fmkey_sf4 = 0x150011f, // shifted M-F4
+ Fmkey_sf5 = 0x1500120, // shifted M-F5
+ Fmkey_sf6 = 0x1500121, // shifted M-F6
+ Fmkey_sf7 = 0x1500122, // shifted M-F7
+ Fmkey_sf8 = 0x1500123, // shifted M-F8
+ Fmkey_sf9 = 0x1500124, // shifted M-F9
+ Fmkey_sf10 = 0x1500125, // shifted M-F10
+ Fmkey_sf11 = 0x1500126, // shifted M-F11
+ Fmkey_sf12 = 0x1500127, // shifted M-F12
+ Fmkey_sup = 0x1500128, // shifted M-Up
+ Fmkey_sdown = 0x1500129, // shifted M-Down
+ Fmkey_sright = 0x150012a, // shifted M-Right
+ Fmkey_sleft = 0x150012b, // shifted M-Left
+ Fckey_ic = 0x150012c, // control-Insert
+ Fckey_dc = 0x150012d, // control-Delete
+ Fckey_home = 0x150012e, // control-Home
+ Fckey_end = 0x150012f, // control-End
+ Fckey_ppage = 0x1500130, // control-Page_Up
+ Fckey_npage = 0x1500131, // control-Page_Down
+ Fckey_up = 0x1500132, // control-Up
+ Fckey_down = 0x1500133, // control-Down
+ Fckey_right = 0x1500134, // control-Right
+ Fckey_left = 0x1500135, // control-Left
+ Fckey_sic = 0x1500136, // shifted control-M-Insert
+ Fckey_sdc = 0x1500137, // shifted control-M-Delete
+ Fckey_shome = 0x1500138, // shifted control-M-Home
+ Fckey_send = 0x1500139, // shifted control-M-End
+ Fckey_sppage = 0x150013a, // shifted control-M-Page_Up
+ Fckey_snpage = 0x150013b, // shifted control-M-Page_Down
+ Fckey_sup = 0x150013c, // shifted control-M-Up
+ Fckey_sdown = 0x150013d, // shifted control-M-Down
+ Fckey_sright = 0x150013e, // shifted control-M-Right
+ Fckey_sleft = 0x150013f, // shifted control-M-Left
+ Fcmkey_ic = 0x1500140, // control-M-Insert
+ Fcmkey_dc = 0x1500141, // control-M-Delete
+ Fcmkey_home = 0x1500142, // control-M-Home
+ Fcmkey_end = 0x1500143, // control-M-End
+ Fcmkey_ppage = 0x1500144, // control-M-Page_Up
+ Fcmkey_npage = 0x1500145, // control-M-Page_Down
+ Fcmkey_up = 0x1500146, // control-M-Up
+ Fcmkey_down = 0x1500147, // control-M-Down
+ Fcmkey_right = 0x1500148, // control-M-Right
+ Fcmkey_left = 0x1500149, // control-M-Left
+ Fcmkey_sic = 0x150014a, // shifted control-M-Insert
+ Fcmkey_sdc = 0x150014b, // shifted control-M-Delete
+ Fcmkey_shome = 0x150014c, // shifted control-M-Home
+ Fcmkey_send = 0x150014d, // shifted control-M-End
+ Fcmkey_sppage = 0x150014e, // shifted control-M-Page_Up
+ Fcmkey_snpage = 0x150014f, // shifted control-M-Page_Down
+ Fcmkey_sf1 = 0x1500150, // shifted control-M-F1
+ Fcmkey_sf2 = 0x1500151, // shifted control-M-F2
+ Fcmkey_sf3 = 0x1500152, // shifted control-M-F3
+ Fcmkey_sf4 = 0x1500153, // shifted control-M-F4
+ Fcmkey_sf5 = 0x1500154, // shifted control-M-F5
+ Fcmkey_sf6 = 0x1500155, // shifted control-M-F6
+ Fcmkey_sf7 = 0x1500156, // shifted control-M-F7
+ Fcmkey_sf8 = 0x1500157, // shifted control-M-F8
+ Fcmkey_sf9 = 0x1500158, // shifted control-M-F9
+ Fcmkey_sf10 = 0x1500159, // shifted control-M-F10
+ Fcmkey_sf11 = 0x150015a, // shifted control-M-F11
+ Fcmkey_sf12 = 0x150015b, // shifted control-M-F12
+ Fcmkey_sup = 0x150015c, // shifted control-M-Up
+ Fcmkey_sdown = 0x150015d, // shifted control-M-Down
+ Fcmkey_sright = 0x150015e, // shifted control-M-Right
+ Fcmkey_sleft = 0x150015f, // shifted control-M-Left
+ Fkey_escape_mintty = 0x200001b, // mintty Esc
+ Fkey_mouse = 0x2000020, // xterm mouse
+ Fkey_extended_mouse = 0x2000021, // SGR extended mouse
+ Fkey_urxvt_mouse = 0x2000022, // urxvt mouse extension
+ Fmkey_space = 0x2000100, // M-' '
+ Fmkey_bang = 0x2000101, // M-!
+ Fmkey_quotes = 0x2000102, // M-"
+ Fmkey_hash = 0x2000103, // M-#
+ Fmkey_dollar = 0x2000104, // M-$
+ Fmkey_percent = 0x2000105, // M-%
+ Fmkey_ampersand = 0x2000106, // M-&
+ Fmkey_apostrophe = 0x2000107, // M-'
+ Fmkey_left_parenthesis = 0x2000108, // M-(
+ Fmkey_right_parenthesis = 0x2000109, // M-)
+ Fmkey_asterisk = 0x200010a, // M-*
+ Fmkey_plus = 0x200010b, // M-+
+ Fmkey_comma = 0x200010c, // M-,
+ Fmkey_minus = 0x200010d, // M-'-'
+ Fmkey_full_stop = 0x200010e, // M-.
+ Fmkey_slash = 0x200010f, // M-/
+ Fmkey_0 = 0x2000110, // M-0
+ Fmkey_1 = 0x2000111, // M-1
+ Fmkey_2 = 0x2000112, // M-2
+ Fmkey_3 = 0x2000113, // M-3
+ Fmkey_4 = 0x2000114, // M-4
+ Fmkey_5 = 0x2000115, // M-5
+ Fmkey_6 = 0x2000116, // M-6
+ Fmkey_7 = 0x2000117, // M-7
+ Fmkey_8 = 0x2000118, // M-8
+ Fmkey_9 = 0x2000119, // M-9
+ Fmkey_colon = 0x200011a, // M-:
+ Fmkey_semicolon = 0x200011b, // M-;
+ Fmkey_less_than = 0x200011c, // M-<
+ Fmkey_equals = 0x200011d, // M-=
+ Fmkey_greater_than = 0x200011e, // M->
+ Fmkey_question_mark = 0x200011f, // M-?
+ Fmkey_at = 0x2000120, // M-@
+ Fmkey_A = 0x2000121, // M-A
+ Fmkey_B = 0x2000122, // M-B
+ Fmkey_C = 0x2000123, // M-C
+ Fmkey_D = 0x2000124, // M-D
+ Fmkey_E = 0x2000125, // M-E
+ Fmkey_F = 0x2000126, // M-F
+ Fmkey_G = 0x2000127, // M-G
+ Fmkey_H = 0x2000128, // M-H
+ Fmkey_I = 0x2000129, // M-I
+ Fmkey_J = 0x200012a, // M-J
+ Fmkey_K = 0x200012b, // M-K
+ Fmkey_L = 0x200012c, // M-L
+ Fmkey_M = 0x200012d, // M-M
+ Fmkey_N = 0x200012e, // M-N
+ Fmkey_O = 0x200012f, // M-O
+ Fmkey_P = 0x2000130, // M-P
+ Fmkey_Q = 0x2000131, // M-Q
+ Fmkey_R = 0x2000132, // M-R
+ Fmkey_S = 0x2000133, // M-S
+ Fmkey_T = 0x2000134, // M-T
+ Fmkey_U = 0x2000135, // M-U
+ Fmkey_V = 0x2000136, // M-V
+ Fmkey_W = 0x2000137, // M-W
+ Fmkey_X = 0x2000138, // M-X
+ Fmkey_Y = 0x2000139, // M-Y
+ Fmkey_Z = 0x200013a, // M-Z
+ Fmkey_left_square_bracket = 0x200013b, // M-[
+ Fmkey_backslash = 0x200013c, // M-'\'
+ Fmkey_right_square_bracket = 0x200013d, // M-]
+ Fmkey_caret = 0x200013e, // M-^
+ Fmkey_underscore = 0x200013f, // M-_
+ Fmkey_grave_accent = 0x2000140, // M-`
+ Fmkey_a = 0x2000141, // M-a
+ Fmkey_b = 0x2000142, // M-b
+ Fmkey_c = 0x2000143, // M-c
+ Fmkey_d = 0x2000144, // M-d
+ Fmkey_e = 0x2000145, // M-e
+ Fmkey_f = 0x2000146, // M-f
+ Fmkey_g = 0x2000147, // M-g
+ Fmkey_h = 0x2000148, // M-h
+ Fmkey_i = 0x2000149, // M-i
+ Fmkey_j = 0x200014a, // M-j
+ Fmkey_k = 0x200014b, // M-k
+ Fmkey_l = 0x200014c, // M-l
+ Fmkey_m = 0x200014d, // M-m
+ Fmkey_n = 0x200014e, // M-n
+ Fmkey_o = 0x200014f, // M-o
+ Fmkey_p = 0x2000150, // M-p
+ Fmkey_q = 0x2000151, // M-q
+ Fmkey_r = 0x2000152, // M-r
+ Fmkey_s = 0x2000153, // M-s
+ Fmkey_t = 0x2000154, // M-t
+ Fmkey_u = 0x2000155, // M-u
+ Fmkey_v = 0x2000156, // M-v
+ Fmkey_w = 0x2000157, // M-w
+ Fmkey_x = 0x2000158, // M-x
+ Fmkey_y = 0x2000159, // M-y
+ Fmkey_z = 0x200015a, // M-z
+ Fmkey_left_curly_bracket = 0x200015b, // M-{
+ Fmkey_vertical_bar = 0x200015c, // M-|
+ Fmkey_right_curly_bracket = 0x200015d, // M-}
+ Fmkey_tilde = 0x200015e // M-~
+ };
+
+ // console color names
+ enum colornames
+ {
+ Black = 0,
+ Blue = 1,
+ Green = 2,
+ Cyan = 3,
+ Red = 4,
+ Magenta = 5,
+ Brown = 6,
+ LightGray = 7,
+ DarkGray = 8,
+ LightBlue = 9,
+ LightGreen = 10,
+ LightCyan = 11,
+ LightRed = 12,
+ LightMagenta = 13,
+ Yellow = 14,
+ White = 15,
+ /* 256 color terminals */
+ Grey0 = 16, // #000000
+ NavyBlue = 17, // #00005f
+ DarkBlue = 18, // #000087
+ Blue3 = 19, // #0000af
+ Blue2 = 20, // #0000d7
+ Blue1 = 21, // #0000ff
+ DarkGreen = 22, // #005f00
+ DarkCyan2 = 23, // #005f5f
+ DeepSkyBlue6 = 24, // #005f87
+ DeepSkyBlue5 = 25, // #005faf
+ DodgerBlue3 = 26, // #005fd7
+ DodgerBlue2 = 27, // #005fff
+ Green4 = 28, // #008700
+ SpringGreen6 = 29, // #00875f
+ Turquoise4 = 30, // #008787
+ DeepSkyBlue4 = 31, // #0087af
+ DeepSkyBlue3 = 32, // #0087d7
+ DodgerBlue1 = 33, // #0087ff
+ Green2 = 34, // #00af00
+ SpringGreen5 = 35, // #00af5f
+ DarkCyan = 36, // #00af87
+ LightSeaGreen = 37, // #00afaf
+ DeepSkyBlue2 = 38, // #00afd7
+ DeepSkyBlue1 = 39, // #00afff
+ Green3 = 40, // #00d700
+ SpringGreen4 = 41, // #00d75f
+ SpringGreen3 = 42, // #00d787
+ Cyan3 = 43, // #00d7af
+ DarkTurquoise = 44, // #00d7d7
+ Turquoise2 = 45, // #00d7ff
+ Green1 = 46, // #00ff00
+ SpringGreen2 = 47, // #00ff5f
+ SpringGreen1 = 48, // #00ff87
+ MediumSpringGreen = 49, // #00ffaf
+ Cyan2 = 50, // #00ffd7
+ Cyan1 = 51, // #00ffff
+ DarkRed = 52, // #5f0000
+ DeepPink7 = 53, // #5f005f
+ Purple4 = 54, // #5f0087
+ Purple3 = 55, // #5f00af
+ Purple2 = 56, // #5f00d7
+ BlueViolet = 57, // #5f00ff
+ Orange4 = 58, // #5f5f00
+ Grey37 = 59, // #5f5f5f
+ MediumPurple6 = 60, // #5f5f87
+ SlateBlue3 = 61, // #5f5faf
+ SlateBlue2 = 62, // #5f5fd7
+ RoyalBlue1 = 63, // #5f5fff
+ Chartreuse5 = 64, // #5f8700
+ DarkSeaGreen8 = 65, // #5f875f
+ PaleTurquoise4 = 66, // #5f8787
+ SteelBlue = 67, // #5f87af
+ SteelBlue3 = 68, // #5f87d7
+ CornflowerBlue = 69, // #5f87ff
+ Chartreuse4 = 70, // #5faf00
+ DarkSeaGreen7 = 71, // #5faf5f
+ CadetBlue2 = 72, // #5faf87
+ CadetBlue1 = 73, // #5fafaf
+ SkyBlue3 = 74, // #5fafd7
+ SteelBlue2 = 75, // #5fafff
+ Chartreuse3 = 76, // #5fd700
+ PaleGreen3 = 77, // #5fd75f
+ SeaGreen4 = 78, // #5fd787
+ Aquamarine3 = 79, // #5fd7af
+ MediumTurquoise = 80, // #5fd7d7
+ SteelBlue1 = 81, // #5fd7ff
+ Chartreuse = 82, // #5fff00
+ SeaGreen3 = 83, // #5fff5f
+ SeaGreen2 = 84, // #5fff87
+ SeaGreen1 = 85, // #5fffaf
+ Aquamarine2 = 86, // #5fffd7
+ DarkSlateGray2 = 87, // #5fffff
+ DarkRed2 = 88, // #870000
+ DeepPink6 = 89, // #87005f
+ DarkMagenta2 = 90, // #870087
+ DarkMagenta = 91, // #8700af
+ DarkViolet1 = 92, // #8700d7
+ Purple1 = 93, // #8700ff
+ Orange3 = 94, // #875f00
+ LightPink4 = 95, // #875f5f
+ Plum4 = 96, // #875f87
+ MediumPurple5 = 97, // #875faf
+ MediumPurple4 = 98, // #875fd7
+ SlateBlue1 = 99, // #875fff
+ Yellow6 = 100, // #878700
+ Wheat4 = 101, // #87875f
+ Grey53 = 102, // #878787
+ LightSlateGrey = 103, // #8787af
+ MediumPurple = 104, // #8787d7
+ LightSlateBlue = 105, // #8787ff
+ Yellow5 = 106, // #87af00
+ DarkOliveGreen5 = 107, // #87af5f
+ DarkSeaGreen6 = 108, // #87af87
+ LightSkyBlue3 = 109, // #87afaf
+ LightSkyBlue2 = 110, // #87afd7
+ SkyBlue2 = 111, // #87afff
+ Chartreuse2 = 112, // #87d700
+ DarkOliveGreen4 = 113, // #87d75f
+ PaleGreen2 = 114, // #87d787
+ DarkSeaGreen5 = 115, // #87d7af
+ DarkSlateGray3 = 116, // #87d7d7
+ SkyBlue1 = 117, // #87d7ff
+ Chartreuse1 = 118, // #87ff00
+ LightGreen3 = 119, // #87ff5f
+ LightGreen2 = 120, // #87ff87
+ PaleGreen1 = 121, // #87ffaf
+ Aquamarine1 = 122, // #87ffd7
+ DarkSlateGray1 = 123, // #87ffff
+ Red3 = 124, // #af0000
+ DeepPink5 = 125, // #af005f
+ MediumVioletRed = 126, // #af0087
+ Magenta6 = 127, // #af00af
+ DarkViolet = 128, // #af00d7
+ Purple = 129, // #af00ff
+ DarkOrange3 = 130, // #af5f00
+ IndianRed3 = 131, // #af5f5f
+ HotPink4 = 132, // #af5f87
+ MediumOrchid3 = 133, // #af5faf
+ MediumOrchid = 134, // #af5fd7
+ MediumPurple3 = 135, // #af5fff
+ DarkGoldenrod = 136, // #af8700
+ LightSalmon3 = 137, // #af875f
+ RosyBrown = 138, // #af8787
+ Grey63 = 139, // #af87af
+ MediumPurple2 = 140, // #af87d7
+ MediumPurple1 = 141, // #af87ff
+ Gold3 = 142, // #afaf00
+ DarkKhaki = 143, // #afaf5f
+ NavajoWhite3 = 144, // #afaf87
+ Grey69 = 145, // #afafaf
+ LightSteelBlue3 = 146, // #afafd7
+ LightSteelBlue = 147, // #afafff
+ Yellow4 = 148, // #afd700
+ DarkOliveGreen3 = 149, // #afd75f
+ DarkSeaGreen4 = 150, // #afd787
+ DarkSeaGreen3 = 151, // #afd7af
+ LightCyan3 = 152, // #afd7d7
+ LightSkyBlue1 = 153, // #afd7ff
+ GreenYellow = 154, // #afff00
+ DarkOliveGreen2 = 155, // #afff5f
+ PaleGreen = 156, // #afff87
+ DarkSeaGreen2 = 157, // #afffaf
+ DarkSeaGreen1 = 158, // #afffd7
+ PaleTurquoise1 = 159, // #afffff
+ Red2 = 160, // #d70000
+ DeepPink4 = 161, // #d7005f
+ DeepPink3 = 162, // #d70087
+ Magenta5 = 163, // #d700af
+ Magenta4 = 164, // #d700d7
+ Magenta3 = 165, // #d700ff
+ DarkOrange2 = 166, // #d75f00
+ IndianRed = 167, // #d75f5f
+ HotPink3 = 168, // #d75f87
+ HotPink2 = 169, // #d75faf
+ Orchid = 170, // #d75fd7
+ MediumOrchid2 = 171, // #d75fff
+ Orange2 = 172, // #d78700
+ LightSalmon2 = 173, // #d7875f
+ LightPink3 = 174, // #d78787
+ Pink3 = 175, // #d787af
+ Plum3 = 176, // #d787d7
+ Violet = 177, // #d787ff
+ Gold2 = 178, // #d7af00
+ LightGoldenrod5 = 179, // #d7af5f
+ Tan = 180, // #d7af87
+ MistyRose3 = 181, // #d7afaf
+ Thistle3 = 182, // #d7afd7
+ Plum2 = 183, // #d7afff
+ Yellow3 = 184, // #d7d700
+ Khaki3 = 185, // #d7d75f
+ LightGoldenrod4 = 186, // #d7d787
+ LightYellow3 = 187, // #d7d7af
+ Grey84 = 188, // #d7d7d7
+ LightSteelBlue1 = 189, // #d7d7ff
+ Yellow2 = 190, // #d7ff00
+ DarkOliveGreen1 = 191, // #d7ff5f
+ DarkOliveGreen = 192, // #d7ff87
+ DarkSeaGreen = 193, // #d7ffaf
+ Honeydew2 = 194, // #d7ffd7
+ LightCyan1 = 195, // #d7ffff
+ Red1 = 196, // #ff0000
+ DeepPink2 = 197, // #ff005f
+ DeepPink1 = 198, // #ff0087
+ DeepPink = 199, // #ff00af
+ Magenta2 = 200, // #ff00d7
+ Magenta1 = 201, // #ff00ff
+ OrangeRed1 = 202, // #ff5f00
+ IndianRed2 = 203, // #ff5f5f
+ IndianRed1 = 204, // #ff5f87
+ HotPink1 = 205, // #ff5faf
+ HotPink = 206, // #ff5fd7
+ MediumOrchid1 = 207, // #ff5fff
+ DarkOrange = 208, // #ff8700
+ Salmon1 = 209, // #ff875f
+ LightCoral = 210, // #ff8787
+ PaleVioletRed1 = 211, // #ff87af
+ Orchid2 = 212, // #ff87d7
+ Orchid1 = 213, // #ff87ff
+ Orange1 = 214, // #ffaf00
+ SandyBrown = 215, // #ffaf5f
+ LightSalmon1 = 216, // #ffaf87
+ LightPink1 = 217, // #ffafaf
+ Pink1 = 218, // #ffafd7
+ Plum1 = 219, // #ffafff
+ Gold1 = 220, // #ffd700
+ LightGoldenrod3 = 221, // #ffd75f
+ LightGoldenrod2 = 222, // #ffd787
+ NavajoWhite1 = 223, // #ffd7af
+ MistyRose1 = 224, // #ffd7d7
+ Thistle1 = 225, // #ffd7ff
+ Yellow1 = 226, // #ffff00
+ LightGoldenrod = 227, // #ffff5f
+ Khaki1 = 228, // #ffff87
+ Wheat1 = 229, // #ffffaf
+ Cornsilk1 = 230, // #ffffd7
+ Grey100 = 231, // #ffffff
+ Grey3 = 232, // #080808
+ Grey7 = 233, // #121212
+ Grey11 = 234, // #1c1c1c
+ Grey15 = 235, // #262626
+ Grey19 = 236, // #303030
+ Grey23 = 237, // #3a3a3a
+ Grey27 = 238, // #444444
+ Grey30 = 239, // #4e4e4e
+ Grey35 = 240, // #585858
+ Grey39 = 241, // #626262
+ Grey42 = 242, // #6c6c6c
+ Grey46 = 243, // #767676
+ Grey50 = 244, // #808080
+ Grey54 = 245, // #8a8a8a
+ Grey58 = 246, // #949494
+ Grey62 = 247, // #9e9e9e
+ Grey66 = 248, // #a8a8a8
+ Grey70 = 249, // #b2b2b2
+ Grey74 = 250, // #bcbcbc
+ Grey78 = 251, // #c6c6c6
+ Grey82 = 252, // #d0d0d0
+ Grey85 = 253, // #dadada
+ Grey89 = 254, // #e4e4e4
+ Grey93 = 255 // #eeeeee
+ };
+
+ // xterm cursor style
+ enum xterm_cursor_style
+ {
+ blinking_block = 0,
+ blinking_block_default = 1,
+ steady_block = 2,
+ blinking_underline = 3,
+ steady_underline = 4,
+ blinking_bar_xterm = 5,
+ steady_bar_xterm = 6
+ };
+
+ // linux console and framebuffer cursor style
+ enum console_cursor_style
+ {
+ default_cursor = 0,
+ invisible_cursor = 1,
+ underscore_cursor = 2,
+ lower_third_cursor = 3,
+ lower_half_cursor = 4,
+ two_thirds_cursor = 5,
+ full_block_cursor = 6
+ };
+
+ // KDE konsole cursor style
+ enum kde_konsole_CursorShape
+ {
+ BlockCursor = 0,
+ IBeamCursor = 1,
+ UnderlineCursor = 2
+ };
+
+ enum text_alignment
+ {
+ alignLeft = 1,
+ alignCenter = 2,
+ alignRight = 3
+ };
+
+ enum orientation
+ {
+ vertical = 0,
+ horizontal = 1
+ };
+
+ enum brackets_type
+ {
+ NoBrackets = 0,
+ SquareBrackets = 1, // [ ]
+ Parenthesis = 2, // ( )
+ CurlyBrackets = 3, // { }
+ AngleBrackets = 4 // < >
+ };
+};
+
+#pragma pack(pop)
+
+#endif // _FENUM_H
diff --git a/src/fevent.cpp b/src/fevent.cpp
new file mode 100644
index 00000000..0b825e83
--- /dev/null
+++ b/src/fevent.cpp
@@ -0,0 +1,275 @@
+// fevent.cpp
+// class FEvent
+
+#include
+
+#include "fevent.h"
+
+
+//----------------------------------------------------------------------
+// class FKeyEvent
+//----------------------------------------------------------------------
+
+FKeyEvent::FKeyEvent(int type, int key) : FEvent(type) // constructor
+{
+ k = key;
+ accpt = false;
+}
+
+//----------------------------------------------------------------------
+int FKeyEvent::key() const
+{ return k; }
+
+//----------------------------------------------------------------------
+bool FKeyEvent::isAccepted() const
+{ return accpt; }
+
+//----------------------------------------------------------------------
+void FKeyEvent::accept()
+{ accpt = true; }
+
+//----------------------------------------------------------------------
+void FKeyEvent::ignore()
+{ accpt = false; }
+
+
+//----------------------------------------------------------------------
+// class FMouseEvent
+//----------------------------------------------------------------------
+
+FMouseEvent::FMouseEvent (int type, // constructor
+ const FPoint& pos,
+ int button) : FEvent(type),
+ p(pos),
+ b(button)
+{
+}
+
+//----------------------------------------------------------------------
+FMouseEvent::FMouseEvent (int type, // constructor
+ const FPoint& pos,
+ const FPoint& globalPos,
+ int button) : FEvent(type),
+ p(pos),
+ g(globalPos),
+ b(button)
+{
+}
+
+//----------------------------------------------------------------------
+const FPoint& FMouseEvent::getPos() const
+{ return p; }
+
+//----------------------------------------------------------------------
+const FPoint& FMouseEvent::getGlobalPos() const
+{ return g; }
+
+//----------------------------------------------------------------------
+int FMouseEvent::getX() const
+{ return p.getX(); }
+
+//----------------------------------------------------------------------
+int FMouseEvent::getY() const
+{ return p.getY(); }
+
+//----------------------------------------------------------------------
+int FMouseEvent::getGlobalX() const
+{ return g.getX(); }
+
+//----------------------------------------------------------------------
+int FMouseEvent::getGlobalY() const
+{ return g.getY(); }
+
+//----------------------------------------------------------------------
+int FMouseEvent::getButton() const
+{ return b; }
+
+
+//----------------------------------------------------------------------
+// class FWheelEvent
+//----------------------------------------------------------------------
+
+FWheelEvent::FWheelEvent (int type, // constructor
+ const FPoint& pos,
+ int wheel) : FEvent(type),
+ p(pos),
+ w(wheel)
+{
+}
+
+//----------------------------------------------------------------------
+FWheelEvent::FWheelEvent (int type, // constructor
+ const FPoint& pos,
+ const FPoint& globalPos,
+ int wheel) : FEvent(type),
+ p(pos),
+ g(globalPos),
+ w(wheel)
+{
+}
+
+//----------------------------------------------------------------------
+const FPoint& FWheelEvent::getPos() const
+{ return p; }
+
+//----------------------------------------------------------------------
+const FPoint& FWheelEvent::getGlobalPos() const
+{ return g; }
+
+//----------------------------------------------------------------------
+int FWheelEvent::getX() const
+{ return p.getX(); }
+
+//----------------------------------------------------------------------
+int FWheelEvent::getY() const
+{ return p.getY(); }
+
+//----------------------------------------------------------------------
+int FWheelEvent::getGlobalX() const
+{ return g.getX(); }
+
+//----------------------------------------------------------------------
+int FWheelEvent::getGlobalY() const
+{ return g.getY(); }
+
+//----------------------------------------------------------------------
+int FWheelEvent::getWheel() const
+{ return w; }
+
+
+//----------------------------------------------------------------------
+// class FFocusEvent
+//----------------------------------------------------------------------
+
+FFocusEvent::FFocusEvent (int type) : FEvent(type) // constructor
+{
+ accpt = true;
+ focus_type = FocusDefiniteWidget;
+}
+
+//----------------------------------------------------------------------
+bool FFocusEvent::gotFocus() const
+{
+ return (type() == FocusIn_Event);
+}
+
+//----------------------------------------------------------------------
+bool FFocusEvent::lostFocus() const
+{
+ return (type() == FocusOut_Event);
+}
+
+//----------------------------------------------------------------------
+FocusTypes FFocusEvent::getFocusType() const
+{ return focus_type; }
+
+//----------------------------------------------------------------------
+void FFocusEvent::setFocusType(FocusTypes ft)
+{ focus_type = ft; }
+
+//----------------------------------------------------------------------
+bool FFocusEvent::isAccepted() const
+{ return accpt; }
+
+//----------------------------------------------------------------------
+void FFocusEvent::accept()
+{ accpt = true; }
+
+//----------------------------------------------------------------------
+void FFocusEvent::ignore()
+{ accpt = false; }
+
+
+//----------------------------------------------------------------------
+// class FAccelEvent
+//----------------------------------------------------------------------
+
+FAccelEvent::FAccelEvent(int type, void* focused) : FEvent(type) // constructor
+{
+ focus_widget = focused;
+ accpt = false;
+}
+
+//----------------------------------------------------------------------
+void* FAccelEvent::focusedWidget() const
+{ return focus_widget; }
+
+//----------------------------------------------------------------------
+bool FAccelEvent::isAccepted() const
+{ return accpt; }
+
+//----------------------------------------------------------------------
+void FAccelEvent::accept()
+{ accpt = true; }
+
+//----------------------------------------------------------------------
+void FAccelEvent::ignore()
+{ accpt = false; }
+
+
+//----------------------------------------------------------------------
+// class FResizeEvent
+//----------------------------------------------------------------------
+
+FResizeEvent::FResizeEvent(int type) : FEvent(type) // constructor
+{ accpt = false; }
+
+//----------------------------------------------------------------------
+bool FResizeEvent::isAccepted() const
+{ return accpt; }
+
+//----------------------------------------------------------------------
+void FResizeEvent::accept()
+{ accpt = true; }
+
+//----------------------------------------------------------------------
+void FResizeEvent::ignore()
+{ accpt = false; }
+
+
+//----------------------------------------------------------------------
+// class FShowEvent
+//----------------------------------------------------------------------
+
+FShowEvent::FShowEvent(int type) : FEvent(type) // constructor
+{
+}
+
+//----------------------------------------------------------------------
+// class FHideEvent
+//----------------------------------------------------------------------
+
+FHideEvent::FHideEvent(int type) : FEvent(type) // constructor
+{
+}
+
+//----------------------------------------------------------------------
+// class FCloseEvent
+//----------------------------------------------------------------------
+
+FCloseEvent::FCloseEvent(int type) : FEvent(type) // constructor
+{ accpt = false; }
+
+//----------------------------------------------------------------------
+bool FCloseEvent::isAccepted() const
+{ return accpt; }
+
+//----------------------------------------------------------------------
+void FCloseEvent::accept()
+{ accpt = true; }
+
+//----------------------------------------------------------------------
+void FCloseEvent::ignore()
+{ accpt = false; }
+
+
+//----------------------------------------------------------------------
+// class FTimerEvent
+//----------------------------------------------------------------------
+
+FTimerEvent::FTimerEvent(int type, int timer_id) : FEvent(type) // constructor
+{ id = timer_id; }
+
+//----------------------------------------------------------------------
+int FTimerEvent::timerId() const
+{ return id; }
diff --git a/src/fevent.h b/src/fevent.h
new file mode 100644
index 00000000..e2742447
--- /dev/null
+++ b/src/fevent.h
@@ -0,0 +1,319 @@
+// fevent.h
+// class FEvent
+
+#ifndef _FEVENT_H
+#define _FEVENT_H
+
+#include "fpoint.h"
+
+
+#define None_Event 0 // invalid event
+#define KeyPress_Event 1 // key pressed
+#define KeyUp_Event 2 // key released
+#define KeyDown_Event 3 // key pressed
+#define MouseDown_Event 4 // mouse button pressed
+#define MouseUp_Event 5 // mouse button released
+#define MouseDoubleClick_Event 6 // mouse button double click
+#define MouseWheel_Event 7 // mouse wheel rolled
+#define MouseMove_Event 8 // mouse move
+#define FocusIn_Event 9 // focus in
+#define FocusOut_Event 10 // focus out
+#define WindowActive_Event 11 // activate window
+#define WindowInactive_Event 12 // deactivate window
+#define WindowRaised_Event 13 // raise window
+#define WindowLowered_Event 14 // lower window
+#define Accelerator_Event 15 // keyboard accelerator
+#define Resize_Event 16 // terminal resize
+#define Show_Event 17 // widget is shown
+#define Hide_Event 18 // widget is hidden
+#define Close_Event 19 // widget close
+#define Timer_Event 20 // timer event occur
+
+
+//----------------------------------------------------------------------
+// class FEvent
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FEvent // event base class
+{
+ public:
+ FEvent(int);
+ ~FEvent();
+ int type() const;
+
+ protected:
+ int t;
+};
+
+#pragma pack(pop)
+
+
+// FEvent inline functions
+//----------------------------------------------------------------------
+inline FEvent::FEvent(int type) // constructor
+{ t = type; }
+
+//----------------------------------------------------------------------
+inline FEvent::~FEvent() // destructor
+{}
+
+//----------------------------------------------------------------------
+inline int FEvent::type() const
+{ return t; }
+
+
+//----------------------------------------------------------------------
+// class FKeyEvent
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FKeyEvent : public FEvent // keyboard event
+{
+ public:
+ FKeyEvent (int, int);
+ int key() const;
+ bool isAccepted() const;
+ void accept();
+ void ignore();
+
+ protected:
+ int k;
+ bool accpt;
+};
+
+#define F_KEY_EVENT(x) ((FKeyEvent*)x)
+#pragma pack(pop)
+
+
+//----------------------------------------------------------------------
+// class FMouseEvent
+//----------------------------------------------------------------------
+
+enum ButtonState // mouse/keyboard state values
+{
+ NoButton = 0x00,
+ LeftButton = 0x01,
+ RightButton = 0x02,
+ MiddleButton = 0x04,
+ MouseButtonMask = 0x07,
+ ShiftButton = 0x08,
+ ControlButton = 0x10,
+ MetaButton = 0x20,
+ KeyButtonMask = 0x38
+};
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FMouseEvent : public FEvent // mouse event
+{
+ public:
+ FMouseEvent (int, const FPoint&, int);
+ FMouseEvent (int, const FPoint&, const FPoint&, int);
+
+ const FPoint& getPos() const;
+ const FPoint& getGlobalPos() const;
+ int getX() const;
+ int getY() const;
+ int getGlobalX() const;
+ int getGlobalY() const;
+ int getButton() const;
+
+ protected:
+ FPoint p;
+ FPoint g;
+ int b;
+};
+
+#define F_MOUSE_EVENT(x) ((FMouseEvent*)x)
+#pragma pack(pop)
+
+
+//----------------------------------------------------------------------
+// class FWheelEvent
+//----------------------------------------------------------------------
+
+enum WheelState // wheel state values
+{
+ NoWheel = 0x00,
+ WheelUp = 0x01,
+ WheelDown = 0x02,
+ WheelMask = 0x03
+};
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FWheelEvent : public FEvent // mouse event
+{
+ public:
+ FWheelEvent (int, const FPoint&, int);
+ FWheelEvent (int, const FPoint&, const FPoint&, int);
+
+ const FPoint& getPos() const;
+ const FPoint& getGlobalPos() const;
+ int getX() const;
+ int getY() const;
+ int getGlobalX() const;
+ int getGlobalY() const;
+ int getWheel() const;
+
+ protected:
+ FPoint p;
+ FPoint g;
+ int w;
+};
+
+#define F_WHEEL_EVENT(x) ((FWheelEvent*)x)
+#pragma pack(pop)
+
+
+//----------------------------------------------------------------------
+// class FFocusEvent
+//----------------------------------------------------------------------
+
+enum FocusTypes
+{
+ FocusNextWidget = 0x00,
+ FocusPreviousWidget = 0x01,
+ FocusDefiniteWidget = 0x03
+};
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FFocusEvent : public FEvent // focus event
+{
+ public:
+ FFocusEvent (int);
+ bool gotFocus() const;
+ bool lostFocus() const;
+ FocusTypes getFocusType() const;
+ void setFocusType(FocusTypes);
+ bool isAccepted() const;
+ void accept();
+ void ignore();
+ protected:
+ bool accpt;
+ FocusTypes focus_type;
+};
+
+#define F_FOCUS_EVENT(x) ((FFocusEvent*)x)
+#pragma pack(pop)
+
+
+//----------------------------------------------------------------------
+// class FAccelEvent
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FAccelEvent : public FEvent // focus event
+{
+ public:
+ FAccelEvent (int, void*);
+ void* focusedWidget() const;
+ bool isAccepted() const;
+ void accept();
+ void ignore();
+
+ protected:
+ void* focus_widget;
+ bool accpt;
+};
+
+#define F_ACCEL_EVENT(x) ((FAccelEvent*)x)
+#pragma pack(pop)
+
+
+//----------------------------------------------------------------------
+// class FResizeEvent
+//----------------------------------------------------------------------
+
+class FResizeEvent : public FEvent // resize event
+{
+ public:
+ FResizeEvent (int);
+ bool isAccepted() const;
+ void accept();
+ void ignore();
+
+ protected:
+ bool accpt;
+};
+
+#define F_RESIZE_EVENT(x) ((FResizeEvent*)x)
+
+
+//----------------------------------------------------------------------
+// class FShowEvent
+//----------------------------------------------------------------------
+
+class FShowEvent : public FEvent // show event
+{
+ public:
+ FShowEvent (int);
+};
+
+#define F_SHOW_EVENT(x) ((FShowEvent*)x)
+
+
+//----------------------------------------------------------------------
+// class FHideEvent
+//----------------------------------------------------------------------
+
+class FHideEvent : public FEvent // hide event
+{
+ public:
+ FHideEvent (int);
+};
+
+#define F_HIDE_EVENT(x) ((FHideEvent*)x)
+
+
+//----------------------------------------------------------------------
+// class FCloseEvent
+//----------------------------------------------------------------------
+
+class FCloseEvent : public FEvent // close event
+{
+ public:
+ FCloseEvent(int);
+ bool isAccepted() const;
+ void accept();
+ void ignore();
+
+ protected:
+ bool accpt;
+};
+
+#define F_CLOSE_EVENT(x) ((FCloseEvent*)x)
+
+
+//----------------------------------------------------------------------
+// class FTimerEvent
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FTimerEvent : public FEvent // timer event
+{
+ public:
+ FTimerEvent(int, int);
+ int timerId() const;
+
+ protected:
+ int id;
+};
+
+#define F_TIMER_EVENT(x) ((FTimerEvent*)x)
+#pragma pack(pop)
+
+#endif // _FEVENT_H
diff --git a/src/ffiledialog.cpp b/src/ffiledialog.cpp
new file mode 100644
index 00000000..d0b810f0
--- /dev/null
+++ b/src/ffiledialog.cpp
@@ -0,0 +1,680 @@
+// ffiledialog.cpp
+// class FFileDialog
+
+#include "ffiledialog.h"
+
+//----------------------------------------------------------------------
+static bool sortByName (const dir_entry &lhs, const dir_entry &rhs)
+{
+ // lhs < rhs
+ return bool(strcasecmp(lhs.name, rhs.name) < 0);
+}
+
+//----------------------------------------------------------------------
+static bool sortDirFirst (const dir_entry &lhs, const dir_entry &rhs)
+{
+ // sort directories first
+ if ( lhs.type == DT_DIR && rhs.type != DT_DIR )
+ return true;
+ else
+ return false;
+}
+
+
+//----------------------------------------------------------------------
+// class FFileDialog
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FFileDialog::FFileDialog(FWidget* parent) : FDialog(parent)
+{
+ dlg_type = FFileDialog::Open;
+ init();
+}
+
+//----------------------------------------------------------------------
+FFileDialog::FFileDialog ( const FString& dirname,
+ const FString& filter,
+ DialogType type,
+ FWidget* parent ) : FDialog(parent)
+{
+ if ( dirname )
+ setPath(dirname);
+ if ( filter )
+ setFilter(filter);
+ dlg_type = type;
+ init();
+}
+
+//----------------------------------------------------------------------
+FFileDialog::~FFileDialog() // destructor
+{
+ delete open;
+ delete cancel;
+ delete hidden;
+ delete filebrowser;
+ delete filename;
+ clear();
+}
+
+
+// private methods of FFileDialog
+//----------------------------------------------------------------------
+void FFileDialog::init()
+{
+ int x, y;
+ show_hidden = false;
+ height = 15;
+ width = 42;
+ if ( width < 15 )
+ width = 15;
+ if ( width < 20 )
+ width = 20;
+ x = 1 + int((parentWidget()->getWidth()-width)/2);
+ y = 1 + int((parentWidget()->getHeight()-height)/3);
+
+ if ( dlg_type == FFileDialog::Save )
+ FDialog::setText("Save file");
+ else
+ FDialog::setText("Open file");
+
+ filename = new FLineEdit(this);
+ filename->setLabelText("File&name:");
+ filename->setText(filter_pattern);
+ filename->setGeometry(11, 1, 28, 1);
+ filename->setShadow();
+ filename->setFocus();
+
+ filebrowser = new FListBox(this);
+ filebrowser->setGeometry(2, 3, 38, 6);
+ printPath(directory);
+
+ hidden = new FCheckBox("&hidden files", this);
+ hidden->setGeometry(2, 10, 16, 1);
+
+ cancel = new FButton("&Cancel", this);
+ cancel->setGeometry(19, 10, 9, 1);
+ cancel->setShadow();
+
+ if ( dlg_type == FFileDialog::Save )
+ open = new FButton("&Save",this);
+ else
+ open = new FButton("&Open",this);
+ open->setGeometry(30, 10, 9, 1);
+ open->setShadow();
+
+ setGeometry (x, y, width, height);
+
+ filename->addCallback
+ (
+ "activate",
+ this,
+ reinterpret_cast(&FFileDialog::cb_processActivate),
+ null
+ );
+ filebrowser->addCallback
+ (
+ "row-changed",
+ this,
+ reinterpret_cast(&FFileDialog::cb_processRowChanged),
+ null
+ );
+ filebrowser->addCallback
+ (
+ "clicked",
+ this,
+ reinterpret_cast(&FFileDialog::cb_processClicked),
+ null
+ );
+ hidden->addCallback
+ (
+ "toggled",
+ this,
+ reinterpret_cast(&FFileDialog::cb_processShowHidden),
+ null
+ );
+ cancel->addCallback
+ (
+ "clicked",
+ this,
+ reinterpret_cast(&FFileDialog::cb_processCancel),
+ null
+ );
+ open->addCallback
+ (
+ "clicked",
+ this,
+ reinterpret_cast(&FFileDialog::cb_processOpen),
+ null
+ );
+ setModal();
+ setTransparentShadow();
+
+ readDir();
+}
+
+//----------------------------------------------------------------------
+char* FFileDialog::getHomeDir()
+{
+ struct passwd* pwd;
+ pwd = getpwuid( geteuid() );
+
+ if ( pwd == 0 )
+ return const_cast("");
+ else
+ {
+ pwd = getpwnam(pwd->pw_name);
+
+ if ( pwd == 0 )
+ return const_cast("");
+ else
+ return pwd->pw_dir;
+ }
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::draw()
+{
+ FDialog::draw();
+
+ if ( Encoding == fc::VT100 )
+ unsetVT100altChar();
+
+}
+
+//----------------------------------------------------------------------
+inline bool FFileDialog::pattern_match ( const char* pattern,
+ const char* fname )
+{
+ char search[128];
+ if ( show_hidden && fname[0] == '.' && fname[1] != '\0' ) // hidden files
+ {
+ search[0] = '.';
+ search[1] = '\0';
+ strncat(search, pattern, sizeof(search) - strlen(search) - 1);
+ }
+ else
+ strncpy(search, pattern, sizeof(search));
+
+ if ( fnmatch (search, fname, FNM_PERIOD) == 0 )
+ return true;
+ else
+ return false;
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::clear()
+{
+ std::vector::const_iterator iter, end;
+
+ if ( dir_entries.empty() )
+ return;
+
+ // delete all directory entries;
+ iter = dir_entries.begin();
+ end = dir_entries.end();
+
+ while ( iter != end )
+ {
+ free ((*iter).name);
+ ++iter;
+ }
+
+ dir_entries.clear();
+}
+
+//----------------------------------------------------------------------
+int FFileDialog::numOfDirs()
+{
+ int n = 0;
+ if ( ! dir_entries.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ iter = dir_entries.begin();
+ end = dir_entries.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter).type == DT_DIR && strcmp((*iter).name, ".") != 0 )
+ n++;
+ ++iter;
+ }
+ }
+ return n;
+}
+
+//----------------------------------------------------------------------
+int FFileDialog::changeDir (const FString& dirname)
+{
+ FString lastdir = directory;
+ FString newdir = dirname;
+
+ if ( newdir.includes('~') )
+ newdir = newdir.replace('~', getHomeDir());
+
+ if ( newdir[0] == '/' )
+ setPath(newdir);
+ else
+ setPath(directory + newdir);
+
+ switch ( readDir() )
+ {
+ case -1:
+ setPath(lastdir);
+ return -1;
+ case -2:
+ setPath(lastdir);
+ readDir();
+ return -2;
+ case 0:
+ if ( newdir == FString("..") )
+ {
+ if ( lastdir == FString('/') )
+ filename->setText('/');
+ else if ( ! dir_entries.empty() )
+ {
+ int i = 1;
+ std::vector::const_iterator iter, end;
+ const char* baseName = basename(const_cast(lastdir.c_str()));
+
+ iter = dir_entries.begin();
+ end = dir_entries.end();
+
+ while ( iter != end )
+ {
+ if ( strcmp((*iter).name, baseName) == 0 )
+ {
+ filebrowser->setCurrentItem(i);
+ filename->setText(FString(baseName) + '/');
+ break;
+ }
+ i++;
+ ++iter;
+ }
+ }
+ }
+ else
+ {
+ FString firstname = dir_entries[0].name;
+ if ( dir_entries[0].type == DT_DIR )
+ filename->setText(firstname + '/');
+ else
+ filename->setText(firstname);
+ }
+ printPath(directory);
+ filename->redraw();
+ filebrowser->redraw();
+ }
+ return 0;
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::printPath (const FString& txt)
+{
+ FString text = txt;
+ uInt max_width = uInt(filebrowser->getWidth()) - 4;
+
+ if ( text.getLength() > max_width )
+ filebrowser->setText(".." + text.right(max_width-2));
+ else
+ filebrowser->setText(text);
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::cb_processActivate (FWidget*, void*)
+{
+ if ( filename->getText().includes('*')
+ || filename->getText().includes('?') )
+ {
+ setFilter(filename->getText());
+ readDir();
+ filebrowser->redraw();
+ }
+ else if ( filename->getText().getLength() == 0 )
+ {
+ setFilter("*");
+ readDir();
+ filebrowser->redraw();
+ }
+ else if ( filename->getText().trim() == FString("..")
+ || filename->getText().includes('/')
+ || filename->getText().includes('~') )
+ {
+ changeDir(filename->getText().trim());
+ }
+ else
+ {
+ bool found = false;
+ if ( ! dir_entries.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ FString input = filename->getText().trim();
+
+ iter = dir_entries.begin();
+ end = dir_entries.end();
+
+ while ( iter != end )
+ {
+ if ( strcmp((*iter).name, input) == 0 && (*iter).type == DT_DIR )
+ {
+ found = true;
+ changeDir(input);
+ break;
+ }
+ ++iter;
+ }
+ }
+ if ( ! found )
+ done (FDialog::Accept);
+ }
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::cb_processRowChanged (FWidget*, void*)
+{
+ int n = filebrowser->currentItem();
+ if ( n == 0 )
+ return;
+ FString name = dir_entries[uLong(n-1)].name;
+ if ( dir_entries[uLong(n-1)].type == DT_DIR )
+ filename->setText( name + '/' );
+ else
+ filename->setText( name );
+ filename->redraw();
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::cb_processClicked (FWidget*, void*)
+{
+ uLong n = uLong(filebrowser->currentItem() - 1);
+
+ if ( dir_entries[n].type == DT_DIR )
+ changeDir(dir_entries[n].name);
+ else
+ done (FDialog::Accept);
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::cb_processCancel (FWidget*, void*)
+{
+ done (FDialog::Reject);
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::cb_processOpen (FWidget*, void*)
+{
+ done (FDialog::Accept);
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::cb_processShowHidden (FWidget*, void*)
+{
+ setShowHiddenFiles(not show_hidden);
+}
+
+
+// protected methods of FFileDialog
+//----------------------------------------------------------------------
+void FFileDialog::adjustSize()
+{
+ int X, Y;
+ int max_height = getRootWidget()->getClientHeight();
+ int max_width = getRootWidget()->getClientWidth();
+ int h = max_height - 6;
+ if ( h < 15 ) // minimum
+ h = 15;
+ if ( h > 30 ) // maximum
+ h = 30;
+ setHeight (h, false);
+ X = 1 + int((max_width-width)/2);
+ Y = 1 + int((max_height-height)/3);
+ setX(X, false);
+ setY(Y, false);
+ filebrowser->setHeight(h-8, false);
+ hidden->setY(h-4, false);
+ cancel->setY(h-4, false);
+ open->setY(h-4, false);
+ FDialog::adjustSize();
+ printPath(directory);
+}
+
+
+// public methods of FFileDialog
+//----------------------------------------------------------------------
+void FFileDialog::onKeyPress (FKeyEvent* event)
+{
+ if ( ! isEnabled() )
+ return;
+
+ FDialog::onKeyPress (event);
+
+ if ( ! filebrowser->hasFocus() )
+ return;
+
+ int key = event->key();
+ switch ( key )
+ {
+ case fc::Fkey_erase:
+ case fc::Fkey_backspace:
+ changeDir("..");
+ event->accept();
+ break;
+ }
+
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::setPath (const FString& dir)
+{
+ const char* dirname = dir.c_str();
+ char resolved_path[MAXPATHLEN];
+ FString r_dir;
+ struct stat sb;
+
+ stat(dirname, &sb);
+ if ( S_ISLNK(sb.st_mode) )
+ {
+ lstat(dirname, &sb);
+ }
+ if ( ! S_ISDIR(sb.st_mode) )
+ {
+ directory = '/';
+ return;
+ }
+
+ if ( realpath(dir.c_str(), resolved_path) != 0 )
+ r_dir = resolved_path;
+ else
+ r_dir = dir;
+
+ if ( r_dir[r_dir.getLength()-1] != '/' )
+ directory = r_dir + "/";
+ else
+ directory = r_dir;
+}
+
+//----------------------------------------------------------------------
+void FFileDialog::setFilter (const FString& filter)
+{
+ filter_pattern = filter;
+}
+
+//----------------------------------------------------------------------
+const FString FFileDialog::getSelectedFile() const
+{
+ uLong n = uLong(filebrowser->currentItem() - 1);
+
+ if ( dir_entries[n].type == DT_DIR )
+ return FString("");
+ else
+ return FString(dir_entries[n].name);
+}
+
+//----------------------------------------------------------------------
+int FFileDialog::readDir()
+{
+ const char* dir = directory.c_str();
+ const char* filter = filter_pattern.c_str();
+ errno = 0;
+ directory_stream = opendir(dir);
+ if ( ! directory_stream )
+ {
+ FMessageBox::error (this, "Can't open directory\n" + directory);
+ return -1;
+ }
+
+ clear();
+
+ while ( true )
+ {
+ errno = 0;
+ struct dirent* next = readdir (directory_stream);
+ if ( next )
+ {
+ if ( next->d_name[0] == '.' && next->d_name[1] == '\0' )
+ continue;
+ if ( ! show_hidden
+ && next->d_name[0] == '.'
+ && next->d_name[1] != '\0'
+ && next->d_name[1] != '.' )
+ continue;
+ if ( dir[0] == '/' && dir[1] == '\0' && strcmp(next->d_name, "..") == 0 )
+ continue;
+ dir_entry entry;
+ entry.name = strdup(next->d_name);
+ entry.type = next->d_type;
+
+ if ( next->d_type == DT_LNK ) // symbolic link
+ {
+ char resolved_path[MAXPATHLEN];
+ char symLink[MAXPATHLEN];
+ strncpy(symLink, dir, sizeof(symLink));
+ strncat(symLink, next->d_name, sizeof(symLink) - strlen(symLink) - 1);
+
+ if ( realpath(symLink, resolved_path) != 0 ) // follow link
+ {
+ struct stat sb;
+ lstat(resolved_path, &sb);
+ if ( S_ISDIR(sb.st_mode) )
+ entry.type = DT_DIR;
+ }
+ }
+ if ( entry.type == DT_DIR )
+ dir_entries.push_back (entry);
+ else if ( pattern_match(filter, entry.name) )
+ dir_entries.push_back (entry);
+ else
+ free(entry.name);
+ }
+ else if (errno != 0)
+ {
+ FMessageBox::error (this, "Reading directory\n" + directory);
+ if ( errno != EOVERFLOW )
+ break;
+ }
+ else
+ break;
+ } // end while
+
+ if ( closedir (directory_stream) != 0 )
+ {
+ FMessageBox::error (this, "Closing directory\n" + directory);
+ return -2;
+ }
+
+ int start;
+ if ( strcmp((*dir_entries.begin()).name, "..") == 0 )
+ start=1;
+ else
+ start=0;
+ int dir_num = numOfDirs();
+
+ // directories first
+ std::sort(dir_entries.begin()+start, dir_entries.end(), sortDirFirst);
+
+ // sort directories by name
+ std::sort(dir_entries.begin()+start, dir_entries.begin()+dir_num, sortByName);
+
+ // sort files by name
+ std::sort(dir_entries.begin()+dir_num, dir_entries.end(), sortByName);
+
+ // fill list with directory entries
+ filebrowser->clear();
+ if ( ! dir_entries.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ iter = dir_entries.begin();
+ end = dir_entries.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter).type == DT_DIR )
+ filebrowser->insert(FString((*iter).name), fc::SquareBrackets);
+ else
+ filebrowser->insert(FString((*iter).name));
+ ++iter;
+ }
+ }
+ return 0;
+}
+
+//----------------------------------------------------------------------
+bool FFileDialog::setShowHiddenFiles (bool on)
+{
+ if ( on == show_hidden )
+ return show_hidden;
+
+ show_hidden = on;
+ readDir();
+ filebrowser->redraw();
+ return show_hidden;
+}
+
+//----------------------------------------------------------------------
+FString FFileDialog::fileOpenChooser ( FWidget* parent,
+ const FString& dirname,
+ const FString& filter )
+{
+ FString ret;
+ FString path = dirname;
+ FString file_filter = filter;
+ if ( path.isNull() )
+ path = getHomeDir();
+ if ( file_filter.isNull() )
+ file_filter = FString("*");
+ FFileDialog* fileopen = new FFileDialog ( path,
+ file_filter,
+ FFileDialog::Open,
+ parent );
+ if ( fileopen->exec() == FDialog::Accept )
+ ret = fileopen->getPath() + fileopen->getSelectedFile();
+ else
+ ret = FString();
+ delete fileopen;
+ return ret;
+}
+
+//----------------------------------------------------------------------
+FString FFileDialog::fileSaveChooser ( FWidget* parent,
+ const FString& dirname,
+ const FString& filter )
+{
+ FString ret;
+ FString path = dirname;
+ FString file_filter = filter;
+ if ( path.isNull() )
+ path = getHomeDir();
+ if ( file_filter.isNull() )
+ file_filter = FString("*");
+ FFileDialog* fileopen = new FFileDialog ( path,
+ file_filter,
+ FFileDialog::Save,
+ parent );
+ if ( fileopen->exec() == FDialog::Accept )
+ ret = fileopen->getPath() + fileopen->getSelectedFile();
+ else
+ ret = FString();
+ delete fileopen;
+ return ret;
+}
diff --git a/src/ffiledialog.h b/src/ffiledialog.h
new file mode 100644
index 00000000..ee4fbd37
--- /dev/null
+++ b/src/ffiledialog.h
@@ -0,0 +1,143 @@
+// ffiledialog.h
+// class FFileDialog.h
+
+#ifndef _FFILEDIALOG_H
+#define _FFILEDIALOG_H
+
+#include
+
+#include
+#include
+#include
+#include
+
+#include
+
+#include "fbutton.h"
+#include "fcheckbox.h"
+#include "fdialog.h"
+#include "flineedit.h"
+#include "flistbox.h"
+#include "fmessagebox.h"
+#include "fstatusbar.h"
+#include "fterm.h"
+
+
+#pragma pack(push)
+#pragma pack(1)
+
+struct dir_entry
+{
+ char* name;
+ uChar type;
+};
+#pragma pack(pop)
+
+
+//----------------------------------------------------------------------
+// class FFileDialog
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FFileDialog : public FDialog
+{
+ public:
+ enum DialogType
+ {
+ Open = 0,
+ Save = 1
+ };
+ private:
+ DIR* directory_stream;
+ std::vector dir_entries;
+
+ FString directory;
+ FString filter_pattern;
+ FListBox* filebrowser;
+ FLineEdit* filename;
+ FCheckBox* hidden;
+ FButton* cancel;
+ FButton* open;
+ DialogType dlg_type;
+ bool show_hidden;
+
+ private:
+ void init();
+ static char* getHomeDir();
+ virtual void draw();
+ inline bool pattern_match (const char*, const char*);
+ void clear();
+ int numOfDirs();
+ int changeDir (const FString&);
+ void printPath (const FString&);
+ void cb_processActivate (FWidget*, void*);
+ void cb_processRowChanged (FWidget*, void*);
+ void cb_processClicked (FWidget*, void*);
+ void cb_processCancel (FWidget*, void*);
+ void cb_processOpen (FWidget*, void*);
+ void cb_processShowHidden (FWidget*, void*);
+
+ protected:
+ void adjustSize();
+
+ public:
+ FFileDialog (FWidget* parent=0);
+ FFileDialog (const FString&,
+ const FString&,
+ DialogType type = FFileDialog::Open,
+ FWidget* parent=0);
+ ~FFileDialog();
+ const char* getClassName() const;
+
+ void onKeyPress (FKeyEvent*);
+
+ const FString getPath() const;
+ void setPath (const FString&);
+ const FString getFilter() const;
+ void setFilter (const FString&);
+ const FString getSelectedFile() const;
+ int readDir();
+ bool setShowHiddenFiles(bool);
+ bool setShowHiddenFiles();
+ bool unsetShowHiddenFiles();
+ bool getShowHiddenFiles();
+
+ static FString fileOpenChooser (FWidget*,
+ const FString& = FString(),
+ const FString& = FString());
+ static FString fileSaveChooser (FWidget*,
+ const FString& = FString(),
+ const FString& = FString());
+};
+#pragma pack(pop)
+
+
+// FMessageBox inline functions
+//----------------------------------------------------------------------
+inline const char* FFileDialog::getClassName() const
+{ return "FFileDialog"; }
+
+//----------------------------------------------------------------------
+inline const FString FFileDialog::getPath() const
+{ return directory; }
+
+//----------------------------------------------------------------------
+inline const FString FFileDialog::getFilter() const
+{ return filter_pattern; }
+
+//----------------------------------------------------------------------
+inline bool FFileDialog::setShowHiddenFiles()
+{ return setShowHiddenFiles(true); }
+
+//----------------------------------------------------------------------
+inline bool FFileDialog::unsetShowHiddenFiles()
+{ return setShowHiddenFiles(false); }
+
+//----------------------------------------------------------------------
+inline bool FFileDialog::getShowHiddenFiles()
+{ return show_hidden; }
+
+#endif // _FFILEDIALOG_H
+
diff --git a/src/final.h b/src/final.h
new file mode 100644
index 00000000..4ba48490
--- /dev/null
+++ b/src/final.h
@@ -0,0 +1,27 @@
+// final.h
+
+#ifndef _FINAL_H
+#define _FINAL_H
+
+#include "fapp.h"
+#include "fterm.h"
+#include "fwidget.h"
+#include "fpoint.h"
+#include "frect.h"
+#include "fstring.h"
+#include "fdialog.h"
+#include "flabel.h"
+#include "fbutton.h"
+#include "fradiobutton.h"
+#include "fcheckbox.h"
+#include "fbuttongroup.h"
+#include "flistbox.h"
+#include "ftextview.h"
+#include "flineedit.h"
+#include "fstatusbar.h"
+#include "fscrollbar.h"
+#include "fprogressbar.h"
+#include "fmessagebox.h"
+#include "ffiledialog.h"
+
+#endif // _FINAL_H
diff --git a/src/fkey_map.h b/src/fkey_map.h
new file mode 100644
index 00000000..e7531365
--- /dev/null
+++ b/src/fkey_map.h
@@ -0,0 +1,755 @@
+// fkey_map.h
+
+#ifndef _FKEYMAP_H
+#define _FKEYMAP_H
+
+
+#pragma pack(push)
+#pragma pack(1)
+
+typedef struct
+{
+ int num;
+ char* string;
+ char tname[4];
+}
+keymap;
+
+#pragma pack(pop)
+
+static keymap Fkey[] =
+{
+ { fc::Fkey_backspace, 0, "kb" }, // backspace key
+ { fc::Fkey_catab , 0, "ka" }, // clear-all-tabs key
+ { fc::Fkey_clear , 0, "kC" }, // clear-screen or erase key
+ { fc::Fkey_ctab , 0, "kt" }, // clear-tab key
+ { fc::Fkey_dc , 0, "kD" }, // delete-character key
+ { fc::Fkey_dl , 0, "kL" }, // delete-line key
+ { fc::Fkey_down , 0, "kd" }, // down-arrow key
+ { fc::Fkey_down , 0, "kdx"}, // down-arrow key
+ { fc::Fkey_eic , 0, "kM" }, // sent by rmir or smir in insert mode
+ { fc::Fkey_eol , 0, "kE" }, // clear-to-end-of-line key
+ { fc::Fkey_eos , 0, "kS" }, // clear-to-end-of-screen key
+ { fc::Fkey_f0 , 0, "k0" }, // F0 function key
+ { fc::Fkey_f1 , 0, "k1" }, // F1 function key
+ { fc::Fkey_f1 , 0, "k1x"}, // F1 function key
+ { fc::Fkey_f1 , 0, "k1X"}, // F1 function key
+ { fc::Fkey_f2 , 0, "k2" }, // F2 function key
+ { fc::Fkey_f2 , 0, "k2x"}, // F2 function key
+ { fc::Fkey_f2 , 0, "k2X"}, // F2 function key
+ { fc::Fkey_f3 , 0, "k3" }, // F3 function key
+ { fc::Fkey_f3 , 0, "k3x"}, // F3 function key
+ { fc::Fkey_f3 , 0, "k3X"}, // F3 function key
+ { fc::Fkey_f4 , 0, "k4" }, // F4 function key
+ { fc::Fkey_f4 , 0, "k4x"}, // F4 function key
+ { fc::Fkey_f4 , 0, "k4X"}, // F4 function key
+ { fc::Fkey_f5 , 0, "k5" }, // F5 function key
+ { fc::Fkey_f6 , 0, "k6" }, // F6 function key
+ { fc::Fkey_f7 , 0, "k7" }, // F7 function key
+ { fc::Fkey_f8 , 0, "k8" }, // F8 fucntion key
+ { fc::Fkey_f9 , 0, "k9" }, // F9 function key
+ { fc::Fkey_f10 , 0, "k;" }, // F10 function key
+ { fc::Fkey_home , 0, "kh" }, // home key
+ { fc::Fkey_home , 0, "khx"}, // home key
+ { fc::Fkey_ic , 0, "kI" }, // insert-character key
+ { fc::Fkey_il , 0, "kA" }, // insert-line key
+ { fc::Fkey_left , 0, "kl" }, // left-arrow key
+ { fc::Fkey_left , 0, "klx"}, // left-arrow key
+ { fc::Fkey_ll , 0, "kH" }, // last-line key
+ { fc::Fkey_npage , 0, "kN" }, // next-page key
+ { fc::Fkey_ppage , 0, "kP" }, // prev-page key
+ { fc::Fkey_right , 0, "kr" }, // right-arrow key
+ { fc::Fkey_right , 0, "krx"}, // right-arrow key
+ { fc::Fkey_sf , 0, "kF" }, // scroll-forward key
+ { fc::Fkey_sr , 0, "kR" }, // scroll-backward key
+ { fc::Fkey_stab , 0, "kT" }, // set-tab key
+ { fc::Fkey_up , 0, "ku" }, // up-arrow key
+ { fc::Fkey_up , 0, "kux"}, // up-arrow key
+ { fc::Fkey_a1 , 0, "K1" }, // upper left of keypad
+ { fc::Fkey_a3 , 0, "K3" }, // upper right of keypad
+ { fc::Fkey_b2 , 0, "K2" }, // center of keypad
+ { fc::Fkey_c1 , 0, "K4" }, // lower left of keypad
+ { fc::Fkey_c3 , 0, "K5" }, // lower right of keypad
+ { fc::Fkey_btab , 0, "kB" }, // back-tab key
+ { fc::Fkey_beg , 0, "@1" }, // begin key
+ { fc::Fkey_cancel , 0, "@2" }, // cancel key
+ { fc::Fkey_close , 0, "@3" }, // close key
+ { fc::Fkey_command , 0, "@4" }, // command key
+ { fc::Fkey_copy , 0, "@5" }, // copy key
+ { fc::Fkey_create , 0, "@6" }, // create key
+ { fc::Fkey_end , 0, "@7" }, // end key
+ { fc::Fkey_end , 0, "@7x"}, // end key
+ { fc::Fkey_enter , 0, "@8" }, // enter/send key
+ { fc::Fkey_exit , 0, "@9" }, // exit key
+ { fc::Fkey_find , 0, "@0" }, // find key
+ { fc::Fkey_help , 0, "%1" }, // help key
+ { fc::Fkey_mark , 0, "%2" }, // mark key
+ { fc::Fkey_message , 0, "%3" }, // message key
+ { fc::Fkey_move , 0, "%4" }, // move key
+ { fc::Fkey_next , 0, "%5" }, // next key
+ { fc::Fkey_open , 0, "%6" }, // open key
+ { fc::Fkey_options , 0, "%7" }, // options key
+ { fc::Fkey_previous , 0, "%8" }, // previous key
+ { fc::Fkey_print , 0, "%9" }, // print key
+ { fc::Fkey_redo , 0, "%0" }, // redo key
+ { fc::Fkey_reference, 0, "&1" }, // reference key
+ { fc::Fkey_refresh , 0, "&2" }, // refresh key
+ { fc::Fkey_replace , 0, "&3" }, // replace key
+ { fc::Fkey_restart , 0, "&4" }, // restart key
+ { fc::Fkey_resume , 0, "&5" }, // resume key
+ { fc::Fkey_save , 0, "&6" }, // save key
+ { fc::Fkey_suspend , 0, "&7" }, // suspend key
+ { fc::Fkey_undo , 0, "&8" }, // undo key
+ { fc::Fkey_sbeg , 0, "&9" }, // shifted key
+ { fc::Fkey_scancel , 0, "&0" }, // shifted key
+ { fc::Fkey_scommand , 0, "*1" }, // shifted key
+ { fc::Fkey_scopy , 0, "*2" }, // shifted key
+ { fc::Fkey_screate , 0, "*3" }, // shifted key
+ { fc::Fkey_sdc , 0, "*4" }, // shifted key
+ { fc::Fkey_sdl , 0, "*5" }, // shifted key
+ { fc::Fkey_select , 0, "*6" }, // select key
+ { fc::Fkey_send , 0, "*7" }, // shifted key
+ { fc::Fkey_seol , 0, "*8" }, // shifted key
+ { fc::Fkey_sexit , 0, "*9" }, // shifted key
+ { fc::Fkey_sfind , 0, "*0" }, // shifted key
+ { fc::Fkey_shelp , 0, "#1" }, // shifted key
+ { fc::Fkey_shome , 0, "#2" }, // shifted key
+ { fc::Fkey_sic , 0, "#3" }, // shifted key
+ { fc::Fkey_sleft , 0, "#4" }, // shifted key
+ { fc::Fkey_smessage , 0, "%a" }, // shifted key
+ { fc::Fkey_smove , 0, "%b" }, // shifted key
+ { fc::Fkey_snext , 0, "%c" }, // shifted key
+ { fc::Fkey_soptions , 0, "%d" }, // shifted key
+ { fc::Fkey_sprevious, 0, "%e" }, // shifted key
+ { fc::Fkey_sprint , 0, "%f" }, // shifted key
+ { fc::Fkey_sredo , 0, "%g" }, // shifted key
+ { fc::Fkey_sreplace , 0, "%h" }, // shifted key
+ { fc::Fkey_sright , 0, "%i" }, // shifted key
+ { fc::Fkey_srsume , 0, "%j" }, // shifted key
+ { fc::Fkey_ssave , 0, "!1" }, // shifted key
+ { fc::Fkey_ssuspend , 0, "!2" }, // shifted key
+ { fc::Fkey_sundo , 0, "!3" }, // shifted key
+ { fc::Fkey_f11 , 0, "F1" }, // F11 function key
+ { fc::Fkey_f12 , 0, "F2" }, // F12 function key
+ { fc::Fkey_f13 , 0, "F3" }, // F13 function key
+ { fc::Fkey_f14 , 0, "F4" }, // F14 function key
+ { fc::Fkey_f15 , 0, "F5" }, // F15 function key
+ { fc::Fkey_f16 , 0, "F6" }, // F16 function key
+ { fc::Fkey_f17 , 0, "F7" }, // F17 function key
+ { fc::Fkey_f18 , 0, "F8" }, // F18 function key
+ { fc::Fkey_f19 , 0, "F9" }, // F19 function key
+ { fc::Fkey_f20 , 0, "FA" }, // F20 function key
+ { fc::Fkey_f21 , 0, "FB" }, // F21 function key
+ { fc::Fkey_f22 , 0, "FC" }, // F22 function key
+ { fc::Fkey_f23 , 0, "FD" }, // F23 function key
+ { fc::Fkey_f24 , 0, "FE" }, // F24 function key
+ { fc::Fkey_f25 , 0, "FF" }, // F25 function key
+ { fc::Fkey_f26 , 0, "FG" }, // F26 function key
+ { fc::Fkey_f27 , 0, "FH" }, // F27 function key
+ { fc::Fkey_f28 , 0, "FI" }, // F28 function key
+ { fc::Fkey_f29 , 0, "FJ" }, // F29 function key
+ { fc::Fkey_f30 , 0, "FK" }, // F30 function key
+ { fc::Fkey_f31 , 0, "FL" }, // F31 function key
+ { fc::Fkey_f32 , 0, "FM" }, // F32 function key
+ { fc::Fkey_f33 , 0, "FN" }, // F33 function key
+ { fc::Fkey_f34 , 0, "FO" }, // F34 function key
+ { fc::Fkey_f35 , 0, "FP" }, // F35 function key
+ { fc::Fkey_f36 , 0, "FQ" }, // F36 function key
+ { fc::Fkey_f37 , 0, "FR" }, // F37 function key
+ { fc::Fkey_f38 , 0, "FS" }, // F38 function key
+ { fc::Fkey_f39 , 0, "FT" }, // F39 function key
+ { fc::Fkey_f40 , 0, "FU" }, // F40 function key
+ { fc::Fkey_f41 , 0, "FV" }, // F41 function key
+ { fc::Fkey_f42 , 0, "FW" }, // F42 function key
+ { fc::Fkey_f43 , 0, "FX" }, // F43 function key
+ { fc::Fkey_f44 , 0, "FY" }, // F44 function key
+ { fc::Fkey_f45 , 0, "FZ" }, // F45 function key
+ { fc::Fkey_f46 , 0, "Fa" }, // F46 function key
+ { fc::Fkey_f47 , 0, "Fb" }, // F47 function key
+ { fc::Fkey_f48 , 0, "Fc" }, // F48 function key
+ { fc::Fkey_f49 , 0, "Fd" }, // F49 function key
+ { fc::Fkey_f50 , 0, "Fe" }, // F50 function key
+ { fc::Fkey_f51 , 0, "Ff" }, // F51 function key
+ { fc::Fkey_f52 , 0, "Fg" }, // F52 function key
+ { fc::Fkey_f53 , 0, "Fh" }, // F53 function key
+ { fc::Fkey_f54 , 0, "Fi" }, // F54 function key
+ { fc::Fkey_f55 , 0, "Fj" }, // F55 function key
+ { fc::Fkey_f56 , 0, "Fk" }, // F56 function key
+ { fc::Fkey_f57 , 0, "Fl" }, // F57 function key
+ { fc::Fkey_f58 , 0, "Fm" }, // F58 function key
+ { fc::Fkey_f59 , 0, "Fn" }, // F59 function key
+ { fc::Fkey_f60 , 0, "Fo" }, // F60 function key
+ { fc::Fkey_f61 , 0, "Fp" }, // F61 function key
+ { fc::Fkey_f62 , 0, "Fq" }, // F62 function key
+ { fc::Fkey_f63 , 0, "Fr" }, // F63 function key
+ { 0 , 0, "\0" }
+};
+
+typedef struct
+{
+ int num;
+ char string[8];
+}
+metakeymap;
+
+static metakeymap Fmetakey[] =
+{
+ { fc::Fmkey_ic , "\033[2;3~" }, // M-insert
+ { fc::Fmkey_dc , "\033[3;3~" }, // M-delete
+ { fc::Fmkey_home , "\033[1;3H" }, // M-home
+ { fc::Fmkey_end , "\033[1;3F" }, // M-end
+ { fc::Fmkey_ppage , "\033[5;3~" }, // M-prev-page
+ { fc::Fmkey_npage , "\033[6;3~" }, // M-next-page
+ { fc::Fmkey_f1 , "\033[1;3P" }, // M-f1
+ { fc::Fmkey_f2 , "\033[1;3Q" }, // M-f2
+ { fc::Fmkey_f3 , "\033[1;3R" }, // M-f3
+ { fc::Fmkey_f4 , "\033[1;3S" }, // M-f4
+ { fc::Fmkey_f5 , "\033[15;3~" }, // M-f5
+ { fc::Fmkey_f6 , "\033[17;3~" }, // M-f6
+ { fc::Fmkey_f7 , "\033[18;3~" }, // M-f7
+ { fc::Fmkey_f8 , "\033[19;3~" }, // M-f8
+ { fc::Fmkey_f9 , "\033[20;3~" }, // M-f9
+ { fc::Fmkey_f10 , "\033[21;3~" }, // M-f10
+ { fc::Fmkey_f11 , "\033[23;3~" }, // M-f11
+ { fc::Fmkey_f12 , "\033[24;3~" }, // M-f12
+ { fc::Fmkey_up , "\033[1;3A" }, // M-up
+ { fc::Fmkey_down , "\033[1;3B" }, // M-down
+ { fc::Fmkey_right , "\033[1;3C" }, // M-right
+ { fc::Fmkey_left , "\033[1;3D" }, // M-left
+ { fc::Fmkey_sic , "\033[2;4~" }, // shift-M-insert
+ { fc::Fmkey_sdc , "\033[3;4~" }, // shift-M-delete
+ { fc::Fmkey_shome , "\033[1;4H" }, // shift-M-home
+ { fc::Fmkey_send , "\033[1;4F" }, // shift-M-end
+ { fc::Fmkey_sppage , "\033[5;4~" }, // shift-M-prev-page
+ { fc::Fmkey_snpage , "\033[6;4~" }, // shift-M-next-page
+ { fc::Fmkey_sf1 , "\033[1;4P" }, // shift-M-f1
+ { fc::Fmkey_sf2 , "\033[1;4Q" }, // shift-M-f2
+ { fc::Fmkey_sf3 , "\033[1;4R" }, // shift-M-f3
+ { fc::Fmkey_sf4 , "\033[1;4S" }, // shift-M-f4
+ { fc::Fmkey_sf5 , "\033[15;4~" }, // shift-M-f5
+ { fc::Fmkey_sf6 , "\033[17;4~" }, // shift-M-f6
+ { fc::Fmkey_sf7 , "\033[18;4~" }, // shift-M-f7
+ { fc::Fmkey_sf8 , "\033[19;4~" }, // shift-M-f8
+ { fc::Fmkey_sf9 , "\033[20;4~" }, // shift-M-f9
+ { fc::Fmkey_sf10 , "\033[21;4~" }, // shift-M-f10
+ { fc::Fmkey_sf11 , "\033[23;4~" }, // shift-M-f11
+ { fc::Fmkey_sf12 , "\033[24;4~" }, // shift-M-f12
+ { fc::Fmkey_sup , "\033[1;4A" }, // shift-M-up
+ { fc::Fmkey_sdown , "\033[1;4B" }, // shift-M-down
+ { fc::Fmkey_sright , "\033[1;4C" }, // shift-M-right
+ { fc::Fmkey_sleft , "\033[1;4D" }, // shift-M-left
+ { fc::Fckey_ic , "\033[2;5~" }, // ctrl-insert
+ { fc::Fckey_dc , "\033[3;5~" }, // ctrl-delete
+ { fc::Fckey_home , "\033[1;5H" }, // ctrl-home
+ { fc::Fckey_end , "\033[1;5F" }, // ctrl-end
+ { fc::Fckey_ppage , "\033[5;5~" }, // ctrl-prev-page
+ { fc::Fckey_npage , "\033[6;5~" }, // ctrl-next-page
+ { fc::Fckey_up , "\033[1;5A" }, // ctrl-up
+ { fc::Fckey_down , "\033[1;5B" }, // ctrl-down
+ { fc::Fckey_right , "\033[1;5C" }, // ctrl-right
+ { fc::Fckey_left , "\033[1;5D" }, // ctrl-left
+ { fc::Fckey_sic , "\033[2;6~" }, // shift-ctrl-M-insert
+ { fc::Fckey_sdc , "\033[3;6~" }, // shift-ctrl-M-delete
+ { fc::Fckey_shome , "\033[1;6H" }, // shift-ctrl-M-home
+ { fc::Fckey_send , "\033[1;6F" }, // shift-ctrl-M-end
+ { fc::Fckey_sppage , "\033[5;6~" }, // shift-ctrl-M-prev-page
+ { fc::Fckey_snpage , "\033[6;6~" }, // shift-ctrl-M-next-page
+ { fc::Fckey_sup , "\033[1;6A" }, // shift-ctrl-M-up
+ { fc::Fckey_sdown , "\033[1;6B" }, // shift-ctrl-M-down
+ { fc::Fckey_sright , "\033[1;6C" }, // shift-ctrl-M-right
+ { fc::Fckey_sleft , "\033[1;6D" }, // shift-ctrl-M-left
+ { fc::Fcmkey_ic , "\033[2;7~" }, // ctrl-M-insert
+ { fc::Fcmkey_dc , "\033[3;7~" }, // ctrl-M-delete
+ { fc::Fcmkey_home , "\033[1;7H" }, // ctrl-M-home
+ { fc::Fcmkey_end , "\033[1;7F" }, // ctrl-M-end
+ { fc::Fcmkey_ppage , "\033[5;7~" }, // ctrl-M-prev-page
+ { fc::Fcmkey_npage , "\033[6;7~" }, // ctrl-M-next-page
+ { fc::Fcmkey_up , "\033[1;7A" }, // ctrl-M-up
+ { fc::Fcmkey_down , "\033[1;7B" }, // ctrl-M-down
+ { fc::Fcmkey_right , "\033[1;7C" }, // ctrl-M-right
+ { fc::Fcmkey_left , "\033[1;7D" }, // ctrl-M-left
+ { fc::Fcmkey_sic , "\033[2;8~" }, // shift-ctrl-M-insert
+ { fc::Fcmkey_sdc , "\033[3;8~" }, // shift-ctrl-M-delete
+ { fc::Fcmkey_shome , "\033[1;8H" }, // shift-ctrl-M-home
+ { fc::Fcmkey_send , "\033[1;8F" }, // shift-ctrl-M-end
+ { fc::Fcmkey_sppage , "\033[5;8~" }, // shift-ctrl-M-prev-page
+ { fc::Fcmkey_snpage , "\033[6;8~" }, // shift-ctrl-M-next-page
+ { fc::Fcmkey_sf1 , "\033[1;8P" }, // shift-ctrl-M-f1
+ { fc::Fcmkey_sf2 , "\033[1;8Q" }, // shift-ctrl-M-f2
+ { fc::Fcmkey_sf3 , "\033[1;8R" }, // shift-ctrl-M-f3
+ { fc::Fcmkey_sf4 , "\033[1;8S" }, // shift-ctrl-M-f4
+ { fc::Fcmkey_sf5 , "\033[15;8~" }, // shift-ctrl-M-f5
+ { fc::Fcmkey_sf6 , "\033[17;8~" }, // shift-ctrl-M-f6
+ { fc::Fcmkey_sf7 , "\033[18;8~" }, // shift-ctrl-M-f7
+ { fc::Fcmkey_sf8 , "\033[19;8~" }, // shift-ctrl-M-f8
+ { fc::Fcmkey_sf9 , "\033[20;8~" }, // shift-ctrl-M-f9
+ { fc::Fcmkey_sf10 , "\033[21;8~" }, // shift-ctrl-M-f10
+ { fc::Fcmkey_sf11 , "\033[23;8~" }, // shift-ctrl-M-f11
+ { fc::Fcmkey_sf12 , "\033[24;8~" }, // shift-ctrl-M-f12
+ { fc::Fcmkey_sup , "\033[1;8A" }, // shift-ctrl-M-up
+ { fc::Fcmkey_sdown , "\033[1;8B" }, // shift-ctrl-M-down
+ { fc::Fcmkey_sright , "\033[1;8C" }, // shift-ctrl-M-right
+ { fc::Fcmkey_sleft , "\033[1;8D" }, // shift-ctrl-M-left
+ { fc::Fkey_escape_mintty , "\033O["}, // mintty Esc
+ { fc::Fmkey_space , "\033 " }, // M-' '
+ { fc::Fmkey_bang , "\033!" }, // M-!
+ { fc::Fmkey_quotes , "\033\""}, // M-"
+ { fc::Fmkey_hash , "\033#" }, // M-#
+ { fc::Fmkey_dollar , "\033$" }, // M-$
+ { fc::Fmkey_percent , "\033%" }, // M-%
+ { fc::Fmkey_ampersand , "\033&" }, // M-&
+ { fc::Fmkey_apostrophe , "\033'" }, // M-'
+ { fc::Fmkey_left_parenthesis , "\033(" }, // M-(
+ { fc::Fmkey_right_parenthesis , "\033)" }, // M-)
+ { fc::Fmkey_asterisk , "\033*" }, // M-*
+ { fc::Fmkey_plus , "\033+" }, // M-+
+ { fc::Fmkey_comma , "\033," }, // M-,
+ { fc::Fmkey_minus , "\033-" }, // M-'-'
+ { fc::Fmkey_full_stop , "\033." }, // M-.
+ { fc::Fmkey_slash , "\033/" }, // M-/
+ { fc::Fmkey_0 , "\0330" }, // M-0
+ { fc::Fmkey_1 , "\0331" }, // M-1
+ { fc::Fmkey_2 , "\0332" }, // M-2
+ { fc::Fmkey_3 , "\0333" }, // M-3
+ { fc::Fmkey_4 , "\0334" }, // M-4
+ { fc::Fmkey_5 , "\0335" }, // M-5
+ { fc::Fmkey_6 , "\0336" }, // M-6
+ { fc::Fmkey_7 , "\0337" }, // M-7
+ { fc::Fmkey_8 , "\0338" }, // M-8
+ { fc::Fmkey_9 , "\0339" }, // M-9
+ { fc::Fmkey_colon , "\033:" }, // M-:
+ { fc::Fmkey_semicolon , "\033;" }, // M-;
+ { fc::Fmkey_less_than , "\033<" }, // M-<
+ { fc::Fmkey_equals , "\033=" }, // M-=
+ { fc::Fmkey_greater_than , "\033>" }, // M->
+ { fc::Fmkey_question_mark , "\033?" }, // M-?
+ { fc::Fmkey_at , "\033@" }, // M-@
+ { fc::Fmkey_A , "\033A" }, // M-A
+ { fc::Fmkey_B , "\033B" }, // M-B
+ { fc::Fmkey_C , "\033C" }, // M-C
+ { fc::Fmkey_D , "\033D" }, // M-D
+ { fc::Fmkey_E , "\033E" }, // M-E
+ { fc::Fmkey_F , "\033F" }, // M-F
+ { fc::Fmkey_G , "\033G" }, // M-G
+ { fc::Fmkey_H , "\033H" }, // M-H
+ { fc::Fmkey_I , "\033I" }, // M-I
+ { fc::Fmkey_J , "\033J" }, // M-J
+ { fc::Fmkey_K , "\033K" }, // M-K
+ { fc::Fmkey_L , "\033L" }, // M-L
+ { fc::Fmkey_M , "\033M" }, // M-M
+ { fc::Fmkey_N , "\033N" }, // M-N
+ { fc::Fmkey_O , "\033O" }, // M-O
+ { fc::Fmkey_P , "\033P" }, // M-P
+ { fc::Fmkey_Q , "\033Q" }, // M-Q
+ { fc::Fmkey_R , "\033R" }, // M-R
+ { fc::Fmkey_S , "\033S" }, // M-S
+ { fc::Fmkey_T , "\033T" }, // M-T
+ { fc::Fmkey_U , "\033U" }, // M-U
+ { fc::Fmkey_V , "\033V" }, // M-V
+ { fc::Fmkey_W , "\033W" }, // M-W
+ { fc::Fmkey_X , "\033X" }, // M-X
+ { fc::Fmkey_Y , "\033Y" }, // M-Y
+ { fc::Fmkey_Z , "\033Z" }, // M-Z
+ { fc::Fmkey_left_square_bracket , "\033[" }, // M-[
+ { fc::Fmkey_backslash , "\033\\"}, // M-'\'
+ { fc::Fmkey_right_square_bracket , "\033]" }, // M-]
+ { fc::Fmkey_caret , "\033^" }, // M-^
+ { fc::Fmkey_underscore , "\033_" }, // M-_
+ { fc::Fmkey_grave_accent , "\033`" }, // M-`
+ { fc::Fmkey_a , "\033a" }, // M-a
+ { fc::Fmkey_b , "\033b" }, // M-b
+ { fc::Fmkey_c , "\033c" }, // M-c
+ { fc::Fmkey_d , "\033d" }, // M-d
+ { fc::Fmkey_e , "\033e" }, // M-e
+ { fc::Fmkey_f , "\033f" }, // M-f
+ { fc::Fmkey_g , "\033g" }, // M-g
+ { fc::Fmkey_h , "\033h" }, // M-h
+ { fc::Fmkey_i , "\033i" }, // M-i
+ { fc::Fmkey_j , "\033j" }, // M-j
+ { fc::Fmkey_k , "\033k" }, // M-k
+ { fc::Fmkey_l , "\033l" }, // M-l
+ { fc::Fmkey_m , "\033m" }, // M-m
+ { fc::Fmkey_n , "\033n" }, // M-n
+ { fc::Fmkey_o , "\033o" }, // M-o
+ { fc::Fmkey_p , "\033p" }, // M-p
+ { fc::Fmkey_q , "\033q" }, // M-q
+ { fc::Fmkey_r , "\033r" }, // M-r
+ { fc::Fmkey_s , "\033s" }, // M-s
+ { fc::Fmkey_t , "\033t" }, // M-t
+ { fc::Fmkey_u , "\033u" }, // M-u
+ { fc::Fmkey_v , "\033v" }, // M-v
+ { fc::Fmkey_w , "\033w" }, // M-w
+ { fc::Fmkey_x , "\033x" }, // M-x
+ { fc::Fmkey_y , "\033y" }, // M-y
+ { fc::Fmkey_z , "\033z" }, // M-z
+ { fc::Fmkey_left_curly_bracket , "\033{" }, // M-{
+ { fc::Fmkey_vertical_bar , "\033|" }, // M-|
+ { fc::Fmkey_right_curly_bracket , "\033}" }, // M-}
+ { fc::Fmkey_tilde , "\033~" }, // M-~
+ { 0 , "\0" }
+};
+
+
+#pragma pack(push)
+#pragma pack(1)
+
+typedef struct
+{
+ int num;
+ char string[25];
+}
+keyname;
+
+#pragma pack(pop)
+
+static keyname FkeyName[] =
+{
+ { fc::Fkey_erase , "Backspace" },
+ { fc::Fkey_tab , "Tab" },
+ { fc::Fkey_return , "Return" },
+ { fc::Fkey_escape , "Esc" },
+ { fc::Fkey_space , "Space" },
+ { fc::Fkey_backspace , "Backspace" },
+ { fc::Fkey_catab , "Clear-All-Tabs" },
+ { fc::Fkey_clear , "Clear-Screen" },
+ { fc::Fkey_ctab , "Clear-Tab" },
+ { fc::Fkey_dc , "Del" },
+ { fc::Fkey_dl , "Del-line" },
+ { fc::Fkey_down , "Down" },
+ { fc::Fkey_eic , "Exit-Ins" },
+ { fc::Fkey_eol , "Clear-End-of-Line" },
+ { fc::Fkey_eos , "Clear-End-of-Screen" },
+ { fc::Fkey_f0 , "F0" },
+ { fc::Fkey_f1 , "F1" },
+ { fc::Fkey_f2 , "F2" },
+ { fc::Fkey_f3 , "F3" },
+ { fc::Fkey_f4 , "F4" },
+ { fc::Fkey_f5 , "F5" },
+ { fc::Fkey_f6 , "F6" },
+ { fc::Fkey_f7 , "F7" },
+ { fc::Fkey_f8 , "F8" },
+ { fc::Fkey_f9 , "F9" },
+ { fc::Fkey_f10 , "F10" },
+ { fc::Fkey_home , "Home" },
+ { fc::Fkey_ic , "Ins" },
+ { fc::Fkey_il , "Ins-Line" },
+ { fc::Fkey_left , "Left" },
+ { fc::Fkey_ll , "Lower-Left" },
+ { fc::Fkey_npage , "PgDn" },
+ { fc::Fkey_ppage , "PgUp" },
+ { fc::Fkey_right , "Right" },
+ { fc::Fkey_sf , "Scroll-Forward" },
+ { fc::Fkey_sr , "Scroll-Backward" },
+ { fc::Fkey_stab , "Set-Tab" },
+ { fc::Fkey_up , "Up" },
+ { fc::Fkey_a1 , "Upper-Left" },
+ { fc::Fkey_a3 , "Upper-Right" },
+ { fc::Fkey_b2 , "Center" },
+ { fc::Fkey_c1 , "Lower-Left" },
+ { fc::Fkey_c3 , "Lower-Right" },
+ { fc::Fkey_btab , "Shift+Tab" },
+ { fc::Fkey_beg , "Begin" },
+ { fc::Fkey_cancel , "Cancel" },
+ { fc::Fkey_close , "Close" },
+ { fc::Fkey_command , "Command" },
+ { fc::Fkey_copy , "Copy" },
+ { fc::Fkey_create , "Create" },
+ { fc::Fkey_end , "End" },
+ { fc::Fkey_enter , "Enter" },
+ { fc::Fkey_exit , "Exit" },
+ { fc::Fkey_find , "Find" },
+ { fc::Fkey_help , "Help" },
+ { fc::Fkey_mark , "Mark" },
+ { fc::Fkey_message , "Message" },
+ { fc::Fkey_move , "Move" },
+ { fc::Fkey_next , "Next" },
+ { fc::Fkey_open , "Open" },
+ { fc::Fkey_options , "Options" },
+ { fc::Fkey_previous , "Previous" },
+ { fc::Fkey_print , "Print" },
+ { fc::Fkey_redo , "Redo" },
+ { fc::Fkey_reference , "Reference" },
+ { fc::Fkey_refresh , "Refresh" },
+ { fc::Fkey_replace , "Replace" },
+ { fc::Fkey_restart , "Restart" },
+ { fc::Fkey_resume , "Resume" },
+ { fc::Fkey_save , "Save" },
+ { fc::Fkey_suspend , "Suspend" },
+ { fc::Fkey_undo , "Undo" },
+ { fc::Fkey_sbeg , "Shift+Begin" },
+ { fc::Fkey_scancel , "Shift+Cancel" },
+ { fc::Fkey_scommand , "Shift+Command" },
+ { fc::Fkey_scopy , "Shift+Copy" },
+ { fc::Fkey_screate , "Shift+Create" },
+ { fc::Fkey_sdc , "Shift+Del" },
+ { fc::Fkey_sdl , "Shift+Del-line" },
+ { fc::Fkey_select , "Select" },
+ { fc::Fkey_send , "Shift+End" },
+ { fc::Fkey_seol , "Shift+Clear-End-of-Line" },
+ { fc::Fkey_sexit , "Shift+Exit" },
+ { fc::Fkey_sfind , "Shift+Find" },
+ { fc::Fkey_shelp , "Shift+Help" },
+ { fc::Fkey_shome , "Shift+Home" },
+ { fc::Fkey_sic , "Shift+Ins" },
+ { fc::Fkey_sleft , "Shift+Left" },
+ { fc::Fkey_smessage , "Shift+Message" },
+ { fc::Fkey_smove , "Shift+Move" },
+ { fc::Fkey_snext , "Shift+Next" },
+ { fc::Fkey_soptions , "Shift+Options" },
+ { fc::Fkey_sprevious , "Shift+Previous" },
+ { fc::Fkey_sprint , "Shift+Print" },
+ { fc::Fkey_sredo , "Shift+Redo" },
+ { fc::Fkey_sreplace , "Shift+Replace" },
+ { fc::Fkey_sright , "Shift+Right" },
+ { fc::Fkey_srsume , "Shift+Resume" },
+ { fc::Fkey_ssave , "Shift+Save" },
+ { fc::Fkey_ssuspend , "Shift+Suspend" },
+ { fc::Fkey_sundo , "Shift+Undo" },
+ { fc::Fkey_f11 , "F11" },
+ { fc::Fkey_f12 , "F12" },
+ { fc::Fkey_f13 , "Shift+F1" },
+ { fc::Fkey_f14 , "Shift+F2" },
+ { fc::Fkey_f15 , "Shift+F3" },
+ { fc::Fkey_f16 , "Shift+F4" },
+ { fc::Fkey_f17 , "Shift+F5" },
+ { fc::Fkey_f18 , "Shift+F6" },
+ { fc::Fkey_f19 , "Shift+F7" },
+ { fc::Fkey_f20 , "Shift+F8" },
+ { fc::Fkey_f21 , "Shift+F9" },
+ { fc::Fkey_f22 , "Shift+F10" },
+ { fc::Fkey_f23 , "Shift+F11" },
+ { fc::Fkey_f24 , "Shift+F12" },
+ { fc::Fkey_f25 , "Ctrl+F1" },
+ { fc::Fkey_f26 , "Ctrl+F2" },
+ { fc::Fkey_f27 , "Ctrl+F3" },
+ { fc::Fkey_f28 , "Ctrl+F4" },
+ { fc::Fkey_f29 , "Ctrl+F5" },
+ { fc::Fkey_f30 , "Ctrl+F6" },
+ { fc::Fkey_f31 , "Ctrl+F7" },
+ { fc::Fkey_f32 , "Ctrl+F8" },
+ { fc::Fkey_f33 , "Ctrl+F9" },
+ { fc::Fkey_f34 , "Ctrl+F10" },
+ { fc::Fkey_f35 , "Ctrl+F11" },
+ { fc::Fkey_f36 , "Ctrl+F12" },
+ { fc::Fkey_f37 , "Shift+Ctrl+F1" },
+ { fc::Fkey_f38 , "Shift+Ctrl+F2" },
+ { fc::Fkey_f39 , "Shift+Ctrl+F3" },
+ { fc::Fkey_f40 , "Shift+Ctrl+F4" },
+ { fc::Fkey_f41 , "Shift+Ctrl+F5" },
+ { fc::Fkey_f42 , "Shift+Ctrl+F6" },
+ { fc::Fkey_f43 , "Shift+Ctrl+F7" },
+ { fc::Fkey_f44 , "Shift+Ctrl+F8" },
+ { fc::Fkey_f45 , "Shift+Ctrl+F9" },
+ { fc::Fkey_f46 , "Shift+Ctrl+F10" },
+ { fc::Fkey_f47 , "Shift+Ctrl+F11" },
+ { fc::Fkey_f48 , "Shift+Ctrl+F12" },
+ { fc::Fkey_f49 , "Meta+F1" },
+ { fc::Fkey_f50 , "Meta+F2" },
+ { fc::Fkey_f51 , "Meta+F3" },
+ { fc::Fkey_f52 , "Meta+F4" },
+ { fc::Fkey_f53 , "Meta+F5" },
+ { fc::Fkey_f54 , "Meta+F6" },
+ { fc::Fkey_f55 , "Meta+F7" },
+ { fc::Fkey_f56 , "Meta+F8" },
+ { fc::Fkey_f57 , "Meta+F9" },
+ { fc::Fkey_f58 , "Meta+F10" },
+ { fc::Fkey_f59 , "Meta+F11" },
+ { fc::Fkey_f60 , "Meta+F12" },
+ { fc::Fkey_f61 , "Shift+Meta+F1" },
+ { fc::Fkey_f62 , "Shift+Meta+F2" },
+ { fc::Fkey_f63 , "Shift+Meta+F3" },
+ { fc::Fmkey_ic , "Meta+Ins" },
+ { fc::Fmkey_dc , "Meta+Del" },
+ { fc::Fmkey_home , "Meta+Home" },
+ { fc::Fmkey_end , "Meta+End" },
+ { fc::Fmkey_ppage , "Meta+PgUp" },
+ { fc::Fmkey_npage , "Meta+PgDn" },
+ { fc::Fmkey_f1 , "Meta+F1" },
+ { fc::Fmkey_f2 , "Meta+F2" },
+ { fc::Fmkey_f3 , "Meta+F3" },
+ { fc::Fmkey_f4 , "Meta+F4" },
+ { fc::Fmkey_f5 , "Meta+F5" },
+ { fc::Fmkey_f6 , "Meta+F6" },
+ { fc::Fmkey_f7 , "Meta+F7" },
+ { fc::Fmkey_f8 , "Meta+F8" },
+ { fc::Fmkey_f9 , "Meta+F9" },
+ { fc::Fmkey_f10 , "Meta+F10" },
+ { fc::Fmkey_f11 , "Meta+F11" },
+ { fc::Fmkey_f12 , "Meta+F12" },
+ { fc::Fmkey_up , "Meta+Up" },
+ { fc::Fmkey_down , "Meta+Down" },
+ { fc::Fmkey_right , "Meta+Right" },
+ { fc::Fmkey_left , "Meta+Left" },
+ { fc::Fmkey_sic , "Shift+Meta+Ins" },
+ { fc::Fmkey_sdc , "Shift+Meta+Del" },
+ { fc::Fmkey_shome , "Shift+Meta+Home" },
+ { fc::Fmkey_send , "Shift+Meta+End" },
+ { fc::Fmkey_sppage , "Shift+Meta+PgUp" },
+ { fc::Fmkey_snpage , "Shift+Meta+PgDn" },
+ { fc::Fmkey_sf1 , "Shift+Meta+F1" },
+ { fc::Fmkey_sf2 , "Shift+Meta+F2" },
+ { fc::Fmkey_sf3 , "Shift+Meta+F3" },
+ { fc::Fmkey_sf4 , "Shift+Meta+F4" },
+ { fc::Fmkey_sf5 , "Shift+Meta+F5" },
+ { fc::Fmkey_sf6 , "Shift+Meta+F6" },
+ { fc::Fmkey_sf7 , "Shift+Meta+F7" },
+ { fc::Fmkey_sf8 , "Shift+Meta+F8" },
+ { fc::Fmkey_sf9 , "Shift+Meta+F9" },
+ { fc::Fmkey_sf10 , "Shift+Meta+F10" },
+ { fc::Fmkey_sf11 , "Shift+Meta+F11" },
+ { fc::Fmkey_sf12 , "Shift+Meta+F12" },
+ { fc::Fmkey_sup , "Shift+Meta+Up" },
+ { fc::Fmkey_sdown , "Shift+Meta+Down" },
+ { fc::Fmkey_sright , "Shift+Meta+Right" },
+ { fc::Fmkey_sleft , "Shift+Meta+Left" },
+ { fc::Fckey_ic , "Ctrl+Ins" },
+ { fc::Fckey_dc , "Ctrl+Del" },
+ { fc::Fckey_home , "Ctrl+Home" },
+ { fc::Fckey_end , "Ctrl+End" },
+ { fc::Fckey_ppage , "Ctrl+PgUp" },
+ { fc::Fckey_npage , "Ctrl+PgDn" },
+ { fc::Fckey_up , "Ctrl+Up" },
+ { fc::Fckey_down , "Ctrl+Down" },
+ { fc::Fckey_right , "Ctrl+Right" },
+ { fc::Fckey_left , "Ctrl+Left" },
+ { fc::Fckey_sic , "Ctrl+Ins" },
+ { fc::Fckey_sdc , "Ctrl+Del" },
+ { fc::Fckey_shome , "Ctrl+Home" },
+ { fc::Fckey_send , "Ctrl+End" },
+ { fc::Fckey_sppage , "Shift+Ctrl+PgUp" },
+ { fc::Fckey_snpage , "Shift+Ctrl+PgDn" },
+ { fc::Fckey_sup , "Shift+Ctrl+Up" },
+ { fc::Fckey_sdown , "Shift+Ctrl+Down" },
+ { fc::Fckey_sright , "Shift+Ctrl+Right" },
+ { fc::Fckey_sleft , "Shift+Ctrl+Left" },
+ { fc::Fcmkey_ic , "Ctrl+Meta+Ins" },
+ { fc::Fcmkey_dc , "Ctrl+Meta+Del" },
+ { fc::Fcmkey_home , "Ctrl+Meta+Home" },
+ { fc::Fcmkey_end , "Ctrl+Meta+End" },
+ { fc::Fcmkey_ppage , "Ctrl+Meta+PgUp" },
+ { fc::Fcmkey_npage , "Ctrl+Meta+PgDn" },
+ { fc::Fcmkey_up , "Ctrl+Meta+Up" },
+ { fc::Fcmkey_down , "Ctrl+Meta+Down" },
+ { fc::Fcmkey_right , "Ctrl+Meta+Right" },
+ { fc::Fcmkey_left , "Ctrl+Meta+Left" },
+ { fc::Fcmkey_sic , "Shift+Ctrl+Meta+Ins" },
+ { fc::Fcmkey_sdc , "Shift+Ctrl+Meta+Del" },
+ { fc::Fcmkey_shome , "Shift+Ctrl+Meta+Home" },
+ { fc::Fcmkey_send , "Shift+Ctrl+Meta+End" },
+ { fc::Fcmkey_sppage , "Shift+Ctrl+Meta+PgUp" },
+ { fc::Fcmkey_snpage , "Shift+Ctrl+Meta+PgDn" },
+ { fc::Fcmkey_sf1 , "Shift+Ctrl+Meta+F1" },
+ { fc::Fcmkey_sf2 , "Shift+Ctrl+Meta+F2" },
+ { fc::Fcmkey_sf3 , "Shift+Ctrl+Meta+F3" },
+ { fc::Fcmkey_sf4 , "Shift+Ctrl+Meta+F4" },
+ { fc::Fcmkey_sf5 , "Shift+Ctrl+Meta+F5" },
+ { fc::Fcmkey_sf6 , "Shift+Ctrl+Meta+F6" },
+ { fc::Fcmkey_sf7 , "Shift+Ctrl+Meta+F7" },
+ { fc::Fcmkey_sf8 , "Shift+Ctrl+Meta+F8" },
+ { fc::Fcmkey_sf9 , "Shift+Ctrl+Meta+F9" },
+ { fc::Fcmkey_sf10 , "Shift+Ctrl+Meta+F10" },
+ { fc::Fcmkey_sf11 , "Shift+Ctrl+Meta+F11" },
+ { fc::Fcmkey_sf12 , "Shift+Ctrl+Meta+F12" },
+ { fc::Fcmkey_sup , "Shift+Ctrl+Meta+Up" },
+ { fc::Fcmkey_sdown , "Shift+Ctrl+Meta+Down" },
+ { fc::Fcmkey_sright , "Shift+Ctrl+Meta+Right" },
+ { fc::Fcmkey_sleft , "Shift+Ctrl+Meta+Left" },
+ { fc::Fmkey_space , "Meta+Space" },
+ { fc::Fmkey_bang , "Meta+!" },
+ { fc::Fmkey_quotes , "Meta+\"" },
+ { fc::Fmkey_hash , "Meta+#" },
+ { fc::Fmkey_dollar , "Meta+$" },
+ { fc::Fmkey_percent , "Meta+%" },
+ { fc::Fmkey_ampersand , "Meta+&" },
+ { fc::Fmkey_apostrophe , "Meta+'" },
+ { fc::Fmkey_left_parenthesis , "Meta+(" },
+ { fc::Fmkey_right_parenthesis , "Meta+)" },
+ { fc::Fmkey_asterisk , "Meta+*" },
+ { fc::Fmkey_plus , "Meta++" },
+ { fc::Fmkey_comma , "Meta+," },
+ { fc::Fmkey_minus , "Meta+-" },
+ { fc::Fmkey_full_stop , "Meta+." },
+ { fc::Fmkey_slash , "Meta+/" },
+ { fc::Fmkey_0 , "Meta+0" },
+ { fc::Fmkey_1 , "Meta+1" },
+ { fc::Fmkey_2 , "Meta+2" },
+ { fc::Fmkey_3 , "Meta+3" },
+ { fc::Fmkey_4 , "Meta+4" },
+ { fc::Fmkey_5 , "Meta+5" },
+ { fc::Fmkey_6 , "Meta+6" },
+ { fc::Fmkey_7 , "Meta+7" },
+ { fc::Fmkey_8 , "Meta+8" },
+ { fc::Fmkey_9 , "Meta+9" },
+ { fc::Fmkey_colon , "Meta+:" },
+ { fc::Fmkey_semicolon , "Meta+;" },
+ { fc::Fmkey_less_than , "Meta+<" },
+ { fc::Fmkey_equals , "Meta+=" },
+ { fc::Fmkey_greater_than , "Meta+>" },
+ { fc::Fmkey_question_mark , "Meta+?" },
+ { fc::Fmkey_at , "Meta+@" },
+ { fc::Fmkey_A , "Shift+Meta+A" },
+ { fc::Fmkey_B , "Shift+Meta+B" },
+ { fc::Fmkey_C , "Shift+Meta+C" },
+ { fc::Fmkey_D , "Shift+Meta+D" },
+ { fc::Fmkey_E , "Shift+Meta+E" },
+ { fc::Fmkey_F , "Shift+Meta+F" },
+ { fc::Fmkey_G , "Shift+Meta+G" },
+ { fc::Fmkey_H , "Shift+Meta+H" },
+ { fc::Fmkey_I , "Shift+Meta+I" },
+ { fc::Fmkey_J , "Shift+Meta+J" },
+ { fc::Fmkey_K , "Shift+Meta+K" },
+ { fc::Fmkey_L , "Shift+Meta+L" },
+ { fc::Fmkey_M , "Shift+Meta+M" },
+ { fc::Fmkey_N , "Shift+Meta+N" },
+ { fc::Fmkey_O , "Shift+Meta+O" },
+ { fc::Fmkey_P , "Shift+Meta+P" },
+ { fc::Fmkey_Q , "Shift+Meta+Q" },
+ { fc::Fmkey_R , "Shift+Meta+R" },
+ { fc::Fmkey_S , "Shift+Meta+S" },
+ { fc::Fmkey_T , "Shift+Meta+T" },
+ { fc::Fmkey_U , "Shift+Meta+U" },
+ { fc::Fmkey_V , "Shift+Meta+V" },
+ { fc::Fmkey_W , "Shift+Meta+W" },
+ { fc::Fmkey_X , "Shift+Meta+X" },
+ { fc::Fmkey_Y , "Shift+Meta+Y" },
+ { fc::Fmkey_Z , "Shift+Meta+Z" },
+ { fc::Fmkey_left_square_bracket , "Meta+[" },
+ { fc::Fmkey_backslash , "Meta+\\" },
+ { fc::Fmkey_right_square_bracket, "Meta+]" },
+ { fc::Fmkey_caret , "Meta+^" },
+ { fc::Fmkey_underscore , "Meta+_" },
+ { fc::Fmkey_grave_accent , "Meta+`" },
+ { fc::Fmkey_a , "Meta+A" },
+ { fc::Fmkey_b , "Meta+B" },
+ { fc::Fmkey_c , "Meta+C" },
+ { fc::Fmkey_d , "Meta+D" },
+ { fc::Fmkey_e , "Meta+E" },
+ { fc::Fmkey_f , "Meta+F" },
+ { fc::Fmkey_g , "Meta+G" },
+ { fc::Fmkey_h , "Meta+H" },
+ { fc::Fmkey_i , "Meta+I" },
+ { fc::Fmkey_j , "Meta+J" },
+ { fc::Fmkey_k , "Meta+K" },
+ { fc::Fmkey_l , "Meta+L" },
+ { fc::Fmkey_m , "Meta+M" },
+ { fc::Fmkey_n , "Meta+N" },
+ { fc::Fmkey_o , "Meta+O" },
+ { fc::Fmkey_p , "Meta+P" },
+ { fc::Fmkey_q , "Meta+Q" },
+ { fc::Fmkey_r , "Meta+R" },
+ { fc::Fmkey_s , "Meta+S" },
+ { fc::Fmkey_t , "Meta+T" },
+ { fc::Fmkey_u , "Meta+U" },
+ { fc::Fmkey_v , "Meta+V" },
+ { fc::Fmkey_w , "Meta+W" },
+ { fc::Fmkey_x , "Meta+X" },
+ { fc::Fmkey_y , "Meta+Y" },
+ { fc::Fmkey_z , "Meta+Z" },
+ { fc::Fmkey_left_curly_bracket , "Meta+{" },
+ { fc::Fmkey_vertical_bar , "Meta+|" },
+ { fc::Fmkey_right_curly_bracket , "Meta+}" },
+ { fc::Fmkey_tilde , "Meta+~" },
+ { 0 , "\0" }
+};
+
+#endif // _FKEYMAP_H
diff --git a/src/flabel.cpp b/src/flabel.cpp
new file mode 100644
index 00000000..6b08963d
--- /dev/null
+++ b/src/flabel.cpp
@@ -0,0 +1,369 @@
+// flabel.cpp
+// class FLabel
+
+#include "fapp.h"
+#include "flabel.h"
+#include "fstatusbar.h"
+
+
+//----------------------------------------------------------------------
+// class FLabel
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FLabel::FLabel(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FLabel::FLabel (const FString& txt, FWidget* parent) : FWidget(parent)
+{
+ this->init();
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FLabel::~FLabel() // destructor
+{
+ delAccelerator (this);
+}
+
+
+// private methods of FLabel
+//----------------------------------------------------------------------
+void FLabel::init()
+{
+ flags = 0;
+ emphasis = 0;
+ xoffset = 0;
+ alignment = fc::alignLeft;
+ this->text = "";
+ accel_widget = 0;
+
+ if ( isEnabled() )
+ this->flags |= ACTIVE;
+
+ unsetFocusable();
+
+ foregroundColor = parentWidget()->getForegroundColor();
+ backgroundColor = parentWidget()->getBackgroundColor();
+ emphasis_color = wc.label_emphasis_fg;
+ ellipsis_color = wc.label_ellipsis_fg;
+ reverse_mode = false;
+}
+
+//----------------------------------------------------------------------
+uChar FLabel::getHotkey()
+{
+ uInt length;
+
+ if ( text.isEmpty() )
+ return 0;
+
+ length = text.getLength();
+
+ for (uInt i=0; i < length; i++)
+ if ( (i+1 < length) && (text[i] == '&') )
+ return uChar(text[++i]);
+ return 0;
+}
+
+//----------------------------------------------------------------------
+void FLabel::setHotkeyAccelerator()
+{
+ int hotkey = getHotkey();
+ if ( hotkey )
+ {
+ if ( isalpha(hotkey) || isdigit(hotkey) )
+ {
+ addAccelerator (tolower(hotkey), this);
+ addAccelerator (toupper(hotkey), this);
+ // Meta + hotkey
+ addAccelerator (0x20000e0 + tolower(hotkey), this);
+ }
+ else
+ addAccelerator (getHotkey(), this);
+ }
+ else
+ delAccelerator(this);
+}
+
+//----------------------------------------------------------------------
+void FLabel::draw()
+{
+ register wchar_t* src;
+ register wchar_t* dest;
+ wchar_t* LabelText;
+ FString txt;
+ uInt length;
+ int hotkeypos, to_char;
+ bool isActive, isNoUnderline;
+
+ if ( text.isNull() || text.isEmpty() )
+ return;
+
+ if ( Encoding == fc::VT100 )
+ unsetVT100altChar();
+
+ setUpdateVTerm(false);
+ if ( hasEmphasis() )
+ setColor (emphasis_color, backgroundColor);
+ else
+ setColor (foregroundColor, backgroundColor);
+
+ length = text.getLength();
+ hotkeypos = -1;
+ LabelText = new wchar_t[length+1];
+ txt = this->text;
+ src = const_cast(txt.wc_str());
+ dest = const_cast(LabelText);
+
+ isActive = ((flags & ACTIVE) != 0);
+ isNoUnderline = ((flags & NO_UNDERLINE) != 0);
+
+ // find hotkey position in string
+ // + generate a new string without the '&'-sign
+ for (uInt i=0; i < length; i++)
+ {
+ if ( (i < length) && (txt[i] == '&') && (hotkeypos == -1) )
+ {
+ hotkeypos = int(i);
+ i++;
+ src++;
+ }
+ *dest++ = *src++;
+ }
+
+ if ( hotkeypos != -1 )
+ length--;
+
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+
+ for (int x=0; x < xoffset; x++)
+ print (' ');
+
+ if ( length <= uInt(width) )
+ to_char = int(length);
+ else
+ to_char = width - 2;
+
+ if ( hasReverseMode() )
+ setReverse(true);
+
+ for (int z=0; z < to_char; z++)
+ {
+ if ( (z == hotkeypos) && isActive )
+ {
+ setColor (wc.label_hotkey_fg, wc.label_hotkey_bg);
+ if ( ! isNoUnderline )
+ setUnderline();
+ print ( LabelText[z] );
+ if ( ! isNoUnderline )
+ unsetUnderline();
+ if ( hasEmphasis() )
+ setColor (emphasis_color, backgroundColor);
+ else
+ setColor (foregroundColor, backgroundColor);
+ }
+ else
+ print ( LabelText[z] );
+ }
+
+ for (int x=to_char+2; x < width; x++)
+ print (' ');
+
+ if ( length > uInt(width) )
+ {
+ setColor (ellipsis_color, backgroundColor);
+ print ("..");
+ }
+ if ( hasReverseMode() )
+ setReverse(false);
+
+ setUpdateVTerm(true);
+ delete[] LabelText;
+}
+
+
+// public methods of FLabel
+//----------------------------------------------------------------------
+void FLabel::hide()
+{
+ int fg, bg;
+ char* blank;
+
+ FWidget::hide();
+
+ fg = parentWidget()->getForegroundColor();
+ bg = parentWidget()->getBackgroundColor();
+ setColor (fg, bg);
+
+ blank = new char[width+1];
+ memset(blank, ' ', uLong(width));
+ blank[width] = '\0';
+ print (blank);
+ delete[] blank;
+}
+
+//----------------------------------------------------------------------
+void FLabel::onMouseDown (FMouseEvent* event)
+{
+ if ( event->getButton() != LeftButton )
+ return;
+
+ if ( ! isEnabled() || ! accel_widget )
+ return;
+
+ if ( ! accel_widget->hasFocus() )
+ {
+ FWidget* focused_widget = getFocusWidget();
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ accel_widget->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ accel_widget->redraw();
+ if ( statusBar() )
+ {
+ accel_widget->statusBar()->drawMessage();
+ updateTerminal();
+ flush_out();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FLabel::onAccel (FAccelEvent* event)
+{
+ if ( ! isEnabled() || ! accel_widget )
+ return;
+
+ if ( ! accel_widget->hasFocus() )
+ {
+ FWidget* focused_widget = static_cast(event->focusedWidget());
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ accel_widget->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ accel_widget->redraw();
+ if ( statusBar() )
+ {
+ accel_widget->statusBar()->drawMessage();
+ updateTerminal();
+ flush_out();
+ }
+ }
+ event->accept();
+}
+
+//----------------------------------------------------------------------
+void FLabel::cb_accel_widget_destroyed (FWidget*, void*)
+{
+ accel_widget = 0;
+ delAccelerator (this);
+}
+
+//----------------------------------------------------------------------
+void FLabel::setAccelWidget (FWidget* widget)
+{
+ if ( widget )
+ accel_widget = widget;
+
+ accel_widget->addCallback
+ (
+ "destroy",
+ this,
+ reinterpret_cast(&FLabel::cb_accel_widget_destroyed),
+ null
+ );
+}
+
+//----------------------------------------------------------------------
+void FLabel::setAlignment (uInt align)
+{
+ int text_length;
+
+ if ( align != fc::alignLeft
+ && align != fc::alignCenter
+ && align != fc::alignRight )
+ alignment = fc::alignLeft;
+ else
+ alignment = align;
+
+ text_length = int(text.getLength());
+
+ if ( getHotkey() )
+ text_length--;
+
+ if ( text_length > width )
+ text_length = width;
+
+ switch ( alignment )
+ { // convert type to msg string
+ case fc::alignLeft:
+ xoffset = 0;
+ break;
+ case fc::alignCenter:
+ xoffset = int((width - text_length) / 2);
+ break;
+ case fc::alignRight:
+ xoffset = width - text_length;
+ break;
+ }
+}
+
+//----------------------------------------------------------------------
+bool FLabel::setEmphasis (bool on)
+{
+ if ( on )
+ this->emphasis |= EMPHASIS;
+ else
+ this->emphasis &= ~EMPHASIS;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FLabel::setReverseMode (bool on)
+{
+ if ( reverse_mode != on )
+ reverse_mode = on;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FLabel::setEnable (bool on)
+{
+ FWidget::setEnable(on);
+
+ if ( on )
+ {
+ this->flags |= ACTIVE;
+ setHotkeyAccelerator();
+ }
+ else
+ {
+ this->flags &= ~ACTIVE;
+ delAccelerator (this);
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+void FLabel::setNumber (long num)
+{
+ setText(FString().setNumber(num));
+}
+
+//----------------------------------------------------------------------
+void FLabel::setText (const FString& txt)
+{
+ this->text = txt;
+ if ( isEnabled() )
+ {
+ delAccelerator (this);
+ setHotkeyAccelerator();
+ }
+}
diff --git a/src/flabel.h b/src/flabel.h
new file mode 100644
index 00000000..616cb1c7
--- /dev/null
+++ b/src/flabel.h
@@ -0,0 +1,112 @@
+// flabel.h
+// class FLabel
+
+#ifndef _FLABEL_H
+#define _FLABEL_H
+
+#include "fwidget.h"
+
+#define NO_EMPHASIS 0x00000000
+#define EMPHASIS 0x00000001
+
+
+//----------------------------------------------------------------------
+// class FLabel
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FLabel : public FWidget
+{
+ private:
+ FString text;
+ int emphasis;
+ int xoffset;
+ uInt alignment;
+ uChar emphasis_color;
+ uChar ellipsis_color;
+ bool reverse_mode;
+ FWidget* accel_widget;
+
+ private:
+ FLabel (const FLabel&);
+ FLabel& operator = (const FLabel&);
+
+ void init();
+ uChar getHotkey();
+ void setHotkeyAccelerator();
+ void draw();
+
+ public:
+ FLabel (FWidget* parent=0); // constructor
+ FLabel (const FString&, FWidget* parent=0); // constructor
+ virtual ~FLabel(); // destructor
+ const char* getClassName() const;
+
+ void hide();
+ void onMouseDown (FMouseEvent*);
+ void onAccel (FAccelEvent*);
+ void cb_accel_widget_destroyed (FWidget*, void*);
+ void setAccelWidget (FWidget* widget=0);
+ FTerm* getAccelWidget();
+ void setAlignment(uInt);
+ uInt getAlignment();
+ bool setEmphasis(bool);
+ bool setEmphasis();
+ bool unsetEmphasis();
+ bool hasEmphasis();
+ bool setReverseMode(bool);
+ bool setReverseMode();
+ bool unsetReverseMode();
+ bool hasReverseMode();
+ bool setEnable (bool);
+ void setNumber(long);
+ void setText (const FString&);
+ FString& getText();
+};
+#pragma pack(pop)
+
+
+// FLabel inline functions
+//----------------------------------------------------------------------
+inline const char* FLabel::getClassName() const
+{ return "FLabel"; }
+
+//----------------------------------------------------------------------
+inline FTerm* FLabel::getAccelWidget ()
+{ return accel_widget; }
+
+//----------------------------------------------------------------------
+inline uInt FLabel::getAlignment()
+{ return alignment; }
+
+//----------------------------------------------------------------------
+inline bool FLabel::setEmphasis()
+{ return setEmphasis(true); }
+
+//----------------------------------------------------------------------
+inline bool FLabel::unsetEmphasis()
+{ return setEmphasis(false); }
+
+//----------------------------------------------------------------------
+inline bool FLabel::hasEmphasis()
+{ return ((emphasis & EMPHASIS) != 0); }
+
+//----------------------------------------------------------------------
+inline bool FLabel::setReverseMode()
+{ return setReverseMode(true); }
+
+//----------------------------------------------------------------------
+inline bool FLabel::unsetReverseMode()
+{ return setReverseMode(false); }
+
+//----------------------------------------------------------------------
+inline bool FLabel::hasReverseMode()
+{ return reverse_mode; }
+
+//----------------------------------------------------------------------
+inline FString& FLabel::getText()
+{ return this->text; }
+
+#endif // _FLABEL_H
diff --git a/src/flineedit.cpp b/src/flineedit.cpp
new file mode 100644
index 00000000..39db2525
--- /dev/null
+++ b/src/flineedit.cpp
@@ -0,0 +1,767 @@
+// flineedit.cpp
+// class FLineEdit
+
+#include "fapp.h"
+#include "flineedit.h"
+#include "fstatusbar.h"
+
+
+//----------------------------------------------------------------------
+// class FLineEdit
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FLineEdit::FLineEdit(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FLineEdit::FLineEdit (const FString& txt, FWidget* parent) : FWidget(parent)
+{
+ this->init();
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FLineEdit::~FLineEdit() // destructor
+{
+ if ( ! insert_mode )
+ {
+ setXTermCursorStyle(fc::blinking_underline);
+ setKDECursor(fc::UnderlineCursor);
+ setConsoleCursor(fc::underscore_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:ffff/ffff/ffff");
+ }
+ if ( hasFocus() )
+ hideCursor();
+}
+
+// private methods of FLineEdit
+//----------------------------------------------------------------------
+void FLineEdit::init()
+{
+ flags = 0;
+ scrollTimer = false;
+ scrollRepeat = 100;
+ dragScroll = FLineEdit::noScroll;
+ insert_mode = true;
+ cursor_pos = 0;
+ offset = 0;
+ this->text = "";
+ this->label_text = "";
+ this->label = new FLabel(label_text, parentWidget());
+ label->setAccelWidget(this);
+ label_orientation = FLineEdit::label_left;
+ setVisibleCursor();
+
+ if ( hasFocus() )
+ this->flags |= FOCUS;
+
+ if ( isEnabled() )
+ {
+ this->flags |= ACTIVE;
+
+ if ( hasFocus() )
+ {
+ foregroundColor = wc.inputfield_active_focus_fg;
+ backgroundColor = wc.inputfield_active_focus_bg;
+ }
+ else
+ {
+ foregroundColor = wc.inputfield_active_fg;
+ backgroundColor = wc.inputfield_active_bg;
+ }
+ }
+ else // inactive
+ {
+ foregroundColor = wc.inputfield_inactive_fg;
+ backgroundColor = wc.inputfield_inactive_bg;
+ }
+}
+
+//----------------------------------------------------------------------
+bool FLineEdit::hasHotkey()
+{
+ if ( label_text.isEmpty() )
+ return 0;
+ return label_text.includes('&');
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::draw()
+{
+ bool isFocus;
+
+ if ( Encoding == fc::VT100 )
+ unsetVT100altChar();
+
+ drawInputField();
+
+ isFocus = ((flags & FOCUS) != 0);
+ if ( isFocus && statusBar() )
+ {
+ FString msg = getStatusbarMessage();
+ FString curMsg = statusBar()->getMessage();
+ if ( curMsg != msg )
+ {
+ statusBar()->setMessage(msg);
+ statusBar()->drawMessage();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::drawInputField()
+{
+ bool isActiveFocus, isActive, isShadow;
+ int x;
+ FString show_text;
+ isActiveFocus = (flags & (ACTIVE+FOCUS)) == (ACTIVE+FOCUS);
+ isActive = ((flags & ACTIVE) != 0);
+ isShadow = ((flags & SHADOW) != 0 );
+
+ setUpdateVTerm(false);
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ if ( isMonochron() )
+ {
+ setReverse(true);
+ print (' ');
+ }
+ else if ( isActiveFocus )
+ {
+ setColor (wc.inputfield_active_focus_bg, wc.dialog_bg);
+ if ( this->isCygwinTerminal() ) // IBM Codepage 850
+ print (fc::FullBlock); // █
+ else
+ print (fc::RightHalfBlock); // ▐
+ }
+ else if ( isActive )
+ {
+ setColor (wc.inputfield_active_bg, wc.dialog_bg);
+ if ( this->isCygwinTerminal() ) // IBM Codepage 850
+ print (fc::FullBlock); // █
+ else
+ print (fc::RightHalfBlock); // ▐
+ }
+ else // isInactive
+ {
+ setColor (wc.inputfield_inactive_bg, wc.dialog_bg);
+ if ( this->isCygwinTerminal() ) // IBM Codepage 850
+ print (fc::FullBlock); // █
+ else
+ print (fc::RightHalfBlock); // ▐
+ }
+ setColor (foregroundColor, backgroundColor);
+ show_text = text.mid(uInt(1+offset), uInt(width-2));
+
+ if ( isUTF8_linux_terminal() )
+ {
+ setUTF8(true);
+ print (show_text);
+ setUTF8(false);
+ }
+ else
+ print (show_text);
+
+ x = int(show_text.getLength());
+ while ( x <= width-2 )
+ {
+ print (' ');
+ x++;
+ }
+ if ( isMonochron() )
+ setReverse(false);
+
+ if ( isShadow )
+ drawShadow ();
+
+ setUpdateVTerm(true);
+
+ // set the cursor to the first pos.
+ setCursorPos (xpos+xmin+cursor_pos-offset, ypos+ymin-1);
+
+ if ( isCursorInside() && hasFocus() && isHiddenCursor() )
+ showCursor();
+ else if ( ! isHiddenCursor() )
+ hideCursor();
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::processActivate()
+{
+ if ( ! hasFocus() )
+ {
+ setFocus();
+ redraw();
+ }
+ emitCallback("activate");
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::processChanged()
+{
+ emitCallback("changed");
+}
+
+
+// protected methods of FListBox
+//----------------------------------------------------------------------
+void FLineEdit::adjustLabel()
+{
+ int label_length = int(label_text.getLength());
+
+ if ( hasHotkey() )
+ label_length--;
+
+ assert ( label_orientation == label_above
+ || label_orientation == label_left );
+
+ switch ( label_orientation )
+ {
+ case label_above:
+ label->setGeometry(xpos, ypos-1, label_length, 1);
+ break;
+ case label_left:
+ label->setGeometry(xpos-label_length, ypos-1, label_length, 1);
+ break;
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::adjustSize()
+{
+ FWidget::adjustSize();
+ adjustLabel();
+}
+
+
+// public methods of FLineEdit
+//----------------------------------------------------------------------
+void FLineEdit::hide()
+{
+ int fg, bg, s, size, lable_Length;
+ char* blank;
+
+ FWidget::hide();
+
+ fg = parentWidget()->getForegroundColor();
+ bg = parentWidget()->getBackgroundColor();
+ setColor (fg, bg);
+ s = hasShadow() ? 1 : 0;
+ size = width + s;
+ blank = new char[size+1];
+ memset(blank, ' ', uLong(size));
+ blank[size] = '\0';
+
+ for (int y=0; y < height+s; y++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+y);
+ print (blank);
+ }
+ delete[] blank;
+
+ lable_Length = int(label_text.getLength());
+
+ if ( lable_Length > 0 )
+ {
+ assert ( label_orientation == label_above
+ || label_orientation == label_left );
+
+ switch ( label_orientation )
+ {
+ case label_above:
+ gotoxy (xpos+xmin-1, ypos+ymin-2);
+ break;
+ case label_left:
+ gotoxy (xpos+xmin-int(lable_Length)-1, ypos+ymin-1);
+ break;
+ }
+ blank = new char[lable_Length+1];
+ memset(blank, ' ', uLong(size));
+ blank[lable_Length] = '\0';
+ print (blank);
+ delete[] blank;
+ }
+}
+
+//----------------------------------------------------------------------
+bool FLineEdit::setEnable (bool on)
+{
+ FWidget::setEnable(on);
+
+ if ( on )
+ {
+ this->flags |= ACTIVE;
+ if ( hasFocus() )
+ {
+ foregroundColor = wc.inputfield_active_focus_fg;
+ backgroundColor = wc.inputfield_active_focus_bg;
+ }
+ else
+ {
+ foregroundColor = wc.inputfield_active_fg;
+ backgroundColor = wc.inputfield_active_bg;
+ }
+ }
+ else
+ {
+ this->flags &= ~ACTIVE;
+ foregroundColor = wc.inputfield_inactive_fg;
+ backgroundColor = wc.inputfield_inactive_bg;
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FLineEdit::setFocus (bool on)
+{
+ FWidget::setFocus(on);
+
+ if ( on )
+ {
+ this->flags |= FOCUS;
+
+ if ( isEnabled() )
+ {
+ foregroundColor = wc.inputfield_active_focus_fg;
+ backgroundColor = wc.inputfield_active_focus_bg;
+
+ if ( statusBar() )
+ {
+ FString msg = getStatusbarMessage();
+ FString curMsg = statusBar()->getMessage();
+ if ( curMsg != msg )
+ statusBar()->setMessage(msg);
+ }
+ }
+ }
+ else
+ {
+ this->flags &= ~FOCUS;
+
+ if ( isEnabled() )
+ {
+ foregroundColor = wc.inputfield_active_fg;
+ backgroundColor = wc.inputfield_active_bg;
+ if ( statusBar() )
+ statusBar()->clearMessage();
+ }
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FLineEdit::setShadow (bool on)
+{
+ if ( on )
+ this->flags |= SHADOW;
+ else
+ this->flags &= ~SHADOW;
+ return on;
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onKeyPress (FKeyEvent* event)
+{
+ int len = int(text.getLength());
+ int key = event->key();
+
+ switch ( key )
+ {
+ case fc::Fkey_left:
+ cursor_pos--;
+ if ( cursor_pos < 0 )
+ cursor_pos=0;
+ if ( cursor_pos < offset )
+ offset--;
+ event->accept();
+ break;
+
+ case fc::Fkey_right:
+ cursor_pos++;
+ if ( cursor_pos >= len )
+ cursor_pos=len;
+ if ( cursor_pos-offset >= width-2 && offset < len-width+2 )
+ offset++;
+ event->accept();
+ break;
+
+ case fc::Fkey_home:
+ cursor_pos=0;
+ offset=0;
+ event->accept();
+ break;
+
+ case fc::Fkey_end:
+ cursor_pos=len;
+ if ( cursor_pos > width-2 )
+ offset=len-width+2;
+ event->accept();
+ break;
+
+ case fc::Fkey_dc: // del key
+ if ( len > 0 && cursor_pos < len )
+ {
+ text.remove(uInt(cursor_pos), 1);
+ processChanged();
+ }
+ if ( cursor_pos >= len )
+ cursor_pos=len;
+ if ( cursor_pos < 0 )
+ cursor_pos=0;
+ if ( offset > 0 && len-offset <= width-2 )
+ offset--;
+ event->accept();
+ break;
+
+ case fc::Fkey_erase:
+ case fc::Fkey_backspace:
+ if ( len > 0 && cursor_pos > 0 )
+ {
+ text.remove(uInt(cursor_pos-1), 1);
+ processChanged();
+ cursor_pos--;
+ if ( offset > 0 )
+ offset--;
+ }
+ event->accept();
+ break;
+
+ case fc::Fkey_ic: // insert key
+ insert_mode = not insert_mode;
+ if ( insert_mode )
+ {
+ setXTermCursorStyle(fc::blinking_underline);
+ setKDECursor(fc::UnderlineCursor);
+ setConsoleCursor(fc::underscore_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:ffff/ffff/ffff");
+ }
+ else
+ {
+ setXTermCursorStyle(fc::steady_block);
+ setKDECursor(fc::BlockCursor);
+ setConsoleCursor(fc::full_block_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:0000/0000/0000");
+ }
+ event->accept();
+ break;
+
+ case fc::Fkey_return:
+ case fc::Fkey_enter:
+ processActivate();
+ event->accept();
+ break;
+
+ case fc::Fkey_tab:
+ event->ignore();
+ break;
+
+ default:
+ if ( key >= 0x20 && key <= 0x10fff )
+ {
+ if ( cursor_pos == len )
+ {
+ text += wchar_t(key);
+ processChanged();
+ }
+ else if ( len > 0 )
+ {
+ if ( insert_mode )
+ text.insert(wchar_t(key), uInt(cursor_pos));
+ else
+ text.overwrite(wchar_t(key), uInt(cursor_pos));
+ processChanged();
+ }
+ else
+ {
+ text = wchar_t(key);
+ processChanged();
+ }
+ cursor_pos++;
+ if ( cursor_pos > width-2 )
+ offset++;
+ event->accept();
+ }
+ else
+ event->ignore();
+ }
+ // end of switch
+
+ if ( event->isAccepted()
+ && key != fc::Fkey_return
+ && key != fc::Fkey_enter )
+ {
+ drawInputField();
+ updateTerminal();
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onMouseDown (FMouseEvent* event)
+{
+ int mouse_x, mouse_y;
+
+ if ( event->getButton() != LeftButton )
+ return;
+
+ if ( ! hasFocus() )
+ {
+ FWidget* focused_widget = getFocusWidget();
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ this->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ this->redraw();
+ if ( statusBar() )
+ statusBar()->drawMessage();
+ }
+
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( mouse_x >= 2 && mouse_x <= width && mouse_y == 1 )
+ {
+ int len = int(text.getLength());
+ cursor_pos = offset + mouse_x - 2;
+ if ( cursor_pos >= len )
+ cursor_pos = len;
+ drawInputField();
+ updateTerminal();
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onMouseUp (FMouseEvent*)
+{
+ if ( dragScroll != FLineEdit::noScroll )
+ {
+ delAllTimer();
+ dragScroll = FLineEdit::noScroll;
+ scrollTimer = false;
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onMouseMove (FMouseEvent* event)
+{
+ int len, mouse_x, mouse_y;
+
+ if ( event->getButton() != LeftButton )
+ return;
+
+ len = int(text.getLength());
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( mouse_x >= 2 && mouse_x <= width && mouse_y == 1 )
+ {
+
+ cursor_pos = offset + mouse_x - 2;
+ if ( cursor_pos >= len )
+ cursor_pos=len;
+ drawInputField();
+ updateTerminal();
+ }
+
+ // auto-scrolling when dragging mouse outside the widget
+ if ( mouse_x < 2 )
+ {
+ // drag left
+ if ( ! scrollTimer && offset > 0 )
+ {
+ scrollTimer = true;
+ addTimer(scrollRepeat);
+ dragScroll = FLineEdit::scrollLeft;
+ }
+ if ( offset == 0 )
+ {
+ delAllTimer();
+ dragScroll = FLineEdit::noScroll;
+ }
+ }
+ else if ( mouse_x >= width )
+ {
+ // drag right
+ if ( ! scrollTimer && offset < len-width+2 )
+ {
+ scrollTimer = true;
+ addTimer(scrollRepeat);
+ dragScroll = FLineEdit::scrollRight;
+ }
+ if ( offset == len-width+2 )
+ {
+ delAllTimer();
+ dragScroll = FLineEdit::noScroll;
+ }
+ }
+ else
+ {
+ // no dragging
+ delAllTimer();
+ scrollTimer = false;
+ dragScroll = FLineEdit::noScroll;
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onTimer (FTimerEvent*)
+{
+ int len = int(text.getLength());
+
+ switch ( dragScroll )
+ {
+ case FLineEdit::noScroll:
+ return;
+
+ case FLineEdit::scrollLeft:
+
+ if ( offset == 0)
+ {
+ dragScroll = FLineEdit::noScroll;
+ return;
+ }
+ offset--;
+ if ( offset < 0 )
+ offset = 0;
+ cursor_pos--;
+ if ( cursor_pos < 0 )
+ cursor_pos = 0;
+ break;
+
+ case FLineEdit::scrollRight:
+ if ( offset == len-width+2 )
+ {
+ dragScroll = FLineEdit::noScroll;
+ return;
+ }
+ offset++;
+ if ( offset > len-width+2 )
+ offset = len-width+2;
+ cursor_pos++;
+ if ( cursor_pos > len )
+ cursor_pos = len;
+ }
+
+ drawInputField();
+ updateTerminal();
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onAccel (FAccelEvent* event)
+{
+ if ( isEnabled() )
+ {
+ if ( ! hasFocus() )
+ {
+ FWidget* focused_widget = static_cast(event->focusedWidget());
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ this->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ this->redraw();
+ if ( statusBar() )
+ {
+ statusBar()->drawMessage();
+ updateTerminal();
+ flush_out();
+ }
+ }
+ event->accept();
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onHide (FHideEvent*)
+{
+ if ( ! insert_mode )
+ {
+ setXTermCursorStyle(fc::blinking_underline);
+ setKDECursor(fc::UnderlineCursor);
+ setConsoleCursor(fc::underscore_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:ffff/ffff/ffff");
+ }
+ if ( hasFocus() )
+ hideCursor();
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onFocusIn (FFocusEvent*)
+{
+ if ( isCursorInside() )
+ showCursor();
+
+ if ( insert_mode )
+ {
+ setXTermCursorStyle(fc::blinking_underline);
+ setKDECursor(fc::UnderlineCursor);
+ setConsoleCursor(fc::underscore_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:ffff/ffff/ffff");
+ }
+ else
+ {
+ setXTermCursorStyle(fc::steady_block);
+ setKDECursor(fc::BlockCursor);
+ setConsoleCursor(fc::full_block_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:0000/0000/0000");
+ }
+ if ( statusBar() )
+ {
+ statusBar()->drawMessage();
+ updateTerminal();
+ flush_out();
+ }
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::onFocusOut (FFocusEvent*)
+{
+ if ( statusBar() )
+ {
+ statusBar()->clearMessage();
+ statusBar()->drawMessage();
+ }
+
+ if ( ! insert_mode )
+ {
+ setXTermCursorStyle(fc::blinking_underline);
+ setKDECursor(fc::UnderlineCursor);
+ setConsoleCursor(fc::underscore_cursor);
+ if ( isUrxvtTerminal() )
+ setXTermCursor("rgb:ffff/ffff/ffff");
+ }
+
+ hideCursor();
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::setText (FString txt)
+{
+ offset = 0;
+ cursor_pos = 0;
+ this->text = txt;
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::setLabelText (FString ltxt)
+{
+ label_text = ltxt;
+ label->setText(label_text);
+ adjustLabel();
+}
+
+//----------------------------------------------------------------------
+void FLineEdit::setLabelOrientation(label_o o)
+{
+ label_orientation = o;
+ adjustLabel();
+}
diff --git a/src/flineedit.h b/src/flineedit.h
new file mode 100644
index 00000000..9f07130d
--- /dev/null
+++ b/src/flineedit.h
@@ -0,0 +1,142 @@
+// flineedit.h
+// class FLineEdit
+
+#ifndef _FLINEEDIT_H
+#define _FLINEEDIT_H
+
+#include "fwidget.h"
+#include "flabel.h"
+
+//----------------------------------------------------------------------
+// class FLineEdit
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FLineEdit : public FWidget
+{
+ private:
+ FString text;
+ FString label_text;
+ FLabel* label;
+ enum drag_scroll
+ {
+ noScroll = 0,
+ scrollLeft = 1,
+ scrollRight = 2
+ };
+ int dragScroll;
+ bool scrollTimer;
+ int scrollRepeat;
+ bool insert_mode;
+ int cursor_pos;
+ int offset;
+
+ public:
+ enum label_o
+ {
+ label_above = 0,
+ label_left = 1
+ };
+ label_o label_orientation;
+
+ private:
+ FLineEdit (const FLineEdit&);
+ FLineEdit& operator = (const FLineEdit&);
+ void init();
+ bool hasHotkey();
+ void draw();
+ void drawInputField();
+ void processActivate();
+ void processChanged();
+
+ protected:
+ void adjustLabel();
+ void adjustSize();
+
+ public:
+ FLineEdit (FWidget* parent=0); // constructor
+ FLineEdit (const FString&, FWidget* parent=0); // constructor
+ virtual ~FLineEdit(); // destructor
+ const char* getClassName() const;
+
+ void hide();
+
+ bool setEnable(bool);
+ bool setEnable();
+ bool unsetEnable();
+ bool setDisable();
+ bool setFocus(bool);
+ bool setFocus();
+ bool unsetFocus();
+ bool setShadow(bool);
+ bool setShadow();
+ bool unsetShadow();
+ bool hasShadow();
+
+ void onKeyPress (FKeyEvent*);
+ void onMouseDown (FMouseEvent*);
+ void onMouseUp (FMouseEvent*);
+ void onMouseMove (FMouseEvent*);
+ void onTimer (FTimerEvent*);
+ void onAccel (FAccelEvent*);
+ void onHide (FHideEvent*);
+ void onFocusIn (FFocusEvent*);
+ void onFocusOut (FFocusEvent*);
+
+ void setText (FString);
+ FString getText() const;
+ void setLabelText (FString);
+ void setLabelOrientation(label_o);
+ int getLabelOrientation();
+};
+#pragma pack(pop)
+
+
+// FLineEdit inline functions
+//----------------------------------------------------------------------
+inline const char* FLineEdit::getClassName() const
+{ return "FLineEdit"; }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::setEnable()
+{ return setEnable(true); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::unsetEnable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::setDisable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::setFocus()
+{ return setFocus(true); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::unsetFocus()
+{ return setFocus(false); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::setShadow()
+{ return setShadow(true); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::unsetShadow()
+{ return setShadow(false); }
+
+//----------------------------------------------------------------------
+inline bool FLineEdit::hasShadow()
+{ return ((flags & SHADOW) != 0); }
+
+//----------------------------------------------------------------------
+inline FString FLineEdit::getText() const
+{ return this->text; }
+
+//----------------------------------------------------------------------
+inline int FLineEdit::getLabelOrientation()
+{ return int(label_orientation); }
+
+#endif // _FLINEEDIT_H
diff --git a/src/flistbox.cpp b/src/flistbox.cpp
new file mode 100644
index 00000000..7182c61e
--- /dev/null
+++ b/src/flistbox.cpp
@@ -0,0 +1,1572 @@
+// flistbox.cpp
+// class FListBoxItem
+// class FListBox
+
+#include "fapp.h"
+#include "flistbox.h"
+#include "fscrollbar.h"
+#include "fstatusbar.h"
+
+
+//----------------------------------------------------------------------
+// class FListBoxItem
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FListBoxItem::FListBoxItem()
+{
+ this->selected = false;
+ this->brackets = fc::NoBrackets;
+}
+
+//----------------------------------------------------------------------
+FListBoxItem::FListBoxItem (FString& txt)
+{
+ this->selected = false;
+ this->brackets = fc::NoBrackets;
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FListBoxItem::FListBoxItem (const std::string& txt)
+{
+ this->selected = false;
+ this->brackets = fc::NoBrackets;
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FListBoxItem::FListBoxItem (const char* txt)
+{
+ this->selected = false;
+ this->brackets = fc::NoBrackets;
+ setText(txt);
+}
+
+//----------------------------------------------------------------------
+FListBoxItem::~FListBoxItem()
+{
+}
+
+
+//----------------------------------------------------------------------
+// class FListBox
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FListBox::FListBox(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FListBox::~FListBox() // destructor
+{
+ delAllTimer();
+ delete VBar;
+ delete HBar;
+}
+
+
+// private methods of FListBox
+//----------------------------------------------------------------------
+void FListBox::init()
+{
+ multiSelect = false;
+ mouseSelect = false;
+ dragScroll = FListBox::noScroll;
+ scrollDistance = 1;
+ scrollTimer = false;
+ scrollRepeat = 100;
+ flags = 0;
+ current = 0;
+ last_current = -1;
+ xoffset = 0;
+ yoffset = 0;
+ last_yoffset = -1;
+ maxLineWidth = 0;
+ text = "";
+ nf_offset = isNewFont() ? 1 : 0;
+
+ if ( hasFocus() )
+ this->flags = FOCUS;
+ if ( isEnabled() )
+ this->flags |= ACTIVE;
+
+ foregroundColor = wc.dialog_fg;
+ backgroundColor = wc.dialog_bg;
+
+ VBar = new FScrollbar(fc::vertical, this);
+ VBar->setMinimum(0);
+ VBar->setValue(0);
+ VBar->hide();
+
+ HBar = new FScrollbar(fc::horizontal, this);
+ HBar->setMinimum(0);
+ HBar->setValue(0);
+ HBar->hide();
+
+ setGeometry (1, 1, 5, 4, false); // initialize geometry values
+
+ VBar->addCallback
+ (
+ "change-value",
+ this,
+ reinterpret_cast(&FListBox::cb_VBarChange),
+ null
+ );
+ HBar->addCallback
+ (
+ "change-value",
+ this,
+ reinterpret_cast(&FListBox::cb_HBarChange),
+ null
+ );
+}
+
+//----------------------------------------------------------------------
+void FListBox::draw()
+{
+ bool isFocus;
+
+ if ( current < 1 )
+ current = 1;
+
+ setUpdateVTerm(false);
+ setColor (foregroundColor, backgroundColor);
+ if ( isNewFont() )
+ width--;
+ drawBorder();
+ if ( isNewFont() )
+ {
+ width++;
+ if ( ! VBar->isVisible() )
+ {
+ setColor (foregroundColor, backgroundColor);
+ for (int y=ypos+ymin; y < ypos+ymin+height-2; y++)
+ {
+ gotoxy(xpos+xmin+width-2, y);
+ print (' '); // clear right side of the scrollbar
+ }
+ }
+ }
+ drawLabel();
+ setUpdateVTerm(true);
+
+ if ( VBar->isVisible() )
+ VBar->redraw();
+ if ( HBar->isVisible() )
+ HBar->redraw();
+
+ drawList();
+
+ isFocus = ((flags & FOCUS) != 0);
+
+ if ( isFocus && statusBar() )
+ {
+ FString msg = getStatusbarMessage();
+ FString curMsg = statusBar()->getMessage();
+ if ( curMsg != msg )
+ {
+ statusBar()->setMessage(msg);
+ statusBar()->drawMessage();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::drawLabel()
+{
+ FString txt;
+ uInt length;
+
+ if ( text.isNull() || text.isEmpty() )
+ return;
+
+ if ( Encoding == fc::VT100 )
+ unsetVT100altChar();
+
+ txt = " " + this->text + " ";
+ length = txt.getLength();
+ gotoxy (xpos+xmin, ypos+ymin-1);
+
+ if ( isEnabled() )
+ setColor(wc.label_emphasis_fg, wc.label_bg);
+ else
+ setColor(wc.label_inactive_fg, wc.label_inactive_bg);
+ if ( length <= uInt(width-2) )
+ print (txt);
+ else
+ {
+ print (text.left(uInt(width-4)));
+ setColor (wc.label_ellipsis_fg, wc.label_bg);
+ print("..");
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::drawList()
+{
+ FString element;
+ uInt start, end, inc_len;
+ bool isFocus;
+
+ if ( data.empty() || height < 4 || width < 5 )
+ return;
+
+ isFocus = ((flags & FOCUS) != 0);
+ start = 0;
+ end = uInt(height-2);
+ inc_len = inc_search.getLength();
+
+ if ( end > count() )
+ end = count();
+
+ if ( last_yoffset >= 0
+ && last_yoffset == yoffset
+ && last_current != current )
+ {
+ // speed up: redraw only the changed rows
+ uInt last_pos = uInt(current)-uInt(yoffset)-1;
+ uInt current_pos = uInt(last_current)-uInt(yoffset)-1;
+ start = std::min(last_pos, current_pos);
+ end = std::max(last_pos, current_pos)+1;
+ }
+
+ setUpdateVTerm(false);
+ for (uInt y=start; y < end; y++)
+ {
+ gotoxy (xpos+xmin, ypos+ymin+int(y));
+ bool serach_mark = false;
+ bool lineHasBrackets = hasBrackets(int(y)+yoffset+1);
+ bool isLineSelected = isSelected(int(y)+yoffset+1);
+
+ if ( isLineSelected )
+ {
+ if ( isMonochron() )
+ setBold();
+ else
+ setColor (wc.selected_list_fg, wc.selected_list_bg);
+ }
+ else
+ {
+ if ( isMonochron() )
+ unsetBold();
+ else
+ setColor (wc.list_fg, wc.list_bg);
+ }
+
+ if ( uInt(y)+uInt(yoffset)+1 == uInt(current) )
+ {
+ if ( isLineSelected )
+ {
+ if ( isMonochron() )
+ setBold();
+ else
+ setColor ( wc.selected_current_element_fg,
+ wc.selected_current_element_bg );
+ }
+ else
+ {
+ if ( isMonochron() )
+ unsetBold();
+ else if ( isFocus )
+ {
+ setColor ( wc.current_element_focus_fg,
+ wc.current_element_focus_bg );
+ if ( inc_len > 0 )
+ {
+ serach_mark = true;
+ int b = ( lineHasBrackets ) ? 1: 0;
+ setCursorPos ( xpos+xmin+int(inc_len)+b,
+ ypos+ymin+int(y) ); // last found character
+ }
+ else
+ setCursorPos ( xpos+xmin+1,
+ ypos+ymin+int(y) ); // first character
+ }
+ else
+ setColor ( wc.current_element_fg,
+ wc.current_element_bg );
+ }
+ if ( isMonochron() )
+ setReverse(true);
+ }
+ else if ( isMonochron() )
+ setReverse(false);
+
+ // print the entry
+ print (' ');
+ if ( lineHasBrackets )
+ {
+ const wchar_t* element_str;
+ int full_length;
+ uInt len;
+ uInt i = 0;
+ uInt b = 0;
+
+ if ( xoffset == 0 )
+ {
+ b=1;
+ switch ( data[y+uInt(yoffset)].brackets )
+ {
+ case fc::NoBrackets:
+ break;
+ case fc::SquareBrackets:
+ print ('[');
+ break;
+ case fc::Parenthesis:
+ print ('(');
+ break;
+ case fc::CurlyBrackets:
+ print ('{');
+ break;
+ case fc::AngleBrackets:
+ print ('<');
+ break;
+ }
+ element = data[y+uInt(yoffset)].getText()
+ .mid ( uInt(1+xoffset),
+ uInt(width-nf_offset-5) );
+ }
+ else
+ element = data[y+uInt(yoffset)].getText()
+ .mid( uInt(xoffset),
+ uInt(width-nf_offset-4) );
+ element_str = element.wc_str();
+ len = element.getLength();
+
+ for (; i < len; i++)
+ {
+ if ( serach_mark && i == 0 )
+ setColor ( wc.current_inc_search_element_fg,
+ wc.current_element_focus_bg );
+ if ( serach_mark && i == inc_len )
+ setColor ( wc.current_element_focus_fg,
+ wc.current_element_focus_bg );
+ print (element_str[i]);
+ }
+ full_length = int(data[y+uInt(yoffset)].getText().getLength());
+ if ( b+i < uInt(width-nf_offset-4) && xoffset <= full_length+1 )
+ {
+ if ( serach_mark && i == inc_len )
+ setColor ( wc.current_element_focus_fg,
+ wc.current_element_focus_bg );
+ switch ( data[y+uInt(yoffset)].brackets )
+ {
+ case fc::NoBrackets:
+ break;
+ case fc::SquareBrackets:
+ print (']');
+ break;
+ case fc::Parenthesis:
+ print (')');
+ break;
+ case fc::CurlyBrackets:
+ print ('}');
+ break;
+ case fc::AngleBrackets:
+ print ('>');
+ break;
+ }
+ i++;
+ }
+ for (; b+i < uInt(width-nf_offset-3); i++)
+ print (' ');
+ }
+ else // line has no brackets
+ {
+ const wchar_t* element_str;
+ uInt i, len;
+ element = data[y+uInt(yoffset)].getText()
+ .mid( uInt(1+xoffset),
+ uInt(width-nf_offset-4) );
+ element_str = element.wc_str();
+ len = element.getLength();
+
+ if ( serach_mark )
+ setColor ( wc.current_inc_search_element_fg,
+ wc.current_element_focus_bg );
+ for (i=0; i < len; i++)
+ {
+ if ( serach_mark && i == inc_len )
+ setColor ( wc.current_element_focus_fg,
+ wc.current_element_focus_bg );
+
+ print (element_str[i]);
+ }
+ for (; i < uInt(width-nf_offset-3); i++)
+ print (' ');
+ }
+ }
+
+ if ( isMonochron() ) // unset for the last element
+ setReverse(false);
+
+ unsetBold();
+ setUpdateVTerm(true);
+ updateTerminal();
+ flush_out();
+
+ if ( hasFocus() )
+ setCursor();
+
+ last_yoffset = yoffset;
+ last_current = current;
+}
+
+//----------------------------------------------------------------------
+void FListBox::processClick()
+{
+ emitCallback("clicked");
+}
+
+//----------------------------------------------------------------------
+void FListBox::processSelect()
+{
+ emitCallback("row-selected");
+}
+
+//----------------------------------------------------------------------
+void FListBox::processChanged()
+{
+ emitCallback("row-changed");
+}
+
+// protected methods of FListBox
+//----------------------------------------------------------------------
+void FListBox::adjustYOffset()
+{
+ int element_count = int(count());
+ if ( yoffset > element_count - height + 2 )
+ yoffset = element_count - height + 2;
+ if ( yoffset < 0 )
+ yoffset = 0;
+ if ( current < yoffset )
+ current = yoffset;
+ if ( current > yoffset+height-2 )
+ yoffset = current - height + 2;
+}
+
+//----------------------------------------------------------------------
+void FListBox::adjustSize()
+{
+ int element_count;
+ adjustYOffset();
+
+ FWidget::adjustSize();
+
+ element_count = int(count());
+ VBar->setMaximum(element_count-height+2);
+ VBar->setPageSize(element_count, height-2);
+ VBar->setX(width);
+ VBar->setHeight (height-2, false);
+ VBar->resize();
+
+ HBar->setMaximum(maxLineWidth-width+nf_offset+4);
+ HBar->setPageSize(maxLineWidth, width-nf_offset-4);
+ HBar->setY(height);
+ HBar->setWidth (width-2, false);
+ HBar->resize();
+
+ if ( element_count <= height-2 )
+ VBar->hide();
+ else
+ VBar->setVisible();
+
+ if ( maxLineWidth <= width-nf_offset-4 )
+ HBar->hide();
+ else
+ HBar->setVisible();
+}
+
+// public methods of FListBox
+//----------------------------------------------------------------------
+void FListBox::setCurrentItem(int index)
+{
+ int element_count;
+ if ( index == current )
+ return;
+
+ element_count = int(count());
+ if ( index > element_count )
+ current = element_count;
+ else if ( index < 1 )
+ current = 1;
+ else
+ current = index;
+ xoffset = 0;
+ yoffset = 0;
+ adjustSize();
+
+ VBar->setValue(yoffset);
+ if ( isVisible() )
+ redraw();
+}
+
+//----------------------------------------------------------------------
+void FListBox::hide()
+{
+ int fg, bg, n, size;
+ char* blank;
+
+ FWidget::hide();
+
+ fg = parentWidget()->getForegroundColor();
+ bg = parentWidget()->getBackgroundColor();
+ setColor (fg, bg);
+
+ n = isNewFont() ? 1 : 0;
+ size = width + n;
+ blank = new char[size+1];
+ memset(blank, ' ', uLong(size));
+ blank[size] = '\0';
+ for (int y=0; y < height; y++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+y);
+ print (blank);
+ }
+ delete[] blank;
+}
+
+//----------------------------------------------------------------------
+void FListBox::showInsideBrackets ( int index,
+ fc::brackets_type b )
+{
+ data[uInt(index-1)].brackets = b;
+
+ if ( b != fc::NoBrackets )
+ {
+ int len = int(data[uInt(index-1)].getText().getLength() + 2);
+
+ if ( len > maxLineWidth )
+ {
+ maxLineWidth = len;
+ if ( len > width-nf_offset-4 )
+ {
+ HBar->setMaximum(maxLineWidth-width+nf_offset+4);
+ HBar->setPageSize(maxLineWidth, width-nf_offset-4);
+ HBar->setValue (xoffset);
+ if ( ! HBar->isVisible() )
+ HBar->setVisible();
+ }
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::setGeometry (int x, int y, int w, int h, bool adjust)
+{
+ FWidget::setGeometry(x, y, w, h, adjust);
+ if ( isNewFont() )
+ {
+ VBar->setGeometry(width, 2, 2, height-2);
+ HBar->setGeometry(1, height, width-2, 1);
+ }
+ else
+ {
+ VBar->setGeometry(width, 2, 1, height-2);
+ HBar->setGeometry(2, height, width-2, 1);
+ }
+}
+
+//----------------------------------------------------------------------
+bool FListBox::setEnable (bool on)
+{
+ FWidget::setEnable(on);
+
+ if ( on )
+ this->flags |= ACTIVE;
+ else
+ this->flags &= ~ACTIVE;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FListBox::setFocus (bool on)
+{
+ FWidget::setFocus(on);
+
+ if ( on )
+ {
+ this->flags |= FOCUS;
+
+ if ( statusBar() )
+ {
+ FString msg = getStatusbarMessage();
+ FString curMsg = statusBar()->getMessage();
+ if ( curMsg != msg )
+ statusBar()->setMessage(msg);
+ }
+ }
+ else
+ {
+ this->flags &= ~FOCUS;
+
+ if ( statusBar() )
+ statusBar()->clearMessage();
+ }
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FListBox::setShadow (bool on)
+{
+ if ( on )
+ this->flags |= SHADOW;
+ else
+ this->flags &= ~SHADOW;
+ return on;
+}
+
+//----------------------------------------------------------------------
+void FListBox::onKeyPress (FKeyEvent* event)
+{
+ int element_count = int(count());
+ int current_before = current;
+ int xoffset_before = xoffset;
+ int yoffset_before = yoffset;
+ int key = event->key();
+
+ switch ( key )
+ {
+ case fc::Fkey_return:
+ case fc::Fkey_enter:
+ processClick();
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_up:
+ current--;
+ if ( current < 1 )
+ current=1;
+ if ( current <= yoffset )
+ yoffset--;
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_down:
+ current++;
+ if ( current > element_count )
+ current = element_count;
+ if ( current-yoffset > height - 2 )
+ yoffset++;
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_left:
+ xoffset--;
+ if ( xoffset < 0 )
+ xoffset = 0;
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_right:
+ xoffset++;
+ if ( xoffset > maxLineWidth-width+nf_offset+4 )
+ xoffset = maxLineWidth-width+nf_offset+4;
+ if ( xoffset < 0 )
+ xoffset = 0;
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_ppage:
+ current -= height-3;
+ if ( current < 1 )
+ current=1;
+ if ( current <= yoffset )
+ {
+ yoffset -= height-3;
+ if ( yoffset < 0 )
+ yoffset=0;
+ }
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_npage:
+ current += height-3;
+ if ( current > element_count )
+ current = element_count;
+ if ( current-yoffset > height-2 )
+ {
+ yoffset += height-3;
+ if ( yoffset > element_count - height + 2 )
+ yoffset = element_count - height + 2;
+ }
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_home:
+ current = 1;
+ yoffset = 0;
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_end:
+ current = element_count;
+ if ( current > height - 2 )
+ yoffset = element_count - height + 2;
+ inc_search.clear();
+ event->accept();
+ break;
+
+ case fc::Fkey_ic: // insert key
+ if ( isMultiSelection() )
+ {
+ if ( isSelected(current) )
+ unselectItem(current);
+ else
+ selectItem(current);
+ processSelect();
+ current++;
+ if ( current > element_count )
+ current = element_count;
+ if ( current-yoffset > height - 2 )
+ yoffset++;
+ event->accept();
+ }
+ inc_search.clear();
+ break;
+
+ case fc::Fkey_space:
+ {
+ uInt inc_len = inc_search.getLength();
+ if ( inc_len > 0 )
+ {
+ inc_search += L' ';
+ bool inc_found = false;
+ uInt end = count();
+ for (uInt i=0; i < end; i++)
+ {
+ if ( ! inc_found
+ && inc_search.toLower()
+ == data[i].getText().left(inc_len+1).toLower() )
+ {
+ setCurrentItem(int(i+1));
+ inc_found = true;
+ break;
+ }
+ }
+ if ( ! inc_found )
+ {
+ inc_search.remove(inc_len, 1);
+ event->ignore();
+ }
+ else
+ event->accept();
+ }
+ else if ( isMultiSelection() )
+ {
+ if ( isSelected(current) )
+ unselectItem(current);
+ else
+ selectItem(current);
+ processSelect();
+ inc_search.clear();
+ event->accept();
+ }
+ }
+ break;
+
+ case fc::Fkey_erase:
+ case fc::Fkey_backspace:
+ {
+ uInt inc_len = inc_search.getLength();
+ if ( inc_len > 0 )
+ {
+ inc_search.remove(inc_len-1, 1);
+
+ if ( inc_len > 1 )
+ {
+ uInt end = count();
+ for (uInt i=0; i < end; i++)
+ {
+ if ( inc_search.toLower()
+ == data[i].getText().left(inc_len-1).toLower() )
+ {
+ setCurrentItem(int(i+1));
+ break;
+ }
+ }
+ }
+ event->accept();
+ }
+ else
+ event->ignore();
+ }
+ break;
+
+ case fc::Fkey_escape:
+ case fc::Fkey_escape_mintty:
+ if ( inc_search.getLength() > 0 )
+ {
+ inc_search.clear();
+ event->accept();
+ }
+ break;
+
+ default:
+ if ( key > 0x20 && key <= 0x10fff )
+ {
+ // incremental search
+ if ( inc_search.getLength() == 0 )
+ inc_search = wchar_t(key);
+ else
+ inc_search += wchar_t(key);
+ uInt inc_len = inc_search.getLength();
+ bool inc_found = false;
+ uInt end = count();
+ for (uInt i=0; i < end; i++)
+ {
+ if ( ! inc_found
+ && inc_search.toLower()
+ == data[i].getText().left(inc_len).toLower() )
+ {
+ setCurrentItem(int(i+1));
+ inc_found = true;
+ break;
+ }
+ }
+ if ( ! inc_found )
+ {
+ inc_search.remove(inc_len-1, 1);
+ if ( inc_len == 1 )
+ event->ignore();
+ else
+ event->accept();
+ }
+ else
+ event->accept();
+ }
+ else
+ event->ignore();
+ }
+
+ if ( current_before != current )
+ {
+ processChanged();
+ if ( ! isMultiSelection() )
+ processSelect();
+ }
+
+ if ( event->isAccepted() )
+ {
+ if ( isVisible() )
+ drawList();
+ VBar->setValue (yoffset);
+ if ( VBar->isVisible() && yoffset_before != yoffset )
+ VBar->drawBar();
+ HBar->setValue (xoffset);
+ if ( HBar->isVisible() && xoffset_before != xoffset )
+ HBar->drawBar();
+
+ updateTerminal();
+ flush_out();
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::onMouseDown (FMouseEvent* event)
+{
+ int yoffset_before, mouse_x, mouse_y;
+
+ if ( event->getButton() != LeftButton
+ && event->getButton() != RightButton )
+ {
+ return;
+ }
+ if ( event->getButton() == RightButton && ! isMultiSelection() )
+ return;
+
+ if ( ! hasFocus() )
+ {
+ FWidget* focused_widget = getFocusWidget();
+ FFocusEvent out (FocusOut_Event);
+ FApplication::queueEvent(focused_widget, &out);
+ this->setFocus();
+ if ( focused_widget )
+ focused_widget->redraw();
+ if ( statusBar() )
+ statusBar()->drawMessage();
+ }
+
+ yoffset_before = yoffset;
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+ if ( mouse_x >= 2 && mouse_x <= width-1
+ && mouse_y >= 2 && mouse_y <= height-1 )
+ {
+ current = yoffset + mouse_y - 1;
+ if ( current > int(count()) )
+ current = int(count());
+ inc_search.clear();
+ if ( event->getButton() == RightButton )
+ {
+ if ( isMultiSelection() )
+ {
+ if ( isSelected(current) )
+ {
+ mouseSelect = false;
+ unselectItem(current);
+ }
+ else
+ {
+ mouseSelect = true;
+ selectItem(current);
+ }
+ processSelect();
+ secect_from_item = current;
+ }
+ }
+ if ( isVisible() )
+ drawList();
+
+ VBar->setValue (yoffset);
+ if ( VBar->isVisible() && yoffset_before != yoffset )
+ VBar->drawBar();
+ updateTerminal();
+ flush_out();
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::onMouseUp (FMouseEvent* event)
+{
+ if ( dragScroll != FListBox::noScroll )
+ {
+ delAllTimer();
+ dragScroll = FListBox::noScroll;
+ scrollDistance = 1;
+ scrollTimer = false;
+ }
+
+ if ( event->getButton() == LeftButton )
+ {
+ int mouse_x = event->getX();
+ int mouse_y = event->getY();
+ if ( mouse_x >= 2 && mouse_x <= width-1
+ && mouse_y >= 2 && mouse_y <= height-1 )
+ {
+ processChanged();
+ if ( ! isMultiSelection() )
+ processSelect();
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::onMouseMove (FMouseEvent* event)
+{
+ int current_before, yoffset_before, mouse_x, mouse_y;
+
+ if ( event->getButton() != LeftButton
+ && event->getButton() != RightButton )
+ {
+ return;
+ }
+ if ( event->getButton() == RightButton && ! isMultiSelection() )
+ return;
+
+ current_before = current;
+ yoffset_before = yoffset;
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( mouse_x >= 2 && mouse_x <= width-1
+ && mouse_y >= 2 && mouse_y <= height-1 )
+ {
+ current = yoffset + mouse_y - 1;
+ if ( current > int(count()) )
+ current = int(count());
+ inc_search.clear();
+
+ // handle multiple selections
+ if ( event->getButton() == RightButton
+ && isMultiSelection()
+ && current_before != current )
+ {
+ int from, to;
+
+ if ( secect_from_item > current )
+ {
+ from = current;
+ to = secect_from_item - 1;
+ }
+ else
+ {
+ from = secect_from_item + 1;
+ to = current;
+ }
+ for (int i=from; i <= to; i++)
+ {
+ if ( mouseSelect )
+ {
+ selectItem(i);
+ processSelect();
+ }
+ else
+ {
+ unselectItem(i);
+ processSelect();
+ }
+ }
+ secect_from_item = current;
+ }
+
+ if ( isVisible() )
+ drawList();
+ VBar->setValue (yoffset);
+ if ( VBar->isVisible() && yoffset_before != yoffset )
+ VBar->drawBar();
+ updateTerminal();
+ flush_out();
+ }
+
+ // auto-scrolling when dragging mouse outside the widget
+ if ( mouse_y < 2 )
+ {
+ // drag up
+ if ( dragScroll != FListBox::noScroll && scrollDistance < height-2 )
+ scrollDistance++;
+ if ( ! scrollTimer && current > 1 )
+ {
+ scrollTimer = true;
+ addTimer(scrollRepeat);
+ if ( event->getButton() == RightButton )
+ dragScroll = FListBox::scrollUpSelect;
+ else
+ dragScroll = FListBox::scrollUp;
+ }
+ if ( current == 1 )
+ {
+ delAllTimer();
+ dragScroll = FListBox::noScroll;
+ }
+ }
+ else if ( mouse_y >= height )
+ {
+ // drag down
+ if ( dragScroll != FListBox::noScroll && scrollDistance < height-2 )
+ scrollDistance++;
+ if ( ! scrollTimer && current < int(count()) )
+ {
+ scrollTimer = true;
+ addTimer(scrollRepeat);
+ if ( event->getButton() == RightButton )
+ dragScroll = FListBox::scrollDownSelect;
+ else
+ dragScroll = FListBox::scrollDown;
+ }
+ if ( current == int(count()) )
+ {
+ delAllTimer();
+ dragScroll = FListBox::noScroll;
+ }
+ }
+ else
+ {
+ // no dragging
+ delAllTimer();
+ scrollTimer = false;
+ scrollDistance = 1;
+ dragScroll = FListBox::noScroll;
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::onMouseDoubleClick (FMouseEvent* event)
+{
+ int mouse_x, mouse_y;
+
+ if ( event->getButton() != LeftButton )
+ return;
+
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( mouse_x >= 2 && mouse_x <= width-1
+ && mouse_y >= 2 && mouse_y <= height-1 )
+ {
+ if ( yoffset + mouse_y - 1 > int(count()) )
+ return;
+ processClick();
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::onTimer (FTimerEvent*)
+{
+ int element_count = int(count());
+ int current_before = current;
+ int yoffset_before = yoffset;
+
+ switch ( dragScroll )
+ {
+ case FListBox::noScroll:
+ return;
+
+ case FListBox::scrollUp:
+ case FListBox::scrollUpSelect:
+ if ( current_before == 1)
+ {
+ dragScroll = FListBox::noScroll;
+ return;
+ }
+ current -= scrollDistance;
+ if ( current < 1 )
+ current=1;
+ if ( current <= yoffset )
+ yoffset -= scrollDistance;
+ if ( yoffset < 0 )
+ yoffset=0;
+ break;
+
+ case FListBox::scrollDown:
+ case FListBox::scrollDownSelect:
+ if ( current_before == element_count )
+ {
+ dragScroll = FListBox::noScroll;
+ return;
+ }
+ current += scrollDistance;
+ if ( current > element_count )
+ current = element_count;
+ if ( current-yoffset > height - 2 )
+ yoffset += scrollDistance;
+ if ( yoffset > element_count - height + 2 )
+ yoffset = element_count - height + 2;
+ }
+
+ // handle multiple selections
+ if ( dragScroll == FListBox::scrollUpSelect
+ || dragScroll == FListBox::scrollDownSelect )
+ {
+ if ( isMultiSelection() && current_before != current )
+ {
+ int from, to;
+
+ if ( secect_from_item > current )
+ {
+ from = current;
+ to = secect_from_item - 1;
+ }
+ else
+ {
+ from = secect_from_item + 1;
+ to = current;
+ }
+ for (int i=from; i <= to; i++)
+ {
+ if ( mouseSelect )
+ {
+ selectItem(i);
+ processSelect();
+ }
+ else
+ {
+ unselectItem(i);
+ processSelect();
+ }
+ }
+ secect_from_item = current;
+ }
+ }
+
+ if ( isVisible() )
+ drawList();
+ VBar->setValue (yoffset);
+ if ( VBar->isVisible() && yoffset_before != yoffset )
+ VBar->drawBar();
+ updateTerminal();
+ flush_out();
+}
+
+//----------------------------------------------------------------------
+void FListBox::onWheel (FWheelEvent* event)
+{
+ int element_count, current_before, yoffset_before, yoffset_end, wheel;
+
+ element_count = int(count());
+ current_before = current;
+ yoffset_before = yoffset;
+ yoffset_end = element_count - height + 2;
+
+ if ( yoffset_end < 0 )
+ yoffset_end = 0;
+
+ wheel = event->getWheel();
+
+ if ( dragScroll != FListBox::noScroll )
+ {
+ delAllTimer();
+ scrollTimer = false;
+ scrollDistance = 1;
+ dragScroll = FListBox::noScroll;
+ }
+
+ switch ( wheel )
+ {
+ case WheelUp:
+ if ( yoffset == 0 )
+ break;
+ yoffset -= 4;
+ if ( yoffset < 0 )
+ {
+ current -= 4+yoffset;
+ yoffset=0;
+ }
+ else
+ current -= 4;
+ if ( current < 1 )
+ current=1;
+ inc_search.clear();
+ break;
+
+ case WheelDown:
+ if ( yoffset == yoffset_end )
+ break;
+ yoffset += 4;
+ if ( yoffset > yoffset_end )
+ {
+ current += 4 - (yoffset-yoffset_end);
+ yoffset = yoffset_end;
+ }
+ else
+ current += 4;
+ if ( current > element_count )
+ current = element_count;
+ inc_search.clear();
+ break;
+ }
+
+ if ( current_before != current )
+ {
+ processChanged();
+ if ( ! isMultiSelection() )
+ processSelect();
+ }
+
+ if ( isVisible() )
+ drawList();
+
+ VBar->setValue (yoffset);
+ if ( VBar->isVisible() && yoffset_before != yoffset )
+ VBar->drawBar();
+ updateTerminal();
+ flush_out();
+}
+
+//----------------------------------------------------------------------
+void FListBox::onFocusIn (FFocusEvent*)
+{
+ if ( statusBar() )
+ statusBar()->drawMessage();
+ inc_search.clear();
+}
+
+//----------------------------------------------------------------------
+void FListBox::onFocusOut (FFocusEvent*)
+{
+ if ( statusBar() )
+ {
+ statusBar()->clearMessage();
+ statusBar()->drawMessage();
+ }
+ delAllTimer();
+ inc_search.clear();
+}
+
+//----------------------------------------------------------------------
+void FListBox::cb_VBarChange (FWidget*, void*)
+{
+ int distance = 1;
+ int element_count = int(count());
+ int yoffset_before = yoffset;
+ int scrollType = VBar->getScrollType();
+
+ switch ( scrollType )
+ {
+ case FScrollbar::scrollPageBackward:
+ distance = height-2;
+ case FScrollbar::scrollStepBackward:
+ current -= distance;
+ if ( current < 1 )
+ current=1;
+ if ( current <= yoffset )
+ yoffset -= distance;
+ if ( yoffset < 0 )
+ yoffset = 0;
+ break;
+
+ case FScrollbar::scrollPageForward:
+ distance = height-2;
+ case FScrollbar::scrollStepForward:
+ current += distance;
+ if ( current > element_count )
+ current = element_count;
+ if ( current-yoffset > height - 2 )
+ yoffset += distance;
+ if ( yoffset > element_count - height + 2 )
+ yoffset = element_count - height + 2;
+ break;
+
+ case FScrollbar::scrollJump:
+ {
+ int val = VBar->getValue();
+ if ( yoffset == val )
+ break;
+ int c = current - yoffset;
+ yoffset = val;
+ if ( yoffset > element_count - height + 2 )
+ yoffset = element_count - height + 2;
+ if ( yoffset < 0 )
+ yoffset = 0;
+ current = yoffset + c;
+ if ( current < yoffset )
+ current = yoffset;
+ if ( current > element_count )
+ current = element_count;
+ break;
+ }
+
+ case FScrollbar::scrollWheelUp:
+ {
+ FWheelEvent wheel_ev (MouseWheel_Event, FPoint(2,2), WheelUp);
+ onWheel(&wheel_ev);
+ break;
+ }
+
+ case FScrollbar::scrollWheelDown:
+ {
+ FWheelEvent wheel_ev (MouseWheel_Event, FPoint(2,2), WheelDown);
+ onWheel(&wheel_ev);
+ break;
+ }
+ }
+
+ if ( isVisible() )
+ drawList();
+
+ if ( scrollType >= FScrollbar::scrollStepBackward
+ && scrollType <= FScrollbar::scrollPageForward )
+ {
+ VBar->setValue (yoffset);
+ if ( VBar->isVisible() && yoffset_before != yoffset )
+ VBar->drawBar();
+ updateTerminal();
+ flush_out();
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::cb_HBarChange (FWidget*, void*)
+{
+ int distance = 1;
+ int xoffset_before = xoffset;
+ int xoffset_end = maxLineWidth-width+nf_offset+4;
+ int scrollType = HBar->getScrollType();
+
+ switch ( scrollType )
+ {
+ case FScrollbar::scrollPageBackward:
+ distance = width-nf_offset-4;
+ case FScrollbar::scrollStepBackward:
+ xoffset -= distance;
+ if ( xoffset < 0 )
+ xoffset = 0;
+ break;
+
+ case FScrollbar::scrollPageForward:
+ distance = width-nf_offset-4;
+ case FScrollbar::scrollStepForward:
+ xoffset += distance;
+ if ( xoffset > maxLineWidth-width+nf_offset+4 )
+ xoffset = maxLineWidth-width+nf_offset+4;
+ if ( xoffset < 0 )
+ xoffset = 0;
+ break;
+
+ case FScrollbar::scrollJump:
+ {
+ int val = HBar->getValue();
+ if ( xoffset == val )
+ break;
+ xoffset = val;
+ if ( xoffset > maxLineWidth-width+nf_offset+4 )
+ xoffset = maxLineWidth-width+nf_offset+4;
+ if ( xoffset < 0 )
+ xoffset = 0;
+ break;
+ }
+
+ case FScrollbar::scrollWheelUp:
+ if ( xoffset == 0 )
+ break;
+ xoffset -= 4;
+ if ( xoffset < 0 )
+ xoffset=0;
+ break;
+
+ case FScrollbar::scrollWheelDown:
+ if ( xoffset == xoffset_end )
+ break;
+ xoffset += 4;
+ if ( xoffset > xoffset_end )
+ xoffset = xoffset_end;
+ break;
+ }
+
+ if ( isVisible() )
+ {
+ drawList();
+ updateTerminal();
+ flush_out();
+ }
+
+ if ( scrollType >= FScrollbar::scrollStepBackward
+ && scrollType <= FScrollbar::scrollWheelDown )
+ {
+ HBar->setValue (xoffset);
+ if ( HBar->isVisible() && xoffset_before != xoffset )
+ HBar->drawBar();
+ updateTerminal();
+ flush_out();
+ }
+}
+
+//----------------------------------------------------------------------
+void FListBox::insert ( FString item,
+ fc::brackets_type b,
+ bool s )
+{
+ int len, element_count;
+
+ len = int(item.getLength());
+ if ( b )
+ len += 2;
+
+ if ( len > maxLineWidth )
+ {
+ maxLineWidth = len;
+ if ( len > width-nf_offset-4 )
+ {
+ HBar->setMaximum(maxLineWidth-width+nf_offset+4);
+ HBar->setPageSize(maxLineWidth, width-nf_offset-4);
+ HBar->calculateSliderValues();
+ if ( ! HBar->isVisible() )
+ HBar->setVisible();
+ }
+ }
+ FListBoxItem listItem (item);
+ listItem.brackets = b;
+ listItem.selected = s;
+ data.push_back ( listItem );
+
+ element_count = int(count());
+ VBar->setMaximum(element_count-height+2);
+ VBar->setPageSize(element_count, height-2);
+ VBar->calculateSliderValues();
+ if ( ! VBar->isVisible() && element_count > height-2 )
+ VBar->setVisible();
+}
+
+//----------------------------------------------------------------------
+void FListBox::insert ( long item,
+ fc::brackets_type b,
+ bool s )
+{
+ insert (FString().setNumber(item), b, s);
+}
+
+//----------------------------------------------------------------------
+void FListBox::remove (int item)
+{
+ int element_count;
+
+ if ( int(count()) < item )
+ return;
+
+ data.erase (data.begin()+item-1);
+
+ element_count = int(count());
+ maxLineWidth = 0;
+
+ for (int i=0; i < element_count; i++)
+ {
+ int len = int(data[uInt(i)].getText().getLength());
+ if ( len > maxLineWidth )
+ maxLineWidth = len;
+ }
+ HBar->setMaximum(maxLineWidth-width+nf_offset+4);
+ HBar->setPageSize(maxLineWidth, width-nf_offset-4);
+ if ( HBar->isVisible() && maxLineWidth <= width-nf_offset-4 )
+ HBar->hide();
+
+ VBar->setMaximum(element_count-height+2);
+ VBar->setPageSize(element_count, height-2);
+ if ( VBar->isVisible() && element_count <= height-2 )
+ VBar->hide();
+
+ if ( current >= item && current > 1 )
+ current--;
+ if ( current > element_count )
+ current = element_count;
+ if ( yoffset > element_count - height + 2 )
+ yoffset = element_count - height + 2;
+ if ( yoffset < 0 )
+ yoffset = 0;
+}
+
+//----------------------------------------------------------------------
+void FListBox::clear()
+{
+ int size;
+ char* blank;
+
+ data.clear();
+
+ current = 0;
+ xoffset = 0;
+ yoffset = 0;
+ maxLineWidth = 0;
+ last_current = -1;
+ last_yoffset = -1;
+
+ VBar->setMinimum(0);
+ VBar->setValue(0);
+ VBar->hide();
+
+ HBar->setMinimum(0);
+ HBar->setValue(0);
+ HBar->hide();
+
+ // clear list from screen
+ setColor (wc.list_fg, wc.list_bg);
+ size = width - 2;
+ blank = new char[size+1];
+ memset(blank, ' ', uLong(size));
+ blank[size] = '\0';
+
+ for (int y=0; y < height-2; y++)
+ {
+ gotoxy (xpos+xmin, ypos+ymin+y);
+ print (blank);
+ }
+ delete[] blank;
+}
+
+//----------------------------------------------------------------------
+void FListBox::setText (FString txt)
+{
+ this->text = txt;
+}
diff --git a/src/flistbox.h b/src/flistbox.h
new file mode 100644
index 00000000..16e6209d
--- /dev/null
+++ b/src/flistbox.h
@@ -0,0 +1,264 @@
+// flistbox.h
+// class FListBoxItem
+// class FListBox
+
+#ifndef _FLISTBOX_H
+#define _FLISTBOX_H
+
+#include "fscrollbar.h"
+#include "fstring.h"
+#include "fwidget.h"
+
+
+//----------------------------------------------------------------------
+// class FListBoxItem
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FListBoxItem
+{
+ private:
+ FString text;
+ fc::brackets_type brackets;
+ bool selected;
+ public:
+ FListBoxItem ();
+ FListBoxItem (FString&);
+ FListBoxItem (const std::string&);
+ FListBoxItem (const char*);
+ virtual ~FListBoxItem();
+ virtual FString getText() const;
+ protected:
+ void setText (FString&);
+ void setText (const std::string&);
+ void setText (const char*);
+ private:
+ friend class FListBox;
+};
+#pragma pack(pop)
+
+// FListBoxItem inline functions
+//----------------------------------------------------------------------
+inline FString FListBoxItem::getText() const
+{ return this->text; }
+
+//----------------------------------------------------------------------
+inline void FListBoxItem::setText (FString& txt)
+{ this->text = txt; }
+
+//----------------------------------------------------------------------
+inline void FListBoxItem::setText (const std::string& txt)
+{ this->text = txt; }
+
+//----------------------------------------------------------------------
+inline void FListBoxItem::setText (const char* txt)
+{ this->text = txt; }
+
+
+//----------------------------------------------------------------------
+// class FListBox
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FListBox : public FWidget
+{
+ private:
+ std::vector data;
+ FScrollbar* VBar;
+ FScrollbar* HBar;
+ FString text;
+ FString inc_search;
+ bool multiSelect;
+ bool mouseSelect;
+ enum drag_scroll
+ {
+ noScroll = 0,
+ scrollUp = 1,
+ scrollDown = 2,
+ scrollUpSelect = 3,
+ scrollDownSelect = 4
+ };
+ int dragScroll;
+ bool scrollTimer;
+ int scrollRepeat;
+ int scrollDistance;
+ int current;
+ int last_current;
+ int secect_from_item;
+ int xoffset;
+ int yoffset;
+ int last_yoffset;
+ int nf_offset;
+ int maxLineWidth;
+
+ private:
+ FListBox (const FListBox&);
+ FListBox& operator = (const FListBox&);
+ void init();
+ void draw();
+ void drawLabel();
+ void drawList();
+ void processClick();
+ void processSelect();
+ void processChanged();
+
+ protected:
+ void adjustYOffset();
+ void adjustSize();
+
+ public:
+ FListBox (FWidget* parent=0); // constructor
+ ~FListBox(); // destructor
+ const char* getClassName() const;
+
+ void hide();
+
+ void onKeyPress (FKeyEvent*);
+ void onMouseDown (FMouseEvent*);
+ void onMouseUp (FMouseEvent*);
+ void onMouseMove (FMouseEvent*);
+ void onMouseDoubleClick (FMouseEvent*);
+ void onWheel (FWheelEvent*);
+ void onTimer (FTimerEvent*);
+ void onFocusIn (FFocusEvent*);
+ void onFocusOut (FFocusEvent*);
+
+ void cb_VBarChange (FWidget*, void*);
+ void cb_HBarChange (FWidget*, void*);
+ uInt count() const;
+ FListBoxItem Item(int) const;
+ int currentItem() const;
+ void setCurrentItem(int);
+ void selectItem(int);
+ void unselectItem(int);
+ bool isSelected(int) const;
+ void showInsideBrackets(int, fc::brackets_type);
+ void showNoBrackets(int);
+ bool hasBrackets(int) const;
+ void setGeometry (int, int, int, int, bool adjust=true);
+
+ void setMultiSelection (bool);
+ void setMultiSelection ();
+ void unsetMultiSelection ();
+ bool isMultiSelection() const;
+ bool setEnable(bool);
+ bool setEnable();
+ bool unsetEnable();
+ bool setDisable();
+ bool setFocus(bool);
+ bool setFocus();
+ bool unsetFocus();
+ bool setShadow(bool);
+ bool setShadow();
+ bool unsetShadow();
+ bool hasShadow();
+
+ void insert ( FString,
+ fc::brackets_type b = fc::NoBrackets,
+ bool s = false );
+ void insert ( long,
+ fc::brackets_type b = fc::NoBrackets,
+ bool s = false );
+ void remove ( int);
+ void clear();
+
+ void setText (const FString);
+ FString& getText();
+};
+#pragma pack(pop)
+
+
+// FListBox inline functions
+//----------------------------------------------------------------------
+inline const char* FListBox::getClassName() const
+{ return "FListBox"; }
+
+//----------------------------------------------------------------------
+inline uInt FListBox::count() const
+{ return uInt(data.size()); }
+
+//----------------------------------------------------------------------
+inline FListBoxItem FListBox::Item(int index) const
+{ return data[uInt(index-1)]; }
+
+//----------------------------------------------------------------------
+inline int FListBox::currentItem() const
+{ return current; }
+
+//----------------------------------------------------------------------
+inline void FListBox::selectItem (int index)
+{ data[uInt(index-1)].selected = true; }
+
+//----------------------------------------------------------------------
+inline void FListBox::unselectItem (int index)
+{ data[uInt(index-1)].selected = false; }
+
+//----------------------------------------------------------------------
+inline bool FListBox::isSelected(int index) const
+{ return data[uInt(index-1)].selected; }
+
+//----------------------------------------------------------------------
+inline void FListBox::showNoBrackets(int index)
+{ data[uInt(index-1)].brackets = fc::NoBrackets; }
+
+//----------------------------------------------------------------------
+inline bool FListBox::hasBrackets(int index) const
+{ return bool(data[uInt(index-1)].brackets > 0); }
+
+//----------------------------------------------------------------------
+inline void FListBox::setMultiSelection (bool on)
+{ this->multiSelect = on; }
+
+//----------------------------------------------------------------------
+inline void FListBox::setMultiSelection()
+{ setMultiSelection(true); }
+
+//----------------------------------------------------------------------
+inline void FListBox::unsetMultiSelection()
+{ setMultiSelection(false); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::isMultiSelection() const
+{ return multiSelect; }
+
+//----------------------------------------------------------------------
+inline bool FListBox::setEnable()
+{ return setEnable(true); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::unsetEnable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::setDisable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::setFocus()
+{ return setFocus(true); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::unsetFocus()
+{ return setFocus(false); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::setShadow()
+{ return setShadow(true); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::unsetShadow()
+{ return setShadow(false); }
+
+//----------------------------------------------------------------------
+inline bool FListBox::hasShadow()
+{ return ((flags & SHADOW) != 0); }
+
+//----------------------------------------------------------------------
+inline FString& FListBox::getText()
+{ return this->text; }
+
+#endif // _FLISTBOX_H
diff --git a/src/fmessagebox.cpp b/src/fmessagebox.cpp
new file mode 100644
index 00000000..86d31f1c
--- /dev/null
+++ b/src/fmessagebox.cpp
@@ -0,0 +1,410 @@
+// fmessagebox.cpp
+// class FMessageBox
+
+#include "fapp.h"
+#include "fmessagebox.h"
+
+
+static const char* button_text[] =
+{
+ 0,
+ "&OK",
+ "&Cancel",
+ "&Yes",
+ "&No",
+ "&Abort",
+ "&Retry",
+ "&Ignore",
+ 0
+};
+
+//----------------------------------------------------------------------
+// class FMessageBox
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FMessageBox::FMessageBox(FWidget* parent) : FDialog(parent)
+{
+ FDialog::setText ("Message for you");
+ this->init(FMessageBox::Ok, 0, 0);
+}
+
+//----------------------------------------------------------------------
+FMessageBox::FMessageBox(const FString& caption,
+ const FString& message,
+ int button0,
+ int button1,
+ int button2,
+ FWidget* parent) : FDialog(parent)
+{
+ FDialog::setText(caption);
+ this->text = message;
+ this->init(button0, button1, button2);
+}
+
+//----------------------------------------------------------------------
+FMessageBox::~FMessageBox() // destructor
+{
+ for (uInt n=0; n < numButtons; n++)
+ delete button[n];
+
+ delete button_digit[2];
+ delete button_digit[1];
+ delete button_digit[0];
+}
+
+
+// private methods of FMessageBox
+//----------------------------------------------------------------------
+void FMessageBox::init(int button0, int button1, int button2)
+{
+ emphasis_color = wc.dialog_emphasis_fg;
+
+ msg_dimension();
+
+ if ( (button2 && ! button1) || (button1 && ! button0) )
+ {
+ button0 = button1 = button2 = 0;
+ }
+ if ( button0 == 0 )
+ button0 = FMessageBox::Ok;
+ if ( button1 == 0 && button2 == 0 )
+ numButtons = 1;
+ else if ( button2 == 0 )
+ numButtons = 2;
+ else
+ numButtons = 3;
+
+ button_digit[0] = new int(button0);
+ button_digit[1] = new int(button1);
+ button_digit[2] = new int(button2);
+
+ button[0] = new FButton (this);
+ button[0]->setText(button_text[button0]);
+ button[0]->setX(3, false);
+ button[0]->setY(height-4, false);
+ button[0]->setWidth(1, false);
+ button[0]->setHeight(1, false);
+ button[0]->setFocus();
+ button[0]->setShadow();
+
+ if ( button1 > 0 )
+ {
+ button[1] = new FButton(this);
+ button[1]->setText(button_text[button1]);
+ button[1]->setX(17, false);
+ button[1]->setY(height-4, false);
+ button[1]->setWidth(0, false);
+ button[1]->setHeight(1, false);
+ button[1]->setShadow();
+ }
+
+ if ( button2 > 0 )
+ {
+ button[2] = new FButton(this);
+ button[2]->setText(button_text[button2]);
+ button[2]->setX(32, false);
+ button[2]->setY(height-4, false);
+ button[2]->setWidth(0, false);
+ button[2]->setHeight(1, false);
+ button[2]->setShadow();
+ }
+
+ resizeButtons();
+ adjustButtons();
+
+ if ( *button_digit[0] != 0 )
+ button[0]->addCallback
+ (
+ "clicked",
+ this,
+ reinterpret_cast(&FMessageBox::cb_processClick),
+ static_cast(button_digit[0])
+ );
+
+
+ if ( *button_digit[1] != 0 )
+ button[1]->addCallback
+ (
+ "clicked",
+ this,
+ reinterpret_cast(&FMessageBox::cb_processClick),
+ static_cast(button_digit[1])
+ );
+
+ if ( *button_digit[2] != 0 )
+ button[2]->addCallback
+ (
+ "clicked",
+ this,
+ reinterpret_cast(&FMessageBox::cb_processClick),
+ static_cast(button_digit[2])
+ );
+
+ setModal();
+ setTransparentShadow();
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::msg_dimension()
+{
+ int x, y, w, h;
+ int headline_height = 0;
+ text_split = text.split("\n");
+ text_num_lines = uInt(text_split.size());
+ text_components = &text_split[0];
+ maxLineWidth = 0;
+ center_text = false;
+
+ if ( ! headline_text.isNull() )
+ headline_height = 2;
+
+ for (uInt i=0; i < text_num_lines; i++)
+ {
+ uInt len = text_components[i].getLength();
+ if ( len > maxLineWidth )
+ maxLineWidth = len;
+ }
+ h = int(text_num_lines) + 8 + headline_height;
+ w = int(maxLineWidth + 4);
+ if ( w < 20 )
+ w = 20;
+ x = 1 + int((parentWidget()->getWidth()-w)/2);
+ y = 1 + int((parentWidget()->getHeight()-h)/3);
+ setGeometry (x, y, w, h);
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::draw()
+{
+ FDialog::draw();
+
+ if ( Encoding == fc::VT100 )
+ unsetVT100altChar();
+
+ int head_offset = 0;
+ int center_x = 0;
+ int msg_x = int((width - int(maxLineWidth)) / 2); // center the whole block
+
+ setUpdateVTerm(false);
+ if ( ! headline_text.isNull() )
+ {
+ setColor(emphasis_color, backgroundColor);
+ uInt headline_length = headline_text.getLength();
+ if ( center_text ) // center one line
+ center_x = int((maxLineWidth - headline_length) / 2);
+ gotoxy (xpos+xmin-1+msg_x+center_x, ypos+ymin+2);
+ print (headline_text);
+ head_offset = 2;
+ }
+
+ setColor(foregroundColor, backgroundColor);
+
+ for (int i=0; i < int(text_num_lines); i++)
+ {
+ uInt line_length = text_components[i].getLength();
+ if ( center_text ) // center one line
+ center_x = int((maxLineWidth - line_length) / 2);
+ gotoxy (xpos+xmin-1+msg_x+center_x, ypos+ymin+2+head_offset+i);
+ print(text_components[i]);
+ }
+ setUpdateVTerm(true);
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::resizeButtons()
+{
+ uInt len[3], max_size;
+ for (uInt n=0; n < numButtons; n++)
+ {
+ len[n] = button[n]->getText().getLength();
+ if ( button[n]->getText().includes('&') )
+ len[n]--;
+ }
+
+ if ( numButtons == 1 )
+ max_size = len[0];
+ else
+ {
+ assert ( numButtons > 1 );
+ max_size = std::max(len[0], len[1]);
+ if ( numButtons == 3 )
+ max_size = std::max(max_size, len[2]);
+ }
+ if ( max_size < 7 )
+ max_size = 7;
+
+ for (uInt n=0; n < numButtons; n++)
+ button[n]->setWidth(int(max_size + 3), false);
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::adjustButtons()
+{
+ int btn_width=0;
+ int gap = 4;
+ for (uInt n=0; n < numButtons; n++)
+ {
+ if ( n == numButtons-1 )
+ btn_width += button[n]->getWidth();
+ else
+ btn_width += button[n]->getWidth() + gap;
+ }
+
+ if ( btn_width > width-5 )
+ {
+ setWidth(btn_width + 5);
+ int max_width = getRootWidget()->getClientWidth();
+ setX(int((max_width-width)/2));
+ }
+
+ int btn_x = int((width-btn_width) / 2);
+
+ for (uInt n=0; n < numButtons; n++)
+ {
+ if ( n == 0 )
+ button[n]->setX(btn_x);
+ else
+ {
+ int btn_size = button[n]->getWidth();
+ button[n]->setX( btn_x + int(n) * (btn_size + gap) );
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::cb_processClick (FWidget*, void* data_ptr)
+{
+ int* reply = static_cast(data_ptr);
+ done (*reply);
+}
+
+// protected methods of FMessageBox
+//----------------------------------------------------------------------
+void FMessageBox::adjustSize()
+{
+ int X, Y, max_width, max_height;
+ max_height = getRootWidget()->getClientHeight();
+ max_width = getRootWidget()->getClientWidth();
+ X = 1 + int((max_width-width)/2);
+ Y = 1 + int((max_height-height)/3);
+ setX(X, false);
+ setY(Y, false);
+ FDialog::adjustSize();
+}
+
+// public methods of FMessageBox
+//----------------------------------------------------------------------
+void FMessageBox::setHeadline (const FString& headline)
+{
+ int old_height = height;
+ this->headline_text = headline;
+ setHeight(height + 2, true);
+ for (uInt n=0; n < numButtons; n++)
+ button[n]->setY(height-4, false);
+ uInt len = headline_text.getLength();
+ if ( len > maxLineWidth )
+ maxLineWidth = len;
+ if ( vwin && height != old_height )
+ resizeArea (vwin);
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::setHeadline (const std::string& headline)
+{
+ FString headline_txt(headline);
+ setHeadline( headline_txt );
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::setHeadline (const char* headline)
+{
+ FString headline_txt(headline);
+ setHeadline( headline_txt );
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::setText (const FString& txt)
+{
+ this->text = txt;
+ msg_dimension();
+ button[0]->setY(height-4, false);
+ if ( *button_digit[1] != 0 )
+ button[1]->setY(height-4, false);
+ if ( *button_digit[2] != 0 )
+ button[2]->setY(height-4, false);
+ adjustButtons();
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::setText (const std::string& txt)
+{
+ FString message_text(txt);
+ setText( message_text );
+}
+
+//----------------------------------------------------------------------
+void FMessageBox::setText (const char* txt)
+{
+ FString message_text(txt);
+ setText( message_text );
+}
+
+//----------------------------------------------------------------------
+int FMessageBox::info ( FWidget* parent,
+ const FString& caption,
+ const FString& message,
+ int button0,
+ int button1,
+ int button2 )
+{
+ int reply;
+ FMessageBox* mbox = new FMessageBox ( caption, message,
+ button0, button1, button2,
+ parent );
+ reply = mbox->exec();
+ delete mbox;
+ return reply;
+}
+
+//----------------------------------------------------------------------
+int FMessageBox::info ( FWidget* parent,
+ const FString& caption,
+ int num,
+ int button0,
+ int button1,
+ int button2 )
+{
+ int reply;
+ FMessageBox* mbox = new FMessageBox ( caption,
+ FString().setNumber(num),
+ button0, button1, button2,
+ parent );
+ reply = mbox->exec();
+ delete mbox;
+ return reply;
+}
+
+//----------------------------------------------------------------------
+int FMessageBox::error ( FWidget* parent,
+ const FString& message,
+ int button0,
+ int button1,
+ int button2 )
+{
+ int reply;
+ const FString caption = "Error message";
+ FMessageBox* mbox = new FMessageBox ( caption, message,
+ button0, button1, button2,
+ parent );
+ mbox->beep();
+ mbox->setHeadline("Warning:");
+ mbox->setCenterText();
+ mbox->foregroundColor = mbox->wc.error_box_fg;
+ mbox->backgroundColor = mbox->wc.error_box_bg;
+ mbox->emphasis_color = mbox->wc.error_box_emphasis_fg;
+ reply = mbox->exec();
+ delete mbox;
+ return reply;
+}
diff --git a/src/fmessagebox.h b/src/fmessagebox.h
new file mode 100644
index 00000000..c643827c
--- /dev/null
+++ b/src/fmessagebox.h
@@ -0,0 +1,130 @@
+// fmessagebox.h
+// class FMessageBox
+
+#ifndef _FMESSAGEBOX_H
+#define _FMESSAGEBOX_H
+
+#include
+
+#include "fbutton.h"
+#include "fdialog.h"
+#include "fterm.h"
+
+
+//----------------------------------------------------------------------
+// class FMessageBox
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FMessageBox : public FDialog
+{
+ public:
+ enum
+ {
+ Reject = 0,
+ Ok = 1,
+ Cancel = 2,
+ Yes = 3,
+ No = 4,
+ Abort = 5,
+ Retry = 6,
+ Ignore = 7
+ };
+
+ private:
+ FString headline_text;
+ FString text;
+ FString* text_components;
+ std::vector text_split;
+ uInt maxLineWidth;
+ bool center_text;
+ uChar emphasis_color;
+ uInt numButtons;
+ uInt text_num_lines;
+ int* button_digit[3];
+ FButton* button[3];
+
+ protected:
+ void adjustSize();
+
+ private:
+ void init(int, int, int);
+ void msg_dimension();
+ virtual void draw();
+ void resizeButtons();
+ void adjustButtons();
+ void cb_processClick (FWidget*, void*);
+
+ public:
+ FMessageBox (FWidget* parent=0);
+ FMessageBox (const FString&, const FString&,
+ int, int, int,
+ FWidget* parent=0);
+ ~FMessageBox();
+ const char* getClassName() const;
+
+ const FString getHeadline() const;
+ void setHeadline (const FString&);
+ void setHeadline (const std::string&);
+ void setHeadline (const char*);
+
+ const FString getText() const;
+ void setText (const FString&);
+ void setText (const std::string&);
+ void setText (const char*);
+
+ bool setCenterText(bool);
+ bool setCenterText();
+ bool unsetCenterText();
+
+ static int info ( FWidget*,
+ const FString&,
+ const FString&,
+ int button0 = FMessageBox::Ok,
+ int button1=0,
+ int button2=0 );
+
+ static int info ( FWidget*,
+ const FString&,
+ int,
+ int button0 = FMessageBox::Ok,
+ int button1=0,
+ int button2=0 );
+
+ static int error ( FWidget*,
+ const FString&,
+ int button0 = FMessageBox::Ok,
+ int button1=0,
+ int button2=0 );
+};
+#pragma pack(pop)
+
+
+// FMessageBox inline functions
+//----------------------------------------------------------------------
+inline const char* FMessageBox::getClassName() const
+{ return "FMessageBox"; }
+
+//----------------------------------------------------------------------
+inline const FString FMessageBox::getHeadline() const
+{ return headline_text; }
+
+//----------------------------------------------------------------------
+inline const FString FMessageBox::getText() const
+{ return text; }
+
+//----------------------------------------------------------------------
+inline bool FMessageBox::setCenterText(bool on)
+{ return this->center_text = on; }
+
+//----------------------------------------------------------------------
+inline bool FMessageBox::setCenterText()
+{ return setCenterText(true); }
+
+//----------------------------------------------------------------------
+inline bool FMessageBox::unsetCenterText()
+{ return setCenterText(false); }
+
+#endif // _FMESSAGEBOX_H
diff --git a/src/fobject.cpp b/src/fobject.cpp
new file mode 100644
index 00000000..d5d92885
--- /dev/null
+++ b/src/fobject.cpp
@@ -0,0 +1,222 @@
+// fobject.cpp
+// class FObject
+
+#include "fobject.h"
+
+// static class attributes
+bool FObject::modify_timer;
+FObject::TimerList* FObject::timer_list = 0;
+
+
+//----------------------------------------------------------------------
+// class FObject
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FObject::FObject (FObject* parent)
+{
+ parentObj = parent;
+ children_list.clear(); // no children yet
+
+ if ( parentObj ) // add object to parent
+ parentObj->addChild(this);
+
+ if ( parent == 0 )
+ {
+ has_parent = false;
+ modify_timer = false;
+ timer_list = new TimerList;
+ }
+ else
+ has_parent = true;
+}
+
+//----------------------------------------------------------------------
+FObject::~FObject() // destructor
+{
+ if ( parentObj )
+ parentObj->delChild(this);
+
+ delAllTimer(); // delete all timers of this object
+
+ if ( ! has_parent && timer_list )
+ {
+ delete timer_list;
+ timer_list = 0;
+ }
+
+ // delete children objects
+ FObject::object_list children = this->children();
+ if ( ! children.empty() )
+ {
+ FObject::object_list::const_iterator iter;
+ iter = children.begin();
+
+ while ( iter != children.end() )
+ {
+ delete (*iter);
+ ++iter;
+ }
+ }
+}
+
+// public methods of FObject
+//----------------------------------------------------------------------
+void FObject::addChild (FObject* obj)
+{
+ if ( obj->parentObj )
+ obj->parentObj->delChild(obj);
+
+ obj->parentObj = this;
+
+ this->children_list.push_back(obj);
+}
+
+//----------------------------------------------------------------------
+void FObject::delChild (FObject* obj)
+{
+ if ( ! children_list.empty() )
+ {
+ obj->removeParent();
+ this->children_list.remove(obj);
+ }
+}
+
+//----------------------------------------------------------------------
+bool FObject::event (FEvent* ev)
+{
+ if ( ev->type() == Timer_Event )
+ {
+ onTimer ( static_cast(ev) );
+ return true;
+ }
+ return false;
+}
+
+//----------------------------------------------------------------------
+void FObject::getCurrentTime (timeval &time)
+{
+ gettimeofday(&time, 0);
+
+ // NTP fix
+ while ( time.tv_usec >= 1000000 )
+ {
+ time.tv_usec -= 1000000;
+ time.tv_sec++;
+ }
+ while ( time.tv_usec < 0 )
+ {
+ if ( time.tv_sec > 0 )
+ {
+ time.tv_usec += 1000000;
+ time.tv_sec--;
+ }
+ else
+ {
+ time.tv_usec = 0;
+ break;
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+int FObject::addTimer (int interval)
+{
+ FObject::TimerList::iterator iter, end;
+ timeval time_interval;
+ timeval currentTime;
+ int id = 1;
+
+ modify_timer = true;
+
+ if ( ! timer_list )
+ timer_list = new TimerList;
+
+ // find an unused timer id
+ if ( ! timer_list->empty() )
+ {
+ iter = timer_list->begin();
+ end = timer_list->end();
+
+ while ( iter != end )
+ {
+ if ( (*iter).id == id )
+ {
+ iter = timer_list->begin();
+ id++;
+ continue;
+ }
+ ++iter;
+ }
+ }
+
+ if ( id <= 0 || id > int(timer_list->size() + 1) )
+ return 0;
+
+
+ time_interval.tv_sec = interval / 1000;
+ time_interval.tv_usec = (interval % 1000) * 1000;
+ getCurrentTime (currentTime);
+ timeval timeout = currentTime + time_interval;
+ timer_data t = { id, time_interval, timeout, this };
+
+ // insert in list sorted by timeout
+ iter = timer_list->begin();
+ end = timer_list->end();
+
+ while ( iter != end && (*iter).timeout < t.timeout )
+ ++iter;
+
+ timer_list->insert (iter, t);
+ modify_timer = false;
+
+ return id;
+}
+
+//----------------------------------------------------------------------
+bool FObject::delTimer (int id)
+{
+ FObject::TimerList::iterator iter, end;
+
+ if ( id <= 0 || id > int(timer_list->size()) )
+ return false;
+
+ modify_timer = true;
+ iter = timer_list->begin();
+ end = timer_list->end();
+
+ while ( iter != end && (*iter).id != id )
+ ++iter;
+
+ if ( iter != end )
+ {
+ timer_list->erase(iter);
+ modify_timer = false;
+ return true;
+ }
+ modify_timer = false;
+
+ return false;
+}
+
+//----------------------------------------------------------------------
+bool FObject::delAllTimer()
+{
+ if ( ! timer_list )
+ return false;
+ if ( timer_list->empty() )
+ return false;
+
+ modify_timer = true;
+ timer_list->clear();
+ modify_timer = false;
+
+ return true;
+}
+
+// protected methods of FObject
+//----------------------------------------------------------------------
+void FObject::onTimer (FTimerEvent*)
+{
+}
diff --git a/src/fobject.h b/src/fobject.h
new file mode 100644
index 00000000..a3cde427
--- /dev/null
+++ b/src/fobject.h
@@ -0,0 +1,166 @@
+// fobject.h
+// class FObject
+
+#ifndef _FOBJECT_H
+#define _FOBJECT_H
+
+#include // need for gettimeofday
+#include
+#include
+#include
+#include "fevent.h"
+
+#define null NULL
+
+typedef unsigned char uChar;
+typedef unsigned int uInt;
+typedef unsigned long uLong;
+typedef unsigned char uInt8;
+typedef unsigned short uInt16;
+typedef unsigned int uInt32;
+typedef u_int64_t uInt64;
+
+typedef signed int sInt;
+typedef signed long sLong;
+typedef signed char sInt8;
+typedef signed short sInt16;
+typedef signed int sInt32;
+typedef int64_t sInt64;
+
+
+//----------------------------------------------------------------------
+// class FObject
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FObject
+{
+ public:
+ typedef std::list object_list;
+
+ struct timer_data
+ {
+ int id;
+ timeval interval;
+ timeval timeout;
+ FObject* object;
+ };
+ typedef std::vector TimerList;
+ static TimerList* timer_list;
+
+ private:
+ FObject* parentObj;
+ object_list children_list;
+ bool has_parent;
+ static bool modify_timer;
+ friend class FApplication;
+
+ public:
+ FObject (FObject* parent=0);
+ virtual ~FObject();
+ virtual const char* getClassName() const;
+
+ FObject* parent() const;
+ bool hasParent() const;
+ void removeParent();
+ object_list children() const;
+ bool hasChildren() const;
+ void addChild (FObject*);
+ void delChild (FObject*);
+ int numOfChildren() const;
+ static void getCurrentTime (timeval&);
+ int addTimer (int interval);
+ bool delTimer (int id);
+ bool delAllTimer();
+ virtual bool event (FEvent*);
+
+ protected:
+ virtual void onTimer (FTimerEvent*);
+
+ private:
+ FObject (const FObject&);
+ FObject& operator = (const FObject&);
+};
+
+#pragma pack(pop)
+
+//----------------------------------------------------------------------
+inline const char* FObject::getClassName() const
+{ return "FObject"; }
+
+//----------------------------------------------------------------------
+inline FObject* FObject::parent() const
+{ return parentObj; }
+
+//----------------------------------------------------------------------
+inline bool FObject::hasParent() const
+{ return has_parent; }
+
+//----------------------------------------------------------------------
+inline void FObject::removeParent()
+{ parentObj = 0; }
+
+//----------------------------------------------------------------------
+inline FObject::object_list FObject::children() const
+{ return children_list; }
+
+//----------------------------------------------------------------------
+inline bool FObject::hasChildren() const
+{ return bool( ! children_list.empty() ); }
+
+//----------------------------------------------------------------------
+inline int FObject::numOfChildren() const
+{ return int(children_list.size()); }
+
+
+//----------------------------------------------------------------------
+// Operator functions for timeval
+//----------------------------------------------------------------------
+
+static inline timeval operator + (const timeval& t1, const timeval& t2)
+{
+ timeval tmp;
+ tmp.tv_sec = t1.tv_sec + t2.tv_sec;
+ if ( (tmp.tv_usec = t1.tv_usec + t2.tv_usec) >= 1000000 )
+ {
+ tmp.tv_sec++;
+ tmp.tv_usec -= 1000000;
+ }
+ return tmp;
+}
+
+//----------------------------------------------------------------------
+static inline timeval operator - (const timeval& t1, const timeval& t2)
+{
+ timeval tmp;
+ tmp.tv_sec = t1.tv_sec - t2.tv_sec;
+ if ( (tmp.tv_usec = t1.tv_usec - t2.tv_usec) < 0 )
+ {
+ tmp.tv_sec--;
+ tmp.tv_usec += 1000000;
+ }
+ return tmp;
+}
+
+//----------------------------------------------------------------------
+static inline timeval& operator += (timeval& t1, const timeval& t2)
+{
+ t1.tv_sec += t2.tv_sec;
+ if ( (t1.tv_usec += t2.tv_usec) >= 1000000 )
+ {
+ t1.tv_sec++;
+ t1.tv_usec -= 1000000;
+ }
+ return t1;
+}
+
+//----------------------------------------------------------------------
+static inline bool operator < (const timeval& t1, const timeval& t2)
+{
+ return (t1.tv_sec < t2.tv_sec)
+ || (t1.tv_sec == t2.tv_sec && t1.tv_usec < t2.tv_usec);
+}
+
+#endif // _FOBJECT_H
diff --git a/src/fonts/8x16graph.bdf b/src/fonts/8x16graph.bdf
new file mode 100644
index 00000000..3f5a887e
--- /dev/null
+++ b/src/fonts/8x16graph.bdf
@@ -0,0 +1,5902 @@
+STARTFONT 2.1
+FONT -misc-8x16graph-medium-r-normal--16-160-75-75-C-80-iso8859-1
+SIZE 16 75 75
+FONTBOUNDINGBOX 8 16 0 -4
+STARTPROPERTIES 6
+FONT_DESCENT 4
+FONT_ASCENT 12
+DEFAULT_CHAR 254
+SPACING "C"
+_GBDFED_INFO "Edited with gbdfed 1.6."
+PIXEL_SIZE 16
+ENDPROPERTIES
+CHARS 256
+STARTCHAR char0
+ENCODING 0
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char1
+ENCODING 1
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7E
+81
+A5
+81
+81
+BD
+99
+81
+81
+7E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char2
+ENCODING 2
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7E
+FF
+DB
+FF
+FF
+C3
+E7
+FF
+FF
+7E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char3
+ENCODING 3
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+6C
+FE
+FE
+FE
+FE
+7C
+38
+10
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char4
+ENCODING 4
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+10
+38
+7C
+FE
+7C
+38
+10
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char5
+ENCODING 5
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+18
+3C
+3C
+E7
+E7
+E7
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char6
+ENCODING 6
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+18
+3C
+7E
+FF
+FF
+7E
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char7
+ENCODING 7
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+18
+3C
+3C
+18
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char8
+ENCODING 8
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+FF
+FF
+FF
+FF
+FF
+E7
+C3
+C3
+E7
+FF
+FF
+FF
+FF
+FF
+FF
+ENDCHAR
+STARTCHAR char9
+ENCODING 9
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+3C
+66
+42
+42
+66
+3C
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char10
+ENCODING 10
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+FF
+FF
+FF
+FF
+C3
+99
+BD
+BD
+99
+C3
+FF
+FF
+FF
+FF
+FF
+ENDCHAR
+STARTCHAR char11
+ENCODING 11
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+1E
+0E
+1A
+32
+78
+CC
+CC
+CC
+CC
+78
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char12
+ENCODING 12
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+66
+66
+66
+66
+3C
+18
+7E
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char13
+ENCODING 13
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3F
+33
+3F
+30
+30
+30
+30
+70
+F0
+E0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char14
+ENCODING 14
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7F
+63
+7F
+63
+63
+63
+63
+67
+E7
+E6
+C0
+00
+00
+00
+ENDCHAR
+STARTCHAR char15
+ENCODING 15
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+18
+18
+DB
+3C
+E7
+3C
+DB
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char16
+ENCODING 16
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+80
+C0
+E0
+F0
+F8
+FE
+F8
+F0
+E0
+C0
+80
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char17
+ENCODING 17
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+02
+06
+0E
+1E
+3E
+FE
+3E
+1E
+0E
+06
+02
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char18
+ENCODING 18
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+3C
+7E
+18
+18
+18
+7E
+3C
+18
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char19
+ENCODING 19
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+66
+66
+66
+66
+66
+66
+66
+00
+66
+66
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char20
+ENCODING 20
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7F
+DB
+DB
+DB
+7B
+1B
+1B
+1B
+1B
+1B
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char21
+ENCODING 21
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7C
+C6
+60
+38
+6C
+C6
+C6
+6C
+38
+0C
+C6
+7C
+00
+00
+00
+ENDCHAR
+STARTCHAR char22
+ENCODING 22
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+FE
+FE
+FE
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char23
+ENCODING 23
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+3C
+7E
+18
+18
+18
+7E
+3C
+18
+7E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char24
+ENCODING 24
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+3C
+7E
+18
+18
+18
+18
+18
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char25
+ENCODING 25
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+18
+18
+18
+18
+18
+18
+7E
+3C
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char26
+ENCODING 26
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+18
+0C
+FE
+0C
+18
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char27
+ENCODING 27
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+30
+60
+FE
+60
+30
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char28
+ENCODING 28
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+C0
+C0
+C0
+FE
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char29
+ENCODING 29
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+28
+6C
+FE
+6C
+28
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char30
+ENCODING 30
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+10
+38
+38
+7C
+7C
+FE
+FE
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char31
+ENCODING 31
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+FE
+FE
+7C
+7C
+38
+38
+10
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char32
+ENCODING 32
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char33
+ENCODING 33
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+3C
+3C
+3C
+18
+18
+18
+00
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char34
+ENCODING 34
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+66
+66
+66
+24
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char35
+ENCODING 35
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+6C
+6C
+FE
+6C
+6C
+6C
+FE
+6C
+6C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char36
+ENCODING 36
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+18
+18
+7C
+C6
+C2
+C0
+7C
+06
+06
+86
+C6
+7C
+18
+18
+00
+00
+ENDCHAR
+STARTCHAR char37
+ENCODING 37
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+C2
+C6
+0C
+18
+30
+60
+C6
+86
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char38
+ENCODING 38
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+38
+6C
+6C
+38
+76
+DC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char39
+ENCODING 39
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+30
+30
+30
+60
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char40
+ENCODING 40
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+0C
+18
+30
+30
+30
+30
+30
+30
+18
+0C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char41
+ENCODING 41
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+30
+18
+0C
+0C
+0C
+0C
+0C
+0C
+18
+30
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char42
+ENCODING 42
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+66
+3C
+FF
+3C
+66
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char43
+ENCODING 43
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+18
+18
+7E
+18
+18
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char44
+ENCODING 44
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+18
+18
+18
+30
+00
+00
+00
+ENDCHAR
+STARTCHAR char45
+ENCODING 45
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+FE
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char46
+ENCODING 46
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char47
+ENCODING 47
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+02
+06
+0C
+18
+30
+60
+C0
+80
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char48
+ENCODING 48
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+38
+6C
+C6
+C6
+D6
+D6
+C6
+C6
+6C
+38
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char49
+ENCODING 49
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+38
+78
+18
+18
+18
+18
+18
+18
+7E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char50
+ENCODING 50
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+06
+0C
+18
+30
+60
+C0
+C6
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char51
+ENCODING 51
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+06
+06
+3C
+06
+06
+06
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char52
+ENCODING 52
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+0C
+1C
+3C
+6C
+CC
+FE
+0C
+0C
+0C
+1E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char53
+ENCODING 53
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FE
+C0
+C0
+C0
+FC
+06
+06
+06
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char54
+ENCODING 54
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+38
+60
+C0
+C0
+FC
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char55
+ENCODING 55
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FE
+C6
+06
+06
+0C
+18
+30
+30
+30
+30
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char56
+ENCODING 56
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+C6
+C6
+7C
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char57
+ENCODING 57
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+C6
+C6
+7E
+06
+06
+06
+0C
+78
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char58
+ENCODING 58
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+18
+18
+00
+00
+00
+18
+18
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char59
+ENCODING 59
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+18
+18
+00
+00
+00
+18
+18
+30
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char60
+ENCODING 60
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+06
+0C
+18
+30
+60
+30
+18
+0C
+06
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char61
+ENCODING 61
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7E
+00
+00
+7E
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char62
+ENCODING 62
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+60
+30
+18
+0C
+06
+0C
+18
+30
+60
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char63
+ENCODING 63
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+C6
+0C
+18
+18
+18
+00
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char64
+ENCODING 64
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+7C
+C6
+C6
+DE
+DE
+DE
+DC
+C0
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char65
+ENCODING 65
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+10
+38
+6C
+C6
+C6
+FE
+C6
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char66
+ENCODING 66
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FC
+66
+66
+66
+7C
+66
+66
+66
+66
+FC
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char67
+ENCODING 67
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+66
+C2
+C0
+C0
+C0
+C0
+C2
+66
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char68
+ENCODING 68
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+F8
+6C
+66
+66
+66
+66
+66
+66
+6C
+F8
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char69
+ENCODING 69
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FE
+66
+62
+68
+78
+68
+60
+62
+66
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char70
+ENCODING 70
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FE
+66
+62
+68
+78
+68
+60
+60
+60
+F0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char71
+ENCODING 71
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+66
+C2
+C0
+C0
+DE
+C6
+C6
+66
+3A
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char72
+ENCODING 72
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+C6
+C6
+C6
+FE
+C6
+C6
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char73
+ENCODING 73
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+18
+18
+18
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char74
+ENCODING 74
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+1E
+0C
+0C
+0C
+0C
+0C
+CC
+CC
+CC
+78
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char75
+ENCODING 75
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+E6
+66
+66
+6C
+78
+78
+6C
+66
+66
+E6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char76
+ENCODING 76
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+F0
+60
+60
+60
+60
+60
+60
+62
+66
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char77
+ENCODING 77
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+EE
+FE
+FE
+D6
+C6
+C6
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char78
+ENCODING 78
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+E6
+F6
+FE
+DE
+CE
+C6
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char79
+ENCODING 79
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char80
+ENCODING 80
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FC
+66
+66
+66
+7C
+60
+60
+60
+60
+F0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char81
+ENCODING 81
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+C6
+C6
+C6
+C6
+C6
+D6
+DE
+7C
+0C
+0E
+00
+00
+ENDCHAR
+STARTCHAR char82
+ENCODING 82
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FC
+66
+66
+66
+7C
+6C
+66
+66
+66
+E6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char83
+ENCODING 83
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7C
+C6
+C6
+60
+38
+0C
+06
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char84
+ENCODING 84
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+7E
+7E
+5A
+18
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char85
+ENCODING 85
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char86
+ENCODING 86
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+6C
+38
+10
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char87
+ENCODING 87
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+C6
+C6
+C6
+D6
+D6
+D6
+FE
+EE
+6C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char88
+ENCODING 88
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+C6
+6C
+7C
+38
+38
+7C
+6C
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char89
+ENCODING 89
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+66
+66
+66
+66
+3C
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char90
+ENCODING 90
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FE
+C6
+86
+0C
+18
+30
+60
+C2
+C6
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char91
+ENCODING 91
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+30
+30
+30
+30
+30
+30
+30
+30
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char92
+ENCODING 92
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+80
+C0
+E0
+70
+38
+1C
+0E
+06
+02
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char93
+ENCODING 93
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+0C
+0C
+0C
+0C
+0C
+0C
+0C
+0C
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char94
+ENCODING 94
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+10
+38
+6C
+C6
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char95
+ENCODING 95
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+FF
+00
+00
+ENDCHAR
+STARTCHAR char96
+ENCODING 96
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+30
+30
+18
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char97
+ENCODING 97
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+78
+0C
+7C
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char98
+ENCODING 98
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+E0
+60
+60
+78
+6C
+66
+66
+66
+66
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char99
+ENCODING 99
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7C
+C6
+C0
+C0
+C0
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char100
+ENCODING 100
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+1C
+0C
+0C
+3C
+6C
+CC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char101
+ENCODING 101
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7C
+C6
+FE
+C0
+C0
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char102
+ENCODING 102
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+38
+6C
+64
+60
+F0
+60
+60
+60
+60
+F0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char103
+ENCODING 103
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+76
+CC
+CC
+CC
+CC
+CC
+7C
+0C
+CC
+78
+00
+ENDCHAR
+STARTCHAR char104
+ENCODING 104
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+E0
+60
+60
+6C
+76
+66
+66
+66
+66
+E6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char105
+ENCODING 105
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+18
+00
+38
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char106
+ENCODING 106
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+06
+06
+00
+0E
+06
+06
+06
+06
+06
+06
+66
+66
+3C
+00
+ENDCHAR
+STARTCHAR char107
+ENCODING 107
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+E0
+60
+60
+66
+6C
+78
+78
+6C
+66
+E6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char108
+ENCODING 108
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+38
+18
+18
+18
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char109
+ENCODING 109
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+EC
+FE
+D6
+D6
+D6
+D6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char110
+ENCODING 110
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+DC
+66
+66
+66
+66
+66
+66
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char111
+ENCODING 111
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7C
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char112
+ENCODING 112
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+DC
+66
+66
+66
+66
+66
+7C
+60
+60
+F0
+00
+ENDCHAR
+STARTCHAR char113
+ENCODING 113
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+76
+CC
+CC
+CC
+CC
+CC
+7C
+0C
+0C
+1E
+00
+ENDCHAR
+STARTCHAR char114
+ENCODING 114
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+DC
+76
+66
+60
+60
+60
+F0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char115
+ENCODING 115
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7C
+C6
+60
+38
+0C
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char116
+ENCODING 116
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+10
+30
+30
+FC
+30
+30
+30
+30
+36
+1C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char117
+ENCODING 117
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+CC
+CC
+CC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char118
+ENCODING 118
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+66
+66
+66
+66
+66
+3C
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char119
+ENCODING 119
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+C6
+C6
+D6
+D6
+D6
+FE
+6C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char120
+ENCODING 120
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+C6
+6C
+38
+38
+38
+6C
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char121
+ENCODING 121
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+C6
+C6
+C6
+C6
+C6
+C6
+7E
+06
+0C
+F8
+00
+ENDCHAR
+STARTCHAR char122
+ENCODING 122
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+FE
+CC
+18
+30
+60
+C6
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char123
+ENCODING 123
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+0E
+18
+18
+18
+70
+18
+18
+18
+18
+0E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char124
+ENCODING 124
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+18
+18
+18
+00
+18
+18
+18
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char125
+ENCODING 125
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+70
+18
+18
+18
+0E
+18
+18
+18
+18
+70
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char126
+ENCODING 126
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+76
+DC
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char127
+ENCODING 127
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+10
+38
+6C
+C6
+C6
+C6
+FE
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char128
+ENCODING 128
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3C
+66
+C2
+C0
+C0
+C0
+C2
+66
+3C
+0C
+06
+7C
+00
+00
+ENDCHAR
+STARTCHAR char129
+ENCODING 129
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+CC
+00
+00
+CC
+CC
+CC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char130
+ENCODING 130
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+0C
+18
+30
+00
+7C
+C6
+FE
+C0
+C0
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char131
+ENCODING 131
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+10
+38
+6C
+00
+78
+0C
+7C
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char132
+ENCODING 132
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+CC
+00
+00
+78
+0C
+7C
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char133
+ENCODING 133
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+60
+30
+18
+00
+78
+0C
+7C
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char134
+ENCODING 134
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+38
+6C
+38
+00
+78
+0C
+7C
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char135
+ENCODING 135
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+3C
+66
+60
+60
+66
+3C
+0C
+06
+3C
+00
+00
+00
+ENDCHAR
+STARTCHAR char136
+ENCODING 136
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+10
+38
+6C
+00
+7C
+C6
+FE
+C0
+C0
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char137
+ENCODING 137
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+00
+00
+7C
+C6
+FE
+C0
+C0
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char138
+ENCODING 138
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+60
+30
+18
+00
+7C
+C6
+FE
+C0
+C0
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char139
+ENCODING 139
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+66
+00
+00
+38
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char140
+ENCODING 140
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+18
+3C
+66
+00
+38
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char141
+ENCODING 141
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+60
+30
+18
+00
+38
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char142
+ENCODING 142
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+C6
+00
+10
+38
+6C
+C6
+C6
+FE
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char143
+ENCODING 143
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+38
+6C
+38
+00
+38
+6C
+C6
+C6
+FE
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char144
+ENCODING 144
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+18
+30
+60
+00
+FE
+66
+60
+7C
+60
+60
+66
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char145
+ENCODING 145
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+CC
+76
+36
+7E
+D8
+D8
+6E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char146
+ENCODING 146
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+3E
+6C
+CC
+CC
+FE
+CC
+CC
+CC
+CC
+CE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char147
+ENCODING 147
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+10
+38
+6C
+00
+7C
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char148
+ENCODING 148
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+00
+00
+7C
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char149
+ENCODING 149
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+60
+30
+18
+00
+7C
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char150
+ENCODING 150
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+30
+78
+CC
+00
+CC
+CC
+CC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char151
+ENCODING 151
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+60
+30
+18
+00
+CC
+CC
+CC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char152
+ENCODING 152
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+C6
+00
+00
+C6
+C6
+C6
+C6
+C6
+C6
+7E
+06
+0C
+78
+00
+ENDCHAR
+STARTCHAR char153
+ENCODING 153
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+C6
+00
+7C
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char154
+ENCODING 154
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+C6
+00
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char155
+ENCODING 155
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+18
+18
+3C
+66
+60
+60
+60
+66
+3C
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char156
+ENCODING 156
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+38
+6C
+64
+60
+F0
+60
+60
+60
+60
+E6
+FC
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char157
+ENCODING 157
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+66
+66
+3C
+18
+7E
+18
+7E
+18
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char158
+ENCODING 158
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+F8
+CC
+CC
+F8
+C4
+CC
+DE
+CC
+CC
+CC
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char159
+ENCODING 159
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+0E
+1B
+18
+18
+18
+7E
+18
+18
+18
+18
+18
+D8
+70
+00
+00
+ENDCHAR
+STARTCHAR char160
+ENCODING 160
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+18
+30
+60
+00
+78
+0C
+7C
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char161
+ENCODING 161
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+0C
+18
+30
+00
+38
+18
+18
+18
+18
+18
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char162
+ENCODING 162
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+18
+30
+60
+00
+7C
+C6
+C6
+C6
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char163
+ENCODING 163
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+18
+30
+60
+00
+CC
+CC
+CC
+CC
+CC
+CC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char164
+ENCODING 164
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+76
+DC
+00
+DC
+66
+66
+66
+66
+66
+66
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char165
+ENCODING 165
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+76
+DC
+00
+C6
+E6
+F6
+FE
+DE
+CE
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char166
+ENCODING 166
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+3C
+6C
+6C
+3E
+00
+7E
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char167
+ENCODING 167
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+38
+6C
+6C
+38
+00
+7C
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char168
+ENCODING 168
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+30
+30
+00
+30
+30
+60
+C0
+C6
+C6
+7C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char169
+ENCODING 169
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+FE
+C0
+C0
+C0
+C0
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char170
+ENCODING 170
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+FE
+06
+06
+06
+06
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char171
+ENCODING 171
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+C0
+C0
+C2
+C6
+CC
+18
+30
+60
+DC
+86
+0C
+18
+3E
+00
+00
+ENDCHAR
+STARTCHAR char172
+ENCODING 172
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+C0
+C0
+C2
+C6
+CC
+18
+30
+66
+CE
+9E
+3E
+06
+06
+00
+00
+ENDCHAR
+STARTCHAR char173
+ENCODING 173
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+18
+18
+00
+18
+18
+18
+3C
+3C
+3C
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char174
+ENCODING 174
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+36
+6C
+D8
+6C
+36
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char175
+ENCODING 175
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+D8
+6C
+36
+6C
+D8
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char176
+ENCODING 176
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+11
+44
+11
+44
+11
+44
+11
+44
+11
+44
+11
+44
+11
+44
+11
+44
+ENDCHAR
+STARTCHAR char177
+ENCODING 177
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+55
+AA
+55
+AA
+55
+AA
+55
+AA
+55
+AA
+55
+AA
+55
+AA
+55
+AA
+ENDCHAR
+STARTCHAR char178
+ENCODING 178
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+DD
+77
+DD
+77
+DD
+77
+DD
+77
+DD
+77
+DD
+77
+DD
+77
+DD
+77
+ENDCHAR
+STARTCHAR char179
+ENCODING 179
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+18
+ENDCHAR
+STARTCHAR char180
+ENCODING 180
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+FE
+FE
+FE
+FE
+02
+02
+02
+FE
+FE
+FE
+FE
+FE
+FE
+00
+ENDCHAR
+STARTCHAR char181
+ENCODING 181
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+FE
+FE
+9E
+8E
+06
+02
+06
+8E
+9E
+FE
+FE
+FE
+FE
+00
+ENDCHAR
+STARTCHAR char182
+ENCODING 182
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+36
+36
+36
+36
+36
+36
+36
+F6
+36
+36
+36
+36
+36
+36
+36
+36
+ENDCHAR
+STARTCHAR char183
+ENCODING 183
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+80
+80
+40
+40
+40
+40
+80
+80
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char184
+ENCODING 184
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+ENDCHAR
+STARTCHAR char185
+ENCODING 185
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+ENDCHAR
+STARTCHAR char186
+ENCODING 186
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+00
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+ENDCHAR
+STARTCHAR char187
+ENCODING 187
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+FE
+00
+ENDCHAR
+STARTCHAR char188
+ENCODING 188
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+ENDCHAR
+STARTCHAR char189
+ENCODING 189
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+FF
+7F
+3F
+1F
+0F
+07
+3F
+3F
+3F
+3F
+3F
+3F
+FF
+00
+ENDCHAR
+STARTCHAR char190
+ENCODING 190
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+3F
+3F
+3F
+3F
+3F
+3F
+07
+0F
+1F
+3F
+7F
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char191
+ENCODING 191
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+F8
+18
+18
+18
+18
+18
+18
+18
+18
+ENDCHAR
+STARTCHAR char192
+ENCODING 192
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+80
+80
+80
+80
+80
+80
+80
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char193
+ENCODING 193
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7F
+7E
+7C
+78
+70
+60
+7C
+7C
+7C
+7C
+7C
+7C
+7F
+00
+ENDCHAR
+STARTCHAR char194
+ENCODING 194
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7C
+7C
+7C
+7C
+7C
+7C
+60
+70
+78
+7C
+7E
+7F
+7F
+00
+ENDCHAR
+STARTCHAR char195
+ENCODING 195
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+80
+80
+80
+80
+80
+80
+80
+FF
+80
+80
+80
+80
+80
+80
+80
+80
+ENDCHAR
+STARTCHAR char196
+ENCODING 196
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char197
+ENCODING 197
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+FF
+ENDCHAR
+STARTCHAR char198
+ENCODING 198
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char199
+ENCODING 199
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+00
+00
+0E
+00
+00
+00
+00
+00
+00
+00
+00
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char200
+ENCODING 200
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7F
+7F
+79
+71
+60
+40
+60
+71
+79
+7F
+7F
+7F
+7F
+00
+ENDCHAR
+STARTCHAR char201
+ENCODING 201
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7F
+7F
+7F
+7F
+40
+40
+40
+7F
+7F
+7F
+7F
+7F
+7F
+00
+ENDCHAR
+STARTCHAR char202
+ENCODING 202
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7F
+7F
+7F
+7F
+7F
+7E
+7E
+7F
+7F
+7F
+7F
+7F
+7F
+00
+ENDCHAR
+STARTCHAR char203
+ENCODING 203
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+FF
+FF
+FF
+FF
+FF
+00
+00
+FF
+FF
+FF
+FF
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char204
+ENCODING 204
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+FF
+80
+80
+80
+80
+80
+80
+80
+80
+ENDCHAR
+STARTCHAR char205
+ENCODING 205
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+00
+00
+6C
+8A
+8A
+8A
+6C
+00
+00
+00
+00
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char206
+ENCODING 206
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+07
+04
+04
+04
+04
+04
+04
+04
+04
+04
+04
+04
+07
+03
+00
+ENDCHAR
+STARTCHAR char182
+ENCODING 207
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+01
+01
+01
+01
+01
+01
+01
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char191
+ENCODING 208
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+FF
+01
+01
+01
+01
+01
+01
+01
+01
+ENDCHAR
+STARTCHAR char209
+ENCODING 209
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+00
+00
+12
+1A
+16
+12
+12
+00
+00
+00
+00
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char210
+ENCODING 210
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7F
+7F
+7F
+7E
+7C
+78
+70
+60
+7F
+7F
+7F
+7F
+7F
+00
+ENDCHAR
+STARTCHAR char211
+ENCODING 211
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+FF
+ENDCHAR
+STARTCHAR char212
+ENCODING 212
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+FF
+ENDCHAR
+STARTCHAR char213
+ENCODING 213
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+01
+00
+00
+00
+00
+00
+00
+00
+00
+01
+FE
+00
+00
+00
+ENDCHAR
+STARTCHAR char214
+ENCODING 214
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+01
+00
+7C
+FE
+FE
+FE
+FE
+7C
+00
+01
+FE
+00
+00
+00
+ENDCHAR
+STARTCHAR char215
+ENCODING 215
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+7F
+7F
+7F
+7F
+7F
+60
+70
+78
+7C
+7E
+7F
+7F
+7F
+7F
+00
+ENDCHAR
+STARTCHAR char216
+ENCODING 216
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char217
+ENCODING 217
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+01
+02
+02
+04
+04
+04
+04
+02
+02
+01
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char218
+ENCODING 218
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+80
+ENDCHAR
+STARTCHAR char219
+ENCODING 219
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+ENDCHAR
+STARTCHAR char220
+ENCODING 220
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FF
+00
+01
+03
+06
+06
+CC
+6C
+38
+18
+00
+00
+FF
+FF
+00
+ENDCHAR
+STARTCHAR char221
+ENCODING 221
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+F0
+ENDCHAR
+STARTCHAR char222
+ENCODING 222
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+0F
+ENDCHAR
+STARTCHAR char223
+ENCODING 223
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+FF
+FF
+FF
+FF
+FF
+FF
+FF
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char224
+ENCODING 224
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+76
+DC
+D8
+D8
+D8
+DC
+76
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char225
+ENCODING 225
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+78
+CC
+CC
+CC
+D8
+CC
+C6
+C6
+C6
+CC
+00
+00
+00
+ENDCHAR
+STARTCHAR char226
+ENCODING 226
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+FE
+C6
+C6
+C6
+C0
+C0
+C0
+C0
+C0
+C0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char227
+ENCODING 227
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+FF
+36
+36
+36
+36
+36
+36
+36
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char228
+ENCODING 228
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+FE
+C6
+60
+30
+18
+30
+60
+C6
+FE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char229
+ENCODING 229
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7E
+D8
+D8
+D8
+D8
+D8
+70
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char230
+ENCODING 230
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+66
+66
+66
+66
+66
+7C
+60
+60
+C0
+00
+00
+00
+ENDCHAR
+STARTCHAR char231
+ENCODING 231
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+76
+DC
+18
+18
+18
+18
+18
+18
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char232
+ENCODING 232
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+FE
+FE
+FE
+7E
+3E
+1E
+0E
+06
+FE
+FE
+FE
+FE
+FE
+00
+ENDCHAR
+STARTCHAR char233
+ENCODING 233
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+FE
+FE
+FE
+FE
+06
+0E
+1E
+3E
+7E
+FE
+FE
+FE
+FE
+00
+ENDCHAR
+STARTCHAR char234
+ENCODING 234
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+38
+6C
+C6
+C6
+C6
+6C
+6C
+6C
+6C
+EE
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char235
+ENCODING 235
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+1E
+30
+18
+0C
+3E
+66
+66
+66
+66
+3C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char236
+ENCODING 236
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+7E
+DB
+DB
+DB
+7E
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char237
+ENCODING 237
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+03
+06
+7E
+DB
+DB
+F3
+7E
+60
+C0
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char238
+ENCODING 238
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+1C
+30
+60
+60
+7C
+60
+60
+60
+30
+1C
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char239
+ENCODING 239
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+7C
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+C6
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char240
+ENCODING 240
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+FE
+00
+00
+FE
+00
+00
+FE
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char241
+ENCODING 241
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+18
+18
+7E
+18
+18
+00
+00
+FF
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char242
+ENCODING 242
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+30
+18
+0C
+06
+0C
+18
+30
+00
+7E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char243
+ENCODING 243
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+0C
+18
+30
+60
+30
+18
+0C
+00
+7E
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char244
+ENCODING 244
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+FE
+FE
+FE
+FE
+FE
+FE
+7E
+7E
+FE
+FE
+FE
+FE
+FE
+FE
+00
+ENDCHAR
+STARTCHAR char245
+ENCODING 245
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+C0
+60
+60
+60
+60
+60
+60
+60
+60
+60
+60
+60
+E0
+E0
+00
+ENDCHAR
+STARTCHAR char246
+ENCODING 246
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+18
+18
+00
+7E
+00
+18
+18
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char247
+ENCODING 247
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+76
+DC
+00
+76
+DC
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char248
+ENCODING 248
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+38
+6C
+6C
+38
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char249
+ENCODING 249
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+18
+18
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char250
+ENCODING 250
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+18
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char251
+ENCODING 251
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+03
+03
+06
+06
+0C
+0C
+CC
+D8
+D8
+78
+38
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char252
+ENCODING 252
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+CC
+78
+30
+30
+78
+CC
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char253
+ENCODING 253
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+70
+D8
+30
+60
+C8
+F8
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char254
+ENCODING 254
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+7C
+7C
+7C
+7C
+7C
+7C
+7C
+00
+00
+00
+00
+00
+ENDCHAR
+STARTCHAR char255
+ENCODING 255
+SWIDTH 480 0
+DWIDTH 8 0
+BBX 8 16 0 -4
+BITMAP
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+00
+ENDCHAR
+ENDFONT
diff --git a/src/fonts/8x16graph.pcf.gz b/src/fonts/8x16graph.pcf.gz
new file mode 100644
index 00000000..b3ffe17c
Binary files /dev/null and b/src/fonts/8x16graph.pcf.gz differ
diff --git a/src/fonts/8x16std b/src/fonts/8x16std
new file mode 100644
index 00000000..24edd76c
Binary files /dev/null and b/src/fonts/8x16std differ
diff --git a/src/fonts/Makefile.am b/src/fonts/Makefile.am
new file mode 100644
index 00000000..715a7df1
--- /dev/null
+++ b/src/fonts/Makefile.am
@@ -0,0 +1,17 @@
+#----------------------------------------------------------------------
+# Makefile.am - the Final Cut library
+#----------------------------------------------------------------------
+
+EXTRA_DIST = \
+ 8x16graph.bdf \
+ 8x16graph.pcf.gz \
+ 8x16std \
+ bdf2c.sh \
+ bdf2pcf.sh \
+ font2c.sh \
+ fonts.alias \
+ fonts.dir \
+ Makefile.am \
+ newfont.h \
+ unicodemap.h \
+ vgafont.h
diff --git a/src/fonts/Makefile.in b/src/fonts/Makefile.in
new file mode 100644
index 00000000..79fcfcd8
--- /dev/null
+++ b/src/fonts/Makefile.in
@@ -0,0 +1,445 @@
+# Makefile.in generated by automake 1.13.4 from Makefile.am.
+# @configure_input@
+
+# Copyright (C) 1994-2013 Free Software Foundation, Inc.
+
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+@SET_MAKE@
+
+#----------------------------------------------------------------------
+# Makefile.am - the Final Cut library
+#----------------------------------------------------------------------
+VPATH = @srcdir@
+am__is_gnu_make = test -n '$(MAKEFILE_LIST)' && test -n '$(MAKELEVEL)'
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
+pkgdatadir = $(datadir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkglibexecdir = $(libexecdir)/@PACKAGE@
+am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd
+install_sh_DATA = $(install_sh) -c -m 644
+install_sh_PROGRAM = $(install_sh) -c
+install_sh_SCRIPT = $(install_sh) -c
+INSTALL_HEADER = $(INSTALL_DATA)
+transform = $(program_transform_name)
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+build_triplet = @build@
+host_triplet = @host@
+subdir = src/fonts
+DIST_COMMON = $(srcdir)/Makefile.in $(srcdir)/Makefile.am
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+am__aclocal_m4_deps = $(top_srcdir)/m4/libtool.m4 \
+ $(top_srcdir)/m4/ltoptions.m4 $(top_srcdir)/m4/ltsugar.m4 \
+ $(top_srcdir)/m4/ltversion.m4 $(top_srcdir)/m4/lt~obsolete.m4 \
+ $(top_srcdir)/configure.ac
+am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+ $(ACLOCAL_M4)
+mkinstalldirs = $(install_sh) -d
+CONFIG_CLEAN_FILES =
+CONFIG_CLEAN_VPATH_FILES =
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+SOURCES =
+DIST_SOURCES =
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST)
+ACLOCAL = @ACLOCAL@
+AMTAR = @AMTAR@
+AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@
+AR = @AR@
+AUTOCONF = @AUTOCONF@
+AUTOHEADER = @AUTOHEADER@
+AUTOMAKE = @AUTOMAKE@
+AWK = @AWK@
+CC = @CC@
+CCDEPMODE = @CCDEPMODE@
+CFLAGS = @CFLAGS@
+CPP = @CPP@
+CPPFLAGS = @CPPFLAGS@
+CXX = @CXX@
+CXXCPP = @CXXCPP@
+CXXDEPMODE = @CXXDEPMODE@
+CXXFLAGS = @CXXFLAGS@
+CYGPATH_W = @CYGPATH_W@
+DEFS = @DEFS@
+DEPDIR = @DEPDIR@
+DLLTOOL = @DLLTOOL@
+DSYMUTIL = @DSYMUTIL@
+DUMPBIN = @DUMPBIN@
+ECHO_C = @ECHO_C@
+ECHO_N = @ECHO_N@
+ECHO_T = @ECHO_T@
+EGREP = @EGREP@
+EXEEXT = @EXEEXT@
+FGREP = @FGREP@
+GREP = @GREP@
+INSTALL = @INSTALL@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@
+LD = @LD@
+LDFLAGS = @LDFLAGS@
+LIBOBJS = @LIBOBJS@
+LIBS = @LIBS@
+LIBTOOL = @LIBTOOL@
+LIBTOOL_DEPS = @LIBTOOL_DEPS@
+LIPO = @LIPO@
+LN_S = @LN_S@
+LTLIBOBJS = @LTLIBOBJS@
+MAKEINFO = @MAKEINFO@
+MANIFEST_TOOL = @MANIFEST_TOOL@
+MKDIR_P = @MKDIR_P@
+NM = @NM@
+NMEDIT = @NMEDIT@
+OBJDUMP = @OBJDUMP@
+OBJEXT = @OBJEXT@
+OTOOL = @OTOOL@
+OTOOL64 = @OTOOL64@
+PACKAGE = @PACKAGE@
+PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@
+PACKAGE_NAME = @PACKAGE_NAME@
+PACKAGE_STRING = @PACKAGE_STRING@
+PACKAGE_TARNAME = @PACKAGE_TARNAME@
+PACKAGE_URL = @PACKAGE_URL@
+PACKAGE_VERSION = @PACKAGE_VERSION@
+PATH_SEPARATOR = @PATH_SEPARATOR@
+RANLIB = @RANLIB@
+SED = @SED@
+SET_MAKE = @SET_MAKE@
+SHELL = @SHELL@
+SO_VERSION = @SO_VERSION@
+STRIP = @STRIP@
+VERSION = @VERSION@
+abs_builddir = @abs_builddir@
+abs_srcdir = @abs_srcdir@
+abs_top_builddir = @abs_top_builddir@
+abs_top_srcdir = @abs_top_srcdir@
+ac_ct_AR = @ac_ct_AR@
+ac_ct_CC = @ac_ct_CC@
+ac_ct_CXX = @ac_ct_CXX@
+ac_ct_DUMPBIN = @ac_ct_DUMPBIN@
+am__include = @am__include@
+am__leading_dot = @am__leading_dot@
+am__quote = @am__quote@
+am__tar = @am__tar@
+am__untar = @am__untar@
+bindir = @bindir@
+build = @build@
+build_alias = @build_alias@
+build_cpu = @build_cpu@
+build_os = @build_os@
+build_vendor = @build_vendor@
+builddir = @builddir@
+datadir = @datadir@
+datarootdir = @datarootdir@
+docdir = @docdir@
+dvidir = @dvidir@
+exec_prefix = @exec_prefix@
+host = @host@
+host_alias = @host_alias@
+host_cpu = @host_cpu@
+host_os = @host_os@
+host_vendor = @host_vendor@
+htmldir = @htmldir@
+includedir = @includedir@
+infodir = @infodir@
+install_sh = @install_sh@
+libdir = @libdir@
+libexecdir = @libexecdir@
+localedir = @localedir@
+localstatedir = @localstatedir@
+mandir = @mandir@
+mkdir_p = @mkdir_p@
+oldincludedir = @oldincludedir@
+pdfdir = @pdfdir@
+prefix = @prefix@
+program_transform_name = @program_transform_name@
+psdir = @psdir@
+sbindir = @sbindir@
+sharedstatedir = @sharedstatedir@
+srcdir = @srcdir@
+sysconfdir = @sysconfdir@
+target_alias = @target_alias@
+top_build_prefix = @top_build_prefix@
+top_builddir = @top_builddir@
+top_srcdir = @top_srcdir@
+EXTRA_DIST = \
+ 8x16graph.bdf \
+ 8x16graph.pcf.gz \
+ 8x16std \
+ bdf2c.sh \
+ bdf2pcf.sh \
+ font2c.sh \
+ fonts.alias \
+ fonts.dir \
+ Makefile.am \
+ newfont.h \
+ unicodemap.h \
+ vgafont.h
+
+all: all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps)
+ @for dep in $?; do \
+ case '$(am__configure_deps)' in \
+ *$$dep*) \
+ ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \
+ && { if test -f $@; then exit 0; else break; fi; }; \
+ exit 1;; \
+ esac; \
+ done; \
+ echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu src/fonts/Makefile'; \
+ $(am__cd) $(top_srcdir) && \
+ $(AUTOMAKE) --gnu src/fonts/Makefile
+.PRECIOUS: Makefile
+Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
+ @case '$?' in \
+ *config.status*) \
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \
+ *) \
+ echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
+ cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+ esac;
+
+$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+
+$(top_srcdir)/configure: $(am__configure_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(ACLOCAL_M4): $(am__aclocal_m4_deps)
+ cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
+$(am__aclocal_m4_deps):
+
+mostlyclean-libtool:
+ -rm -f *.lo
+
+clean-libtool:
+ -rm -rf .libs _libs
+tags TAGS:
+
+ctags CTAGS:
+
+cscope cscopelist:
+
+
+distdir: $(DISTFILES)
+ @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \
+ list='$(DISTFILES)'; \
+ dist_files=`for file in $$list; do echo $$file; done | \
+ sed -e "s|^$$srcdirstrip/||;t" \
+ -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \
+ case $$dist_files in \
+ */*) $(MKDIR_P) `echo "$$dist_files" | \
+ sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \
+ sort -u` ;; \
+ esac; \
+ for file in $$dist_files; do \
+ if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \
+ if test -d $$d/$$file; then \
+ dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \
+ if test -d "$(distdir)/$$file"; then \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \
+ cp -fpR $(srcdir)/$$file "$(distdir)$$dir" || exit 1; \
+ find "$(distdir)/$$file" -type d ! -perm -700 -exec chmod u+rwx {} \;; \
+ fi; \
+ cp -fpR $$d/$$file "$(distdir)$$dir" || exit 1; \
+ else \
+ test -f "$(distdir)/$$file" \
+ || cp -p $$d/$$file "$(distdir)/$$file" \
+ || exit 1; \
+ fi; \
+ done
+check-am: all-am
+check: check-am
+all-am: Makefile
+installdirs:
+install: install-am
+install-exec: install-exec-am
+install-data: install-data-am
+uninstall: uninstall-am
+
+install-am: all-am
+ @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am
+
+installcheck: installcheck-am
+install-strip:
+ if test -z '$(STRIP)'; then \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ install; \
+ else \
+ $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \
+ install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \
+ "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'" install; \
+ fi
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+ -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES)
+ -test . = "$(srcdir)" || test -z "$(CONFIG_CLEAN_VPATH_FILES)" || rm -f $(CONFIG_CLEAN_VPATH_FILES)
+
+maintainer-clean-generic:
+ @echo "This command is intended for maintainers to use"
+ @echo "it deletes files that may require special tools to rebuild."
+clean: clean-am
+
+clean-am: clean-generic clean-libtool mostlyclean-am
+
+distclean: distclean-am
+ -rm -f Makefile
+distclean-am: clean-am distclean-generic
+
+dvi: dvi-am
+
+dvi-am:
+
+html: html-am
+
+html-am:
+
+info: info-am
+
+info-am:
+
+install-data-am:
+
+install-dvi: install-dvi-am
+
+install-dvi-am:
+
+install-exec-am:
+
+install-html: install-html-am
+
+install-html-am:
+
+install-info: install-info-am
+
+install-info-am:
+
+install-man:
+
+install-pdf: install-pdf-am
+
+install-pdf-am:
+
+install-ps: install-ps-am
+
+install-ps-am:
+
+installcheck-am:
+
+maintainer-clean: maintainer-clean-am
+ -rm -f Makefile
+maintainer-clean-am: distclean-am maintainer-clean-generic
+
+mostlyclean: mostlyclean-am
+
+mostlyclean-am: mostlyclean-generic mostlyclean-libtool
+
+pdf: pdf-am
+
+pdf-am:
+
+ps: ps-am
+
+ps-am:
+
+uninstall-am:
+
+.MAKE: install-am install-strip
+
+.PHONY: all all-am check check-am clean clean-generic clean-libtool \
+ cscopelist-am ctags-am distclean distclean-generic \
+ distclean-libtool distdir dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am install-dvi \
+ install-dvi-am install-exec install-exec-am install-html \
+ install-html-am install-info install-info-am install-man \
+ install-pdf install-pdf-am install-ps install-ps-am \
+ install-strip installcheck installcheck-am installdirs \
+ maintainer-clean maintainer-clean-generic mostlyclean \
+ mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
+ tags-am uninstall uninstall-am
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/src/fonts/bdf2c.sh b/src/fonts/bdf2c.sh
new file mode 100755
index 00000000..0f1c6abc
--- /dev/null
+++ b/src/fonts/bdf2c.sh
@@ -0,0 +1,31 @@
+#!/bin/bash
+
+N=0
+HEIGHT=16
+FONTFILE="8x16graph.bdf"
+
+(
+ echo -e "// newfont.h\n"
+ echo -e "#ifndef _FNEWFONT_H"
+ echo -e "#define _FNEWFONT_H\n"
+ echo -e "\nstatic unsigned char __8x16graph[] =\n{"
+
+ grep -A${HEIGHT} ^BITMAP "$FONTFILE" \
+ | tr '\n' ',' \
+ | sed -e 's/BITMAP,//g' \
+ | sed -e 's/--,/\n/g' \
+ | tr '[A-Z]' '[a-z]' \
+ | sed -e 's/,/, /g' \
+ | sed -e 's/\([0-9a-f][0-9a-f]\)/0x\1/g' \
+ | sed -e 's/^0/ 0/g' \
+ | sed -e '$s/, $/ \n/' \
+ | while IFS=$'\n'; read LINE
+ do
+ echo "$LINE /* $N */"
+ let N++
+ done
+
+ echo -e "};"
+ echo -e "\n#endif // _FNEWFONT_H"
+) > newfont.h
+
diff --git a/src/fonts/bdf2pcf.sh b/src/fonts/bdf2pcf.sh
new file mode 100755
index 00000000..f7179653
--- /dev/null
+++ b/src/fonts/bdf2pcf.sh
@@ -0,0 +1,5 @@
+#!/bin/bash
+
+bdftopcf -o 8x16graph.pcf 8x16graph.bdf
+gzip -9 8x16graph.pcf
+
diff --git a/src/fonts/font2c.sh b/src/fonts/font2c.sh
new file mode 100755
index 00000000..e685c961
--- /dev/null
+++ b/src/fonts/font2c.sh
@@ -0,0 +1,28 @@
+#!/bin/bash
+
+N=0
+HEIGHT=16
+FONTFILE="8x16std"
+
+(
+ echo -e "// vgafont.h\n"
+ echo -e "#ifndef _FVGAFONT_H"
+ echo -e "#define _FVGAFONT_H\n"
+
+ xxd -g 1 -i -c $HEIGHT $FONTFILE \
+ | sed -e 's/ {$/\n{/' \
+ | sed -e 's/^unsigned/static unsigned/' \
+ | sed -e '/len = /d' \
+ | while IFS=$'\n'; read LINE
+ do
+ if [ "${LINE:0:1}" != " " ]
+ then
+ echo "$LINE"
+ else
+ echo "$LINE /* $N */" | sed -e 's/\([0-9]\) \/\*/\1 \/*/'
+ let N++
+ fi
+ done
+
+ echo -e "\n#endif // _FVGAFONT_H"
+) > vgafont.h
diff --git a/src/fonts/fonts.alias b/src/fonts/fonts.alias
new file mode 100644
index 00000000..23e67a51
--- /dev/null
+++ b/src/fonts/fonts.alias
@@ -0,0 +1,4 @@
+! fonts.alias
+8x16graph -misc-8x16graph-medium-r-normal--17-160-75-75-p-80-iso8859-1
+-misc-8x16graph-medium-r-normal--17-160-75-75-p-80-ibm-cp437 -misc-8x16graph-medium-r-normal--17-160-75-75-p-80-iso8859-1
+
diff --git a/src/fonts/fonts.dir b/src/fonts/fonts.dir
new file mode 100644
index 00000000..f313a672
--- /dev/null
+++ b/src/fonts/fonts.dir
@@ -0,0 +1,2 @@
+1
+8x16graph.pcf.gz -misc-8x16graph-medium-r-normal--17-160-75-75-p-80-iso8859-1
diff --git a/src/fonts/newfont.h b/src/fonts/newfont.h
new file mode 100644
index 00000000..3840813a
--- /dev/null
+++ b/src/fonts/newfont.h
@@ -0,0 +1,267 @@
+// newfont.h
+
+#ifndef _FNEWFONT_H
+#define _FNEWFONT_H
+
+
+static unsigned char __8x16graph[] =
+{
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 0 */
+ 0x00, 0x00, 0x7e, 0x81, 0xa5, 0x81, 0x81, 0xbd, 0x99, 0x81, 0x81, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 1 */
+ 0x00, 0x00, 0x7e, 0xff, 0xdb, 0xff, 0xff, 0xc3, 0xe7, 0xff, 0xff, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 2 */
+ 0x00, 0x00, 0x00, 0x00, 0x6c, 0xfe, 0xfe, 0xfe, 0xfe, 0x7c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, /* 3 */
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x7c, 0xfe, 0x7c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, /* 4 */
+ 0x00, 0x00, 0x00, 0x18, 0x3c, 0x3c, 0xe7, 0xe7, 0xe7, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 5 */
+ 0x00, 0x00, 0x00, 0x18, 0x3c, 0x7e, 0xff, 0xff, 0x7e, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 6 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x3c, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 7 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xe7, 0xc3, 0xc3, 0xe7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* 8 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0x66, 0x42, 0x42, 0x66, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, /* 9 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xc3, 0x99, 0xbd, 0xbd, 0x99, 0xc3, 0xff, 0xff, 0xff, 0xff, 0xff, /* 10 */
+ 0x00, 0x00, 0x1e, 0x0e, 0x1a, 0x32, 0x78, 0xcc, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, /* 11 */
+ 0x00, 0x00, 0x3c, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x7e, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 12 */
+ 0x00, 0x00, 0x3f, 0x33, 0x3f, 0x30, 0x30, 0x30, 0x30, 0x70, 0xf0, 0xe0, 0x00, 0x00, 0x00, 0x00, /* 13 */
+ 0x00, 0x00, 0x7f, 0x63, 0x7f, 0x63, 0x63, 0x63, 0x63, 0x67, 0xe7, 0xe6, 0xc0, 0x00, 0x00, 0x00, /* 14 */
+ 0x00, 0x00, 0x00, 0x18, 0x18, 0xdb, 0x3c, 0xe7, 0x3c, 0xdb, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 15 */
+ 0x00, 0x80, 0xc0, 0xe0, 0xf0, 0xf8, 0xfe, 0xf8, 0xf0, 0xe0, 0xc0, 0x80, 0x00, 0x00, 0x00, 0x00, /* 16 */
+ 0x00, 0x02, 0x06, 0x0e, 0x1e, 0x3e, 0xfe, 0x3e, 0x1e, 0x0e, 0x06, 0x02, 0x00, 0x00, 0x00, 0x00, /* 17 */
+ 0x00, 0x00, 0x18, 0x3c, 0x7e, 0x18, 0x18, 0x18, 0x7e, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, /* 18 */
+ 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x00, 0x66, 0x66, 0x00, 0x00, 0x00, 0x00, /* 19 */
+ 0x00, 0x00, 0x7f, 0xdb, 0xdb, 0xdb, 0x7b, 0x1b, 0x1b, 0x1b, 0x1b, 0x1b, 0x00, 0x00, 0x00, 0x00, /* 20 */
+ 0x00, 0x7c, 0xc6, 0x60, 0x38, 0x6c, 0xc6, 0xc6, 0x6c, 0x38, 0x0c, 0xc6, 0x7c, 0x00, 0x00, 0x00, /* 21 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 22 */
+ 0x00, 0x00, 0x18, 0x3c, 0x7e, 0x18, 0x18, 0x18, 0x7e, 0x3c, 0x18, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 23 */
+ 0x00, 0x00, 0x18, 0x3c, 0x7e, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 24 */
+ 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x7e, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, /* 25 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x0c, 0xfe, 0x0c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 26 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x60, 0xfe, 0x60, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 27 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc0, 0xc0, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 28 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x28, 0x6c, 0xfe, 0x6c, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 29 */
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x38, 0x7c, 0x7c, 0xfe, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, /* 30 */
+ 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0x7c, 0x7c, 0x38, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, /* 31 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 32 */
+ 0x00, 0x00, 0x18, 0x3c, 0x3c, 0x3c, 0x18, 0x18, 0x18, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 33 */
+ 0x00, 0x66, 0x66, 0x66, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 34 */
+ 0x00, 0x00, 0x00, 0x6c, 0x6c, 0xfe, 0x6c, 0x6c, 0x6c, 0xfe, 0x6c, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 35 */
+ 0x18, 0x18, 0x7c, 0xc6, 0xc2, 0xc0, 0x7c, 0x06, 0x06, 0x86, 0xc6, 0x7c, 0x18, 0x18, 0x00, 0x00, /* 36 */
+ 0x00, 0x00, 0x00, 0x00, 0xc2, 0xc6, 0x0c, 0x18, 0x30, 0x60, 0xc6, 0x86, 0x00, 0x00, 0x00, 0x00, /* 37 */
+ 0x00, 0x00, 0x38, 0x6c, 0x6c, 0x38, 0x76, 0xdc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 38 */
+ 0x00, 0x30, 0x30, 0x30, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 39 */
+ 0x00, 0x00, 0x0c, 0x18, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x18, 0x0c, 0x00, 0x00, 0x00, 0x00, /* 40 */
+ 0x00, 0x00, 0x30, 0x18, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x18, 0x30, 0x00, 0x00, 0x00, 0x00, /* 41 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x66, 0x3c, 0xff, 0x3c, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 42 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 43 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x18, 0x30, 0x00, 0x00, 0x00, /* 44 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 45 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 46 */
+ 0x00, 0x00, 0x00, 0x00, 0x02, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0x80, 0x00, 0x00, 0x00, 0x00, /* 47 */
+ 0x00, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xd6, 0xd6, 0xc6, 0xc6, 0x6c, 0x38, 0x00, 0x00, 0x00, 0x00, /* 48 */
+ 0x00, 0x00, 0x18, 0x38, 0x78, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 49 */
+ 0x00, 0x00, 0x7c, 0xc6, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 50 */
+ 0x00, 0x00, 0x7c, 0xc6, 0x06, 0x06, 0x3c, 0x06, 0x06, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 51 */
+ 0x00, 0x00, 0x0c, 0x1c, 0x3c, 0x6c, 0xcc, 0xfe, 0x0c, 0x0c, 0x0c, 0x1e, 0x00, 0x00, 0x00, 0x00, /* 52 */
+ 0x00, 0x00, 0xfe, 0xc0, 0xc0, 0xc0, 0xfc, 0x06, 0x06, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 53 */
+ 0x00, 0x00, 0x38, 0x60, 0xc0, 0xc0, 0xfc, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 54 */
+ 0x00, 0x00, 0xfe, 0xc6, 0x06, 0x06, 0x0c, 0x18, 0x30, 0x30, 0x30, 0x30, 0x00, 0x00, 0x00, 0x00, /* 55 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 56 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x06, 0x06, 0x0c, 0x78, 0x00, 0x00, 0x00, 0x00, /* 57 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, /* 58 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x18, 0x18, 0x30, 0x00, 0x00, 0x00, 0x00, /* 59 */
+ 0x00, 0x00, 0x00, 0x06, 0x0c, 0x18, 0x30, 0x60, 0x30, 0x18, 0x0c, 0x06, 0x00, 0x00, 0x00, 0x00, /* 60 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x00, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 61 */
+ 0x00, 0x00, 0x00, 0x60, 0x30, 0x18, 0x0c, 0x06, 0x0c, 0x18, 0x30, 0x60, 0x00, 0x00, 0x00, 0x00, /* 62 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0x0c, 0x18, 0x18, 0x18, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 63 */
+ 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xde, 0xde, 0xde, 0xdc, 0xc0, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 64 */
+ 0x00, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 65 */
+ 0x00, 0x00, 0xfc, 0x66, 0x66, 0x66, 0x7c, 0x66, 0x66, 0x66, 0x66, 0xfc, 0x00, 0x00, 0x00, 0x00, /* 66 */
+ 0x00, 0x00, 0x3c, 0x66, 0xc2, 0xc0, 0xc0, 0xc0, 0xc0, 0xc2, 0x66, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 67 */
+ 0x00, 0x00, 0xf8, 0x6c, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x6c, 0xf8, 0x00, 0x00, 0x00, 0x00, /* 68 */
+ 0x00, 0x00, 0xfe, 0x66, 0x62, 0x68, 0x78, 0x68, 0x60, 0x62, 0x66, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 69 */
+ 0x00, 0x00, 0xfe, 0x66, 0x62, 0x68, 0x78, 0x68, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 70 */
+ 0x00, 0x00, 0x3c, 0x66, 0xc2, 0xc0, 0xc0, 0xde, 0xc6, 0xc6, 0x66, 0x3a, 0x00, 0x00, 0x00, 0x00, /* 71 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 72 */
+ 0x00, 0x00, 0x3c, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 73 */
+ 0x00, 0x00, 0x1e, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, /* 74 */
+ 0x00, 0x00, 0xe6, 0x66, 0x66, 0x6c, 0x78, 0x78, 0x6c, 0x66, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 75 */
+ 0x00, 0x00, 0xf0, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x62, 0x66, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 76 */
+ 0x00, 0x00, 0xc6, 0xee, 0xfe, 0xfe, 0xd6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 77 */
+ 0x00, 0x00, 0xc6, 0xe6, 0xf6, 0xfe, 0xde, 0xce, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 78 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 79 */
+ 0x00, 0x00, 0xfc, 0x66, 0x66, 0x66, 0x7c, 0x60, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 80 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xd6, 0xde, 0x7c, 0x0c, 0x0e, 0x00, 0x00, /* 81 */
+ 0x00, 0x00, 0xfc, 0x66, 0x66, 0x66, 0x7c, 0x6c, 0x66, 0x66, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 82 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0x60, 0x38, 0x0c, 0x06, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 83 */
+ 0x00, 0x00, 0x7e, 0x7e, 0x5a, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 84 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 85 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x6c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, /* 86 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xfe, 0xee, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 87 */
+ 0x00, 0x00, 0xc6, 0xc6, 0x6c, 0x7c, 0x38, 0x38, 0x7c, 0x6c, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 88 */
+ 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 89 */
+ 0x00, 0x00, 0xfe, 0xc6, 0x86, 0x0c, 0x18, 0x30, 0x60, 0xc2, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 90 */
+ 0x00, 0x00, 0x3c, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 91 */
+ 0x00, 0x00, 0x00, 0x80, 0xc0, 0xe0, 0x70, 0x38, 0x1c, 0x0e, 0x06, 0x02, 0x00, 0x00, 0x00, 0x00, /* 92 */
+ 0x00, 0x00, 0x3c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 93 */
+ 0x10, 0x38, 0x6c, 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 94 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, /* 95 */
+ 0x30, 0x30, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 96 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 97 */
+ 0x00, 0x00, 0xe0, 0x60, 0x60, 0x78, 0x6c, 0x66, 0x66, 0x66, 0x66, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 98 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc0, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 99 */
+ 0x00, 0x00, 0x1c, 0x0c, 0x0c, 0x3c, 0x6c, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 100 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 101 */
+ 0x00, 0x00, 0x38, 0x6c, 0x64, 0x60, 0xf0, 0x60, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 102 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x7c, 0x0c, 0xcc, 0x78, 0x00, /* 103 */
+ 0x00, 0x00, 0xe0, 0x60, 0x60, 0x6c, 0x76, 0x66, 0x66, 0x66, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 104 */
+ 0x00, 0x00, 0x18, 0x18, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 105 */
+ 0x00, 0x00, 0x06, 0x06, 0x00, 0x0e, 0x06, 0x06, 0x06, 0x06, 0x06, 0x06, 0x66, 0x66, 0x3c, 0x00, /* 106 */
+ 0x00, 0x00, 0xe0, 0x60, 0x60, 0x66, 0x6c, 0x78, 0x78, 0x6c, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 107 */
+ 0x00, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 108 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xec, 0xfe, 0xd6, 0xd6, 0xd6, 0xd6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 109 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x00, 0x00, 0x00, 0x00, /* 110 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 111 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x66, 0x66, 0x66, 0x66, 0x66, 0x7c, 0x60, 0x60, 0xf0, 0x00, /* 112 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x7c, 0x0c, 0x0c, 0x1e, 0x00, /* 113 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x76, 0x66, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 114 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0x60, 0x38, 0x0c, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 115 */
+ 0x00, 0x00, 0x10, 0x30, 0x30, 0xfc, 0x30, 0x30, 0x30, 0x30, 0x36, 0x1c, 0x00, 0x00, 0x00, 0x00, /* 116 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 117 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, /* 118 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xfe, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 119 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0x6c, 0x38, 0x38, 0x38, 0x6c, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 120 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x0c, 0xf8, 0x00, /* 121 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xcc, 0x18, 0x30, 0x60, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 122 */
+ 0x00, 0x00, 0x0e, 0x18, 0x18, 0x18, 0x70, 0x18, 0x18, 0x18, 0x18, 0x0e, 0x00, 0x00, 0x00, 0x00, /* 123 */
+ 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, 0x00, 0x18, 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 124 */
+ 0x00, 0x00, 0x70, 0x18, 0x18, 0x18, 0x0e, 0x18, 0x18, 0x18, 0x18, 0x70, 0x00, 0x00, 0x00, 0x00, /* 125 */
+ 0x00, 0x00, 0x76, 0xdc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 126 */
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, /* 127 */
+ 0x00, 0x00, 0x3c, 0x66, 0xc2, 0xc0, 0xc0, 0xc0, 0xc2, 0x66, 0x3c, 0x0c, 0x06, 0x7c, 0x00, 0x00, /* 128 */
+ 0x00, 0x00, 0xcc, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 129 */
+ 0x00, 0x0c, 0x18, 0x30, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 130 */
+ 0x00, 0x10, 0x38, 0x6c, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 131 */
+ 0x00, 0x00, 0xcc, 0x00, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 132 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 133 */
+ 0x00, 0x38, 0x6c, 0x38, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 134 */
+ 0x00, 0x00, 0x00, 0x00, 0x3c, 0x66, 0x60, 0x60, 0x66, 0x3c, 0x0c, 0x06, 0x3c, 0x00, 0x00, 0x00, /* 135 */
+ 0x00, 0x10, 0x38, 0x6c, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 136 */
+ 0x00, 0x00, 0xc6, 0x00, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 137 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 138 */
+ 0x00, 0x00, 0x66, 0x00, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 139 */
+ 0x00, 0x18, 0x3c, 0x66, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 140 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 141 */
+ 0x00, 0xc6, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 142 */
+ 0x38, 0x6c, 0x38, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 143 */
+ 0x18, 0x30, 0x60, 0x00, 0xfe, 0x66, 0x60, 0x7c, 0x60, 0x60, 0x66, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 144 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0x76, 0x36, 0x7e, 0xd8, 0xd8, 0x6e, 0x00, 0x00, 0x00, 0x00, /* 145 */
+ 0x00, 0x00, 0x3e, 0x6c, 0xcc, 0xcc, 0xfe, 0xcc, 0xcc, 0xcc, 0xcc, 0xce, 0x00, 0x00, 0x00, 0x00, /* 146 */
+ 0x00, 0x10, 0x38, 0x6c, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 147 */
+ 0x00, 0x00, 0xc6, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 148 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 149 */
+ 0x00, 0x30, 0x78, 0xcc, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 150 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 151 */
+ 0x00, 0x00, 0xc6, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x0c, 0x78, 0x00, /* 152 */
+ 0x00, 0xc6, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 153 */
+ 0x00, 0xc6, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 154 */
+ 0x00, 0x18, 0x18, 0x3c, 0x66, 0x60, 0x60, 0x60, 0x66, 0x3c, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 155 */
+ 0x00, 0x38, 0x6c, 0x64, 0x60, 0xf0, 0x60, 0x60, 0x60, 0x60, 0xe6, 0xfc, 0x00, 0x00, 0x00, 0x00, /* 156 */
+ 0x00, 0x00, 0x66, 0x66, 0x3c, 0x18, 0x7e, 0x18, 0x7e, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 157 */
+ 0x00, 0xf8, 0xcc, 0xcc, 0xf8, 0xc4, 0xcc, 0xde, 0xcc, 0xcc, 0xcc, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 158 */
+ 0x00, 0x0e, 0x1b, 0x18, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x18, 0x18, 0x18, 0xd8, 0x70, 0x00, 0x00, /* 159 */
+ 0x00, 0x18, 0x30, 0x60, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 160 */
+ 0x00, 0x0c, 0x18, 0x30, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 161 */
+ 0x00, 0x18, 0x30, 0x60, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 162 */
+ 0x00, 0x18, 0x30, 0x60, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 163 */
+ 0x00, 0x00, 0x76, 0xdc, 0x00, 0xdc, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x00, 0x00, 0x00, 0x00, /* 164 */
+ 0x76, 0xdc, 0x00, 0xc6, 0xe6, 0xf6, 0xfe, 0xde, 0xce, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 165 */
+ 0x00, 0x3c, 0x6c, 0x6c, 0x3e, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 166 */
+ 0x00, 0x38, 0x6c, 0x6c, 0x38, 0x00, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 167 */
+ 0x00, 0x00, 0x30, 0x30, 0x00, 0x30, 0x30, 0x60, 0xc0, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 168 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, /* 169 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x06, 0x06, 0x06, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, /* 170 */
+ 0x00, 0xc0, 0xc0, 0xc2, 0xc6, 0xcc, 0x18, 0x30, 0x60, 0xdc, 0x86, 0x0c, 0x18, 0x3e, 0x00, 0x00, /* 171 */
+ 0x00, 0xc0, 0xc0, 0xc2, 0xc6, 0xcc, 0x18, 0x30, 0x66, 0xce, 0x9e, 0x3e, 0x06, 0x06, 0x00, 0x00, /* 172 */
+ 0x00, 0x00, 0x18, 0x18, 0x00, 0x18, 0x18, 0x18, 0x3c, 0x3c, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, /* 173 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x36, 0x6c, 0xd8, 0x6c, 0x36, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 174 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xd8, 0x6c, 0x36, 0x6c, 0xd8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 175 */
+ 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, /* 176 */
+ 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, /* 177 */
+ 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, /* 178 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 179 */
+ 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x02, 0x02, 0x02, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, /* 180 */
+ 0x00, 0xfe, 0xfe, 0xfe, 0x9e, 0x8e, 0x06, 0x02, 0x06, 0x8e, 0x9e, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, /* 181 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 182 */
+ 0x00, 0x00, 0x00, 0x80, 0x80, 0x40, 0x40, 0x40, 0x40, 0x80, 0x80, 0x00, 0x00, 0x00, 0x00, 0x00, /* 183 */
+ 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, /* 184 */
+ 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, /* 185 */
+ 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, /* 186 */
+ 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, /* 187 */
+ 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, /* 188 */
+ 0x00, 0xff, 0xff, 0x7f, 0x3f, 0x1f, 0x0f, 0x07, 0x3f, 0x3f, 0x3f, 0x3f, 0x3f, 0x3f, 0xff, 0x00, /* 189 */
+ 0x00, 0xff, 0x3f, 0x3f, 0x3f, 0x3f, 0x3f, 0x3f, 0x07, 0x0f, 0x1f, 0x3f, 0x7f, 0xff, 0xff, 0x00, /* 190 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 191 */
+ 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 192 */
+ 0x00, 0x7f, 0x7f, 0x7e, 0x7c, 0x78, 0x70, 0x60, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7f, 0x00, /* 193 */
+ 0x00, 0x7f, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x60, 0x70, 0x78, 0x7c, 0x7e, 0x7f, 0x7f, 0x00, /* 194 */
+ 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0xff, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, /* 195 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 196 */
+ 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, /* 197 */
+ 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0x00, /* 198 */
+ 0x00, 0xff, 0x00, 0x00, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0x00, /* 199 */
+ 0x00, 0x7f, 0x7f, 0x7f, 0x79, 0x71, 0x60, 0x40, 0x60, 0x71, 0x79, 0x7f, 0x7f, 0x7f, 0x7f, 0x00, /* 200 */
+ 0x00, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x40, 0x40, 0x40, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x00, /* 201 */
+ 0x00, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x7e, 0x7e, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x00, /* 202 */
+ 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, /* 203 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, /* 204 */
+ 0x00, 0xff, 0x00, 0x00, 0x6c, 0x8a, 0x8a, 0x8a, 0x6c, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0x00, /* 205 */
+ 0x00, 0x07, 0x04, 0x04, 0x04, 0x04, 0x04, 0x04, 0x04, 0x04, 0x04, 0x04, 0x04, 0x07, 0x03, 0x00, /* 206 */
+ 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 207 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, 0x01, /* 208 */
+ 0x00, 0xff, 0x00, 0x00, 0x12, 0x1a, 0x16, 0x12, 0x12, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0x00, /* 209 */
+ 0x00, 0x7f, 0x7f, 0x7f, 0x7f, 0x7e, 0x7c, 0x78, 0x70, 0x60, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x00, /* 210 */
+ 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0xff, /* 211 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, /* 212 */
+ 0x00, 0xfe, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0xfe, 0x00, 0x00, 0x00, /* 213 */
+ 0x00, 0xfe, 0x01, 0x00, 0x7c, 0xfe, 0xfe, 0xfe, 0xfe, 0x7c, 0x00, 0x01, 0xfe, 0x00, 0x00, 0x00, /* 214 */
+ 0x00, 0x7f, 0x7f, 0x7f, 0x7f, 0x7f, 0x60, 0x70, 0x78, 0x7c, 0x7e, 0x7f, 0x7f, 0x7f, 0x7f, 0x00, /* 215 */
+ 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 216 */
+ 0x00, 0x00, 0x01, 0x02, 0x02, 0x04, 0x04, 0x04, 0x04, 0x02, 0x02, 0x01, 0x00, 0x00, 0x00, 0x00, /* 217 */
+ 0xff, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, 0x80, /* 218 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* 219 */
+ 0x00, 0xff, 0x00, 0x01, 0x03, 0x06, 0x06, 0xcc, 0x6c, 0x38, 0x18, 0x00, 0x00, 0xff, 0xff, 0x00, /* 220 */
+ 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, /* 221 */
+ 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, /* 222 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 223 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0xd8, 0xd8, 0xd8, 0xdc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 224 */
+ 0x00, 0x00, 0x00, 0x78, 0xcc, 0xcc, 0xcc, 0xd8, 0xcc, 0xc6, 0xc6, 0xc6, 0xcc, 0x00, 0x00, 0x00, /* 225 */
+ 0x00, 0x00, 0xfe, 0xc6, 0xc6, 0xc6, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, /* 226 */
+ 0x00, 0x00, 0x00, 0x00, 0xff, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x00, 0x00, 0x00, 0x00, /* 227 */
+ 0x00, 0x00, 0x00, 0xfe, 0xc6, 0x60, 0x30, 0x18, 0x30, 0x60, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 228 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0xd8, 0xd8, 0xd8, 0xd8, 0xd8, 0x70, 0x00, 0x00, 0x00, 0x00, /* 229 */
+ 0x00, 0x00, 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x7c, 0x60, 0x60, 0xc0, 0x00, 0x00, 0x00, /* 230 */
+ 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 231 */
+ 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0x7e, 0x3e, 0x1e, 0x0e, 0x06, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, /* 232 */
+ 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x06, 0x0e, 0x1e, 0x3e, 0x7e, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, /* 233 */
+ 0x00, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0x6c, 0x6c, 0x6c, 0x6c, 0xee, 0x00, 0x00, 0x00, 0x00, /* 234 */
+ 0x00, 0x00, 0x1e, 0x30, 0x18, 0x0c, 0x3e, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 235 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0xdb, 0xdb, 0xdb, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 236 */
+ 0x00, 0x00, 0x00, 0x03, 0x06, 0x7e, 0xdb, 0xdb, 0xf3, 0x7e, 0x60, 0xc0, 0x00, 0x00, 0x00, 0x00, /* 237 */
+ 0x00, 0x00, 0x1c, 0x30, 0x60, 0x60, 0x7c, 0x60, 0x60, 0x60, 0x30, 0x1c, 0x00, 0x00, 0x00, 0x00, /* 238 */
+ 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 239 */
+ 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, /* 240 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, /* 241 */
+ 0x00, 0x00, 0x00, 0x30, 0x18, 0x0c, 0x06, 0x0c, 0x18, 0x30, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 242 */
+ 0x00, 0x00, 0x00, 0x0c, 0x18, 0x30, 0x60, 0x30, 0x18, 0x0c, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 243 */
+ 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x7e, 0x7e, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, /* 244 */
+ 0x00, 0xc0, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0xe0, 0xe0, 0x00, /* 245 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x7e, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, /* 246 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0x00, 0x76, 0xdc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 247 */
+ 0x00, 0x38, 0x6c, 0x6c, 0x38, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 248 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 249 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 250 */
+ 0x00, 0x03, 0x03, 0x06, 0x06, 0x0c, 0x0c, 0xcc, 0xd8, 0xd8, 0x78, 0x38, 0x00, 0x00, 0x00, 0x00, /* 251 */
+ 0x00, 0xcc, 0x78, 0x30, 0x30, 0x78, 0xcc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 252 */
+ 0x00, 0x70, 0xd8, 0x30, 0x60, 0xc8, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 253 */
+ 0x00, 0x00, 0x00, 0x00, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, /* 254 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 /* 255 */
+};
+
+#endif // _FNEWFONT_H
diff --git a/src/fonts/unicodemap.h b/src/fonts/unicodemap.h
new file mode 100644
index 00000000..d63fed5a
--- /dev/null
+++ b/src/fonts/unicodemap.h
@@ -0,0 +1,316 @@
+// unicodemap.h
+
+#ifndef _FUNICODEMAP_H
+#define _FUNICODEMAP_H
+
+static struct unipair unicode_cp437_pairs[] =
+{
+ // .----------- unicode
+ // | .---- fontpos
+ // | |
+ {0x0000, 0x00},
+ {0x0020, 0x20},
+ {0x0021, 0x21},
+ {0x0022, 0x22},
+ {0x0023, 0x23},
+ {0x0024, 0x24},
+ {0x0025, 0x25},
+ {0x0026, 0x26},
+ {0x0027, 0x27},
+ {0x0028, 0x28},
+ {0x0029, 0x29},
+ {0x002a, 0x2a},
+ {0x002b, 0x2b},
+ {0x002c, 0x2c},
+ {0x002d, 0x2d},
+ {0x002e, 0x2e},
+ {0x002f, 0x2f},
+ {0x0030, 0x30},
+ {0x0031, 0x31},
+ {0x0032, 0x32},
+ {0x0033, 0x33},
+ {0x0034, 0x34},
+ {0x0035, 0x35},
+ {0x0036, 0x36},
+ {0x0037, 0x37},
+ {0x0038, 0x38},
+ {0x0039, 0x39},
+ {0x003a, 0x3a},
+ {0x003b, 0x3b},
+ {0x003c, 0x3c},
+ {0x003d, 0x3d},
+ {0x003e, 0x3e},
+ {0x003f, 0x3f},
+ {0x0040, 0x40},
+ {0x0041, 0x41},
+ {0x0042, 0x42},
+ {0x0043, 0x43},
+ {0x0044, 0x44},
+ {0x0045, 0x45},
+ {0x0046, 0x46},
+ {0x0047, 0x47},
+ {0x0048, 0x48},
+ {0x0049, 0x49},
+ {0x004a, 0x4a},
+ {0x004b, 0x4b},
+ {0x004c, 0x4c},
+ {0x004d, 0x4d},
+ {0x004e, 0x4e},
+ {0x004f, 0x4f},
+ {0x0050, 0x50},
+ {0x0051, 0x51},
+ {0x0052, 0x52},
+ {0x0053, 0x53},
+ {0x0054, 0x54},
+ {0x0055, 0x55},
+ {0x0056, 0x56},
+ {0x0057, 0x57},
+ {0x0058, 0x58},
+ {0x0059, 0x59},
+ {0x005a, 0x5a},
+ {0x005b, 0x5b},
+ {0x005c, 0x5c},
+ {0x005d, 0x5d},
+ {0x005e, 0x5e},
+ {0x005f, 0x5f},
+ {0x0060, 0x60},
+ {0x0061, 0x61},
+ {0x0062, 0x62},
+ {0x0063, 0x63},
+ {0x0064, 0x64},
+ {0x0065, 0x65},
+ {0x0066, 0x66},
+ {0x0067, 0x67},
+ {0x0068, 0x68},
+ {0x0069, 0x69},
+ {0x006a, 0x6a},
+ {0x006b, 0x6b},
+ {0x006c, 0x6c},
+ {0x006d, 0x6d},
+ {0x006e, 0x6e},
+ {0x006f, 0x6f},
+ {0x0070, 0x70},
+ {0x0071, 0x71},
+ {0x0072, 0x72},
+ {0x0073, 0x73},
+ {0x0074, 0x74},
+ {0x0075, 0x75},
+ {0x0076, 0x76},
+ {0x0077, 0x77},
+ {0x0078, 0x78},
+ {0x0079, 0x79},
+ {0x007a, 0x7a},
+ {0x007b, 0x7b},
+ {0x007c, 0x7c},
+ {0x007d, 0x7d},
+ {0x007e, 0x7e},
+ {0x00a0, 0xff},
+ {0x00a1, 0xad},
+ {0x00a2, 0x9b},
+ {0x00a3, 0x9c},
+ {0x00a4, 0x0f},
+ {0x00a5, 0x9d},
+ {0x00a6, 0x7c},
+ {0x00a7, 0x15},
+ {0x00a8, 0x22},
+ {0x00a9, 0x43},
+ {0x00aa, 0xa6},
+ {0x00ab, 0xae},
+ {0x00ac, 0xaa},
+ {0x00ad, 0x2d},
+ {0x00ae, 0x52},
+ {0x00b0, 0xf8},
+ {0x00b1, 0xf1},
+ {0x00b2, 0xfd},
+ {0x00b4, 0x27},
+ {0x00b5, 0xe6},
+ {0x00b6, 0x14},
+ {0x00b7, 0xfa},
+ {0x00b8, 0x2c},
+ {0x00ba, 0xa7},
+ {0x00bb, 0xaf},
+ {0x00bc, 0xac},
+ {0x00bd, 0xab},
+ {0x00bf, 0xa8},
+ {0x00c0, 0x41},
+ {0x00c1, 0x41},
+ {0x00c2, 0x41},
+ {0x00c3, 0x41},
+ {0x00c4, 0x8e},
+ {0x00c5, 0x8f},
+ {0x00c6, 0x92},
+ {0x00c7, 0x80},
+ {0x00c8, 0x45},
+ {0x00c9, 0x90},
+ {0x00ca, 0x45},
+ {0x00cb, 0x45},
+ {0x00cc, 0x49},
+ {0x00cd, 0x49},
+ {0x00ce, 0x49},
+ {0x00cf, 0x49},
+ {0x00d0, 0x44},
+ {0x00d1, 0xa5},
+ {0x00d2, 0x4f},
+ {0x00d3, 0x4f},
+ {0x00d4, 0x4f},
+ {0x00d5, 0x4f},
+ {0x00d6, 0x99},
+ {0x00d7, 0x78},
+ {0x00d8, 0xe8},
+ {0x00d9, 0x55},
+ {0x00da, 0x55},
+ {0x00db, 0x55},
+ {0x00dc, 0x9a},
+ {0x00dd, 0x59},
+ {0x00df, 0xe1},
+ {0x00e0, 0x85},
+ {0x00e1, 0xa0},
+ {0x00e2, 0x83},
+ {0x00e3, 0x61},
+ {0x00e4, 0x84},
+ {0x00e5, 0x86},
+ {0x00e6, 0x91},
+ {0x00e7, 0x87},
+ {0x00e8, 0x8a},
+ {0x00e9, 0x82},
+ {0x00ea, 0x88},
+ {0x00eb, 0x89},
+ {0x00ec, 0x8d},
+ {0x00ed, 0xa1},
+ {0x00ee, 0x8c},
+ {0x00ef, 0x8b},
+ {0x00f0, 0xeb},
+ {0x00f1, 0xa4},
+ {0x00f2, 0x95},
+ {0x00f3, 0xa2},
+ {0x00f4, 0x93},
+ {0x00f5, 0x6f},
+ {0x00f6, 0x94},
+ {0x00f7, 0xf6},
+ {0x00f8, 0xed},
+ {0x00f9, 0x97},
+ {0x00fa, 0xa3},
+ {0x00fb, 0x96},
+ {0x00fc, 0x81},
+ {0x00fd, 0x79},
+ {0x00ff, 0x98},
+ {0x0192, 0x9f},
+ {0x0393, 0xe2},
+ {0x0398, 0xe9},
+ {0x03a3, 0xe4},
+ {0x03a6, 0xe8},
+ {0x03a9, 0xea},
+ {0x03b1, 0xe0},
+ {0x03b2, 0xe1},
+ {0x03b4, 0xeb},
+ {0x03b5, 0xee},
+ {0x03bc, 0xe6},
+ {0x03c0, 0xe3},
+ {0x03c3, 0xe5},
+ {0x03c4, 0xe7},
+ {0x03c6, 0xed},
+ {0x2022, 0x07},
+ {0x203c, 0x13},
+ {0x207f, 0xfc},
+ {0x20a7, 0x9e},
+ {0x2126, 0xea},
+ {0x212a, 0x4b},
+ {0x212b, 0x8f},
+ {0x2190, 0x1b},
+ {0x2191, 0x18},
+ {0x2192, 0x1a},
+ {0x2193, 0x19},
+ {0x2194, 0x1d},
+ {0x2195, 0x12},
+ {0x21a8, 0x17},
+ {0x2208, 0xee},
+ {0x2219, 0xf9},
+ {0x221a, 0xfb},
+ {0x221e, 0xec},
+ {0x221f, 0x1c},
+ {0x2229, 0xef},
+ {0x2248, 0xf7},
+ {0x2261, 0xf0},
+ {0x2264, 0xf3},
+ {0x2265, 0xf2},
+ {0x2302, 0x7f},
+ {0x2310, 0xa9},
+ {0x2320, 0xf4},
+ {0x2321, 0xf5},
+ {0x23bd, 0x5f},
+ {0x2500, 0xc4},
+ {0x2502, 0xb3},
+ {0x250c, 0xda},
+ {0x2510, 0xbf},
+ {0x2514, 0xc0},
+ {0x2518, 0xd9},
+ {0x251c, 0xc3},
+ {0x2524, 0xb4},
+ {0x252c, 0xc2},
+ {0x2534, 0xc1},
+ {0x253c, 0xc5},
+ {0x2550, 0xcd},
+ {0x2551, 0xba},
+ {0x2552, 0xd5},
+ {0x2553, 0xd6},
+ {0x2554, 0xc9},
+ {0x2555, 0xb8},
+ {0x2556, 0xb7},
+ {0x2557, 0xbb},
+ {0x2558, 0xd4},
+ {0x2559, 0xd3},
+ {0x255a, 0xc8},
+ {0x255b, 0xbe},
+ {0x255c, 0xbd},
+ {0x255d, 0xbc},
+ {0x255e, 0xc6},
+ {0x255f, 0xc7},
+ {0x2560, 0xcc},
+ {0x2561, 0xb5},
+ {0x2562, 0xb6},
+ {0x2563, 0xb9},
+ {0x2564, 0xd1},
+ {0x2565, 0xd2},
+ {0x2566, 0xcb},
+ {0x2567, 0xcf},
+ {0x2568, 0xd0},
+ {0x2569, 0xca},
+ {0x256a, 0xd8},
+ {0x256b, 0xd7},
+ {0x256c, 0xce},
+ {0x2580, 0xdf},
+ {0x2584, 0xdc},
+ {0x2588, 0xdb},
+ {0x258c, 0xdd},
+ {0x2590, 0xde},
+ {0x2591, 0xb0},
+ {0x2592, 0xb1},
+ {0x2593, 0xb2},
+ {0x25a0, 0xfe},
+ {0x25ac, 0x16},
+ {0x25b2, 0x1e},
+ {0x25b6, 0x10},
+ {0x25ba, 0x10},
+ {0x25bc, 0x1f},
+ {0x25c0, 0x11},
+ {0x25c4, 0x11},
+ {0x25c6, 0x04},
+ {0x25cb, 0x09},
+ {0x25d8, 0x08},
+ {0x25d9, 0x0a},
+ {0x263a, 0x01},
+ {0x263b, 0x02},
+ {0x263c, 0x0f},
+ {0x2640, 0x0c},
+ {0x2642, 0x0b},
+ {0x2660, 0x06},
+ {0x2663, 0x05},
+ {0x2665, 0x03},
+ {0x2666, 0x04},
+ {0x266a, 0x0d},
+ {0x266b, 0x0e},
+ {0xf804, 0x5f},
+ {0xfffd, 0xfe}
+};
+
+#endif // _FUNICODEMAP_H
diff --git a/src/fonts/vgafont.h b/src/fonts/vgafont.h
new file mode 100644
index 00000000..d34a101c
--- /dev/null
+++ b/src/fonts/vgafont.h
@@ -0,0 +1,266 @@
+// vgafont.h
+
+#ifndef _FVGAFONT_H
+#define _FVGAFONT_H
+
+static unsigned char __8x16std[] =
+{
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 0 */
+ 0x00, 0x00, 0x7e, 0x81, 0xa5, 0x81, 0x81, 0xbd, 0x99, 0x81, 0x81, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 1 */
+ 0x00, 0x00, 0x7e, 0xff, 0xdb, 0xff, 0xff, 0xc3, 0xe7, 0xff, 0xff, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 2 */
+ 0x00, 0x00, 0x00, 0x00, 0x6c, 0xfe, 0xfe, 0xfe, 0xfe, 0x7c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, /* 3 */
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x7c, 0xfe, 0x7c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, /* 4 */
+ 0x00, 0x00, 0x00, 0x18, 0x3c, 0x3c, 0xe7, 0xe7, 0xe7, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 5 */
+ 0x00, 0x00, 0x00, 0x18, 0x3c, 0x7e, 0xff, 0xff, 0x7e, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 6 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x3c, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 7 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xe7, 0xc3, 0xc3, 0xe7, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* 8 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c, 0x66, 0x42, 0x42, 0x66, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, /* 9 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xc3, 0x99, 0xbd, 0xbd, 0x99, 0xc3, 0xff, 0xff, 0xff, 0xff, 0xff, /* 10 */
+ 0x00, 0x00, 0x1e, 0x0e, 0x1a, 0x32, 0x78, 0xcc, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, /* 11 */
+ 0x00, 0x00, 0x3c, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x7e, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 12 */
+ 0x00, 0x00, 0x3f, 0x33, 0x3f, 0x30, 0x30, 0x30, 0x30, 0x70, 0xf0, 0xe0, 0x00, 0x00, 0x00, 0x00, /* 13 */
+ 0x00, 0x00, 0x7f, 0x63, 0x7f, 0x63, 0x63, 0x63, 0x63, 0x67, 0xe7, 0xe6, 0xc0, 0x00, 0x00, 0x00, /* 14 */
+ 0x00, 0x00, 0x00, 0x18, 0x18, 0xdb, 0x3c, 0xe7, 0x3c, 0xdb, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 15 */
+ 0x00, 0x80, 0xc0, 0xe0, 0xf0, 0xf8, 0xfe, 0xf8, 0xf0, 0xe0, 0xc0, 0x80, 0x00, 0x00, 0x00, 0x00, /* 16 */
+ 0x00, 0x02, 0x06, 0x0e, 0x1e, 0x3e, 0xfe, 0x3e, 0x1e, 0x0e, 0x06, 0x02, 0x00, 0x00, 0x00, 0x00, /* 17 */
+ 0x00, 0x00, 0x18, 0x3c, 0x7e, 0x18, 0x18, 0x18, 0x7e, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, /* 18 */
+ 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x00, 0x66, 0x66, 0x00, 0x00, 0x00, 0x00, /* 19 */
+ 0x00, 0x00, 0x7f, 0xdb, 0xdb, 0xdb, 0x7b, 0x1b, 0x1b, 0x1b, 0x1b, 0x1b, 0x00, 0x00, 0x00, 0x00, /* 20 */
+ 0x00, 0x7c, 0xc6, 0x60, 0x38, 0x6c, 0xc6, 0xc6, 0x6c, 0x38, 0x0c, 0xc6, 0x7c, 0x00, 0x00, 0x00, /* 21 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0xfe, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 22 */
+ 0x00, 0x00, 0x18, 0x3c, 0x7e, 0x18, 0x18, 0x18, 0x7e, 0x3c, 0x18, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 23 */
+ 0x00, 0x00, 0x18, 0x3c, 0x7e, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 24 */
+ 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x7e, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, /* 25 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x0c, 0xfe, 0x0c, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 26 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x30, 0x60, 0xfe, 0x60, 0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 27 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc0, 0xc0, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 28 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x28, 0x6c, 0xfe, 0x6c, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 29 */
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x38, 0x7c, 0x7c, 0xfe, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, /* 30 */
+ 0x00, 0x00, 0x00, 0x00, 0xfe, 0xfe, 0x7c, 0x7c, 0x38, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, 0x00, /* 31 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 32 */
+ 0x00, 0x00, 0x18, 0x3c, 0x3c, 0x3c, 0x18, 0x18, 0x18, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 33 */
+ 0x00, 0x66, 0x66, 0x66, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 34 */
+ 0x00, 0x00, 0x00, 0x6c, 0x6c, 0xfe, 0x6c, 0x6c, 0x6c, 0xfe, 0x6c, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 35 */
+ 0x18, 0x18, 0x7c, 0xc6, 0xc2, 0xc0, 0x7c, 0x06, 0x06, 0x86, 0xc6, 0x7c, 0x18, 0x18, 0x00, 0x00, /* 36 */
+ 0x00, 0x00, 0x00, 0x00, 0xc2, 0xc6, 0x0c, 0x18, 0x30, 0x60, 0xc6, 0x86, 0x00, 0x00, 0x00, 0x00, /* 37 */
+ 0x00, 0x00, 0x38, 0x6c, 0x6c, 0x38, 0x76, 0xdc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 38 */
+ 0x00, 0x30, 0x30, 0x30, 0x60, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 39 */
+ 0x00, 0x00, 0x0c, 0x18, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x18, 0x0c, 0x00, 0x00, 0x00, 0x00, /* 40 */
+ 0x00, 0x00, 0x30, 0x18, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x18, 0x30, 0x00, 0x00, 0x00, 0x00, /* 41 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x66, 0x3c, 0xff, 0x3c, 0x66, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 42 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 43 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x18, 0x30, 0x00, 0x00, 0x00, /* 44 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 45 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 46 */
+ 0x00, 0x00, 0x00, 0x00, 0x02, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0x80, 0x00, 0x00, 0x00, 0x00, /* 47 */
+ 0x00, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xd6, 0xd6, 0xc6, 0xc6, 0x6c, 0x38, 0x00, 0x00, 0x00, 0x00, /* 48 */
+ 0x00, 0x00, 0x18, 0x38, 0x78, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 49 */
+ 0x00, 0x00, 0x7c, 0xc6, 0x06, 0x0c, 0x18, 0x30, 0x60, 0xc0, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 50 */
+ 0x00, 0x00, 0x7c, 0xc6, 0x06, 0x06, 0x3c, 0x06, 0x06, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 51 */
+ 0x00, 0x00, 0x0c, 0x1c, 0x3c, 0x6c, 0xcc, 0xfe, 0x0c, 0x0c, 0x0c, 0x1e, 0x00, 0x00, 0x00, 0x00, /* 52 */
+ 0x00, 0x00, 0xfe, 0xc0, 0xc0, 0xc0, 0xfc, 0x06, 0x06, 0x06, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 53 */
+ 0x00, 0x00, 0x38, 0x60, 0xc0, 0xc0, 0xfc, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 54 */
+ 0x00, 0x00, 0xfe, 0xc6, 0x06, 0x06, 0x0c, 0x18, 0x30, 0x30, 0x30, 0x30, 0x00, 0x00, 0x00, 0x00, /* 55 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 56 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x06, 0x06, 0x0c, 0x78, 0x00, 0x00, 0x00, 0x00, /* 57 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, /* 58 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x18, 0x18, 0x30, 0x00, 0x00, 0x00, 0x00, /* 59 */
+ 0x00, 0x00, 0x00, 0x06, 0x0c, 0x18, 0x30, 0x60, 0x30, 0x18, 0x0c, 0x06, 0x00, 0x00, 0x00, 0x00, /* 60 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0x00, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 61 */
+ 0x00, 0x00, 0x00, 0x60, 0x30, 0x18, 0x0c, 0x06, 0x0c, 0x18, 0x30, 0x60, 0x00, 0x00, 0x00, 0x00, /* 62 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0x0c, 0x18, 0x18, 0x18, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 63 */
+ 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xde, 0xde, 0xde, 0xdc, 0xc0, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 64 */
+ 0x00, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 65 */
+ 0x00, 0x00, 0xfc, 0x66, 0x66, 0x66, 0x7c, 0x66, 0x66, 0x66, 0x66, 0xfc, 0x00, 0x00, 0x00, 0x00, /* 66 */
+ 0x00, 0x00, 0x3c, 0x66, 0xc2, 0xc0, 0xc0, 0xc0, 0xc0, 0xc2, 0x66, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 67 */
+ 0x00, 0x00, 0xf8, 0x6c, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x6c, 0xf8, 0x00, 0x00, 0x00, 0x00, /* 68 */
+ 0x00, 0x00, 0xfe, 0x66, 0x62, 0x68, 0x78, 0x68, 0x60, 0x62, 0x66, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 69 */
+ 0x00, 0x00, 0xfe, 0x66, 0x62, 0x68, 0x78, 0x68, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 70 */
+ 0x00, 0x00, 0x3c, 0x66, 0xc2, 0xc0, 0xc0, 0xde, 0xc6, 0xc6, 0x66, 0x3a, 0x00, 0x00, 0x00, 0x00, /* 71 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 72 */
+ 0x00, 0x00, 0x3c, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 73 */
+ 0x00, 0x00, 0x1e, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0xcc, 0xcc, 0xcc, 0x78, 0x00, 0x00, 0x00, 0x00, /* 74 */
+ 0x00, 0x00, 0xe6, 0x66, 0x66, 0x6c, 0x78, 0x78, 0x6c, 0x66, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 75 */
+ 0x00, 0x00, 0xf0, 0x60, 0x60, 0x60, 0x60, 0x60, 0x60, 0x62, 0x66, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 76 */
+ 0x00, 0x00, 0xc6, 0xee, 0xfe, 0xfe, 0xd6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 77 */
+ 0x00, 0x00, 0xc6, 0xe6, 0xf6, 0xfe, 0xde, 0xce, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 78 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 79 */
+ 0x00, 0x00, 0xfc, 0x66, 0x66, 0x66, 0x7c, 0x60, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 80 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xd6, 0xde, 0x7c, 0x0c, 0x0e, 0x00, 0x00, /* 81 */
+ 0x00, 0x00, 0xfc, 0x66, 0x66, 0x66, 0x7c, 0x6c, 0x66, 0x66, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 82 */
+ 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0x60, 0x38, 0x0c, 0x06, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 83 */
+ 0x00, 0x00, 0x7e, 0x7e, 0x5a, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 84 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 85 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x6c, 0x38, 0x10, 0x00, 0x00, 0x00, 0x00, /* 86 */
+ 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xfe, 0xee, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 87 */
+ 0x00, 0x00, 0xc6, 0xc6, 0x6c, 0x7c, 0x38, 0x38, 0x7c, 0x6c, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 88 */
+ 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 89 */
+ 0x00, 0x00, 0xfe, 0xc6, 0x86, 0x0c, 0x18, 0x30, 0x60, 0xc2, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 90 */
+ 0x00, 0x00, 0x3c, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x30, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 91 */
+ 0x00, 0x00, 0x00, 0x80, 0xc0, 0xe0, 0x70, 0x38, 0x1c, 0x0e, 0x06, 0x02, 0x00, 0x00, 0x00, 0x00, /* 92 */
+ 0x00, 0x00, 0x3c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 93 */
+ 0x10, 0x38, 0x6c, 0xc6, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 94 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, /* 95 */
+ 0x30, 0x30, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 96 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 97 */
+ 0x00, 0x00, 0xe0, 0x60, 0x60, 0x78, 0x6c, 0x66, 0x66, 0x66, 0x66, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 98 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc0, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 99 */
+ 0x00, 0x00, 0x1c, 0x0c, 0x0c, 0x3c, 0x6c, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 100 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 101 */
+ 0x00, 0x00, 0x38, 0x6c, 0x64, 0x60, 0xf0, 0x60, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 102 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x7c, 0x0c, 0xcc, 0x78, 0x00, /* 103 */
+ 0x00, 0x00, 0xe0, 0x60, 0x60, 0x6c, 0x76, 0x66, 0x66, 0x66, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 104 */
+ 0x00, 0x00, 0x18, 0x18, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 105 */
+ 0x00, 0x00, 0x06, 0x06, 0x00, 0x0e, 0x06, 0x06, 0x06, 0x06, 0x06, 0x06, 0x66, 0x66, 0x3c, 0x00, /* 106 */
+ 0x00, 0x00, 0xe0, 0x60, 0x60, 0x66, 0x6c, 0x78, 0x78, 0x6c, 0x66, 0xe6, 0x00, 0x00, 0x00, 0x00, /* 107 */
+ 0x00, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 108 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xec, 0xfe, 0xd6, 0xd6, 0xd6, 0xd6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 109 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x00, 0x00, 0x00, 0x00, /* 110 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 111 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x66, 0x66, 0x66, 0x66, 0x66, 0x7c, 0x60, 0x60, 0xf0, 0x00, /* 112 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x7c, 0x0c, 0x0c, 0x1e, 0x00, /* 113 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xdc, 0x76, 0x66, 0x60, 0x60, 0x60, 0xf0, 0x00, 0x00, 0x00, 0x00, /* 114 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7c, 0xc6, 0x60, 0x38, 0x0c, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 115 */
+ 0x00, 0x00, 0x10, 0x30, 0x30, 0xfc, 0x30, 0x30, 0x30, 0x30, 0x36, 0x1c, 0x00, 0x00, 0x00, 0x00, /* 116 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 117 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, /* 118 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xd6, 0xd6, 0xd6, 0xfe, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 119 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0x6c, 0x38, 0x38, 0x38, 0x6c, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 120 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x0c, 0xf8, 0x00, /* 121 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xcc, 0x18, 0x30, 0x60, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 122 */
+ 0x00, 0x00, 0x0e, 0x18, 0x18, 0x18, 0x70, 0x18, 0x18, 0x18, 0x18, 0x0e, 0x00, 0x00, 0x00, 0x00, /* 123 */
+ 0x00, 0x00, 0x18, 0x18, 0x18, 0x18, 0x00, 0x18, 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 124 */
+ 0x00, 0x00, 0x70, 0x18, 0x18, 0x18, 0x0e, 0x18, 0x18, 0x18, 0x18, 0x70, 0x00, 0x00, 0x00, 0x00, /* 125 */
+ 0x00, 0x00, 0x76, 0xdc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 126 */
+ 0x00, 0x00, 0x00, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, /* 127 */
+ 0x00, 0x00, 0x3c, 0x66, 0xc2, 0xc0, 0xc0, 0xc0, 0xc2, 0x66, 0x3c, 0x0c, 0x06, 0x7c, 0x00, 0x00, /* 128 */
+ 0x00, 0x00, 0xcc, 0x00, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 129 */
+ 0x00, 0x0c, 0x18, 0x30, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 130 */
+ 0x00, 0x10, 0x38, 0x6c, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 131 */
+ 0x00, 0x00, 0xcc, 0x00, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 132 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 133 */
+ 0x00, 0x38, 0x6c, 0x38, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 134 */
+ 0x00, 0x00, 0x00, 0x00, 0x3c, 0x66, 0x60, 0x60, 0x66, 0x3c, 0x0c, 0x06, 0x3c, 0x00, 0x00, 0x00, /* 135 */
+ 0x00, 0x10, 0x38, 0x6c, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 136 */
+ 0x00, 0x00, 0xc6, 0x00, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 137 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x7c, 0xc6, 0xfe, 0xc0, 0xc0, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 138 */
+ 0x00, 0x00, 0x66, 0x00, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 139 */
+ 0x00, 0x18, 0x3c, 0x66, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 140 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 141 */
+ 0x00, 0xc6, 0x00, 0x10, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 142 */
+ 0x38, 0x6c, 0x38, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 143 */
+ 0x18, 0x30, 0x60, 0x00, 0xfe, 0x66, 0x60, 0x7c, 0x60, 0x60, 0x66, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 144 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xcc, 0x76, 0x36, 0x7e, 0xd8, 0xd8, 0x6e, 0x00, 0x00, 0x00, 0x00, /* 145 */
+ 0x00, 0x00, 0x3e, 0x6c, 0xcc, 0xcc, 0xfe, 0xcc, 0xcc, 0xcc, 0xcc, 0xce, 0x00, 0x00, 0x00, 0x00, /* 146 */
+ 0x00, 0x10, 0x38, 0x6c, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 147 */
+ 0x00, 0x00, 0xc6, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 148 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 149 */
+ 0x00, 0x30, 0x78, 0xcc, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 150 */
+ 0x00, 0x60, 0x30, 0x18, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 151 */
+ 0x00, 0x00, 0xc6, 0x00, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7e, 0x06, 0x0c, 0x78, 0x00, /* 152 */
+ 0x00, 0xc6, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 153 */
+ 0x00, 0xc6, 0x00, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 154 */
+ 0x00, 0x18, 0x18, 0x3c, 0x66, 0x60, 0x60, 0x60, 0x66, 0x3c, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 155 */
+ 0x00, 0x38, 0x6c, 0x64, 0x60, 0xf0, 0x60, 0x60, 0x60, 0x60, 0xe6, 0xfc, 0x00, 0x00, 0x00, 0x00, /* 156 */
+ 0x00, 0x00, 0x66, 0x66, 0x3c, 0x18, 0x7e, 0x18, 0x7e, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 157 */
+ 0x00, 0xf8, 0xcc, 0xcc, 0xf8, 0xc4, 0xcc, 0xde, 0xcc, 0xcc, 0xcc, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 158 */
+ 0x00, 0x0e, 0x1b, 0x18, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x18, 0x18, 0x18, 0xd8, 0x70, 0x00, 0x00, /* 159 */
+ 0x00, 0x18, 0x30, 0x60, 0x00, 0x78, 0x0c, 0x7c, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 160 */
+ 0x00, 0x0c, 0x18, 0x30, 0x00, 0x38, 0x18, 0x18, 0x18, 0x18, 0x18, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 161 */
+ 0x00, 0x18, 0x30, 0x60, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 162 */
+ 0x00, 0x18, 0x30, 0x60, 0x00, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0xcc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 163 */
+ 0x00, 0x00, 0x76, 0xdc, 0x00, 0xdc, 0x66, 0x66, 0x66, 0x66, 0x66, 0x66, 0x00, 0x00, 0x00, 0x00, /* 164 */
+ 0x76, 0xdc, 0x00, 0xc6, 0xe6, 0xf6, 0xfe, 0xde, 0xce, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 165 */
+ 0x00, 0x3c, 0x6c, 0x6c, 0x3e, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 166 */
+ 0x00, 0x38, 0x6c, 0x6c, 0x38, 0x00, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 167 */
+ 0x00, 0x00, 0x30, 0x30, 0x00, 0x30, 0x30, 0x60, 0xc0, 0xc6, 0xc6, 0x7c, 0x00, 0x00, 0x00, 0x00, /* 168 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, /* 169 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x06, 0x06, 0x06, 0x06, 0x00, 0x00, 0x00, 0x00, 0x00, /* 170 */
+ 0x00, 0xc0, 0xc0, 0xc2, 0xc6, 0xcc, 0x18, 0x30, 0x60, 0xdc, 0x86, 0x0c, 0x18, 0x3e, 0x00, 0x00, /* 171 */
+ 0x00, 0xc0, 0xc0, 0xc2, 0xc6, 0xcc, 0x18, 0x30, 0x66, 0xce, 0x9e, 0x3e, 0x06, 0x06, 0x00, 0x00, /* 172 */
+ 0x00, 0x00, 0x18, 0x18, 0x00, 0x18, 0x18, 0x18, 0x3c, 0x3c, 0x3c, 0x18, 0x00, 0x00, 0x00, 0x00, /* 173 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x36, 0x6c, 0xd8, 0x6c, 0x36, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 174 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xd8, 0x6c, 0x36, 0x6c, 0xd8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 175 */
+ 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, 0x11, 0x44, /* 176 */
+ 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, /* 177 */
+ 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, 0xdd, 0x77, /* 178 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 179 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 180 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0x18, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 181 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 182 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 183 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xf8, 0x18, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 184 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0xf6, 0x06, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 185 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 186 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x06, 0xf6, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 187 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0xf6, 0x06, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 188 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 189 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0x18, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 190 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf8, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 191 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 192 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 193 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 194 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 195 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 196 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 197 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x18, 0x1f, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 198 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x37, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 199 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x37, 0x30, 0x3f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 200 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x30, 0x37, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 201 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0xf7, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 202 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0xf7, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 203 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x37, 0x30, 0x37, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 204 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 205 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0xf7, 0x00, 0xf7, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 206 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 207 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 208 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x00, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 209 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 210 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x3f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 211 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x1f, 0x18, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 212 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x1f, 0x18, 0x1f, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 213 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3f, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 214 */
+ 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0xff, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, 0x36, /* 215 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0xff, 0x18, 0xff, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 216 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 217 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1f, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 218 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* 219 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, /* 220 */
+ 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, 0xf0, /* 221 */
+ 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, 0x0f, /* 222 */
+ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 223 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0xd8, 0xd8, 0xd8, 0xdc, 0x76, 0x00, 0x00, 0x00, 0x00, /* 224 */
+ 0x00, 0x00, 0x78, 0xcc, 0xcc, 0xcc, 0xd8, 0xcc, 0xc6, 0xc6, 0xc6, 0xcc, 0x00, 0x00, 0x00, 0x00, /* 225 */
+ 0x00, 0x00, 0xfe, 0xc6, 0xc6, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0xc0, 0x00, 0x00, 0x00, 0x00, /* 226 */
+ 0x00, 0x00, 0x00, 0x00, 0xfe, 0x6c, 0x6c, 0x6c, 0x6c, 0x6c, 0x6c, 0x6c, 0x00, 0x00, 0x00, 0x00, /* 227 */
+ 0x00, 0x00, 0x00, 0xfe, 0xc6, 0x60, 0x30, 0x18, 0x30, 0x60, 0xc6, 0xfe, 0x00, 0x00, 0x00, 0x00, /* 228 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0xd8, 0xd8, 0xd8, 0xd8, 0xd8, 0x70, 0x00, 0x00, 0x00, 0x00, /* 229 */
+ 0x00, 0x00, 0x00, 0x00, 0x66, 0x66, 0x66, 0x66, 0x66, 0x7c, 0x60, 0x60, 0xc0, 0x00, 0x00, 0x00, /* 230 */
+ 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, /* 231 */
+ 0x00, 0x00, 0x00, 0x7e, 0x18, 0x3c, 0x66, 0x66, 0x66, 0x3c, 0x18, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 232 */
+ 0x00, 0x00, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xfe, 0xc6, 0xc6, 0x6c, 0x38, 0x00, 0x00, 0x00, 0x00, /* 233 */
+ 0x00, 0x00, 0x38, 0x6c, 0xc6, 0xc6, 0xc6, 0x6c, 0x6c, 0x6c, 0x6c, 0xee, 0x00, 0x00, 0x00, 0x00, /* 234 */
+ 0x00, 0x00, 0x1e, 0x30, 0x18, 0x0c, 0x3e, 0x66, 0x66, 0x66, 0x66, 0x3c, 0x00, 0x00, 0x00, 0x00, /* 235 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x7e, 0xdb, 0xdb, 0xdb, 0x7e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 236 */
+ 0x00, 0x00, 0x00, 0x03, 0x06, 0x7e, 0xdb, 0xdb, 0xf3, 0x7e, 0x60, 0xc0, 0x00, 0x00, 0x00, 0x00, /* 237 */
+ 0x00, 0x00, 0x1c, 0x30, 0x60, 0x60, 0x7c, 0x60, 0x60, 0x60, 0x30, 0x1c, 0x00, 0x00, 0x00, 0x00, /* 238 */
+ 0x00, 0x00, 0x00, 0x7c, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0xc6, 0x00, 0x00, 0x00, 0x00, /* 239 */
+ 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00, /* 240 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x7e, 0x18, 0x18, 0x00, 0x00, 0xff, 0x00, 0x00, 0x00, 0x00, /* 241 */
+ 0x00, 0x00, 0x00, 0x30, 0x18, 0x0c, 0x06, 0x0c, 0x18, 0x30, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 242 */
+ 0x00, 0x00, 0x00, 0x0c, 0x18, 0x30, 0x60, 0x30, 0x18, 0x0c, 0x00, 0x7e, 0x00, 0x00, 0x00, 0x00, /* 243 */
+ 0x00, 0x00, 0x0e, 0x1b, 0x1b, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, /* 244 */
+ 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0x18, 0xd8, 0xd8, 0xd8, 0x70, 0x00, 0x00, 0x00, 0x00, /* 245 */
+ 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x7e, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, /* 246 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x76, 0xdc, 0x00, 0x76, 0xdc, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 247 */
+ 0x00, 0x38, 0x6c, 0x6c, 0x38, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 248 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 249 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x18, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 250 */
+ 0x00, 0x0f, 0x0c, 0x0c, 0x0c, 0x0c, 0x0c, 0xec, 0x6c, 0x6c, 0x3c, 0x1c, 0x00, 0x00, 0x00, 0x00, /* 251 */
+ 0x00, 0xd8, 0x6c, 0x6c, 0x6c, 0x6c, 0x6c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 252 */
+ 0x00, 0x70, 0xd8, 0x30, 0x60, 0xc8, 0xf8, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, /* 253 */
+ 0x00, 0x00, 0x00, 0x00, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x7c, 0x00, 0x00, 0x00, 0x00, 0x00, /* 254 */
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 /* 255 */
+};
+
+#endif // _FVGAFONT_H
diff --git a/src/foptimove.cpp b/src/foptimove.cpp
new file mode 100644
index 00000000..25b41e04
--- /dev/null
+++ b/src/foptimove.cpp
@@ -0,0 +1,643 @@
+// foptimove.cpp
+// class FOptiMove
+
+#include "foptimove.h"
+
+//----------------------------------------------------------------------
+// class FOptiMove
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FOptiMove::FOptiMove (int baud)
+{
+ assert ( baud >= 0 );
+
+ baudrate = baud;
+ tabstop = 0;
+ move_buf[0] = '\0';
+
+ // init structs with 0
+ memset(&F_cursor_home, 0x00, sizeof(capability));
+ memset(&F_carriage_return, 0x00, sizeof(capability));
+ memset(&F_cursor_to_ll, 0x00, sizeof(capability));
+ memset(&F_tab, 0x00, sizeof(capability));
+ memset(&F_back_tab, 0x00, sizeof(capability));
+ memset(&F_cursor_up, 0x00, sizeof(capability));
+ memset(&F_cursor_down, 0x00, sizeof(capability));
+ memset(&F_cursor_left, 0x00, sizeof(capability));
+ memset(&F_cursor_right, 0x00, sizeof(capability));
+ memset(&F_cursor_address, 0x00, sizeof(capability));
+ memset(&F_column_address, 0x00, sizeof(capability));
+ memset(&F_row_address, 0x00, sizeof(capability));
+ memset(&F_parm_up_cursor, 0x00, sizeof(capability));
+ memset(&F_parm_down_cursor, 0x00, sizeof(capability));
+ memset(&F_parm_left_cursor, 0x00, sizeof(capability));
+ memset(&F_parm_right_cursor, 0x00, sizeof(capability));
+ automatic_left_margin = false;
+ eat_nl_glitch = false;
+
+ calculateCharDuration();
+}
+
+//----------------------------------------------------------------------
+FOptiMove::~FOptiMove() // destructor
+{
+}
+
+
+// private methods of FApplication
+//----------------------------------------------------------------------
+void FOptiMove::calculateCharDuration()
+{
+ if ( baudrate != 0 )
+ {
+ const int baudbyte = 9; // = 7 bit + 1 parity + 1 stop
+ char_duration = (baudbyte * 1000 * 10)
+ / (baudrate > 0 ? baudrate : 9600); // milliseconds
+ if ( char_duration <= 0 )
+ char_duration = 1;
+ }
+ else
+ char_duration = 1;
+}
+
+//----------------------------------------------------------------------
+int FOptiMove::cap_duration (char*& cap, int affcnt)
+{
+ // calculate the duration in milliseconds of a given operation
+ // cap - the term capability
+ // affcnt - the number of lines affected
+
+ if ( cap )
+ {
+ const char* p;
+ float ms = 0;
+
+ for (p=cap; *p; p++)
+ {
+ // check for delay with padding character
+ if ( p[0] == '$' && p[1] == '<' && strchr(p, '>') )
+ {
+ float num=0;
+
+ for (p += 2; *p != '>'; p++)
+ {
+ if ( isdigit(uChar(*p)) )
+ num = num * 10 + float(*p - '0');
+ else if ( *p == '*' )
+ num *= float(affcnt);
+ else if ( *p == '.' && *++p != '>' && isdigit(uChar(*p)) )
+ num += float((*p - '0') / 10.0);
+ }
+ ms += num * 10;
+ }
+ else
+ ms += char_duration;
+ }
+ return int(ms);
+ }
+ else
+ return LONG_DURATION;
+}
+
+
+// public methods of FOptiMove
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_home (char*& cap)
+{
+ F_cursor_home.cap = cap;
+ F_cursor_home.duration = cap_duration(cap, 0);
+ F_cursor_home.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_to_ll (char*& cap)
+{
+ F_cursor_to_ll.cap = cap;
+ F_cursor_to_ll.duration = cap_duration(cap, 0);
+ F_cursor_to_ll.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_carriage_return (char*& cap)
+{
+ F_carriage_return.cap = cap;
+ F_carriage_return.duration = cap_duration(cap, 0);
+ F_carriage_return.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_tabular (char*& cap)
+{
+ F_tab.cap = cap;
+ F_tab.duration = cap_duration(cap, 0);
+ F_tab.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_back_tab (char*& cap)
+{
+ F_back_tab.cap = cap;
+ F_back_tab.duration = cap_duration(cap, 0);
+ F_back_tab.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_up (char*& cap)
+{
+ F_cursor_up.cap = cap;
+ F_cursor_up.duration = cap_duration(cap, 0);
+ F_cursor_up.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_down (char*& cap)
+{
+ F_cursor_down.cap = cap;
+ F_cursor_down.duration = cap_duration(cap, 0);
+ F_cursor_down.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_left (char*& cap)
+{
+ F_cursor_left.cap = cap;
+ F_cursor_left.duration = cap_duration(cap, 0);
+ F_cursor_left.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_right (char*& cap)
+{
+ F_cursor_right.cap = cap;
+ F_cursor_right.duration = cap_duration(cap, 0);
+ F_cursor_right.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_cursor_address (char*& cap)
+{
+ char* temp = tgoto(cap, 23, 23);
+ F_cursor_address.cap = cap;
+ F_cursor_address.duration = cap_duration(temp, 1);
+ F_cursor_address.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_column_address (char*& cap)
+{
+ char* temp = tparm(cap, 23);
+ F_column_address.cap = cap;
+ F_column_address.duration = cap_duration(temp, 1);
+ F_column_address.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_row_address (char*& cap)
+{
+ char* temp = tparm(cap, 23);
+ F_row_address.cap = cap;
+ F_row_address.duration = cap_duration(temp, 1);
+ F_row_address.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_parm_up_cursor (char*& cap)
+{
+ char* temp = tparm(cap, 23);
+ F_parm_up_cursor.cap = cap;
+ F_parm_up_cursor.duration = cap_duration(temp, 1);
+ F_parm_up_cursor.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_parm_down_cursor (char*& cap)
+{
+ char* temp = tparm(cap, 23);
+ F_parm_down_cursor.cap = cap;
+ F_parm_down_cursor.duration = cap_duration(temp, 1);
+ F_parm_down_cursor.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_parm_left_cursor (char*& cap)
+{
+ char* temp = tparm(cap, 23);
+ F_parm_left_cursor.cap = cap;
+ F_parm_left_cursor.duration = cap_duration(temp, 1);
+ F_parm_left_cursor.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::set_parm_right_cursor (char*& cap)
+{
+ char* temp = tparm(cap, 23);
+ F_parm_right_cursor.cap = cap;
+ F_parm_right_cursor.duration = cap_duration(temp, 1);
+ F_parm_right_cursor.length = ( cap != 0 ) ? int(strlen(cap)) : 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::setBaudRate (int baud)
+{
+ assert ( baud >= 0 );
+
+ baudrate = baud;
+ calculateCharDuration();
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::setTabStop (int t)
+{
+ assert ( t > 0 );
+ tabstop = t;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::setTermSize (int w, int h)
+{
+ assert ( w > 0 );
+ assert ( h > 0 );
+ screen_width = w;
+ screen_height = h;
+}
+
+//----------------------------------------------------------------------
+int FOptiMove::repeated_append (capability& o, int count, char* dst)
+{
+ register size_t src_len;
+ register size_t dst_len;
+ register int total;
+
+ src_len = strlen(o.cap);
+ dst_len = ( dst != 0 ) ? strlen(dst) : 0;
+ total = 0;
+
+ if ( (dst_len + uInt(count) * src_len) < sizeof(move_buf)-1 )
+ {
+ total += count * o.duration;
+ if ( dst )
+ {
+ dst += dst_len;
+ while ( count-- > 0 )
+ {
+ strcpy (dst, o.cap);
+ dst += src_len;
+ }
+ }
+ }
+ else
+ total = LONG_DURATION;
+
+ return total;
+}
+
+//----------------------------------------------------------------------
+int FOptiMove::relative_move ( char*& move,
+ int from_x, int from_y,
+ int to_x, int to_y )
+{
+ int num;
+ int vtime = 0;
+ int htime = 0;
+
+ if ( move )
+ move[0] = '\0';
+
+ if ( to_y != from_y ) // vertical move
+ {
+ vtime = LONG_DURATION;
+
+ if ( F_row_address.cap )
+ {
+ if ( move )
+ strcpy (move, tparm(F_row_address.cap, to_y));
+ vtime = F_row_address.duration;
+ }
+
+ if ( to_y > from_y )
+ {
+ num = to_y - from_y;
+
+ if ( F_parm_down_cursor.cap && F_parm_down_cursor.duration < vtime )
+ {
+ if ( move )
+ strcpy (move, tparm(F_parm_down_cursor.cap, num));
+ vtime = F_parm_down_cursor.duration;
+ }
+
+ if ( F_cursor_down.cap && (num * F_cursor_down.duration < vtime) )
+ {
+ if ( move )
+ move[0] = '\0';
+ vtime = repeated_append (F_cursor_down, num, move);
+ }
+ }
+ else // to_y < from_y
+ {
+ num = from_y - to_y;
+
+ if ( F_parm_up_cursor.cap && F_parm_up_cursor.duration < vtime )
+ {
+ if ( move )
+ strcpy (move, tparm(F_parm_up_cursor.cap, num));
+ vtime = F_parm_up_cursor.duration;
+ }
+
+ if ( F_cursor_up.cap && (num * F_cursor_up.duration < vtime) )
+ {
+ if ( move )
+ move[0] = '\0';
+ vtime = repeated_append (F_cursor_up, num, move);
+ }
+ }
+
+ if ( vtime >= LONG_DURATION )
+ return LONG_DURATION;
+ }
+
+ if ( to_x != from_x ) // horizontal move
+ {
+ char str[sizeof(move_buf)];
+ char hmove[sizeof(move_buf)];
+ hmove[0] = '\0';
+ htime = LONG_DURATION;
+
+ if ( F_column_address.cap )
+ {
+ strcat (hmove, tparm(F_column_address.cap, to_x));
+ htime = F_column_address.duration;
+ }
+
+ if ( to_x > from_x )
+ {
+ num = to_x - from_x;
+
+ if ( F_parm_right_cursor.cap && F_parm_right_cursor.duration < htime )
+ {
+ strcat (hmove, tparm(F_parm_right_cursor.cap, num));
+ htime = F_parm_right_cursor.duration;
+ }
+
+ if ( F_cursor_right.cap )
+ {
+ int htime_r = 0;
+ str[0] = '\0';
+
+ // try to use tab
+ if ( tabstop > 0 && F_tab.cap )
+ {
+ int pos = from_x;
+
+ while ( true )
+ {
+ int tab_pos = pos + tabstop - (pos % tabstop);
+
+ if ( tab_pos > to_x )
+ break;
+ htime_r += repeated_append (F_tab, 1, str);
+ if ( htime_r >= LONG_DURATION )
+ break;
+ pos = tab_pos;
+ }
+ num = to_x - pos;
+ }
+
+ htime_r += repeated_append (F_cursor_right, num, str);
+
+ if ( htime_r < htime )
+ {
+ strcpy (hmove, str);
+ htime = htime_r;
+ }
+ }
+ }
+ else // to_x < from_x
+ {
+ num = from_x - to_x;
+
+ if ( F_parm_left_cursor.cap && F_parm_left_cursor.duration < htime )
+ {
+ strcat (hmove, tparm(F_parm_left_cursor.cap, num));
+ htime = F_parm_left_cursor.duration;
+ }
+
+ if ( F_cursor_left.cap )
+ {
+ int htime_l = 0;
+ str[0] = '\0';
+
+ // try to use backward tab
+ if ( tabstop > 0 && F_back_tab.cap )
+ {
+ int pos = from_x;
+ while ( true )
+ {
+ int tab_pos = ( pos > 0 ) ? ((pos-1)/tabstop)*tabstop : -1;
+
+ if ( tab_pos < to_x )
+ break;
+ htime_l += repeated_append (F_back_tab, 1, str);
+ if ( htime_l >= LONG_DURATION )
+ break;
+ pos = tab_pos;
+ }
+ num = pos - to_x;
+ }
+
+ htime_l += repeated_append (F_cursor_left, num, str);
+
+ if ( htime_l < htime )
+ {
+ strcpy (hmove, str);
+ htime = htime_l;
+ }
+ }
+ }
+
+ if ( htime >= LONG_DURATION )
+ return LONG_DURATION;
+
+ if ( move )
+ strcat (move, hmove);
+ else
+ move = hmove;
+ }
+
+ return (vtime + htime);
+}
+
+//----------------------------------------------------------------------
+inline bool FOptiMove::isTwoDirectionMove ( int xold, int yold,
+ int xnew, int ynew )
+{
+ return bool ( (xold != xnew || ! F_row_address.cap)
+ && (yold != ynew || ! F_column_address.cap) );
+}
+
+//----------------------------------------------------------------------
+inline bool FOptiMove::isWideMove ( int xold, int yold,
+ int xnew, int ynew )
+{
+ return bool ( (xnew > MOVE_LIMIT)
+ && (xnew < screen_width - 1 - MOVE_LIMIT)
+ && (abs(xnew-xold) + abs(ynew-yold) > MOVE_LIMIT) );
+}
+
+//----------------------------------------------------------------------
+char* FOptiMove::cursor_move (int xold, int yold, int xnew, int ynew)
+{
+ char null_result[sizeof(move_buf)];
+ char* null_ptr = null_result;
+ char* move_ptr = move_buf;
+ char* move_xy;
+ int method = 0;
+ int new_time;
+ int move_time = LONG_DURATION;
+
+ // Method 0: direct cursor addressing
+ move_xy = tgoto(F_cursor_address.cap, xnew, ynew);
+ if ( move_xy )
+ {
+ method = 0;
+ strcpy (move_ptr, move_xy);
+ move_time = F_cursor_address.duration;
+
+ if ( xold < 0
+ || yold < 0
+ || isTwoDirectionMove (xold, yold, xnew, ynew)
+ || isWideMove (xold, yold, xnew, ynew) )
+ {
+ return ( move_time < LONG_DURATION ) ? move_buf : 0;
+ }
+ }
+
+ // Method 1: local movement
+ if ( xold >= 0 && yold >= 0 )
+ {
+ new_time = relative_move (null_ptr, xold, yold, xnew, ynew);
+ if ( new_time < LONG_DURATION && new_time < move_time )
+ {
+ method = 1;
+ move_time = new_time;
+ }
+ }
+
+ // Method 2: carriage-return + local movement
+ if ( yold >= 0 && F_carriage_return.cap )
+ {
+ new_time = relative_move (null_ptr, 0, yold, xnew, ynew);
+ if ( new_time < LONG_DURATION
+ && F_carriage_return.duration + new_time < move_time )
+ {
+ method = 2;
+ move_time = F_carriage_return.duration + new_time;
+ }
+ }
+
+ // Method 3: home-cursor + local movement
+ if ( F_cursor_home.cap )
+ {
+ new_time = relative_move (null_ptr, 0, 0, xnew, ynew);
+ if ( new_time < LONG_DURATION
+ && F_cursor_home.duration + new_time < move_time )
+ {
+ method = 3;
+ move_time = F_cursor_home.duration + new_time;
+ }
+ }
+
+ // Method 4: home-down + local movement
+ if ( F_cursor_to_ll.cap )
+ {
+ new_time = relative_move (null_ptr, 0, screen_height-1, xnew, ynew);
+ if ( new_time < LONG_DURATION
+ && F_cursor_to_ll.duration + new_time < move_time )
+ {
+ method = 4;
+ move_time = F_cursor_to_ll.duration + new_time;
+ }
+ }
+
+ // Method 5: left margin for wrap to right-hand side
+ if ( automatic_left_margin
+ && ! eat_nl_glitch
+ && yold > 0
+ && F_cursor_left.cap )
+ {
+ new_time = relative_move (null_ptr, screen_width-1, yold-1, xnew, ynew);
+ if ( new_time < LONG_DURATION
+ && F_carriage_return.duration
+ + F_cursor_left.duration + new_time < move_time )
+ {
+ method = 5;
+ move_time = F_carriage_return.duration
+ + F_cursor_left.duration + new_time;
+ }
+ }
+
+ if ( method )
+ {
+ switch ( method )
+ {
+ case 1:
+ relative_move (move_ptr, xold, yold, xnew, ynew);
+ break;
+
+ case 2:
+ strcpy (move_ptr, F_carriage_return.cap);
+ move_ptr += F_carriage_return.length;
+ relative_move (move_ptr, 0, yold, xnew, ynew);
+ break;
+
+ case 3:
+ strcpy (move_ptr, F_cursor_home.cap);
+ move_ptr += F_cursor_home.length;
+ relative_move (move_ptr, 0, 0, xnew, ynew);
+ break;
+
+ case 4:
+ strcpy (move_ptr, F_cursor_to_ll.cap);
+ move_ptr += F_cursor_to_ll.length;
+ relative_move (move_ptr, 0, screen_height-1, xnew, ynew);
+ break;
+
+ case 5:
+ move_buf[0] = '\0';
+ if ( xold >= 0 )
+ strcat (move_ptr, F_carriage_return.cap);
+ strcat (move_ptr, F_cursor_left.cap);
+ move_ptr += strlen(move_buf);
+ relative_move (move_ptr, screen_width-1, yold-1, xnew, ynew);
+ break;
+ }
+ }
+ if ( move_time < LONG_DURATION )
+ return move_buf;
+ else
+ return 0;
+}
+
+//----------------------------------------------------------------------
+void FOptiMove::printDurations()
+{
+ ::printf (" speed: %d baud\n", baudrate);
+ ::printf (" char_duration: %d ms\n", char_duration);
+ ::printf (" cursor_home: %d ms\n", F_cursor_home.duration);
+ ::printf (" cursor_to_ll: %d ms\n", F_cursor_to_ll.duration);
+ ::printf (" carriage_return: %d ms\n", F_carriage_return.duration);
+ ::printf (" tab: %d ms\n", F_tab.duration);
+ ::printf (" back_tab: %d ms\n", F_back_tab.duration);
+ ::printf (" cursor_up: %d ms\n", F_cursor_up.duration);
+ ::printf (" cursor_down: %d ms\n", F_cursor_down.duration);
+ ::printf (" cursor_left: %d ms\n", F_cursor_left.duration);
+ ::printf (" cursor_right: %d ms\n", F_cursor_right.duration);
+ ::printf (" cursor_address: %d ms\n", F_cursor_address.duration);
+ ::printf (" column_address: %d ms\n", F_column_address.duration);
+ ::printf (" row_address: %d ms\n", F_row_address.duration);
+ ::printf (" parm_up_cursor: %d ms\n", F_parm_up_cursor.duration);
+ ::printf (" parm_down_cursor: %d ms\n", F_parm_down_cursor.duration);
+ ::printf (" parm_left_cursor: %d ms\n", F_parm_left_cursor.duration);
+ ::printf ("parm_right_cursor: %d ms\n", F_parm_right_cursor.duration);
+}
diff --git a/src/foptimove.h b/src/foptimove.h
new file mode 100644
index 00000000..9cb15dac
--- /dev/null
+++ b/src/foptimove.h
@@ -0,0 +1,121 @@
+// foptimove.h
+// class FOptiMove
+//
+// The cursor optimisation based on ncurses lib_mvcur.c
+// ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+#ifndef _FOPTIMOVE_H
+#define _FOPTIMOVE_H
+
+#include
+#include
+
+#include
+#include // need for printf
+#include
+#include
+
+
+// value for a long capability waiting time
+#define LONG_DURATION 9999999
+
+// maximum character distance to avoid direct cursor addressing
+#define MOVE_LIMIT 7
+
+//----------------------------------------------------------------------
+// class FOptiMove
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FOptiMove
+{
+ private:
+ typedef unsigned char uChar;
+ typedef unsigned int uInt;
+
+ typedef struct
+ {
+ char* cap;
+ int duration;
+ int length;
+ } capability;
+
+ capability F_cursor_home;
+ capability F_carriage_return;
+ capability F_cursor_to_ll;
+ capability F_tab;
+ capability F_back_tab;
+ capability F_cursor_up;
+ capability F_cursor_down;
+ capability F_cursor_left;
+ capability F_cursor_right;
+ capability F_cursor_address;
+ capability F_column_address;
+ capability F_row_address;
+ capability F_parm_up_cursor;
+ capability F_parm_down_cursor;
+ capability F_parm_left_cursor;
+ capability F_parm_right_cursor;
+
+ bool automatic_left_margin;
+ bool eat_nl_glitch;
+
+ char move_buf[512];
+ int char_duration;
+ int baudrate;
+ int tabstop;
+ int screen_width;
+ int screen_height;
+
+ private:
+ void calculateCharDuration();
+ int cap_duration (char*&, int);
+ int repeated_append (capability&, int, char*);
+ int relative_move (char*&, int, int, int, int);
+ bool isTwoDirectionMove (int, int, int, int);
+ bool isWideMove (int, int, int, int);
+
+ public:
+ FOptiMove(int baud=0); // constructor
+ ~FOptiMove(); // destructor
+
+ void setBaudRate (int);
+ void setTabStop (int);
+ void setTermSize (int, int);
+ void set_cursor_home (char*&);
+ void set_cursor_to_ll (char*&);
+ void set_carriage_return (char*&);
+ void set_tabular (char*&);
+ void set_back_tab (char*&);
+ void set_cursor_up (char*&);
+ void set_cursor_down (char*&);
+ void set_cursor_left (char*&);
+ void set_cursor_right (char*&);
+ void set_cursor_address (char*&);
+ void set_column_address (char*&);
+ void set_row_address (char*&);
+ void set_parm_up_cursor (char*&);
+ void set_parm_down_cursor (char*&);
+ void set_parm_left_cursor (char*&);
+ void set_parm_right_cursor (char*&);
+ void set_auto_left_margin (bool&);
+ void set_eat_newline_glitch (bool&);
+
+ char* cursor_move (int, int, int, int);
+ void printDurations();
+};
+#pragma pack(pop)
+
+
+// FOptiMove inline functions
+//----------------------------------------------------------------------
+inline void FOptiMove::set_auto_left_margin (bool& bcap)
+{ automatic_left_margin = bcap; }
+
+//----------------------------------------------------------------------
+inline void FOptiMove::set_eat_newline_glitch (bool& bcap)
+{ eat_nl_glitch = bcap; }
+
+#endif // _FOPTIMOVE_H
diff --git a/src/fpoint.cpp b/src/fpoint.cpp
new file mode 100644
index 00000000..b91bd3d0
--- /dev/null
+++ b/src/fpoint.cpp
@@ -0,0 +1,63 @@
+// fpoint.cpp
+// class FPoint
+
+#include "fpoint.h"
+
+
+//----------------------------------------------------------------------
+// class FPoint
+//----------------------------------------------------------------------
+
+FPoint::~FPoint() // destructor
+{
+}
+
+// public methods of FPoint
+//----------------------------------------------------------------------
+bool FPoint::isNull() const
+{
+ return xpos == 0 && ypos == 0;
+}
+
+//----------------------------------------------------------------------
+void FPoint::setX (int x)
+{
+ xpos = short(x);
+}
+
+//----------------------------------------------------------------------
+void FPoint::setY (int y)
+{
+ ypos = short(y);
+}
+
+//----------------------------------------------------------------------
+void FPoint::setPoint (int x, int y)
+{
+ xpos = short(x);
+ ypos = short(y);
+}
+
+//----------------------------------------------------------------------
+FPoint& FPoint::operator = (const FPoint& p)
+{
+ xpos = p.xpos;
+ ypos = p.ypos;
+ return *this;
+}
+
+//----------------------------------------------------------------------
+FPoint& FPoint::operator += (const FPoint& p)
+{
+ xpos += p.xpos;
+ ypos += p.ypos;
+ return *this;
+}
+
+//----------------------------------------------------------------------
+FPoint& FPoint::operator -= (const FPoint& p)
+{
+ xpos -= p.xpos;
+ ypos -= p.ypos;
+ return *this;
+}
diff --git a/src/fpoint.h b/src/fpoint.h
new file mode 100644
index 00000000..6086d8ea
--- /dev/null
+++ b/src/fpoint.h
@@ -0,0 +1,100 @@
+// fpoint.h
+// class FPoint
+
+#ifndef _FPOINT_H
+#define _FPOINT_H
+
+//----------------------------------------------------------------------
+// class FPoint
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FPoint
+{
+ private:
+ short xpos;
+ short ypos;
+
+ public:
+ FPoint (); // constructor
+ FPoint (int, int); // constructor
+ virtual ~FPoint(); // destructor
+ virtual const char* getClassName();
+
+ bool isNull() const;
+ int getX() const;
+ int getY() const;
+ short& x_ref();
+ short& y_ref();
+ void setX (int);
+ void setY (int);
+ void setPoint (int, int);
+
+ FPoint& operator = (const FPoint&);
+ FPoint& operator += (const FPoint&);
+ FPoint& operator -= (const FPoint&);
+
+ friend inline bool operator == (const FPoint&, const FPoint&);
+ friend inline bool operator != (const FPoint&, const FPoint&);
+ friend inline FPoint operator + (const FPoint&, const FPoint&);
+ friend inline FPoint operator - (const FPoint&, const FPoint&);
+ friend inline FPoint operator - (const FPoint&);
+};
+#pragma pack(pop)
+
+
+// FPoint inline functions
+//----------------------------------------------------------------------
+inline FPoint::FPoint()
+{ xpos = ypos = 0; }
+
+//----------------------------------------------------------------------
+inline FPoint::FPoint (int x, int y)
+{
+ xpos = short(x);
+ ypos = short(y);
+}
+
+//----------------------------------------------------------------------
+inline const char* FPoint::getClassName()
+{ return "FPoint"; }
+
+//----------------------------------------------------------------------
+inline int FPoint::getX() const
+{ return xpos; }
+
+//----------------------------------------------------------------------
+inline int FPoint::getY() const
+{ return ypos; }
+
+//----------------------------------------------------------------------
+inline short& FPoint::x_ref()
+{ return xpos; }
+
+//----------------------------------------------------------------------
+inline short& FPoint::y_ref()
+{ return ypos; }
+
+//----------------------------------------------------------------------
+inline bool operator == (const FPoint& p1, const FPoint& p2)
+{ return p1.xpos == p2.xpos && p1.ypos == p2.ypos; }
+
+//----------------------------------------------------------------------
+inline bool operator != (const FPoint& p1, const FPoint& p2)
+{ return p1.xpos != p2.xpos || p1.ypos != p2.ypos; }
+
+//----------------------------------------------------------------------
+inline FPoint operator + (const FPoint& p1, const FPoint& p2)
+{ return FPoint(p1.xpos+p2.xpos, p1.ypos+p2.ypos); }
+
+//----------------------------------------------------------------------
+inline FPoint operator - (const FPoint& p1, const FPoint& p2)
+{ return FPoint(p1.xpos-p2.xpos, p1.ypos-p2.ypos); }
+
+//----------------------------------------------------------------------
+inline FPoint operator - (const FPoint& p)
+{ return FPoint(-p.xpos, -p.ypos); }
+
+#endif // _FPOINT_H
diff --git a/src/fprogressbar.cpp b/src/fprogressbar.cpp
new file mode 100644
index 00000000..aa7d3e98
--- /dev/null
+++ b/src/fprogressbar.cpp
@@ -0,0 +1,245 @@
+// fprogressbar.cpp
+// class FProgressbar
+
+#include "fprogressbar.h"
+
+//----------------------------------------------------------------------
+// class FProgressbar
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FProgressbar::FProgressbar(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FProgressbar::~FProgressbar()
+{
+}
+
+// private methods of FProgressbar
+//----------------------------------------------------------------------
+void FProgressbar::init()
+{
+ percentage = -1;
+ flags = 0;
+ BarLength = width;
+ unsetFocusable();
+}
+
+//----------------------------------------------------------------------
+void FProgressbar::drawPercentage()
+{
+ setColor ( parentWidget()->getForegroundColor(),
+ parentWidget()->getBackgroundColor() );
+ gotoxy (xpos+xmin+width-5, ypos+ymin-2);
+ if ( percentage < 0 || percentage > 100 )
+ print ("--- %");
+ else
+ printf ("%3d %%", percentage);
+}
+
+//----------------------------------------------------------------------
+void FProgressbar::drawBar()
+{
+ int i = 1;
+ float length = float(BarLength*percentage)/100;
+
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ if ( isMonochron() )
+ {
+ if ( round(length) >= 1)
+ {
+ setReverse(true);
+ print (' ');
+ setReverse(false);
+ }
+ else
+ print (fc::MediumShade); // ▒
+ }
+ else if ( getMaxColor() < 16 )
+ {
+ setColor ( wc.progressbar_bg,
+ wc.progressbar_fg );
+ if ( round(length) >= 1)
+ print (' ');
+ else
+ print (fc::MediumShade);
+ }
+
+ if ( round(length) >= 1)
+ setColor( wc.progressbar_fg,
+ parentWidget()->getBackgroundColor() );
+ else
+ setColor( wc.progressbar_bg,
+ parentWidget()->getBackgroundColor() );
+
+ if ( ! isMonochron() && getMaxColor() >= 16 )
+ {
+ // Cygwin terminal use IBM Codepage 850
+ if ( this->isCygwinTerminal() )
+ print (fc::FullBlock); // █
+ else
+ print (fc::RightHalfBlock); // ▐
+ }
+
+ setColor ( wc.progressbar_bg,
+ wc.progressbar_fg );
+ if ( isMonochron() )
+ setReverse(true);
+ for (; i < trunc(length); i++)
+ print (' ');
+ if ( isMonochron() )
+ setReverse(false);
+
+ if ( trunc(length) >= 1 && trunc(length) < BarLength )
+ {
+ if ( round(length) > trunc(length)
+ || this->isCygwinTerminal()
+ || getMaxColor() < 16 )
+ {
+ if ( isMonochron() )
+ {
+ setReverse(true);
+ print (' ');
+ setReverse(false);
+ }
+ else
+ print (' ');
+ }
+ else
+ {
+ setColor(wc.progressbar_fg, wc.progressbar_bg);
+ print (fc::LeftHalfBlock); // ▌
+ }
+ i++;
+ }
+
+ setColor(wc.progressbar_fg, wc.progressbar_bg);
+ if ( getMaxColor() < 16 )
+ {
+ for (; i < BarLength; i++)
+ print (fc::MediumShade); // ▒
+ }
+ else
+ {
+ for (; i < BarLength; i++)
+ print (' ');
+ }
+ updateTerminal();
+ flush_out();
+}
+
+
+// protected methods of FProgressbar
+//----------------------------------------------------------------------
+void FProgressbar::draw()
+{
+ setUpdateVTerm(false);
+ drawPercentage();
+ drawBar();
+
+ if ( (flags & SHADOW) != 0 )
+ drawShadow ();
+ setUpdateVTerm(true);
+ flush_out();
+}
+
+
+// public methods of FProgressbar
+//----------------------------------------------------------------------
+void FProgressbar::hide()
+{
+ int fg, bg, s, size;
+ char* blank;
+
+ FWidget::hide();
+
+ fg = parentWidget()->getForegroundColor();
+ bg = parentWidget()->getBackgroundColor();
+ setColor (fg, bg);
+
+ s = hasShadow() ? 1 : 0;
+ size = width + s;
+ blank = new char[size+1];
+ memset(blank, ' ', uLong(size));
+ blank[size] = '\0';
+
+ for (int y=0; y < height+s; y++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+y);
+ print (blank);
+ }
+ delete[] blank;
+
+ gotoxy (xpos+xmin+width-5, ypos+ymin-2);
+ print (" "); // hide percentage
+}
+
+//----------------------------------------------------------------------
+void FProgressbar::setPercentage (int percentage_value)
+{
+ if ( percentage_value <= percentage )
+ return;
+
+ if ( percentage_value > 100 )
+ percentage = 100;
+ else if ( percentage_value < 0 )
+ percentage = 0;
+ else
+ percentage = percentage_value;
+
+ setUpdateVTerm(false);
+ if ( isVisible() )
+ {
+ drawPercentage();
+ drawBar();
+ }
+ setUpdateVTerm(true);
+ updateTerminal();
+}
+
+//----------------------------------------------------------------------
+void FProgressbar::reset()
+{
+ setUpdateVTerm(false);
+ percentage = -1;
+ if ( isVisible() )
+ {
+ drawPercentage();
+ drawBar();
+ }
+ setUpdateVTerm(true);
+ updateTerminal();
+}
+
+//----------------------------------------------------------------------
+void FProgressbar::setGeometry (int x, int y, int w, int h, bool adjust)
+{
+ FWidget::setGeometry (x, y, w, h, adjust);
+ BarLength = w;
+}
+
+//----------------------------------------------------------------------
+bool FProgressbar::setEnable (bool on)
+{
+ FWidget::setEnable(on);
+
+ if ( on )
+ this->flags |= ACTIVE;
+ else
+ this->flags &= ~ACTIVE;
+ return on;
+}
+
+//----------------------------------------------------------------------
+bool FProgressbar::setShadow (bool on)
+{
+ if ( on )
+ this->flags |= SHADOW;
+ else
+ this->flags &= ~SHADOW;
+ return on;
+}
diff --git a/src/fprogressbar.h b/src/fprogressbar.h
new file mode 100644
index 00000000..841d5c45
--- /dev/null
+++ b/src/fprogressbar.h
@@ -0,0 +1,88 @@
+// fprogressbar.h
+// class FProgressbar
+
+#ifndef _FPROGRESSBAR_H
+#define _FPROGRESSBAR_H
+
+#include "fwidget.h"
+
+
+//----------------------------------------------------------------------
+// class FProgressbar
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FProgressbar : public FWidget
+{
+ private:
+ int percentage;
+ int BarLength;
+
+ private:
+ void init();
+ void drawPercentage();
+ void drawBar();
+
+ protected:
+ virtual void draw();
+
+ public:
+ FProgressbar(FWidget* parent=0); // constructor
+ virtual ~FProgressbar();
+ const char* getClassName() const;
+
+ void hide();
+
+ int getPercentage();
+ void setPercentage (int);
+ void reset();
+ void setGeometry (int, int, int, int, bool adjust=true);
+ bool setEnable (bool);
+ bool setEnable();
+ bool unsetEnable();
+ bool setDisable();
+ bool setShadow (bool);
+ bool setShadow();
+ bool unsetShadow();
+ bool hasShadow();
+};
+#pragma pack(pop)
+
+
+// FProgressbar inline functions
+//----------------------------------------------------------------------
+inline const char* FProgressbar::getClassName() const
+{ return "FProgressbar"; }
+
+//----------------------------------------------------------------------
+inline int FProgressbar::getPercentage()
+{ return percentage; }
+
+//----------------------------------------------------------------------
+inline bool FProgressbar::setEnable()
+{ return setEnable(true); }
+
+//----------------------------------------------------------------------
+inline bool FProgressbar::unsetEnable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FProgressbar::setDisable()
+{ return setEnable(false); }
+
+//----------------------------------------------------------------------
+inline bool FProgressbar::setShadow()
+{ return setShadow(true); }
+
+//----------------------------------------------------------------------
+inline bool FProgressbar::unsetShadow()
+{ return setShadow(false); }
+
+//----------------------------------------------------------------------
+inline bool FProgressbar::hasShadow()
+{ return ((flags & SHADOW) != 0); }
+
+
+#endif // _FPROGRESSBAR_H
diff --git a/src/fradiobutton.cpp b/src/fradiobutton.cpp
new file mode 100644
index 00000000..9e0c8bd1
--- /dev/null
+++ b/src/fradiobutton.cpp
@@ -0,0 +1,72 @@
+// fradiobutton.cpp
+// class FRadioButton
+
+#include "fapp.h"
+#include "fradiobutton.h"
+
+
+//----------------------------------------------------------------------
+// class FRadioButton
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FRadioButton::FRadioButton(FWidget* parent) : FToggleButton(parent)
+{
+}
+
+//----------------------------------------------------------------------
+FRadioButton::FRadioButton ( const FString& txt,
+ FWidget* parent ) : FToggleButton(txt, parent)
+{
+}
+
+//----------------------------------------------------------------------
+FRadioButton::~FRadioButton() // destructor
+{
+}
+
+
+// private methods of FRadioButton
+//----------------------------------------------------------------------
+void FRadioButton::draw()
+{
+ setUpdateVTerm(false);
+ drawRadioButton();
+ drawLabel();
+ setUpdateVTerm(true);
+
+ FToggleButton::draw();
+}
+
+//----------------------------------------------------------------------
+void FRadioButton::drawRadioButton()
+{
+ if ( ! isVisible() )
+ return;
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ setColor (foregroundColor, backgroundColor);
+ if ( checked )
+ {
+ if ( isNewFont() )
+ print (CHECKED_RADIO_BUTTON);
+ else
+ {
+ print ('(');
+ print (fc::Bullet); // Bullet •
+ print (')');
+ }
+ }
+ else
+ {
+ if ( isNewFont() )
+ print (RADIO_BUTTON);
+ else
+ {
+ print ('(');
+ print (' ');
+ print (')');
+ }
+ }
+}
+
diff --git a/src/fradiobutton.h b/src/fradiobutton.h
new file mode 100644
index 00000000..41fec81b
--- /dev/null
+++ b/src/fradiobutton.h
@@ -0,0 +1,38 @@
+// fradiobutton.h
+// class FRadioButton
+
+#ifndef _FRADIOBUTTON_H
+#define _FRADIOBUTTON_H
+
+#include "ftogglebutton.h"
+
+//----------------------------------------------------------------------
+// class FRadioButton
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FRadioButton : public FToggleButton
+{
+ private:
+ FRadioButton (const FRadioButton&);
+ FRadioButton& operator = (const FRadioButton&);
+ void draw();
+ void drawRadioButton();
+
+ public:
+ FRadioButton (FWidget* parent=0); // constructor
+ FRadioButton (const FString&, FWidget* parent=0); // constructor
+ virtual ~FRadioButton(); // destructor
+ const char* getClassName() const;
+};
+#pragma pack(pop)
+
+
+// FRadioButton inline functions
+//----------------------------------------------------------------------
+inline const char* FRadioButton::getClassName() const
+{ return "FRadioButton"; }
+
+#endif // _FRADIOBUTTON_H
diff --git a/src/frect.cpp b/src/frect.cpp
new file mode 100644
index 00000000..3b715c10
--- /dev/null
+++ b/src/frect.cpp
@@ -0,0 +1,191 @@
+// frect.cpp
+// class FRect
+
+#include "frect.h"
+
+//----------------------------------------------------------------------
+// class FRect
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FRect::FRect (const FPoint& p1, const FPoint& p2)
+{
+ X1 = short(p1.getX());
+ Y1 = short(p1.getY());
+ X2 = short(p2.getX());
+ Y2 = short(p2.getY());
+}
+
+//----------------------------------------------------------------------
+FRect::~FRect() // destructor
+{
+}
+
+// public methods of FRect
+//----------------------------------------------------------------------
+bool FRect::isNull() const
+{
+ return X2 == X1-1 && Y2 == Y1-1;
+}
+
+//----------------------------------------------------------------------
+void FRect::setX1 (int n)
+{
+ X1 = short(n);
+}
+
+//----------------------------------------------------------------------
+void FRect::setY1 (int n)
+{
+ Y1 = short(n);
+}
+
+//----------------------------------------------------------------------
+void FRect::setX2 (int n)
+{
+ X2 = short(n);
+}
+
+//----------------------------------------------------------------------
+void FRect::setY2 (int n)
+{
+ Y2 = short(n);
+}
+
+//----------------------------------------------------------------------
+void FRect::setX (int n)
+{
+ short dX = X2 - X1;
+ X1 = short(n);
+ X2 = short(X1 + dX);
+}
+
+//----------------------------------------------------------------------
+void FRect::setY (int n)
+{
+ short dY = Y2 - Y1;
+ Y1 = short(n);
+ Y2 = short(Y1 + dY);
+}
+
+//----------------------------------------------------------------------
+void FRect::setWidth (int w)
+{
+ X2 = short(X1 + w - 1);
+}
+
+//----------------------------------------------------------------------
+void FRect::setHeight (int h)
+{
+ Y2 = short(Y1 + h - 1);
+}
+
+//----------------------------------------------------------------------
+void FRect::setRect (const FRect& r)
+{
+ setRect (r.X1, r.Y1, r.X2-r.X1+1, r.Y2-r.Y1+1);
+}
+
+//----------------------------------------------------------------------
+void FRect::setRect (int x, int y, int width, int height)
+{
+ X1 = short(x);
+ Y1 = short(y);
+ X2 = short(x+width-1);
+ Y2 = short(y+height-1);
+}
+
+//----------------------------------------------------------------------
+void FRect::move (int dx, int dy)
+{
+ X1 += short(dx);
+ Y1 += short(dy);
+ X2 += short(dx);
+ Y2 += short(dy);
+}
+
+//----------------------------------------------------------------------
+void FRect::move (const FPoint& d)
+{
+ X1 += short(d.getX());
+ Y1 += short(d.getY());
+ X2 += short(d.getX());
+ Y2 += short(d.getY());
+}
+
+//----------------------------------------------------------------------
+bool FRect::contains (int x, int y) const
+{
+ return x >= X1 && x <= X2
+ && y >= Y1 && y <= Y2;
+}
+
+//----------------------------------------------------------------------
+bool FRect::contains (const FPoint& p) const
+{
+ return p.getX() >= X1 && p.getX() <= X2
+ && p.getY() >= Y1 && p.getY() <= Y2;
+}
+
+//----------------------------------------------------------------------
+bool FRect::contains (const FRect& r) const
+{
+ return r.X1 >= X1 && r.X2 <= X2
+ && r.Y1 >= Y1 && r.Y2 <= Y2;
+}
+
+//----------------------------------------------------------------------
+bool FRect::overlap (const FRect &r) const
+{
+ return ( std::max(X1, r.X1) <= std::min(X2, r.X2)
+ && std::max(Y1, r.Y1) <= std::min(Y2, r.Y2) );
+}
+
+//----------------------------------------------------------------------
+FRect FRect::intersect (const FRect& r) const
+{
+ // intersection: this ∩ r
+ FRect new_rect;
+ new_rect.X1 = std::max(X1, r.X1);
+ new_rect.Y1 = std::max(Y1, r.Y1);
+ new_rect.X2 = std::min(X2, r.X2);
+ new_rect.Y2 = std::min(Y2, r.Y2);
+ return new_rect;
+}
+
+//----------------------------------------------------------------------
+FRect operator + (const FRect& r, const FPoint& p)
+{
+ return FRect( r.X1,
+ r.Y1,
+ r.X2 - r.X1 + 1 + p.getX(),
+ r.Y2 - r.Y1 + 1 + p.getY() );
+}
+
+//----------------------------------------------------------------------
+FRect operator - (const FRect& r, const FPoint& p)
+{
+ return FRect( r.X1,
+ r.Y1,
+ r.X2 - r.X1 + 1 - p.getX(),
+ r.Y2 - r.Y1 + 1 - p.getY() );
+}
+
+//----------------------------------------------------------------------
+bool operator == (const FRect& r1, const FRect& r2)
+{
+ return r1.X1 == r2.X1
+ && r1.Y1 == r2.Y1
+ && r1.X2 == r2.X2
+ && r1.Y2 == r2.Y2;
+}
+
+//----------------------------------------------------------------------
+bool operator != (const FRect& r1, const FRect& r2)
+{
+ return r1.X1 != r2.X1
+ || r1.Y1 != r2.Y1
+ || r1.X2 != r2.X2
+ || r1.Y2 != r2.Y2;
+}
diff --git a/src/frect.h b/src/frect.h
new file mode 100644
index 00000000..7f637bd5
--- /dev/null
+++ b/src/frect.h
@@ -0,0 +1,124 @@
+// frect.h
+// class FRect
+
+#ifndef _FRECT_H
+#define _FRECT_H
+
+#include
+
+#include "fpoint.h"
+
+
+//----------------------------------------------------------------------
+// class FRect
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FRect
+{
+ private:
+ short X1;
+ short Y1;
+ short X2;
+ short Y2;
+
+ public:
+ FRect (); // constructor
+ FRect (int, int, int, int); // constructor
+ FRect (const FPoint&, const FPoint&); // constructor
+ virtual ~FRect(); // destructor
+ virtual const char* getClassName();
+
+ bool isNull() const;
+ int getX1() const;
+ int getY1() const;
+ int getX2() const;
+ int getY2() const;
+ int getX() const;
+ int getY() const;
+ int getWidth() const;
+ int getHeight() const;
+
+ void setX1 (int);
+ void setY1 (int);
+ void setX2 (int);
+ void setY2 (int);
+ void setX (int);
+ void setY (int);
+ void setWidth (int);
+ void setHeight (int);
+ void setRect (const FRect&);
+ void setRect (int, int, int, int);
+
+ void move (int, int);
+ void move (const FPoint&);
+ bool contains (int, int) const;
+ bool contains (const FPoint&) const;
+ bool contains (const FRect&) const;
+ bool overlap (const FRect&) const;
+ FRect intersect (const FRect&) const;
+
+ friend FRect operator + (const FRect&, const FPoint&);
+ friend FRect operator - (const FRect&, const FPoint&);
+ friend bool operator == (const FRect&, const FRect&);
+ friend bool operator != (const FRect&, const FRect&);
+};
+#pragma pack(pop)
+
+
+// FRect inline functions
+//----------------------------------------------------------------------
+inline FRect::FRect()
+{
+ X1 = Y1 = 0;
+ X2 = Y2 = -1;
+}
+
+//----------------------------------------------------------------------
+inline FRect::FRect (int x, int y, int width, int height)
+{
+ X1 = short(x);
+ Y1 = short(y);
+ X2 = short(x+width-1);
+ Y2 = short(y+height-1);
+}
+
+//----------------------------------------------------------------------
+inline const char* FRect::getClassName()
+{ return "FRect"; }
+
+//----------------------------------------------------------------------
+inline int FRect::getX1() const
+{ return X1; }
+
+//----------------------------------------------------------------------
+inline int FRect::getY1() const
+{ return Y1; }
+
+//----------------------------------------------------------------------
+inline int FRect::getX2() const
+{ return X2; }
+
+//----------------------------------------------------------------------
+inline int FRect::getY2() const
+{ return Y2; }
+
+//----------------------------------------------------------------------
+inline int FRect::getX() const
+{ return X1; }
+
+//----------------------------------------------------------------------
+inline int FRect::getY() const
+{ return Y1; }
+
+//----------------------------------------------------------------------
+inline int FRect::getWidth() const
+{ return X2 - X1 + 1; }
+
+//----------------------------------------------------------------------
+inline int FRect::getHeight() const
+{ return Y2 - Y1 + 1; }
+
+#endif // _FRECT_H
diff --git a/src/fscrollbar.cpp b/src/fscrollbar.cpp
new file mode 100644
index 00000000..08dc7e49
--- /dev/null
+++ b/src/fscrollbar.cpp
@@ -0,0 +1,671 @@
+// fscrollbar.cpp
+// class FScrollbar
+
+#include "fscrollbar.h"
+
+//----------------------------------------------------------------------
+// class FScrollbar
+//----------------------------------------------------------------------
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FScrollbar::FScrollbar(FWidget* parent) : FWidget(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FScrollbar::FScrollbar(int o, FWidget* parent) : FWidget(parent)
+{
+ this->init();
+ setOrientation (o);
+}
+
+//----------------------------------------------------------------------
+FScrollbar::~FScrollbar()
+{
+ delAllTimer();
+}
+
+// private methods of FScrollbar
+//----------------------------------------------------------------------
+void FScrollbar::init()
+{
+ SliderPos = 0;
+ SliderClickPos = -1;
+ currentSliderPos = -1;
+ min = val = 0;
+ max = 99;
+ steps = 1;
+ pageSize = 0;
+ bar_orientation = fc::vertical;
+ width = 1;
+ length = height = 20;
+ BarLength = length - 2;
+ SliderLength = BarLength = 20-2;
+ setGeometry(1, 1, 1, 20);
+ scrollType = FScrollbar::noScroll;
+ thresholdTime = 500;
+ repeatTime = 10;
+ max_color = getMaxColor();
+ ignore_padding = true;
+ unsetFocusable();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::draw()
+{
+ //setUpdateVTerm(false);
+ drawButtons();
+ currentSliderPos = -1;
+ drawBar();
+ //setUpdateVTerm(true);
+}
+
+//----------------------------------------------------------------------
+int FScrollbar::getClickedScrollType (int x, int y)
+{
+ int stype;
+ if ( bar_orientation == fc::vertical )
+ {
+ if ( y == 1 )
+ {
+ stype = FScrollbar::scrollStepBackward; // decrement button
+ }
+ else if ( y >1 && y <= SliderPos+1 )
+ {
+ stype = FScrollbar::scrollPageBackward; // before slider
+ }
+ else if ( y > SliderPos+SliderLength+1 && y < height )
+ {
+ stype = FScrollbar::scrollPageForward; // after slider
+ }
+ else if ( y == height )
+ {
+ stype = FScrollbar::scrollStepForward; // increment button
+ }
+ else
+ stype = FScrollbar::noScroll;
+ }
+ else // horizontal
+ {
+ if ( isNewFont() )
+ {
+ if ( x == 1 || x == 2 )
+ {
+ stype = FScrollbar::scrollStepBackward; // decrement button
+ }
+ else if ( x >2 && x <= SliderPos+2 )
+ {
+ stype = FScrollbar::scrollPageBackward; // before slider
+ }
+ else if ( x > SliderPos+SliderLength+2 && x < width-1 )
+ {
+ stype = FScrollbar::scrollPageForward; // after slider
+ }
+ else if ( x == width-1 || x == width )
+ {
+ stype = FScrollbar::scrollStepForward; // increment button
+ }
+ else
+ stype = FScrollbar::noScroll;
+ }
+ else
+ {
+ if ( x == 1 )
+ {
+ stype = FScrollbar::scrollStepBackward; // decrement button
+ }
+ else if ( x >1 && x <= SliderPos+1 )
+ {
+ stype = FScrollbar::scrollPageBackward; // before slider
+ }
+ else if ( x > SliderPos+SliderLength+1 && x < width )
+ {
+ stype = FScrollbar::scrollPageForward; // after slider
+ }
+ else if ( x == width )
+ {
+ stype = FScrollbar::scrollStepForward; // increment button
+ }
+ else
+ stype = FScrollbar::noScroll;
+ }
+ }
+ return stype;
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::processMiddleButton (int x, int y)
+{
+ int new_val;
+ if ( bar_orientation == fc::vertical )
+ {
+ if ( y >1 && y < height )
+ {
+ new_val = int( round ( float(max-min) * (y-2-(SliderLength/2))
+ / float(BarLength-SliderLength) ) );
+ }
+ else
+ return;
+ }
+ else // horizontal
+ {
+ int nf = isNewFont() ? 1 : 0;
+ if ( x > 1+nf && x < width-nf )
+ {
+ new_val = int( round ( float(max-min) * (x-2-nf-(SliderLength/2))
+ / float(BarLength-SliderLength) ) );
+ }
+ else
+ return;
+ }
+ if ( new_val != val )
+ {
+ setValue(new_val);
+ drawBar();
+ updateTerminal();
+ scrollType = FScrollbar::scrollJump;
+ processScroll();
+ }
+}
+
+
+//----------------------------------------------------------------------
+void FScrollbar::processScroll()
+{
+ emitCallback("change-value");
+}
+
+
+// public methods of FScrollbar
+//----------------------------------------------------------------------
+void FScrollbar::onMouseDown (FMouseEvent* event)
+{
+ int mouse_x, mouse_y;
+
+ if ( event->getButton() != LeftButton
+ && event->getButton() != MiddleButton )
+ return;
+
+ if ( min == max )
+ return;
+
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( event->getButton() == MiddleButton )
+ {
+ processMiddleButton (mouse_x, mouse_y);
+ return;
+ }
+
+ // process LeftButton
+ scrollType = getClickedScrollType(mouse_x, mouse_y);
+
+ if ( bar_orientation == fc::vertical )
+ {
+ if ( mouse_y > SliderPos+1 && mouse_y <= SliderPos+SliderLength+1 )
+ SliderClickPos = mouse_y; // on slider
+ }
+ else // horizontal
+ {
+ if ( isNewFont() )
+ {
+ if ( mouse_x > SliderPos+2 && mouse_x <= SliderPos+SliderLength+2 )
+ SliderClickPos = mouse_x; // on slider
+ }
+ else
+ {
+ if ( mouse_x > SliderPos+1 && mouse_x <= SliderPos+SliderLength+1 )
+ SliderClickPos = mouse_x; // on slider
+ }
+ }
+
+ if ( SliderClickPos > 0 )
+ scrollType = FScrollbar::scrollJump;
+
+ if ( scrollType == FScrollbar::scrollPageBackward
+ || scrollType == FScrollbar::scrollPageForward )
+ {
+ if ( bar_orientation == fc::vertical )
+ SliderClickStopPos = mouse_y - 2;
+ else
+ if ( isNewFont() )
+ SliderClickStopPos = mouse_x - 3;
+ else
+ SliderClickStopPos = mouse_x - 2;
+ }
+ else
+ SliderClickStopPos = -1;
+
+ if ( scrollType >= FScrollbar::scrollStepBackward
+ && scrollType <= FScrollbar::scrollPageForward )
+ {
+ processScroll();
+ thresholdReached = false;
+ addTimer(thresholdTime);
+ }
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::onMouseUp (FMouseEvent* event)
+{
+ if ( event->getButton() != LeftButton
+ && event->getButton() != MiddleButton )
+ return;
+
+ SliderClickPos = -1;
+
+ if ( scrollType != FScrollbar::noScroll )
+ {
+ delAllTimer();
+ scrollType = FScrollbar::noScroll;
+ }
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::onMouseMove (FMouseEvent* event)
+{
+ int mouse_x, mouse_y, newScrollType;
+
+ if ( event->getButton() != LeftButton
+ && event->getButton() != MiddleButton )
+ return;
+
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( event->getButton() == MiddleButton )
+ {
+ processMiddleButton (mouse_x, mouse_y);
+ return;
+ }
+
+ // process LeftButton
+ newScrollType = getClickedScrollType(mouse_x, mouse_y);
+
+ if ( scrollType == FScrollbar::scrollJump )
+ {
+ int new_val;
+ if ( bar_orientation == fc::vertical )
+ {
+ int dy = mouse_y - SliderClickPos;
+ SliderClickPos = mouse_y;
+
+ new_val = int( round ( float(max-min) * (SliderPos + dy)
+ / float(BarLength-SliderLength) ) );
+ }
+ else // horizontal
+ {
+ int dx = mouse_x - SliderClickPos;
+ SliderClickPos = mouse_x;
+
+ new_val = int( round ( float(max-min) * (SliderPos + dx)
+ / float(BarLength-SliderLength) ) );
+ }
+ if ( new_val != val )
+ {
+ setValue(new_val);
+ drawBar();
+ updateTerminal();
+ processScroll();
+ }
+ }
+
+ if ( mouse_x < 1 || mouse_x > width
+ || mouse_y < 1 || mouse_y > height )
+ {
+ delAllTimer();
+ }
+ else if ( scrollType != FScrollbar::scrollJump )
+ {
+ addTimer(repeatTime);
+ }
+
+ if ( scrollType != newScrollType )
+ {
+ delAllTimer();
+ }
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::onWheel (FWheelEvent* event)
+{
+ int wheel = event->getWheel();
+
+ if ( scrollType != FScrollbar::noScroll )
+ {
+ delAllTimer();
+ scrollType = FScrollbar::noScroll;
+ }
+
+ if ( wheel == WheelUp )
+ scrollType = FScrollbar::scrollWheelUp;
+ else if ( wheel == WheelDown )
+ scrollType = FScrollbar::scrollWheelDown;
+
+ processScroll();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::onTimer (FTimerEvent*)
+{
+ if ( scrollType == FScrollbar::noScroll )
+ return;
+
+ if ( ! thresholdReached )
+ {
+ thresholdReached = true;
+ delAllTimer();
+ addTimer(repeatTime);
+ }
+
+ if ( ( scrollType == scrollPageBackward
+ && SliderPos < SliderClickStopPos )
+ || ( scrollType == scrollPageForward
+ && SliderPos+SliderLength-1 >= SliderClickStopPos ) )
+ {
+ delAllTimer();
+ return;
+ }
+
+ processScroll();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::resize()
+{
+ FWidget::resize();
+ setOrientation (bar_orientation);
+ setValue (val);
+ calculateSliderValues();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::redraw()
+{
+ draw();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setMinimum (int minimum)
+{
+ this->min = minimum;
+ calculateSliderValues();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setMaximum (int maximum)
+{
+ this->max = maximum;
+ calculateSliderValues();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setRange(int minimum, int maximum)
+{
+ this->min = minimum;
+ this->max = maximum;
+ calculateSliderValues();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setValue (int value)
+{
+ this->val = value;
+ calculateSliderValues();
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setSteps (float st)
+{
+ if ( st <= 0 )
+ steps = 1;
+ else
+ steps = st;
+ if ( pageSize == 0 )
+ pageSize = int(max/steps);
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setPageSize (int document_size, int page_size)
+{
+ if ( page_size == 0 )
+ {
+ pageSize = document_size;
+ this->steps = 1.0;
+ }
+ else
+ {
+ pageSize = page_size;
+ this->steps = float(float(document_size) / float(page_size));
+ }
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::calculateSliderValues()
+{
+ if ( isNewFont() && bar_orientation == fc::horizontal )
+ BarLength = length - 4;
+ else
+ BarLength = length - 2;
+ SliderLength = int(float(BarLength / steps));
+
+ if ( SliderLength < 1 )
+ SliderLength = 1;
+ else if ( SliderLength > BarLength )
+ SliderLength = BarLength;
+
+ if ( val == min )
+ {
+ SliderPos = 0;
+ return;
+ }
+ if ( val == max )
+ {
+ SliderPos = BarLength - SliderLength;
+ return;
+ }
+
+ SliderPos = int( round ( float((BarLength-SliderLength) * val)
+ / float(max-min) ) );
+
+ if ( SliderPos < 0 )
+ SliderPos = 0;
+ else if ( SliderPos > BarLength - SliderLength )
+ SliderPos = BarLength - SliderLength;
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setOrientation (int o)
+{
+ int nf = 0;
+ length = (height > width) ? height : width;
+
+ if ( o == fc::vertical && bar_orientation == fc::horizontal )
+ {
+ width = 1;
+ height = length;
+ }
+ else if ( o == fc::horizontal && bar_orientation == fc::vertical )
+ {
+ height = 1;
+ width = length;
+ if ( isNewFont() )
+ nf = 2;
+ }
+ SliderLength = BarLength = length-nf-2;
+ bar_orientation = o;
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::setGeometry (int x, int y, int w, int h, bool adjust)
+{
+ FWidget::setGeometry (x, y, w, h, adjust);
+
+ int nf = 0;
+ length = (h > w) ? h : w;
+
+ if ( bar_orientation == fc::vertical )
+ {
+ width = isNewFont() ? 2 : 1;
+ height = length;
+ }
+ else // horizontal
+ {
+ height = 1;
+ width = length;
+ if ( isNewFont() )
+ nf = 2;
+ }
+ SliderLength = BarLength = length-nf-2;
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::drawBar()
+{
+ setUpdateVTerm(false);
+ if (SliderPos != currentSliderPos)
+ {
+ int z;
+ if ( bar_orientation == fc::vertical )
+ {
+ setColor (wc.scrollbar_fg, wc.scrollbar_bg);
+ for (z=1; z <= SliderPos; z++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+z);
+ if ( isNewFont() )
+ print (fc::NF_border_line_left); // ⎸
+ if ( isMonochron() || max_color < 16 )
+ print (fc::MediumShade); // ▒
+ else
+ print (' ');
+ }
+ setColor (wc.scrollbar_bg, wc.scrollbar_fg);
+ if ( isMonochron() )
+ setReverse(true);
+ for (z=1; z <= SliderLength; z++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+SliderPos+z);
+ if ( isNewFont() )
+ print (' ');
+ print (' ');
+ }
+ if ( isMonochron() )
+ setReverse(false);
+ setColor (wc.scrollbar_fg, wc.scrollbar_bg);
+ for (z=SliderPos+SliderLength+1; z <= BarLength; z++)
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1+z);
+ if ( isNewFont() )
+ print (fc::NF_border_line_left); // ⎸
+ if ( isMonochron() || max_color < 16 )
+ print (fc::MediumShade);
+ else
+ print (' ');
+ }
+ }
+ else // horizontal
+ {
+ setColor (wc.scrollbar_fg, wc.scrollbar_bg);
+
+ z = 0;
+ if ( isNewFont() )
+ gotoxy (xpos+xmin+1+z, ypos+ymin-1);
+ else
+ gotoxy (xpos+xmin+z, ypos+ymin-1);
+
+ for (; z < SliderPos; z++)
+ {
+ if ( isNewFont() )
+ print (fc::NF_border_line_upper); // ¯
+ else if ( isMonochron() || max_color < 16 )
+ print (fc::MediumShade); // ▒
+ else
+ print (' ');
+ }
+ setColor (wc.scrollbar_bg, wc.scrollbar_fg);
+ if ( isMonochron() )
+ setReverse(true);
+
+ z = 0;
+ for (; z < SliderLength; z++)
+ print (' ');
+ if ( isMonochron() )
+ setReverse(false);
+ setColor (wc.scrollbar_fg, wc.scrollbar_bg);
+ z = SliderPos + SliderLength + 1;
+ for (; z <= BarLength; z++)
+ {
+ if ( isNewFont() )
+ print (fc::NF_border_line_upper); // ¯
+ else if ( isMonochron() || max_color < 16 )
+ print (fc::MediumShade); // ▒
+ else
+ print (' ');
+ }
+ }
+ currentSliderPos = SliderPos;
+ }
+ setUpdateVTerm(true);
+}
+
+//----------------------------------------------------------------------
+void FScrollbar::drawButtons()
+{
+ setColor (wc.scrollbar_button_fg, wc.scrollbar_button_bg);
+
+ if ( isNewFont() )
+ {
+ if ( bar_orientation == fc::vertical )
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ print (fc::NF_rev_up_arrow1);
+ print (fc::NF_rev_up_arrow2);
+ gotoxy (xpos+xmin-1, ypos+ymin+length-2);
+ print (fc::NF_rev_down_arrow1);
+ print (fc::NF_rev_down_arrow2);
+ }
+ else // horizontal
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ print (fc::NF_rev_left_arrow1);
+ print (fc::NF_rev_left_arrow2);
+ gotoxy (xpos+xmin+length-3, ypos+ymin-1);
+ print (fc::NF_rev_right_arrow1);
+ print (fc::NF_rev_right_arrow2);
+ }
+ }
+ else
+ {
+ if ( bar_orientation == fc::vertical )
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ if ( isMonochron() )
+ setReverse(true);
+ if ( isCygwinTerminal() )
+ print ('^');
+ else
+ print (fc::BlackUpPointingTriangle); // ▲
+ gotoxy (xpos+xmin-1, ypos+ymin+length-2);
+ if ( isCygwinTerminal() )
+ print ('v');
+ else
+ print (fc::BlackDownPointingTriangle); // ▼
+ if ( isMonochron() )
+ setReverse(false);
+ }
+ else // horizontal
+ {
+ gotoxy (xpos+xmin-1, ypos+ymin-1);
+ if ( isMonochron() )
+ setReverse(true);
+ print (fc::BlackLeftPointingPointer); // ◄
+ gotoxy (xpos+xmin+length-2, ypos+ymin-1);
+ print (fc::BlackRightPointingPointer); // ►
+ if ( isMonochron() )
+ setReverse(false);
+ }
+ }
+}
diff --git a/src/fscrollbar.h b/src/fscrollbar.h
new file mode 100644
index 00000000..7f22d549
--- /dev/null
+++ b/src/fscrollbar.h
@@ -0,0 +1,105 @@
+// fscrollbar.h
+// class FScrollbar
+
+#ifndef _FSCROLLBAR_H
+#define _FSCROLLBAR_H
+
+#include "fwidget.h"
+
+//----------------------------------------------------------------------
+// class FScrollbar
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FScrollbar : public FWidget
+{
+ private:
+ int scrollType;
+ bool thresholdReached;
+ int thresholdTime;
+ int repeatTime;
+ int SliderClickPos;
+ int SliderClickStopPos;
+ int currentSliderPos;
+ int SliderPos;
+ int SliderLength;
+ int BarLength;
+ int val;
+ int min;
+ int max;
+ float steps;
+ int pageSize;
+ int length;
+ int bar_orientation;
+ int max_color;
+
+ public:
+ enum scroll_type
+ {
+ noScroll = 0,
+ scrollJump = 1,
+ scrollStepBackward = 2,
+ scrollStepForward = 3,
+ scrollPageBackward = 4,
+ scrollPageForward = 5,
+ scrollWheelUp = 6,
+ scrollWheelDown = 7
+ };
+
+ private:
+ FScrollbar (const FScrollbar&);
+ FScrollbar& operator = (const FScrollbar&);
+
+ void init();
+ void draw();
+ int getClickedScrollType (int, int);
+ void processMiddleButton (int, int);
+ void processScroll();
+
+ public:
+ FScrollbar(FWidget* parent=0); // constructor
+ FScrollbar(int o=fc::vertical, FWidget* parent=0); // constructor
+ virtual ~FScrollbar();
+ const char* getClassName() const;
+
+ void onMouseDown (FMouseEvent*);
+ void onMouseUp (FMouseEvent*);
+ void onMouseMove (FMouseEvent*);
+ void onWheel (FWheelEvent*);
+ void onTimer (FTimerEvent*);
+
+ void resize();
+ void redraw();
+ void setMinimum (int);
+ void setMaximum (int);
+ void setRange (int, int);
+ void setValue (int);
+ int getValue() const;
+ void setSteps (float);
+ void setPageSize (int, int);
+ void calculateSliderValues();
+ void setOrientation (int);
+ void setGeometry (int, int, int, int, bool adjust=true);
+ void drawButtons();
+ void drawBar();
+ int getScrollType() const;
+};
+#pragma pack(pop)
+
+
+// FScrollbar inline functions
+//----------------------------------------------------------------------
+inline const char* FScrollbar::getClassName() const
+{ return "FScrollbar"; }
+
+//----------------------------------------------------------------------
+inline int FScrollbar::getValue() const
+{ return val; }
+
+//----------------------------------------------------------------------
+inline int FScrollbar::getScrollType() const
+{ return scrollType; }
+
+#endif // _FSCROLLBAR_H
diff --git a/src/fstatusbar.cpp b/src/fstatusbar.cpp
new file mode 100644
index 00000000..5b402434
--- /dev/null
+++ b/src/fstatusbar.cpp
@@ -0,0 +1,701 @@
+// fstatusbar.cpp
+// class FStatusKey
+// class FStatusBar
+
+#include "fstatusbar.h"
+
+//----------------------------------------------------------------------
+// class FStatusKey
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FStatusKey::FStatusKey(FWidget* parent) : FWidget(parent)
+{
+ this->active = false;
+ this->mouse_focus = false;
+ setGeometry (1,1,1,1);
+
+ if ( parent && strcmp ( parent->getClassName(),
+ const_cast("FStatusBar") ) == 0 )
+ {
+ setStatusbar( static_cast(parent) );
+ statusbar()->insert(this);
+ }
+}
+
+//----------------------------------------------------------------------
+FStatusKey::FStatusKey ( int k,
+ FString& txt,
+ FWidget* parent ) : FWidget(parent)
+{
+ this->active = false;
+ this->mouse_focus = false;
+ setKey(k);
+ setText(txt);
+ setGeometry (1,1,1,1);
+
+ if ( parent && strcmp ( parent->getClassName(),
+ const_cast("FStatusBar") ) == 0 )
+ {
+ setStatusbar( static_cast(parent) );
+ statusbar()->insert(this);
+ }
+}
+
+//----------------------------------------------------------------------
+FStatusKey::FStatusKey ( int k,
+ const std::string& txt,
+ FWidget* parent) : FWidget(parent)
+{
+ this->active = false;
+ this->mouse_focus = false;
+ setKey(k);
+ setText(txt);
+ setGeometry (1,1,1,1);
+
+ if ( parent && strcmp ( parent->getClassName(),
+ const_cast("FStatusBar") ) == 0 )
+ {
+ setStatusbar( static_cast(parent) );
+ statusbar()->insert(this);
+ }
+}
+
+//----------------------------------------------------------------------
+FStatusKey::FStatusKey ( int k,
+ const char* txt,
+ FWidget* parent ) : FWidget(parent)
+{
+ this->active = false;
+ this->mouse_focus = false;
+ setKey(k);
+ setText(txt);
+
+ setGeometry (1,1,1,1);
+ if ( parent && strcmp ( parent->getClassName(),
+ const_cast("FStatusBar") ) == 0 )
+ {
+ setStatusbar( static_cast(parent) );
+ statusbar()->insert(this);
+ }
+}
+
+//----------------------------------------------------------------------
+FStatusKey::~FStatusKey() // destructor
+{
+ if ( statusbar() )
+ statusbar()->remove(this);
+ delAccelerator(this);
+}
+
+
+// private methods of FStatusKey
+//----------------------------------------------------------------------
+void FStatusKey::processActivate()
+{
+ emitCallback("activate");
+}
+
+//----------------------------------------------------------------------
+void FStatusKey::onAccel (FAccelEvent* event)
+{
+ if ( ! isActivated() )
+ {
+ setActive();
+ statusbar()->redraw();
+ event->accept();
+ }
+}
+
+//----------------------------------------------------------------------
+FStatusBar* FStatusKey::statusbar() const
+{
+ return bar;
+}
+
+//----------------------------------------------------------------------
+void FStatusKey::setStatusbar (FStatusBar* sb)
+{
+ bar = sb;
+}
+
+// public methods of FStatusKey
+//----------------------------------------------------------------------
+inline void FStatusKey::setActive()
+{
+ this->active = true;
+ processActivate();
+}
+
+//----------------------------------------------------------------------
+bool FStatusKey::setMouseFocus(bool on)
+{
+ if ( on == mouse_focus )
+ return true;
+
+ return mouse_focus = (on) ? true : false;
+}
+
+
+//----------------------------------------------------------------------
+// class FStatusBar
+//----------------------------------------------------------------------
+
+// constructor and destructor
+//----------------------------------------------------------------------
+FStatusBar::FStatusBar(FWidget* parent) : FWindow(parent)
+{
+ this->init();
+}
+
+//----------------------------------------------------------------------
+FStatusBar::~FStatusBar()
+{
+ if ( vstatusbar != 0 )
+ {
+ if ( vstatusbar->changes != 0 )
+ delete[] vstatusbar->changes;
+ if ( vstatusbar->text != 0 )
+ delete[] vstatusbar->text;
+ delete vstatusbar;
+ }
+ vstatusbar = 0;
+
+ // delete all keys
+ if ( ! keylist.empty() )
+ {
+ std::vector::iterator iter;
+ iter = keylist.begin();
+
+ while ( iter != keylist.end() )
+ {
+ (*iter)->setStatusbar(0);
+ delAccelerator (*iter);
+ iter = keylist.erase(iter);
+ }
+ }
+}
+
+
+// private methods of FStatusBar
+//----------------------------------------------------------------------
+void FStatusBar::init()
+{
+ xmin = ymin = 1;
+ xpos = 1;
+ ypos = getLineNumber();
+ createArea (vstatusbar);
+ // initialize geometry values
+ setGeometry (1, ypos, getColumnNumber(), 1, false);
+ getRootWidget()->setBottomPadding(1, true);
+ text = "";
+ x = x_msg = -1;
+ setStatusBar(this);
+ foregroundColor = wc.statusbar_fg;
+ backgroundColor = wc.statusbar_bg;
+ window_object = true;
+ mouse_down = false;
+ ignore_padding = true;
+ unsetFocusable();
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::draw()
+{
+ xmin = ymin = 1;
+ height = 1;
+ xpos = 1;
+ drawKeys();
+ drawMessage();
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::drawKeys()
+{
+ std::vector::const_iterator iter, end;
+ int screenWidth, lastLine;
+
+ x = 1;
+ screenWidth = getColumnNumber();
+ lastLine = getLineNumber();
+ width = screenWidth;
+ ypos = lastLine;
+
+ if ( keylist.empty() )
+ return;
+
+ setUpdateVTerm(false);
+ gotoxy (1, lastLine);
+
+ iter = keylist.begin();
+ end = keylist.end();
+
+ if ( isMonochron() )
+ setReverse(true);
+ while ( iter != end )
+ {
+ int kname_len = int(getKeyName((*iter)->getKey()).getLength());
+ if ( x+kname_len+2 < screenWidth )
+ {
+ if ( (*iter)->isActivated() || (*iter)->hasMouseFocus() )
+ {
+ if ( isMonochron() )
+ setReverse(false);
+ setColor ( wc.statusbar_active_hotkey_fg,
+ wc.statusbar_active_hotkey_bg );
+ x++;
+ print (vstatusbar, ' ');
+ x += kname_len;
+ print (vstatusbar, getKeyName((*iter)->getKey()));
+
+ setColor (wc.statusbar_active_fg, wc.statusbar_active_bg);
+ x++;
+ print (vstatusbar, '-');
+
+ int txt_length = int((*iter)->getText().getLength());
+ x += txt_length;
+ if ( x <= screenWidth )
+ {
+ print (vstatusbar, (*iter)->getText());
+ x++;
+ print (vstatusbar, fc::RightHalfBlock); // ▌
+ }
+ else
+ {
+ print ( vstatusbar,
+ (*iter)->getText()
+ .left(uInt(txt_length+screenWidth-x-1)) );
+ print ( vstatusbar, ".." );
+ }
+ if ( isMonochron() )
+ setReverse(true);
+ }
+ else
+ {
+ int txt_length;
+
+ // not active
+ setColor (wc.statusbar_hotkey_fg, wc.statusbar_hotkey_bg);
+ x++;
+ print (vstatusbar, ' ');
+
+ x += kname_len;
+ print (vstatusbar, getKeyName((*iter)->getKey()));
+
+ setColor (wc.statusbar_fg, wc.statusbar_bg);
+ x++;
+ print (vstatusbar, '-');
+
+ txt_length = int((*iter)->getText().getLength());
+ x += txt_length;
+ if ( x-1 <= screenWidth )
+ print (vstatusbar, (*iter)->getText());
+ else
+ {
+ print ( vstatusbar,
+ (*iter)->getText()
+ .left(uInt(txt_length+screenWidth-x-1)) );
+ print ( vstatusbar, ".." );
+ }
+ if ( iter+1 != keylist.end()
+ && ( (*(iter+1))->isActivated() || (*(iter+1))->hasMouseFocus() )
+ && x + int(getKeyName((*(iter+1))->getKey()).getLength()) + 3
+ < screenWidth )
+ {
+ // next element is active
+ if ( isMonochron() )
+ setReverse(false);
+ setColor (wc.statusbar_active_fg, wc.statusbar_active_bg);
+ x++;
+ print (vstatusbar, fc::LeftHalfBlock); // ▐
+ if ( isMonochron() )
+ setReverse(true);
+ }
+ else if ( iter+1 != keylist.end() && x < screenWidth )
+ {
+ // not the last element
+ setColor (wc.statusbar_separator_fg, wc.statusbar_bg);
+ x++;
+ print (vstatusbar, fc::BoxDrawingsVertical); // │
+ }
+ }
+ }
+ else
+ {
+ setColor (wc.statusbar_fg, wc.statusbar_bg);
+ for (; x <= screenWidth; x++)
+ print (vstatusbar, ' ');
+ }
+ ++iter;
+ }
+ if ( isMonochron() )
+ setReverse(false);
+
+ setUpdateVTerm(true);
+ x_msg = x;
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::adjustSize()
+{
+ xmin = ymin = 1;
+ height = 1;
+ xpos = 1;
+ width = getColumnNumber();
+ ypos = getLineNumber();
+ FWidget::adjustSize();
+}
+
+
+// public methods of FStatusBar
+//----------------------------------------------------------------------
+void FStatusBar::onMouseDown (FMouseEvent* event)
+{
+ if ( hasActivatedKey() )
+ return;
+ if ( event->getButton() != LeftButton )
+ {
+ mouse_down = false;
+ if ( ! keylist.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ iter = keylist.begin();
+ end = keylist.end();
+
+ while ( iter != end )
+ {
+ (*iter)->unsetMouseFocus();
+ ++iter;
+ }
+ }
+ this->redraw();
+ return;
+ }
+ if ( mouse_down )
+ return;
+ mouse_down = true;
+
+ if ( ! keylist.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ int X = 1;
+
+ iter = keylist.begin();
+ end = keylist.end();
+
+ while ( iter != end )
+ {
+ int x1, x2, mouse_x, mouse_y, kname_len, txt_length;
+
+ x1 = X;
+ kname_len = int(getKeyName((*iter)->getKey()).getLength());
+ txt_length = int((*iter)->getText().getLength());
+ x2 = x1 + kname_len + txt_length + 1;
+ mouse_x = event->getX();
+ mouse_y = event->getY();
+
+ if ( mouse_x >= x1
+ && mouse_x <= x2
+ && mouse_y == 1
+ && ! (*iter)->hasMouseFocus() )
+ {
+ (*iter)->setMouseFocus();
+ this->redraw();
+ }
+ X = x2 + 2;
+ ++iter;
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::onMouseUp (FMouseEvent* event)
+{
+ if ( hasActivatedKey() )
+ return;
+ if ( event->getButton() != LeftButton )
+ return;
+
+ if ( mouse_down )
+ {
+ mouse_down = false;
+ if ( ! keylist.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ int X = 1;
+
+ iter = keylist.begin();
+ end = keylist.end();
+
+ while ( iter != end )
+ {
+ int x1 = X;
+ int kname_len = int(getKeyName((*iter)->getKey()).getLength());
+ int txt_length = int((*iter)->getText().getLength());
+ int x2 = x1 + kname_len + txt_length + 1;
+
+ if ( (*iter)->hasMouseFocus() )
+ {
+ (*iter)->unsetMouseFocus();
+ int mouse_x = event->getX();
+ int mouse_y = event->getY();
+ if ( mouse_x >= x1 && mouse_x <= x2 && mouse_y == 1 )
+ (*iter)->setActive();
+ this->redraw();
+ }
+ X = x2 + 2;
+ ++iter;
+ }
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::onMouseMove (FMouseEvent* event)
+{
+ if ( hasActivatedKey() )
+ return;
+ if ( event->getButton() != LeftButton )
+ return;
+
+ if ( mouse_down && ! keylist.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ bool focus_changed = false;
+ int X=1;
+
+ iter = keylist.begin();
+ end = keylist.end();
+
+ while ( iter != end )
+ {
+ int x1 = X;
+ int kname_len = int(getKeyName((*iter)->getKey()).getLength());
+ int txt_length = int((*iter)->getText().getLength());
+ int x2 = x1 + kname_len + txt_length + 1;
+
+ int mouse_x = event->getX();
+ int mouse_y = event->getY();
+ if ( mouse_x >= x1
+ && mouse_x <= x2
+ && mouse_y == 1 )
+ {
+ if ( ! (*iter)->hasMouseFocus() )
+ {
+ (*iter)->setMouseFocus();
+ focus_changed = true;
+ }
+ }
+ else
+ {
+ if ( (*iter)->hasMouseFocus() )
+ {
+ (*iter)->unsetMouseFocus();
+ focus_changed = true;
+ }
+ }
+ X = x2 + 2;
+ ++iter;
+ }
+ if ( focus_changed )
+ this->redraw();
+ }
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::hide()
+{
+ int fg, bg, lastLine, screenWidth;
+ char* blank;
+
+ FWidget::hide();
+
+ fg = wc.term_fg;
+ bg = wc.term_bg;
+ setColor (fg, bg);
+
+ lastLine = getLineNumber();
+ screenWidth = getColumnNumber();
+ blank = new char[screenWidth+1];
+ memset(blank, ' ', uLong(screenWidth));
+ blank[screenWidth] = '\0';
+
+ gotoxy (1, lastLine);
+ print (vstatusbar, blank);
+ delete[] blank;
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::setGeometry (int xx, int yy, int ww, int hh, bool adjust)
+{
+ int old_width = width;
+ int old_height = height;
+ FWidget::setGeometry (xx, yy, ww, hh, adjust);
+ if ( vstatusbar && (width != old_width || height != old_height) )
+ resizeArea (vstatusbar);
+}
+
+//----------------------------------------------------------------------
+bool FStatusBar::hasActivatedKey()
+{
+ if ( ! keylist.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ iter = keylist.begin();
+ end = keylist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter)->isActivated() )
+ return true;
+ ++iter;
+ }
+ }
+ return false;
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::drawMessage()
+{
+ int termWidth, lastLine, space_offset;
+ bool isLastActiveFocus;
+
+ if ( ! isVisible() )
+ return;
+ if ( x < 0 || x_msg < 0 )
+ return;
+
+ x = x_msg;
+ termWidth = getColumnNumber();
+ lastLine = getLineNumber();
+ space_offset = 1;
+
+ if ( ! keylist.empty() )
+ {
+ std::vector::const_iterator iter = keylist.end();
+ isLastActiveFocus = bool( (*(iter-1))->isActivated()
+ || (*(iter-1))->hasMouseFocus() );
+ }
+ else
+ isLastActiveFocus = false;
+
+ if ( isLastActiveFocus )
+ space_offset = 0;
+
+ setUpdateVTerm(false);
+ setColor (wc.statusbar_fg, wc.statusbar_bg);
+ gotoxy (x, lastLine);
+ if ( isMonochron() )
+ setReverse(true);
+ if ( x+space_offset+3 < termWidth )
+ {
+ if ( this->text )
+ {
+ x += 2;
+ if ( ! isLastActiveFocus )
+ {
+ x++;
+ print (vstatusbar, ' ');
+ }
+ print (vstatusbar, fc::BoxDrawingsVertical); // │
+ print (vstatusbar, ' ');
+
+ int msg_length = int(getMessage().getLength());
+ x += msg_length;
+ if ( x-1 <= termWidth )
+ print (vstatusbar, getMessage());
+ else
+ {
+ print ( vstatusbar,
+ getMessage().left(uInt(msg_length+termWidth-x-1)) );
+ print ( vstatusbar, ".." );
+ }
+ }
+ }
+ for (int i=x; i < termWidth+1; i++)
+ print (vstatusbar, ' ');
+ if ( isMonochron() )
+ setReverse(false);
+
+ setUpdateVTerm(true);
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::insert (FStatusKey* skey)
+{
+ keylist.push_back (skey);
+
+ addAccelerator (skey->getKey(), skey);
+
+ skey->addCallback
+ (
+ "activate",
+ this,
+ reinterpret_cast(&FStatusBar::cb_statuskey_activated),
+ null
+ );
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::remove (FStatusKey* skey)
+{
+ std::vector::iterator iter;
+
+ delAccelerator (skey);
+
+ if ( keylist.empty() )
+ return;
+
+ iter = keylist.begin();
+ while ( iter != keylist.end() )
+ {
+ if ( (*iter) == skey )
+ {
+ iter = keylist.erase(iter);
+ skey->setStatusbar(0);
+ break;
+ }
+ else
+ ++iter;
+ }
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::remove (int skey)
+{
+ if ( int(count()) < skey )
+ return;
+
+ keylist.erase (keylist.begin()+skey-1);
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::clear()
+{
+ keylist.clear();
+}
+
+//----------------------------------------------------------------------
+void FStatusBar::cb_statuskey_activated (FWidget* widget, void*)
+{
+ if ( ! keylist.empty() )
+ {
+ std::vector::const_iterator iter, end;
+ FStatusKey* statuskey = static_cast(widget);
+
+ iter = keylist.begin();
+ end = keylist.end();
+
+ while ( iter != end )
+ {
+ if ( (*iter) != statuskey && (*iter)->isActivated() )
+ (*iter)->unsetActive();
+ ++iter;
+ }
+ }
+ if ( isVisible() && isShown() )
+ redraw();
+ if ( ! isHiddenCursor() )
+ hideCursor();
+}
diff --git a/src/fstatusbar.h b/src/fstatusbar.h
new file mode 100644
index 00000000..9bb85411
--- /dev/null
+++ b/src/fstatusbar.h
@@ -0,0 +1,205 @@
+// fstatusbar.h
+// class FStatusKey
+// class FStatusBar
+
+#ifndef _FSTATUSBAR_H
+#define _FSTATUSBAR_H
+
+#include "fwindow.h"
+
+class FStatusBar;
+
+//----------------------------------------------------------------------
+// class FStatusKey
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FStatusKey : public FWidget
+{
+ private:
+ int key;
+ FString text;
+ bool active;
+ bool mouse_focus;
+ FStatusBar* bar;
+
+ private:
+ FStatusKey (const FStatusKey&);
+ FStatusKey& operator = (const FStatusKey&);
+ void processActivate();
+ FStatusBar* statusbar() const;
+ void setStatusbar (FStatusBar*);
+
+ public:
+ FStatusKey (FWidget* parent=0);
+ FStatusKey (int, FString&, FWidget* parent=0);
+ FStatusKey (int, const std::string&, FWidget* parent=0);
+ FStatusKey (int, const char*, FWidget* parent=0);
+ virtual ~FStatusKey();
+
+ void onAccel (FAccelEvent*);
+ void setActive();
+ void unsetActive();
+ bool isActivated() const;
+ bool setMouseFocus(bool);
+ bool setMouseFocus();
+ bool unsetMouseFocus();
+ bool hasMouseFocus() const;
+ virtual int getKey() const;
+ virtual FString getText() const;
+
+ protected:
+ void setKey (int);
+ void setText (FString&);
+ void setText (const std::string&);
+ void setText (const char*);
+
+ private:
+ friend class FStatusBar;
+};
+#pragma pack(pop)
+
+
+// FStatusKey inline functions
+//----------------------------------------------------------------------
+inline void FStatusKey::unsetActive()
+{ this->active = false; }
+
+//----------------------------------------------------------------------
+inline bool FStatusKey::isActivated() const
+{ return active; }
+
+//----------------------------------------------------------------------
+inline bool FStatusKey::setMouseFocus()
+{ return setMouseFocus(true); }
+
+//----------------------------------------------------------------------
+inline bool FStatusKey::unsetMouseFocus()
+{ return setMouseFocus(false); }
+
+//----------------------------------------------------------------------
+inline bool FStatusKey::hasMouseFocus() const
+{ return mouse_focus; }
+
+//----------------------------------------------------------------------
+inline int FStatusKey::getKey() const
+{ return this->key; }
+
+//----------------------------------------------------------------------
+inline FString FStatusKey::getText() const
+{ return this->text; }
+
+//----------------------------------------------------------------------
+inline void FStatusKey::setKey (int k)
+{ this->key = k; }
+
+//----------------------------------------------------------------------
+inline void FStatusKey::setText (FString& txt)
+{ this->text = txt; }
+
+//----------------------------------------------------------------------
+inline void FStatusKey::setText (const std::string& txt)
+{ this->text = txt; }
+
+//----------------------------------------------------------------------
+inline void FStatusKey::setText (const char* txt)
+{ this->text = txt; }
+
+
+//----------------------------------------------------------------------
+// class FStatusBar
+//----------------------------------------------------------------------
+
+#pragma pack(push)
+#pragma pack(1)
+
+class FStatusBar : public FWindow
+{
+ private:
+ std::vector keylist;
+ FString text;
+ bool mouse_down;
+ int x;
+ int x_msg;
+
+ private:
+ FStatusBar (const FStatusBar&);
+ FStatusBar& operator = (const FStatusBar&);
+ void init();
+ void draw();
+ void drawKeys();
+ void adjustSize();
+
+ public:
+ FStatusBar (FWidget* parent=0); // constructor
+ virtual ~FStatusBar(); // destructor
+ virtual const char* getClassName() const;
+
+ void onMouseDown (FMouseEvent*);
+ void onMouseUp (FMouseEvent*);
+ void onMouseMove (FMouseEvent*);
+ void hide();
+ void setGeometry (int, int, int, int, bool adjust=true);
+
+ uInt count() const;
+ FStatusKey* key (int) const;
+ void activateKey (int);
+ void deactivateKey (int);
+ bool isActivated (int) const;
+ bool hasActivatedKey();
+
+ void drawMessage();
+ void setMessage (const FString);
+ FString getMessage() const;
+ void clearMessage();
+
+ void insert (FStatusKey*);
+ void remove (FStatusKey*);
+ void remove (int);
+ void clear();
+
+ void cb_statuskey_activated (FWidget*, void*);
+};
+#pragma pack(pop)
+
+
+// FStatusBar inline functions
+//----------------------------------------------------------------------
+inline const char* FStatusBar::getClassName() const
+{ return "FStatusBar"; }
+
+//----------------------------------------------------------------------
+inline uInt FStatusBar::count() const
+{ return uInt(keylist.size()); }
+
+//----------------------------------------------------------------------
+inline FStatusKey* FStatusBar::key(int index) const
+{ return keylist[uInt(index-1)]; }
+
+//----------------------------------------------------------------------
+inline void FStatusBar::activateKey (int index)
+{ keylist[uInt(index-1)]->setActive(); }
+
+//----------------------------------------------------------------------
+inline void FStatusBar::deactivateKey (int index)
+{ keylist[uInt(index-1)]->unsetActive(); }
+
+//----------------------------------------------------------------------
+inline bool FStatusBar::isActivated(int index) const
+{ return keylist[uInt(index-1)]->isActivated(); }
+
+//----------------------------------------------------------------------
+inline void FStatusBar::setMessage (FString mgs)
+{ text = mgs; }
+
+//----------------------------------------------------------------------
+inline FString FStatusBar::getMessage() const
+{ return text; }
+
+//----------------------------------------------------------------------
+inline void FStatusBar::clearMessage()
+{ text.clear(); }
+
+#endif // _FSTATUSBAR_H
diff --git a/src/fstring.cpp b/src/fstring.cpp
new file mode 100644
index 00000000..9df80f4b
--- /dev/null
+++ b/src/fstring.cpp
@@ -0,0 +1,1985 @@
+// fstring.cpp
+// class FString
+
+#include "fstring.h"
+
+//----------------------------------------------------------------------
+// class FString
+//----------------------------------------------------------------------
+
+
+// constructors and destructor
+//----------------------------------------------------------------------
+FString::FString()
+{
+ length = 0;
+ bufsize = 0;
+ string = 0;
+ c_string = 0;
+}
+
+//----------------------------------------------------------------------
+FString::FString (int len)
+{
+ if ( len >= 0 )
+ initLength(uInt(len));
+ else
+ initLength(0);
+}
+
+//----------------------------------------------------------------------
+FString::FString (uInt len)
+{
+ initLength(len);
+}
+
+//----------------------------------------------------------------------
+FString::FString (int len, wchar_t c)
+{
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+
+ if ( len >= 0 )
+ _replace ( FString(uInt(len), c).string );
+ else
+ initLength(0);
+}
+
+//----------------------------------------------------------------------
+FString::FString (uInt len, wchar_t c)
+{
+ register wchar_t* ps;
+ register wchar_t* pe;
+
+ initLength(len);
+ ps = string;
+ pe = string + len;
+
+ while ( pe != ps )
+ *--pe = c;
+}
+
+//----------------------------------------------------------------------
+FString::FString (int len, char c)
+{
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+
+ if ( len >= 0 )
+ _replace ( FString(uInt(len), c).string );
+ else
+ initLength(0);
+}
+
+//----------------------------------------------------------------------
+FString::FString (uInt len, char c)
+{
+ register wchar_t* ps;
+ register wchar_t* pe;
+
+ initLength(len);
+ ps = string;
+ pe = string + len;
+
+ while ( pe != ps )
+ *--pe = wchar_t(c);
+}
+
+//----------------------------------------------------------------------
+FString::FString (const FString& s)
+{
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+ if ( s.string )
+ _replace (s.string);
+}
+
+//----------------------------------------------------------------------
+FString::FString (const std::wstring& s)
+{
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+ if ( ! s.empty() )
+ _replace ( s.c_str() );
+}
+
+//----------------------------------------------------------------------
+FString::FString (const wchar_t* s)
+{
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+ if ( s )
+ _replace (s);
+}
+
+//----------------------------------------------------------------------
+FString::FString (const std::string& s)
+{
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+
+ if ( ! s.empty() )
+ {
+ const wchar_t* wc_str;
+ wc_str = c_to_wc_str(s.c_str());
+
+ if ( wc_str )
+ {
+ _replace( wc_str );
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+FString::FString (const char* s)
+{
+ const wchar_t* wc_str;
+
+ string = 0;
+ length = 0;
+ bufsize = 0;
+ c_string = 0;
+
+ wc_str = c_to_wc_str(s);
+
+ if ( wc_str )
+ {
+ _replace( wc_str );
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+}
+
+//----------------------------------------------------------------------
+FString::FString (const wchar_t c)
+{
+ string = 0;
+ c_string = 0;
+ wchar_t s[2];
+ s[0] = c;
+ s[1] = L'\0';
+ _replace (s);
+}
+
+//----------------------------------------------------------------------
+FString::FString (const char c)
+{
+ string = 0;
+ c_string = 0;
+ wchar_t s[2];
+ s[0] = wchar_t(c & 0xff);
+ s[1] = L'\0';
+ _replace (s);
+}
+
+//----------------------------------------------------------------------
+FString::~FString() // destructor
+{
+ if ( string )
+ delete[](string);
+ if ( c_string )
+ delete[](c_string);
+}
+
+
+// private methods of FString
+//----------------------------------------------------------------------
+inline void FString::initLength (uInt len)
+{
+ if ( len > 0 )
+ {
+ length = len;
+ bufsize = FWDBUFFER + len + 1;
+ string = new wchar_t[bufsize];
+ wmemset(string, L'\0', bufsize);
+ }
+ else
+ {
+ length = 0;
+ bufsize = 0;
+ string = 0;
+ }
+ c_string = 0;
+}
+
+//----------------------------------------------------------------------
+inline void FString::_replace (const wchar_t* s)
+{
+ if ( string )
+ delete[](string);
+
+ length = uInt(wcslen(s));
+ bufsize = FWDBUFFER + length + 1;
+
+ try
+ {
+ string = new wchar_t[bufsize];
+ }
+ catch (const std::bad_alloc& ex)
+ {
+ std::cerr << bad_alloc_str << ex.what() << std::endl;
+ return;
+ }
+/* catch (std::exception& e)
+ {
+ std::cerr << "not enough memory for a new FString object "
+ << e.what() << std::endl;
+ return;
+ }*/
+ wcscpy (string, s);
+}
+
+//----------------------------------------------------------------------
+inline void FString::_insert (uInt pos, uInt len, const wchar_t* s)
+{
+ if ( ! string )
+ {
+ // string is null
+ length = len;
+ bufsize = FWDBUFFER + length + 1;
+ try
+ {
+ string = new wchar_t[bufsize];
+ }
+ catch (const std::bad_alloc& ex)
+ {
+ std::cerr << bad_alloc_str << " " << ex.what() << std::endl;
+ return;
+ }
+ wcscpy (string, s);
+ return;
+ }
+ else
+ {
+ uInt x;
+
+ if ( (length + len + 1) <= bufsize )
+ {
+ // output string <= bufsize
+ for (x = length+1; x >= pos+1; x--)
+ string[x+len-1] = string[x-1];
+ for (x=0; x < len; x++)
+ string[x+pos] = s[x];
+ length += len;
+ }
+ else
+ {
+ wchar_t* sptr;
+ // output string > bufsize
+ bufsize = FWDBUFFER + length + len + 1;
+
+ try
+ {
+ sptr = new wchar_t[bufsize];
+ }
+ catch (const std::bad_alloc& ex)
+ {
+ std::cerr << bad_alloc_str << " " << ex.what() << std::endl;
+ return;
+ }
+ uInt y = 0;
+ for (x=0; x < pos; x++)
+ sptr[y++] = string[x];
+ for (x=0; x < len; x++)
+ sptr[y++] = s[x];
+ for (x=pos; x <= length; x++)
+ sptr[y++] = string[x];
+ length += len;
+ delete[](string);
+ string = sptr;
+ }
+ }
+}
+
+//----------------------------------------------------------------------
+inline void FString::_remove (uInt pos, uInt len)
+{
+ if ( (bufsize - length - 1 + len) <= FWDBUFFER )
+ {
+ for (uInt i=pos; (i+len) <= length; i++)
+ string[i] = string[i+len];
+ length -= len;
+ }
+ else
+ {
+ wchar_t* sptr;
+ bufsize = length + 1 - len + FWDBUFFER;
+
+ try
+ {
+ sptr = new wchar_t[bufsize];
+ }
+ catch (const std::bad_alloc& ex)
+ {
+ std::cerr << bad_alloc_str << " " << ex.what() << std::endl;
+ return;
+ }
+ uInt x, y = 0;
+ for (x=0; x < pos; x++)
+ sptr[y++] = string[x];
+ for (x=pos+len; x <= length; x++)
+ sptr[y++] = string[x];
+ delete[](string);
+ string = sptr;
+ length -= len;
+ }
+}
+
+//----------------------------------------------------------------------
+inline char* FString::wc_to_c_str (const wchar_t* s) const
+{
+ int mblength, size, dest_size;
+ const wchar_t* src;
+
+ if ( ! s ) // handle NULL string
+ return 0;
+ if ( ! *s ) // handle empty string
+ return const_cast("");
+ if ( c_string )
+ delete[](c_string);
+
+ size = int(wcslen(s)) + 1;
+ dest_size = size * int(CHAR_SIZE);
+ src = s;
+ mbstate_t state;
+ memset (&state, '\0', sizeof(mbstate_t));
+
+ try
+ {
+ c_string = new char[dest_size];
+
+ // pre-initialiaze the whole string with '\0'
+ memset (c_string, '\0', size_t(dest_size));
+ }
+ catch (const std::bad_alloc& ex)
+ {
+ std::cerr << bad_alloc_str << " " << ex.what() << std::endl;
+ return 0;
+ }
+
+ mblength = int(wcsrtombs (c_string, &src, uLong(dest_size), &state));
+
+ if ( mblength == -1 && errno != EILSEQ )
+ {
+ delete[](c_string);
+ c_string = 0;
+ return const_cast("");
+ }
+ return c_string;
+}
+
+//----------------------------------------------------------------------
+inline wchar_t* FString::c_to_wc_str (const char* s) const
+{
+ int wclength, size, dest_size;
+ const char* src;
+ wchar_t* dest;
+
+ if ( ! s ) // handle NULL string
+ return 0;
+ if ( ! *s ) // handle empty string
+ return const_cast(L"");
+
+
+ size = int(strlen(s)) + 1;
+ dest_size = size * int(CHAR_SIZE);
+ src = s;
+ mbstate_t state;
+ memset (&state, '\0', sizeof(mbstate_t));
+
+ try
+ {
+ dest = new wchar_t[size];
+ // pre-initialiaze the whole string with '\0'
+ wmemset (dest, L'\0', size_t(size));
+ }
+ catch (const std::bad_alloc& ex)
+ {
+ std::cerr << bad_alloc_str << " " << ex.what() << std::endl;
+ return 0;
+ }
+
+ wclength = int(mbsrtowcs (dest, &src, uLong(dest_size), &state));
+
+ if ( wclength == -1 )
+ {
+ if ( src != s )
+ return dest;
+ else
+ {
+ delete[] dest;
+ return 0;
+ }
+ }
+ if ( wclength == size )
+ dest[size-1] = '\0';
+ if ( wclength )
+ return dest;
+ else
+ {
+ delete[] dest;
+ return 0;
+ }
+}
+
+//----------------------------------------------------------------------
+inline wchar_t* FString::extractToken ( wchar_t** rest,
+ const wchar_t* s,
+ const wchar_t* delim )
+{
+ register wchar_t* token;
+ token = ( s ) ? const_cast(s) : *rest;
+
+ if ( ! *token )
+ return 0;
+
+ *rest = wcspbrk(token, delim);
+
+ if ( *rest )
+ *(*rest)++ = '\0';
+ else
+ *rest = token + wcslen(token);
+ return token;
+}
+
+
+// FString operators
+//----------------------------------------------------------------------
+std::ostream& operator << (std::ostream& outstr, const FString& s)
+{
+ if ( s.length )
+ outstr << s.wc_to_c_str( s.string );
+ return (outstr);
+}
+
+//----------------------------------------------------------------------
+std::istream& operator >> (std::istream& instr, FString& s)
+{
+ const wchar_t* wc_str;
+ char buf[INPBUFFER+1];
+
+ instr.getline (buf, INPBUFFER);
+ wc_str = s.c_to_wc_str(buf);
+
+ if ( wc_str )
+ {
+ s._replace (wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ return (instr);
+}
+
+//----------------------------------------------------------------------
+std::wostream& operator << (std::wostream& outstr, const FString& s)
+{
+ if ( s.length )
+ outstr << s.string;
+ return (outstr);
+}
+
+//----------------------------------------------------------------------
+std::wistream& operator >> (std::wistream& instr, FString& s)
+{
+ wchar_t buf[INPBUFFER+1];
+ instr.getline (buf, INPBUFFER);
+ s._replace (buf);
+ return (instr);
+}
+
+//----------------------------------------------------------------------
+FString& FString::operator = (const FString& s)
+{
+ if ( s )
+ _replace (s.string);
+ else
+ length = bufsize = 0, string = 0;
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+FString& FString::operator = (const std::wstring& s)
+{
+ if ( ! s.empty() )
+ _replace (s.c_str());
+ else
+ length = bufsize = 0, string = 0;
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator = (const wchar_t* s)
+{
+ if ( s )
+ _replace (s);
+ else
+ length = bufsize = 0, string = 0;
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+FString& FString::operator = (const std::string& s)
+{
+ const wchar_t* wc_str = c_to_wc_str(s.c_str());
+ if ( wc_str )
+ {
+ _replace( wc_str );
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ else
+ length = bufsize = 0, string = 0;
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator = (const char* s)
+{
+ const wchar_t* wc_str = c_to_wc_str(s);
+ if ( wc_str )
+ {
+ _replace( wc_str );
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ else
+ length = bufsize = 0, string = 0;
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator = (const wchar_t c)
+{
+ wchar_t s[2];
+ s[0] = c;
+ s[1] = L'\0';
+ _replace (s);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator = (const char c)
+{
+ wchar_t s[2];
+ s[0] = wchar_t(c & 0xff);
+ s[1] = L'\0';
+ _replace (s);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const FString& s)
+{
+ _insert (length, s.length, s.string);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const std::wstring& s)
+{
+ _insert (length, uInt(s.length()), s.c_str());
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const wchar_t* s)
+{
+ _insert (length, uInt(wcslen(s)), s);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const std::string& s)
+{
+ const wchar_t* wc_str = c_to_wc_str(s.c_str());
+ if ( wc_str )
+ {
+ _insert (length, uInt(s.length()), wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const char* s)
+{
+ const wchar_t* wc_str = c_to_wc_str(s);
+ if ( wc_str )
+ {
+ _insert (length, uInt(strlen(s)), wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const wchar_t c)
+{
+ _insert (length, 1, &c);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::operator += (const char c)
+{
+ const wchar_t wc = static_cast(c);
+ _insert (length, 1, &wc );
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const FString& s)
+{
+ FString tmp = string;
+ tmp._insert (length, s.length, s.string);
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const std::wstring& s)
+{
+ FString tmp = string;
+ tmp._insert (length, uInt(s.length()), s.c_str());
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const wchar_t* s)
+{
+ FString tmp = string;
+ tmp._insert (length, uInt(wcslen(s)), s);
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const std::string& s)
+{
+ FString tmp = string;
+ wchar_t* wc_str = c_to_wc_str(s.c_str());
+ if ( ! wc_str )
+ return (tmp);
+ tmp._insert (length, uInt(wcslen(wc_str)), wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const char* s)
+{
+ FString tmp = string;
+ wchar_t* wc_str = c_to_wc_str(s);
+ if ( ! wc_str )
+ return (tmp);
+ tmp._insert (length, uInt(wcslen(wc_str)), wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const wchar_t c)
+{
+ FString tmp = string;
+ tmp._insert (length, 1, &c);
+ return(tmp);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator + (const char c)
+{
+ const wchar_t wc = static_cast(c);
+ FString tmp = string;
+ tmp._insert (length, 1, &wc);
+ return(tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const FString& s1, const FString& s2)
+{
+ FString tmp = s1;
+ tmp._insert ( uInt(wcslen(s1.wc_str())),
+ uInt(wcslen(s2.wc_str())),
+ s2.wc_str() );
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const std::wstring& s1, const FString& s2)
+{
+ FString tmp = s1;
+ tmp._insert ( uInt(wcslen(s1.c_str())),
+ uInt(wcslen(s2.wc_str())),
+ s2.wc_str() );
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const wchar_t* s1, const FString& s2)
+{
+ FString tmp = s1;
+ tmp._insert ( uInt(wcslen(s1)),
+ uInt(wcslen(s2.wc_str())),
+ s2.wc_str() );
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const std::string& s1, const FString& s2)
+{
+ FString tmp = s1;
+ tmp._insert ( tmp.getLength(),
+ uInt(wcslen(s2.wc_str())),
+ s2.wc_str() );
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const char* s1, const FString& s2)
+{
+ FString tmp = s1;
+ tmp._insert ( tmp.getLength(),
+ uInt(wcslen(s2.wc_str())),
+ s2.wc_str() );
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const wchar_t c, const FString& s)
+{
+ FString tmp = c;
+ tmp._insert (1, uInt(wcslen(s.wc_str())), s.wc_str());
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+const FString operator + (const char c, const FString& s)
+{
+ FString tmp = c;
+ tmp._insert (1, uInt(wcslen(s.wc_str())), s.wc_str());
+ return (tmp);
+}
+
+//----------------------------------------------------------------------
+wchar_t& FString::operator [] (uInt pos)
+{
+ assert ( (pos < length) && "Invalid index position!" );
+ if (pos >= length)
+ throw std::out_of_range("");
+ return (string[pos]);
+}
+
+//----------------------------------------------------------------------
+const FString FString::operator () (uInt pos, uInt len)
+{
+ assert ( (pos < length) && ((pos+len) <= length) );
+ FString tmp = L"";
+ tmp._insert (0, len, string + pos);
+ return (tmp);
+}
+
+
+// public methods of FString
+//----------------------------------------------------------------------
+uInt FString::getUTF8length() const
+{
+ uInt len;
+ const char* s;
+
+ len = 0;
+ s = c_str();
+
+ while ( *s )
+ len += uInt((*s++ & 0xc0) != 0x80);
+
+ return len;
+}
+
+//----------------------------------------------------------------------
+FString& FString::sprintf (const wchar_t* format, ...)
+{
+ const int buf_size = 4096;
+ wchar_t buffer[buf_size];
+ va_list args;
+
+ va_start (args, format);
+ vswprintf (buffer, buf_size, format, args);
+ va_end (args);
+
+ this->_replace (buffer);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+FString& FString::sprintf (const char* format, ...)
+{
+ const wchar_t* wc_str;
+ char buf[1024];
+ char* buffer;
+ int len;
+ va_list args;
+
+ buffer = buf;
+ va_start (args, format);
+ len = vsnprintf (buffer, sizeof(buf), format, args);
+ va_end (args);
+
+ if ( len >= int(sizeof(buf)) )
+ {
+ buffer = new char[len+1];
+ va_start (args, format);
+ vsnprintf (buffer, uLong(len+1), format, args);
+ va_end (args);
+ }
+
+ wc_str = c_to_wc_str(buffer);
+ if ( wc_str )
+ {
+ this->_replace(wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ if ( buffer != buf )
+ delete[] buffer;
+
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+FString FString::clear()
+{
+ if ( string )
+ delete[](string);
+ length = 0;
+ bufsize = 0;
+ string = 0;
+
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const wchar_t* FString::wc_str() const
+{
+ return (string);
+}
+
+//----------------------------------------------------------------------
+const char* FString::c_str() const
+{
+ return wc_to_c_str (string);
+}
+
+//----------------------------------------------------------------------
+const std::string FString::toString() const
+{
+ return std::string(this->c_str(), length+1);
+}
+
+//----------------------------------------------------------------------
+FString FString::toLower() const
+{
+ register wchar_t* p;
+ FString s(this->string);
+ p = s.string;
+
+ if ( p )
+ {
+ while ( *p )
+ {
+ *p = wchar_t(towlower(uInt(*p)));
+ p++;
+ }
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::toUpper() const
+{
+ register wchar_t* p;
+ FString s(this->string);
+ p = s.string;
+
+ if ( p )
+ {
+ while ( *p )
+ {
+ *p = wchar_t(towupper(uInt(*p)));
+ p++;
+ }
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+long FString::toLong() const
+{
+ register long num;
+ register long tenth_limit;
+ register long tenth_limit_digit;
+ register wchar_t* p;
+ FString s;
+
+ num = 0;
+ tenth_limit = LONG_MAX / 10;
+ tenth_limit_digit = LONG_MAX % 10;
+ s = this->trim();
+ p = s.string;
+
+ if ( p )
+ {
+ register bool neg = false;
+ register bool overflow = false;
+ if ( *p == '-' )
+ {
+ p++;
+ neg = true;
+ tenth_limit = -(LONG_MIN / 10);
+ tenth_limit_digit += 1;
+ }
+ else if ( *p == '+' )
+ {
+ p++;
+ }
+ while ( isdigit(*p) )
+ {
+ register uChar d = uChar((*p) - '0');
+ if ( num > tenth_limit
+ || (num == tenth_limit && d > tenth_limit_digit) )
+ {
+ overflow = true;
+ break;
+ }
+ num = (num<<3)+(num<<1) + d; // (10 * num) + d
+ p++;
+ }
+ if ( overflow )
+ num = neg ? LONG_MIN : LONG_MAX;
+ else if ( neg )
+ num = (~num) + 1;
+ }
+ return num;
+}
+
+//----------------------------------------------------------------------
+uLong FString::toULong() const
+{
+ register uLong num;
+ register uLong tenth_limit;
+ register uLong tenth_limit_digit;
+ register wchar_t* p;
+ FString s;
+
+ num = 0;
+ tenth_limit = ULONG_MAX / 10;
+ tenth_limit_digit = ULONG_MAX % 10;
+ s = this->trim();
+ p = s.string;
+
+ if ( p )
+ {
+ register bool overflow = false;
+ if ( *p == '+' )
+ {
+ p++;
+ }
+ while ( isdigit(*p) )
+ {
+ register uChar d = uChar((*p) - '0');
+ if ( num > tenth_limit
+ || (num == tenth_limit && d > tenth_limit_digit) )
+ {
+ overflow = true;
+ break;
+ }
+ num = (num<<3)+(num<<1) + d; // (10 * num) + d
+ p++;
+ }
+ if ( overflow )
+ num = ULONG_MAX;
+ }
+ return num;
+}
+
+//----------------------------------------------------------------------
+FString FString::ltrim() const
+{
+ register wchar_t* p;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ p = s.string;
+ while ( iswspace(uInt(*p)) )
+ p++;
+ return FString(p);
+}
+
+//----------------------------------------------------------------------
+FString FString::rtrim() const
+{
+ register wchar_t* p;
+ register wchar_t* last;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ p = s.string;
+ last = p + length;
+ while ( iswspace(uInt(*--last)) && last > p );
+ if ( last == p && iswspace(uInt(*last)) )
+ s.clear();
+ else
+ *(last+1) = '\0';
+
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::trim() const
+{
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return (*this);
+ FString s(this->ltrim());
+ return s.rtrim();
+}
+
+//----------------------------------------------------------------------
+FString FString::left(uInt len) const
+{
+ register wchar_t* p;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ if ( len > length )
+ return s;
+ p = s.string;
+ *(p+len) = '\0';
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::right(uInt len) const
+{
+ register wchar_t* p;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ if ( len > length )
+ return s;
+ p = s.string;
+ p += (length-len);
+ return FString(p);
+}
+
+//----------------------------------------------------------------------
+FString FString::mid(uInt pos, uInt len) const
+{
+ register wchar_t* p;
+ register wchar_t* first;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ if ( pos == 0 )
+ pos = 1;
+ if ( pos <= length && pos+len > length )
+ len = length - pos + 1;
+ if ( pos > length || pos+len-1 > length || len == 0 )
+ return FString(L"");
+
+ p = s.string;
+ first = p + pos - 1;
+ *(first+len) = '\0';
+ return FString(first);
+}
+
+//----------------------------------------------------------------------
+std::vector FString::split (const FString& delimiter)
+{
+ wchar_t* rest;
+ wchar_t* token;
+ FString s(this->string);
+ std::vector stringList;
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return stringList;
+
+ rest = 0;
+ token = extractToken(&rest, s.string, delimiter.wc_str());
+
+ while ( token )
+ {
+ stringList.push_back(token);
+ token = extractToken(&rest, 0, delimiter.wc_str());
+ }
+ return stringList;
+}
+
+//----------------------------------------------------------------------
+FString& FString::setString (const wchar_t* s)
+{
+ _replace (s);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+FString& FString::setString (const char* s)
+{
+ const wchar_t* wc_str = c_to_wc_str(s);
+ if ( wc_str )
+ {
+ _replace (wc_str);
+ if ( *wc_str )
+ delete[] wc_str;
+ }
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+FString& FString::setNumber (long num)
+{
+ register wchar_t* s;
+ register bool neg;
+ wchar_t buf[30];
+
+ s = &buf[29];
+
+ if ( num < 0 )
+ {
+ neg = true;
+ num = -num;
+ }
+ else
+ {
+ neg = false;
+ }
+ *s = '\0';
+ do
+ {
+ *--s = wchar_t(int(num%10) + '0');
+ num /= 10;
+ } while ( num );
+
+ if ( neg )
+ *--s = '-';
+ _replace (s);
+ return *this;
+}
+
+//----------------------------------------------------------------------
+FString& FString::setNumber (uLong num)
+{
+ register wchar_t* s;
+ wchar_t buf[30];
+
+ s = &buf[29];
+ *s = '\0';
+
+ do
+ {
+ *--s = wchar_t(int(num%10) + '0');
+ num /= 10;
+ } while ( num );
+
+ _replace (s);
+
+ return *this;
+}
+
+//----------------------------------------------------------------------
+FString& FString::setFormatedNumber (long num, char separator)
+{
+ register int n;
+ register wchar_t* s;
+ register bool neg;
+ wchar_t buf[30];
+
+ n = 0;
+ s = &buf[29];
+
+ if ( num < 0 )
+ {
+ neg = true;
+ num = -num;
+ }
+ else
+ {
+ neg = false;
+ }
+ *s = L'\0';
+ do
+ {
+ *--s = wchar_t(int(num%10) + '0');
+ num /= 10;
+ if ( num && ++n % 3 == 0 )
+ *--s = separator;
+ } while ( num );
+
+ if ( neg )
+ *--s = '-';
+ _replace (s);
+ return *this;
+}
+
+//----------------------------------------------------------------------
+FString& FString::setFormatedNumber (uLong num, char separator)
+{
+ register int n;
+ register wchar_t* s;
+ wchar_t buf[30];
+
+ n = 0;
+ s = &buf[29];
+ *s = L'\0';
+
+ do
+ {
+ *--s = wchar_t(int(num%10) + '0');
+ num /= 10;
+ if ( num && ++n % 3 == 0 )
+ *--s = separator;
+
+ } while ( num );
+
+ _replace (s);
+
+ return *this;
+}
+
+// FString operators
+//----------------------------------------------------------------------
+bool FString::operator < (const FString& s) const
+{
+ if ( ! s )
+ return false;
+ if ( string && ! s.string )
+ return false;
+ if ( ! string && s.string )
+ return true;
+ if ( ! string && ! s.string )
+ return false;
+ return (wcscmp(string, s.string) < 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::operator <= (const FString& s) const
+{
+ if ( ! s )
+ return false;
+ if ( string && ! s.string )
+ return false;
+ if ( ! string && s.string )
+ return true;
+ if ( ! string && ! s.string )
+ return true;
+ return (wcscmp(string, s.string) <= 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::operator == (const FString& s) const
+{
+ if ( ! s )
+ return false;
+ if ( (string && ! s.string ) || (! string && s.string) )
+ return false;
+ if ( ! string && ! s.string )
+ return true;
+ return (wcscmp(string, s.string) == 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::operator != (const FString& s) const
+{
+ if ( ! s )
+ return true;
+ if ( (string && ! s.string ) || (! string && s.string) )
+ return true;
+ if ( ! string && ! s.string )
+ return false;
+ return (wcscmp(string, s.string) != 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::operator >= (const FString& s) const
+{
+ if ( ! s )
+ return true;
+ if ( string && ! s.string )
+ return true;
+ if ( ! string && s.string )
+ return false;
+ if ( ! string && ! s.string )
+ return true;
+ return (wcscmp(string, s.string) >= 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::operator > (const FString& s) const
+{
+ if ( ! s )
+ return true;
+ if ( string && ! s.string )
+ return true;
+ if ( ! string && s.string )
+ return false;
+ if ( ! string && ! s.string )
+ return false;
+ return (wcscmp(string, s.string) > 0);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::insert (const FString& s, uInt pos)
+{
+ // assert (pos <= length);
+ if ( pos >= length )
+ throw std::out_of_range("");
+ _insert (pos, s.length, s.string);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::insert (const wchar_t* s, uInt pos)
+{
+ // assert (pos <= length);
+ if ( pos >= length )
+ throw std::out_of_range("");
+ _insert (pos, uInt(wcslen(s)), s);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::insert (const char* s, uInt pos)
+{
+ return (insert(FString(s), pos));
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const FString& to)
+{
+ register wchar_t* p;
+ uInt from_length, to_length, pos;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ if ( from.isNull() || to.isNull() )
+ return s;
+ p = s.string;
+ from_length = from.getLength();
+ to_length = to.getLength();
+ pos = 0;
+ while ( *p )
+ {
+ if ( wcsncmp(p, from.string, from_length) == 0 )
+ {
+ s._remove(pos, from_length);
+ s._insert(pos, to_length, to.string);
+ pos += to_length;
+ p = s.string + pos;
+ }
+ else
+ {
+ pos++;
+ p++;
+ }
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const std::wstring& to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const wchar_t* to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const std::string& to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const char* to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const wchar_t to)
+{
+ FString to_wchar(to);
+ return replace (from, to_wchar);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const FString& from, const char to)
+{
+ FString to_char(to);
+ return replace (from, to_char);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const FString& to)
+{
+ FString from_str(from);
+ return replace (from_str, to);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const std::wstring& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const wchar_t* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const std::string& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const char* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const wchar_t to)
+{
+ FString from_str(from);
+ FString to_wchar(to);
+ return replace (from_str, to_wchar);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::wstring& from, const char to)
+{
+ FString from_str(from);
+ FString to_char(to);
+ return replace (from_str, to_char);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const FString& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const std::wstring& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const wchar_t* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const std::string& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const char* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const wchar_t to)
+{
+ FString from_str(from);
+ FString to_wchar(to);
+ return replace (from_str, to_wchar);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const std::string& from, const char to)
+{
+ FString from_str(from);
+ FString to_char(to);
+ return replace (from_str, to_char);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t* from, const FString& to)
+{
+ FString from_str(from);
+ return replace (from_str, to);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t* from, const std::wstring& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t* from, const wchar_t* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t* from, const wchar_t to)
+{
+ FString from_str(from);
+ FString to_wchar(to);
+ return replace (from_str, to_wchar);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t* from, const char to)
+{
+ FString from_str(from);
+ FString to_char(to);
+ return replace (from_str, to_char);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const FString& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const std::wstring& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const wchar_t* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const std::string& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const char* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const wchar_t to)
+{
+ FString from_str(from);
+ FString to_wchar(to);
+ return replace (from_str, to_wchar);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char* from, const char to)
+{
+ FString from_str(from);
+ FString to_char(to);
+ return replace (from_str, to_char);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t from, const FString& to)
+{
+ register wchar_t* p;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+ if ( to.isNull() )
+ return s;
+ p = s.string;
+ uInt to_length = to.getLength();
+ uInt pos = 0;
+ while ( *p )
+ {
+ if ( wchar_t(*p) == from )
+ {
+ s._remove(pos, 1);
+ s._insert(pos, to_length, to.wc_str());
+ pos += to_length;
+ p = s.string + pos;
+ }
+ else
+ {
+ pos++;
+ p++;
+ }
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t from, const std::wstring& to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t from, const wchar_t* to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t from, const std::string& to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t from, const char* to)
+{
+ FString to_str(to);
+ return replace (from, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const wchar_t from, const wchar_t to)
+{
+ FString to_wchar(to);
+ return replace (from, to_wchar);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const FString& to)
+{
+ FString from_str(from);
+ return replace (from_str, to);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const std::wstring& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const wchar_t* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const std::string& to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const char* to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const wchar_t to)
+{
+ FString from_str(from);
+ FString to_str(to);
+ return replace (from_str, to_str);
+}
+
+//----------------------------------------------------------------------
+FString FString::replace (const char from, const char to)
+{
+ register wchar_t* p;
+ FString s(this->string);
+
+ // handle NULL and empty string
+ if ( ! this->string || ! *this->string )
+ return s;
+
+ p = s.string;
+ while ( *p )
+ {
+ if ( char(*p) == from )
+ *p = to;
+ p++;
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::replaceControlCodes() const
+{
+ register wchar_t* p;
+ FString s(this->string);
+
+ p = s.string;
+
+ if ( p )
+ {
+ while ( *p )
+ {
+ if ( *p <= L'\x1f' )
+ {
+ *p += L'\x2400';
+ }
+ else if ( *p == L'\x7f' )
+ {
+ *p = L'\x2421';
+ }
+ else if ( *p >= L'\x80' && *p <= L'\x9f' )
+ {
+ *p = L' ';
+ }
+ else if ( ! iswprint(wint_t(*p)) )
+ *p = L' ';
+ p++;
+ }
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+FString FString::expandTabs (uInt tabstop) const
+{
+ uLong end;
+ FString instr(this->string);
+ FString outstr = "";
+
+ std::vector tab_split = instr.split("\t");
+ end = tab_split.size();
+ for (uInt i=0; i < end; i++)
+ {
+ uInt len = tab_split[i].getLength();
+ outstr += tab_split[i] + FString(tabstop - len % tabstop, L' ');
+ }
+ return outstr;
+}
+
+//----------------------------------------------------------------------
+FString FString::removeDel() const
+{
+ register wchar_t* p;
+
+ FString s(this->string);
+ p = s.string;
+
+ if ( p )
+ {
+ uInt i=0;
+ uInt d=0;
+ while ( *p )
+ {
+ if ( *p == 0x7f )
+ {
+ d++;
+ }
+ else if ( d > 0 )
+ {
+ d--;
+ }
+ else
+ {
+ s.string[i] = *p;
+ i++;
+ }
+ p++;
+ }
+ s.string[i] = L'\0';
+ s.length = i;
+ }
+ return s;
+}
+
+
+//----------------------------------------------------------------------
+FString FString::removeBackspaces() const
+{
+ register wchar_t* p;
+
+ FString s(this->string);
+ p = s.string;
+
+ if ( p )
+ {
+ uInt i=0;
+ while ( *p )
+ {
+ if ( *p != L'\b' )
+ {
+ s.string[i] = *p;
+ i++;
+ }
+ else if ( i > 0 )
+ {
+ i--;
+ }
+ p++;
+ }
+ s.string[i] = L'\0';
+ s.length = i;
+ }
+ return s;
+}
+
+//----------------------------------------------------------------------
+const FString& FString::overwrite (const FString& s, uInt pos)
+{
+ if (length >= (pos + s.length))
+ {
+ wcsncpy(string + pos, s.string, s.length);
+ }
+ else
+ {
+ wcsncpy (string + pos, s.string, length - pos);
+ _insert (length, pos + s.length - length, s.string + length - pos);
+ }
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::overwrite (const wchar_t* s, uInt pos)
+{
+ uInt len = uInt(wcslen(s));
+ if (length >= (pos+len) )
+ {
+ wcsncpy (string + pos, s, len);
+ }
+ else
+ {
+ wcsncpy (string + pos, s, length - pos);
+ _insert (length, pos + len - length, s + length - pos);
+ }
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::overwrite (const wchar_t c, uInt pos)
+{
+ if ( length >= (pos+1) )
+ {
+ string[pos] = c;
+ }
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+const FString& FString::remove (uInt pos, uInt len)
+{
+ assert ((pos < length) && ((pos + len) <= length));
+ _remove (pos, len);
+ return (*this);
+}
+
+//----------------------------------------------------------------------
+bool FString::includes (const FString& s)
+{
+ return (wcsstr(string, s.string) != 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::includes (const wchar_t* s)
+{
+ return (wcsstr(string, s) != 0);
+}
+
+//----------------------------------------------------------------------
+bool FString::includes (const char* s)
+{
+ bool ret;
+ const wchar_t* wc_str = c_to_wc_str(s);
+ if ( ! wc_str )
+ return false;
+ ret = bool(wcsstr(string, wc_str) != 0);
+ if ( *wc_str )
+ delete[] wc_str;
+ return (ret);
+}
diff --git a/src/fstring.h b/src/fstring.h
new file mode 100644
index 00000000..babcc026
--- /dev/null
+++ b/src/fstring.h
@@ -0,0 +1,353 @@
+// fstring.h
+// class FString
+
+#ifndef _FSTRING_H
+#define _FSTRING_H
+
+#include
+
+#include
+
+#include